diff --git a/.devcontainer/Dockerfile b/.devcontainer/Dockerfile new file mode 100644 index 0000000..62c2d13 --- /dev/null +++ b/.devcontainer/Dockerfile @@ -0,0 +1,8 @@ +ARG VARIANT="3.9" +FROM mcr.microsoft.com/vscode/devcontainers/python:0-${VARIANT} + +USER vscode + +COPY --from=ghcr.io/astral-sh/uv:latest /uv /uvx /bin/ + +RUN echo "[[ -d .venv ]] && source .venv/bin/activate || export PATH=\$PATH" >> /home/vscode/.bashrc diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json new file mode 100644 index 0000000..e01283d --- /dev/null +++ b/.devcontainer/devcontainer.json @@ -0,0 +1,43 @@ +// For format details, see https://aka.ms/devcontainer.json. For config options, see the +// README at: https://github.com/devcontainers/templates/tree/main/src/debian +{ + "name": "Debian", + "build": { + "dockerfile": "Dockerfile", + "context": ".." + }, + + "postStartCommand": "uv sync --all-extras", + + "customizations": { + "vscode": { + "extensions": [ + "ms-python.python" + ], + "settings": { + "terminal.integrated.shell.linux": "/bin/bash", + "python.pythonPath": ".venv/bin/python", + "python.defaultInterpreterPath": ".venv/bin/python", + "python.typeChecking": "basic", + "terminal.integrated.env.linux": { + "PATH": "${env:PATH}" + } + } + } + }, + "features": { + "ghcr.io/devcontainers/features/node:1": {} + } + + // Features to add to the dev container. More info: https://containers.dev/features. + // "features": {}, + + // Use 'forwardPorts' to make a list of ports inside the container available locally. + // "forwardPorts": [], + + // Configure tool-specific properties. + // "customizations": {}, + + // Uncomment to connect as root instead. More info: https://aka.ms/dev-containers-non-root. + // "remoteUser": "root" +} diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml new file mode 100644 index 0000000..4d0e2d9 --- /dev/null +++ b/.github/workflows/ci.yml @@ -0,0 +1,95 @@ +name: CI +on: + push: + branches: + - '**' + - '!integrated/**' + - '!stl-preview-head/**' + - '!stl-preview-base/**' + - '!generated' + - '!codegen/**' + - 'codegen/stl/**' + pull_request: + branches-ignore: + - 'stl-preview-head/**' + - 'stl-preview-base/**' + +jobs: + lint: + timeout-minutes: 10 + name: lint + runs-on: ${{ github.repository == 'stainless-sdks/warp-api-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: (github.event_name == 'push' || github.event.pull_request.head.repo.fork) && (github.event_name != 'push' || github.event.head_commit.message != 'codegen metadata') + steps: + - uses: actions/checkout@v6 + + - name: Install uv + uses: astral-sh/setup-uv@v5 + with: + version: '0.10.2' + + - name: Install dependencies + run: uv sync --all-extras + + - name: Run lints + run: ./scripts/lint + + build: + if: (github.event_name == 'push' || github.event.pull_request.head.repo.fork) && (github.event_name != 'push' || github.event.head_commit.message != 'codegen metadata') + timeout-minutes: 10 + name: build + permissions: + contents: read + id-token: write + runs-on: ${{ github.repository == 'stainless-sdks/warp-api-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + steps: + - uses: actions/checkout@v6 + + - name: Install uv + uses: astral-sh/setup-uv@v5 + with: + version: '0.10.2' + + - name: Install dependencies + run: uv sync --all-extras + + - name: Run build + run: uv build + + - name: Get GitHub OIDC Token + if: |- + github.repository == 'stainless-sdks/warp-api-python' && + !startsWith(github.ref, 'refs/heads/stl/') + id: github-oidc + uses: actions/github-script@v8 + with: + script: core.setOutput('github_token', await core.getIDToken()); + + - name: Upload tarball + if: |- + github.repository == 'stainless-sdks/warp-api-python' && + !startsWith(github.ref, 'refs/heads/stl/') + env: + URL: https://pkg.stainless.com/s + AUTH: ${{ steps.github-oidc.outputs.github_token }} + SHA: ${{ github.sha }} + run: ./scripts/utils/upload-artifact.sh + + test: + timeout-minutes: 10 + name: test + runs-on: ${{ github.repository == 'stainless-sdks/warp-api-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: github.event_name == 'push' || github.event.pull_request.head.repo.fork + steps: + - uses: actions/checkout@v6 + + - name: Install uv + uses: astral-sh/setup-uv@v5 + with: + version: '0.10.2' + + - name: Bootstrap + run: ./scripts/bootstrap + + - name: Run tests + run: ./scripts/test diff --git a/.github/workflows/publish-pypi.yml b/.github/workflows/publish-pypi.yml new file mode 100644 index 0000000..74160e1 --- /dev/null +++ b/.github/workflows/publish-pypi.yml @@ -0,0 +1,29 @@ +# This workflow is triggered when a GitHub release is created. +# It can also be run manually to re-publish to PyPI in case it failed for some reason. +# You can run this workflow by navigating to https://www.github.com/warpdotdev/oz-sdk-python/actions/workflows/publish-pypi.yml +name: Publish PyPI +on: + workflow_dispatch: + + release: + types: [published] + +jobs: + publish: + name: publish + runs-on: ubuntu-latest + permissions: + contents: read + id-token: write + + steps: + - uses: actions/checkout@v6 + + - name: Install uv + uses: astral-sh/setup-uv@v5 + with: + version: '0.9.13' + + - name: Publish to PyPI + run: | + bash ./bin/publish-pypi diff --git a/.github/workflows/release-doctor.yml b/.github/workflows/release-doctor.yml new file mode 100644 index 0000000..bb0047d --- /dev/null +++ b/.github/workflows/release-doctor.yml @@ -0,0 +1,19 @@ +name: Release Doctor +on: + pull_request: + branches: + - main + workflow_dispatch: + +jobs: + release_doctor: + name: release doctor + runs-on: ubuntu-latest + if: github.repository == 'warpdotdev/oz-sdk-python' && (github.event_name == 'push' || github.event_name == 'workflow_dispatch' || startsWith(github.head_ref, 'release-please') || github.head_ref == 'next') + + steps: + - uses: actions/checkout@v6 + + - name: Check release environment + run: | + bash ./bin/check-release-environment diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..3824f4c --- /dev/null +++ b/.gitignore @@ -0,0 +1,16 @@ +.prism.log +.stdy.log +_dev + +__pycache__ +.mypy_cache + +dist + +.venv +.idea + +.env +.envrc +codegen.log +Brewfile.lock.json diff --git a/.python-version b/.python-version new file mode 100644 index 0000000..43077b2 --- /dev/null +++ b/.python-version @@ -0,0 +1 @@ +3.9.18 diff --git a/.release-please-manifest.json b/.release-please-manifest.json new file mode 100644 index 0000000..e1a2442 --- /dev/null +++ b/.release-please-manifest.json @@ -0,0 +1,3 @@ +{ + ".": "0.10.1" +} \ No newline at end of file diff --git a/.stats.yml b/.stats.yml new file mode 100644 index 0000000..11ad6be --- /dev/null +++ b/.stats.yml @@ -0,0 +1,4 @@ +configured_endpoints: 14 +openapi_spec_url: https://storage.googleapis.com/stainless-sdk-openapi-specs/warp-bnavetta%2Fwarp-api-a29592b2ba26cba9d89b95969d66506f49c08e140b76ce4aea4189e5c1dccc06.yml +openapi_spec_hash: 27a5de1f891104d5e47904ad8e4b4bd1 +config_hash: 40327fb76b7cce7b97f23de9b8d48efb diff --git a/.vscode/settings.json b/.vscode/settings.json new file mode 100644 index 0000000..5b01030 --- /dev/null +++ b/.vscode/settings.json @@ -0,0 +1,3 @@ +{ + "python.analysis.importFormat": "relative", +} diff --git a/Brewfile b/Brewfile new file mode 100644 index 0000000..c43041c --- /dev/null +++ b/Brewfile @@ -0,0 +1,2 @@ +brew "uv" + diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md new file mode 100644 index 0000000..e1ecb81 --- /dev/null +++ b/CONTRIBUTING.md @@ -0,0 +1,121 @@ +## Setting up the environment + +### With `uv` + +We use [uv](https://docs.astral.sh/uv/) to manage dependencies because it will automatically provision a Python environment with the expected Python version. To set it up, run: + +```sh +$ ./scripts/bootstrap +``` + +Or [install uv manually](https://docs.astral.sh/uv/getting-started/installation/) and run: + +```sh +$ uv sync --all-extras +``` + +You can then run scripts using `uv run python script.py` or by manually activating the virtual environment: + +```sh +# manually activate - https://docs.python.org/3/library/venv.html#how-venvs-work +$ source .venv/bin/activate + +# now you can omit the `uv run` prefix +$ python script.py +``` + +### Without `uv` + +Alternatively if you don't want to install `uv`, you can stick with the standard `pip` setup by ensuring you have the Python version specified in `.python-version`, create a virtual environment however you desire and then install dependencies using this command: + +```sh +$ pip install -r requirements-dev.lock +``` + +## Modifying/Adding code + +Most of the SDK is generated code. Modifications to code will be persisted between generations, but may +result in merge conflicts between manual patches and changes from the generator. The generator will never +modify the contents of the `src/oz_agent_sdk/lib/` and `examples/` directories. + +## Adding and running examples + +All files in the `examples/` directory are not modified by the generator and can be freely edited or added to. + +```py +# add an example to examples/.py + +#!/usr/bin/env -S uv run python +… +``` + +```sh +$ chmod +x examples/.py +# run the example against your api +$ ./examples/.py +``` + +## Using the repository from source + +If you’d like to use the repository from source, you can either install from git or link to a cloned repository: + +To install via git: + +```sh +$ pip install git+ssh://git@github.com/warpdotdev/oz-sdk-python.git +``` + +Alternatively, you can build from source and install the wheel file: + +Building this package will create two files in the `dist/` directory, a `.tar.gz` containing the source files and a `.whl` that can be used to install the package efficiently. + +To create a distributable version of the library, all you have to do is run this command: + +```sh +$ uv build +# or +$ python -m build +``` + +Then to install: + +```sh +$ pip install ./path-to-wheel-file.whl +``` + +## Running tests + +```sh +$ ./scripts/test +``` + +## Linting and formatting + +This repository uses [ruff](https://github.com/astral-sh/ruff) and +[black](https://github.com/psf/black) to format the code in the repository. + +To lint: + +```sh +$ ./scripts/lint +``` + +To format and fix all ruff issues automatically: + +```sh +$ ./scripts/format +``` + +## Publishing and releases + +Changes made to this repository via the automated release PR pipeline should publish to PyPI automatically. If +the changes aren't made through the automated pipeline, you may want to make releases manually. + +### Publish with a GitHub workflow + +You can release to package managers by using [the `Publish PyPI` GitHub action](https://www.github.com/warpdotdev/oz-sdk-python/actions/workflows/publish-pypi.yml). This requires a setup organization or repository secret to be set up. + +### Publish manually + +If you need to manually release a package, you can run the `bin/publish-pypi` script with a `PYPI_TOKEN` set on +the environment. diff --git a/LICENSE b/LICENSE new file mode 100644 index 0000000..c3e6041 --- /dev/null +++ b/LICENSE @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright 2026 Oz API + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/README.md b/README.md index a2cfb8f..29f6f38 100644 --- a/README.md +++ b/README.md @@ -1 +1,458 @@ -# warp-api-python \ No newline at end of file +# Oz API Python API library + + +[![PyPI version](https://img.shields.io/pypi/v/oz-agent-sdk.svg?label=pypi%20(stable))](https://pypi.org/project/oz-agent-sdk/) + +The Oz API Python library provides convenient access to the Oz API REST API from any Python 3.9+ +application. The library includes type definitions for all request params and response fields, +and offers both synchronous and asynchronous clients powered by [httpx](https://github.com/encode/httpx). + +It is generated with [Stainless](https://www.stainless.com/). + +## Documentation + +The full API of this library can be found in [api.md](api.md). + +## Installation + +```sh +# install from PyPI +pip install oz-agent-sdk +``` + +## Usage + +The full API of this library can be found in [api.md](api.md). + +```python +import os +from oz_agent_sdk import OzAPI + +client = OzAPI( + api_key=os.environ.get("WARP_API_KEY"), # This is the default and can be omitted +) + +response = client.agent.run( + prompt="Fix the bug in auth.go", +) +print(response.run_id) +``` + +While you can provide an `api_key` keyword argument, +we recommend using [python-dotenv](https://pypi.org/project/python-dotenv/) +to add `WARP_API_KEY="My API Key"` to your `.env` file +so that your API Key is not stored in source control. + +## Async usage + +Simply import `AsyncOzAPI` instead of `OzAPI` and use `await` with each API call: + +```python +import os +import asyncio +from oz_agent_sdk import AsyncOzAPI + +client = AsyncOzAPI( + api_key=os.environ.get("WARP_API_KEY"), # This is the default and can be omitted +) + + +async def main() -> None: + response = await client.agent.run( + prompt="Fix the bug in auth.go", + ) + print(response.run_id) + + +asyncio.run(main()) +``` + +Functionality between the synchronous and asynchronous clients is otherwise identical. + +### With aiohttp + +By default, the async client uses `httpx` for HTTP requests. However, for improved concurrency performance you may also use `aiohttp` as the HTTP backend. + +You can enable this by installing `aiohttp`: + +```sh +# install from PyPI +pip install oz-agent-sdk[aiohttp] +``` + +Then you can enable it by instantiating the client with `http_client=DefaultAioHttpClient()`: + +```python +import os +import asyncio +from oz_agent_sdk import DefaultAioHttpClient +from oz_agent_sdk import AsyncOzAPI + + +async def main() -> None: + async with AsyncOzAPI( + api_key=os.environ.get("WARP_API_KEY"), # This is the default and can be omitted + http_client=DefaultAioHttpClient(), + ) as client: + response = await client.agent.run( + prompt="Fix the bug in auth.go", + ) + print(response.run_id) + + +asyncio.run(main()) +``` + +## Using types + +Nested request parameters are [TypedDicts](https://docs.python.org/3/library/typing.html#typing.TypedDict). Responses are [Pydantic models](https://docs.pydantic.dev) which also provide helper methods for things like: + +- Serializing back into JSON, `model.to_json()` +- Converting to a dictionary, `model.to_dict()` + +Typed requests and responses provide autocomplete and documentation within your editor. If you would like to see type errors in VS Code to help catch bugs earlier, set `python.analysis.typeCheckingMode` to `basic`. + +## Pagination + +List methods in the Oz API API are paginated. + +This library provides auto-paginating iterators with each list response, so you do not have to request successive pages manually: + +```python +from oz_agent_sdk import OzAPI + +client = OzAPI() + +all_runs = [] +# Automatically fetches more pages as needed. +for run in client.agent.runs.list(): + # Do something with run here + all_runs.append(run) +print(all_runs) +``` + +Or, asynchronously: + +```python +import asyncio +from oz_agent_sdk import AsyncOzAPI + +client = AsyncOzAPI() + + +async def main() -> None: + all_runs = [] + # Iterate through items across all pages, issuing requests as needed. + async for run in client.agent.runs.list(): + all_runs.append(run) + print(all_runs) + + +asyncio.run(main()) +``` + +Alternatively, you can use the `.has_next_page()`, `.next_page_info()`, or `.get_next_page()` methods for more granular control working with pages: + +```python +first_page = await client.agent.runs.list() +if first_page.has_next_page(): + print(f"will fetch next page using these details: {first_page.next_page_info()}") + next_page = await first_page.get_next_page() + print(f"number of items we just fetched: {len(next_page.runs)}") + +# Remove `await` for non-async usage. +``` + +Or just work directly with the returned data: + +```python +first_page = await client.agent.runs.list() + +print(f"next page cursor: {first_page.page_info.next_cursor}") # => "next page cursor: ..." +for run in first_page.runs: + print(run.run_id) + +# Remove `await` for non-async usage. +``` + +## Nested params + +Nested parameters are dictionaries, typed using `TypedDict`, for example: + +```python +from oz_agent_sdk import OzAPI + +client = OzAPI() + +response = client.agent.run( + config={}, +) +print(response.config) +``` + +## Handling errors + +When the library is unable to connect to the API (for example, due to network connection problems or a timeout), a subclass of `oz_agent_sdk.APIConnectionError` is raised. + +When the API returns a non-success status code (that is, 4xx or 5xx +response), a subclass of `oz_agent_sdk.APIStatusError` is raised, containing `status_code` and `response` properties. + +All errors inherit from `oz_agent_sdk.APIError`. + +```python +import oz_agent_sdk +from oz_agent_sdk import OzAPI + +client = OzAPI() + +try: + client.agent.run( + prompt="Fix the bug in auth.go", + ) +except oz_agent_sdk.APIConnectionError as e: + print("The server could not be reached") + print(e.__cause__) # an underlying Exception, likely raised within httpx. +except oz_agent_sdk.RateLimitError as e: + print("A 429 status code was received; we should back off a bit.") +except oz_agent_sdk.APIStatusError as e: + print("Another non-200-range status code was received") + print(e.status_code) + print(e.response) +``` + +Error codes are as follows: + +| Status Code | Error Type | +| ----------- | -------------------------- | +| 400 | `BadRequestError` | +| 401 | `AuthenticationError` | +| 403 | `PermissionDeniedError` | +| 404 | `NotFoundError` | +| 422 | `UnprocessableEntityError` | +| 429 | `RateLimitError` | +| >=500 | `InternalServerError` | +| N/A | `APIConnectionError` | + +### Retries + +Certain errors are automatically retried 2 times by default, with a short exponential backoff. +Connection errors (for example, due to a network connectivity problem), 408 Request Timeout, 409 Conflict, +429 Rate Limit, and >=500 Internal errors are all retried by default. + +You can use the `max_retries` option to configure or disable retry settings: + +```python +from oz_agent_sdk import OzAPI + +# Configure the default for all requests: +client = OzAPI( + # default is 2 + max_retries=0, +) + +# Or, configure per-request: +client.with_options(max_retries=5).agent.run( + prompt="Fix the bug in auth.go", +) +``` + +### Timeouts + +By default requests time out after 1 minute. You can configure this with a `timeout` option, +which accepts a float or an [`httpx.Timeout`](https://www.python-httpx.org/advanced/timeouts/#fine-tuning-the-configuration) object: + +```python +from oz_agent_sdk import OzAPI + +# Configure the default for all requests: +client = OzAPI( + # 20 seconds (default is 1 minute) + timeout=20.0, +) + +# More granular control: +client = OzAPI( + timeout=httpx.Timeout(60.0, read=5.0, write=10.0, connect=2.0), +) + +# Override per-request: +client.with_options(timeout=5.0).agent.run( + prompt="Fix the bug in auth.go", +) +``` + +On timeout, an `APITimeoutError` is thrown. + +Note that requests that time out are [retried twice by default](#retries). + +## Advanced + +### Logging + +We use the standard library [`logging`](https://docs.python.org/3/library/logging.html) module. + +You can enable logging by setting the environment variable `OZ_API_LOG` to `info`. + +```shell +$ export OZ_API_LOG=info +``` + +Or to `debug` for more verbose logging. + +### How to tell whether `None` means `null` or missing + +In an API response, a field may be explicitly `null`, or missing entirely; in either case, its value is `None` in this library. You can differentiate the two cases with `.model_fields_set`: + +```py +if response.my_field is None: + if 'my_field' not in response.model_fields_set: + print('Got json like {}, without a "my_field" key present at all.') + else: + print('Got json like {"my_field": null}.') +``` + +### Accessing raw response data (e.g. headers) + +The "raw" Response object can be accessed by prefixing `.with_raw_response.` to any HTTP method call, e.g., + +```py +from oz_agent_sdk import OzAPI + +client = OzAPI() +response = client.agent.with_raw_response.run( + prompt="Fix the bug in auth.go", +) +print(response.headers.get('X-My-Header')) + +agent = response.parse() # get the object that `agent.run()` would have returned +print(agent.run_id) +``` + +These methods return an [`APIResponse`](https://github.com/warpdotdev/oz-sdk-python/tree/main/src/oz_agent_sdk/_response.py) object. + +The async client returns an [`AsyncAPIResponse`](https://github.com/warpdotdev/oz-sdk-python/tree/main/src/oz_agent_sdk/_response.py) with the same structure, the only difference being `await`able methods for reading the response content. + +#### `.with_streaming_response` + +The above interface eagerly reads the full response body when you make the request, which may not always be what you want. + +To stream the response body, use `.with_streaming_response` instead, which requires a context manager and only reads the response body once you call `.read()`, `.text()`, `.json()`, `.iter_bytes()`, `.iter_text()`, `.iter_lines()` or `.parse()`. In the async client, these are async methods. + +```python +with client.agent.with_streaming_response.run( + prompt="Fix the bug in auth.go", +) as response: + print(response.headers.get("X-My-Header")) + + for line in response.iter_lines(): + print(line) +``` + +The context manager is required so that the response will reliably be closed. + +### Making custom/undocumented requests + +This library is typed for convenient access to the documented API. + +If you need to access undocumented endpoints, params, or response properties, the library can still be used. + +#### Undocumented endpoints + +To make requests to undocumented endpoints, you can make requests using `client.get`, `client.post`, and other +http verbs. Options on the client will be respected (such as retries) when making this request. + +```py +import httpx + +response = client.post( + "/foo", + cast_to=httpx.Response, + body={"my_param": True}, +) + +print(response.headers.get("x-foo")) +``` + +#### Undocumented request params + +If you want to explicitly send an extra param, you can do so with the `extra_query`, `extra_body`, and `extra_headers` request +options. + +#### Undocumented response properties + +To access undocumented response properties, you can access the extra fields like `response.unknown_prop`. You +can also get all the extra fields on the Pydantic model as a dict with +[`response.model_extra`](https://docs.pydantic.dev/latest/api/base_model/#pydantic.BaseModel.model_extra). + +### Configuring the HTTP client + +You can directly override the [httpx client](https://www.python-httpx.org/api/#client) to customize it for your use case, including: + +- Support for [proxies](https://www.python-httpx.org/advanced/proxies/) +- Custom [transports](https://www.python-httpx.org/advanced/transports/) +- Additional [advanced](https://www.python-httpx.org/advanced/clients/) functionality + +```python +import httpx +from oz_agent_sdk import OzAPI, DefaultHttpxClient + +client = OzAPI( + # Or use the `OZ_API_BASE_URL` env var + base_url="http://my.test.server.example.com:8083", + http_client=DefaultHttpxClient( + proxy="http://my.test.proxy.example.com", + transport=httpx.HTTPTransport(local_address="0.0.0.0"), + ), +) +``` + +You can also customize the client on a per-request basis by using `with_options()`: + +```python +client.with_options(http_client=DefaultHttpxClient(...)) +``` + +### Managing HTTP resources + +By default the library closes underlying HTTP connections whenever the client is [garbage collected](https://docs.python.org/3/reference/datamodel.html#object.__del__). You can manually close the client using the `.close()` method if desired, or with a context manager that closes when exiting. + +```py +from oz_agent_sdk import OzAPI + +with OzAPI() as client: + # make requests here + ... + +# HTTP client is now closed +``` + +## Versioning + +This package generally follows [SemVer](https://semver.org/spec/v2.0.0.html) conventions, though certain backwards-incompatible changes may be released as minor versions: + +1. Changes that only affect static types, without breaking runtime behavior. +2. Changes to library internals which are technically public but not intended or documented for external use. _(Please open a GitHub issue to let us know if you are relying on such internals.)_ +3. Changes that we do not expect to impact the vast majority of users in practice. + +We take backwards-compatibility seriously and work hard to ensure you can rely on a smooth upgrade experience. + +We are keen for your feedback; please open an [issue](https://www.github.com/warpdotdev/oz-sdk-python/issues) with questions, bugs, or suggestions. + +### Determining the installed version + +If you've upgraded to the latest version but aren't seeing any new features you were expecting then your python environment is likely still using an older version. + +You can determine the version that is being used at runtime with: + +```py +import oz_agent_sdk +print(oz_agent_sdk.__version__) +``` + +## Requirements + +Python 3.9 or higher. + +## Contributing + +See [the contributing documentation](./CONTRIBUTING.md). diff --git a/SECURITY.md b/SECURITY.md new file mode 100644 index 0000000..221f548 --- /dev/null +++ b/SECURITY.md @@ -0,0 +1,23 @@ +# Security Policy + +## Reporting Security Issues + +This SDK is generated by [Stainless Software Inc](http://stainless.com). Stainless takes security seriously, and encourages you to report any security vulnerability promptly so that appropriate action can be taken. + +To report a security issue, please contact the Stainless team at security@stainless.com. + +## Responsible Disclosure + +We appreciate the efforts of security researchers and individuals who help us maintain the security of +SDKs we generate. If you believe you have found a security vulnerability, please adhere to responsible +disclosure practices by allowing us a reasonable amount of time to investigate and address the issue +before making any information public. + +## Reporting Non-SDK Related Security Issues + +If you encounter security issues that are not directly related to SDKs but pertain to the services +or products provided by Oz API, please follow the respective company's security reporting guidelines. + +--- + +Thank you for helping us keep the SDKs and systems they interact with secure. diff --git a/api.md b/api.md new file mode 100644 index 0000000..3ef6227 --- /dev/null +++ b/api.md @@ -0,0 +1,82 @@ +# Agent + +Types: + +```python +from oz_agent_sdk.types import ( + AgentSkill, + AmbientAgentConfig, + AwsProviderConfig, + CloudEnvironmentConfig, + Error, + ErrorCode, + GcpProviderConfig, + McpServerConfig, + Scope, + UserProfile, + AgentListResponse, + AgentGetArtifactResponse, + AgentRunResponse, +) +``` + +Methods: + +- client.agent.list(\*\*params) -> AgentListResponse +- client.agent.get_artifact(artifact_uid) -> AgentGetArtifactResponse +- client.agent.run(\*\*params) -> AgentRunResponse + +## Runs + +Types: + +```python +from oz_agent_sdk.types.agent import ( + ArtifactItem, + RunItem, + RunSourceType, + RunState, + RunCancelResponse, +) +``` + +Methods: + +- client.agent.runs.retrieve(run_id) -> RunItem +- client.agent.runs.list(\*\*params) -> SyncRunsCursorPage[RunItem] +- client.agent.runs.cancel(run_id) -> str + +## Schedules + +Types: + +```python +from oz_agent_sdk.types.agent import ( + ScheduledAgentHistoryItem, + ScheduledAgentItem, + ScheduleListResponse, + ScheduleDeleteResponse, +) +``` + +Methods: + +- client.agent.schedules.create(\*\*params) -> ScheduledAgentItem +- client.agent.schedules.retrieve(schedule_id) -> ScheduledAgentItem +- client.agent.schedules.update(schedule_id, \*\*params) -> ScheduledAgentItem +- client.agent.schedules.list() -> ScheduleListResponse +- client.agent.schedules.delete(schedule_id) -> ScheduleDeleteResponse +- client.agent.schedules.pause(schedule_id) -> ScheduledAgentItem +- client.agent.schedules.resume(schedule_id) -> ScheduledAgentItem + +## Sessions + +Types: + +```python +from oz_agent_sdk.types.agent import SessionCheckRedirectResponse +``` + +Methods: + +- client.agent.sessions.check_redirect(session_uuid) -> SessionCheckRedirectResponse diff --git a/bin/check-release-environment b/bin/check-release-environment new file mode 100644 index 0000000..1e951e9 --- /dev/null +++ b/bin/check-release-environment @@ -0,0 +1,17 @@ +#!/usr/bin/env bash + +errors=() + +lenErrors=${#errors[@]} + +if [[ lenErrors -gt 0 ]]; then + echo -e "Found the following errors in the release environment:\n" + + for error in "${errors[@]}"; do + echo -e "- $error\n" + done + + exit 1 +fi + +echo "The environment is ready to push releases!" diff --git a/bin/publish-pypi b/bin/publish-pypi new file mode 100644 index 0000000..5895700 --- /dev/null +++ b/bin/publish-pypi @@ -0,0 +1,11 @@ +#!/usr/bin/env bash + +set -eux +rm -rf dist +mkdir -p dist +uv build +if [ -n "${PYPI_TOKEN:-}" ]; then + uv publish --token=$PYPI_TOKEN +else + uv publish +fi diff --git a/examples/.keep b/examples/.keep new file mode 100644 index 0000000..d8c73e9 --- /dev/null +++ b/examples/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store example files demonstrating usage of this SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/pyproject.toml b/pyproject.toml new file mode 100644 index 0000000..e8c1daf --- /dev/null +++ b/pyproject.toml @@ -0,0 +1,255 @@ +[project] +name = "oz-agent-sdk" +version = "0.10.1" +description = "The official Python library for the oz-api API" +dynamic = ["readme"] +license = "Apache-2.0" +authors = [ +{ name = "Oz API", email = "" }, +] + +dependencies = [ + "httpx>=0.23.0, <1", + "pydantic>=1.9.0, <3", + "typing-extensions>=4.14, <5", + "anyio>=3.5.0, <5", + "distro>=1.7.0, <2", + "sniffio", +] + +requires-python = ">= 3.9" +classifiers = [ + "Typing :: Typed", + "Intended Audience :: Developers", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Programming Language :: Python :: 3.12", + "Programming Language :: Python :: 3.13", + "Programming Language :: Python :: 3.14", + "Operating System :: OS Independent", + "Operating System :: POSIX", + "Operating System :: MacOS", + "Operating System :: POSIX :: Linux", + "Operating System :: Microsoft :: Windows", + "Topic :: Software Development :: Libraries :: Python Modules", + "License :: OSI Approved :: Apache Software License" +] + +[project.urls] +Homepage = "https://github.com/warpdotdev/oz-sdk-python" +Repository = "https://github.com/warpdotdev/oz-sdk-python" + +[project.optional-dependencies] +aiohttp = ["aiohttp", "httpx_aiohttp>=0.1.9"] + +[tool.uv] +managed = true +required-version = ">=0.9" +conflicts = [ + [ + { group = "pydantic-v1" }, + { group = "pydantic-v2" }, + ], +] + +[dependency-groups] +# version pins are in uv.lock +dev = [ + "pyright==1.1.399", + "mypy==1.17", + "respx", + "pytest", + "pytest-asyncio", + "ruff", + "time-machine", + "dirty-equals>=0.6.0", + "importlib-metadata>=6.7.0", + "rich>=13.7.1", + "pytest-xdist>=3.6.1", +] +pydantic-v1 = [ + "pydantic>=1.9.0,<2", +] +pydantic-v2 = [ + "pydantic~=2.0 ; python_full_version < '3.14'", + "pydantic~=2.12 ; python_full_version >= '3.14'", +] + +[build-system] +requires = ["hatchling==1.26.3", "hatch-fancy-pypi-readme"] +build-backend = "hatchling.build" + +[tool.hatch.build] +include = [ + "src/*" +] + +[tool.hatch.build.targets.wheel] +packages = ["src/oz_agent_sdk"] + +[tool.hatch.build.targets.sdist] +# Basically everything except hidden files/directories (such as .github, .devcontainers, .python-version, etc) +include = [ + "/*.toml", + "/*.json", + "/*.lock", + "/*.md", + "/mypy.ini", + "/noxfile.py", + "bin/*", + "examples/*", + "src/*", + "tests/*", +] + +[tool.hatch.metadata.hooks.fancy-pypi-readme] +content-type = "text/markdown" + +[[tool.hatch.metadata.hooks.fancy-pypi-readme.fragments]] +path = "README.md" + +[[tool.hatch.metadata.hooks.fancy-pypi-readme.substitutions]] +# replace relative links with absolute links +pattern = '\[(.+?)\]\(((?!https?://)\S+?)\)' +replacement = '[\1](https://github.com/warpdotdev/oz-sdk-python/tree/main/\g<2>)' + +[tool.pytest.ini_options] +testpaths = ["tests"] +addopts = "--tb=short -n auto" +xfail_strict = true +asyncio_mode = "auto" +asyncio_default_fixture_loop_scope = "session" +filterwarnings = [ + "error" +] + +[tool.pyright] +# this enables practically every flag given by pyright. +# there are a couple of flags that are still disabled by +# default in strict mode as they are experimental and niche. +typeCheckingMode = "strict" +pythonVersion = "3.9" + +exclude = [ + "_dev", + ".venv", + ".nox", + ".git", +] + +reportImplicitOverride = true +reportOverlappingOverload = false + +reportImportCycles = false +reportPrivateUsage = false + +[tool.mypy] +pretty = true +show_error_codes = true + +# Exclude _files.py because mypy isn't smart enough to apply +# the correct type narrowing and as this is an internal module +# it's fine to just use Pyright. +# +# We also exclude our `tests` as mypy doesn't always infer +# types correctly and Pyright will still catch any type errors. +exclude = ['src/oz_agent_sdk/_files.py', '_dev/.*.py', 'tests/.*'] + +strict_equality = true +implicit_reexport = true +check_untyped_defs = true +no_implicit_optional = true + +warn_return_any = true +warn_unreachable = true +warn_unused_configs = true + +# Turn these options off as it could cause conflicts +# with the Pyright options. +warn_unused_ignores = false +warn_redundant_casts = false + +disallow_any_generics = true +disallow_untyped_defs = true +disallow_untyped_calls = true +disallow_subclassing_any = true +disallow_incomplete_defs = true +disallow_untyped_decorators = true +cache_fine_grained = true + +# By default, mypy reports an error if you assign a value to the result +# of a function call that doesn't return anything. We do this in our test +# cases: +# ``` +# result = ... +# assert result is None +# ``` +# Changing this codegen to make mypy happy would increase complexity +# and would not be worth it. +disable_error_code = "func-returns-value,overload-cannot-match" + +# https://github.com/python/mypy/issues/12162 +[[tool.mypy.overrides]] +module = "black.files.*" +ignore_errors = true +ignore_missing_imports = true + + +[tool.ruff] +line-length = 120 +output-format = "grouped" +target-version = "py38" + +[tool.ruff.format] +docstring-code-format = true + +[tool.ruff.lint] +select = [ + # isort + "I", + # bugbear rules + "B", + # remove unused imports + "F401", + # check for missing future annotations + "FA102", + # bare except statements + "E722", + # unused arguments + "ARG", + # print statements + "T201", + "T203", + # misuse of typing.TYPE_CHECKING + "TC004", + # import rules + "TID251", +] +ignore = [ + # mutable defaults + "B006", +] +unfixable = [ + # disable auto fix for print statements + "T201", + "T203", +] + +extend-safe-fixes = ["FA102"] + +[tool.ruff.lint.flake8-tidy-imports.banned-api] +"functools.lru_cache".msg = "This function does not retain type information for the wrapped function's arguments; The `lru_cache` function from `_utils` should be used instead" + +[tool.ruff.lint.isort] +length-sort = true +length-sort-straight = true +combine-as-imports = true +extra-standard-library = ["typing_extensions"] +known-first-party = ["oz_agent_sdk", "tests"] + +[tool.ruff.lint.per-file-ignores] +"bin/**.py" = ["T201", "T203"] +"scripts/**.py" = ["T201", "T203"] +"tests/**.py" = ["T201", "T203"] +"examples/**.py" = ["T201", "T203"] diff --git a/release-please-config.json b/release-please-config.json new file mode 100644 index 0000000..37299b0 --- /dev/null +++ b/release-please-config.json @@ -0,0 +1,66 @@ +{ + "packages": { + ".": {} + }, + "$schema": "https://raw.githubusercontent.com/stainless-api/release-please/main/schemas/config.json", + "include-v-in-tag": true, + "include-component-in-tag": false, + "versioning": "prerelease", + "prerelease": true, + "bump-minor-pre-major": true, + "bump-patch-for-minor-pre-major": false, + "pull-request-header": "Automated Release PR", + "pull-request-title-pattern": "release: ${version}", + "changelog-sections": [ + { + "type": "feat", + "section": "Features" + }, + { + "type": "fix", + "section": "Bug Fixes" + }, + { + "type": "perf", + "section": "Performance Improvements" + }, + { + "type": "revert", + "section": "Reverts" + }, + { + "type": "chore", + "section": "Chores" + }, + { + "type": "docs", + "section": "Documentation" + }, + { + "type": "style", + "section": "Styles" + }, + { + "type": "refactor", + "section": "Refactors" + }, + { + "type": "test", + "section": "Tests", + "hidden": true + }, + { + "type": "build", + "section": "Build System" + }, + { + "type": "ci", + "section": "Continuous Integration", + "hidden": true + } + ], + "release-type": "python", + "extra-files": [ + "src/oz_agent_sdk/_version.py" + ] +} \ No newline at end of file diff --git a/requirements-dev.lock b/requirements-dev.lock new file mode 100644 index 0000000..f34eca7 --- /dev/null +++ b/requirements-dev.lock @@ -0,0 +1,110 @@ +# This file was autogenerated by uv via the following command: +# uv export -o requirements-dev.lock --no-hashes +-e . +annotated-types==0.7.0 + # via pydantic +anyio==4.12.1 + # via + # httpx + # oz-agent-sdk +backports-asyncio-runner==1.2.0 ; python_full_version < '3.11' + # via pytest-asyncio +certifi==2026.1.4 + # via + # httpcore + # httpx +colorama==0.4.6 ; sys_platform == 'win32' + # via pytest +dirty-equals==0.11 +distro==1.9.0 + # via oz-agent-sdk +exceptiongroup==1.3.1 ; python_full_version < '3.11' + # via + # anyio + # pytest +execnet==2.1.2 + # via pytest-xdist +h11==0.16.0 + # via httpcore +httpcore==1.0.9 + # via httpx +httpx==0.28.1 + # via + # oz-agent-sdk + # respx +idna==3.11 + # via + # anyio + # httpx +importlib-metadata==8.7.1 +iniconfig==2.1.0 ; python_full_version < '3.10' + # via pytest +iniconfig==2.3.0 ; python_full_version >= '3.10' + # via pytest +markdown-it-py==3.0.0 ; python_full_version < '3.10' + # via rich +markdown-it-py==4.0.0 ; python_full_version >= '3.10' + # via rich +mdurl==0.1.2 + # via markdown-it-py +mypy==1.17.0 +mypy-extensions==1.1.0 + # via mypy +nodeenv==1.10.0 + # via pyright +packaging==25.0 + # via pytest +pathspec==1.0.3 + # via mypy +pluggy==1.6.0 + # via pytest +pydantic==2.12.5 + # via oz-agent-sdk +pydantic-core==2.41.5 + # via pydantic +pygments==2.19.2 + # via + # pytest + # rich +pyright==1.1.399 +pytest==8.4.2 ; python_full_version < '3.10' + # via + # pytest-asyncio + # pytest-xdist +pytest==9.0.2 ; python_full_version >= '3.10' + # via + # pytest-asyncio + # pytest-xdist +pytest-asyncio==1.2.0 ; python_full_version < '3.10' +pytest-asyncio==1.3.0 ; python_full_version >= '3.10' +pytest-xdist==3.8.0 +python-dateutil==2.9.0.post0 ; python_full_version < '3.10' + # via time-machine +respx==0.22.0 +rich==14.2.0 +ruff==0.14.13 +six==1.17.0 ; python_full_version < '3.10' + # via python-dateutil +sniffio==1.3.1 + # via oz-agent-sdk +time-machine==2.19.0 ; python_full_version < '3.10' +time-machine==3.2.0 ; python_full_version >= '3.10' +tomli==2.4.0 ; python_full_version < '3.11' + # via + # mypy + # pytest +typing-extensions==4.15.0 + # via + # anyio + # exceptiongroup + # mypy + # oz-agent-sdk + # pydantic + # pydantic-core + # pyright + # pytest-asyncio + # typing-inspection +typing-inspection==0.4.2 + # via pydantic +zipp==3.23.0 + # via importlib-metadata diff --git a/scripts/bootstrap b/scripts/bootstrap new file mode 100755 index 0000000..4638ec6 --- /dev/null +++ b/scripts/bootstrap @@ -0,0 +1,30 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [ -f "Brewfile" ] && [ "$(uname -s)" = "Darwin" ] && [ "$SKIP_BREW" != "1" ] && [ -t 0 ]; then + brew bundle check >/dev/null 2>&1 || { + echo -n "==> Install Homebrew dependencies? (y/N): " + read -r response + case "$response" in + [yY][eE][sS]|[yY]) + brew bundle + ;; + *) + ;; + esac + echo + } +fi + +echo "==> Installing Python…" +uv python install + +echo "==> Installing Python dependencies…" +uv sync --all-extras + +echo "==> Exporting Python dependencies…" +# note: `--no-hashes` is required because of https://github.com/pypa/pip/issues/4995 +uv export -o requirements-dev.lock --no-hashes diff --git a/scripts/format b/scripts/format new file mode 100755 index 0000000..c8e1f69 --- /dev/null +++ b/scripts/format @@ -0,0 +1,14 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Running ruff" +uv run ruff format +uv run ruff check --fix . +# run formatting again to fix any inconsistencies when imports are stripped +uv run ruff format + +echo "==> Formatting docs" +uv run python scripts/utils/ruffen-docs.py README.md $(find . -type f -name api.md) diff --git a/scripts/lint b/scripts/lint new file mode 100755 index 0000000..7087a2b --- /dev/null +++ b/scripts/lint @@ -0,0 +1,22 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [ "$1" = "--fix" ]; then + echo "==> Running ruff with --fix" + uv run ruff check . --fix +else + echo "==> Running ruff" + uv run ruff check . +fi + +echo "==> Running pyright" +uv run pyright + +echo "==> Running mypy" +uv run mypy . + +echo "==> Making sure it imports" +uv run python -c 'import oz_agent_sdk' diff --git a/scripts/test b/scripts/test new file mode 100755 index 0000000..fe50ebb --- /dev/null +++ b/scripts/test @@ -0,0 +1,38 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + + + +export DEFER_PYDANTIC_BUILD=false + +# Note that we need to specify the patch version here so that uv +# won't use unstable (alpha, beta, rc) releases for the tests +PY_VERSION_MIN=">=3.9.0" +PY_VERSION_MAX=">=3.14.0" + +function run_tests() { + echo "==> Running tests with Pydantic v2" + uv run --isolated --all-extras pytest "$@" + + # Skip Pydantic v1 tests on latest Python (not supported) + if [[ "$UV_PYTHON" != "$PY_VERSION_MAX" ]]; then + echo "==> Running tests with Pydantic v1" + uv run --isolated --all-extras --group=pydantic-v1 pytest "$@" + fi +} + +# If UV_PYTHON is already set in the environment, just run the command once +if [[ -n "$UV_PYTHON" ]]; then + run_tests "$@" +else + # If UV_PYTHON is not set, run the command for min and max versions + + echo "==> Running tests for Python $PY_VERSION_MIN" + UV_PYTHON="$PY_VERSION_MIN" run_tests "$@" + + echo "==> Running tests for Python $PY_VERSION_MAX" + UV_PYTHON="$PY_VERSION_MAX" run_tests "$@" +fi diff --git a/scripts/utils/ruffen-docs.py b/scripts/utils/ruffen-docs.py new file mode 100644 index 0000000..0cf2bd2 --- /dev/null +++ b/scripts/utils/ruffen-docs.py @@ -0,0 +1,167 @@ +# fork of https://github.com/asottile/blacken-docs adapted for ruff +from __future__ import annotations + +import re +import sys +import argparse +import textwrap +import contextlib +import subprocess +from typing import Match, Optional, Sequence, Generator, NamedTuple, cast + +MD_RE = re.compile( + r"(?P^(?P *)```\s*python\n)" r"(?P.*?)" r"(?P^(?P=indent)```\s*$)", + re.DOTALL | re.MULTILINE, +) +MD_PYCON_RE = re.compile( + r"(?P^(?P *)```\s*pycon\n)" r"(?P.*?)" r"(?P^(?P=indent)```.*$)", + re.DOTALL | re.MULTILINE, +) +PYCON_PREFIX = ">>> " +PYCON_CONTINUATION_PREFIX = "..." +PYCON_CONTINUATION_RE = re.compile( + rf"^{re.escape(PYCON_CONTINUATION_PREFIX)}( |$)", +) +DEFAULT_LINE_LENGTH = 100 + + +class CodeBlockError(NamedTuple): + offset: int + exc: Exception + + +def format_str( + src: str, +) -> tuple[str, Sequence[CodeBlockError]]: + errors: list[CodeBlockError] = [] + + @contextlib.contextmanager + def _collect_error(match: Match[str]) -> Generator[None, None, None]: + try: + yield + except Exception as e: + errors.append(CodeBlockError(match.start(), e)) + + def _md_match(match: Match[str]) -> str: + code = textwrap.dedent(match["code"]) + with _collect_error(match): + code = format_code_block(code) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + def _pycon_match(match: Match[str]) -> str: + code = "" + fragment = cast(Optional[str], None) + + def finish_fragment() -> None: + nonlocal code + nonlocal fragment + + if fragment is not None: + with _collect_error(match): + fragment = format_code_block(fragment) + fragment_lines = fragment.splitlines() + code += f"{PYCON_PREFIX}{fragment_lines[0]}\n" + for line in fragment_lines[1:]: + # Skip blank lines to handle Black adding a blank above + # functions within blocks. A blank line would end the REPL + # continuation prompt. + # + # >>> if True: + # ... def f(): + # ... pass + # ... + if line: + code += f"{PYCON_CONTINUATION_PREFIX} {line}\n" + if fragment_lines[-1].startswith(" "): + code += f"{PYCON_CONTINUATION_PREFIX}\n" + fragment = None + + indentation = None + for line in match["code"].splitlines(): + orig_line, line = line, line.lstrip() + if indentation is None and line: + indentation = len(orig_line) - len(line) + continuation_match = PYCON_CONTINUATION_RE.match(line) + if continuation_match and fragment is not None: + fragment += line[continuation_match.end() :] + "\n" + else: + finish_fragment() + if line.startswith(PYCON_PREFIX): + fragment = line[len(PYCON_PREFIX) :] + "\n" + else: + code += orig_line[indentation:] + "\n" + finish_fragment() + return code + + def _md_pycon_match(match: Match[str]) -> str: + code = _pycon_match(match) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + src = MD_RE.sub(_md_match, src) + src = MD_PYCON_RE.sub(_md_pycon_match, src) + return src, errors + + +def format_code_block(code: str) -> str: + return subprocess.check_output( + [ + sys.executable, + "-m", + "ruff", + "format", + "--stdin-filename=script.py", + f"--line-length={DEFAULT_LINE_LENGTH}", + ], + encoding="utf-8", + input=code, + ) + + +def format_file( + filename: str, + skip_errors: bool, +) -> int: + with open(filename, encoding="UTF-8") as f: + contents = f.read() + new_contents, errors = format_str(contents) + for error in errors: + lineno = contents[: error.offset].count("\n") + 1 + print(f"{filename}:{lineno}: code block parse error {error.exc}") + if errors and not skip_errors: + return 1 + if contents != new_contents: + print(f"{filename}: Rewriting...") + with open(filename, "w", encoding="UTF-8") as f: + f.write(new_contents) + return 0 + else: + return 0 + + +def main(argv: Sequence[str] | None = None) -> int: + parser = argparse.ArgumentParser() + parser.add_argument( + "-l", + "--line-length", + type=int, + default=DEFAULT_LINE_LENGTH, + ) + parser.add_argument( + "-S", + "--skip-string-normalization", + action="store_true", + ) + parser.add_argument("-E", "--skip-errors", action="store_true") + parser.add_argument("filenames", nargs="*") + args = parser.parse_args(argv) + + retv = 0 + for filename in args.filenames: + retv |= format_file(filename, skip_errors=args.skip_errors) + return retv + + +if __name__ == "__main__": + raise SystemExit(main()) diff --git a/scripts/utils/upload-artifact.sh b/scripts/utils/upload-artifact.sh new file mode 100755 index 0000000..9f6eb1f --- /dev/null +++ b/scripts/utils/upload-artifact.sh @@ -0,0 +1,27 @@ +#!/usr/bin/env bash +set -exuo pipefail + +FILENAME=$(basename dist/*.whl) + +RESPONSE=$(curl -X POST "$URL?filename=$FILENAME" \ + -H "Authorization: Bearer $AUTH" \ + -H "Content-Type: application/json") + +SIGNED_URL=$(echo "$RESPONSE" | jq -r '.url') + +if [[ "$SIGNED_URL" == "null" ]]; then + echo -e "\033[31mFailed to get signed URL.\033[0m" + exit 1 +fi + +UPLOAD_RESPONSE=$(curl -v -X PUT \ + -H "Content-Type: binary/octet-stream" \ + --data-binary "@dist/$FILENAME" "$SIGNED_URL" 2>&1) + +if echo "$UPLOAD_RESPONSE" | grep -q "HTTP/[0-9.]* 200"; then + echo -e "\033[32mUploaded build to Stainless storage.\033[0m" + echo -e "\033[32mInstallation: pip install 'https://pkg.stainless.com/s/warp-api-python/$SHA/$FILENAME'\033[0m" +else + echo -e "\033[31mFailed to upload artifact.\033[0m" + exit 1 +fi diff --git a/src/oz_agent_sdk/__init__.py b/src/oz_agent_sdk/__init__.py new file mode 100644 index 0000000..ea8b882 --- /dev/null +++ b/src/oz_agent_sdk/__init__.py @@ -0,0 +1,92 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import typing as _t + +from . import types +from ._types import NOT_GIVEN, Omit, NoneType, NotGiven, Transport, ProxiesTypes, omit, not_given +from ._utils import file_from_path +from ._client import OzAPI, Client, Stream, Timeout, Transport, AsyncOzAPI, AsyncClient, AsyncStream, RequestOptions +from ._models import BaseModel +from ._version import __title__, __version__ +from ._response import APIResponse as APIResponse, AsyncAPIResponse as AsyncAPIResponse +from ._constants import DEFAULT_TIMEOUT, DEFAULT_MAX_RETRIES, DEFAULT_CONNECTION_LIMITS +from ._exceptions import ( + APIError, + OzAPIError, + ConflictError, + NotFoundError, + APIStatusError, + RateLimitError, + APITimeoutError, + BadRequestError, + APIConnectionError, + AuthenticationError, + InternalServerError, + PermissionDeniedError, + UnprocessableEntityError, + APIResponseValidationError, +) +from ._base_client import DefaultHttpxClient, DefaultAioHttpClient, DefaultAsyncHttpxClient +from ._utils._logs import setup_logging as _setup_logging + +__all__ = [ + "types", + "__version__", + "__title__", + "NoneType", + "Transport", + "ProxiesTypes", + "NotGiven", + "NOT_GIVEN", + "not_given", + "Omit", + "omit", + "OzAPIError", + "APIError", + "APIStatusError", + "APITimeoutError", + "APIConnectionError", + "APIResponseValidationError", + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", + "Timeout", + "RequestOptions", + "Client", + "AsyncClient", + "Stream", + "AsyncStream", + "OzAPI", + "AsyncOzAPI", + "file_from_path", + "BaseModel", + "DEFAULT_TIMEOUT", + "DEFAULT_MAX_RETRIES", + "DEFAULT_CONNECTION_LIMITS", + "DefaultHttpxClient", + "DefaultAsyncHttpxClient", + "DefaultAioHttpClient", +] + +if not _t.TYPE_CHECKING: + from ._utils._resources_proxy import resources as resources + +_setup_logging() + +# Update the __module__ attribute for exported symbols so that +# error messages point to this module instead of the module +# it was originally defined in, e.g. +# oz_agent_sdk._exceptions.NotFoundError -> oz_agent_sdk.NotFoundError +__locals = locals() +for __name in __all__: + if not __name.startswith("__"): + try: + __locals[__name].__module__ = "oz_agent_sdk" + except (TypeError, AttributeError): + # Some of our exported symbols are builtins which we can't set attributes for. + pass diff --git a/src/oz_agent_sdk/_base_client.py b/src/oz_agent_sdk/_base_client.py new file mode 100644 index 0000000..047d5bb --- /dev/null +++ b/src/oz_agent_sdk/_base_client.py @@ -0,0 +1,2153 @@ +from __future__ import annotations + +import sys +import json +import time +import uuid +import email +import asyncio +import inspect +import logging +import platform +import warnings +import email.utils +from types import TracebackType +from random import random +from typing import ( + TYPE_CHECKING, + Any, + Dict, + Type, + Union, + Generic, + Mapping, + TypeVar, + Iterable, + Iterator, + Optional, + Generator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Literal, override, get_origin + +import anyio +import httpx +import distro +import pydantic +from httpx import URL +from pydantic import PrivateAttr + +from . import _exceptions +from ._qs import Querystring +from ._files import to_httpx_files, async_to_httpx_files +from ._types import ( + Body, + Omit, + Query, + Headers, + Timeout, + NotGiven, + ResponseT, + AnyMapping, + PostParser, + BinaryTypes, + RequestFiles, + HttpxSendArgs, + RequestOptions, + AsyncBinaryTypes, + HttpxRequestFiles, + ModelBuilderProtocol, + not_given, +) +from ._utils import is_dict, is_list, asyncify, is_given, lru_cache, is_mapping +from ._compat import PYDANTIC_V1, model_copy, model_dump +from ._models import GenericModel, SecurityOptions, FinalRequestOptions, validate_type, construct_type +from ._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + extract_response_type, +) +from ._constants import ( + DEFAULT_TIMEOUT, + MAX_RETRY_DELAY, + DEFAULT_MAX_RETRIES, + INITIAL_RETRY_DELAY, + RAW_RESPONSE_HEADER, + OVERRIDE_CAST_TO_HEADER, + DEFAULT_CONNECTION_LIMITS, +) +from ._streaming import Stream, SSEDecoder, AsyncStream, SSEBytesDecoder +from ._exceptions import ( + APIStatusError, + APITimeoutError, + APIConnectionError, + APIResponseValidationError, +) +from ._utils._json import openapi_dumps + +log: logging.Logger = logging.getLogger(__name__) + +# TODO: make base page type vars covariant +SyncPageT = TypeVar("SyncPageT", bound="BaseSyncPage[Any]") +AsyncPageT = TypeVar("AsyncPageT", bound="BaseAsyncPage[Any]") + + +_T = TypeVar("_T") +_T_co = TypeVar("_T_co", covariant=True) + +_StreamT = TypeVar("_StreamT", bound=Stream[Any]) +_AsyncStreamT = TypeVar("_AsyncStreamT", bound=AsyncStream[Any]) + +if TYPE_CHECKING: + from httpx._config import ( + DEFAULT_TIMEOUT_CONFIG, # pyright: ignore[reportPrivateImportUsage] + ) + + HTTPX_DEFAULT_TIMEOUT = DEFAULT_TIMEOUT_CONFIG +else: + try: + from httpx._config import DEFAULT_TIMEOUT_CONFIG as HTTPX_DEFAULT_TIMEOUT + except ImportError: + # taken from https://github.com/encode/httpx/blob/3ba5fe0d7ac70222590e759c31442b1cab263791/httpx/_config.py#L366 + HTTPX_DEFAULT_TIMEOUT = Timeout(5.0) + + +class PageInfo: + """Stores the necessary information to build the request to retrieve the next page. + + Either `url` or `params` must be set. + """ + + url: URL | NotGiven + params: Query | NotGiven + json: Body | NotGiven + + @overload + def __init__( + self, + *, + url: URL, + ) -> None: ... + + @overload + def __init__( + self, + *, + params: Query, + ) -> None: ... + + @overload + def __init__( + self, + *, + json: Body, + ) -> None: ... + + def __init__( + self, + *, + url: URL | NotGiven = not_given, + json: Body | NotGiven = not_given, + params: Query | NotGiven = not_given, + ) -> None: + self.url = url + self.json = json + self.params = params + + @override + def __repr__(self) -> str: + if self.url: + return f"{self.__class__.__name__}(url={self.url})" + if self.json: + return f"{self.__class__.__name__}(json={self.json})" + return f"{self.__class__.__name__}(params={self.params})" + + +class BasePage(GenericModel, Generic[_T]): + """ + Defines the core interface for pagination. + + Type Args: + ModelT: The pydantic model that represents an item in the response. + + Methods: + has_next_page(): Check if there is another page available + next_page_info(): Get the necessary information to make a request for the next page + """ + + _options: FinalRequestOptions = PrivateAttr() + _model: Type[_T] = PrivateAttr() + + def has_next_page(self) -> bool: + items = self._get_page_items() + if not items: + return False + return self.next_page_info() is not None + + def next_page_info(self) -> Optional[PageInfo]: ... + + def _get_page_items(self) -> Iterable[_T]: # type: ignore[empty-body] + ... + + def _params_from_url(self, url: URL) -> httpx.QueryParams: + # TODO: do we have to preprocess params here? + return httpx.QueryParams(cast(Any, self._options.params)).merge(url.params) + + def _info_to_options(self, info: PageInfo) -> FinalRequestOptions: + options = model_copy(self._options) + options._strip_raw_response_header() + + if not isinstance(info.params, NotGiven): + options.params = {**options.params, **info.params} + return options + + if not isinstance(info.url, NotGiven): + params = self._params_from_url(info.url) + url = info.url.copy_with(params=params) + options.params = dict(url.params) + options.url = str(url) + return options + + if not isinstance(info.json, NotGiven): + if not is_mapping(info.json): + raise TypeError("Pagination is only supported with mappings") + + if not options.json_data: + options.json_data = {**info.json} + else: + if not is_mapping(options.json_data): + raise TypeError("Pagination is only supported with mappings") + + options.json_data = {**options.json_data, **info.json} + return options + + raise ValueError("Unexpected PageInfo state") + + +class BaseSyncPage(BasePage[_T], Generic[_T]): + _client: SyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + client: SyncAPIClient, + model: Type[_T], + options: FinalRequestOptions, + ) -> None: + if (not PYDANTIC_V1) and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + # Pydantic uses a custom `__iter__` method to support casting BaseModels + # to dictionaries. e.g. dict(model). + # As we want to support `for item in page`, this is inherently incompatible + # with the default pydantic behaviour. It is not possible to support both + # use cases at once. Fortunately, this is not a big deal as all other pydantic + # methods should continue to work as expected as there is an alternative method + # to cast a model to a dictionary, model.dict(), which is used internally + # by pydantic. + def __iter__(self) -> Iterator[_T]: # type: ignore + for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + def iter_pages(self: SyncPageT) -> Iterator[SyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = page.get_next_page() + else: + return + + def get_next_page(self: SyncPageT) -> SyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return self._client._request_api_list(self._model, page=self.__class__, options=options) + + +class AsyncPaginator(Generic[_T, AsyncPageT]): + def __init__( + self, + client: AsyncAPIClient, + options: FinalRequestOptions, + page_cls: Type[AsyncPageT], + model: Type[_T], + ) -> None: + self._model = model + self._client = client + self._options = options + self._page_cls = page_cls + + def __await__(self) -> Generator[Any, None, AsyncPageT]: + return self._get_page().__await__() + + async def _get_page(self) -> AsyncPageT: + def _parser(resp: AsyncPageT) -> AsyncPageT: + resp._set_private_attributes( + model=self._model, + options=self._options, + client=self._client, + ) + return resp + + self._options.post_parser = _parser + + return await self._client.request(self._page_cls, self._options) + + async def __aiter__(self) -> AsyncIterator[_T]: + # https://github.com/microsoft/pyright/issues/3464 + page = cast( + AsyncPageT, + await self, # type: ignore + ) + async for item in page: + yield item + + +class BaseAsyncPage(BasePage[_T], Generic[_T]): + _client: AsyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + model: Type[_T], + client: AsyncAPIClient, + options: FinalRequestOptions, + ) -> None: + if (not PYDANTIC_V1) and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + async def __aiter__(self) -> AsyncIterator[_T]: + async for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + async def iter_pages(self: AsyncPageT) -> AsyncIterator[AsyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = await page.get_next_page() + else: + return + + async def get_next_page(self: AsyncPageT) -> AsyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return await self._client._request_api_list(self._model, page=self.__class__, options=options) + + +_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient]) +_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]]) + + +class BaseClient(Generic[_HttpxClientT, _DefaultStreamT]): + _client: _HttpxClientT + _version: str + _base_url: URL + max_retries: int + timeout: Union[float, Timeout, None] + _strict_response_validation: bool + _idempotency_header: str | None + _default_stream_cls: type[_DefaultStreamT] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None = DEFAULT_TIMEOUT, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + self._version = version + self._base_url = self._enforce_trailing_slash(URL(base_url)) + self.max_retries = max_retries + self.timeout = timeout + self._custom_headers = custom_headers or {} + self._custom_query = custom_query or {} + self._strict_response_validation = _strict_response_validation + self._idempotency_header = None + self._platform: Platform | None = None + + if max_retries is None: # pyright: ignore[reportUnnecessaryComparison] + raise TypeError( + "max_retries cannot be None. If you want to disable retries, pass `0`; if you want unlimited retries, pass `math.inf` or a very high number; if you want the default behavior, pass `oz_agent_sdk.DEFAULT_MAX_RETRIES`" + ) + + def _enforce_trailing_slash(self, url: URL) -> URL: + if url.raw_path.endswith(b"/"): + return url + return url.copy_with(raw_path=url.raw_path + b"/") + + def _make_status_error_from_response( + self, + response: httpx.Response, + ) -> APIStatusError: + if response.is_closed and not response.is_stream_consumed: + # We can't read the response body as it has been closed + # before it was read. This can happen if an event hook + # raises a status error. + body = None + err_msg = f"Error code: {response.status_code}" + else: + err_text = response.text.strip() + body = err_text + + try: + body = json.loads(err_text) + err_msg = f"Error code: {response.status_code} - {body}" + except Exception: + err_msg = err_text or f"Error code: {response.status_code}" + + return self._make_status_error(err_msg, body=body, response=response) + + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> _exceptions.APIStatusError: + raise NotImplementedError() + + def _auth_headers( + self, + security: SecurityOptions, # noqa: ARG002 + ) -> dict[str, str]: + return {} + + def _auth_query( + self, + security: SecurityOptions, # noqa: ARG002 + ) -> dict[str, str]: + return {} + + def _custom_auth( + self, + security: SecurityOptions, # noqa: ARG002 + ) -> httpx.Auth | None: + return None + + def _build_headers(self, options: FinalRequestOptions, *, retries_taken: int = 0) -> httpx.Headers: + custom_headers = options.headers or {} + headers_dict = _merge_mappings({**self._auth_headers(options.security), **self.default_headers}, custom_headers) + self._validate_headers(headers_dict, custom_headers) + + # headers are case-insensitive while dictionaries are not. + headers = httpx.Headers(headers_dict) + + idempotency_header = self._idempotency_header + if idempotency_header and options.idempotency_key and idempotency_header not in headers: + headers[idempotency_header] = options.idempotency_key + + # Don't set these headers if they were already set or removed by the caller. We check + # `custom_headers`, which can contain `Omit()`, instead of `headers` to account for the removal case. + lower_custom_headers = [header.lower() for header in custom_headers] + if "x-stainless-retry-count" not in lower_custom_headers: + headers["x-stainless-retry-count"] = str(retries_taken) + if "x-stainless-read-timeout" not in lower_custom_headers: + timeout = self.timeout if isinstance(options.timeout, NotGiven) else options.timeout + if isinstance(timeout, Timeout): + timeout = timeout.read + if timeout is not None: + headers["x-stainless-read-timeout"] = str(timeout) + + return headers + + def _prepare_url(self, url: str) -> URL: + """ + Merge a URL argument together with any 'base_url' on the client, + to create the URL used for the outgoing request. + """ + # Copied from httpx's `_merge_url` method. + merge_url = URL(url) + if merge_url.is_relative_url: + merge_raw_path = self.base_url.raw_path + merge_url.raw_path.lstrip(b"/") + return self.base_url.copy_with(raw_path=merge_raw_path) + + return merge_url + + def _make_sse_decoder(self) -> SSEDecoder | SSEBytesDecoder: + return SSEDecoder() + + def _build_request( + self, + options: FinalRequestOptions, + *, + retries_taken: int = 0, + ) -> httpx.Request: + if log.isEnabledFor(logging.DEBUG): + log.debug( + "Request options: %s", + model_dump( + options, + exclude_unset=True, + # Pydantic v1 can't dump every type we support in content, so we exclude it for now. + exclude={ + "content", + } + if PYDANTIC_V1 + else {}, + ), + ) + kwargs: dict[str, Any] = {} + + json_data = options.json_data + if options.extra_json is not None: + if json_data is None: + json_data = cast(Body, options.extra_json) + elif is_mapping(json_data): + json_data = _merge_mappings(json_data, options.extra_json) + else: + raise RuntimeError(f"Unexpected JSON data type, {type(json_data)}, cannot merge with `extra_body`") + + headers = self._build_headers(options, retries_taken=retries_taken) + params = _merge_mappings({**self._auth_query(options.security), **self.default_query}, options.params) + content_type = headers.get("Content-Type") + files = options.files + + # If the given Content-Type header is multipart/form-data then it + # has to be removed so that httpx can generate the header with + # additional information for us as it has to be in this form + # for the server to be able to correctly parse the request: + # multipart/form-data; boundary=---abc-- + if content_type is not None and content_type.startswith("multipart/form-data"): + if "boundary" not in content_type: + # only remove the header if the boundary hasn't been explicitly set + # as the caller doesn't want httpx to come up with their own boundary + headers.pop("Content-Type") + + # As we are now sending multipart/form-data instead of application/json + # we need to tell httpx to use it, https://www.python-httpx.org/advanced/clients/#multipart-file-encoding + if json_data: + if not is_dict(json_data): + raise TypeError( + f"Expected query input to be a dictionary for multipart requests but got {type(json_data)} instead." + ) + kwargs["data"] = self._serialize_multipartform(json_data) + + # httpx determines whether or not to send a "multipart/form-data" + # request based on the truthiness of the "files" argument. + # This gets around that issue by generating a dict value that + # evaluates to true. + # + # https://github.com/encode/httpx/discussions/2399#discussioncomment-3814186 + if not files: + files = cast(HttpxRequestFiles, ForceMultipartDict()) + + prepared_url = self._prepare_url(options.url) + # preserve hard-coded query params from the url + if params and prepared_url.query: + params = {**dict(prepared_url.params.items()), **params} + prepared_url = prepared_url.copy_with(raw_path=prepared_url.raw_path.split(b"?", 1)[0]) + if "_" in prepared_url.host: + # work around https://github.com/encode/httpx/discussions/2880 + kwargs["extensions"] = {"sni_hostname": prepared_url.host.replace("_", "-")} + + is_body_allowed = options.method.lower() != "get" + + if is_body_allowed: + if options.content is not None and json_data is not None: + raise TypeError("Passing both `content` and `json_data` is not supported") + if options.content is not None and files is not None: + raise TypeError("Passing both `content` and `files` is not supported") + if options.content is not None: + kwargs["content"] = options.content + elif isinstance(json_data, bytes): + kwargs["content"] = json_data + elif not files: + # Don't set content when JSON is sent as multipart/form-data, + # since httpx's content param overrides other body arguments + kwargs["content"] = openapi_dumps(json_data) if is_given(json_data) and json_data is not None else None + kwargs["files"] = files + else: + headers.pop("Content-Type", None) + kwargs.pop("data", None) + + # TODO: report this error to httpx + return self._client.build_request( # pyright: ignore[reportUnknownMemberType] + headers=headers, + timeout=self.timeout if isinstance(options.timeout, NotGiven) else options.timeout, + method=options.method, + url=prepared_url, + # the `Query` type that we use is incompatible with qs' + # `Params` type as it needs to be typed as `Mapping[str, object]` + # so that passing a `TypedDict` doesn't cause an error. + # https://github.com/microsoft/pyright/issues/3526#event-6715453066 + params=self.qs.stringify(cast(Mapping[str, Any], params)) if params else None, + **kwargs, + ) + + def _serialize_multipartform(self, data: Mapping[object, object]) -> dict[str, object]: + items = self.qs.stringify_items( + # TODO: type ignore is required as stringify_items is well typed but we can't be + # well typed without heavy validation. + data, # type: ignore + array_format="brackets", + ) + serialized: dict[str, object] = {} + for key, value in items: + existing = serialized.get(key) + + if not existing: + serialized[key] = value + continue + + # If a value has already been set for this key then that + # means we're sending data like `array[]=[1, 2, 3]` and we + # need to tell httpx that we want to send multiple values with + # the same key which is done by using a list or a tuple. + # + # Note: 2d arrays should never result in the same key at both + # levels so it's safe to assume that if the value is a list, + # it was because we changed it to be a list. + if is_list(existing): + existing.append(value) + else: + serialized[key] = [existing, value] + + return serialized + + def _maybe_override_cast_to(self, cast_to: type[ResponseT], options: FinalRequestOptions) -> type[ResponseT]: + if not is_given(options.headers): + return cast_to + + # make a copy of the headers so we don't mutate user-input + headers = dict(options.headers) + + # we internally support defining a temporary header to override the + # default `cast_to` type for use with `.with_raw_response` and `.with_streaming_response` + # see _response.py for implementation details + override_cast_to = headers.pop(OVERRIDE_CAST_TO_HEADER, not_given) + if is_given(override_cast_to): + options.headers = headers + return cast(Type[ResponseT], override_cast_to) + + return cast_to + + def _should_stream_response_body(self, request: httpx.Request) -> bool: + return request.headers.get(RAW_RESPONSE_HEADER) == "stream" # type: ignore[no-any-return] + + def _process_response_data( + self, + *, + data: object, + cast_to: type[ResponseT], + response: httpx.Response, + ) -> ResponseT: + if data is None: + return cast(ResponseT, None) + + if cast_to is object: + return cast(ResponseT, data) + + try: + if inspect.isclass(cast_to) and issubclass(cast_to, ModelBuilderProtocol): + return cast(ResponseT, cast_to.build(response=response, data=data)) + + if self._strict_response_validation: + return cast(ResponseT, validate_type(type_=cast_to, value=data)) + + return cast(ResponseT, construct_type(type_=cast_to, value=data)) + except pydantic.ValidationError as err: + raise APIResponseValidationError(response=response, body=data) from err + + @property + def qs(self) -> Querystring: + return Querystring() + + @property + def custom_auth(self) -> httpx.Auth | None: + return None + + @property + def auth_headers(self) -> dict[str, str]: + return {} + + @property + def default_headers(self) -> dict[str, str | Omit]: + return { + "Accept": "application/json", + "Content-Type": "application/json", + "User-Agent": self.user_agent, + **self.platform_headers(), + **self._custom_headers, + } + + @property + def default_query(self) -> dict[str, object]: + return { + **self._custom_query, + } + + def _validate_headers( + self, + headers: Headers, # noqa: ARG002 + custom_headers: Headers, # noqa: ARG002 + ) -> None: + """Validate the given default headers and custom headers. + + Does nothing by default. + """ + return + + @property + def user_agent(self) -> str: + return f"{self.__class__.__name__}/Python {self._version}" + + @property + def base_url(self) -> URL: + return self._base_url + + @base_url.setter + def base_url(self, url: URL | str) -> None: + self._base_url = self._enforce_trailing_slash(url if isinstance(url, URL) else URL(url)) + + def platform_headers(self) -> Dict[str, str]: + # the actual implementation is in a separate `lru_cache` decorated + # function because adding `lru_cache` to methods will leak memory + # https://github.com/python/cpython/issues/88476 + return platform_headers(self._version, platform=self._platform) + + def _parse_retry_after_header(self, response_headers: Optional[httpx.Headers] = None) -> float | None: + """Returns a float of the number of seconds (not milliseconds) to wait after retrying, or None if unspecified. + + About the Retry-After header: https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After + See also https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After#syntax + """ + if response_headers is None: + return None + + # First, try the non-standard `retry-after-ms` header for milliseconds, + # which is more precise than integer-seconds `retry-after` + try: + retry_ms_header = response_headers.get("retry-after-ms", None) + return float(retry_ms_header) / 1000 + except (TypeError, ValueError): + pass + + # Next, try parsing `retry-after` header as seconds (allowing nonstandard floats). + retry_header = response_headers.get("retry-after") + try: + # note: the spec indicates that this should only ever be an integer + # but if someone sends a float there's no reason for us to not respect it + return float(retry_header) + except (TypeError, ValueError): + pass + + # Last, try parsing `retry-after` as a date. + retry_date_tuple = email.utils.parsedate_tz(retry_header) + if retry_date_tuple is None: + return None + + retry_date = email.utils.mktime_tz(retry_date_tuple) + return float(retry_date - time.time()) + + def _calculate_retry_timeout( + self, + remaining_retries: int, + options: FinalRequestOptions, + response_headers: Optional[httpx.Headers] = None, + ) -> float: + max_retries = options.get_max_retries(self.max_retries) + + # If the API asks us to wait a certain amount of time (and it's a reasonable amount), just do what it says. + retry_after = self._parse_retry_after_header(response_headers) + if retry_after is not None and 0 < retry_after <= 60: + return retry_after + + # Also cap retry count to 1000 to avoid any potential overflows with `pow` + nb_retries = min(max_retries - remaining_retries, 1000) + + # Apply exponential backoff, but not more than the max. + sleep_seconds = min(INITIAL_RETRY_DELAY * pow(2.0, nb_retries), MAX_RETRY_DELAY) + + # Apply some jitter, plus-or-minus half a second. + jitter = 1 - 0.25 * random() + timeout = sleep_seconds * jitter + return timeout if timeout >= 0 else 0 + + def _should_retry(self, response: httpx.Response) -> bool: + # Note: this is not a standard header + should_retry_header = response.headers.get("x-should-retry") + + # If the server explicitly says whether or not to retry, obey. + if should_retry_header == "true": + log.debug("Retrying as header `x-should-retry` is set to `true`") + return True + if should_retry_header == "false": + log.debug("Not retrying as header `x-should-retry` is set to `false`") + return False + + # Retry on request timeouts. + if response.status_code == 408: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on lock timeouts. + if response.status_code == 409: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on rate limits. + if response.status_code == 429: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry internal errors. + if response.status_code >= 500: + log.debug("Retrying due to status code %i", response.status_code) + return True + + log.debug("Not retrying") + return False + + def _idempotency_key(self) -> str: + return f"stainless-python-retry-{uuid.uuid4()}" + + +class _DefaultHttpxClient(httpx.Client): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultHttpxClient = httpx.Client + """An alias to `httpx.Client` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.Client` will result in httpx's defaults being used, not ours. + """ +else: + DefaultHttpxClient = _DefaultHttpxClient + + +class SyncHttpxClientWrapper(DefaultHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + self.close() + except Exception: + pass + + +class SyncAPIClient(BaseClient[httpx.Client, Stream[Any]]): + _client: httpx.Client + _default_stream_cls: type[Stream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.Client | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + _strict_response_validation: bool, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.Client): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.Client` but got {type(http_client)}" + ) + + super().__init__( + version=version, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + base_url=base_url, + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or SyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + # If an error is thrown while constructing a client, self._client + # may not be present + if hasattr(self, "_client"): + self._client.close() + + def __enter__(self: _T) -> _T: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: Type[_StreamT], + ) -> _StreamT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: Type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + custom_auth = self._custom_auth(options.security) + if custom_auth is not None: + kwargs["auth"] = custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + err.response.close() + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + err.response.read() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + time.sleep(timeout) + + def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, APIResponse): + raise TypeError(f"API Response types must subclass {APIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + ResponseT, + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = APIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return api_response.parse() + + def _request_api_list( + self, + model: Type[object], + page: Type[SyncPageT], + options: FinalRequestOptions, + ) -> SyncPageT: + def _parser(resp: SyncPageT) -> SyncPageT: + resp._set_private_attributes( + client=self, + model=model, + options=options, + ) + return resp + + options.post_parser = _parser + + return self.request(page, options, stream=False) + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + # cast is required because mypy complains about returning Any even though + # it understands the type variables + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, content=content, files=to_httpx_files(files), **options + ) + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="patch", url=path, json_data=body, content=content, files=to_httpx_files(files), **options + ) + return self.request(cast_to, opts) + + def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, content=content, files=to_httpx_files(files), **options + ) + return self.request(cast_to, opts) + + def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, content=content, **options) + return self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[object], + page: Type[SyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> SyncPageT: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +class _DefaultAsyncHttpxClient(httpx.AsyncClient): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +try: + import httpx_aiohttp +except ImportError: + + class _DefaultAioHttpClient(httpx.AsyncClient): + def __init__(self, **_kwargs: Any) -> None: + raise RuntimeError("To use the aiohttp client you must have installed the package with the `aiohttp` extra") +else: + + class _DefaultAioHttpClient(httpx_aiohttp.HttpxAiohttpClient): # type: ignore + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultAsyncHttpxClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.AsyncClient` will result in httpx's defaults being used, not ours. + """ + + DefaultAioHttpClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that changes the default HTTP transport to `aiohttp`.""" +else: + DefaultAsyncHttpxClient = _DefaultAsyncHttpxClient + DefaultAioHttpClient = _DefaultAioHttpClient + + +class AsyncHttpxClientWrapper(DefaultAsyncHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + # TODO(someday): support non asyncio runtimes here + asyncio.get_running_loop().create_task(self.aclose()) + except Exception: + pass + + +class AsyncAPIClient(BaseClient[httpx.AsyncClient, AsyncStream[Any]]): + _client: httpx.AsyncClient + _default_stream_cls: type[AsyncStream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.AsyncClient | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.AsyncClient): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.AsyncClient` but got {type(http_client)}" + ) + + super().__init__( + version=version, + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or AsyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + async def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + await self._client.aclose() + + async def __aenter__(self: _T) -> _T: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + async def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + if self._platform is None: + # `get_platform` can make blocking IO calls so we + # execute it earlier while we are in an async context + self._platform = await asyncify(get_platform)() + + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = await self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + await self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = await self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + await err.response.aclose() + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + await err.response.aread() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return await self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + async def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + await anyio.sleep(timeout) + + async def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, AsyncAPIResponse): + raise TypeError(f"API Response types must subclass {AsyncAPIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + "ResponseT", + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = AsyncAPIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return await api_response.parse() + + def _request_api_list( + self, + model: Type[_T], + page: Type[AsyncPageT], + options: FinalRequestOptions, + ) -> AsyncPaginator[_T, AsyncPageT]: + return AsyncPaginator(client=self, options=options, page_cls=page, model=model) + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, content=content, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + async def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="patch", + url=path, + json_data=body, + content=content, + files=await async_to_httpx_files(files), + **options, + ) + return await self.request(cast_to, opts) + + async def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, content=content, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts) + + async def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, content=content, **options) + return await self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[_T], + page: Type[AsyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> AsyncPaginator[_T, AsyncPageT]: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +def make_request_options( + *, + query: Query | None = None, + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + idempotency_key: str | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + post_parser: PostParser | NotGiven = not_given, + security: SecurityOptions | None = None, +) -> RequestOptions: + """Create a dict of type RequestOptions without keys of NotGiven values.""" + options: RequestOptions = {} + if extra_headers is not None: + options["headers"] = extra_headers + + if extra_body is not None: + options["extra_json"] = cast(AnyMapping, extra_body) + + if query is not None: + options["params"] = query + + if extra_query is not None: + options["params"] = {**options.get("params", {}), **extra_query} + + if not isinstance(timeout, NotGiven): + options["timeout"] = timeout + + if idempotency_key is not None: + options["idempotency_key"] = idempotency_key + + if is_given(post_parser): + # internal + options["post_parser"] = post_parser # type: ignore + + if security is not None: + options["security"] = security + + return options + + +class ForceMultipartDict(Dict[str, None]): + def __bool__(self) -> bool: + return True + + +class OtherPlatform: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"Other:{self.name}" + + +Platform = Union[ + OtherPlatform, + Literal[ + "MacOS", + "Linux", + "Windows", + "FreeBSD", + "OpenBSD", + "iOS", + "Android", + "Unknown", + ], +] + + +def get_platform() -> Platform: + try: + system = platform.system().lower() + platform_name = platform.platform().lower() + except Exception: + return "Unknown" + + if "iphone" in platform_name or "ipad" in platform_name: + # Tested using Python3IDE on an iPhone 11 and Pythonista on an iPad 7 + # system is Darwin and platform_name is a string like: + # - Darwin-21.6.0-iPhone12,1-64bit + # - Darwin-21.6.0-iPad7,11-64bit + return "iOS" + + if system == "darwin": + return "MacOS" + + if system == "windows": + return "Windows" + + if "android" in platform_name: + # Tested using Pydroid 3 + # system is Linux and platform_name is a string like 'Linux-5.10.81-android12-9-00001-geba40aecb3b7-ab8534902-aarch64-with-libc' + return "Android" + + if system == "linux": + # https://distro.readthedocs.io/en/latest/#distro.id + distro_id = distro.id() + if distro_id == "freebsd": + return "FreeBSD" + + if distro_id == "openbsd": + return "OpenBSD" + + return "Linux" + + if platform_name: + return OtherPlatform(platform_name) + + return "Unknown" + + +@lru_cache(maxsize=None) +def platform_headers(version: str, *, platform: Platform | None) -> Dict[str, str]: + return { + "X-Stainless-Lang": "python", + "X-Stainless-Package-Version": version, + "X-Stainless-OS": str(platform or get_platform()), + "X-Stainless-Arch": str(get_architecture()), + "X-Stainless-Runtime": get_python_runtime(), + "X-Stainless-Runtime-Version": get_python_version(), + } + + +class OtherArch: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"other:{self.name}" + + +Arch = Union[OtherArch, Literal["x32", "x64", "arm", "arm64", "unknown"]] + + +def get_python_runtime() -> str: + try: + return platform.python_implementation() + except Exception: + return "unknown" + + +def get_python_version() -> str: + try: + return platform.python_version() + except Exception: + return "unknown" + + +def get_architecture() -> Arch: + try: + machine = platform.machine().lower() + except Exception: + return "unknown" + + if machine in ("arm64", "aarch64"): + return "arm64" + + # TODO: untested + if machine == "arm": + return "arm" + + if machine == "x86_64": + return "x64" + + # TODO: untested + if sys.maxsize <= 2**32: + return "x32" + + if machine: + return OtherArch(machine) + + return "unknown" + + +def _merge_mappings( + obj1: Mapping[_T_co, Union[_T, Omit]], + obj2: Mapping[_T_co, Union[_T, Omit]], +) -> Dict[_T_co, _T]: + """Merge two mappings of the same type, removing any values that are instances of `Omit`. + + In cases with duplicate keys the second mapping takes precedence. + """ + merged = {**obj1, **obj2} + return {key: value for key, value in merged.items() if not isinstance(value, Omit)} diff --git a/src/oz_agent_sdk/_client.py b/src/oz_agent_sdk/_client.py new file mode 100644 index 0000000..81603d2 --- /dev/null +++ b/src/oz_agent_sdk/_client.py @@ -0,0 +1,459 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import TYPE_CHECKING, Any, Mapping +from typing_extensions import Self, override + +import httpx + +from . import _exceptions +from ._qs import Querystring +from ._types import ( + Omit, + Timeout, + NotGiven, + Transport, + ProxiesTypes, + RequestOptions, + not_given, +) +from ._utils import is_given, get_async_library +from ._compat import cached_property +from ._models import SecurityOptions +from ._version import __version__ +from ._streaming import Stream as Stream, AsyncStream as AsyncStream +from ._exceptions import OzAPIError, APIStatusError +from ._base_client import ( + DEFAULT_MAX_RETRIES, + SyncAPIClient, + AsyncAPIClient, +) + +if TYPE_CHECKING: + from .resources import agent + from .resources.agent.agent import AgentResource, AsyncAgentResource + +__all__ = ["Timeout", "Transport", "ProxiesTypes", "RequestOptions", "OzAPI", "AsyncOzAPI", "Client", "AsyncClient"] + + +class OzAPI(SyncAPIClient): + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details. + http_client: httpx.Client | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new synchronous OzAPI client instance. + + This automatically infers the `api_key` argument from the `WARP_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("WARP_API_KEY") + if api_key is None: + raise OzAPIError( + "The api_key client option must be set either by passing api_key to the client or by setting the WARP_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("OZ_API_BASE_URL") + if base_url is None: + base_url = f"https://app.warp.dev/api/v1" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + @cached_property + def agent(self) -> AgentResource: + """Operations for running and managing cloud agents""" + from .resources.agent import AgentResource + + return AgentResource(self) + + @cached_property + def with_raw_response(self) -> OzAPIWithRawResponse: + return OzAPIWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> OzAPIWithStreamedResponse: + return OzAPIWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="repeat") + + @override + def _auth_headers(self, security: SecurityOptions) -> dict[str, str]: + return { + **(self._bearer_auth if security.get("bearer_auth", False) else {}), + } + + @property + def _bearer_auth(self) -> dict[str, str]: + api_key = self.api_key + return {"Authorization": f"Bearer {api_key}"} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": "false", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.Client | None = None, + max_retries: int | NotGiven = not_given, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class AsyncOzAPI(AsyncAPIClient): + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultAsyncHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#asyncclient) for more details. + http_client: httpx.AsyncClient | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new async AsyncOzAPI client instance. + + This automatically infers the `api_key` argument from the `WARP_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("WARP_API_KEY") + if api_key is None: + raise OzAPIError( + "The api_key client option must be set either by passing api_key to the client or by setting the WARP_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("OZ_API_BASE_URL") + if base_url is None: + base_url = f"https://app.warp.dev/api/v1" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + @cached_property + def agent(self) -> AsyncAgentResource: + """Operations for running and managing cloud agents""" + from .resources.agent import AsyncAgentResource + + return AsyncAgentResource(self) + + @cached_property + def with_raw_response(self) -> AsyncOzAPIWithRawResponse: + return AsyncOzAPIWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncOzAPIWithStreamedResponse: + return AsyncOzAPIWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="repeat") + + @override + def _auth_headers(self, security: SecurityOptions) -> dict[str, str]: + return { + **(self._bearer_auth if security.get("bearer_auth", False) else {}), + } + + @property + def _bearer_auth(self) -> dict[str, str]: + api_key = self.api_key + return {"Authorization": f"Bearer {api_key}"} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": f"async:{get_async_library()}", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.AsyncClient | None = None, + max_retries: int | NotGiven = not_given, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class OzAPIWithRawResponse: + _client: OzAPI + + def __init__(self, client: OzAPI) -> None: + self._client = client + + @cached_property + def agent(self) -> agent.AgentResourceWithRawResponse: + """Operations for running and managing cloud agents""" + from .resources.agent import AgentResourceWithRawResponse + + return AgentResourceWithRawResponse(self._client.agent) + + +class AsyncOzAPIWithRawResponse: + _client: AsyncOzAPI + + def __init__(self, client: AsyncOzAPI) -> None: + self._client = client + + @cached_property + def agent(self) -> agent.AsyncAgentResourceWithRawResponse: + """Operations for running and managing cloud agents""" + from .resources.agent import AsyncAgentResourceWithRawResponse + + return AsyncAgentResourceWithRawResponse(self._client.agent) + + +class OzAPIWithStreamedResponse: + _client: OzAPI + + def __init__(self, client: OzAPI) -> None: + self._client = client + + @cached_property + def agent(self) -> agent.AgentResourceWithStreamingResponse: + """Operations for running and managing cloud agents""" + from .resources.agent import AgentResourceWithStreamingResponse + + return AgentResourceWithStreamingResponse(self._client.agent) + + +class AsyncOzAPIWithStreamedResponse: + _client: AsyncOzAPI + + def __init__(self, client: AsyncOzAPI) -> None: + self._client = client + + @cached_property + def agent(self) -> agent.AsyncAgentResourceWithStreamingResponse: + """Operations for running and managing cloud agents""" + from .resources.agent import AsyncAgentResourceWithStreamingResponse + + return AsyncAgentResourceWithStreamingResponse(self._client.agent) + + +Client = OzAPI + +AsyncClient = AsyncOzAPI diff --git a/src/oz_agent_sdk/_compat.py b/src/oz_agent_sdk/_compat.py new file mode 100644 index 0000000..e6690a4 --- /dev/null +++ b/src/oz_agent_sdk/_compat.py @@ -0,0 +1,226 @@ +from __future__ import annotations + +from typing import TYPE_CHECKING, Any, Union, Generic, TypeVar, Callable, cast, overload +from datetime import date, datetime +from typing_extensions import Self, Literal, TypedDict + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import IncEx, StrBytesIntFloat + +_T = TypeVar("_T") +_ModelT = TypeVar("_ModelT", bound=pydantic.BaseModel) + +# --------------- Pydantic v2, v3 compatibility --------------- + +# Pyright incorrectly reports some of our functions as overriding a method when they don't +# pyright: reportIncompatibleMethodOverride=false + +PYDANTIC_V1 = pydantic.VERSION.startswith("1.") + +if TYPE_CHECKING: + + def parse_date(value: date | StrBytesIntFloat) -> date: # noqa: ARG001 + ... + + def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: # noqa: ARG001 + ... + + def get_args(t: type[Any]) -> tuple[Any, ...]: # noqa: ARG001 + ... + + def is_union(tp: type[Any] | None) -> bool: # noqa: ARG001 + ... + + def get_origin(t: type[Any]) -> type[Any] | None: # noqa: ARG001 + ... + + def is_literal_type(type_: type[Any]) -> bool: # noqa: ARG001 + ... + + def is_typeddict(type_: type[Any]) -> bool: # noqa: ARG001 + ... + +else: + # v1 re-exports + if PYDANTIC_V1: + from pydantic.typing import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, + ) + from pydantic.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime + else: + from ._utils import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + parse_date as parse_date, + is_typeddict as is_typeddict, + parse_datetime as parse_datetime, + is_literal_type as is_literal_type, + ) + + +# refactored config +if TYPE_CHECKING: + from pydantic import ConfigDict as ConfigDict +else: + if PYDANTIC_V1: + # TODO: provide an error message here? + ConfigDict = None + else: + from pydantic import ConfigDict as ConfigDict + + +# renamed methods / properties +def parse_obj(model: type[_ModelT], value: object) -> _ModelT: + if PYDANTIC_V1: + return cast(_ModelT, model.parse_obj(value)) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + else: + return model.model_validate(value) + + +def field_is_required(field: FieldInfo) -> bool: + if PYDANTIC_V1: + return field.required # type: ignore + return field.is_required() + + +def field_get_default(field: FieldInfo) -> Any: + value = field.get_default() + if PYDANTIC_V1: + return value + from pydantic_core import PydanticUndefined + + if value == PydanticUndefined: + return None + return value + + +def field_outer_type(field: FieldInfo) -> Any: + if PYDANTIC_V1: + return field.outer_type_ # type: ignore + return field.annotation + + +def get_model_config(model: type[pydantic.BaseModel]) -> Any: + if PYDANTIC_V1: + return model.__config__ # type: ignore + return model.model_config + + +def get_model_fields(model: type[pydantic.BaseModel]) -> dict[str, FieldInfo]: + if PYDANTIC_V1: + return model.__fields__ # type: ignore + return model.model_fields + + +def model_copy(model: _ModelT, *, deep: bool = False) -> _ModelT: + if PYDANTIC_V1: + return model.copy(deep=deep) # type: ignore + return model.model_copy(deep=deep) + + +def model_json(model: pydantic.BaseModel, *, indent: int | None = None) -> str: + if PYDANTIC_V1: + return model.json(indent=indent) # type: ignore + return model.model_dump_json(indent=indent) + + +class _ModelDumpKwargs(TypedDict, total=False): + by_alias: bool + + +def model_dump( + model: pydantic.BaseModel, + *, + exclude: IncEx | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + warnings: bool = True, + mode: Literal["json", "python"] = "python", + by_alias: bool | None = None, +) -> dict[str, Any]: + if (not PYDANTIC_V1) or hasattr(model, "model_dump"): + kwargs: _ModelDumpKwargs = {} + if by_alias is not None: + kwargs["by_alias"] = by_alias + return model.model_dump( + mode=mode, + exclude=exclude, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + # warnings are not supported in Pydantic v1 + warnings=True if PYDANTIC_V1 else warnings, + **kwargs, + ) + return cast( + "dict[str, Any]", + model.dict( # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + exclude=exclude, exclude_unset=exclude_unset, exclude_defaults=exclude_defaults, by_alias=bool(by_alias) + ), + ) + + +def model_parse(model: type[_ModelT], data: Any) -> _ModelT: + if PYDANTIC_V1: + return model.parse_obj(data) # pyright: ignore[reportDeprecated] + return model.model_validate(data) + + +# generic models +if TYPE_CHECKING: + + class GenericModel(pydantic.BaseModel): ... + +else: + if PYDANTIC_V1: + import pydantic.generics + + class GenericModel(pydantic.generics.GenericModel, pydantic.BaseModel): ... + else: + # there no longer needs to be a distinction in v2 but + # we still have to create our own subclass to avoid + # inconsistent MRO ordering errors + class GenericModel(pydantic.BaseModel): ... + + +# cached properties +if TYPE_CHECKING: + cached_property = property + + # we define a separate type (copied from typeshed) + # that represents that `cached_property` is `set`able + # at runtime, which differs from `@property`. + # + # this is a separate type as editors likely special case + # `@property` and we don't want to cause issues just to have + # more helpful internal types. + + class typed_cached_property(Generic[_T]): + func: Callable[[Any], _T] + attrname: str | None + + def __init__(self, func: Callable[[Any], _T]) -> None: ... + + @overload + def __get__(self, instance: None, owner: type[Any] | None = None) -> Self: ... + + @overload + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T: ... + + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T | Self: + raise NotImplementedError() + + def __set_name__(self, owner: type[Any], name: str) -> None: ... + + # __set__ is not defined at runtime, but @cached_property is designed to be settable + def __set__(self, instance: object, value: _T) -> None: ... +else: + from functools import cached_property as cached_property + + typed_cached_property = cached_property diff --git a/src/oz_agent_sdk/_constants.py b/src/oz_agent_sdk/_constants.py new file mode 100644 index 0000000..6ddf2c7 --- /dev/null +++ b/src/oz_agent_sdk/_constants.py @@ -0,0 +1,14 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import httpx + +RAW_RESPONSE_HEADER = "X-Stainless-Raw-Response" +OVERRIDE_CAST_TO_HEADER = "____stainless_override_cast_to" + +# default timeout is 1 minute +DEFAULT_TIMEOUT = httpx.Timeout(timeout=60, connect=5.0) +DEFAULT_MAX_RETRIES = 2 +DEFAULT_CONNECTION_LIMITS = httpx.Limits(max_connections=100, max_keepalive_connections=20) + +INITIAL_RETRY_DELAY = 0.5 +MAX_RETRY_DELAY = 8.0 diff --git a/src/oz_agent_sdk/_exceptions.py b/src/oz_agent_sdk/_exceptions.py new file mode 100644 index 0000000..d84512f --- /dev/null +++ b/src/oz_agent_sdk/_exceptions.py @@ -0,0 +1,108 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal + +import httpx + +__all__ = [ + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", +] + + +class OzAPIError(Exception): + pass + + +class APIError(OzAPIError): + message: str + request: httpx.Request + + body: object | None + """The API response body. + + If the API responded with a valid JSON structure then this property will be the + decoded result. + + If it isn't a valid JSON structure then this will be the raw response. + + If there was no response associated with this error then it will be `None`. + """ + + def __init__(self, message: str, request: httpx.Request, *, body: object | None) -> None: # noqa: ARG002 + super().__init__(message) + self.request = request + self.message = message + self.body = body + + +class APIResponseValidationError(APIError): + response: httpx.Response + status_code: int + + def __init__(self, response: httpx.Response, body: object | None, *, message: str | None = None) -> None: + super().__init__(message or "Data returned by API invalid for expected schema.", response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIStatusError(APIError): + """Raised when an API response has a status code of 4xx or 5xx.""" + + response: httpx.Response + status_code: int + + def __init__(self, message: str, *, response: httpx.Response, body: object | None) -> None: + super().__init__(message, response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIConnectionError(APIError): + def __init__(self, *, message: str = "Connection error.", request: httpx.Request) -> None: + super().__init__(message, request, body=None) + + +class APITimeoutError(APIConnectionError): + def __init__(self, request: httpx.Request) -> None: + super().__init__(message="Request timed out.", request=request) + + +class BadRequestError(APIStatusError): + status_code: Literal[400] = 400 # pyright: ignore[reportIncompatibleVariableOverride] + + +class AuthenticationError(APIStatusError): + status_code: Literal[401] = 401 # pyright: ignore[reportIncompatibleVariableOverride] + + +class PermissionDeniedError(APIStatusError): + status_code: Literal[403] = 403 # pyright: ignore[reportIncompatibleVariableOverride] + + +class NotFoundError(APIStatusError): + status_code: Literal[404] = 404 # pyright: ignore[reportIncompatibleVariableOverride] + + +class ConflictError(APIStatusError): + status_code: Literal[409] = 409 # pyright: ignore[reportIncompatibleVariableOverride] + + +class UnprocessableEntityError(APIStatusError): + status_code: Literal[422] = 422 # pyright: ignore[reportIncompatibleVariableOverride] + + +class RateLimitError(APIStatusError): + status_code: Literal[429] = 429 # pyright: ignore[reportIncompatibleVariableOverride] + + +class InternalServerError(APIStatusError): + pass diff --git a/src/oz_agent_sdk/_files.py b/src/oz_agent_sdk/_files.py new file mode 100644 index 0000000..cc14c14 --- /dev/null +++ b/src/oz_agent_sdk/_files.py @@ -0,0 +1,123 @@ +from __future__ import annotations + +import io +import os +import pathlib +from typing import overload +from typing_extensions import TypeGuard + +import anyio + +from ._types import ( + FileTypes, + FileContent, + RequestFiles, + HttpxFileTypes, + Base64FileInput, + HttpxFileContent, + HttpxRequestFiles, +) +from ._utils import is_tuple_t, is_mapping_t, is_sequence_t + + +def is_base64_file_input(obj: object) -> TypeGuard[Base64FileInput]: + return isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + + +def is_file_content(obj: object) -> TypeGuard[FileContent]: + return ( + isinstance(obj, bytes) or isinstance(obj, tuple) or isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + ) + + +def assert_is_file_content(obj: object, *, key: str | None = None) -> None: + if not is_file_content(obj): + prefix = f"Expected entry at `{key}`" if key is not None else f"Expected file input `{obj!r}`" + raise RuntimeError( + f"{prefix} to be bytes, an io.IOBase instance, PathLike or a tuple but received {type(obj)} instead." + ) from None + + +@overload +def to_httpx_files(files: None) -> None: ... + + +@overload +def to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +def to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: _transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, _transform_file(file)) for key, file in files] + else: + raise TypeError(f"Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +def _transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = pathlib.Path(file) + return (path.name, path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +def read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return pathlib.Path(file).read_bytes() + return file + + +@overload +async def async_to_httpx_files(files: None) -> None: ... + + +@overload +async def async_to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +async def async_to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: await _async_transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, await _async_transform_file(file)) for key, file in files] + else: + raise TypeError("Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +async def _async_transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = anyio.Path(file) + return (path.name, await path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], await async_read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +async def async_read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return await anyio.Path(file).read_bytes() + + return file diff --git a/src/oz_agent_sdk/_models.py b/src/oz_agent_sdk/_models.py new file mode 100644 index 0000000..e22dd2a --- /dev/null +++ b/src/oz_agent_sdk/_models.py @@ -0,0 +1,878 @@ +from __future__ import annotations + +import os +import inspect +import weakref +from typing import ( + IO, + TYPE_CHECKING, + Any, + Type, + Union, + Generic, + TypeVar, + Callable, + Iterable, + Optional, + AsyncIterable, + cast, +) +from datetime import date, datetime +from typing_extensions import ( + List, + Unpack, + Literal, + ClassVar, + Protocol, + Required, + ParamSpec, + TypedDict, + TypeGuard, + final, + override, + runtime_checkable, +) + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import ( + Body, + IncEx, + Query, + ModelT, + Headers, + Timeout, + NotGiven, + AnyMapping, + HttpxRequestFiles, +) +from ._utils import ( + PropertyInfo, + is_list, + is_given, + json_safe, + lru_cache, + is_mapping, + parse_date, + coerce_boolean, + parse_datetime, + strip_not_given, + extract_type_arg, + is_annotated_type, + is_type_alias_type, + strip_annotated_type, +) +from ._compat import ( + PYDANTIC_V1, + ConfigDict, + GenericModel as BaseGenericModel, + get_args, + is_union, + parse_obj, + get_origin, + is_literal_type, + get_model_config, + get_model_fields, + field_get_default, +) +from ._constants import RAW_RESPONSE_HEADER + +if TYPE_CHECKING: + from pydantic_core.core_schema import ModelField, ModelSchema, LiteralSchema, ModelFieldsSchema + +__all__ = ["BaseModel", "GenericModel"] + +_T = TypeVar("_T") +_BaseModelT = TypeVar("_BaseModelT", bound="BaseModel") + +P = ParamSpec("P") + + +@runtime_checkable +class _ConfigProtocol(Protocol): + allow_population_by_field_name: bool + + +class BaseModel(pydantic.BaseModel): + if PYDANTIC_V1: + + @property + @override + def model_fields_set(self) -> set[str]: + # a forwards-compat shim for pydantic v2 + return self.__fields_set__ # type: ignore + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + extra: Any = pydantic.Extra.allow # type: ignore + else: + model_config: ClassVar[ConfigDict] = ConfigDict( + extra="allow", defer_build=coerce_boolean(os.environ.get("DEFER_PYDANTIC_BUILD", "true")) + ) + + def to_dict( + self, + *, + mode: Literal["json", "python"] = "python", + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> dict[str, object]: + """Recursively generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + mode: + If mode is 'json', the dictionary will only contain JSON serializable types. e.g. `datetime` will be turned into a string, `"2024-3-22T18:11:19.117000Z"`. + If mode is 'python', the dictionary may contain any Python objects. e.g. `datetime(2024, 3, 22)` + + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that are set to their default value from the output. + exclude_none: Whether to exclude fields that have a value of `None` from the output. + warnings: Whether to log warnings when invalid fields are encountered. This is only supported in Pydantic v2. + """ + return self.model_dump( + mode=mode, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + def to_json( + self, + *, + indent: int | None = 2, + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> str: + """Generates a JSON string representing this model as it would be received from or sent to the API (but with indentation). + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + indent: Indentation to use in the JSON output. If `None` is passed, the output will be compact. Defaults to `2` + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + warnings: Whether to show any warnings that occurred during serialization. This is only supported in Pydantic v2. + """ + return self.model_dump_json( + indent=indent, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + @override + def __str__(self) -> str: + # mypy complains about an invalid self arg + return f"{self.__repr_name__()}({self.__repr_str__(', ')})" # type: ignore[misc] + + # Override the 'construct' method in a way that supports recursive parsing without validation. + # Based on https://github.com/samuelcolvin/pydantic/issues/1168#issuecomment-817742836. + @classmethod + @override + def construct( # pyright: ignore[reportIncompatibleMethodOverride] + __cls: Type[ModelT], + _fields_set: set[str] | None = None, + **values: object, + ) -> ModelT: + m = __cls.__new__(__cls) + fields_values: dict[str, object] = {} + + config = get_model_config(__cls) + populate_by_name = ( + config.allow_population_by_field_name + if isinstance(config, _ConfigProtocol) + else config.get("populate_by_name") + ) + + if _fields_set is None: + _fields_set = set() + + model_fields = get_model_fields(__cls) + for name, field in model_fields.items(): + key = field.alias + if key is None or (key not in values and populate_by_name): + key = name + + if key in values: + fields_values[name] = _construct_field(value=values[key], field=field, key=key) + _fields_set.add(name) + else: + fields_values[name] = field_get_default(field) + + extra_field_type = _get_extra_fields_type(__cls) + + _extra = {} + for key, value in values.items(): + if key not in model_fields: + parsed = construct_type(value=value, type_=extra_field_type) if extra_field_type is not None else value + + if PYDANTIC_V1: + _fields_set.add(key) + fields_values[key] = parsed + else: + _extra[key] = parsed + + object.__setattr__(m, "__dict__", fields_values) + + if PYDANTIC_V1: + # init_private_attributes() does not exist in v2 + m._init_private_attributes() # type: ignore + + # copied from Pydantic v1's `construct()` method + object.__setattr__(m, "__fields_set__", _fields_set) + else: + # these properties are copied from Pydantic's `model_construct()` method + object.__setattr__(m, "__pydantic_private__", None) + object.__setattr__(m, "__pydantic_extra__", _extra) + object.__setattr__(m, "__pydantic_fields_set__", _fields_set) + + return m + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + # because the type signatures are technically different + # although not in practice + model_construct = construct + + if PYDANTIC_V1: + # we define aliases for some of the new pydantic v2 methods so + # that we can just document these methods without having to specify + # a specific pydantic version as some users may not know which + # pydantic version they are currently using + + @override + def model_dump( + self, + *, + mode: Literal["json", "python"] | str = "python", + include: IncEx | None = None, + exclude: IncEx | None = None, + context: Any | None = None, + by_alias: bool | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + exclude_computed_fields: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + fallback: Callable[[Any], Any] | None = None, + serialize_as_any: bool = False, + ) -> dict[str, Any]: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump + + Generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + Args: + mode: The mode in which `to_python` should run. + If mode is 'json', the output will only contain JSON serializable types. + If mode is 'python', the output may contain non-JSON-serializable Python objects. + include: A set of fields to include in the output. + exclude: A set of fields to exclude from the output. + context: Additional context to pass to the serializer. + by_alias: Whether to use the field's alias in the dictionary key if defined. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that are set to their default value. + exclude_none: Whether to exclude fields that have a value of `None`. + exclude_computed_fields: Whether to exclude computed fields. + While this can be useful for round-tripping, it is usually recommended to use the dedicated + `round_trip` parameter instead. + round_trip: If True, dumped values should be valid as input for non-idempotent types such as Json[T]. + warnings: How to handle serialization errors. False/"none" ignores them, True/"warn" logs errors, + "error" raises a [`PydanticSerializationError`][pydantic_core.PydanticSerializationError]. + fallback: A function to call when an unknown value is encountered. If not provided, + a [`PydanticSerializationError`][pydantic_core.PydanticSerializationError] error is raised. + serialize_as_any: Whether to serialize fields with duck-typing serialization behavior. + + Returns: + A dictionary representation of the model. + """ + if mode not in {"json", "python"}: + raise ValueError("mode must be either 'json' or 'python'") + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + if fallback is not None: + raise ValueError("fallback is only supported in Pydantic v2") + if exclude_computed_fields != False: + raise ValueError("exclude_computed_fields is only supported in Pydantic v2") + dumped = super().dict( # pyright: ignore[reportDeprecated] + include=include, + exclude=exclude, + by_alias=by_alias if by_alias is not None else False, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + return cast("dict[str, Any]", json_safe(dumped)) if mode == "json" else dumped + + @override + def model_dump_json( + self, + *, + indent: int | None = None, + ensure_ascii: bool = False, + include: IncEx | None = None, + exclude: IncEx | None = None, + context: Any | None = None, + by_alias: bool | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + exclude_computed_fields: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + fallback: Callable[[Any], Any] | None = None, + serialize_as_any: bool = False, + ) -> str: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump_json + + Generates a JSON representation of the model using Pydantic's `to_json` method. + + Args: + indent: Indentation to use in the JSON output. If None is passed, the output will be compact. + include: Field(s) to include in the JSON output. Can take either a string or set of strings. + exclude: Field(s) to exclude from the JSON output. Can take either a string or set of strings. + by_alias: Whether to serialize using field aliases. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + round_trip: Whether to use serialization/deserialization between JSON and class instance. + warnings: Whether to show any warnings that occurred during serialization. + + Returns: + A JSON string representation of the model. + """ + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + if fallback is not None: + raise ValueError("fallback is only supported in Pydantic v2") + if ensure_ascii != False: + raise ValueError("ensure_ascii is only supported in Pydantic v2") + if exclude_computed_fields != False: + raise ValueError("exclude_computed_fields is only supported in Pydantic v2") + return super().json( # type: ignore[reportDeprecated] + indent=indent, + include=include, + exclude=exclude, + by_alias=by_alias if by_alias is not None else False, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + +def _construct_field(value: object, field: FieldInfo, key: str) -> object: + if value is None: + return field_get_default(field) + + if PYDANTIC_V1: + type_ = cast(type, field.outer_type_) # type: ignore + else: + type_ = field.annotation # type: ignore + + if type_ is None: + raise RuntimeError(f"Unexpected field type is None for {key}") + + return construct_type(value=value, type_=type_, metadata=getattr(field, "metadata", None)) + + +def _get_extra_fields_type(cls: type[pydantic.BaseModel]) -> type | None: + if PYDANTIC_V1: + # TODO + return None + + schema = cls.__pydantic_core_schema__ + if schema["type"] == "model": + fields = schema["schema"] + if fields["type"] == "model-fields": + extras = fields.get("extras_schema") + if extras and "cls" in extras: + # mypy can't narrow the type + return extras["cls"] # type: ignore[no-any-return] + + return None + + +def is_basemodel(type_: type) -> bool: + """Returns whether or not the given type is either a `BaseModel` or a union of `BaseModel`""" + if is_union(type_): + for variant in get_args(type_): + if is_basemodel(variant): + return True + + return False + + return is_basemodel_type(type_) + + +def is_basemodel_type(type_: type) -> TypeGuard[type[BaseModel] | type[GenericModel]]: + origin = get_origin(type_) or type_ + if not inspect.isclass(origin): + return False + return issubclass(origin, BaseModel) or issubclass(origin, GenericModel) + + +def build( + base_model_cls: Callable[P, _BaseModelT], + *args: P.args, + **kwargs: P.kwargs, +) -> _BaseModelT: + """Construct a BaseModel class without validation. + + This is useful for cases where you need to instantiate a `BaseModel` + from an API response as this provides type-safe params which isn't supported + by helpers like `construct_type()`. + + ```py + build(MyModel, my_field_a="foo", my_field_b=123) + ``` + """ + if args: + raise TypeError( + "Received positional arguments which are not supported; Keyword arguments must be used instead", + ) + + return cast(_BaseModelT, construct_type(type_=base_model_cls, value=kwargs)) + + +def construct_type_unchecked(*, value: object, type_: type[_T]) -> _T: + """Loose coercion to the expected type with construction of nested values. + + Note: the returned value from this function is not guaranteed to match the + given type. + """ + return cast(_T, construct_type(value=value, type_=type_)) + + +def construct_type(*, value: object, type_: object, metadata: Optional[List[Any]] = None) -> object: + """Loose coercion to the expected type with construction of nested values. + + If the given value does not match the expected type then it is returned as-is. + """ + + # store a reference to the original type we were given before we extract any inner + # types so that we can properly resolve forward references in `TypeAliasType` annotations + original_type = None + + # we allow `object` as the input type because otherwise, passing things like + # `Literal['value']` will be reported as a type error by type checkers + type_ = cast("type[object]", type_) + if is_type_alias_type(type_): + original_type = type_ # type: ignore[unreachable] + type_ = type_.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if metadata is not None and len(metadata) > 0: + meta: tuple[Any, ...] = tuple(metadata) + elif is_annotated_type(type_): + meta = get_args(type_)[1:] + type_ = extract_type_arg(type_, 0) + else: + meta = tuple() + + # we need to use the origin class for any types that are subscripted generics + # e.g. Dict[str, object] + origin = get_origin(type_) or type_ + args = get_args(type_) + + if is_union(origin): + try: + return validate_type(type_=cast("type[object]", original_type or type_), value=value) + except Exception: + pass + + # if the type is a discriminated union then we want to construct the right variant + # in the union, even if the data doesn't match exactly, otherwise we'd break code + # that relies on the constructed class types, e.g. + # + # class FooType: + # kind: Literal['foo'] + # value: str + # + # class BarType: + # kind: Literal['bar'] + # value: int + # + # without this block, if the data we get is something like `{'kind': 'bar', 'value': 'foo'}` then + # we'd end up constructing `FooType` when it should be `BarType`. + discriminator = _build_discriminated_union_meta(union=type_, meta_annotations=meta) + if discriminator and is_mapping(value): + variant_value = value.get(discriminator.field_alias_from or discriminator.field_name) + if variant_value and isinstance(variant_value, str): + variant_type = discriminator.mapping.get(variant_value) + if variant_type: + return construct_type(type_=variant_type, value=value) + + # if the data is not valid, use the first variant that doesn't fail while deserializing + for variant in args: + try: + return construct_type(value=value, type_=variant) + except Exception: + continue + + raise RuntimeError(f"Could not convert data into a valid instance of {type_}") + + if origin == dict: + if not is_mapping(value): + return value + + _, items_type = get_args(type_) # Dict[_, items_type] + return {key: construct_type(value=item, type_=items_type) for key, item in value.items()} + + if ( + not is_literal_type(type_) + and inspect.isclass(origin) + and (issubclass(origin, BaseModel) or issubclass(origin, GenericModel)) + ): + if is_list(value): + return [cast(Any, type_).construct(**entry) if is_mapping(entry) else entry for entry in value] + + if is_mapping(value): + if issubclass(type_, BaseModel): + return type_.construct(**value) # type: ignore[arg-type] + + return cast(Any, type_).construct(**value) + + if origin == list: + if not is_list(value): + return value + + inner_type = args[0] # List[inner_type] + return [construct_type(value=entry, type_=inner_type) for entry in value] + + if origin == float: + if isinstance(value, int): + coerced = float(value) + if coerced != value: + return value + return coerced + + return value + + if type_ == datetime: + try: + return parse_datetime(value) # type: ignore + except Exception: + return value + + if type_ == date: + try: + return parse_date(value) # type: ignore + except Exception: + return value + + return value + + +@runtime_checkable +class CachedDiscriminatorType(Protocol): + __discriminator__: DiscriminatorDetails + + +DISCRIMINATOR_CACHE: weakref.WeakKeyDictionary[type, DiscriminatorDetails] = weakref.WeakKeyDictionary() + + +class DiscriminatorDetails: + field_name: str + """The name of the discriminator field in the variant class, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] + ``` + + Will result in field_name='type' + """ + + field_alias_from: str | None + """The name of the discriminator field in the API response, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] = Field(alias='type_from_api') + ``` + + Will result in field_alias_from='type_from_api' + """ + + mapping: dict[str, type] + """Mapping of discriminator value to variant type, e.g. + + {'foo': FooVariant, 'bar': BarVariant} + """ + + def __init__( + self, + *, + mapping: dict[str, type], + discriminator_field: str, + discriminator_alias: str | None, + ) -> None: + self.mapping = mapping + self.field_name = discriminator_field + self.field_alias_from = discriminator_alias + + +def _build_discriminated_union_meta(*, union: type, meta_annotations: tuple[Any, ...]) -> DiscriminatorDetails | None: + cached = DISCRIMINATOR_CACHE.get(union) + if cached is not None: + return cached + + discriminator_field_name: str | None = None + + for annotation in meta_annotations: + if isinstance(annotation, PropertyInfo) and annotation.discriminator is not None: + discriminator_field_name = annotation.discriminator + break + + if not discriminator_field_name: + return None + + mapping: dict[str, type] = {} + discriminator_alias: str | None = None + + for variant in get_args(union): + variant = strip_annotated_type(variant) + if is_basemodel_type(variant): + if PYDANTIC_V1: + field_info = cast("dict[str, FieldInfo]", variant.__fields__).get(discriminator_field_name) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + if not field_info: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field_info.alias + + if (annotation := getattr(field_info, "annotation", None)) and is_literal_type(annotation): + for entry in get_args(annotation): + if isinstance(entry, str): + mapping[entry] = variant + else: + field = _extract_field_schema_pv2(variant, discriminator_field_name) + if not field: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field.get("serialization_alias") + + field_schema = field["schema"] + + if field_schema["type"] == "literal": + for entry in cast("LiteralSchema", field_schema)["expected"]: + if isinstance(entry, str): + mapping[entry] = variant + + if not mapping: + return None + + details = DiscriminatorDetails( + mapping=mapping, + discriminator_field=discriminator_field_name, + discriminator_alias=discriminator_alias, + ) + DISCRIMINATOR_CACHE.setdefault(union, details) + return details + + +def _extract_field_schema_pv2(model: type[BaseModel], field_name: str) -> ModelField | None: + schema = model.__pydantic_core_schema__ + if schema["type"] == "definitions": + schema = schema["schema"] + + if schema["type"] != "model": + return None + + schema = cast("ModelSchema", schema) + fields_schema = schema["schema"] + if fields_schema["type"] != "model-fields": + return None + + fields_schema = cast("ModelFieldsSchema", fields_schema) + field = fields_schema["fields"].get(field_name) + if not field: + return None + + return cast("ModelField", field) # pyright: ignore[reportUnnecessaryCast] + + +def validate_type(*, type_: type[_T], value: object) -> _T: + """Strict validation that the given value matches the expected type""" + if inspect.isclass(type_) and issubclass(type_, pydantic.BaseModel): + return cast(_T, parse_obj(type_, value)) + + return cast(_T, _validate_non_model_type(type_=type_, value=value)) + + +def set_pydantic_config(typ: Any, config: pydantic.ConfigDict) -> None: + """Add a pydantic config for the given type. + + Note: this is a no-op on Pydantic v1. + """ + setattr(typ, "__pydantic_config__", config) # noqa: B010 + + +# our use of subclassing here causes weirdness for type checkers, +# so we just pretend that we don't subclass +if TYPE_CHECKING: + GenericModel = BaseModel +else: + + class GenericModel(BaseGenericModel, BaseModel): + pass + + +if not PYDANTIC_V1: + from pydantic import TypeAdapter as _TypeAdapter + + _CachedTypeAdapter = cast("TypeAdapter[object]", lru_cache(maxsize=None)(_TypeAdapter)) + + if TYPE_CHECKING: + from pydantic import TypeAdapter + else: + TypeAdapter = _CachedTypeAdapter + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + return TypeAdapter(type_).validate_python(value) + +elif not TYPE_CHECKING: # TODO: condition is weird + + class RootModel(GenericModel, Generic[_T]): + """Used as a placeholder to easily convert runtime types to a Pydantic format + to provide validation. + + For example: + ```py + validated = RootModel[int](__root__="5").__root__ + # validated: 5 + ``` + """ + + __root__: _T + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + model = _create_pydantic_model(type_).validate(value) + return cast(_T, model.__root__) + + def _create_pydantic_model(type_: _T) -> Type[RootModel[_T]]: + return RootModel[type_] # type: ignore + + +class SecurityOptions(TypedDict, total=False): + bearer_auth: bool + + +class FinalRequestOptionsInput(TypedDict, total=False): + method: Required[str] + url: Required[str] + params: Query + headers: Headers + max_retries: int + timeout: float | Timeout | None + files: HttpxRequestFiles | None + idempotency_key: str + content: Union[bytes, bytearray, IO[bytes], Iterable[bytes], AsyncIterable[bytes], None] + json_data: Body + extra_json: AnyMapping + follow_redirects: bool + security: SecurityOptions + + +@final +class FinalRequestOptions(pydantic.BaseModel): + method: str + url: str + params: Query = {} + headers: Union[Headers, NotGiven] = NotGiven() + max_retries: Union[int, NotGiven] = NotGiven() + timeout: Union[float, Timeout, None, NotGiven] = NotGiven() + files: Union[HttpxRequestFiles, None] = None + idempotency_key: Union[str, None] = None + post_parser: Union[Callable[[Any], Any], NotGiven] = NotGiven() + follow_redirects: Union[bool, None] = None + security: SecurityOptions = {"bearer_auth": True} + + content: Union[bytes, bytearray, IO[bytes], Iterable[bytes], AsyncIterable[bytes], None] = None + # It should be noted that we cannot use `json` here as that would override + # a BaseModel method in an incompatible fashion. + json_data: Union[Body, None] = None + extra_json: Union[AnyMapping, None] = None + + if PYDANTIC_V1: + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + arbitrary_types_allowed: bool = True + else: + model_config: ClassVar[ConfigDict] = ConfigDict(arbitrary_types_allowed=True) + + def get_max_retries(self, max_retries: int) -> int: + if isinstance(self.max_retries, NotGiven): + return max_retries + return self.max_retries + + def _strip_raw_response_header(self) -> None: + if not is_given(self.headers): + return + + if self.headers.get(RAW_RESPONSE_HEADER): + self.headers = {**self.headers} + self.headers.pop(RAW_RESPONSE_HEADER) + + # override the `construct` method so that we can run custom transformations. + # this is necessary as we don't want to do any actual runtime type checking + # (which means we can't use validators) but we do want to ensure that `NotGiven` + # values are not present + # + # type ignore required because we're adding explicit types to `**values` + @classmethod + def construct( # type: ignore + cls, + _fields_set: set[str] | None = None, + **values: Unpack[FinalRequestOptionsInput], + ) -> FinalRequestOptions: + kwargs: dict[str, Any] = { + # we unconditionally call `strip_not_given` on any value + # as it will just ignore any non-mapping types + key: strip_not_given(value) + for key, value in values.items() + } + if PYDANTIC_V1: + return cast(FinalRequestOptions, super().construct(_fields_set, **kwargs)) # pyright: ignore[reportDeprecated] + return super().model_construct(_fields_set, **kwargs) + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + model_construct = construct diff --git a/src/oz_agent_sdk/_qs.py b/src/oz_agent_sdk/_qs.py new file mode 100644 index 0000000..de8c99b --- /dev/null +++ b/src/oz_agent_sdk/_qs.py @@ -0,0 +1,153 @@ +from __future__ import annotations + +from typing import Any, List, Tuple, Union, Mapping, TypeVar +from urllib.parse import parse_qs, urlencode +from typing_extensions import Literal, get_args + +from ._types import NotGiven, not_given +from ._utils import flatten + +_T = TypeVar("_T") + + +ArrayFormat = Literal["comma", "repeat", "indices", "brackets"] +NestedFormat = Literal["dots", "brackets"] + +PrimitiveData = Union[str, int, float, bool, None] +# this should be Data = Union[PrimitiveData, "List[Data]", "Tuple[Data]", "Mapping[str, Data]"] +# https://github.com/microsoft/pyright/issues/3555 +Data = Union[PrimitiveData, List[Any], Tuple[Any], "Mapping[str, Any]"] +Params = Mapping[str, Data] + + +class Querystring: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + *, + array_format: ArrayFormat = "repeat", + nested_format: NestedFormat = "brackets", + ) -> None: + self.array_format = array_format + self.nested_format = nested_format + + def parse(self, query: str) -> Mapping[str, object]: + # Note: custom format syntax is not supported yet + return parse_qs(query) + + def stringify( + self, + params: Params, + *, + array_format: ArrayFormat | NotGiven = not_given, + nested_format: NestedFormat | NotGiven = not_given, + ) -> str: + return urlencode( + self.stringify_items( + params, + array_format=array_format, + nested_format=nested_format, + ) + ) + + def stringify_items( + self, + params: Params, + *, + array_format: ArrayFormat | NotGiven = not_given, + nested_format: NestedFormat | NotGiven = not_given, + ) -> list[tuple[str, str]]: + opts = Options( + qs=self, + array_format=array_format, + nested_format=nested_format, + ) + return flatten([self._stringify_item(key, value, opts) for key, value in params.items()]) + + def _stringify_item( + self, + key: str, + value: Data, + opts: Options, + ) -> list[tuple[str, str]]: + if isinstance(value, Mapping): + items: list[tuple[str, str]] = [] + nested_format = opts.nested_format + for subkey, subvalue in value.items(): + items.extend( + self._stringify_item( + # TODO: error if unknown format + f"{key}.{subkey}" if nested_format == "dots" else f"{key}[{subkey}]", + subvalue, + opts, + ) + ) + return items + + if isinstance(value, (list, tuple)): + array_format = opts.array_format + if array_format == "comma": + return [ + ( + key, + ",".join(self._primitive_value_to_str(item) for item in value if item is not None), + ), + ] + elif array_format == "repeat": + items = [] + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + elif array_format == "indices": + items = [] + for i, item in enumerate(value): + items.extend(self._stringify_item(f"{key}[{i}]", item, opts)) + return items + elif array_format == "brackets": + items = [] + key = key + "[]" + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + else: + raise NotImplementedError( + f"Unknown array_format value: {array_format}, choose from {', '.join(get_args(ArrayFormat))}" + ) + + serialised = self._primitive_value_to_str(value) + if not serialised: + return [] + return [(key, serialised)] + + def _primitive_value_to_str(self, value: PrimitiveData) -> str: + # copied from httpx + if value is True: + return "true" + elif value is False: + return "false" + elif value is None: + return "" + return str(value) + + +_qs = Querystring() +parse = _qs.parse +stringify = _qs.stringify +stringify_items = _qs.stringify_items + + +class Options: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + qs: Querystring = _qs, + *, + array_format: ArrayFormat | NotGiven = not_given, + nested_format: NestedFormat | NotGiven = not_given, + ) -> None: + self.array_format = qs.array_format if isinstance(array_format, NotGiven) else array_format + self.nested_format = qs.nested_format if isinstance(nested_format, NotGiven) else nested_format diff --git a/src/oz_agent_sdk/_resource.py b/src/oz_agent_sdk/_resource.py new file mode 100644 index 0000000..b875682 --- /dev/null +++ b/src/oz_agent_sdk/_resource.py @@ -0,0 +1,43 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import time +from typing import TYPE_CHECKING + +import anyio + +if TYPE_CHECKING: + from ._client import OzAPI, AsyncOzAPI + + +class SyncAPIResource: + _client: OzAPI + + def __init__(self, client: OzAPI) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + def _sleep(self, seconds: float) -> None: + time.sleep(seconds) + + +class AsyncAPIResource: + _client: AsyncOzAPI + + def __init__(self, client: AsyncOzAPI) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + async def _sleep(self, seconds: float) -> None: + await anyio.sleep(seconds) diff --git a/src/oz_agent_sdk/_response.py b/src/oz_agent_sdk/_response.py new file mode 100644 index 0000000..4781d7c --- /dev/null +++ b/src/oz_agent_sdk/_response.py @@ -0,0 +1,835 @@ +from __future__ import annotations + +import os +import inspect +import logging +import datetime +import functools +from types import TracebackType +from typing import ( + TYPE_CHECKING, + Any, + Union, + Generic, + TypeVar, + Callable, + Iterator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Awaitable, ParamSpec, override, get_origin + +import anyio +import httpx +import pydantic + +from ._types import NoneType +from ._utils import is_given, extract_type_arg, is_annotated_type, is_type_alias_type, extract_type_var_from_base +from ._models import BaseModel, is_basemodel +from ._constants import RAW_RESPONSE_HEADER, OVERRIDE_CAST_TO_HEADER +from ._streaming import Stream, AsyncStream, is_stream_class_type, extract_stream_chunk_type +from ._exceptions import OzAPIError, APIResponseValidationError + +if TYPE_CHECKING: + from ._models import FinalRequestOptions + from ._base_client import BaseClient + + +P = ParamSpec("P") +R = TypeVar("R") +_T = TypeVar("_T") +_APIResponseT = TypeVar("_APIResponseT", bound="APIResponse[Any]") +_AsyncAPIResponseT = TypeVar("_AsyncAPIResponseT", bound="AsyncAPIResponse[Any]") + +log: logging.Logger = logging.getLogger(__name__) + + +class BaseAPIResponse(Generic[R]): + _cast_to: type[R] + _client: BaseClient[Any, Any] + _parsed_by_type: dict[type[Any], Any] + _is_sse_stream: bool + _stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None + _options: FinalRequestOptions + + http_response: httpx.Response + + retries_taken: int + """The number of retries made. If no retries happened this will be `0`""" + + def __init__( + self, + *, + raw: httpx.Response, + cast_to: type[R], + client: BaseClient[Any, Any], + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + options: FinalRequestOptions, + retries_taken: int = 0, + ) -> None: + self._cast_to = cast_to + self._client = client + self._parsed_by_type = {} + self._is_sse_stream = stream + self._stream_cls = stream_cls + self._options = options + self.http_response = raw + self.retries_taken = retries_taken + + @property + def headers(self) -> httpx.Headers: + return self.http_response.headers + + @property + def http_request(self) -> httpx.Request: + """Returns the httpx Request instance associated with the current response.""" + return self.http_response.request + + @property + def status_code(self) -> int: + return self.http_response.status_code + + @property + def url(self) -> httpx.URL: + """Returns the URL for which the request was made.""" + return self.http_response.url + + @property + def method(self) -> str: + return self.http_request.method + + @property + def http_version(self) -> str: + return self.http_response.http_version + + @property + def elapsed(self) -> datetime.timedelta: + """The time taken for the complete request/response cycle to complete.""" + return self.http_response.elapsed + + @property + def is_closed(self) -> bool: + """Whether or not the response body has been closed. + + If this is False then there is response data that has not been read yet. + You must either fully consume the response body or call `.close()` + before discarding the response to prevent resource leaks. + """ + return self.http_response.is_closed + + @override + def __repr__(self) -> str: + return ( + f"<{self.__class__.__name__} [{self.status_code} {self.http_response.reason_phrase}] type={self._cast_to}>" + ) + + def _parse(self, *, to: type[_T] | None = None) -> R | _T: + cast_to = to if to is not None else self._cast_to + + # unwrap `TypeAlias('Name', T)` -> `T` + if is_type_alias_type(cast_to): + cast_to = cast_to.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if cast_to and is_annotated_type(cast_to): + cast_to = extract_type_arg(cast_to, 0) + + origin = get_origin(cast_to) or cast_to + + if self._is_sse_stream: + if to: + if not is_stream_class_type(to): + raise TypeError(f"Expected custom parse type to be a subclass of {Stream} or {AsyncStream}") + + return cast( + _T, + to( + cast_to=extract_stream_chunk_type( + to, + failure_message="Expected custom stream type to be passed with a type argument, e.g. Stream[ChunkType]", + ), + response=self.http_response, + client=cast(Any, self._client), + options=self._options, + ), + ) + + if self._stream_cls: + return cast( + R, + self._stream_cls( + cast_to=extract_stream_chunk_type(self._stream_cls), + response=self.http_response, + client=cast(Any, self._client), + options=self._options, + ), + ) + + stream_cls = cast("type[Stream[Any]] | type[AsyncStream[Any]] | None", self._client._default_stream_cls) + if stream_cls is None: + raise MissingStreamClassError() + + return cast( + R, + stream_cls( + cast_to=cast_to, + response=self.http_response, + client=cast(Any, self._client), + options=self._options, + ), + ) + + if cast_to is NoneType: + return cast(R, None) + + response = self.http_response + if cast_to == str: + return cast(R, response.text) + + if cast_to == bytes: + return cast(R, response.content) + + if cast_to == int: + return cast(R, int(response.text)) + + if cast_to == float: + return cast(R, float(response.text)) + + if cast_to == bool: + return cast(R, response.text.lower() == "true") + + if origin == APIResponse: + raise RuntimeError("Unexpected state - cast_to is `APIResponse`") + + if inspect.isclass(origin) and issubclass(origin, httpx.Response): + # Because of the invariance of our ResponseT TypeVar, users can subclass httpx.Response + # and pass that class to our request functions. We cannot change the variance to be either + # covariant or contravariant as that makes our usage of ResponseT illegal. We could construct + # the response class ourselves but that is something that should be supported directly in httpx + # as it would be easy to incorrectly construct the Response object due to the multitude of arguments. + if cast_to != httpx.Response: + raise ValueError(f"Subclasses of httpx.Response cannot be passed to `cast_to`") + return cast(R, response) + + if ( + inspect.isclass( + origin # pyright: ignore[reportUnknownArgumentType] + ) + and not issubclass(origin, BaseModel) + and issubclass(origin, pydantic.BaseModel) + ): + raise TypeError( + "Pydantic models must subclass our base model type, e.g. `from oz_agent_sdk import BaseModel`" + ) + + if ( + cast_to is not object + and not origin is list + and not origin is dict + and not origin is Union + and not issubclass(origin, BaseModel) + ): + raise RuntimeError( + f"Unsupported type, expected {cast_to} to be a subclass of {BaseModel}, {dict}, {list}, {Union}, {NoneType}, {str} or {httpx.Response}." + ) + + # split is required to handle cases where additional information is included + # in the response, e.g. application/json; charset=utf-8 + content_type, *_ = response.headers.get("content-type", "*").split(";") + if not content_type.endswith("json"): + if is_basemodel(cast_to): + try: + data = response.json() + except Exception as exc: + log.debug("Could not read JSON from response data due to %s - %s", type(exc), exc) + else: + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + if self._client._strict_response_validation: + raise APIResponseValidationError( + response=response, + message=f"Expected Content-Type response header to be `application/json` but received `{content_type}` instead.", + body=response.text, + ) + + # If the API responds with content that isn't JSON then we just return + # the (decoded) text without performing any parsing so that you can still + # handle the response however you need to. + return response.text # type: ignore + + data = response.json() + + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + +class APIResponse(BaseAPIResponse[R]): + @overload + def parse(self, *, to: type[_T]) -> _T: ... + + @overload + def parse(self) -> R: ... + + def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from oz_agent_sdk import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `int` + - `float` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return self.http_response.read() + except httpx.StreamConsumed as exc: + # The default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message. + raise StreamAlreadyConsumed() from exc + + def text(self) -> str: + """Read and decode the response content into a string.""" + self.read() + return self.http_response.text + + def json(self) -> object: + """Read and decode the JSON response content.""" + self.read() + return self.http_response.json() + + def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.http_response.close() + + def iter_bytes(self, chunk_size: int | None = None) -> Iterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + for chunk in self.http_response.iter_bytes(chunk_size): + yield chunk + + def iter_text(self, chunk_size: int | None = None) -> Iterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + for chunk in self.http_response.iter_text(chunk_size): + yield chunk + + def iter_lines(self) -> Iterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + for chunk in self.http_response.iter_lines(): + yield chunk + + +class AsyncAPIResponse(BaseAPIResponse[R]): + @overload + async def parse(self, *, to: type[_T]) -> _T: ... + + @overload + async def parse(self) -> R: ... + + async def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from oz_agent_sdk import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + await self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + async def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return await self.http_response.aread() + except httpx.StreamConsumed as exc: + # the default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message + raise StreamAlreadyConsumed() from exc + + async def text(self) -> str: + """Read and decode the response content into a string.""" + await self.read() + return self.http_response.text + + async def json(self) -> object: + """Read and decode the JSON response content.""" + await self.read() + return self.http_response.json() + + async def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.http_response.aclose() + + async def iter_bytes(self, chunk_size: int | None = None) -> AsyncIterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + async for chunk in self.http_response.aiter_bytes(chunk_size): + yield chunk + + async def iter_text(self, chunk_size: int | None = None) -> AsyncIterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + async for chunk in self.http_response.aiter_text(chunk_size): + yield chunk + + async def iter_lines(self) -> AsyncIterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + async for chunk in self.http_response.aiter_lines(): + yield chunk + + +class BinaryAPIResponse(APIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(): + f.write(data) + + +class AsyncBinaryAPIResponse(AsyncAPIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + async def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(): + await f.write(data) + + +class StreamedBinaryAPIResponse(APIResponse[bytes]): + def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(chunk_size): + f.write(data) + + +class AsyncStreamedBinaryAPIResponse(AsyncAPIResponse[bytes]): + async def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(chunk_size): + await f.write(data) + + +class MissingStreamClassError(TypeError): + def __init__(self) -> None: + super().__init__( + "The `stream` argument was set to `True` but the `stream_cls` argument was not given. See `oz_agent_sdk._streaming` for reference", + ) + + +class StreamAlreadyConsumed(OzAPIError): + """ + Attempted to read or stream content, but the content has already + been streamed. + + This can happen if you use a method like `.iter_lines()` and then attempt + to read th entire response body afterwards, e.g. + + ```py + response = await client.post(...) + async for line in response.iter_lines(): + ... # do something with `line` + + content = await response.read() + # ^ error + ``` + + If you want this behaviour you'll need to either manually accumulate the response + content or call `await response.read()` before iterating over the stream. + """ + + def __init__(self) -> None: + message = ( + "Attempted to read or stream some content, but the content has " + "already been streamed. " + "This could be due to attempting to stream the response " + "content more than once." + "\n\n" + "You can fix this by manually accumulating the response content while streaming " + "or by calling `.read()` before starting to stream." + ) + super().__init__(message) + + +class ResponseContextManager(Generic[_APIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, request_func: Callable[[], _APIResponseT]) -> None: + self._request_func = request_func + self.__response: _APIResponseT | None = None + + def __enter__(self) -> _APIResponseT: + self.__response = self._request_func() + return self.__response + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + self.__response.close() + + +class AsyncResponseContextManager(Generic[_AsyncAPIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, api_request: Awaitable[_AsyncAPIResponseT]) -> None: + self._api_request = api_request + self.__response: _AsyncAPIResponseT | None = None + + async def __aenter__(self) -> _AsyncAPIResponseT: + self.__response = await self._api_request + return self.__response + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + await self.__response.close() + + +def to_streamed_response_wrapper(func: Callable[P, R]) -> Callable[P, ResponseContextManager[APIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[APIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], APIResponse[R]], make_request)) + + return wrapped + + +def async_to_streamed_response_wrapper( + func: Callable[P, Awaitable[R]], +) -> Callable[P, AsyncResponseContextManager[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[AsyncAPIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[AsyncAPIResponse[R]], make_request)) + + return wrapped + + +def to_custom_streamed_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, ResponseContextManager[_APIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[_APIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], _APIResponseT], make_request)) + + return wrapped + + +def async_to_custom_streamed_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, AsyncResponseContextManager[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[_AsyncAPIResponseT], make_request)) + + return wrapped + + +def to_raw_response_wrapper(func: Callable[P, R]) -> Callable[P, APIResponse[R]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> APIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(APIResponse[R], func(*args, **kwargs)) + + return wrapped + + +def async_to_raw_response_wrapper(func: Callable[P, Awaitable[R]]) -> Callable[P, Awaitable[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + async def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncAPIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(AsyncAPIResponse[R], await func(*args, **kwargs)) + + return wrapped + + +def to_custom_raw_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, _APIResponseT]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> _APIResponseT: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(_APIResponseT, func(*args, **kwargs)) + + return wrapped + + +def async_to_custom_raw_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, Awaitable[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> Awaitable[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(Awaitable[_AsyncAPIResponseT], func(*args, **kwargs)) + + return wrapped + + +def extract_response_type(typ: type[BaseAPIResponse[Any]]) -> type: + """Given a type like `APIResponse[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(APIResponse[bytes]): + ... + + extract_response_type(MyResponse) -> bytes + ``` + """ + return extract_type_var_from_base( + typ, + generic_bases=cast("tuple[type, ...]", (BaseAPIResponse, APIResponse, AsyncAPIResponse)), + index=0, + ) diff --git a/src/oz_agent_sdk/_streaming.py b/src/oz_agent_sdk/_streaming.py new file mode 100644 index 0000000..dbfe0f8 --- /dev/null +++ b/src/oz_agent_sdk/_streaming.py @@ -0,0 +1,338 @@ +# Note: initially copied from https://github.com/florimondmanca/httpx-sse/blob/master/src/httpx_sse/_decoders.py +from __future__ import annotations + +import json +import inspect +from types import TracebackType +from typing import TYPE_CHECKING, Any, Generic, TypeVar, Iterator, Optional, AsyncIterator, cast +from typing_extensions import Self, Protocol, TypeGuard, override, get_origin, runtime_checkable + +import httpx + +from ._utils import extract_type_var_from_base + +if TYPE_CHECKING: + from ._client import OzAPI, AsyncOzAPI + from ._models import FinalRequestOptions + + +_T = TypeVar("_T") + + +class Stream(Generic[_T]): + """Provides the core interface to iterate over a synchronous stream response.""" + + response: httpx.Response + _options: Optional[FinalRequestOptions] = None + _decoder: SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: OzAPI, + options: Optional[FinalRequestOptions] = None, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._options = options + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + def __next__(self) -> _T: + return self._iterator.__next__() + + def __iter__(self) -> Iterator[_T]: + for item in self._iterator: + yield item + + def _iter_events(self) -> Iterator[ServerSentEvent]: + yield from self._decoder.iter_bytes(self.response.iter_bytes()) + + def __stream__(self) -> Iterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + try: + for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + finally: + # Ensure the response is closed even if the consumer doesn't read all data + response.close() + + def __enter__(self) -> Self: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.response.close() + + +class AsyncStream(Generic[_T]): + """Provides the core interface to iterate over an asynchronous stream response.""" + + response: httpx.Response + _options: Optional[FinalRequestOptions] = None + _decoder: SSEDecoder | SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: AsyncOzAPI, + options: Optional[FinalRequestOptions] = None, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._options = options + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + async def __anext__(self) -> _T: + return await self._iterator.__anext__() + + async def __aiter__(self) -> AsyncIterator[_T]: + async for item in self._iterator: + yield item + + async def _iter_events(self) -> AsyncIterator[ServerSentEvent]: + async for sse in self._decoder.aiter_bytes(self.response.aiter_bytes()): + yield sse + + async def __stream__(self) -> AsyncIterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + try: + async for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + finally: + # Ensure the response is closed even if the consumer doesn't read all data + await response.aclose() + + async def __aenter__(self) -> Self: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.response.aclose() + + +class ServerSentEvent: + def __init__( + self, + *, + event: str | None = None, + data: str | None = None, + id: str | None = None, + retry: int | None = None, + ) -> None: + if data is None: + data = "" + + self._id = id + self._data = data + self._event = event or None + self._retry = retry + + @property + def event(self) -> str | None: + return self._event + + @property + def id(self) -> str | None: + return self._id + + @property + def retry(self) -> int | None: + return self._retry + + @property + def data(self) -> str: + return self._data + + def json(self) -> Any: + return json.loads(self.data) + + @override + def __repr__(self) -> str: + return f"ServerSentEvent(event={self.event}, data={self.data}, id={self.id}, retry={self.retry})" + + +class SSEDecoder: + _data: list[str] + _event: str | None + _retry: int | None + _last_event_id: str | None + + def __init__(self) -> None: + self._event = None + self._data = [] + self._last_event_id = None + self._retry = None + + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + for chunk in self._iter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + def _iter_chunks(self, iterator: Iterator[bytes]) -> Iterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + async def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + async for chunk in self._aiter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + async def _aiter_chunks(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + async for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + def decode(self, line: str) -> ServerSentEvent | None: + # See: https://html.spec.whatwg.org/multipage/server-sent-events.html#event-stream-interpretation # noqa: E501 + + if not line: + if not self._event and not self._data and not self._last_event_id and self._retry is None: + return None + + sse = ServerSentEvent( + event=self._event, + data="\n".join(self._data), + id=self._last_event_id, + retry=self._retry, + ) + + # NOTE: as per the SSE spec, do not reset last_event_id. + self._event = None + self._data = [] + self._retry = None + + return sse + + if line.startswith(":"): + return None + + fieldname, _, value = line.partition(":") + + if value.startswith(" "): + value = value[1:] + + if fieldname == "event": + self._event = value + elif fieldname == "data": + self._data.append(value) + elif fieldname == "id": + if "\0" in value: + pass + else: + self._last_event_id = value + elif fieldname == "retry": + try: + self._retry = int(value) + except (TypeError, ValueError): + pass + else: + pass # Field is ignored. + + return None + + +@runtime_checkable +class SSEBytesDecoder(Protocol): + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an async iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + +def is_stream_class_type(typ: type) -> TypeGuard[type[Stream[object]] | type[AsyncStream[object]]]: + """TypeGuard for determining whether or not the given type is a subclass of `Stream` / `AsyncStream`""" + origin = get_origin(typ) or typ + return inspect.isclass(origin) and issubclass(origin, (Stream, AsyncStream)) + + +def extract_stream_chunk_type( + stream_cls: type, + *, + failure_message: str | None = None, +) -> type: + """Given a type like `Stream[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyStream(Stream[bytes]): + ... + + extract_stream_chunk_type(MyStream) -> bytes + ``` + """ + from ._base_client import Stream, AsyncStream + + return extract_type_var_from_base( + stream_cls, + index=0, + generic_bases=cast("tuple[type, ...]", (Stream, AsyncStream)), + failure_message=failure_message, + ) diff --git a/src/oz_agent_sdk/_types.py b/src/oz_agent_sdk/_types.py new file mode 100644 index 0000000..cbb7d7e --- /dev/null +++ b/src/oz_agent_sdk/_types.py @@ -0,0 +1,271 @@ +from __future__ import annotations + +from os import PathLike +from typing import ( + IO, + TYPE_CHECKING, + Any, + Dict, + List, + Type, + Tuple, + Union, + Mapping, + TypeVar, + Callable, + Iterable, + Iterator, + Optional, + Sequence, + AsyncIterable, +) +from typing_extensions import ( + Set, + Literal, + Protocol, + TypeAlias, + TypedDict, + SupportsIndex, + overload, + override, + runtime_checkable, +) + +import httpx +import pydantic +from httpx import URL, Proxy, Timeout, Response, BaseTransport, AsyncBaseTransport + +if TYPE_CHECKING: + from ._models import BaseModel, SecurityOptions + from ._response import APIResponse, AsyncAPIResponse + +Transport = BaseTransport +AsyncTransport = AsyncBaseTransport +Query = Mapping[str, object] +Body = object +AnyMapping = Mapping[str, object] +ModelT = TypeVar("ModelT", bound=pydantic.BaseModel) +_T = TypeVar("_T") + + +# Approximates httpx internal ProxiesTypes and RequestFiles types +# while adding support for `PathLike` instances +ProxiesDict = Dict["str | URL", Union[None, str, URL, Proxy]] +ProxiesTypes = Union[str, Proxy, ProxiesDict] +if TYPE_CHECKING: + Base64FileInput = Union[IO[bytes], PathLike[str]] + FileContent = Union[IO[bytes], bytes, PathLike[str]] +else: + Base64FileInput = Union[IO[bytes], PathLike] + FileContent = Union[IO[bytes], bytes, PathLike] # PathLike is not subscriptable in Python 3.8. + + +# Used for sending raw binary data / streaming data in request bodies +# e.g. for file uploads without multipart encoding +BinaryTypes = Union[bytes, bytearray, IO[bytes], Iterable[bytes]] +AsyncBinaryTypes = Union[bytes, bytearray, IO[bytes], AsyncIterable[bytes]] + +FileTypes = Union[ + # file (or bytes) + FileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], FileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], FileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], FileContent, Optional[str], Mapping[str, str]], +] +RequestFiles = Union[Mapping[str, FileTypes], Sequence[Tuple[str, FileTypes]]] + +# duplicate of the above but without our custom file support +HttpxFileContent = Union[IO[bytes], bytes] +HttpxFileTypes = Union[ + # file (or bytes) + HttpxFileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], HttpxFileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], HttpxFileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], HttpxFileContent, Optional[str], Mapping[str, str]], +] +HttpxRequestFiles = Union[Mapping[str, HttpxFileTypes], Sequence[Tuple[str, HttpxFileTypes]]] + +# Workaround to support (cast_to: Type[ResponseT]) -> ResponseT +# where ResponseT includes `None`. In order to support directly +# passing `None`, overloads would have to be defined for every +# method that uses `ResponseT` which would lead to an unacceptable +# amount of code duplication and make it unreadable. See _base_client.py +# for example usage. +# +# This unfortunately means that you will either have +# to import this type and pass it explicitly: +# +# from oz_agent_sdk import NoneType +# client.get('/foo', cast_to=NoneType) +# +# or build it yourself: +# +# client.get('/foo', cast_to=type(None)) +if TYPE_CHECKING: + NoneType: Type[None] +else: + NoneType = type(None) + + +class RequestOptions(TypedDict, total=False): + headers: Headers + max_retries: int + timeout: float | Timeout | None + params: Query + extra_json: AnyMapping + idempotency_key: str + follow_redirects: bool + security: SecurityOptions + + +# Sentinel class used until PEP 0661 is accepted +class NotGiven: + """ + For parameters with a meaningful None value, we need to distinguish between + the user explicitly passing None, and the user not passing the parameter at + all. + + User code shouldn't need to use not_given directly. + + For example: + + ```py + def create(timeout: Timeout | None | NotGiven = not_given): ... + + + create(timeout=1) # 1s timeout + create(timeout=None) # No timeout + create() # Default timeout behavior + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + @override + def __repr__(self) -> str: + return "NOT_GIVEN" + + +not_given = NotGiven() +# for backwards compatibility: +NOT_GIVEN = NotGiven() + + +class Omit: + """ + To explicitly omit something from being sent in a request, use `omit`. + + ```py + # as the default `Content-Type` header is `application/json` that will be sent + client.post("/upload/files", files={"file": b"my raw file content"}) + + # you can't explicitly override the header as it has to be dynamically generated + # to look something like: 'multipart/form-data; boundary=0d8382fcf5f8c3be01ca2e11002d2983' + client.post(..., headers={"Content-Type": "multipart/form-data"}) + + # instead you can remove the default `application/json` header by passing omit + client.post(..., headers={"Content-Type": omit}) + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + +omit = Omit() + + +@runtime_checkable +class ModelBuilderProtocol(Protocol): + @classmethod + def build( + cls: type[_T], + *, + response: Response, + data: object, + ) -> _T: ... + + +Headers = Mapping[str, Union[str, Omit]] + + +class HeadersLikeProtocol(Protocol): + def get(self, __key: str) -> str | None: ... + + +HeadersLike = Union[Headers, HeadersLikeProtocol] + +ResponseT = TypeVar( + "ResponseT", + bound=Union[ + object, + str, + None, + "BaseModel", + List[Any], + Dict[str, Any], + Response, + ModelBuilderProtocol, + "APIResponse[Any]", + "AsyncAPIResponse[Any]", + ], +) + +StrBytesIntFloat = Union[str, bytes, int, float] + +# Note: copied from Pydantic +# https://github.com/pydantic/pydantic/blob/6f31f8f68ef011f84357330186f603ff295312fd/pydantic/main.py#L79 +IncEx: TypeAlias = Union[Set[int], Set[str], Mapping[int, Union["IncEx", bool]], Mapping[str, Union["IncEx", bool]]] + +PostParser = Callable[[Any], Any] + + +@runtime_checkable +class InheritsGeneric(Protocol): + """Represents a type that has inherited from `Generic` + + The `__orig_bases__` property can be used to determine the resolved + type variable for a given base class. + """ + + __orig_bases__: tuple[_GenericAlias] + + +class _GenericAlias(Protocol): + __origin__: type[object] + + +class HttpxSendArgs(TypedDict, total=False): + auth: httpx.Auth + follow_redirects: bool + + +_T_co = TypeVar("_T_co", covariant=True) + + +if TYPE_CHECKING: + # This works because str.__contains__ does not accept object (either in typeshed or at runtime) + # https://github.com/hauntsaninja/useful_types/blob/5e9710f3875107d068e7679fd7fec9cfab0eff3b/useful_types/__init__.py#L285 + # + # Note: index() and count() methods are intentionally omitted to allow pyright to properly + # infer TypedDict types when dict literals are used in lists assigned to SequenceNotStr. + class SequenceNotStr(Protocol[_T_co]): + @overload + def __getitem__(self, index: SupportsIndex, /) -> _T_co: ... + @overload + def __getitem__(self, index: slice, /) -> Sequence[_T_co]: ... + def __contains__(self, value: object, /) -> bool: ... + def __len__(self) -> int: ... + def __iter__(self) -> Iterator[_T_co]: ... + def __reversed__(self) -> Iterator[_T_co]: ... +else: + # just point this to a normal `Sequence` at runtime to avoid having to special case + # deserializing our custom sequence type + SequenceNotStr = Sequence diff --git a/src/oz_agent_sdk/_utils/__init__.py b/src/oz_agent_sdk/_utils/__init__.py new file mode 100644 index 0000000..10cb66d --- /dev/null +++ b/src/oz_agent_sdk/_utils/__init__.py @@ -0,0 +1,65 @@ +from ._path import path_template as path_template +from ._sync import asyncify as asyncify +from ._proxy import LazyProxy as LazyProxy +from ._utils import ( + flatten as flatten, + is_dict as is_dict, + is_list as is_list, + is_given as is_given, + is_tuple as is_tuple, + json_safe as json_safe, + lru_cache as lru_cache, + is_mapping as is_mapping, + is_tuple_t as is_tuple_t, + is_iterable as is_iterable, + is_sequence as is_sequence, + coerce_float as coerce_float, + is_mapping_t as is_mapping_t, + removeprefix as removeprefix, + removesuffix as removesuffix, + extract_files as extract_files, + is_sequence_t as is_sequence_t, + required_args as required_args, + coerce_boolean as coerce_boolean, + coerce_integer as coerce_integer, + file_from_path as file_from_path, + strip_not_given as strip_not_given, + deepcopy_minimal as deepcopy_minimal, + get_async_library as get_async_library, + maybe_coerce_float as maybe_coerce_float, + get_required_header as get_required_header, + maybe_coerce_boolean as maybe_coerce_boolean, + maybe_coerce_integer as maybe_coerce_integer, +) +from ._compat import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, +) +from ._typing import ( + is_list_type as is_list_type, + is_union_type as is_union_type, + extract_type_arg as extract_type_arg, + is_iterable_type as is_iterable_type, + is_required_type as is_required_type, + is_sequence_type as is_sequence_type, + is_annotated_type as is_annotated_type, + is_type_alias_type as is_type_alias_type, + strip_annotated_type as strip_annotated_type, + extract_type_var_from_base as extract_type_var_from_base, +) +from ._streams import consume_sync_iterator as consume_sync_iterator, consume_async_iterator as consume_async_iterator +from ._transform import ( + PropertyInfo as PropertyInfo, + transform as transform, + async_transform as async_transform, + maybe_transform as maybe_transform, + async_maybe_transform as async_maybe_transform, +) +from ._reflection import ( + function_has_argument as function_has_argument, + assert_signatures_in_sync as assert_signatures_in_sync, +) +from ._datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime diff --git a/src/oz_agent_sdk/_utils/_compat.py b/src/oz_agent_sdk/_utils/_compat.py new file mode 100644 index 0000000..2c70b29 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_compat.py @@ -0,0 +1,45 @@ +from __future__ import annotations + +import sys +import typing_extensions +from typing import Any, Type, Union, Literal, Optional +from datetime import date, datetime +from typing_extensions import get_args as _get_args, get_origin as _get_origin + +from .._types import StrBytesIntFloat +from ._datetime_parse import parse_date as _parse_date, parse_datetime as _parse_datetime + +_LITERAL_TYPES = {Literal, typing_extensions.Literal} + + +def get_args(tp: type[Any]) -> tuple[Any, ...]: + return _get_args(tp) + + +def get_origin(tp: type[Any]) -> type[Any] | None: + return _get_origin(tp) + + +def is_union(tp: Optional[Type[Any]]) -> bool: + if sys.version_info < (3, 10): + return tp is Union # type: ignore[comparison-overlap] + else: + import types + + return tp is Union or tp is types.UnionType # type: ignore[comparison-overlap] + + +def is_typeddict(tp: Type[Any]) -> bool: + return typing_extensions.is_typeddict(tp) + + +def is_literal_type(tp: Type[Any]) -> bool: + return get_origin(tp) in _LITERAL_TYPES + + +def parse_date(value: Union[date, StrBytesIntFloat]) -> date: + return _parse_date(value) + + +def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: + return _parse_datetime(value) diff --git a/src/oz_agent_sdk/_utils/_datetime_parse.py b/src/oz_agent_sdk/_utils/_datetime_parse.py new file mode 100644 index 0000000..7cb9d9e --- /dev/null +++ b/src/oz_agent_sdk/_utils/_datetime_parse.py @@ -0,0 +1,136 @@ +""" +This file contains code from https://github.com/pydantic/pydantic/blob/main/pydantic/v1/datetime_parse.py +without the Pydantic v1 specific errors. +""" + +from __future__ import annotations + +import re +from typing import Dict, Union, Optional +from datetime import date, datetime, timezone, timedelta + +from .._types import StrBytesIntFloat + +date_expr = r"(?P\d{4})-(?P\d{1,2})-(?P\d{1,2})" +time_expr = ( + r"(?P\d{1,2}):(?P\d{1,2})" + r"(?::(?P\d{1,2})(?:\.(?P\d{1,6})\d{0,6})?)?" + r"(?PZ|[+-]\d{2}(?::?\d{2})?)?$" +) + +date_re = re.compile(f"{date_expr}$") +datetime_re = re.compile(f"{date_expr}[T ]{time_expr}") + + +EPOCH = datetime(1970, 1, 1) +# if greater than this, the number is in ms, if less than or equal it's in seconds +# (in seconds this is 11th October 2603, in ms it's 20th August 1970) +MS_WATERSHED = int(2e10) +# slightly more than datetime.max in ns - (datetime.max - EPOCH).total_seconds() * 1e9 +MAX_NUMBER = int(3e20) + + +def _get_numeric(value: StrBytesIntFloat, native_expected_type: str) -> Union[None, int, float]: + if isinstance(value, (int, float)): + return value + try: + return float(value) + except ValueError: + return None + except TypeError: + raise TypeError(f"invalid type; expected {native_expected_type}, string, bytes, int or float") from None + + +def _from_unix_seconds(seconds: Union[int, float]) -> datetime: + if seconds > MAX_NUMBER: + return datetime.max + elif seconds < -MAX_NUMBER: + return datetime.min + + while abs(seconds) > MS_WATERSHED: + seconds /= 1000 + dt = EPOCH + timedelta(seconds=seconds) + return dt.replace(tzinfo=timezone.utc) + + +def _parse_timezone(value: Optional[str]) -> Union[None, int, timezone]: + if value == "Z": + return timezone.utc + elif value is not None: + offset_mins = int(value[-2:]) if len(value) > 3 else 0 + offset = 60 * int(value[1:3]) + offset_mins + if value[0] == "-": + offset = -offset + return timezone(timedelta(minutes=offset)) + else: + return None + + +def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: + """ + Parse a datetime/int/float/string and return a datetime.datetime. + + This function supports time zone offsets. When the input contains one, + the output uses a timezone with a fixed offset from UTC. + + Raise ValueError if the input is well formatted but not a valid datetime. + Raise ValueError if the input isn't well formatted. + """ + if isinstance(value, datetime): + return value + + number = _get_numeric(value, "datetime") + if number is not None: + return _from_unix_seconds(number) + + if isinstance(value, bytes): + value = value.decode() + + assert not isinstance(value, (float, int)) + + match = datetime_re.match(value) + if match is None: + raise ValueError("invalid datetime format") + + kw = match.groupdict() + if kw["microsecond"]: + kw["microsecond"] = kw["microsecond"].ljust(6, "0") + + tzinfo = _parse_timezone(kw.pop("tzinfo")) + kw_: Dict[str, Union[None, int, timezone]] = {k: int(v) for k, v in kw.items() if v is not None} + kw_["tzinfo"] = tzinfo + + return datetime(**kw_) # type: ignore + + +def parse_date(value: Union[date, StrBytesIntFloat]) -> date: + """ + Parse a date/int/float/string and return a datetime.date. + + Raise ValueError if the input is well formatted but not a valid date. + Raise ValueError if the input isn't well formatted. + """ + if isinstance(value, date): + if isinstance(value, datetime): + return value.date() + else: + return value + + number = _get_numeric(value, "date") + if number is not None: + return _from_unix_seconds(number).date() + + if isinstance(value, bytes): + value = value.decode() + + assert not isinstance(value, (float, int)) + match = date_re.match(value) + if match is None: + raise ValueError("invalid date format") + + kw = {k: int(v) for k, v in match.groupdict().items()} + + try: + return date(**kw) + except ValueError: + raise ValueError("invalid date format") from None diff --git a/src/oz_agent_sdk/_utils/_json.py b/src/oz_agent_sdk/_utils/_json.py new file mode 100644 index 0000000..6058421 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_json.py @@ -0,0 +1,35 @@ +import json +from typing import Any +from datetime import datetime +from typing_extensions import override + +import pydantic + +from .._compat import model_dump + + +def openapi_dumps(obj: Any) -> bytes: + """ + Serialize an object to UTF-8 encoded JSON bytes. + + Extends the standard json.dumps with support for additional types + commonly used in the SDK, such as `datetime`, `pydantic.BaseModel`, etc. + """ + return json.dumps( + obj, + cls=_CustomEncoder, + # Uses the same defaults as httpx's JSON serialization + ensure_ascii=False, + separators=(",", ":"), + allow_nan=False, + ).encode() + + +class _CustomEncoder(json.JSONEncoder): + @override + def default(self, o: Any) -> Any: + if isinstance(o, datetime): + return o.isoformat() + if isinstance(o, pydantic.BaseModel): + return model_dump(o, exclude_unset=True, mode="json", by_alias=True) + return super().default(o) diff --git a/src/oz_agent_sdk/_utils/_logs.py b/src/oz_agent_sdk/_utils/_logs.py new file mode 100644 index 0000000..5bba9a5 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_logs.py @@ -0,0 +1,25 @@ +import os +import logging + +logger: logging.Logger = logging.getLogger("oz_agent_sdk") +httpx_logger: logging.Logger = logging.getLogger("httpx") + + +def _basic_config() -> None: + # e.g. [2023-10-05 14:12:26 - oz_agent_sdk._base_client:818 - DEBUG] HTTP Request: POST http://127.0.0.1:4010/foo/bar "200 OK" + logging.basicConfig( + format="[%(asctime)s - %(name)s:%(lineno)d - %(levelname)s] %(message)s", + datefmt="%Y-%m-%d %H:%M:%S", + ) + + +def setup_logging() -> None: + env = os.environ.get("OZ_API_LOG") + if env == "debug": + _basic_config() + logger.setLevel(logging.DEBUG) + httpx_logger.setLevel(logging.DEBUG) + elif env == "info": + _basic_config() + logger.setLevel(logging.INFO) + httpx_logger.setLevel(logging.INFO) diff --git a/src/oz_agent_sdk/_utils/_path.py b/src/oz_agent_sdk/_utils/_path.py new file mode 100644 index 0000000..4d6e1e4 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_path.py @@ -0,0 +1,127 @@ +from __future__ import annotations + +import re +from typing import ( + Any, + Mapping, + Callable, +) +from urllib.parse import quote + +# Matches '.' or '..' where each dot is either literal or percent-encoded (%2e / %2E). +_DOT_SEGMENT_RE = re.compile(r"^(?:\.|%2[eE]){1,2}$") + +_PLACEHOLDER_RE = re.compile(r"\{(\w+)\}") + + +def _quote_path_segment_part(value: str) -> str: + """Percent-encode `value` for use in a URI path segment. + + Considers characters not in `pchar` set from RFC 3986 §3.3 to be unsafe. + https://datatracker.ietf.org/doc/html/rfc3986#section-3.3 + """ + # quote() already treats unreserved characters (letters, digits, and -._~) + # as safe, so we only need to add sub-delims, ':', and '@'. + # Notably, unlike the default `safe` for quote(), / is unsafe and must be quoted. + return quote(value, safe="!$&'()*+,;=:@") + + +def _quote_query_part(value: str) -> str: + """Percent-encode `value` for use in a URI query string. + + Considers &, = and characters not in `query` set from RFC 3986 §3.4 to be unsafe. + https://datatracker.ietf.org/doc/html/rfc3986#section-3.4 + """ + return quote(value, safe="!$'()*+,;:@/?") + + +def _quote_fragment_part(value: str) -> str: + """Percent-encode `value` for use in a URI fragment. + + Considers characters not in `fragment` set from RFC 3986 §3.5 to be unsafe. + https://datatracker.ietf.org/doc/html/rfc3986#section-3.5 + """ + return quote(value, safe="!$&'()*+,;=:@/?") + + +def _interpolate( + template: str, + values: Mapping[str, Any], + quoter: Callable[[str], str], +) -> str: + """Replace {name} placeholders in `template`, quoting each value with `quoter`. + + Placeholder names are looked up in `values`. + + Raises: + KeyError: If a placeholder is not found in `values`. + """ + # re.split with a capturing group returns alternating + # [text, name, text, name, ..., text] elements. + parts = _PLACEHOLDER_RE.split(template) + + for i in range(1, len(parts), 2): + name = parts[i] + if name not in values: + raise KeyError(f"a value for placeholder {{{name}}} was not provided") + val = values[name] + if val is None: + parts[i] = "null" + elif isinstance(val, bool): + parts[i] = "true" if val else "false" + else: + parts[i] = quoter(str(values[name])) + + return "".join(parts) + + +def path_template(template: str, /, **kwargs: Any) -> str: + """Interpolate {name} placeholders in `template` from keyword arguments. + + Args: + template: The template string containing {name} placeholders. + **kwargs: Keyword arguments to interpolate into the template. + + Returns: + The template with placeholders interpolated and percent-encoded. + + Safe characters for percent-encoding are dependent on the URI component. + Placeholders in path and fragment portions are percent-encoded where the `segment` + and `fragment` sets from RFC 3986 respectively are considered safe. + Placeholders in the query portion are percent-encoded where the `query` set from + RFC 3986 §3.3 is considered safe except for = and & characters. + + Raises: + KeyError: If a placeholder is not found in `kwargs`. + ValueError: If resulting path contains /./ or /../ segments (including percent-encoded dot-segments). + """ + # Split the template into path, query, and fragment portions. + fragment_template: str | None = None + query_template: str | None = None + + rest = template + if "#" in rest: + rest, fragment_template = rest.split("#", 1) + if "?" in rest: + rest, query_template = rest.split("?", 1) + path_template = rest + + # Interpolate each portion with the appropriate quoting rules. + path_result = _interpolate(path_template, kwargs, _quote_path_segment_part) + + # Reject dot-segments (. and ..) in the final assembled path. The check + # runs after interpolation so that adjacent placeholders or a mix of static + # text and placeholders that together form a dot-segment are caught. + # Also reject percent-encoded dot-segments to protect against incorrectly + # implemented normalization in servers/proxies. + for segment in path_result.split("/"): + if _DOT_SEGMENT_RE.match(segment): + raise ValueError(f"Constructed path {path_result!r} contains dot-segment {segment!r} which is not allowed") + + result = path_result + if query_template is not None: + result += "?" + _interpolate(query_template, kwargs, _quote_query_part) + if fragment_template is not None: + result += "#" + _interpolate(fragment_template, kwargs, _quote_fragment_part) + + return result diff --git a/src/oz_agent_sdk/_utils/_proxy.py b/src/oz_agent_sdk/_utils/_proxy.py new file mode 100644 index 0000000..0f239a3 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_proxy.py @@ -0,0 +1,65 @@ +from __future__ import annotations + +from abc import ABC, abstractmethod +from typing import Generic, TypeVar, Iterable, cast +from typing_extensions import override + +T = TypeVar("T") + + +class LazyProxy(Generic[T], ABC): + """Implements data methods to pretend that an instance is another instance. + + This includes forwarding attribute access and other methods. + """ + + # Note: we have to special case proxies that themselves return proxies + # to support using a proxy as a catch-all for any random access, e.g. `proxy.foo.bar.baz` + + def __getattr__(self, attr: str) -> object: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied # pyright: ignore + return getattr(proxied, attr) + + @override + def __repr__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return repr(self.__get_proxied__()) + + @override + def __str__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return str(proxied) + + @override + def __dir__(self) -> Iterable[str]: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return [] + return proxied.__dir__() + + @property # type: ignore + @override + def __class__(self) -> type: # pyright: ignore + try: + proxied = self.__get_proxied__() + except Exception: + return type(self) + if issubclass(type(proxied), LazyProxy): + return type(proxied) + return proxied.__class__ + + def __get_proxied__(self) -> T: + return self.__load__() + + def __as_proxied__(self) -> T: + """Helper method that returns the current proxy, typed as the loaded object""" + return cast(T, self) + + @abstractmethod + def __load__(self) -> T: ... diff --git a/src/oz_agent_sdk/_utils/_reflection.py b/src/oz_agent_sdk/_utils/_reflection.py new file mode 100644 index 0000000..89aa712 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_reflection.py @@ -0,0 +1,42 @@ +from __future__ import annotations + +import inspect +from typing import Any, Callable + + +def function_has_argument(func: Callable[..., Any], arg_name: str) -> bool: + """Returns whether or not the given function has a specific parameter""" + sig = inspect.signature(func) + return arg_name in sig.parameters + + +def assert_signatures_in_sync( + source_func: Callable[..., Any], + check_func: Callable[..., Any], + *, + exclude_params: set[str] = set(), +) -> None: + """Ensure that the signature of the second function matches the first.""" + + check_sig = inspect.signature(check_func) + source_sig = inspect.signature(source_func) + + errors: list[str] = [] + + for name, source_param in source_sig.parameters.items(): + if name in exclude_params: + continue + + custom_param = check_sig.parameters.get(name) + if not custom_param: + errors.append(f"the `{name}` param is missing") + continue + + if custom_param.annotation != source_param.annotation: + errors.append( + f"types for the `{name}` param are do not match; source={repr(source_param.annotation)} checking={repr(custom_param.annotation)}" + ) + continue + + if errors: + raise AssertionError(f"{len(errors)} errors encountered when comparing signatures:\n\n" + "\n\n".join(errors)) diff --git a/src/oz_agent_sdk/_utils/_resources_proxy.py b/src/oz_agent_sdk/_utils/_resources_proxy.py new file mode 100644 index 0000000..961a666 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_resources_proxy.py @@ -0,0 +1,24 @@ +from __future__ import annotations + +from typing import Any +from typing_extensions import override + +from ._proxy import LazyProxy + + +class ResourcesProxy(LazyProxy[Any]): + """A proxy for the `oz_agent_sdk.resources` module. + + This is used so that we can lazily import `oz_agent_sdk.resources` only when + needed *and* so that users can just import `oz_agent_sdk` and reference `oz_agent_sdk.resources` + """ + + @override + def __load__(self) -> Any: + import importlib + + mod = importlib.import_module("oz_agent_sdk.resources") + return mod + + +resources = ResourcesProxy().__as_proxied__() diff --git a/src/oz_agent_sdk/_utils/_streams.py b/src/oz_agent_sdk/_utils/_streams.py new file mode 100644 index 0000000..f4a0208 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_streams.py @@ -0,0 +1,12 @@ +from typing import Any +from typing_extensions import Iterator, AsyncIterator + + +def consume_sync_iterator(iterator: Iterator[Any]) -> None: + for _ in iterator: + ... + + +async def consume_async_iterator(iterator: AsyncIterator[Any]) -> None: + async for _ in iterator: + ... diff --git a/src/oz_agent_sdk/_utils/_sync.py b/src/oz_agent_sdk/_utils/_sync.py new file mode 100644 index 0000000..f6027c1 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_sync.py @@ -0,0 +1,58 @@ +from __future__ import annotations + +import asyncio +import functools +from typing import TypeVar, Callable, Awaitable +from typing_extensions import ParamSpec + +import anyio +import sniffio +import anyio.to_thread + +T_Retval = TypeVar("T_Retval") +T_ParamSpec = ParamSpec("T_ParamSpec") + + +async def to_thread( + func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs +) -> T_Retval: + if sniffio.current_async_library() == "asyncio": + return await asyncio.to_thread(func, *args, **kwargs) + + return await anyio.to_thread.run_sync( + functools.partial(func, *args, **kwargs), + ) + + +# inspired by `asyncer`, https://github.com/tiangolo/asyncer +def asyncify(function: Callable[T_ParamSpec, T_Retval]) -> Callable[T_ParamSpec, Awaitable[T_Retval]]: + """ + Take a blocking function and create an async one that receives the same + positional and keyword arguments. + + Usage: + + ```python + def blocking_func(arg1, arg2, kwarg1=None): + # blocking code + return result + + + result = asyncify(blocking_function)(arg1, arg2, kwarg1=value1) + ``` + + ## Arguments + + `function`: a blocking regular callable (e.g. a function) + + ## Return + + An async function that takes the same positional and keyword arguments as the + original one, that when called runs the same original function in a thread worker + and returns the result. + """ + + async def wrapper(*args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs) -> T_Retval: + return await to_thread(function, *args, **kwargs) + + return wrapper diff --git a/src/oz_agent_sdk/_utils/_transform.py b/src/oz_agent_sdk/_utils/_transform.py new file mode 100644 index 0000000..5207549 --- /dev/null +++ b/src/oz_agent_sdk/_utils/_transform.py @@ -0,0 +1,457 @@ +from __future__ import annotations + +import io +import base64 +import pathlib +from typing import Any, Mapping, TypeVar, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, override, get_type_hints as _get_type_hints + +import anyio +import pydantic + +from ._utils import ( + is_list, + is_given, + lru_cache, + is_mapping, + is_iterable, + is_sequence, +) +from .._files import is_base64_file_input +from ._compat import get_origin, is_typeddict +from ._typing import ( + is_list_type, + is_union_type, + extract_type_arg, + is_iterable_type, + is_required_type, + is_sequence_type, + is_annotated_type, + strip_annotated_type, +) + +_T = TypeVar("_T") + + +# TODO: support for drilling globals() and locals() +# TODO: ensure works correctly with forward references in all cases + + +PropertyFormat = Literal["iso8601", "base64", "custom"] + + +class PropertyInfo: + """Metadata class to be used in Annotated types to provide information about a given type. + + For example: + + class MyParams(TypedDict): + account_holder_name: Annotated[str, PropertyInfo(alias='accountHolderName')] + + This means that {'account_holder_name': 'Robert'} will be transformed to {'accountHolderName': 'Robert'} before being sent to the API. + """ + + alias: str | None + format: PropertyFormat | None + format_template: str | None + discriminator: str | None + + def __init__( + self, + *, + alias: str | None = None, + format: PropertyFormat | None = None, + format_template: str | None = None, + discriminator: str | None = None, + ) -> None: + self.alias = alias + self.format = format + self.format_template = format_template + self.discriminator = discriminator + + @override + def __repr__(self) -> str: + return f"{self.__class__.__name__}(alias='{self.alias}', format={self.format}, format_template='{self.format_template}', discriminator='{self.discriminator}')" + + +def maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `transform()` that allows `None` to be passed. + + See `transform()` for more details. + """ + if data is None: + return None + return transform(data, expected_type) + + +# Wrapper over _transform_recursive providing fake types +def transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = _transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +@lru_cache(maxsize=8096) +def _get_annotated_type(type_: type) -> type | None: + """If the given type is an `Annotated` type then it is returned, if not `None` is returned. + + This also unwraps the type when applicable, e.g. `Required[Annotated[T, ...]]` + """ + if is_required_type(type_): + # Unwrap `Required[Annotated[T, ...]]` to `Annotated[T, ...]` + type_ = get_args(type_)[0] + + if is_annotated_type(type_): + return type_ + + return None + + +def _maybe_transform_key(key: str, type_: type) -> str: + """Transform the given `data` based on the annotations provided in `type_`. + + Note: this function only looks at `Annotated` types that contain `PropertyInfo` metadata. + """ + annotated_type = _get_annotated_type(type_) + if annotated_type is None: + # no `Annotated` definition for this type, no transformation needed + return key + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.alias is not None: + return annotation.alias + + return key + + +def _no_transform_needed(annotation: type) -> bool: + return annotation == float or annotation == int + + +def _transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + from .._compat import model_dump + + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return _transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + # Sequence[T] + or (is_sequence_type(stripped_type) and is_sequence(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = _transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return _format_data(data, annotation.format, annotation.format_template) + + return data + + +def _format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = data.read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +def _transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include omitted values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = _transform_recursive(value, annotation=type_) + return result + + +async def async_maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `async_transform()` that allows `None` to be passed. + + See `async_transform()` for more details. + """ + if data is None: + return None + return await async_transform(data, expected_type) + + +async def async_transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = await _async_transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +async def _async_transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + from .._compat import model_dump + + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return await _async_transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + # Sequence[T] + or (is_sequence_type(stripped_type) and is_sequence(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [await _async_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = await _async_transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return await _async_format_data(data, annotation.format, annotation.format_template) + + return data + + +async def _async_format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = await anyio.Path(data).read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +async def _async_transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include omitted values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = await _async_transform_recursive(value, annotation=type_) + return result + + +@lru_cache(maxsize=8096) +def get_type_hints( + obj: Any, + globalns: dict[str, Any] | None = None, + localns: Mapping[str, Any] | None = None, + include_extras: bool = False, +) -> dict[str, Any]: + return _get_type_hints(obj, globalns=globalns, localns=localns, include_extras=include_extras) diff --git a/src/oz_agent_sdk/_utils/_typing.py b/src/oz_agent_sdk/_utils/_typing.py new file mode 100644 index 0000000..193109f --- /dev/null +++ b/src/oz_agent_sdk/_utils/_typing.py @@ -0,0 +1,156 @@ +from __future__ import annotations + +import sys +import typing +import typing_extensions +from typing import Any, TypeVar, Iterable, cast +from collections import abc as _c_abc +from typing_extensions import ( + TypeIs, + Required, + Annotated, + get_args, + get_origin, +) + +from ._utils import lru_cache +from .._types import InheritsGeneric +from ._compat import is_union as _is_union + + +def is_annotated_type(typ: type) -> bool: + return get_origin(typ) == Annotated + + +def is_list_type(typ: type) -> bool: + return (get_origin(typ) or typ) == list + + +def is_sequence_type(typ: type) -> bool: + origin = get_origin(typ) or typ + return origin == typing_extensions.Sequence or origin == typing.Sequence or origin == _c_abc.Sequence + + +def is_iterable_type(typ: type) -> bool: + """If the given type is `typing.Iterable[T]`""" + origin = get_origin(typ) or typ + return origin == Iterable or origin == _c_abc.Iterable + + +def is_union_type(typ: type) -> bool: + return _is_union(get_origin(typ)) + + +def is_required_type(typ: type) -> bool: + return get_origin(typ) == Required + + +def is_typevar(typ: type) -> bool: + # type ignore is required because type checkers + # think this expression will always return False + return type(typ) == TypeVar # type: ignore + + +_TYPE_ALIAS_TYPES: tuple[type[typing_extensions.TypeAliasType], ...] = (typing_extensions.TypeAliasType,) +if sys.version_info >= (3, 12): + _TYPE_ALIAS_TYPES = (*_TYPE_ALIAS_TYPES, typing.TypeAliasType) + + +def is_type_alias_type(tp: Any, /) -> TypeIs[typing_extensions.TypeAliasType]: + """Return whether the provided argument is an instance of `TypeAliasType`. + + ```python + type Int = int + is_type_alias_type(Int) + # > True + Str = TypeAliasType("Str", str) + is_type_alias_type(Str) + # > True + ``` + """ + return isinstance(tp, _TYPE_ALIAS_TYPES) + + +# Extracts T from Annotated[T, ...] or from Required[Annotated[T, ...]] +@lru_cache(maxsize=8096) +def strip_annotated_type(typ: type) -> type: + if is_required_type(typ) or is_annotated_type(typ): + return strip_annotated_type(cast(type, get_args(typ)[0])) + + return typ + + +def extract_type_arg(typ: type, index: int) -> type: + args = get_args(typ) + try: + return cast(type, args[index]) + except IndexError as err: + raise RuntimeError(f"Expected type {typ} to have a type argument at index {index} but it did not") from err + + +def extract_type_var_from_base( + typ: type, + *, + generic_bases: tuple[type, ...], + index: int, + failure_message: str | None = None, +) -> type: + """Given a type like `Foo[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(Foo[bytes]): + ... + + extract_type_var(MyResponse, bases=(Foo,), index=0) -> bytes + ``` + + And where a generic subclass is given: + ```py + _T = TypeVar('_T') + class MyResponse(Foo[_T]): + ... + + extract_type_var(MyResponse[bytes], bases=(Foo,), index=0) -> bytes + ``` + """ + cls = cast(object, get_origin(typ) or typ) + if cls in generic_bases: # pyright: ignore[reportUnnecessaryContains] + # we're given the class directly + return extract_type_arg(typ, index) + + # if a subclass is given + # --- + # this is needed as __orig_bases__ is not present in the typeshed stubs + # because it is intended to be for internal use only, however there does + # not seem to be a way to resolve generic TypeVars for inherited subclasses + # without using it. + if isinstance(cls, InheritsGeneric): + target_base_class: Any | None = None + for base in cls.__orig_bases__: + if base.__origin__ in generic_bases: + target_base_class = base + break + + if target_base_class is None: + raise RuntimeError( + "Could not find the generic base class;\n" + "This should never happen;\n" + f"Does {cls} inherit from one of {generic_bases} ?" + ) + + extracted = extract_type_arg(target_base_class, index) + if is_typevar(extracted): + # If the extracted type argument is itself a type variable + # then that means the subclass itself is generic, so we have + # to resolve the type argument from the class itself, not + # the base class. + # + # Note: if there is more than 1 type argument, the subclass could + # change the ordering of the type arguments, this is not currently + # supported. + return extract_type_arg(typ, index) + + return extracted + + raise RuntimeError(failure_message or f"Could not resolve inner type variable at index {index} for {typ}") diff --git a/src/oz_agent_sdk/_utils/_utils.py b/src/oz_agent_sdk/_utils/_utils.py new file mode 100644 index 0000000..eec7f4a --- /dev/null +++ b/src/oz_agent_sdk/_utils/_utils.py @@ -0,0 +1,421 @@ +from __future__ import annotations + +import os +import re +import inspect +import functools +from typing import ( + Any, + Tuple, + Mapping, + TypeVar, + Callable, + Iterable, + Sequence, + cast, + overload, +) +from pathlib import Path +from datetime import date, datetime +from typing_extensions import TypeGuard + +import sniffio + +from .._types import Omit, NotGiven, FileTypes, HeadersLike + +_T = TypeVar("_T") +_TupleT = TypeVar("_TupleT", bound=Tuple[object, ...]) +_MappingT = TypeVar("_MappingT", bound=Mapping[str, object]) +_SequenceT = TypeVar("_SequenceT", bound=Sequence[object]) +CallableT = TypeVar("CallableT", bound=Callable[..., Any]) + + +def flatten(t: Iterable[Iterable[_T]]) -> list[_T]: + return [item for sublist in t for item in sublist] + + +def extract_files( + # TODO: this needs to take Dict but variance issues..... + # create protocol type ? + query: Mapping[str, object], + *, + paths: Sequence[Sequence[str]], +) -> list[tuple[str, FileTypes]]: + """Recursively extract files from the given dictionary based on specified paths. + + A path may look like this ['foo', 'files', '', 'data']. + + Note: this mutates the given dictionary. + """ + files: list[tuple[str, FileTypes]] = [] + for path in paths: + files.extend(_extract_items(query, path, index=0, flattened_key=None)) + return files + + +def _extract_items( + obj: object, + path: Sequence[str], + *, + index: int, + flattened_key: str | None, +) -> list[tuple[str, FileTypes]]: + try: + key = path[index] + except IndexError: + if not is_given(obj): + # no value was provided - we can safely ignore + return [] + + # cyclical import + from .._files import assert_is_file_content + + # We have exhausted the path, return the entry we found. + assert flattened_key is not None + + if is_list(obj): + files: list[tuple[str, FileTypes]] = [] + for entry in obj: + assert_is_file_content(entry, key=flattened_key + "[]" if flattened_key else "") + files.append((flattened_key + "[]", cast(FileTypes, entry))) + return files + + assert_is_file_content(obj, key=flattened_key) + return [(flattened_key, cast(FileTypes, obj))] + + index += 1 + if is_dict(obj): + try: + # We are at the last entry in the path so we must remove the field + if (len(path)) == index: + item = obj.pop(key) + else: + item = obj[key] + except KeyError: + # Key was not present in the dictionary, this is not indicative of an error + # as the given path may not point to a required field. We also do not want + # to enforce required fields as the API may differ from the spec in some cases. + return [] + if flattened_key is None: + flattened_key = key + else: + flattened_key += f"[{key}]" + return _extract_items( + item, + path, + index=index, + flattened_key=flattened_key, + ) + elif is_list(obj): + if key != "": + return [] + + return flatten( + [ + _extract_items( + item, + path, + index=index, + flattened_key=flattened_key + "[]" if flattened_key is not None else "[]", + ) + for item in obj + ] + ) + + # Something unexpected was passed, just ignore it. + return [] + + +def is_given(obj: _T | NotGiven | Omit) -> TypeGuard[_T]: + return not isinstance(obj, NotGiven) and not isinstance(obj, Omit) + + +# Type safe methods for narrowing types with TypeVars. +# The default narrowing for isinstance(obj, dict) is dict[unknown, unknown], +# however this cause Pyright to rightfully report errors. As we know we don't +# care about the contained types we can safely use `object` in its place. +# +# There are two separate functions defined, `is_*` and `is_*_t` for different use cases. +# `is_*` is for when you're dealing with an unknown input +# `is_*_t` is for when you're narrowing a known union type to a specific subset + + +def is_tuple(obj: object) -> TypeGuard[tuple[object, ...]]: + return isinstance(obj, tuple) + + +def is_tuple_t(obj: _TupleT | object) -> TypeGuard[_TupleT]: + return isinstance(obj, tuple) + + +def is_sequence(obj: object) -> TypeGuard[Sequence[object]]: + return isinstance(obj, Sequence) + + +def is_sequence_t(obj: _SequenceT | object) -> TypeGuard[_SequenceT]: + return isinstance(obj, Sequence) + + +def is_mapping(obj: object) -> TypeGuard[Mapping[str, object]]: + return isinstance(obj, Mapping) + + +def is_mapping_t(obj: _MappingT | object) -> TypeGuard[_MappingT]: + return isinstance(obj, Mapping) + + +def is_dict(obj: object) -> TypeGuard[dict[object, object]]: + return isinstance(obj, dict) + + +def is_list(obj: object) -> TypeGuard[list[object]]: + return isinstance(obj, list) + + +def is_iterable(obj: object) -> TypeGuard[Iterable[object]]: + return isinstance(obj, Iterable) + + +def deepcopy_minimal(item: _T) -> _T: + """Minimal reimplementation of copy.deepcopy() that will only copy certain object types: + + - mappings, e.g. `dict` + - list + + This is done for performance reasons. + """ + if is_mapping(item): + return cast(_T, {k: deepcopy_minimal(v) for k, v in item.items()}) + if is_list(item): + return cast(_T, [deepcopy_minimal(entry) for entry in item]) + return item + + +# copied from https://github.com/Rapptz/RoboDanny +def human_join(seq: Sequence[str], *, delim: str = ", ", final: str = "or") -> str: + size = len(seq) + if size == 0: + return "" + + if size == 1: + return seq[0] + + if size == 2: + return f"{seq[0]} {final} {seq[1]}" + + return delim.join(seq[:-1]) + f" {final} {seq[-1]}" + + +def quote(string: str) -> str: + """Add single quotation marks around the given string. Does *not* do any escaping.""" + return f"'{string}'" + + +def required_args(*variants: Sequence[str]) -> Callable[[CallableT], CallableT]: + """Decorator to enforce a given set of arguments or variants of arguments are passed to the decorated function. + + Useful for enforcing runtime validation of overloaded functions. + + Example usage: + ```py + @overload + def foo(*, a: str) -> str: ... + + + @overload + def foo(*, b: bool) -> str: ... + + + # This enforces the same constraints that a static type checker would + # i.e. that either a or b must be passed to the function + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: bool | None = None) -> str: ... + ``` + """ + + def inner(func: CallableT) -> CallableT: + params = inspect.signature(func).parameters + positional = [ + name + for name, param in params.items() + if param.kind + in { + param.POSITIONAL_ONLY, + param.POSITIONAL_OR_KEYWORD, + } + ] + + @functools.wraps(func) + def wrapper(*args: object, **kwargs: object) -> object: + given_params: set[str] = set() + for i, _ in enumerate(args): + try: + given_params.add(positional[i]) + except IndexError: + raise TypeError( + f"{func.__name__}() takes {len(positional)} argument(s) but {len(args)} were given" + ) from None + + for key in kwargs.keys(): + given_params.add(key) + + for variant in variants: + matches = all((param in given_params for param in variant)) + if matches: + break + else: # no break + if len(variants) > 1: + variations = human_join( + ["(" + human_join([quote(arg) for arg in variant], final="and") + ")" for variant in variants] + ) + msg = f"Missing required arguments; Expected either {variations} arguments to be given" + else: + assert len(variants) > 0 + + # TODO: this error message is not deterministic + missing = list(set(variants[0]) - given_params) + if len(missing) > 1: + msg = f"Missing required arguments: {human_join([quote(arg) for arg in missing])}" + else: + msg = f"Missing required argument: {quote(missing[0])}" + raise TypeError(msg) + return func(*args, **kwargs) + + return wrapper # type: ignore + + return inner + + +_K = TypeVar("_K") +_V = TypeVar("_V") + + +@overload +def strip_not_given(obj: None) -> None: ... + + +@overload +def strip_not_given(obj: Mapping[_K, _V | NotGiven]) -> dict[_K, _V]: ... + + +@overload +def strip_not_given(obj: object) -> object: ... + + +def strip_not_given(obj: object | None) -> object: + """Remove all top-level keys where their values are instances of `NotGiven`""" + if obj is None: + return None + + if not is_mapping(obj): + return obj + + return {key: value for key, value in obj.items() if not isinstance(value, NotGiven)} + + +def coerce_integer(val: str) -> int: + return int(val, base=10) + + +def coerce_float(val: str) -> float: + return float(val) + + +def coerce_boolean(val: str) -> bool: + return val == "true" or val == "1" or val == "on" + + +def maybe_coerce_integer(val: str | None) -> int | None: + if val is None: + return None + return coerce_integer(val) + + +def maybe_coerce_float(val: str | None) -> float | None: + if val is None: + return None + return coerce_float(val) + + +def maybe_coerce_boolean(val: str | None) -> bool | None: + if val is None: + return None + return coerce_boolean(val) + + +def removeprefix(string: str, prefix: str) -> str: + """Remove a prefix from a string. + + Backport of `str.removeprefix` for Python < 3.9 + """ + if string.startswith(prefix): + return string[len(prefix) :] + return string + + +def removesuffix(string: str, suffix: str) -> str: + """Remove a suffix from a string. + + Backport of `str.removesuffix` for Python < 3.9 + """ + if string.endswith(suffix): + return string[: -len(suffix)] + return string + + +def file_from_path(path: str) -> FileTypes: + contents = Path(path).read_bytes() + file_name = os.path.basename(path) + return (file_name, contents) + + +def get_required_header(headers: HeadersLike, header: str) -> str: + lower_header = header.lower() + if is_mapping_t(headers): + # mypy doesn't understand the type narrowing here + for k, v in headers.items(): # type: ignore + if k.lower() == lower_header and isinstance(v, str): + return v + + # to deal with the case where the header looks like Stainless-Event-Id + intercaps_header = re.sub(r"([^\w])(\w)", lambda pat: pat.group(1) + pat.group(2).upper(), header.capitalize()) + + for normalized_header in [header, lower_header, header.upper(), intercaps_header]: + value = headers.get(normalized_header) + if value: + return value + + raise ValueError(f"Could not find {header} header") + + +def get_async_library() -> str: + try: + return sniffio.current_async_library() + except Exception: + return "false" + + +def lru_cache(*, maxsize: int | None = 128) -> Callable[[CallableT], CallableT]: + """A version of functools.lru_cache that retains the type signature + for the wrapped function arguments. + """ + wrapper = functools.lru_cache( # noqa: TID251 + maxsize=maxsize, + ) + return cast(Any, wrapper) # type: ignore[no-any-return] + + +def json_safe(data: object) -> object: + """Translates a mapping / sequence recursively in the same fashion + as `pydantic` v2's `model_dump(mode="json")`. + """ + if is_mapping(data): + return {json_safe(key): json_safe(value) for key, value in data.items()} + + if is_iterable(data) and not isinstance(data, (str, bytes, bytearray)): + return [json_safe(item) for item in data] + + if isinstance(data, (datetime, date)): + return data.isoformat() + + return data diff --git a/src/oz_agent_sdk/_version.py b/src/oz_agent_sdk/_version.py new file mode 100644 index 0000000..0f7ea40 --- /dev/null +++ b/src/oz_agent_sdk/_version.py @@ -0,0 +1,4 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +__title__ = "oz_agent_sdk" +__version__ = "0.10.1" # x-release-please-version diff --git a/src/oz_agent_sdk/lib/.keep b/src/oz_agent_sdk/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/oz_agent_sdk/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/src/oz_agent_sdk/pagination.py b/src/oz_agent_sdk/pagination.py new file mode 100644 index 0000000..3f925ea --- /dev/null +++ b/src/oz_agent_sdk/pagination.py @@ -0,0 +1,85 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Generic, TypeVar, Optional +from typing_extensions import override + +from ._models import BaseModel +from ._base_client import BasePage, PageInfo, BaseSyncPage, BaseAsyncPage + +__all__ = ["RunsCursorPagePageInfo", "SyncRunsCursorPage", "AsyncRunsCursorPage"] + +_T = TypeVar("_T") + + +class RunsCursorPagePageInfo(BaseModel): + has_next_page: Optional[bool] = None + + next_cursor: Optional[str] = None + + +class SyncRunsCursorPage(BaseSyncPage[_T], BasePage[_T], Generic[_T]): + runs: List[_T] + page_info: Optional[RunsCursorPagePageInfo] = None + + @override + def _get_page_items(self) -> List[_T]: + runs = self.runs + if not runs: + return [] + return runs + + @override + def has_next_page(self) -> bool: + has_next_page = None + if self.page_info is not None: + if self.page_info.has_next_page is not None: + has_next_page = self.page_info.has_next_page + if has_next_page is not None and has_next_page is False: + return False + + return super().has_next_page() + + @override + def next_page_info(self) -> Optional[PageInfo]: + next_cursor = None + if self.page_info is not None: + if self.page_info.next_cursor is not None: + next_cursor = self.page_info.next_cursor + if not next_cursor: + return None + + return PageInfo(params={"cursor": next_cursor}) + + +class AsyncRunsCursorPage(BaseAsyncPage[_T], BasePage[_T], Generic[_T]): + runs: List[_T] + page_info: Optional[RunsCursorPagePageInfo] = None + + @override + def _get_page_items(self) -> List[_T]: + runs = self.runs + if not runs: + return [] + return runs + + @override + def has_next_page(self) -> bool: + has_next_page = None + if self.page_info is not None: + if self.page_info.has_next_page is not None: + has_next_page = self.page_info.has_next_page + if has_next_page is not None and has_next_page is False: + return False + + return super().has_next_page() + + @override + def next_page_info(self) -> Optional[PageInfo]: + next_cursor = None + if self.page_info is not None: + if self.page_info.next_cursor is not None: + next_cursor = self.page_info.next_cursor + if not next_cursor: + return None + + return PageInfo(params={"cursor": next_cursor}) diff --git a/src/oz_agent_sdk/py.typed b/src/oz_agent_sdk/py.typed new file mode 100644 index 0000000..e69de29 diff --git a/src/oz_agent_sdk/resources/__init__.py b/src/oz_agent_sdk/resources/__init__.py new file mode 100644 index 0000000..38032a4 --- /dev/null +++ b/src/oz_agent_sdk/resources/__init__.py @@ -0,0 +1,19 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .agent import ( + AgentResource, + AsyncAgentResource, + AgentResourceWithRawResponse, + AsyncAgentResourceWithRawResponse, + AgentResourceWithStreamingResponse, + AsyncAgentResourceWithStreamingResponse, +) + +__all__ = [ + "AgentResource", + "AsyncAgentResource", + "AgentResourceWithRawResponse", + "AsyncAgentResourceWithRawResponse", + "AgentResourceWithStreamingResponse", + "AsyncAgentResourceWithStreamingResponse", +] diff --git a/src/oz_agent_sdk/resources/agent/__init__.py b/src/oz_agent_sdk/resources/agent/__init__.py new file mode 100644 index 0000000..4336e34 --- /dev/null +++ b/src/oz_agent_sdk/resources/agent/__init__.py @@ -0,0 +1,61 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .runs import ( + RunsResource, + AsyncRunsResource, + RunsResourceWithRawResponse, + AsyncRunsResourceWithRawResponse, + RunsResourceWithStreamingResponse, + AsyncRunsResourceWithStreamingResponse, +) +from .agent import ( + AgentResource, + AsyncAgentResource, + AgentResourceWithRawResponse, + AsyncAgentResourceWithRawResponse, + AgentResourceWithStreamingResponse, + AsyncAgentResourceWithStreamingResponse, +) +from .sessions import ( + SessionsResource, + AsyncSessionsResource, + SessionsResourceWithRawResponse, + AsyncSessionsResourceWithRawResponse, + SessionsResourceWithStreamingResponse, + AsyncSessionsResourceWithStreamingResponse, +) +from .schedules import ( + SchedulesResource, + AsyncSchedulesResource, + SchedulesResourceWithRawResponse, + AsyncSchedulesResourceWithRawResponse, + SchedulesResourceWithStreamingResponse, + AsyncSchedulesResourceWithStreamingResponse, +) + +__all__ = [ + "RunsResource", + "AsyncRunsResource", + "RunsResourceWithRawResponse", + "AsyncRunsResourceWithRawResponse", + "RunsResourceWithStreamingResponse", + "AsyncRunsResourceWithStreamingResponse", + "SchedulesResource", + "AsyncSchedulesResource", + "SchedulesResourceWithRawResponse", + "AsyncSchedulesResourceWithRawResponse", + "SchedulesResourceWithStreamingResponse", + "AsyncSchedulesResourceWithStreamingResponse", + "SessionsResource", + "AsyncSessionsResource", + "SessionsResourceWithRawResponse", + "AsyncSessionsResourceWithRawResponse", + "SessionsResourceWithStreamingResponse", + "AsyncSessionsResourceWithStreamingResponse", + "AgentResource", + "AsyncAgentResource", + "AgentResourceWithRawResponse", + "AsyncAgentResourceWithRawResponse", + "AgentResourceWithStreamingResponse", + "AsyncAgentResourceWithStreamingResponse", +] diff --git a/src/oz_agent_sdk/resources/agent/agent.py b/src/oz_agent_sdk/resources/agent/agent.py new file mode 100644 index 0000000..a0240ce --- /dev/null +++ b/src/oz_agent_sdk/resources/agent/agent.py @@ -0,0 +1,619 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Any, Iterable, cast +from typing_extensions import Literal + +import httpx + +from .runs import ( + RunsResource, + AsyncRunsResource, + RunsResourceWithRawResponse, + AsyncRunsResourceWithRawResponse, + RunsResourceWithStreamingResponse, + AsyncRunsResourceWithStreamingResponse, +) +from ...types import agent_run_params, agent_list_params +from ..._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from ..._utils import path_template, maybe_transform, async_maybe_transform +from .sessions import ( + SessionsResource, + AsyncSessionsResource, + SessionsResourceWithRawResponse, + AsyncSessionsResourceWithRawResponse, + SessionsResourceWithStreamingResponse, + AsyncSessionsResourceWithStreamingResponse, +) +from ..._compat import cached_property +from .schedules import ( + SchedulesResource, + AsyncSchedulesResource, + SchedulesResourceWithRawResponse, + AsyncSchedulesResourceWithRawResponse, + SchedulesResourceWithStreamingResponse, + AsyncSchedulesResourceWithStreamingResponse, +) +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ..._base_client import make_request_options +from ...types.agent_run_response import AgentRunResponse +from ...types.agent_list_response import AgentListResponse +from ...types.ambient_agent_config_param import AmbientAgentConfigParam +from ...types.agent_get_artifact_response import AgentGetArtifactResponse + +__all__ = ["AgentResource", "AsyncAgentResource"] + + +class AgentResource(SyncAPIResource): + """Operations for running and managing cloud agents""" + + @cached_property + def runs(self) -> RunsResource: + """Operations for running and managing cloud agents""" + return RunsResource(self._client) + + @cached_property + def schedules(self) -> SchedulesResource: + """Operations for creating and managing scheduled agents""" + return SchedulesResource(self._client) + + @cached_property + def sessions(self) -> SessionsResource: + """Operations for running and managing cloud agents""" + return SessionsResource(self._client) + + @cached_property + def with_raw_response(self) -> AgentResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return AgentResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AgentResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return AgentResourceWithStreamingResponse(self) + + def list( + self, + *, + include_malformed_skills: bool | Omit = omit, + refresh: bool | Omit = omit, + repo: str | Omit = omit, + sort_by: Literal["name", "last_run"] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AgentListResponse: + """ + Retrieve a list of available agents (skills) that can be used to run tasks. + Agents are discovered from environments or a specific repository. + + Args: + include_malformed_skills: When true, includes skills whose SKILL.md file exists but is malformed. These + variants will have a non-empty `error` field describing the parse failure. + Defaults to false. + + refresh: When true, clears the agent list cache before fetching. Use this to force a + refresh of the available agents. + + repo: Optional repository specification to list agents from (format: "owner/repo"). If + not provided, lists agents from all accessible environments. + + sort_by: Sort order for the returned agents. + + - "name": Sort alphabetically by name (default) + - "last_run": Sort by most recently used + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._get( + "/agent", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "include_malformed_skills": include_malformed_skills, + "refresh": refresh, + "repo": repo, + "sort_by": sort_by, + }, + agent_list_params.AgentListParams, + ), + ), + cast_to=AgentListResponse, + ) + + def get_artifact( + self, + artifact_uid: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AgentGetArtifactResponse: + """Retrieve an artifact by its UUID. + + For supported downloadable artifacts, returns + a time-limited signed download URL. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not artifact_uid: + raise ValueError(f"Expected a non-empty value for `artifact_uid` but received {artifact_uid!r}") + return cast( + AgentGetArtifactResponse, + self._get( + path_template("/agent/artifacts/{artifact_uid}", artifact_uid=artifact_uid), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=cast( + Any, AgentGetArtifactResponse + ), # Union types cannot be passed in as arguments in the type system + ), + ) + + def run( + self, + *, + attachments: Iterable[agent_run_params.Attachment] | Omit = omit, + config: AmbientAgentConfigParam | Omit = omit, + conversation_id: str | Omit = omit, + interactive: bool | Omit = omit, + parent_run_id: str | Omit = omit, + prompt: str | Omit = omit, + skill: str | Omit = omit, + team: bool | Omit = omit, + title: str | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AgentRunResponse: + """Alias for POST /agent/run. + + This is the preferred endpoint for creating new agent + runs. Behavior is identical to POST /agent/run. + + Args: + attachments: Optional file attachments to include with the prompt (max 5). Attachments are + uploaded to cloud storage and made available to the agent. + + config: Configuration for a cloud agent run + + conversation_id: Optional conversation ID to continue an existing conversation. If provided, the + agent will continue from where the previous run left off. + + interactive: Whether the run should be interactive. If not set, defaults to false. + + parent_run_id: Optional run ID of the parent that spawned this run. Used for orchestration + hierarchies. + + prompt: The prompt/instruction for the agent to execute. Required unless a skill is + specified via the skill field or config.skill_spec. + + skill: + Skill specification to use as the base prompt for the agent. Supported formats: + + - "repo:skill_name" - Simple name in specific repo + - "repo:skill_path" - Full path in specific repo + - "org/repo:skill_name" - Simple name with org and repo + - "org/repo:skill_path" - Full path with org and repo When provided, this takes + precedence over config.skill_spec. + + team: Whether to create a team-owned run. Defaults to true for users on a single team. + + title: Custom title for the run (auto-generated if not provided) + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._post( + "/agent/runs", + body=maybe_transform( + { + "attachments": attachments, + "config": config, + "conversation_id": conversation_id, + "interactive": interactive, + "parent_run_id": parent_run_id, + "prompt": prompt, + "skill": skill, + "team": team, + "title": title, + }, + agent_run_params.AgentRunParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=AgentRunResponse, + ) + + +class AsyncAgentResource(AsyncAPIResource): + """Operations for running and managing cloud agents""" + + @cached_property + def runs(self) -> AsyncRunsResource: + """Operations for running and managing cloud agents""" + return AsyncRunsResource(self._client) + + @cached_property + def schedules(self) -> AsyncSchedulesResource: + """Operations for creating and managing scheduled agents""" + return AsyncSchedulesResource(self._client) + + @cached_property + def sessions(self) -> AsyncSessionsResource: + """Operations for running and managing cloud agents""" + return AsyncSessionsResource(self._client) + + @cached_property + def with_raw_response(self) -> AsyncAgentResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncAgentResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncAgentResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return AsyncAgentResourceWithStreamingResponse(self) + + async def list( + self, + *, + include_malformed_skills: bool | Omit = omit, + refresh: bool | Omit = omit, + repo: str | Omit = omit, + sort_by: Literal["name", "last_run"] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AgentListResponse: + """ + Retrieve a list of available agents (skills) that can be used to run tasks. + Agents are discovered from environments or a specific repository. + + Args: + include_malformed_skills: When true, includes skills whose SKILL.md file exists but is malformed. These + variants will have a non-empty `error` field describing the parse failure. + Defaults to false. + + refresh: When true, clears the agent list cache before fetching. Use this to force a + refresh of the available agents. + + repo: Optional repository specification to list agents from (format: "owner/repo"). If + not provided, lists agents from all accessible environments. + + sort_by: Sort order for the returned agents. + + - "name": Sort alphabetically by name (default) + - "last_run": Sort by most recently used + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._get( + "/agent", + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "include_malformed_skills": include_malformed_skills, + "refresh": refresh, + "repo": repo, + "sort_by": sort_by, + }, + agent_list_params.AgentListParams, + ), + ), + cast_to=AgentListResponse, + ) + + async def get_artifact( + self, + artifact_uid: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AgentGetArtifactResponse: + """Retrieve an artifact by its UUID. + + For supported downloadable artifacts, returns + a time-limited signed download URL. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not artifact_uid: + raise ValueError(f"Expected a non-empty value for `artifact_uid` but received {artifact_uid!r}") + return cast( + AgentGetArtifactResponse, + await self._get( + path_template("/agent/artifacts/{artifact_uid}", artifact_uid=artifact_uid), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=cast( + Any, AgentGetArtifactResponse + ), # Union types cannot be passed in as arguments in the type system + ), + ) + + async def run( + self, + *, + attachments: Iterable[agent_run_params.Attachment] | Omit = omit, + config: AmbientAgentConfigParam | Omit = omit, + conversation_id: str | Omit = omit, + interactive: bool | Omit = omit, + parent_run_id: str | Omit = omit, + prompt: str | Omit = omit, + skill: str | Omit = omit, + team: bool | Omit = omit, + title: str | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AgentRunResponse: + """Alias for POST /agent/run. + + This is the preferred endpoint for creating new agent + runs. Behavior is identical to POST /agent/run. + + Args: + attachments: Optional file attachments to include with the prompt (max 5). Attachments are + uploaded to cloud storage and made available to the agent. + + config: Configuration for a cloud agent run + + conversation_id: Optional conversation ID to continue an existing conversation. If provided, the + agent will continue from where the previous run left off. + + interactive: Whether the run should be interactive. If not set, defaults to false. + + parent_run_id: Optional run ID of the parent that spawned this run. Used for orchestration + hierarchies. + + prompt: The prompt/instruction for the agent to execute. Required unless a skill is + specified via the skill field or config.skill_spec. + + skill: + Skill specification to use as the base prompt for the agent. Supported formats: + + - "repo:skill_name" - Simple name in specific repo + - "repo:skill_path" - Full path in specific repo + - "org/repo:skill_name" - Simple name with org and repo + - "org/repo:skill_path" - Full path with org and repo When provided, this takes + precedence over config.skill_spec. + + team: Whether to create a team-owned run. Defaults to true for users on a single team. + + title: Custom title for the run (auto-generated if not provided) + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._post( + "/agent/runs", + body=await async_maybe_transform( + { + "attachments": attachments, + "config": config, + "conversation_id": conversation_id, + "interactive": interactive, + "parent_run_id": parent_run_id, + "prompt": prompt, + "skill": skill, + "team": team, + "title": title, + }, + agent_run_params.AgentRunParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=AgentRunResponse, + ) + + +class AgentResourceWithRawResponse: + def __init__(self, agent: AgentResource) -> None: + self._agent = agent + + self.list = to_raw_response_wrapper( + agent.list, + ) + self.get_artifact = to_raw_response_wrapper( + agent.get_artifact, + ) + self.run = to_raw_response_wrapper( + agent.run, + ) + + @cached_property + def runs(self) -> RunsResourceWithRawResponse: + """Operations for running and managing cloud agents""" + return RunsResourceWithRawResponse(self._agent.runs) + + @cached_property + def schedules(self) -> SchedulesResourceWithRawResponse: + """Operations for creating and managing scheduled agents""" + return SchedulesResourceWithRawResponse(self._agent.schedules) + + @cached_property + def sessions(self) -> SessionsResourceWithRawResponse: + """Operations for running and managing cloud agents""" + return SessionsResourceWithRawResponse(self._agent.sessions) + + +class AsyncAgentResourceWithRawResponse: + def __init__(self, agent: AsyncAgentResource) -> None: + self._agent = agent + + self.list = async_to_raw_response_wrapper( + agent.list, + ) + self.get_artifact = async_to_raw_response_wrapper( + agent.get_artifact, + ) + self.run = async_to_raw_response_wrapper( + agent.run, + ) + + @cached_property + def runs(self) -> AsyncRunsResourceWithRawResponse: + """Operations for running and managing cloud agents""" + return AsyncRunsResourceWithRawResponse(self._agent.runs) + + @cached_property + def schedules(self) -> AsyncSchedulesResourceWithRawResponse: + """Operations for creating and managing scheduled agents""" + return AsyncSchedulesResourceWithRawResponse(self._agent.schedules) + + @cached_property + def sessions(self) -> AsyncSessionsResourceWithRawResponse: + """Operations for running and managing cloud agents""" + return AsyncSessionsResourceWithRawResponse(self._agent.sessions) + + +class AgentResourceWithStreamingResponse: + def __init__(self, agent: AgentResource) -> None: + self._agent = agent + + self.list = to_streamed_response_wrapper( + agent.list, + ) + self.get_artifact = to_streamed_response_wrapper( + agent.get_artifact, + ) + self.run = to_streamed_response_wrapper( + agent.run, + ) + + @cached_property + def runs(self) -> RunsResourceWithStreamingResponse: + """Operations for running and managing cloud agents""" + return RunsResourceWithStreamingResponse(self._agent.runs) + + @cached_property + def schedules(self) -> SchedulesResourceWithStreamingResponse: + """Operations for creating and managing scheduled agents""" + return SchedulesResourceWithStreamingResponse(self._agent.schedules) + + @cached_property + def sessions(self) -> SessionsResourceWithStreamingResponse: + """Operations for running and managing cloud agents""" + return SessionsResourceWithStreamingResponse(self._agent.sessions) + + +class AsyncAgentResourceWithStreamingResponse: + def __init__(self, agent: AsyncAgentResource) -> None: + self._agent = agent + + self.list = async_to_streamed_response_wrapper( + agent.list, + ) + self.get_artifact = async_to_streamed_response_wrapper( + agent.get_artifact, + ) + self.run = async_to_streamed_response_wrapper( + agent.run, + ) + + @cached_property + def runs(self) -> AsyncRunsResourceWithStreamingResponse: + """Operations for running and managing cloud agents""" + return AsyncRunsResourceWithStreamingResponse(self._agent.runs) + + @cached_property + def schedules(self) -> AsyncSchedulesResourceWithStreamingResponse: + """Operations for creating and managing scheduled agents""" + return AsyncSchedulesResourceWithStreamingResponse(self._agent.schedules) + + @cached_property + def sessions(self) -> AsyncSessionsResourceWithStreamingResponse: + """Operations for running and managing cloud agents""" + return AsyncSessionsResourceWithStreamingResponse(self._agent.sessions) diff --git a/src/oz_agent_sdk/resources/agent/runs.py b/src/oz_agent_sdk/resources/agent/runs.py new file mode 100644 index 0000000..e6e55b5 --- /dev/null +++ b/src/oz_agent_sdk/resources/agent/runs.py @@ -0,0 +1,528 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Union +from datetime import datetime +from typing_extensions import Literal + +import httpx + +from ..._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from ..._utils import path_template, maybe_transform +from ..._compat import cached_property +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ...pagination import SyncRunsCursorPage, AsyncRunsCursorPage +from ...types.agent import RunSourceType, run_list_params +from ..._base_client import AsyncPaginator, make_request_options +from ...types.agent.run_item import RunItem +from ...types.agent.run_state import RunState +from ...types.agent.run_source_type import RunSourceType + +__all__ = ["RunsResource", "AsyncRunsResource"] + + +class RunsResource(SyncAPIResource): + """Operations for running and managing cloud agents""" + + @cached_property + def with_raw_response(self) -> RunsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return RunsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> RunsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return RunsResourceWithStreamingResponse(self) + + def retrieve( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> RunItem: + """ + Retrieve detailed information about a specific agent run, including the full + prompt, session link, and resolved configuration. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + return self._get( + path_template("/agent/runs/{run_id}", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=RunItem, + ) + + def list( + self, + *, + artifact_type: Literal["PLAN", "PULL_REQUEST", "SCREENSHOT", "FILE"] | Omit = omit, + created_after: Union[str, datetime] | Omit = omit, + created_before: Union[str, datetime] | Omit = omit, + creator: str | Omit = omit, + cursor: str | Omit = omit, + environment_id: str | Omit = omit, + execution_location: Literal["LOCAL", "REMOTE"] | Omit = omit, + limit: int | Omit = omit, + model_id: str | Omit = omit, + name: str | Omit = omit, + q: str | Omit = omit, + schedule_id: str | Omit = omit, + skill: str | Omit = omit, + skill_spec: str | Omit = omit, + sort_by: Literal["updated_at", "created_at", "title", "agent"] | Omit = omit, + sort_order: Literal["asc", "desc"] | Omit = omit, + source: RunSourceType | Omit = omit, + state: List[RunState] | Omit = omit, + updated_after: Union[str, datetime] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> SyncRunsCursorPage[RunItem]: + """Retrieve a paginated list of agent runs with optional filtering. + + Results default + to `sort_by=updated_at` and `sort_order=desc`. + + Args: + artifact_type: Filter runs by artifact type + + created_after: Filter runs created after this timestamp (RFC3339 format) + + created_before: Filter runs created before this timestamp (RFC3339 format) + + creator: Filter by creator UID (user or service account) + + cursor: Pagination cursor from previous response + + environment_id: Filter runs by environment ID + + execution_location: Filter by where the run executed + + limit: Maximum number of runs to return + + model_id: Filter by model ID + + name: Filter by agent config name + + q: Fuzzy search query across run title, prompt, and skill_spec + + schedule_id: Filter runs by the scheduled agent ID that created them + + skill: Filter runs by skill spec (e.g., "owner/repo:path/to/SKILL.md"). Alias for + skill_spec. + + skill_spec: Filter runs by skill spec (e.g., "owner/repo:path/to/SKILL.md") + + sort_by: Sort field for results. + + - `updated_at`: Sort by last update timestamp (default) + - `created_at`: Sort by creation timestamp + - `title`: Sort alphabetically by run title + - `agent`: Sort alphabetically by skill. Runs without a skill are grouped last. + + sort_order: Sort direction + + source: Filter by run source type + + state: Filter by run state. Can be specified multiple times to match any of the given + states. + + updated_after: Filter runs updated after this timestamp (RFC3339 format) + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._get_api_list( + "/agent/runs", + page=SyncRunsCursorPage[RunItem], + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "artifact_type": artifact_type, + "created_after": created_after, + "created_before": created_before, + "creator": creator, + "cursor": cursor, + "environment_id": environment_id, + "execution_location": execution_location, + "limit": limit, + "model_id": model_id, + "name": name, + "q": q, + "schedule_id": schedule_id, + "skill": skill, + "skill_spec": skill_spec, + "sort_by": sort_by, + "sort_order": sort_order, + "source": source, + "state": state, + "updated_after": updated_after, + }, + run_list_params.RunListParams, + ), + ), + model=RunItem, + ) + + def cancel( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> str: + """Cancel an agent run that is currently queued or in progress. + + Once cancelled, the + run will transition to a cancelled state. + + Not all runs can be cancelled. Runs that are in a terminal state (SUCCEEDED, + FAILED, ERROR, BLOCKED, CANCELLED) return 400. Runs in PENDING state return 409 + (retry after a moment). Self-hosted, local, and GitHub Action runs return 422. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + return self._post( + path_template("/agent/runs/{run_id}/cancel", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=str, + ) + + +class AsyncRunsResource(AsyncAPIResource): + """Operations for running and managing cloud agents""" + + @cached_property + def with_raw_response(self) -> AsyncRunsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncRunsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncRunsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return AsyncRunsResourceWithStreamingResponse(self) + + async def retrieve( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> RunItem: + """ + Retrieve detailed information about a specific agent run, including the full + prompt, session link, and resolved configuration. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + return await self._get( + path_template("/agent/runs/{run_id}", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=RunItem, + ) + + def list( + self, + *, + artifact_type: Literal["PLAN", "PULL_REQUEST", "SCREENSHOT", "FILE"] | Omit = omit, + created_after: Union[str, datetime] | Omit = omit, + created_before: Union[str, datetime] | Omit = omit, + creator: str | Omit = omit, + cursor: str | Omit = omit, + environment_id: str | Omit = omit, + execution_location: Literal["LOCAL", "REMOTE"] | Omit = omit, + limit: int | Omit = omit, + model_id: str | Omit = omit, + name: str | Omit = omit, + q: str | Omit = omit, + schedule_id: str | Omit = omit, + skill: str | Omit = omit, + skill_spec: str | Omit = omit, + sort_by: Literal["updated_at", "created_at", "title", "agent"] | Omit = omit, + sort_order: Literal["asc", "desc"] | Omit = omit, + source: RunSourceType | Omit = omit, + state: List[RunState] | Omit = omit, + updated_after: Union[str, datetime] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AsyncPaginator[RunItem, AsyncRunsCursorPage[RunItem]]: + """Retrieve a paginated list of agent runs with optional filtering. + + Results default + to `sort_by=updated_at` and `sort_order=desc`. + + Args: + artifact_type: Filter runs by artifact type + + created_after: Filter runs created after this timestamp (RFC3339 format) + + created_before: Filter runs created before this timestamp (RFC3339 format) + + creator: Filter by creator UID (user or service account) + + cursor: Pagination cursor from previous response + + environment_id: Filter runs by environment ID + + execution_location: Filter by where the run executed + + limit: Maximum number of runs to return + + model_id: Filter by model ID + + name: Filter by agent config name + + q: Fuzzy search query across run title, prompt, and skill_spec + + schedule_id: Filter runs by the scheduled agent ID that created them + + skill: Filter runs by skill spec (e.g., "owner/repo:path/to/SKILL.md"). Alias for + skill_spec. + + skill_spec: Filter runs by skill spec (e.g., "owner/repo:path/to/SKILL.md") + + sort_by: Sort field for results. + + - `updated_at`: Sort by last update timestamp (default) + - `created_at`: Sort by creation timestamp + - `title`: Sort alphabetically by run title + - `agent`: Sort alphabetically by skill. Runs without a skill are grouped last. + + sort_order: Sort direction + + source: Filter by run source type + + state: Filter by run state. Can be specified multiple times to match any of the given + states. + + updated_after: Filter runs updated after this timestamp (RFC3339 format) + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._get_api_list( + "/agent/runs", + page=AsyncRunsCursorPage[RunItem], + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "artifact_type": artifact_type, + "created_after": created_after, + "created_before": created_before, + "creator": creator, + "cursor": cursor, + "environment_id": environment_id, + "execution_location": execution_location, + "limit": limit, + "model_id": model_id, + "name": name, + "q": q, + "schedule_id": schedule_id, + "skill": skill, + "skill_spec": skill_spec, + "sort_by": sort_by, + "sort_order": sort_order, + "source": source, + "state": state, + "updated_after": updated_after, + }, + run_list_params.RunListParams, + ), + ), + model=RunItem, + ) + + async def cancel( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> str: + """Cancel an agent run that is currently queued or in progress. + + Once cancelled, the + run will transition to a cancelled state. + + Not all runs can be cancelled. Runs that are in a terminal state (SUCCEEDED, + FAILED, ERROR, BLOCKED, CANCELLED) return 400. Runs in PENDING state return 409 + (retry after a moment). Self-hosted, local, and GitHub Action runs return 422. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + return await self._post( + path_template("/agent/runs/{run_id}/cancel", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=str, + ) + + +class RunsResourceWithRawResponse: + def __init__(self, runs: RunsResource) -> None: + self._runs = runs + + self.retrieve = to_raw_response_wrapper( + runs.retrieve, + ) + self.list = to_raw_response_wrapper( + runs.list, + ) + self.cancel = to_raw_response_wrapper( + runs.cancel, + ) + + +class AsyncRunsResourceWithRawResponse: + def __init__(self, runs: AsyncRunsResource) -> None: + self._runs = runs + + self.retrieve = async_to_raw_response_wrapper( + runs.retrieve, + ) + self.list = async_to_raw_response_wrapper( + runs.list, + ) + self.cancel = async_to_raw_response_wrapper( + runs.cancel, + ) + + +class RunsResourceWithStreamingResponse: + def __init__(self, runs: RunsResource) -> None: + self._runs = runs + + self.retrieve = to_streamed_response_wrapper( + runs.retrieve, + ) + self.list = to_streamed_response_wrapper( + runs.list, + ) + self.cancel = to_streamed_response_wrapper( + runs.cancel, + ) + + +class AsyncRunsResourceWithStreamingResponse: + def __init__(self, runs: AsyncRunsResource) -> None: + self._runs = runs + + self.retrieve = async_to_streamed_response_wrapper( + runs.retrieve, + ) + self.list = async_to_streamed_response_wrapper( + runs.list, + ) + self.cancel = async_to_streamed_response_wrapper( + runs.cancel, + ) diff --git a/src/oz_agent_sdk/resources/agent/schedules.py b/src/oz_agent_sdk/resources/agent/schedules.py new file mode 100644 index 0000000..f9fbac0 --- /dev/null +++ b/src/oz_agent_sdk/resources/agent/schedules.py @@ -0,0 +1,748 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import httpx + +from ..._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from ..._utils import path_template, maybe_transform, async_maybe_transform +from ..._compat import cached_property +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ...types.agent import schedule_create_params, schedule_update_params +from ..._base_client import make_request_options +from ...types.agent.scheduled_agent_item import ScheduledAgentItem +from ...types.ambient_agent_config_param import AmbientAgentConfigParam +from ...types.agent.schedule_list_response import ScheduleListResponse +from ...types.agent.schedule_delete_response import ScheduleDeleteResponse + +__all__ = ["SchedulesResource", "AsyncSchedulesResource"] + + +class SchedulesResource(SyncAPIResource): + """Operations for creating and managing scheduled agents""" + + @cached_property + def with_raw_response(self) -> SchedulesResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return SchedulesResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> SchedulesResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return SchedulesResourceWithStreamingResponse(self) + + def create( + self, + *, + cron_schedule: str, + name: str, + agent_config: AmbientAgentConfigParam | Omit = omit, + enabled: bool | Omit = omit, + prompt: str | Omit = omit, + team: bool | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Create a new scheduled agent that runs on a cron schedule. + + The agent will be + triggered automatically based on the cron expression. + + Args: + cron_schedule: Cron expression defining when the agent runs (e.g., "0 9 \\** \\** \\**" for daily at + 9am UTC) + + name: Human-readable name for the schedule + + agent_config: Configuration for a cloud agent run + + enabled: Whether the schedule should be active immediately + + prompt: The prompt/instruction for the agent to execute. Required unless + agent_config.skill_spec is provided. + + team: Whether to create a team-owned schedule. Defaults to true for users on a single + team. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return self._post( + "/agent/schedules", + body=maybe_transform( + { + "cron_schedule": cron_schedule, + "name": name, + "agent_config": agent_config, + "enabled": enabled, + "prompt": prompt, + "team": team, + }, + schedule_create_params.ScheduleCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + def retrieve( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """ + Retrieve detailed information about a specific scheduled agent, including its + configuration, history, and next scheduled run time. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return self._get( + path_template("/agent/schedules/{schedule_id}", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + def update( + self, + schedule_id: str, + *, + cron_schedule: str, + enabled: bool, + name: str, + agent_config: AmbientAgentConfigParam | Omit = omit, + prompt: str | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Update an existing scheduled agent's configuration. + + All fields except + agent_config are required. + + Args: + cron_schedule: Cron expression defining when the agent runs + + enabled: Whether the schedule should be active + + name: Human-readable name for the schedule + + agent_config: Configuration for a cloud agent run + + prompt: The prompt/instruction for the agent to execute. Required unless + agent_config.skill_spec is provided. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return self._put( + path_template("/agent/schedules/{schedule_id}", schedule_id=schedule_id), + body=maybe_transform( + { + "cron_schedule": cron_schedule, + "enabled": enabled, + "name": name, + "agent_config": agent_config, + "prompt": prompt, + }, + schedule_update_params.ScheduleUpdateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + def list( + self, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduleListResponse: + """Retrieve all scheduled agents accessible to the authenticated user. + + Results are + sorted alphabetically by name. + """ + return self._get( + "/agent/schedules", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduleListResponse, + ) + + def delete( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduleDeleteResponse: + """Delete a scheduled agent. + + This will stop all future scheduled runs. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return self._delete( + path_template("/agent/schedules/{schedule_id}", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduleDeleteResponse, + ) + + def pause( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Pause a scheduled agent. + + The agent will not run until resumed. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return self._post( + path_template("/agent/schedules/{schedule_id}/pause", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + def resume( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Resume a paused scheduled agent. + + The agent will start running according to its + cron schedule. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return self._post( + path_template("/agent/schedules/{schedule_id}/resume", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + +class AsyncSchedulesResource(AsyncAPIResource): + """Operations for creating and managing scheduled agents""" + + @cached_property + def with_raw_response(self) -> AsyncSchedulesResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncSchedulesResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncSchedulesResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return AsyncSchedulesResourceWithStreamingResponse(self) + + async def create( + self, + *, + cron_schedule: str, + name: str, + agent_config: AmbientAgentConfigParam | Omit = omit, + enabled: bool | Omit = omit, + prompt: str | Omit = omit, + team: bool | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Create a new scheduled agent that runs on a cron schedule. + + The agent will be + triggered automatically based on the cron expression. + + Args: + cron_schedule: Cron expression defining when the agent runs (e.g., "0 9 \\** \\** \\**" for daily at + 9am UTC) + + name: Human-readable name for the schedule + + agent_config: Configuration for a cloud agent run + + enabled: Whether the schedule should be active immediately + + prompt: The prompt/instruction for the agent to execute. Required unless + agent_config.skill_spec is provided. + + team: Whether to create a team-owned schedule. Defaults to true for users on a single + team. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + return await self._post( + "/agent/schedules", + body=await async_maybe_transform( + { + "cron_schedule": cron_schedule, + "name": name, + "agent_config": agent_config, + "enabled": enabled, + "prompt": prompt, + "team": team, + }, + schedule_create_params.ScheduleCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + async def retrieve( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """ + Retrieve detailed information about a specific scheduled agent, including its + configuration, history, and next scheduled run time. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return await self._get( + path_template("/agent/schedules/{schedule_id}", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + async def update( + self, + schedule_id: str, + *, + cron_schedule: str, + enabled: bool, + name: str, + agent_config: AmbientAgentConfigParam | Omit = omit, + prompt: str | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Update an existing scheduled agent's configuration. + + All fields except + agent_config are required. + + Args: + cron_schedule: Cron expression defining when the agent runs + + enabled: Whether the schedule should be active + + name: Human-readable name for the schedule + + agent_config: Configuration for a cloud agent run + + prompt: The prompt/instruction for the agent to execute. Required unless + agent_config.skill_spec is provided. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return await self._put( + path_template("/agent/schedules/{schedule_id}", schedule_id=schedule_id), + body=await async_maybe_transform( + { + "cron_schedule": cron_schedule, + "enabled": enabled, + "name": name, + "agent_config": agent_config, + "prompt": prompt, + }, + schedule_update_params.ScheduleUpdateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + async def list( + self, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduleListResponse: + """Retrieve all scheduled agents accessible to the authenticated user. + + Results are + sorted alphabetically by name. + """ + return await self._get( + "/agent/schedules", + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduleListResponse, + ) + + async def delete( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduleDeleteResponse: + """Delete a scheduled agent. + + This will stop all future scheduled runs. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return await self._delete( + path_template("/agent/schedules/{schedule_id}", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduleDeleteResponse, + ) + + async def pause( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Pause a scheduled agent. + + The agent will not run until resumed. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return await self._post( + path_template("/agent/schedules/{schedule_id}/pause", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + async def resume( + self, + schedule_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ScheduledAgentItem: + """Resume a paused scheduled agent. + + The agent will start running according to its + cron schedule. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not schedule_id: + raise ValueError(f"Expected a non-empty value for `schedule_id` but received {schedule_id!r}") + return await self._post( + path_template("/agent/schedules/{schedule_id}/resume", schedule_id=schedule_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ScheduledAgentItem, + ) + + +class SchedulesResourceWithRawResponse: + def __init__(self, schedules: SchedulesResource) -> None: + self._schedules = schedules + + self.create = to_raw_response_wrapper( + schedules.create, + ) + self.retrieve = to_raw_response_wrapper( + schedules.retrieve, + ) + self.update = to_raw_response_wrapper( + schedules.update, + ) + self.list = to_raw_response_wrapper( + schedules.list, + ) + self.delete = to_raw_response_wrapper( + schedules.delete, + ) + self.pause = to_raw_response_wrapper( + schedules.pause, + ) + self.resume = to_raw_response_wrapper( + schedules.resume, + ) + + +class AsyncSchedulesResourceWithRawResponse: + def __init__(self, schedules: AsyncSchedulesResource) -> None: + self._schedules = schedules + + self.create = async_to_raw_response_wrapper( + schedules.create, + ) + self.retrieve = async_to_raw_response_wrapper( + schedules.retrieve, + ) + self.update = async_to_raw_response_wrapper( + schedules.update, + ) + self.list = async_to_raw_response_wrapper( + schedules.list, + ) + self.delete = async_to_raw_response_wrapper( + schedules.delete, + ) + self.pause = async_to_raw_response_wrapper( + schedules.pause, + ) + self.resume = async_to_raw_response_wrapper( + schedules.resume, + ) + + +class SchedulesResourceWithStreamingResponse: + def __init__(self, schedules: SchedulesResource) -> None: + self._schedules = schedules + + self.create = to_streamed_response_wrapper( + schedules.create, + ) + self.retrieve = to_streamed_response_wrapper( + schedules.retrieve, + ) + self.update = to_streamed_response_wrapper( + schedules.update, + ) + self.list = to_streamed_response_wrapper( + schedules.list, + ) + self.delete = to_streamed_response_wrapper( + schedules.delete, + ) + self.pause = to_streamed_response_wrapper( + schedules.pause, + ) + self.resume = to_streamed_response_wrapper( + schedules.resume, + ) + + +class AsyncSchedulesResourceWithStreamingResponse: + def __init__(self, schedules: AsyncSchedulesResource) -> None: + self._schedules = schedules + + self.create = async_to_streamed_response_wrapper( + schedules.create, + ) + self.retrieve = async_to_streamed_response_wrapper( + schedules.retrieve, + ) + self.update = async_to_streamed_response_wrapper( + schedules.update, + ) + self.list = async_to_streamed_response_wrapper( + schedules.list, + ) + self.delete = async_to_streamed_response_wrapper( + schedules.delete, + ) + self.pause = async_to_streamed_response_wrapper( + schedules.pause, + ) + self.resume = async_to_streamed_response_wrapper( + schedules.resume, + ) diff --git a/src/oz_agent_sdk/resources/agent/sessions.py b/src/oz_agent_sdk/resources/agent/sessions.py new file mode 100644 index 0000000..0beb811 --- /dev/null +++ b/src/oz_agent_sdk/resources/agent/sessions.py @@ -0,0 +1,172 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import httpx + +from ..._types import Body, Query, Headers, NotGiven, not_given +from ..._utils import path_template +from ..._compat import cached_property +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ..._base_client import make_request_options +from ...types.agent.session_check_redirect_response import SessionCheckRedirectResponse + +__all__ = ["SessionsResource", "AsyncSessionsResource"] + + +class SessionsResource(SyncAPIResource): + """Operations for running and managing cloud agents""" + + @cached_property + def with_raw_response(self) -> SessionsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return SessionsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> SessionsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return SessionsResourceWithStreamingResponse(self) + + def check_redirect( + self, + session_uuid: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> SessionCheckRedirectResponse: + """ + Check whether a shared session should redirect to a conversation transcript. + Returns a conversation_id if the agent sandbox has finished and conversation + data is available, or an empty object if no redirect is needed. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not session_uuid: + raise ValueError(f"Expected a non-empty value for `session_uuid` but received {session_uuid!r}") + return self._get( + path_template("/agent/sessions/{session_uuid}/redirect", session_uuid=session_uuid), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=SessionCheckRedirectResponse, + ) + + +class AsyncSessionsResource(AsyncAPIResource): + """Operations for running and managing cloud agents""" + + @cached_property + def with_raw_response(self) -> AsyncSessionsResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncSessionsResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncSessionsResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/warpdotdev/oz-sdk-python#with_streaming_response + """ + return AsyncSessionsResourceWithStreamingResponse(self) + + async def check_redirect( + self, + session_uuid: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> SessionCheckRedirectResponse: + """ + Check whether a shared session should redirect to a conversation transcript. + Returns a conversation_id if the agent sandbox has finished and conversation + data is available, or an empty object if no redirect is needed. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not session_uuid: + raise ValueError(f"Expected a non-empty value for `session_uuid` but received {session_uuid!r}") + return await self._get( + path_template("/agent/sessions/{session_uuid}/redirect", session_uuid=session_uuid), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=SessionCheckRedirectResponse, + ) + + +class SessionsResourceWithRawResponse: + def __init__(self, sessions: SessionsResource) -> None: + self._sessions = sessions + + self.check_redirect = to_raw_response_wrapper( + sessions.check_redirect, + ) + + +class AsyncSessionsResourceWithRawResponse: + def __init__(self, sessions: AsyncSessionsResource) -> None: + self._sessions = sessions + + self.check_redirect = async_to_raw_response_wrapper( + sessions.check_redirect, + ) + + +class SessionsResourceWithStreamingResponse: + def __init__(self, sessions: SessionsResource) -> None: + self._sessions = sessions + + self.check_redirect = to_streamed_response_wrapper( + sessions.check_redirect, + ) + + +class AsyncSessionsResourceWithStreamingResponse: + def __init__(self, sessions: AsyncSessionsResource) -> None: + self._sessions = sessions + + self.check_redirect = async_to_streamed_response_wrapper( + sessions.check_redirect, + ) diff --git a/src/oz_agent_sdk/types/__init__.py b/src/oz_agent_sdk/types/__init__.py new file mode 100644 index 0000000..4c520a7 --- /dev/null +++ b/src/oz_agent_sdk/types/__init__.py @@ -0,0 +1,20 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .scope import Scope as Scope +from .error_code import ErrorCode as ErrorCode +from .agent_skill import AgentSkill as AgentSkill +from .user_profile import UserProfile as UserProfile +from .agent_run_params import AgentRunParams as AgentRunParams +from .agent_list_params import AgentListParams as AgentListParams +from .mcp_server_config import McpServerConfig as McpServerConfig +from .agent_run_response import AgentRunResponse as AgentRunResponse +from .agent_list_response import AgentListResponse as AgentListResponse +from .aws_provider_config import AwsProviderConfig as AwsProviderConfig +from .gcp_provider_config import GcpProviderConfig as GcpProviderConfig +from .ambient_agent_config import AmbientAgentConfig as AmbientAgentConfig +from .mcp_server_config_param import McpServerConfigParam as McpServerConfigParam +from .cloud_environment_config import CloudEnvironmentConfig as CloudEnvironmentConfig +from .ambient_agent_config_param import AmbientAgentConfigParam as AmbientAgentConfigParam +from .agent_get_artifact_response import AgentGetArtifactResponse as AgentGetArtifactResponse diff --git a/src/oz_agent_sdk/types/agent/__init__.py b/src/oz_agent_sdk/types/agent/__init__.py new file mode 100644 index 0000000..1176974 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/__init__.py @@ -0,0 +1,17 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .run_item import RunItem as RunItem +from .run_state import RunState as RunState +from .artifact_item import ArtifactItem as ArtifactItem +from .run_list_params import RunListParams as RunListParams +from .run_source_type import RunSourceType as RunSourceType +from .run_cancel_response import RunCancelResponse as RunCancelResponse +from .scheduled_agent_item import ScheduledAgentItem as ScheduledAgentItem +from .schedule_create_params import ScheduleCreateParams as ScheduleCreateParams +from .schedule_list_response import ScheduleListResponse as ScheduleListResponse +from .schedule_update_params import ScheduleUpdateParams as ScheduleUpdateParams +from .schedule_delete_response import ScheduleDeleteResponse as ScheduleDeleteResponse +from .scheduled_agent_history_item import ScheduledAgentHistoryItem as ScheduledAgentHistoryItem +from .session_check_redirect_response import SessionCheckRedirectResponse as SessionCheckRedirectResponse diff --git a/src/oz_agent_sdk/types/agent/artifact_item.py b/src/oz_agent_sdk/types/agent/artifact_item.py new file mode 100644 index 0000000..299379b --- /dev/null +++ b/src/oz_agent_sdk/types/agent/artifact_item.py @@ -0,0 +1,116 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union, Optional +from datetime import datetime +from typing_extensions import Literal, Annotated, TypeAlias + +from ..._utils import PropertyInfo +from ..._models import BaseModel + +__all__ = [ + "ArtifactItem", + "PlanArtifact", + "PlanArtifactData", + "PullRequestArtifact", + "PullRequestArtifactData", + "ScreenshotArtifact", + "ScreenshotArtifactData", + "FileArtifact", + "FileArtifactData", +] + + +class PlanArtifactData(BaseModel): + document_uid: str + """Unique identifier for the plan document""" + + notebook_uid: Optional[str] = None + """Unique identifier for the associated notebook""" + + title: Optional[str] = None + """Title of the plan""" + + +class PlanArtifact(BaseModel): + artifact_type: Literal["PLAN"] + """Type of the artifact""" + + created_at: datetime + """Timestamp when the artifact was created (RFC3339)""" + + data: PlanArtifactData + + +class PullRequestArtifactData(BaseModel): + branch: str + """Branch name for the pull request""" + + url: str + """URL of the pull request""" + + +class PullRequestArtifact(BaseModel): + artifact_type: Literal["PULL_REQUEST"] + """Type of the artifact""" + + created_at: datetime + """Timestamp when the artifact was created (RFC3339)""" + + data: PullRequestArtifactData + + +class ScreenshotArtifactData(BaseModel): + artifact_uid: str + """Unique identifier for the screenshot artifact""" + + mime_type: str + """MIME type of the screenshot image""" + + description: Optional[str] = None + """Optional description of the screenshot""" + + +class ScreenshotArtifact(BaseModel): + artifact_type: Literal["SCREENSHOT"] + """Type of the artifact""" + + created_at: datetime + """Timestamp when the artifact was created (RFC3339)""" + + data: ScreenshotArtifactData + + +class FileArtifactData(BaseModel): + artifact_uid: str + """Unique identifier for the file artifact""" + + filename: str + """Last path component of filepath""" + + filepath: str + """Conversation-relative filepath for the uploaded file""" + + mime_type: str + """MIME type of the uploaded file""" + + description: Optional[str] = None + """Optional description of the file""" + + size_bytes: Optional[int] = None + """Size of the uploaded file in bytes""" + + +class FileArtifact(BaseModel): + artifact_type: Literal["FILE"] + """Type of the artifact""" + + created_at: datetime + """Timestamp when the artifact was created (RFC3339)""" + + data: FileArtifactData + + +ArtifactItem: TypeAlias = Annotated[ + Union[PlanArtifact, PullRequestArtifact, ScreenshotArtifact, FileArtifact], + PropertyInfo(discriminator="artifact_type"), +] diff --git a/src/oz_agent_sdk/types/agent/run_cancel_response.py b/src/oz_agent_sdk/types/agent/run_cancel_response.py new file mode 100644 index 0000000..b002815 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/run_cancel_response.py @@ -0,0 +1,7 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing_extensions import TypeAlias + +__all__ = ["RunCancelResponse"] + +RunCancelResponse: TypeAlias = str diff --git a/src/oz_agent_sdk/types/agent/run_item.py b/src/oz_agent_sdk/types/agent/run_item.py new file mode 100644 index 0000000..d246450 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/run_item.py @@ -0,0 +1,217 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional +from datetime import datetime +from typing_extensions import Literal + +from ..scope import Scope +from ..._models import BaseModel +from .run_state import RunState +from ..error_code import ErrorCode +from ..user_profile import UserProfile +from .artifact_item import ArtifactItem +from .run_source_type import RunSourceType +from ..ambient_agent_config import AmbientAgentConfig + +__all__ = ["RunItem", "AgentSkill", "RequestUsage", "Schedule", "StatusMessage"] + + +class AgentSkill(BaseModel): + """ + Information about the agent skill used for the run. + Either full_path or bundled_skill_id will be set, but not both. + """ + + bundled_skill_id: Optional[str] = None + """Unique identifier for bundled skills""" + + description: Optional[str] = None + """Description of the skill""" + + full_path: Optional[str] = None + """Path to the SKILL.md file (for file-based skills)""" + + name: Optional[str] = None + """Human-readable name of the skill""" + + +class RequestUsage(BaseModel): + """Resource usage information for the run""" + + compute_cost: Optional[float] = None + """Cost of compute resources for the run""" + + inference_cost: Optional[float] = None + """Cost of LLM inference for the run""" + + +class Schedule(BaseModel): + """ + Information about the schedule that triggered this run (only present for scheduled runs) + """ + + cron_schedule: str + """Cron expression at the time the run was created""" + + schedule_id: str + """Unique identifier for the schedule""" + + schedule_name: str + """Name of the schedule at the time the run was created""" + + +class StatusMessage(BaseModel): + """Status message for a run. + + For terminal error states, includes structured + error code and retryability info from the platform error catalog. + """ + + message: str + """Human-readable status message""" + + error_code: Optional[ErrorCode] = None + """ + Machine-readable error code identifying the problem type. Used in the `type` URI + of Error responses and in the `error_code` field of RunStatusMessage. + + User errors (run transitions to FAILED): + + - `insufficient_credits` — Team has no remaining add-on credits + - `feature_not_available` — Required feature not enabled for user's plan + - `external_authentication_required` — User hasn't authorized a required + external service + - `not_authorized` — Principal lacks permission for the requested operation + - `invalid_request` — Request is malformed or contains invalid parameters + - `resource_not_found` — Referenced resource does not exist + - `budget_exceeded` — Spending budget limit has been reached + - `integration_disabled` — Integration is disabled and must be enabled + - `integration_not_configured` — Integration setup is incomplete + - `operation_not_supported` — Requested operation not supported for this + resource/state + - `environment_setup_failed` — Client-side environment setup failed + - `content_policy_violation` — Prompt or setup commands violated content policy + - `conflict` — Request conflicts with the current state of the resource + + Warp errors (run transitions to ERROR): + + - `authentication_required` — Request lacks valid authentication credentials + - `resource_unavailable` — Transient infrastructure issue (retryable) + - `internal_error` — Unexpected server-side error (retryable) + """ + + retryable: Optional[bool] = None + """Whether the error is transient and the client may retry by submitting a new run. + + Only present on terminal error states. When false, retrying without addressing + the underlying cause will not succeed. + """ + + +class RunItem(BaseModel): + created_at: datetime + """Timestamp when the run was created (RFC3339)""" + + prompt: str + """The prompt/instruction for the agent""" + + run_id: str + """Unique identifier for the run""" + + state: RunState + """Current state of the run: + + - QUEUED: Run is waiting to be picked up + - PENDING: Run is being prepared + - CLAIMED: Run has been claimed by a worker + - INPROGRESS: Run is actively being executed + - SUCCEEDED: Run completed successfully + - FAILED: Run failed + - BLOCKED: Run is blocked (e.g., awaiting user input or approval) + - ERROR: Run encountered an error + - CANCELLED: Run was cancelled by user + """ + + task_id: str + """Unique identifier for the task (typically matches run_id). + + Deprecated - use run_id instead. + """ + + title: str + """Human-readable title for the run""" + + updated_at: datetime + """Timestamp when the run was last updated (RFC3339)""" + + agent_config: Optional[AmbientAgentConfig] = None + """Configuration for a cloud agent run""" + + agent_skill: Optional[AgentSkill] = None + """ + Information about the agent skill used for the run. Either full_path or + bundled_skill_id will be set, but not both. + """ + + artifacts: Optional[List[ArtifactItem]] = None + """Artifacts created during the run (plans, pull requests, etc.)""" + + conversation_id: Optional[str] = None + """UUID of the conversation associated with the run""" + + creator: Optional[UserProfile] = None + + execution_location: Optional[Literal["LOCAL", "REMOTE"]] = None + """Where the run executed: + + - LOCAL: Executed in the user's local Oz environment + - REMOTE: Executed by a remote/cloud worker + """ + + is_sandbox_running: Optional[bool] = None + """Whether the sandbox environment is currently running""" + + parent_run_id: Optional[str] = None + """UUID of the parent run that spawned this run""" + + request_usage: Optional[RequestUsage] = None + """Resource usage information for the run""" + + schedule: Optional[Schedule] = None + """ + Information about the schedule that triggered this run (only present for + scheduled runs) + """ + + scope: Optional[Scope] = None + """Ownership scope for a resource (team or personal)""" + + session_id: Optional[str] = None + """UUID of the shared session (if available)""" + + session_link: Optional[str] = None + """URL to view the agent session""" + + source: Optional[RunSourceType] = None + """Source that created the run: + + - LINEAR: Created from Linear integration + - API: Created via the Warp API + - SLACK: Created from Slack integration + - LOCAL: Created from local CLI/app + - SCHEDULED_AGENT: Created by a scheduled agent + - WEB_APP: Created from the Warp web app + - GITHUB_ACTION: Created from a GitHub action + - CLOUD_MODE: Created from a Cloud Mode + - CLI: Created from the CLI + """ + + started_at: Optional[datetime] = None + """Timestamp when the agent started working on the run (RFC3339)""" + + status_message: Optional[StatusMessage] = None + """Status message for a run. + + For terminal error states, includes structured error code and retryability info + from the platform error catalog. + """ diff --git a/src/oz_agent_sdk/types/agent/run_list_params.py b/src/oz_agent_sdk/types/agent/run_list_params.py new file mode 100644 index 0000000..0b4e389 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/run_list_params.py @@ -0,0 +1,84 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Union +from datetime import datetime +from typing_extensions import Literal, Annotated, TypedDict + +from ..._utils import PropertyInfo +from .run_state import RunState +from .run_source_type import RunSourceType + +__all__ = ["RunListParams"] + + +class RunListParams(TypedDict, total=False): + artifact_type: Literal["PLAN", "PULL_REQUEST", "SCREENSHOT", "FILE"] + """Filter runs by artifact type""" + + created_after: Annotated[Union[str, datetime], PropertyInfo(format="iso8601")] + """Filter runs created after this timestamp (RFC3339 format)""" + + created_before: Annotated[Union[str, datetime], PropertyInfo(format="iso8601")] + """Filter runs created before this timestamp (RFC3339 format)""" + + creator: str + """Filter by creator UID (user or service account)""" + + cursor: str + """Pagination cursor from previous response""" + + environment_id: str + """Filter runs by environment ID""" + + execution_location: Literal["LOCAL", "REMOTE"] + """Filter by where the run executed""" + + limit: int + """Maximum number of runs to return""" + + model_id: str + """Filter by model ID""" + + name: str + """Filter by agent config name""" + + q: str + """Fuzzy search query across run title, prompt, and skill_spec""" + + schedule_id: str + """Filter runs by the scheduled agent ID that created them""" + + skill: str + """ + Filter runs by skill spec (e.g., "owner/repo:path/to/SKILL.md"). Alias for + skill_spec. + """ + + skill_spec: str + """Filter runs by skill spec (e.g., "owner/repo:path/to/SKILL.md")""" + + sort_by: Literal["updated_at", "created_at", "title", "agent"] + """Sort field for results. + + - `updated_at`: Sort by last update timestamp (default) + - `created_at`: Sort by creation timestamp + - `title`: Sort alphabetically by run title + - `agent`: Sort alphabetically by skill. Runs without a skill are grouped last. + """ + + sort_order: Literal["asc", "desc"] + """Sort direction""" + + source: RunSourceType + """Filter by run source type""" + + state: List[RunState] + """Filter by run state. + + Can be specified multiple times to match any of the given states. + """ + + updated_after: Annotated[Union[str, datetime], PropertyInfo(format="iso8601")] + """Filter runs updated after this timestamp (RFC3339 format)""" diff --git a/src/oz_agent_sdk/types/agent/run_source_type.py b/src/oz_agent_sdk/types/agent/run_source_type.py new file mode 100644 index 0000000..344fa13 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/run_source_type.py @@ -0,0 +1,9 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing_extensions import Literal, TypeAlias + +__all__ = ["RunSourceType"] + +RunSourceType: TypeAlias = Literal[ + "LINEAR", "API", "SLACK", "LOCAL", "SCHEDULED_AGENT", "WEB_APP", "GITHUB_ACTION", "CLOUD_MODE", "CLI" +] diff --git a/src/oz_agent_sdk/types/agent/run_state.py b/src/oz_agent_sdk/types/agent/run_state.py new file mode 100644 index 0000000..c3fbe73 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/run_state.py @@ -0,0 +1,9 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing_extensions import Literal, TypeAlias + +__all__ = ["RunState"] + +RunState: TypeAlias = Literal[ + "QUEUED", "PENDING", "CLAIMED", "INPROGRESS", "SUCCEEDED", "FAILED", "BLOCKED", "ERROR", "CANCELLED" +] diff --git a/src/oz_agent_sdk/types/agent/schedule_create_params.py b/src/oz_agent_sdk/types/agent/schedule_create_params.py new file mode 100644 index 0000000..e94a3b3 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/schedule_create_params.py @@ -0,0 +1,38 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Required, TypedDict + +from ..ambient_agent_config_param import AmbientAgentConfigParam + +__all__ = ["ScheduleCreateParams"] + + +class ScheduleCreateParams(TypedDict, total=False): + cron_schedule: Required[str] + """ + Cron expression defining when the agent runs (e.g., "0 9 \\** \\** \\**" for daily at + 9am UTC) + """ + + name: Required[str] + """Human-readable name for the schedule""" + + agent_config: AmbientAgentConfigParam + """Configuration for a cloud agent run""" + + enabled: bool + """Whether the schedule should be active immediately""" + + prompt: str + """ + The prompt/instruction for the agent to execute. Required unless + agent_config.skill_spec is provided. + """ + + team: bool + """ + Whether to create a team-owned schedule. Defaults to true for users on a single + team. + """ diff --git a/src/oz_agent_sdk/types/agent/schedule_delete_response.py b/src/oz_agent_sdk/types/agent/schedule_delete_response.py new file mode 100644 index 0000000..af8e5fd --- /dev/null +++ b/src/oz_agent_sdk/types/agent/schedule_delete_response.py @@ -0,0 +1,10 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from ..._models import BaseModel + +__all__ = ["ScheduleDeleteResponse"] + + +class ScheduleDeleteResponse(BaseModel): + success: bool + """Whether the deletion was successful""" diff --git a/src/oz_agent_sdk/types/agent/schedule_list_response.py b/src/oz_agent_sdk/types/agent/schedule_list_response.py new file mode 100644 index 0000000..e0983ef --- /dev/null +++ b/src/oz_agent_sdk/types/agent/schedule_list_response.py @@ -0,0 +1,13 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List + +from ..._models import BaseModel +from .scheduled_agent_item import ScheduledAgentItem + +__all__ = ["ScheduleListResponse"] + + +class ScheduleListResponse(BaseModel): + schedules: List[ScheduledAgentItem] + """List of scheduled agents""" diff --git a/src/oz_agent_sdk/types/agent/schedule_update_params.py b/src/oz_agent_sdk/types/agent/schedule_update_params.py new file mode 100644 index 0000000..2c82454 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/schedule_update_params.py @@ -0,0 +1,29 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Required, TypedDict + +from ..ambient_agent_config_param import AmbientAgentConfigParam + +__all__ = ["ScheduleUpdateParams"] + + +class ScheduleUpdateParams(TypedDict, total=False): + cron_schedule: Required[str] + """Cron expression defining when the agent runs""" + + enabled: Required[bool] + """Whether the schedule should be active""" + + name: Required[str] + """Human-readable name for the schedule""" + + agent_config: AmbientAgentConfigParam + """Configuration for a cloud agent run""" + + prompt: str + """ + The prompt/instruction for the agent to execute. Required unless + agent_config.skill_spec is provided. + """ diff --git a/src/oz_agent_sdk/types/agent/scheduled_agent_history_item.py b/src/oz_agent_sdk/types/agent/scheduled_agent_history_item.py new file mode 100644 index 0000000..d8ad5f7 --- /dev/null +++ b/src/oz_agent_sdk/types/agent/scheduled_agent_history_item.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from datetime import datetime + +from ..._models import BaseModel + +__all__ = ["ScheduledAgentHistoryItem"] + + +class ScheduledAgentHistoryItem(BaseModel): + """Scheduler-derived history metadata for a scheduled agent""" + + last_ran: Optional[datetime] = None + """Timestamp of the last successful run (RFC3339)""" + + next_run: Optional[datetime] = None + """Timestamp of the next scheduled run (RFC3339)""" diff --git a/src/oz_agent_sdk/types/agent/scheduled_agent_item.py b/src/oz_agent_sdk/types/agent/scheduled_agent_item.py new file mode 100644 index 0000000..d66ddfa --- /dev/null +++ b/src/oz_agent_sdk/types/agent/scheduled_agent_item.py @@ -0,0 +1,58 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from datetime import datetime + +from ..scope import Scope +from ..._models import BaseModel +from ..user_profile import UserProfile +from ..ambient_agent_config import AmbientAgentConfig +from ..cloud_environment_config import CloudEnvironmentConfig +from .scheduled_agent_history_item import ScheduledAgentHistoryItem + +__all__ = ["ScheduledAgentItem"] + + +class ScheduledAgentItem(BaseModel): + id: str + """Unique identifier for the scheduled agent""" + + created_at: datetime + """Timestamp when the schedule was created (RFC3339)""" + + cron_schedule: str + """ + Cron expression defining when the agent runs (e.g., "0 9 \\** \\** \\**" for daily at + 9am UTC) + """ + + enabled: bool + """Whether the schedule is currently active""" + + name: str + """Human-readable name for the schedule""" + + prompt: str + """The prompt/instruction for the agent to execute""" + + updated_at: datetime + """Timestamp when the schedule was last updated (RFC3339)""" + + agent_config: Optional[AmbientAgentConfig] = None + """Configuration for a cloud agent run""" + + created_by: Optional[UserProfile] = None + + environment: Optional[CloudEnvironmentConfig] = None + """Configuration for a cloud environment used by scheduled agents""" + + history: Optional[ScheduledAgentHistoryItem] = None + """Scheduler-derived history metadata for a scheduled agent""" + + last_spawn_error: Optional[str] = None + """Error message from the last failed spawn attempt, if any""" + + scope: Optional[Scope] = None + """Ownership scope for a resource (team or personal)""" + + updated_by: Optional[UserProfile] = None diff --git a/src/oz_agent_sdk/types/agent/session_check_redirect_response.py b/src/oz_agent_sdk/types/agent/session_check_redirect_response.py new file mode 100644 index 0000000..9a287fc --- /dev/null +++ b/src/oz_agent_sdk/types/agent/session_check_redirect_response.py @@ -0,0 +1,12 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional + +from ..._models import BaseModel + +__all__ = ["SessionCheckRedirectResponse"] + + +class SessionCheckRedirectResponse(BaseModel): + conversation_id: Optional[str] = None + """The conversation ID to redirect to (only present when redirect is needed)""" diff --git a/src/oz_agent_sdk/types/agent_get_artifact_response.py b/src/oz_agent_sdk/types/agent_get_artifact_response.py new file mode 100644 index 0000000..30405bc --- /dev/null +++ b/src/oz_agent_sdk/types/agent_get_artifact_response.py @@ -0,0 +1,94 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union, Optional +from datetime import datetime +from typing_extensions import Literal, Annotated, TypeAlias + +from .._utils import PropertyInfo +from .._models import BaseModel + +__all__ = [ + "AgentGetArtifactResponse", + "ScreenshotArtifactResponse", + "ScreenshotArtifactResponseData", + "FileArtifactResponse", + "FileArtifactResponseData", +] + + +class ScreenshotArtifactResponseData(BaseModel): + """Response data for a screenshot artifact, including a signed download URL.""" + + content_type: str + """MIME type of the screenshot (e.g., image/png)""" + + download_url: str + """Time-limited signed URL to download the screenshot""" + + expires_at: datetime + """Timestamp when the download URL expires (RFC3339)""" + + description: Optional[str] = None + """Optional description of the screenshot""" + + +class ScreenshotArtifactResponse(BaseModel): + """Response for retrieving a screenshot artifact.""" + + artifact_type: Literal["SCREENSHOT"] + """Type of the artifact""" + + artifact_uid: str + """Unique identifier (UUID) for the artifact""" + + created_at: datetime + """Timestamp when the artifact was created (RFC3339)""" + + data: ScreenshotArtifactResponseData + """Response data for a screenshot artifact, including a signed download URL.""" + + +class FileArtifactResponseData(BaseModel): + """Response data for a file artifact, including a signed download URL.""" + + content_type: str + """MIME type of the uploaded file""" + + download_url: str + """Time-limited signed URL to download the file""" + + expires_at: datetime + """Timestamp when the download URL expires (RFC3339)""" + + filename: str + """Last path component of filepath""" + + filepath: str + """Conversation-relative filepath for the uploaded file""" + + description: Optional[str] = None + """Optional description of the file""" + + size_bytes: Optional[int] = None + """Size of the uploaded file in bytes""" + + +class FileArtifactResponse(BaseModel): + """Response for retrieving a file artifact.""" + + artifact_type: Literal["FILE"] + """Type of the artifact""" + + artifact_uid: str + """Unique identifier (UUID) for the artifact""" + + created_at: datetime + """Timestamp when the artifact was created (RFC3339)""" + + data: FileArtifactResponseData + """Response data for a file artifact, including a signed download URL.""" + + +AgentGetArtifactResponse: TypeAlias = Annotated[ + Union[ScreenshotArtifactResponse, FileArtifactResponse], PropertyInfo(discriminator="artifact_type") +] diff --git a/src/oz_agent_sdk/types/agent_list_params.py b/src/oz_agent_sdk/types/agent_list_params.py new file mode 100644 index 0000000..d3157f4 --- /dev/null +++ b/src/oz_agent_sdk/types/agent_list_params.py @@ -0,0 +1,35 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, TypedDict + +__all__ = ["AgentListParams"] + + +class AgentListParams(TypedDict, total=False): + include_malformed_skills: bool + """When true, includes skills whose SKILL.md file exists but is malformed. + + These variants will have a non-empty `error` field describing the parse failure. + Defaults to false. + """ + + refresh: bool + """ + When true, clears the agent list cache before fetching. Use this to force a + refresh of the available agents. + """ + + repo: str + """ + Optional repository specification to list agents from (format: "owner/repo"). If + not provided, lists agents from all accessible environments. + """ + + sort_by: Literal["name", "last_run"] + """Sort order for the returned agents. + + - "name": Sort alphabetically by name (default) + - "last_run": Sort by most recently used + """ diff --git a/src/oz_agent_sdk/types/agent_list_response.py b/src/oz_agent_sdk/types/agent_list_response.py new file mode 100644 index 0000000..b32e870 --- /dev/null +++ b/src/oz_agent_sdk/types/agent_list_response.py @@ -0,0 +1,13 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List + +from .._models import BaseModel +from .agent_skill import AgentSkill + +__all__ = ["AgentListResponse"] + + +class AgentListResponse(BaseModel): + agents: List[AgentSkill] + """List of available agents""" diff --git a/src/oz_agent_sdk/types/agent_run_params.py b/src/oz_agent_sdk/types/agent_run_params.py new file mode 100644 index 0000000..2a346ed --- /dev/null +++ b/src/oz_agent_sdk/types/agent_run_params.py @@ -0,0 +1,82 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Union, Iterable +from typing_extensions import Required, Annotated, TypedDict + +from .._types import Base64FileInput +from .._utils import PropertyInfo +from .._models import set_pydantic_config +from .ambient_agent_config_param import AmbientAgentConfigParam + +__all__ = ["AgentRunParams", "Attachment"] + + +class AgentRunParams(TypedDict, total=False): + attachments: Iterable[Attachment] + """ + Optional file attachments to include with the prompt (max 5). Attachments are + uploaded to cloud storage and made available to the agent. + """ + + config: AmbientAgentConfigParam + """Configuration for a cloud agent run""" + + conversation_id: str + """ + Optional conversation ID to continue an existing conversation. If provided, the + agent will continue from where the previous run left off. + """ + + interactive: bool + """Whether the run should be interactive. If not set, defaults to false.""" + + parent_run_id: str + """ + Optional run ID of the parent that spawned this run. Used for orchestration + hierarchies. + """ + + prompt: str + """ + The prompt/instruction for the agent to execute. Required unless a skill is + specified via the skill field or config.skill_spec. + """ + + skill: str + """Skill specification to use as the base prompt for the agent. Supported formats: + + - "repo:skill_name" - Simple name in specific repo + - "repo:skill_path" - Full path in specific repo + - "org/repo:skill_name" - Simple name with org and repo + - "org/repo:skill_path" - Full path with org and repo When provided, this takes + precedence over config.skill_spec. + """ + + team: bool + """ + Whether to create a team-owned run. Defaults to true for users on a single team. + """ + + title: str + """Custom title for the run (auto-generated if not provided)""" + + +class Attachment(TypedDict, total=False): + """A base64-encoded file attachment to include with the prompt""" + + data: Required[Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")]] + """Base64-encoded attachment data""" + + file_name: Required[str] + """Name of the attached file""" + + mime_type: Required[str] + """ + MIME type of the attachment. Supported image types: image/jpeg, image/png, + image/gif, image/webp + """ + + +set_pydantic_config(Attachment, {"arbitrary_types_allowed": True}) diff --git a/src/oz_agent_sdk/types/agent_run_response.py b/src/oz_agent_sdk/types/agent_run_response.py new file mode 100644 index 0000000..fb2480e --- /dev/null +++ b/src/oz_agent_sdk/types/agent_run_response.py @@ -0,0 +1,36 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional + +from .._models import BaseModel +from .agent.run_state import RunState + +__all__ = ["AgentRunResponse"] + + +class AgentRunResponse(BaseModel): + run_id: str + """Unique identifier for the created run""" + + state: RunState + """Current state of the run: + + - QUEUED: Run is waiting to be picked up + - PENDING: Run is being prepared + - CLAIMED: Run has been claimed by a worker + - INPROGRESS: Run is actively being executed + - SUCCEEDED: Run completed successfully + - FAILED: Run failed + - BLOCKED: Run is blocked (e.g., awaiting user input or approval) + - ERROR: Run encountered an error + - CANCELLED: Run was cancelled by user + """ + + task_id: str + """Unique identifier for the task (same as run_id). + + Deprecated - use run_id instead. + """ + + at_capacity: Optional[bool] = None + """Whether the system is at capacity when the run was created""" diff --git a/src/oz_agent_sdk/types/agent_skill.py b/src/oz_agent_sdk/types/agent_skill.py new file mode 100644 index 0000000..9b3386f --- /dev/null +++ b/src/oz_agent_sdk/types/agent_skill.py @@ -0,0 +1,64 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional +from datetime import datetime + +from .._models import BaseModel + +__all__ = ["AgentSkill", "Variant", "VariantEnvironment", "VariantSource"] + + +class VariantEnvironment(BaseModel): + name: str + """Human-readable name of the environment""" + + uid: str + """Unique identifier for the environment""" + + +class VariantSource(BaseModel): + name: str + """GitHub repository name""" + + owner: str + """GitHub repository owner""" + + skill_path: str + """Path to the skill definition file within the repository""" + + +class Variant(BaseModel): + id: str + """ + Stable identifier for this skill variant. Format: "{owner}/{repo}:{skill_path}" + Example: "warpdotdev/warp-server:.claude/skills/deploy/SKILL.md" + """ + + base_prompt: str + """Base prompt/instructions for the agent""" + + description: str + """Description of the agent variant""" + + environments: List[VariantEnvironment] + """Environments where this agent variant is available""" + + source: VariantSource + + error: Optional[str] = None + """ + Non-empty when the skill's SKILL.md file exists but is malformed. Contains a + description of the parse failure. Only present when + include_malformed_skills=true is passed to the list agents endpoint. + """ + + last_run_timestamp: Optional[datetime] = None + """Timestamp of the last time this skill was run (RFC3339)""" + + +class AgentSkill(BaseModel): + name: str + """Human-readable name of the agent""" + + variants: List[Variant] + """Available variants of this agent""" diff --git a/src/oz_agent_sdk/types/ambient_agent_config.py b/src/oz_agent_sdk/types/ambient_agent_config.py new file mode 100644 index 0000000..abd16c1 --- /dev/null +++ b/src/oz_agent_sdk/types/ambient_agent_config.py @@ -0,0 +1,91 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Optional +from typing_extensions import Literal + +from pydantic import Field as FieldInfo + +from .._models import BaseModel +from .mcp_server_config import McpServerConfig + +__all__ = ["AmbientAgentConfig", "Harness"] + + +class Harness(BaseModel): + """ + Specifies which execution harness to use for the agent run. + Default (nil/empty) uses Warp's built-in harness. + """ + + auth_secret_name: Optional[str] = None + """Name of a managed secret to use as the authentication credential for the + harness. + + The secret must exist within the caller's personal or team scope. The + environment variable injected into the agent is determined by the secret type + (e.g. ANTHROPIC_API_KEY for anthropic_api_key secrets). + """ + + type: Optional[Literal["oz", "claude"]] = None + """The harness type identifier. + + - oz: Warp's built-in harness (default) + - claude: Claude Code harness + """ + + +class AmbientAgentConfig(BaseModel): + """Configuration for a cloud agent run""" + + base_prompt: Optional[str] = None + """Custom base prompt for the agent""" + + computer_use_enabled: Optional[bool] = None + """ + Controls whether computer use is enabled for this agent. If not set, defaults to + false. + """ + + environment_id: Optional[str] = None + """UID of the environment to run the agent in""" + + harness: Optional[Harness] = None + """ + Specifies which execution harness to use for the agent run. Default (nil/empty) + uses Warp's built-in harness. + """ + + idle_timeout_minutes: Optional[int] = None + """ + Number of minutes to keep the agent environment alive after task completion. If + not set, defaults to 10 minutes. Maximum allowed value is min(60, + floor(max_instance_runtime_seconds / 60) for your billing tier). + """ + + mcp_servers: Optional[Dict[str, McpServerConfig]] = None + """Map of MCP server configurations by name""" + + api_model_id: Optional[str] = FieldInfo(alias="model_id", default=None) + """LLM model to use (uses team default if not specified)""" + + name: Optional[str] = None + """ + Human-readable label for grouping, filtering, and traceability. Automatically + set to the skill name when running a skill-based agent. Set this explicitly to + categorize runs by intent (e.g., "nightly-dependency-check") so you can filter + and track them via the name query parameter on GET /agent/runs. + """ + + skill_spec: Optional[str] = None + """ + Skill specification identifying which agent skill to use. Format: + "{owner}/{repo}:{skill_path}" Example: + "warpdotdev/warp-server:.claude/skills/deploy/SKILL.md" Use the list agents + endpoint to discover available skills. + """ + + worker_host: Optional[str] = None + """ + Self-hosted worker ID that should execute this task. If not specified or set to + "warp", the task runs on Warp-hosted workers. + """ diff --git a/src/oz_agent_sdk/types/ambient_agent_config_param.py b/src/oz_agent_sdk/types/ambient_agent_config_param.py new file mode 100644 index 0000000..24da607 --- /dev/null +++ b/src/oz_agent_sdk/types/ambient_agent_config_param.py @@ -0,0 +1,90 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict +from typing_extensions import Literal, TypedDict + +from .mcp_server_config_param import McpServerConfigParam + +__all__ = ["AmbientAgentConfigParam", "Harness"] + + +class Harness(TypedDict, total=False): + """ + Specifies which execution harness to use for the agent run. + Default (nil/empty) uses Warp's built-in harness. + """ + + auth_secret_name: str + """Name of a managed secret to use as the authentication credential for the + harness. + + The secret must exist within the caller's personal or team scope. The + environment variable injected into the agent is determined by the secret type + (e.g. ANTHROPIC_API_KEY for anthropic_api_key secrets). + """ + + type: Literal["oz", "claude"] + """The harness type identifier. + + - oz: Warp's built-in harness (default) + - claude: Claude Code harness + """ + + +class AmbientAgentConfigParam(TypedDict, total=False): + """Configuration for a cloud agent run""" + + base_prompt: str + """Custom base prompt for the agent""" + + computer_use_enabled: bool + """ + Controls whether computer use is enabled for this agent. If not set, defaults to + false. + """ + + environment_id: str + """UID of the environment to run the agent in""" + + harness: Harness + """ + Specifies which execution harness to use for the agent run. Default (nil/empty) + uses Warp's built-in harness. + """ + + idle_timeout_minutes: int + """ + Number of minutes to keep the agent environment alive after task completion. If + not set, defaults to 10 minutes. Maximum allowed value is min(60, + floor(max_instance_runtime_seconds / 60) for your billing tier). + """ + + mcp_servers: Dict[str, McpServerConfigParam] + """Map of MCP server configurations by name""" + + model_id: str + """LLM model to use (uses team default if not specified)""" + + name: str + """ + Human-readable label for grouping, filtering, and traceability. Automatically + set to the skill name when running a skill-based agent. Set this explicitly to + categorize runs by intent (e.g., "nightly-dependency-check") so you can filter + and track them via the name query parameter on GET /agent/runs. + """ + + skill_spec: str + """ + Skill specification identifying which agent skill to use. Format: + "{owner}/{repo}:{skill_path}" Example: + "warpdotdev/warp-server:.claude/skills/deploy/SKILL.md" Use the list agents + endpoint to discover available skills. + """ + + worker_host: str + """ + Self-hosted worker ID that should execute this task. If not specified or set to + "warp", the task runs on Warp-hosted workers. + """ diff --git a/src/oz_agent_sdk/types/aws_provider_config.py b/src/oz_agent_sdk/types/aws_provider_config.py new file mode 100644 index 0000000..61020d8 --- /dev/null +++ b/src/oz_agent_sdk/types/aws_provider_config.py @@ -0,0 +1,12 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .._models import BaseModel + +__all__ = ["AwsProviderConfig"] + + +class AwsProviderConfig(BaseModel): + """AWS IAM role assumption settings""" + + role_arn: str + """AWS IAM role ARN to assume""" diff --git a/src/oz_agent_sdk/types/cloud_environment_config.py b/src/oz_agent_sdk/types/cloud_environment_config.py new file mode 100644 index 0000000..15ef158 --- /dev/null +++ b/src/oz_agent_sdk/types/cloud_environment_config.py @@ -0,0 +1,49 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from .._models import BaseModel +from .aws_provider_config import AwsProviderConfig +from .gcp_provider_config import GcpProviderConfig + +__all__ = ["CloudEnvironmentConfig", "GitHubRepo", "Providers"] + + +class GitHubRepo(BaseModel): + owner: str + """GitHub repository owner (user or organization)""" + + repo: str + """GitHub repository name""" + + +class Providers(BaseModel): + """Optional cloud provider configurations for automatic auth""" + + aws: Optional[AwsProviderConfig] = None + """AWS IAM role assumption settings""" + + gcp: Optional[GcpProviderConfig] = None + """GCP Workload Identity Federation settings""" + + +class CloudEnvironmentConfig(BaseModel): + """Configuration for a cloud environment used by scheduled agents""" + + description: Optional[str] = None + """Optional description of the environment""" + + docker_image: Optional[str] = None + """Docker image to use (e.g., "ubuntu:latest" or "registry/repo:tag")""" + + github_repos: Optional[List[GitHubRepo]] = None + """List of GitHub repositories to clone into the environment""" + + name: Optional[str] = None + """Human-readable name for the environment""" + + providers: Optional[Providers] = None + """Optional cloud provider configurations for automatic auth""" + + setup_commands: Optional[List[str]] = None + """Shell commands to run during environment setup""" diff --git a/src/oz_agent_sdk/types/error_code.py b/src/oz_agent_sdk/types/error_code.py new file mode 100644 index 0000000..5732142 --- /dev/null +++ b/src/oz_agent_sdk/types/error_code.py @@ -0,0 +1,24 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing_extensions import Literal, TypeAlias + +__all__ = ["ErrorCode"] + +ErrorCode: TypeAlias = Literal[ + "insufficient_credits", + "feature_not_available", + "external_authentication_required", + "not_authorized", + "invalid_request", + "resource_not_found", + "budget_exceeded", + "integration_disabled", + "integration_not_configured", + "operation_not_supported", + "environment_setup_failed", + "content_policy_violation", + "conflict", + "authentication_required", + "resource_unavailable", + "internal_error", +] diff --git a/src/oz_agent_sdk/types/gcp_provider_config.py b/src/oz_agent_sdk/types/gcp_provider_config.py new file mode 100644 index 0000000..168ab6a --- /dev/null +++ b/src/oz_agent_sdk/types/gcp_provider_config.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .._models import BaseModel + +__all__ = ["GcpProviderConfig"] + + +class GcpProviderConfig(BaseModel): + """GCP Workload Identity Federation settings""" + + project_number: str + """GCP project number""" + + workload_identity_federation_pool_id: str + """Workload Identity Federation pool ID""" + + workload_identity_federation_provider_id: str + """Workload Identity Federation provider ID""" diff --git a/src/oz_agent_sdk/types/mcp_server_config.py b/src/oz_agent_sdk/types/mcp_server_config.py new file mode 100644 index 0000000..c9b7134 --- /dev/null +++ b/src/oz_agent_sdk/types/mcp_server_config.py @@ -0,0 +1,32 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Optional + +from .._models import BaseModel + +__all__ = ["McpServerConfig"] + + +class McpServerConfig(BaseModel): + """Configuration for an MCP server. + + Must have exactly one of: warp_id, command, or url. + """ + + args: Optional[List[str]] = None + """Stdio transport - command arguments""" + + command: Optional[str] = None + """Stdio transport - command to run""" + + env: Optional[Dict[str, str]] = None + """Environment variables for the server""" + + headers: Optional[Dict[str, str]] = None + """HTTP headers for SSE/HTTP transport""" + + url: Optional[str] = None + """SSE/HTTP transport - server URL""" + + warp_id: Optional[str] = None + """Reference to a Warp shared MCP server by UUID""" diff --git a/src/oz_agent_sdk/types/mcp_server_config_param.py b/src/oz_agent_sdk/types/mcp_server_config_param.py new file mode 100644 index 0000000..63a63aa --- /dev/null +++ b/src/oz_agent_sdk/types/mcp_server_config_param.py @@ -0,0 +1,35 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict +from typing_extensions import TypedDict + +from .._types import SequenceNotStr + +__all__ = ["McpServerConfigParam"] + + +class McpServerConfigParam(TypedDict, total=False): + """Configuration for an MCP server. + + Must have exactly one of: warp_id, command, or url. + """ + + args: SequenceNotStr[str] + """Stdio transport - command arguments""" + + command: str + """Stdio transport - command to run""" + + env: Dict[str, str] + """Environment variables for the server""" + + headers: Dict[str, str] + """HTTP headers for SSE/HTTP transport""" + + url: str + """SSE/HTTP transport - server URL""" + + warp_id: str + """Reference to a Warp shared MCP server by UUID""" diff --git a/src/oz_agent_sdk/types/scope.py b/src/oz_agent_sdk/types/scope.py new file mode 100644 index 0000000..ac765e3 --- /dev/null +++ b/src/oz_agent_sdk/types/scope.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["Scope"] + + +class Scope(BaseModel): + """Ownership scope for a resource (team or personal)""" + + type: Literal["User", "Team"] + """Type of ownership ("User" for personal, "Team" for team-owned)""" + + uid: Optional[str] = None + """UID of the owning user or team""" diff --git a/src/oz_agent_sdk/types/user_profile.py b/src/oz_agent_sdk/types/user_profile.py new file mode 100644 index 0000000..5892be4 --- /dev/null +++ b/src/oz_agent_sdk/types/user_profile.py @@ -0,0 +1,25 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["UserProfile"] + + +class UserProfile(BaseModel): + display_name: Optional[str] = None + """Display name of the creator""" + + email: Optional[str] = None + """Email address of the creator""" + + photo_url: Optional[str] = None + """URL to the creator's photo""" + + type: Optional[Literal["user", "service_account"]] = None + """Type of the creator principal""" + + uid: Optional[str] = None + """Unique identifier of the creator""" diff --git a/src/warp_agent_sdk/lib/.keep b/src/warp_agent_sdk/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/warp_agent_sdk/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/src/warp_api/lib/.keep b/src/warp_api/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/warp_api/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/src/warp_sdk/lib/.keep b/src/warp_sdk/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/warp_sdk/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/tests/__init__.py b/tests/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/__init__.py b/tests/api_resources/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/api_resources/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/agent/__init__.py b/tests/api_resources/agent/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/api_resources/agent/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/agent/test_runs.py b/tests/api_resources/agent/test_runs.py new file mode 100644 index 0000000..bf257f8 --- /dev/null +++ b/tests/api_resources/agent/test_runs.py @@ -0,0 +1,302 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from tests.utils import assert_matches_type +from oz_agent_sdk import OzAPI, AsyncOzAPI +from oz_agent_sdk._utils import parse_datetime +from oz_agent_sdk.pagination import SyncRunsCursorPage, AsyncRunsCursorPage +from oz_agent_sdk.types.agent import RunItem + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestRuns: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_retrieve(self, client: OzAPI) -> None: + run = client.agent.runs.retrieve( + "runId", + ) + assert_matches_type(RunItem, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_retrieve(self, client: OzAPI) -> None: + response = client.agent.runs.with_raw_response.retrieve( + "runId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + run = response.parse() + assert_matches_type(RunItem, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_retrieve(self, client: OzAPI) -> None: + with client.agent.runs.with_streaming_response.retrieve( + "runId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + run = response.parse() + assert_matches_type(RunItem, run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_retrieve(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.agent.runs.with_raw_response.retrieve( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_list(self, client: OzAPI) -> None: + run = client.agent.runs.list() + assert_matches_type(SyncRunsCursorPage[RunItem], run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_list_with_all_params(self, client: OzAPI) -> None: + run = client.agent.runs.list( + artifact_type="PLAN", + created_after=parse_datetime("2019-12-27T18:11:19.117Z"), + created_before=parse_datetime("2019-12-27T18:11:19.117Z"), + creator="creator", + cursor="cursor", + environment_id="environment_id", + execution_location="LOCAL", + limit=1, + model_id="model_id", + name="name", + q="q", + schedule_id="schedule_id", + skill="skill", + skill_spec="skill_spec", + sort_by="updated_at", + sort_order="asc", + source="LINEAR", + state=["QUEUED"], + updated_after=parse_datetime("2019-12-27T18:11:19.117Z"), + ) + assert_matches_type(SyncRunsCursorPage[RunItem], run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_list(self, client: OzAPI) -> None: + response = client.agent.runs.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + run = response.parse() + assert_matches_type(SyncRunsCursorPage[RunItem], run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_list(self, client: OzAPI) -> None: + with client.agent.runs.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + run = response.parse() + assert_matches_type(SyncRunsCursorPage[RunItem], run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_cancel(self, client: OzAPI) -> None: + run = client.agent.runs.cancel( + "runId", + ) + assert_matches_type(str, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_cancel(self, client: OzAPI) -> None: + response = client.agent.runs.with_raw_response.cancel( + "runId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + run = response.parse() + assert_matches_type(str, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_cancel(self, client: OzAPI) -> None: + with client.agent.runs.with_streaming_response.cancel( + "runId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + run = response.parse() + assert_matches_type(str, run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_cancel(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.agent.runs.with_raw_response.cancel( + "", + ) + + +class TestAsyncRuns: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_retrieve(self, async_client: AsyncOzAPI) -> None: + run = await async_client.agent.runs.retrieve( + "runId", + ) + assert_matches_type(RunItem, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.runs.with_raw_response.retrieve( + "runId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + run = await response.parse() + assert_matches_type(RunItem, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.runs.with_streaming_response.retrieve( + "runId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + run = await response.parse() + assert_matches_type(RunItem, run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_retrieve(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.agent.runs.with_raw_response.retrieve( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_list(self, async_client: AsyncOzAPI) -> None: + run = await async_client.agent.runs.list() + assert_matches_type(AsyncRunsCursorPage[RunItem], run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_list_with_all_params(self, async_client: AsyncOzAPI) -> None: + run = await async_client.agent.runs.list( + artifact_type="PLAN", + created_after=parse_datetime("2019-12-27T18:11:19.117Z"), + created_before=parse_datetime("2019-12-27T18:11:19.117Z"), + creator="creator", + cursor="cursor", + environment_id="environment_id", + execution_location="LOCAL", + limit=1, + model_id="model_id", + name="name", + q="q", + schedule_id="schedule_id", + skill="skill", + skill_spec="skill_spec", + sort_by="updated_at", + sort_order="asc", + source="LINEAR", + state=["QUEUED"], + updated_after=parse_datetime("2019-12-27T18:11:19.117Z"), + ) + assert_matches_type(AsyncRunsCursorPage[RunItem], run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_list(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.runs.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + run = await response.parse() + assert_matches_type(AsyncRunsCursorPage[RunItem], run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_list(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.runs.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + run = await response.parse() + assert_matches_type(AsyncRunsCursorPage[RunItem], run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_cancel(self, async_client: AsyncOzAPI) -> None: + run = await async_client.agent.runs.cancel( + "runId", + ) + assert_matches_type(str, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_cancel(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.runs.with_raw_response.cancel( + "runId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + run = await response.parse() + assert_matches_type(str, run, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_cancel(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.runs.with_streaming_response.cancel( + "runId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + run = await response.parse() + assert_matches_type(str, run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_cancel(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.agent.runs.with_raw_response.cancel( + "", + ) diff --git a/tests/api_resources/agent/test_schedules.py b/tests/api_resources/agent/test_schedules.py new file mode 100644 index 0000000..9b22b45 --- /dev/null +++ b/tests/api_resources/agent/test_schedules.py @@ -0,0 +1,746 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from tests.utils import assert_matches_type +from oz_agent_sdk import OzAPI, AsyncOzAPI +from oz_agent_sdk.types.agent import ( + ScheduledAgentItem, + ScheduleListResponse, + ScheduleDeleteResponse, +) + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestSchedules: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_create(self, client: OzAPI) -> None: + schedule = client.agent.schedules.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_create_with_all_params(self, client: OzAPI) -> None: + schedule = client.agent.schedules.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + agent_config={ + "base_prompt": "base_prompt", + "computer_use_enabled": True, + "environment_id": "environment_id", + "harness": { + "auth_secret_name": "auth_secret_name", + "type": "oz", + }, + "idle_timeout_minutes": 1, + "mcp_servers": { + "foo": { + "args": ["string"], + "command": "command", + "env": {"foo": "string"}, + "headers": {"foo": "string"}, + "url": "https://example.com", + "warp_id": "warp_id", + } + }, + "model_id": "model_id", + "name": "name", + "skill_spec": "skill_spec", + "worker_host": "worker_host", + }, + enabled=True, + prompt="Review open pull requests and provide feedback", + team=True, + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_create(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_create(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_retrieve(self, client: OzAPI) -> None: + schedule = client.agent.schedules.retrieve( + "scheduleId", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_retrieve(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.retrieve( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_retrieve(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.retrieve( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_retrieve(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + client.agent.schedules.with_raw_response.retrieve( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_update(self, client: OzAPI) -> None: + schedule = client.agent.schedules.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_update_with_all_params(self, client: OzAPI) -> None: + schedule = client.agent.schedules.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + agent_config={ + "base_prompt": "base_prompt", + "computer_use_enabled": True, + "environment_id": "environment_id", + "harness": { + "auth_secret_name": "auth_secret_name", + "type": "oz", + }, + "idle_timeout_minutes": 1, + "mcp_servers": { + "foo": { + "args": ["string"], + "command": "command", + "env": {"foo": "string"}, + "headers": {"foo": "string"}, + "url": "https://example.com", + "warp_id": "warp_id", + } + }, + "model_id": "model_id", + "name": "name", + "skill_spec": "skill_spec", + "worker_host": "worker_host", + }, + prompt="prompt", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_update(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_update(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_update(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + client.agent.schedules.with_raw_response.update( + schedule_id="", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_list(self, client: OzAPI) -> None: + schedule = client.agent.schedules.list() + assert_matches_type(ScheduleListResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_list(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduleListResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_list(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduleListResponse, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_delete(self, client: OzAPI) -> None: + schedule = client.agent.schedules.delete( + "scheduleId", + ) + assert_matches_type(ScheduleDeleteResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_delete(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.delete( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduleDeleteResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_delete(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.delete( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduleDeleteResponse, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_delete(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + client.agent.schedules.with_raw_response.delete( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_pause(self, client: OzAPI) -> None: + schedule = client.agent.schedules.pause( + "scheduleId", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_pause(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.pause( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_pause(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.pause( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_pause(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + client.agent.schedules.with_raw_response.pause( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_resume(self, client: OzAPI) -> None: + schedule = client.agent.schedules.resume( + "scheduleId", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_resume(self, client: OzAPI) -> None: + response = client.agent.schedules.with_raw_response.resume( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_resume(self, client: OzAPI) -> None: + with client.agent.schedules.with_streaming_response.resume( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_resume(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + client.agent.schedules.with_raw_response.resume( + "", + ) + + +class TestAsyncSchedules: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_create(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_create_with_all_params(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + agent_config={ + "base_prompt": "base_prompt", + "computer_use_enabled": True, + "environment_id": "environment_id", + "harness": { + "auth_secret_name": "auth_secret_name", + "type": "oz", + }, + "idle_timeout_minutes": 1, + "mcp_servers": { + "foo": { + "args": ["string"], + "command": "command", + "env": {"foo": "string"}, + "headers": {"foo": "string"}, + "url": "https://example.com", + "warp_id": "warp_id", + } + }, + "model_id": "model_id", + "name": "name", + "skill_spec": "skill_spec", + "worker_host": "worker_host", + }, + enabled=True, + prompt="Review open pull requests and provide feedback", + team=True, + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_create(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_create(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.create( + cron_schedule="0 9 * * *", + name="Daily Code Review", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_retrieve(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.retrieve( + "scheduleId", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.retrieve( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.retrieve( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_retrieve(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + await async_client.agent.schedules.with_raw_response.retrieve( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_update(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_update_with_all_params(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + agent_config={ + "base_prompt": "base_prompt", + "computer_use_enabled": True, + "environment_id": "environment_id", + "harness": { + "auth_secret_name": "auth_secret_name", + "type": "oz", + }, + "idle_timeout_minutes": 1, + "mcp_servers": { + "foo": { + "args": ["string"], + "command": "command", + "env": {"foo": "string"}, + "headers": {"foo": "string"}, + "url": "https://example.com", + "warp_id": "warp_id", + } + }, + "model_id": "model_id", + "name": "name", + "skill_spec": "skill_spec", + "worker_host": "worker_host", + }, + prompt="prompt", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_update(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_update(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.update( + schedule_id="scheduleId", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_update(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + await async_client.agent.schedules.with_raw_response.update( + schedule_id="", + cron_schedule="cron_schedule", + enabled=True, + name="name", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_list(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.list() + assert_matches_type(ScheduleListResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_list(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduleListResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_list(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduleListResponse, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_delete(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.delete( + "scheduleId", + ) + assert_matches_type(ScheduleDeleteResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_delete(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.delete( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduleDeleteResponse, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_delete(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.delete( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduleDeleteResponse, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_delete(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + await async_client.agent.schedules.with_raw_response.delete( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_pause(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.pause( + "scheduleId", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_pause(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.pause( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_pause(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.pause( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_pause(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + await async_client.agent.schedules.with_raw_response.pause( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_resume(self, async_client: AsyncOzAPI) -> None: + schedule = await async_client.agent.schedules.resume( + "scheduleId", + ) + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_resume(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.schedules.with_raw_response.resume( + "scheduleId", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_resume(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.schedules.with_streaming_response.resume( + "scheduleId", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + schedule = await response.parse() + assert_matches_type(ScheduledAgentItem, schedule, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_resume(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `schedule_id` but received ''"): + await async_client.agent.schedules.with_raw_response.resume( + "", + ) diff --git a/tests/api_resources/agent/test_sessions.py b/tests/api_resources/agent/test_sessions.py new file mode 100644 index 0000000..5b344ac --- /dev/null +++ b/tests/api_resources/agent/test_sessions.py @@ -0,0 +1,108 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from tests.utils import assert_matches_type +from oz_agent_sdk import OzAPI, AsyncOzAPI +from oz_agent_sdk.types.agent import SessionCheckRedirectResponse + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestSessions: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_check_redirect(self, client: OzAPI) -> None: + session = client.agent.sessions.check_redirect( + "sessionUuid", + ) + assert_matches_type(SessionCheckRedirectResponse, session, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_check_redirect(self, client: OzAPI) -> None: + response = client.agent.sessions.with_raw_response.check_redirect( + "sessionUuid", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + session = response.parse() + assert_matches_type(SessionCheckRedirectResponse, session, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_check_redirect(self, client: OzAPI) -> None: + with client.agent.sessions.with_streaming_response.check_redirect( + "sessionUuid", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + session = response.parse() + assert_matches_type(SessionCheckRedirectResponse, session, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_check_redirect(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `session_uuid` but received ''"): + client.agent.sessions.with_raw_response.check_redirect( + "", + ) + + +class TestAsyncSessions: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_check_redirect(self, async_client: AsyncOzAPI) -> None: + session = await async_client.agent.sessions.check_redirect( + "sessionUuid", + ) + assert_matches_type(SessionCheckRedirectResponse, session, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_check_redirect(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.sessions.with_raw_response.check_redirect( + "sessionUuid", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + session = await response.parse() + assert_matches_type(SessionCheckRedirectResponse, session, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_check_redirect(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.sessions.with_streaming_response.check_redirect( + "sessionUuid", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + session = await response.parse() + assert_matches_type(SessionCheckRedirectResponse, session, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_check_redirect(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `session_uuid` but received ''"): + await async_client.agent.sessions.with_raw_response.check_redirect( + "", + ) diff --git a/tests/api_resources/test_agent.py b/tests/api_resources/test_agent.py new file mode 100644 index 0000000..b641c09 --- /dev/null +++ b/tests/api_resources/test_agent.py @@ -0,0 +1,336 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from tests.utils import assert_matches_type +from oz_agent_sdk import OzAPI, AsyncOzAPI +from oz_agent_sdk.types import ( + AgentRunResponse, + AgentListResponse, + AgentGetArtifactResponse, +) + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestAgent: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_list(self, client: OzAPI) -> None: + agent = client.agent.list() + assert_matches_type(AgentListResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_list_with_all_params(self, client: OzAPI) -> None: + agent = client.agent.list( + include_malformed_skills=True, + refresh=True, + repo="repo", + sort_by="name", + ) + assert_matches_type(AgentListResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_list(self, client: OzAPI) -> None: + response = client.agent.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + agent = response.parse() + assert_matches_type(AgentListResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_list(self, client: OzAPI) -> None: + with client.agent.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + agent = response.parse() + assert_matches_type(AgentListResponse, agent, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_get_artifact(self, client: OzAPI) -> None: + agent = client.agent.get_artifact( + "artifactUid", + ) + assert_matches_type(AgentGetArtifactResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_get_artifact(self, client: OzAPI) -> None: + response = client.agent.with_raw_response.get_artifact( + "artifactUid", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + agent = response.parse() + assert_matches_type(AgentGetArtifactResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_get_artifact(self, client: OzAPI) -> None: + with client.agent.with_streaming_response.get_artifact( + "artifactUid", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + agent = response.parse() + assert_matches_type(AgentGetArtifactResponse, agent, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_path_params_get_artifact(self, client: OzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `artifact_uid` but received ''"): + client.agent.with_raw_response.get_artifact( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_run(self, client: OzAPI) -> None: + agent = client.agent.run() + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_method_run_with_all_params(self, client: OzAPI) -> None: + agent = client.agent.run( + attachments=[ + { + "data": "U3RhaW5sZXNzIHJvY2tz", + "file_name": "file_name", + "mime_type": "mime_type", + } + ], + config={ + "base_prompt": "base_prompt", + "computer_use_enabled": True, + "environment_id": "environment_id", + "harness": { + "auth_secret_name": "auth_secret_name", + "type": "oz", + }, + "idle_timeout_minutes": 1, + "mcp_servers": { + "foo": { + "args": ["string"], + "command": "command", + "env": {"foo": "string"}, + "headers": {"foo": "string"}, + "url": "https://example.com", + "warp_id": "warp_id", + } + }, + "model_id": "model_id", + "name": "name", + "skill_spec": "skill_spec", + "worker_host": "worker_host", + }, + conversation_id="conversation_id", + interactive=True, + parent_run_id="parent_run_id", + prompt="prompt", + skill="skill", + team=True, + title="title", + ) + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_raw_response_run(self, client: OzAPI) -> None: + response = client.agent.with_raw_response.run() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + agent = response.parse() + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + def test_streaming_response_run(self, client: OzAPI) -> None: + with client.agent.with_streaming_response.run() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + agent = response.parse() + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + assert cast(Any, response.is_closed) is True + + +class TestAsyncAgent: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_list(self, async_client: AsyncOzAPI) -> None: + agent = await async_client.agent.list() + assert_matches_type(AgentListResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_list_with_all_params(self, async_client: AsyncOzAPI) -> None: + agent = await async_client.agent.list( + include_malformed_skills=True, + refresh=True, + repo="repo", + sort_by="name", + ) + assert_matches_type(AgentListResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_list(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.with_raw_response.list() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + agent = await response.parse() + assert_matches_type(AgentListResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_list(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.with_streaming_response.list() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + agent = await response.parse() + assert_matches_type(AgentListResponse, agent, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_get_artifact(self, async_client: AsyncOzAPI) -> None: + agent = await async_client.agent.get_artifact( + "artifactUid", + ) + assert_matches_type(AgentGetArtifactResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_get_artifact(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.with_raw_response.get_artifact( + "artifactUid", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + agent = await response.parse() + assert_matches_type(AgentGetArtifactResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_get_artifact(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.with_streaming_response.get_artifact( + "artifactUid", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + agent = await response.parse() + assert_matches_type(AgentGetArtifactResponse, agent, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_path_params_get_artifact(self, async_client: AsyncOzAPI) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `artifact_uid` but received ''"): + await async_client.agent.with_raw_response.get_artifact( + "", + ) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_run(self, async_client: AsyncOzAPI) -> None: + agent = await async_client.agent.run() + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_method_run_with_all_params(self, async_client: AsyncOzAPI) -> None: + agent = await async_client.agent.run( + attachments=[ + { + "data": "U3RhaW5sZXNzIHJvY2tz", + "file_name": "file_name", + "mime_type": "mime_type", + } + ], + config={ + "base_prompt": "base_prompt", + "computer_use_enabled": True, + "environment_id": "environment_id", + "harness": { + "auth_secret_name": "auth_secret_name", + "type": "oz", + }, + "idle_timeout_minutes": 1, + "mcp_servers": { + "foo": { + "args": ["string"], + "command": "command", + "env": {"foo": "string"}, + "headers": {"foo": "string"}, + "url": "https://example.com", + "warp_id": "warp_id", + } + }, + "model_id": "model_id", + "name": "name", + "skill_spec": "skill_spec", + "worker_host": "worker_host", + }, + conversation_id="conversation_id", + interactive=True, + parent_run_id="parent_run_id", + prompt="prompt", + skill="skill", + team=True, + title="title", + ) + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_raw_response_run(self, async_client: AsyncOzAPI) -> None: + response = await async_client.agent.with_raw_response.run() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + agent = await response.parse() + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + @pytest.mark.skip(reason="Mock server tests are disabled") + @parametrize + async def test_streaming_response_run(self, async_client: AsyncOzAPI) -> None: + async with async_client.agent.with_streaming_response.run() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + agent = await response.parse() + assert_matches_type(AgentRunResponse, agent, path=["response"]) + + assert cast(Any, response.is_closed) is True diff --git a/tests/conftest.py b/tests/conftest.py new file mode 100644 index 0000000..5884465 --- /dev/null +++ b/tests/conftest.py @@ -0,0 +1,84 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +import logging +from typing import TYPE_CHECKING, Iterator, AsyncIterator + +import httpx +import pytest +from pytest_asyncio import is_async_test + +from oz_agent_sdk import OzAPI, AsyncOzAPI, DefaultAioHttpClient +from oz_agent_sdk._utils import is_dict + +if TYPE_CHECKING: + from _pytest.fixtures import FixtureRequest # pyright: ignore[reportPrivateImportUsage] + +pytest.register_assert_rewrite("tests.utils") + +logging.getLogger("oz_agent_sdk").setLevel(logging.DEBUG) + + +# automatically add `pytest.mark.asyncio()` to all of our async tests +# so we don't have to add that boilerplate everywhere +def pytest_collection_modifyitems(items: list[pytest.Function]) -> None: + pytest_asyncio_tests = (item for item in items if is_async_test(item)) + session_scope_marker = pytest.mark.asyncio(loop_scope="session") + for async_test in pytest_asyncio_tests: + async_test.add_marker(session_scope_marker, append=False) + + # We skip tests that use both the aiohttp client and respx_mock as respx_mock + # doesn't support custom transports. + for item in items: + if "async_client" not in item.fixturenames or "respx_mock" not in item.fixturenames: + continue + + if not hasattr(item, "callspec"): + continue + + async_client_param = item.callspec.params.get("async_client") + if is_dict(async_client_param) and async_client_param.get("http_client") == "aiohttp": + item.add_marker(pytest.mark.skip(reason="aiohttp client is not compatible with respx_mock")) + + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + +api_key = "My API Key" + + +@pytest.fixture(scope="session") +def client(request: FixtureRequest) -> Iterator[OzAPI]: + strict = getattr(request, "param", True) + if not isinstance(strict, bool): + raise TypeError(f"Unexpected fixture parameter type {type(strict)}, expected {bool}") + + with OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=strict) as client: + yield client + + +@pytest.fixture(scope="session") +async def async_client(request: FixtureRequest) -> AsyncIterator[AsyncOzAPI]: + param = getattr(request, "param", True) + + # defaults + strict = True + http_client: None | httpx.AsyncClient = None + + if isinstance(param, bool): + strict = param + elif is_dict(param): + strict = param.get("strict", True) + assert isinstance(strict, bool) + + http_client_type = param.get("http_client", "httpx") + if http_client_type == "aiohttp": + http_client = DefaultAioHttpClient() + else: + raise TypeError(f"Unexpected fixture parameter type {type(param)}, expected bool or dict") + + async with AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=strict, http_client=http_client + ) as client: + yield client diff --git a/tests/sample_file.txt b/tests/sample_file.txt new file mode 100644 index 0000000..af5626b --- /dev/null +++ b/tests/sample_file.txt @@ -0,0 +1 @@ +Hello, world! diff --git a/tests/test_client.py b/tests/test_client.py new file mode 100644 index 0000000..988622f --- /dev/null +++ b/tests/test_client.py @@ -0,0 +1,1954 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import gc +import os +import sys +import json +import asyncio +import inspect +import dataclasses +import tracemalloc +from typing import Any, Union, TypeVar, Callable, Iterable, Iterator, Optional, Coroutine, cast +from unittest import mock +from typing_extensions import Literal, AsyncIterator, override + +import httpx +import pytest +from respx import MockRouter +from pydantic import ValidationError + +from oz_agent_sdk import OzAPI, AsyncOzAPI, APIResponseValidationError +from oz_agent_sdk._types import Omit +from oz_agent_sdk._utils import asyncify +from oz_agent_sdk._models import BaseModel, FinalRequestOptions +from oz_agent_sdk._exceptions import OzAPIError, APIStatusError, APITimeoutError, APIResponseValidationError +from oz_agent_sdk._base_client import ( + DEFAULT_TIMEOUT, + HTTPX_DEFAULT_TIMEOUT, + BaseClient, + OtherPlatform, + DefaultHttpxClient, + DefaultAsyncHttpxClient, + get_platform, + make_request_options, +) + +from .utils import update_env + +T = TypeVar("T") +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") +api_key = "My API Key" + + +def _get_params(client: BaseClient[Any, Any]) -> dict[str, str]: + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + return dict(url.params) + + +def _low_retry_timeout(*_args: Any, **_kwargs: Any) -> float: + return 0.1 + + +def mirror_request_content(request: httpx.Request) -> httpx.Response: + return httpx.Response(200, content=request.content) + + +# note: we can't use the httpx.MockTransport class as it consumes the request +# body itself, which means we can't test that the body is read lazily +class MockTransport(httpx.BaseTransport, httpx.AsyncBaseTransport): + def __init__( + self, + handler: Callable[[httpx.Request], httpx.Response] + | Callable[[httpx.Request], Coroutine[Any, Any, httpx.Response]], + ) -> None: + self.handler = handler + + @override + def handle_request( + self, + request: httpx.Request, + ) -> httpx.Response: + assert not inspect.iscoroutinefunction(self.handler), "handler must not be a coroutine function" + assert inspect.isfunction(self.handler), "handler must be a function" + return self.handler(request) + + @override + async def handle_async_request( + self, + request: httpx.Request, + ) -> httpx.Response: + assert inspect.iscoroutinefunction(self.handler), "handler must be a coroutine function" + return await self.handler(request) + + +@dataclasses.dataclass +class Counter: + value: int = 0 + + +def _make_sync_iterator(iterable: Iterable[T], counter: Optional[Counter] = None) -> Iterator[T]: + for item in iterable: + if counter: + counter.value += 1 + yield item + + +async def _make_async_iterator(iterable: Iterable[T], counter: Optional[Counter] = None) -> AsyncIterator[T]: + for item in iterable: + if counter: + counter.value += 1 + yield item + + +def _get_open_connections(client: OzAPI | AsyncOzAPI) -> int: + transport = client._client._transport + assert isinstance(transport, httpx.HTTPTransport) or isinstance(transport, httpx.AsyncHTTPTransport) + + pool = transport._pool + return len(pool._requests) + + +class TestOzAPI: + @pytest.mark.respx(base_url=base_url) + def test_raw_response(self, respx_mock: MockRouter, client: OzAPI) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + def test_raw_response_for_binary(self, respx_mock: MockRouter, client: OzAPI) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self, client: OzAPI) -> None: + copied = client.copy() + assert id(copied) != id(client) + + copied = client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert client.api_key == "My API Key" + + def test_copy_default_options(self, client: OzAPI) -> None: + # options that have a default are overridden correctly + copied = client.copy(max_retries=7) + assert copied.max_retries == 7 + assert client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(client.timeout, httpx.Timeout) + copied = client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(client.timeout, httpx.Timeout) + + def test_copy_default_headers(self) -> None: + client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + client.close() + + def test_copy_default_query(self) -> None: + client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + client.close() + + def test_copy_signature(self, client: OzAPI) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self, client: OzAPI) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client_copy = client.copy() + client_copy._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "oz_agent_sdk/_legacy_response.py", + "oz_agent_sdk/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "oz_agent_sdk/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + def test_request_timeout(self, client: OzAPI) -> None: + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = client._build_request(FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0))) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + def test_client_timeout_option(self) -> None: + client = OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0)) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + client.close() + + def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + with httpx.Client(timeout=None) as http_client: + client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + client.close() + + # no timeout given to the httpx client should not use the httpx default + with httpx.Client() as http_client: + client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + client.close() + + # explicitly passing the default timeout currently results in it being ignored + with httpx.Client(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + client.close() + + async def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + async with httpx.AsyncClient() as http_client: + OzAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + def test_default_headers_option(self) -> None: + test_client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = test_client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + test_client2 = OzAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = test_client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + test_client.close() + test_client2.close() + + def test_validate_headers(self) -> None: + client = OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("Authorization") == f"Bearer {api_key}" + + with pytest.raises(OzAPIError): + with update_env(**{"WARP_API_KEY": Omit()}): + client2 = OzAPI(base_url=base_url, api_key=None, _strict_response_validation=True) + _ = client2 + + def test_default_query_option(self) -> None: + client = OzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + client.close() + + def test_hardcoded_query_params_in_url(self, client: OzAPI) -> None: + request = client._build_request(FinalRequestOptions(method="get", url="/foo?beta=true")) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo?beta=true", + params={"limit": "10", "page": "abc"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true", "limit": "10", "page": "abc"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/files/a%2Fb?beta=true", + params={"limit": "10"}, + ) + ) + assert request.url.raw_path == b"/files/a%2Fb?beta=true&limit=10" + + def test_request_extra_json(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions.construct( + method="post", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + def test_binary_content_upload(self, respx_mock: MockRouter, client: OzAPI) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + response = client.post( + "/upload", + content=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + def test_binary_content_upload_with_iterator(self) -> None: + file_content = b"Hello, this is a test file." + counter = Counter() + iterator = _make_sync_iterator([file_content], counter=counter) + + def mock_handler(request: httpx.Request) -> httpx.Response: + assert counter.value == 0, "the request body should not have been read" + return httpx.Response(200, content=request.read()) + + with OzAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(transport=MockTransport(handler=mock_handler)), + ) as client: + response = client.post( + "/upload", + content=iterator, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + assert counter.value == 1 + + @pytest.mark.respx(base_url=base_url) + def test_binary_content_upload_with_body_is_deprecated(self, respx_mock: MockRouter, client: OzAPI) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + with pytest.deprecated_call( + match="Passing raw bytes as `body` is deprecated and will be removed in a future version. Please pass raw bytes via the `content` parameter instead." + ): + response = client.post( + "/upload", + body=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + @pytest.mark.respx(base_url=base_url) + def test_basic_union_response(self, respx_mock: MockRouter, client: OzAPI) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + def test_union_response_different_types(self, respx_mock: MockRouter, client: OzAPI) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + def test_non_application_json_content_type_for_json_data(self, respx_mock: MockRouter, client: OzAPI) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + def test_base_url_setter(self) -> None: + client = OzAPI(base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + client.close() + + def test_base_url_env(self) -> None: + with update_env(OZ_API_BASE_URL="http://localhost:5000/from/env"): + client = OzAPI(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + OzAPI(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + OzAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_trailing_slash(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + client.close() + + @pytest.mark.parametrize( + "client", + [ + OzAPI(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + OzAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_no_trailing_slash(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + client.close() + + @pytest.mark.parametrize( + "client", + [ + OzAPI(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + OzAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_absolute_request_url(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + client.close() + + def test_copied_client_does_not_close_http(self) -> None: + test_client = OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not test_client.is_closed() + + copied = test_client.copy() + assert copied is not test_client + + del copied + + assert not test_client.is_closed() + + def test_client_context_manager(self) -> None: + test_client = OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + with test_client as c2: + assert c2 is test_client + assert not c2.is_closed() + assert not test_client.is_closed() + assert test_client.is_closed() + + @pytest.mark.respx(base_url=base_url) + def test_client_response_validation_error(self, respx_mock: MockRouter, client: OzAPI) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None)) + + @pytest.mark.respx(base_url=base_url) + def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + strict_client.get("/foo", cast_to=Model) + + non_strict_client = OzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = non_strict_client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + strict_client.close() + non_strict_client.close() + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + def test_parse_retry_after_header( + self, remaining_retries: int, retry_after: str, timeout: float, client: OzAPI + ) -> None: + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_timeout_errors_doesnt_leak(self, respx_mock: MockRouter, client: OzAPI) -> None: + respx_mock.post("/agent/runs").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + client.agent.with_streaming_response.run().__enter__() + + assert _get_open_connections(client) == 0 + + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_status_errors_doesnt_leak(self, respx_mock: MockRouter, client: OzAPI) -> None: + respx_mock.post("/agent/runs").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + client.agent.with_streaming_response.run().__enter__() + assert _get_open_connections(client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + def test_retries_taken( + self, + client: OzAPI, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/agent/runs").mock(side_effect=retry_handler) + + response = client.agent.with_raw_response.run() + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_omit_retry_count_header(self, client: OzAPI, failures_before_success: int, respx_mock: MockRouter) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/agent/runs").mock(side_effect=retry_handler) + + response = client.agent.with_raw_response.run(extra_headers={"x-stainless-retry-count": Omit()}) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_overwrite_retry_count_header( + self, client: OzAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/agent/runs").mock(side_effect=retry_handler) + + response = client.agent.with_raw_response.run(extra_headers={"x-stainless-retry-count": "42"}) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + # Delete in case our environment has any proxy env vars set + monkeypatch.delenv("HTTP_PROXY", raising=False) + monkeypatch.delenv("ALL_PROXY", raising=False) + monkeypatch.delenv("NO_PROXY", raising=False) + monkeypatch.delenv("http_proxy", raising=False) + monkeypatch.delenv("https_proxy", raising=False) + monkeypatch.delenv("all_proxy", raising=False) + monkeypatch.delenv("no_proxy", raising=False) + + client = DefaultHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects(self, respx_mock: MockRouter, client: OzAPI) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects_disabled(self, respx_mock: MockRouter, client: OzAPI) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + client.post("/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" + + +class TestAsyncOzAPI: + @pytest.mark.respx(base_url=base_url) + async def test_raw_response(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await async_client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + async def test_raw_response_for_binary(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = await async_client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self, async_client: AsyncOzAPI) -> None: + copied = async_client.copy() + assert id(copied) != id(async_client) + + copied = async_client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert async_client.api_key == "My API Key" + + def test_copy_default_options(self, async_client: AsyncOzAPI) -> None: + # options that have a default are overridden correctly + copied = async_client.copy(max_retries=7) + assert copied.max_retries == 7 + assert async_client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(async_client.timeout, httpx.Timeout) + copied = async_client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(async_client.timeout, httpx.Timeout) + + async def test_copy_default_headers(self) -> None: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + await client.close() + + async def test_copy_default_query(self) -> None: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + await client.close() + + def test_copy_signature(self, async_client: AsyncOzAPI) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + async_client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(async_client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self, async_client: AsyncOzAPI) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client_copy = async_client.copy() + client_copy._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "oz_agent_sdk/_legacy_response.py", + "oz_agent_sdk/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "oz_agent_sdk/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + async def test_request_timeout(self, async_client: AsyncOzAPI) -> None: + request = async_client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = async_client._build_request( + FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0)) + ) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + async def test_client_timeout_option(self) -> None: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0) + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + await client.close() + + async def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + async with httpx.AsyncClient(timeout=None) as http_client: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + await client.close() + + # no timeout given to the httpx client should not use the httpx default + async with httpx.AsyncClient() as http_client: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + await client.close() + + # explicitly passing the default timeout currently results in it being ignored + async with httpx.AsyncClient(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + await client.close() + + def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + with httpx.Client() as http_client: + AsyncOzAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + async def test_default_headers_option(self) -> None: + test_client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = test_client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + test_client2 = AsyncOzAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = test_client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + await test_client.close() + await test_client2.close() + + def test_validate_headers(self) -> None: + client = AsyncOzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("Authorization") == f"Bearer {api_key}" + + with pytest.raises(OzAPIError): + with update_env(**{"WARP_API_KEY": Omit()}): + client2 = AsyncOzAPI(base_url=base_url, api_key=None, _strict_response_validation=True) + _ = client2 + + async def test_default_query_option(self) -> None: + client = AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + await client.close() + + async def test_hardcoded_query_params_in_url(self, async_client: AsyncOzAPI) -> None: + request = async_client._build_request(FinalRequestOptions(method="get", url="/foo?beta=true")) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true"} + + request = async_client._build_request( + FinalRequestOptions( + method="get", + url="/foo?beta=true", + params={"limit": "10", "page": "abc"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true", "limit": "10", "page": "abc"} + + request = async_client._build_request( + FinalRequestOptions( + method="get", + url="/files/a%2Fb?beta=true", + params={"limit": "10"}, + ) + ) + assert request.url.raw_path == b"/files/a%2Fb?beta=true&limit=10" + + def test_request_extra_json(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self, client: OzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, async_client: AsyncOzAPI) -> None: + request = async_client._build_request( + FinalRequestOptions.construct( + method="post", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + async def test_binary_content_upload(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + response = await async_client.post( + "/upload", + content=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + async def test_binary_content_upload_with_asynciterator(self) -> None: + file_content = b"Hello, this is a test file." + counter = Counter() + iterator = _make_async_iterator([file_content], counter=counter) + + async def mock_handler(request: httpx.Request) -> httpx.Response: + assert counter.value == 0, "the request body should not have been read" + return httpx.Response(200, content=await request.aread()) + + async with AsyncOzAPI( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(transport=MockTransport(handler=mock_handler)), + ) as client: + response = await client.post( + "/upload", + content=iterator, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + assert counter.value == 1 + + @pytest.mark.respx(base_url=base_url) + async def test_binary_content_upload_with_body_is_deprecated( + self, respx_mock: MockRouter, async_client: AsyncOzAPI + ) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + with pytest.deprecated_call( + match="Passing raw bytes as `body` is deprecated and will be removed in a future version. Please pass raw bytes via the `content` parameter instead." + ): + response = await async_client.post( + "/upload", + body=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + @pytest.mark.respx(base_url=base_url) + async def test_basic_union_response(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await async_client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + async def test_union_response_different_types(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await async_client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = await async_client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + async def test_non_application_json_content_type_for_json_data( + self, respx_mock: MockRouter, async_client: AsyncOzAPI + ) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = await async_client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + async def test_base_url_setter(self) -> None: + client = AsyncOzAPI(base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + await client.close() + + async def test_base_url_env(self) -> None: + with update_env(OZ_API_BASE_URL="http://localhost:5000/from/env"): + client = AsyncOzAPI(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + AsyncOzAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncOzAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + async def test_base_url_trailing_slash(self, client: AsyncOzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + await client.close() + + @pytest.mark.parametrize( + "client", + [ + AsyncOzAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncOzAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + async def test_base_url_no_trailing_slash(self, client: AsyncOzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + await client.close() + + @pytest.mark.parametrize( + "client", + [ + AsyncOzAPI( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncOzAPI( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + async def test_absolute_request_url(self, client: AsyncOzAPI) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + await client.close() + + async def test_copied_client_does_not_close_http(self) -> None: + test_client = AsyncOzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not test_client.is_closed() + + copied = test_client.copy() + assert copied is not test_client + + del copied + + await asyncio.sleep(0.2) + assert not test_client.is_closed() + + async def test_client_context_manager(self) -> None: + test_client = AsyncOzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + async with test_client as c2: + assert c2 is test_client + assert not c2.is_closed() + assert not test_client.is_closed() + assert test_client.is_closed() + + @pytest.mark.respx(base_url=base_url) + async def test_client_response_validation_error(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + await async_client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + async def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + AsyncOzAPI( + base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None) + ) + + @pytest.mark.respx(base_url=base_url) + async def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = AsyncOzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + await strict_client.get("/foo", cast_to=Model) + + non_strict_client = AsyncOzAPI(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = await non_strict_client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + await strict_client.close() + await non_strict_client.close() + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + async def test_parse_retry_after_header( + self, remaining_retries: int, retry_after: str, timeout: float, async_client: AsyncOzAPI + ) -> None: + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = async_client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_timeout_errors_doesnt_leak(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + respx_mock.post("/agent/runs").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + await async_client.agent.with_streaming_response.run().__aenter__() + + assert _get_open_connections(async_client) == 0 + + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_status_errors_doesnt_leak(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + respx_mock.post("/agent/runs").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + await async_client.agent.with_streaming_response.run().__aenter__() + assert _get_open_connections(async_client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + async def test_retries_taken( + self, + async_client: AsyncOzAPI, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/agent/runs").mock(side_effect=retry_handler) + + response = await client.agent.with_raw_response.run() + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_omit_retry_count_header( + self, async_client: AsyncOzAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/agent/runs").mock(side_effect=retry_handler) + + response = await client.agent.with_raw_response.run(extra_headers={"x-stainless-retry-count": Omit()}) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("oz_agent_sdk._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_overwrite_retry_count_header( + self, async_client: AsyncOzAPI, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/agent/runs").mock(side_effect=retry_handler) + + response = await client.agent.with_raw_response.run(extra_headers={"x-stainless-retry-count": "42"}) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + async def test_get_platform(self) -> None: + platform = await asyncify(get_platform)() + assert isinstance(platform, (str, OtherPlatform)) + + async def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + # Delete in case our environment has any proxy env vars set + monkeypatch.delenv("HTTP_PROXY", raising=False) + monkeypatch.delenv("ALL_PROXY", raising=False) + monkeypatch.delenv("NO_PROXY", raising=False) + monkeypatch.delenv("http_proxy", raising=False) + monkeypatch.delenv("https_proxy", raising=False) + monkeypatch.delenv("all_proxy", raising=False) + monkeypatch.delenv("no_proxy", raising=False) + + client = DefaultAsyncHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + async def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultAsyncHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = await async_client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects_disabled(self, respx_mock: MockRouter, async_client: AsyncOzAPI) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + await async_client.post( + "/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response + ) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" diff --git a/tests/test_deepcopy.py b/tests/test_deepcopy.py new file mode 100644 index 0000000..009b9b9 --- /dev/null +++ b/tests/test_deepcopy.py @@ -0,0 +1,58 @@ +from oz_agent_sdk._utils import deepcopy_minimal + + +def assert_different_identities(obj1: object, obj2: object) -> None: + assert obj1 == obj2 + assert id(obj1) != id(obj2) + + +def test_simple_dict() -> None: + obj1 = {"foo": "bar"} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_dict() -> None: + obj1 = {"foo": {"bar": True}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + + +def test_complex_nested_dict() -> None: + obj1 = {"foo": {"bar": [{"hello": "world"}]}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + assert_different_identities(obj1["foo"]["bar"], obj2["foo"]["bar"]) + assert_different_identities(obj1["foo"]["bar"][0], obj2["foo"]["bar"][0]) + + +def test_simple_list() -> None: + obj1 = ["a", "b", "c"] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_list() -> None: + obj1 = ["a", [1, 2, 3]] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1[1], obj2[1]) + + +class MyObject: ... + + +def test_ignores_other_types() -> None: + # custom classes + my_obj = MyObject() + obj1 = {"foo": my_obj} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert obj1["foo"] is my_obj + + # tuples + obj3 = ("a", "b") + obj4 = deepcopy_minimal(obj3) + assert obj3 is obj4 diff --git a/tests/test_extract_files.py b/tests/test_extract_files.py new file mode 100644 index 0000000..95b71bd --- /dev/null +++ b/tests/test_extract_files.py @@ -0,0 +1,64 @@ +from __future__ import annotations + +from typing import Sequence + +import pytest + +from oz_agent_sdk._types import FileTypes +from oz_agent_sdk._utils import extract_files + + +def test_removes_files_from_input() -> None: + query = {"foo": "bar"} + assert extract_files(query, paths=[]) == [] + assert query == {"foo": "bar"} + + query2 = {"foo": b"Bar", "hello": "world"} + assert extract_files(query2, paths=[["foo"]]) == [("foo", b"Bar")] + assert query2 == {"hello": "world"} + + query3 = {"foo": {"foo": {"bar": b"Bar"}}, "hello": "world"} + assert extract_files(query3, paths=[["foo", "foo", "bar"]]) == [("foo[foo][bar]", b"Bar")] + assert query3 == {"foo": {"foo": {}}, "hello": "world"} + + query4 = {"foo": {"bar": b"Bar", "baz": "foo"}, "hello": "world"} + assert extract_files(query4, paths=[["foo", "bar"]]) == [("foo[bar]", b"Bar")] + assert query4 == {"hello": "world", "foo": {"baz": "foo"}} + + +def test_multiple_files() -> None: + query = {"documents": [{"file": b"My first file"}, {"file": b"My second file"}]} + assert extract_files(query, paths=[["documents", "", "file"]]) == [ + ("documents[][file]", b"My first file"), + ("documents[][file]", b"My second file"), + ] + assert query == {"documents": [{}, {}]} + + +@pytest.mark.parametrize( + "query,paths,expected", + [ + [ + {"foo": {"bar": "baz"}}, + [["foo", "", "bar"]], + [], + ], + [ + {"foo": ["bar", "baz"]}, + [["foo", "bar"]], + [], + ], + [ + {"foo": {"bar": "baz"}}, + [["foo", "foo"]], + [], + ], + ], + ids=["dict expecting array", "array expecting dict", "unknown keys"], +) +def test_ignores_incorrect_paths( + query: dict[str, object], + paths: Sequence[Sequence[str]], + expected: list[tuple[str, FileTypes]], +) -> None: + assert extract_files(query, paths=paths) == expected diff --git a/tests/test_files.py b/tests/test_files.py new file mode 100644 index 0000000..a1255cc --- /dev/null +++ b/tests/test_files.py @@ -0,0 +1,51 @@ +from pathlib import Path + +import anyio +import pytest +from dirty_equals import IsDict, IsList, IsBytes, IsTuple + +from oz_agent_sdk._files import to_httpx_files, async_to_httpx_files + +readme_path = Path(__file__).parent.parent.joinpath("README.md") + + +def test_pathlib_includes_file_name() -> None: + result = to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +def test_tuple_input() -> None: + result = to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +@pytest.mark.asyncio +async def test_async_pathlib_includes_file_name() -> None: + result = await async_to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_supports_anyio_path() -> None: + result = await async_to_httpx_files({"file": anyio.Path(readme_path)}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_tuple_input() -> None: + result = await async_to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +def test_string_not_allowed() -> None: + with pytest.raises(TypeError, match="Expected file types input to be a FileContent type or to be a tuple"): + to_httpx_files( + { + "file": "foo", # type: ignore + } + ) diff --git a/tests/test_models.py b/tests/test_models.py new file mode 100644 index 0000000..c0b225d --- /dev/null +++ b/tests/test_models.py @@ -0,0 +1,963 @@ +import json +from typing import TYPE_CHECKING, Any, Dict, List, Union, Optional, cast +from datetime import datetime, timezone +from typing_extensions import Literal, Annotated, TypeAliasType + +import pytest +import pydantic +from pydantic import Field + +from oz_agent_sdk._utils import PropertyInfo +from oz_agent_sdk._compat import PYDANTIC_V1, parse_obj, model_dump, model_json +from oz_agent_sdk._models import DISCRIMINATOR_CACHE, BaseModel, construct_type + + +class BasicModel(BaseModel): + foo: str + + +@pytest.mark.parametrize("value", ["hello", 1], ids=["correct type", "mismatched"]) +def test_basic(value: object) -> None: + m = BasicModel.construct(foo=value) + assert m.foo == value + + +def test_directly_nested_model() -> None: + class NestedModel(BaseModel): + nested: BasicModel + + m = NestedModel.construct(nested={"foo": "Foo!"}) + assert m.nested.foo == "Foo!" + + # mismatched types + m = NestedModel.construct(nested="hello!") + assert cast(Any, m.nested) == "hello!" + + +def test_optional_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[BasicModel] + + m1 = NestedModel.construct(nested=None) + assert m1.nested is None + + m2 = NestedModel.construct(nested={"foo": "bar"}) + assert m2.nested is not None + assert m2.nested.foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested={"foo"}) + assert isinstance(cast(Any, m3.nested), set) + assert cast(Any, m3.nested) == {"foo"} + + +def test_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[BasicModel] + + m = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0].foo == "bar" + assert m.nested[1].foo == "2" + + # mismatched types + m = NestedModel.construct(nested=True) + assert cast(Any, m.nested) is True + + m = NestedModel.construct(nested=[False]) + assert cast(Any, m.nested) == [False] + + +def test_optional_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[List[BasicModel]] + + m1 = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m1.nested is not None + assert isinstance(m1.nested, list) + assert len(m1.nested) == 2 + assert m1.nested[0].foo == "bar" + assert m1.nested[1].foo == "2" + + m2 = NestedModel.construct(nested=None) + assert m2.nested is None + + # mismatched types + m3 = NestedModel.construct(nested={1}) + assert cast(Any, m3.nested) == {1} + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_optional_items_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[Optional[BasicModel]] + + m = NestedModel.construct(nested=[None, {"foo": "bar"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0] is None + assert m.nested[1] is not None + assert m.nested[1].foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested="foo") + assert cast(Any, m3.nested) == "foo" + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_mismatched_type() -> None: + class NestedModel(BaseModel): + nested: List[str] + + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_raw_dictionary() -> None: + class NestedModel(BaseModel): + nested: Dict[str, str] + + m = NestedModel.construct(nested={"hello": "world"}) + assert m.nested == {"hello": "world"} + + # mismatched types + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_nested_dictionary_model() -> None: + class NestedModel(BaseModel): + nested: Dict[str, BasicModel] + + m = NestedModel.construct(nested={"hello": {"foo": "bar"}}) + assert isinstance(m.nested, dict) + assert m.nested["hello"].foo == "bar" + + # mismatched types + m = NestedModel.construct(nested={"hello": False}) + assert cast(Any, m.nested["hello"]) is False + + +def test_unknown_fields() -> None: + m1 = BasicModel.construct(foo="foo", unknown=1) + assert m1.foo == "foo" + assert cast(Any, m1).unknown == 1 + + m2 = BasicModel.construct(foo="foo", unknown={"foo_bar": True}) + assert m2.foo == "foo" + assert cast(Any, m2).unknown == {"foo_bar": True} + + assert model_dump(m2) == {"foo": "foo", "unknown": {"foo_bar": True}} + + +def test_strict_validation_unknown_fields() -> None: + class Model(BaseModel): + foo: str + + model = parse_obj(Model, dict(foo="hello!", user="Robert")) + assert model.foo == "hello!" + assert cast(Any, model).user == "Robert" + + assert model_dump(model) == {"foo": "hello!", "user": "Robert"} + + +def test_aliases() -> None: + class Model(BaseModel): + my_field: int = Field(alias="myField") + + m = Model.construct(myField=1) + assert m.my_field == 1 + + # mismatched types + m = Model.construct(myField={"hello": False}) + assert cast(Any, m.my_field) == {"hello": False} + + +def test_repr() -> None: + model = BasicModel(foo="bar") + assert str(model) == "BasicModel(foo='bar')" + assert repr(model) == "BasicModel(foo='bar')" + + +def test_repr_nested_model() -> None: + class Child(BaseModel): + name: str + age: int + + class Parent(BaseModel): + name: str + child: Child + + model = Parent(name="Robert", child=Child(name="Foo", age=5)) + assert str(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + assert repr(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + + +def test_optional_list() -> None: + class Submodel(BaseModel): + name: str + + class Model(BaseModel): + items: Optional[List[Submodel]] + + m = Model.construct(items=None) + assert m.items is None + + m = Model.construct(items=[]) + assert m.items == [] + + m = Model.construct(items=[{"name": "Robert"}]) + assert m.items is not None + assert len(m.items) == 1 + assert m.items[0].name == "Robert" + + +def test_nested_union_of_models() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + +def test_nested_union_of_mixed_types() -> None: + class Submodel1(BaseModel): + bar: bool + + class Model(BaseModel): + foo: Union[Submodel1, Literal[True], Literal["CARD_HOLDER"]] + + m = Model.construct(foo=True) + assert m.foo is True + + m = Model.construct(foo="CARD_HOLDER") + assert m.foo == "CARD_HOLDER" + + m = Model.construct(foo={"bar": False}) + assert isinstance(m.foo, Submodel1) + assert m.foo.bar is False + + +def test_nested_union_multiple_variants() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Submodel3(BaseModel): + foo: int + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2, None, Submodel3] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + m = Model.construct(foo=None) + assert m.foo is None + + m = Model.construct() + assert m.foo is None + + m = Model.construct(foo={"foo": "1"}) + assert isinstance(m.foo, Submodel3) + assert m.foo.foo == 1 + + +def test_nested_union_invalid_data() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo=True) + assert cast(bool, m.foo) is True + + m = Model.construct(foo={"name": 3}) + if PYDANTIC_V1: + assert isinstance(m.foo, Submodel2) + assert m.foo.name == "3" + else: + assert isinstance(m.foo, Submodel1) + assert m.foo.name == 3 # type: ignore + + +def test_list_of_unions() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + items: List[Union[Submodel1, Submodel2]] + + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], Submodel2) + assert m.items[1].name == "Robert" + + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_union_of_lists() -> None: + class SubModel1(BaseModel): + level: int + + class SubModel2(BaseModel): + name: str + + class Model(BaseModel): + items: Union[List[SubModel1], List[SubModel2]] + + # with one valid entry + m = Model.construct(items=[{"name": "Robert"}]) + assert len(m.items) == 1 + assert isinstance(m.items[0], SubModel2) + assert m.items[0].name == "Robert" + + # with two entries pointing to different types + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], SubModel1) + assert cast(Any, m.items[1]).name == "Robert" + + # with two entries pointing to *completely* different types + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_dict_of_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Dict[str, Union[SubModel1, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel2) + assert m.data["foo"].foo == "bar" + + # TODO: test mismatched type + + +def test_double_nested_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + bar: str + + class Model(BaseModel): + data: Dict[str, List[Union[SubModel1, SubModel2]]] + + m = Model.construct(data={"foo": [{"bar": "baz"}, {"name": "Robert"}]}) + assert len(m.data["foo"]) == 2 + + entry1 = m.data["foo"][0] + assert isinstance(entry1, SubModel2) + assert entry1.bar == "baz" + + entry2 = m.data["foo"][1] + assert isinstance(entry2, SubModel1) + assert entry2.name == "Robert" + + # TODO: test mismatched type + + +def test_union_of_dict() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Union[Dict[str, SubModel1], Dict[str, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel1) + assert cast(Any, m.data["foo"]).foo == "bar" + + +def test_iso8601_datetime() -> None: + class Model(BaseModel): + created_at: datetime + + expected = datetime(2019, 12, 27, 18, 11, 19, 117000, tzinfo=timezone.utc) + + if PYDANTIC_V1: + expected_json = '{"created_at": "2019-12-27T18:11:19.117000+00:00"}' + else: + expected_json = '{"created_at":"2019-12-27T18:11:19.117000Z"}' + + model = Model.construct(created_at="2019-12-27T18:11:19.117Z") + assert model.created_at == expected + assert model_json(model) == expected_json + + model = parse_obj(Model, dict(created_at="2019-12-27T18:11:19.117Z")) + assert model.created_at == expected + assert model_json(model) == expected_json + + +def test_does_not_coerce_int() -> None: + class Model(BaseModel): + bar: int + + assert Model.construct(bar=1).bar == 1 + assert Model.construct(bar=10.9).bar == 10.9 + assert Model.construct(bar="19").bar == "19" # type: ignore[comparison-overlap] + assert Model.construct(bar=False).bar is False + + +def test_int_to_float_safe_conversion() -> None: + class Model(BaseModel): + float_field: float + + m = Model.construct(float_field=10) + assert m.float_field == 10.0 + assert isinstance(m.float_field, float) + + m = Model.construct(float_field=10.12) + assert m.float_field == 10.12 + assert isinstance(m.float_field, float) + + # number too big + m = Model.construct(float_field=2**53 + 1) + assert m.float_field == 2**53 + 1 + assert isinstance(m.float_field, int) + + +def test_deprecated_alias() -> None: + class Model(BaseModel): + resource_id: str = Field(alias="model_id") + + @property + def model_id(self) -> str: + return self.resource_id + + m = Model.construct(model_id="id") + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + m = parse_obj(Model, {"model_id": "id"}) + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + +def test_omitted_fields() -> None: + class Model(BaseModel): + resource_id: Optional[str] = None + + m = Model.construct() + assert m.resource_id is None + assert "resource_id" not in m.model_fields_set + + m = Model.construct(resource_id=None) + assert m.resource_id is None + assert "resource_id" in m.model_fields_set + + m = Model.construct(resource_id="foo") + assert m.resource_id == "foo" + assert "resource_id" in m.model_fields_set + + +def test_to_dict() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.to_dict() == {"FOO": "hello"} + assert m.to_dict(use_api_names=False) == {"foo": "hello"} + + m2 = Model() + assert m2.to_dict() == {} + assert m2.to_dict(exclude_unset=False) == {"FOO": None} + assert m2.to_dict(exclude_unset=False, exclude_none=True) == {} + assert m2.to_dict(exclude_unset=False, exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.to_dict() == {"FOO": None} + assert m3.to_dict(exclude_none=True) == {} + assert m3.to_dict(exclude_defaults=True) == {} + + class Model2(BaseModel): + created_at: datetime + + time_str = "2024-03-21T11:39:01.275859" + m4 = Model2.construct(created_at=time_str) + assert m4.to_dict(mode="python") == {"created_at": datetime.fromisoformat(time_str)} + assert m4.to_dict(mode="json") == {"created_at": time_str} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_dict(warnings=False) + + +def test_forwards_compat_model_dump_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.model_dump() == {"foo": "hello"} + assert m.model_dump(include={"bar"}) == {} + assert m.model_dump(exclude={"foo"}) == {} + assert m.model_dump(by_alias=True) == {"FOO": "hello"} + + m2 = Model() + assert m2.model_dump() == {"foo": None} + assert m2.model_dump(exclude_unset=True) == {} + assert m2.model_dump(exclude_none=True) == {} + assert m2.model_dump(exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.model_dump() == {"foo": None} + assert m3.model_dump(exclude_none=True) == {} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump(warnings=False) + + +def test_compat_method_no_error_for_warnings() -> None: + class Model(BaseModel): + foo: Optional[str] + + m = Model(foo="hello") + assert isinstance(model_dump(m, warnings=False), dict) + + +def test_to_json() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.to_json()) == {"FOO": "hello"} + assert json.loads(m.to_json(use_api_names=False)) == {"foo": "hello"} + + if PYDANTIC_V1: + assert m.to_json(indent=None) == '{"FOO": "hello"}' + else: + assert m.to_json(indent=None) == '{"FOO":"hello"}' + + m2 = Model() + assert json.loads(m2.to_json()) == {} + assert json.loads(m2.to_json(exclude_unset=False)) == {"FOO": None} + assert json.loads(m2.to_json(exclude_unset=False, exclude_none=True)) == {} + assert json.loads(m2.to_json(exclude_unset=False, exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.to_json()) == {"FOO": None} + assert json.loads(m3.to_json(exclude_none=True)) == {} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_json(warnings=False) + + +def test_forwards_compat_model_dump_json_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.model_dump_json()) == {"foo": "hello"} + assert json.loads(m.model_dump_json(include={"bar"})) == {} + assert json.loads(m.model_dump_json(include={"foo"})) == {"foo": "hello"} + assert json.loads(m.model_dump_json(by_alias=True)) == {"FOO": "hello"} + + assert m.model_dump_json(indent=2) == '{\n "foo": "hello"\n}' + + m2 = Model() + assert json.loads(m2.model_dump_json()) == {"foo": None} + assert json.loads(m2.model_dump_json(exclude_unset=True)) == {} + assert json.loads(m2.model_dump_json(exclude_none=True)) == {} + assert json.loads(m2.model_dump_json(exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.model_dump_json()) == {"foo": None} + assert json.loads(m3.model_dump_json(exclude_none=True)) == {} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump_json(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump_json(warnings=False) + + +def test_type_compat() -> None: + # our model type can be assigned to Pydantic's model type + + def takes_pydantic(model: pydantic.BaseModel) -> None: # noqa: ARG001 + ... + + class OurModel(BaseModel): + foo: Optional[str] = None + + takes_pydantic(OurModel()) + + +def test_annotated_types() -> None: + class Model(BaseModel): + value: str + + m = construct_type( + value={"value": "foo"}, + type_=cast(Any, Annotated[Model, "random metadata"]), + ) + assert isinstance(m, Model) + assert m.value == "foo" + + +def test_discriminated_unions_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, A) + assert m.type == "a" + if PYDANTIC_V1: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + else: + assert m.data == 100 # type: ignore[comparison-overlap] + + +def test_discriminated_unions_unknown_variant() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "c", "data": None, "new_thing": "bar"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + + # just chooses the first variant + assert isinstance(m, A) + assert m.type == "c" # type: ignore[comparison-overlap] + assert m.data == None # type: ignore[unreachable] + assert m.new_thing == "bar" + + +def test_discriminated_unions_invalid_data_nested_unions() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + class C(BaseModel): + type: Literal["c"] + + data: bool + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "c", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, C) + assert m.type == "c" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_with_aliases_invalid_data() -> None: + class A(BaseModel): + foo_type: Literal["a"] = Field(alias="type") + + data: str + + class B(BaseModel): + foo_type: Literal["b"] = Field(alias="type") + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, B) + assert m.foo_type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, A) + assert m.foo_type == "a" + if PYDANTIC_V1: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + else: + assert m.data == 100 # type: ignore[comparison-overlap] + + +def test_discriminated_unions_overlapping_discriminators_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["a"] + + data: int + + m = construct_type( + value={"type": "a", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "a" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_invalid_data_uses_cache() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + UnionType = cast(Any, Union[A, B]) + + assert not DISCRIMINATOR_CACHE.get(UnionType) + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + discriminator = DISCRIMINATOR_CACHE.get(UnionType) + assert discriminator is not None + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + # if the discriminator details object stays the same between invocations then + # we hit the cache + assert DISCRIMINATOR_CACHE.get(UnionType) is discriminator + + +@pytest.mark.skipif(PYDANTIC_V1, reason="TypeAliasType is not supported in Pydantic v1") +def test_type_alias_type() -> None: + Alias = TypeAliasType("Alias", str) # pyright: ignore + + class Model(BaseModel): + alias: Alias + union: Union[int, Alias] + + m = construct_type(value={"alias": "foo", "union": "bar"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.alias, str) + assert m.alias == "foo" + assert isinstance(m.union, str) + assert m.union == "bar" + + +@pytest.mark.skipif(PYDANTIC_V1, reason="TypeAliasType is not supported in Pydantic v1") +def test_field_named_cls() -> None: + class Model(BaseModel): + cls: str + + m = construct_type(value={"cls": "foo"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.cls, str) + + +def test_discriminated_union_case() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["b"] + + data: List[Union[A, object]] + + class ModelA(BaseModel): + type: Literal["modelA"] + + data: int + + class ModelB(BaseModel): + type: Literal["modelB"] + + required: str + + data: Union[A, B] + + # when constructing ModelA | ModelB, value data doesn't match ModelB exactly - missing `required` + m = construct_type( + value={"type": "modelB", "data": {"type": "a", "data": True}}, + type_=cast(Any, Annotated[Union[ModelA, ModelB], PropertyInfo(discriminator="type")]), + ) + + assert isinstance(m, ModelB) + + +def test_nested_discriminated_union() -> None: + class InnerType1(BaseModel): + type: Literal["type_1"] + + class InnerModel(BaseModel): + inner_value: str + + class InnerType2(BaseModel): + type: Literal["type_2"] + some_inner_model: InnerModel + + class Type1(BaseModel): + base_type: Literal["base_type_1"] + value: Annotated[ + Union[ + InnerType1, + InnerType2, + ], + PropertyInfo(discriminator="type"), + ] + + class Type2(BaseModel): + base_type: Literal["base_type_2"] + + T = Annotated[ + Union[ + Type1, + Type2, + ], + PropertyInfo(discriminator="base_type"), + ] + + model = construct_type( + type_=T, + value={ + "base_type": "base_type_1", + "value": { + "type": "type_2", + }, + }, + ) + assert isinstance(model, Type1) + assert isinstance(model.value, InnerType2) + + +@pytest.mark.skipif(PYDANTIC_V1, reason="this is only supported in pydantic v2 for now") +def test_extra_properties() -> None: + class Item(BaseModel): + prop: int + + class Model(BaseModel): + __pydantic_extra__: Dict[str, Item] = Field(init=False) # pyright: ignore[reportIncompatibleVariableOverride] + + other: str + + if TYPE_CHECKING: + + def __getattr__(self, attr: str) -> Item: ... + + model = construct_type( + type_=Model, + value={ + "a": {"prop": 1}, + "other": "foo", + }, + ) + assert isinstance(model, Model) + assert model.a.prop == 1 + assert isinstance(model.a, Item) + assert model.other == "foo" diff --git a/tests/test_qs.py b/tests/test_qs.py new file mode 100644 index 0000000..23508d8 --- /dev/null +++ b/tests/test_qs.py @@ -0,0 +1,78 @@ +from typing import Any, cast +from functools import partial +from urllib.parse import unquote + +import pytest + +from oz_agent_sdk._qs import Querystring, stringify + + +def test_empty() -> None: + assert stringify({}) == "" + assert stringify({"a": {}}) == "" + assert stringify({"a": {"b": {"c": {}}}}) == "" + + +def test_basic() -> None: + assert stringify({"a": 1}) == "a=1" + assert stringify({"a": "b"}) == "a=b" + assert stringify({"a": True}) == "a=true" + assert stringify({"a": False}) == "a=false" + assert stringify({"a": 1.23456}) == "a=1.23456" + assert stringify({"a": None}) == "" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_nested_dotted(method: str) -> None: + if method == "class": + serialise = Querystring(nested_format="dots").stringify + else: + serialise = partial(stringify, nested_format="dots") + + assert unquote(serialise({"a": {"b": "c"}})) == "a.b=c" + assert unquote(serialise({"a": {"b": "c", "d": "e", "f": "g"}})) == "a.b=c&a.d=e&a.f=g" + assert unquote(serialise({"a": {"b": {"c": {"d": "e"}}}})) == "a.b.c.d=e" + assert unquote(serialise({"a": {"b": True}})) == "a.b=true" + + +def test_nested_brackets() -> None: + assert unquote(stringify({"a": {"b": "c"}})) == "a[b]=c" + assert unquote(stringify({"a": {"b": "c", "d": "e", "f": "g"}})) == "a[b]=c&a[d]=e&a[f]=g" + assert unquote(stringify({"a": {"b": {"c": {"d": "e"}}}})) == "a[b][c][d]=e" + assert unquote(stringify({"a": {"b": True}})) == "a[b]=true" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_comma(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="comma").stringify + else: + serialise = partial(stringify, array_format="comma") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in=foo,bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b]=true,false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b]=true,false,true" + + +def test_array_repeat() -> None: + assert unquote(stringify({"in": ["foo", "bar"]})) == "in=foo&in=bar" + assert unquote(stringify({"a": {"b": [True, False]}})) == "a[b]=true&a[b]=false" + assert unquote(stringify({"a": {"b": [True, False, None, True]}})) == "a[b]=true&a[b]=false&a[b]=true" + assert unquote(stringify({"in": ["foo", {"b": {"c": ["d", "e"]}}]})) == "in=foo&in[b][c]=d&in[b][c]=e" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_brackets(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="brackets").stringify + else: + serialise = partial(stringify, array_format="brackets") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in[]=foo&in[]=bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b][]=true&a[b][]=false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b][]=true&a[b][]=false&a[b][]=true" + + +def test_unknown_array_format() -> None: + with pytest.raises(NotImplementedError, match="Unknown array_format value: foo, choose from comma, repeat"): + stringify({"a": ["foo", "bar"]}, array_format=cast(Any, "foo")) diff --git a/tests/test_required_args.py b/tests/test_required_args.py new file mode 100644 index 0000000..78ff0bf --- /dev/null +++ b/tests/test_required_args.py @@ -0,0 +1,111 @@ +from __future__ import annotations + +import pytest + +from oz_agent_sdk._utils import required_args + + +def test_too_many_positional_params() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + with pytest.raises(TypeError, match=r"foo\(\) takes 1 argument\(s\) but 2 were given"): + foo("a", "b") # type: ignore + + +def test_positional_param() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + assert foo("a") == "a" + assert foo(None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_keyword_only_param() -> None: + @required_args(["a"]) + def foo(*, a: str | None = None) -> str | None: + return a + + assert foo(a="a") == "a" + assert foo(a=None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_multiple_params() -> None: + @required_args(["a", "b", "c"]) + def foo(a: str = "", *, b: str = "", c: str = "") -> str | None: + return f"{a} {b} {c}" + + assert foo(a="a", b="b", c="c") == "a b c" + + error_message = r"Missing required arguments.*" + + with pytest.raises(TypeError, match=error_message): + foo() + + with pytest.raises(TypeError, match=error_message): + foo(a="a") + + with pytest.raises(TypeError, match=error_message): + foo(b="b") + + with pytest.raises(TypeError, match=error_message): + foo(c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'a'"): + foo(b="a", c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'b'"): + foo("a", c="c") + + +def test_multiple_variants() -> None: + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: str | None = None) -> str | None: + return a if a is not None else b + + assert foo(a="foo") == "foo" + assert foo(b="bar") == "bar" + assert foo(a=None) is None + assert foo(b=None) is None + + # TODO: this error message could probably be improved + with pytest.raises( + TypeError, + match=r"Missing required arguments; Expected either \('a'\) or \('b'\) arguments to be given", + ): + foo() + + +def test_multiple_params_multiple_variants() -> None: + @required_args(["a", "b"], ["c"]) + def foo(*, a: str | None = None, b: str | None = None, c: str | None = None) -> str | None: + if a is not None: + return a + if b is not None: + return b + return c + + error_message = r"Missing required arguments; Expected either \('a' and 'b'\) or \('c'\) arguments to be given" + + with pytest.raises(TypeError, match=error_message): + foo(a="foo") + + with pytest.raises(TypeError, match=error_message): + foo(b="bar") + + with pytest.raises(TypeError, match=error_message): + foo() + + assert foo(a=None, b="bar") == "bar" + assert foo(c=None) is None + assert foo(c="foo") == "foo" diff --git a/tests/test_response.py b/tests/test_response.py new file mode 100644 index 0000000..b81481c --- /dev/null +++ b/tests/test_response.py @@ -0,0 +1,277 @@ +import json +from typing import Any, List, Union, cast +from typing_extensions import Annotated + +import httpx +import pytest +import pydantic + +from oz_agent_sdk import OzAPI, BaseModel, AsyncOzAPI +from oz_agent_sdk._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + BinaryAPIResponse, + AsyncBinaryAPIResponse, + extract_response_type, +) +from oz_agent_sdk._streaming import Stream +from oz_agent_sdk._base_client import FinalRequestOptions + + +class ConcreteBaseAPIResponse(APIResponse[bytes]): ... + + +class ConcreteAPIResponse(APIResponse[List[str]]): ... + + +class ConcreteAsyncAPIResponse(APIResponse[httpx.Response]): ... + + +def test_extract_response_type_direct_classes() -> None: + assert extract_response_type(BaseAPIResponse[str]) == str + assert extract_response_type(APIResponse[str]) == str + assert extract_response_type(AsyncAPIResponse[str]) == str + + +def test_extract_response_type_direct_class_missing_type_arg() -> None: + with pytest.raises( + RuntimeError, + match="Expected type to have a type argument at index 0 but it did not", + ): + extract_response_type(AsyncAPIResponse) + + +def test_extract_response_type_concrete_subclasses() -> None: + assert extract_response_type(ConcreteBaseAPIResponse) == bytes + assert extract_response_type(ConcreteAPIResponse) == List[str] + assert extract_response_type(ConcreteAsyncAPIResponse) == httpx.Response + + +def test_extract_response_type_binary_response() -> None: + assert extract_response_type(BinaryAPIResponse) == bytes + assert extract_response_type(AsyncBinaryAPIResponse) == bytes + + +class PydanticModel(pydantic.BaseModel): ... + + +def test_response_parse_mismatched_basemodel(client: OzAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from oz_agent_sdk import BaseModel`", + ): + response.parse(to=PydanticModel) + + +@pytest.mark.asyncio +async def test_async_response_parse_mismatched_basemodel(async_client: AsyncOzAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from oz_agent_sdk import BaseModel`", + ): + await response.parse(to=PydanticModel) + + +def test_response_parse_custom_stream(client: OzAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = response.parse(to=Stream[int]) + assert stream._cast_to == int + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_stream(async_client: AsyncOzAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = await response.parse(to=Stream[int]) + assert stream._cast_to == int + + +class CustomModel(BaseModel): + foo: str + bar: int + + +def test_response_parse_custom_model(client: OzAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_model(async_client: AsyncOzAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +def test_response_parse_annotated_type(client: OzAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +async def test_async_response_parse_annotated_type(async_client: AsyncOzAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +def test_response_parse_bool(client: OzAPI, content: str, expected: bool) -> None: + response = APIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = response.parse(to=bool) + assert result is expected + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +async def test_async_response_parse_bool(client: AsyncOzAPI, content: str, expected: bool) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = await response.parse(to=bool) + assert result is expected + + +class OtherModel(BaseModel): + a: str + + +@pytest.mark.parametrize("client", [False], indirect=True) # loose validation +def test_response_parse_expect_model_union_non_json_content(client: OzAPI) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" + + +@pytest.mark.asyncio +@pytest.mark.parametrize("async_client", [False], indirect=True) # loose validation +async def test_async_response_parse_expect_model_union_non_json_content(async_client: AsyncOzAPI) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" diff --git a/tests/test_streaming.py b/tests/test_streaming.py new file mode 100644 index 0000000..b9b682f --- /dev/null +++ b/tests/test_streaming.py @@ -0,0 +1,248 @@ +from __future__ import annotations + +from typing import Iterator, AsyncIterator + +import httpx +import pytest + +from oz_agent_sdk import OzAPI, AsyncOzAPI +from oz_agent_sdk._streaming import Stream, AsyncStream, ServerSentEvent + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_basic(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: completion\n" + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_missing_event(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_event_missing_data(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + yield b"event: completion\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events_with_data(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo":true}\n' + yield b"\n" + yield b"event: completion\n" + yield b'data: {"bar":false}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"bar": False} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines_with_empty_line(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: \n" + yield b"data:\n" + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + assert sse.data == '{\n"foo":\n\n\ntrue}' + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_json_escaped_double_new_line(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo": "my long\\n\\ncontent"}' + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": "my long\n\ncontent"} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines(sync: bool, client: OzAPI, async_client: AsyncOzAPI) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_special_new_line_character( + sync: bool, + client: OzAPI, + async_client: AsyncOzAPI, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":" culpa"}\n' + yield b"\n" + yield b'data: {"content":" \xe2\x80\xa8"}\n' + yield b"\n" + yield b'data: {"content":"foo"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " culpa"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " 
"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "foo"} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multi_byte_character_multiple_chunks( + sync: bool, + client: OzAPI, + async_client: AsyncOzAPI, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":"' + # bytes taken from the string 'известни' and arbitrarily split + # so that some multi-byte characters span multiple chunks + yield b"\xd0" + yield b"\xb8\xd0\xb7\xd0" + yield b"\xb2\xd0\xb5\xd1\x81\xd1\x82\xd0\xbd\xd0\xb8" + yield b'"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "известни"} + + +async def to_aiter(iter: Iterator[bytes]) -> AsyncIterator[bytes]: + for chunk in iter: + yield chunk + + +async def iter_next(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> ServerSentEvent: + if isinstance(iter, AsyncIterator): + return await iter.__anext__() + + return next(iter) + + +async def assert_empty_iter(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> None: + with pytest.raises((StopAsyncIteration, RuntimeError)): + await iter_next(iter) + + +def make_event_iterator( + content: Iterator[bytes], + *, + sync: bool, + client: OzAPI, + async_client: AsyncOzAPI, +) -> Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]: + if sync: + return Stream(cast_to=object, client=client, response=httpx.Response(200, content=content))._iter_events() + + return AsyncStream( + cast_to=object, client=async_client, response=httpx.Response(200, content=to_aiter(content)) + )._iter_events() diff --git a/tests/test_transform.py b/tests/test_transform.py new file mode 100644 index 0000000..6b1bb6b --- /dev/null +++ b/tests/test_transform.py @@ -0,0 +1,460 @@ +from __future__ import annotations + +import io +import pathlib +from typing import Any, Dict, List, Union, TypeVar, Iterable, Optional, cast +from datetime import date, datetime +from typing_extensions import Required, Annotated, TypedDict + +import pytest + +from oz_agent_sdk._types import Base64FileInput, omit, not_given +from oz_agent_sdk._utils import ( + PropertyInfo, + transform as _transform, + parse_datetime, + async_transform as _async_transform, +) +from oz_agent_sdk._compat import PYDANTIC_V1 +from oz_agent_sdk._models import BaseModel + +_T = TypeVar("_T") + +SAMPLE_FILE_PATH = pathlib.Path(__file__).parent.joinpath("sample_file.txt") + + +async def transform( + data: _T, + expected_type: object, + use_async: bool, +) -> _T: + if use_async: + return await _async_transform(data, expected_type=expected_type) + + return _transform(data, expected_type=expected_type) + + +parametrize = pytest.mark.parametrize("use_async", [False, True], ids=["sync", "async"]) + + +class Foo1(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +@parametrize +@pytest.mark.asyncio +async def test_top_level_alias(use_async: bool) -> None: + assert await transform({"foo_bar": "hello"}, expected_type=Foo1, use_async=use_async) == {"fooBar": "hello"} + + +class Foo2(TypedDict): + bar: Bar2 + + +class Bar2(TypedDict): + this_thing: Annotated[int, PropertyInfo(alias="this__thing")] + baz: Annotated[Baz2, PropertyInfo(alias="Baz")] + + +class Baz2(TypedDict): + my_baz: Annotated[str, PropertyInfo(alias="myBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_recursive_typeddict(use_async: bool) -> None: + assert await transform({"bar": {"this_thing": 1}}, Foo2, use_async) == {"bar": {"this__thing": 1}} + assert await transform({"bar": {"baz": {"my_baz": "foo"}}}, Foo2, use_async) == {"bar": {"Baz": {"myBaz": "foo"}}} + + +class Foo3(TypedDict): + things: List[Bar3] + + +class Bar3(TypedDict): + my_field: Annotated[str, PropertyInfo(alias="myField")] + + +@parametrize +@pytest.mark.asyncio +async def test_list_of_typeddict(use_async: bool) -> None: + result = await transform({"things": [{"my_field": "foo"}, {"my_field": "foo2"}]}, Foo3, use_async) + assert result == {"things": [{"myField": "foo"}, {"myField": "foo2"}]} + + +class Foo4(TypedDict): + foo: Union[Bar4, Baz4] + + +class Bar4(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz4(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_typeddict(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo4, use_async) == {"foo": {"fooBar": "bar"}} + assert await transform({"foo": {"foo_baz": "baz"}}, Foo4, use_async) == {"foo": {"fooBaz": "baz"}} + assert await transform({"foo": {"foo_baz": "baz", "foo_bar": "bar"}}, Foo4, use_async) == { + "foo": {"fooBaz": "baz", "fooBar": "bar"} + } + + +class Foo5(TypedDict): + foo: Annotated[Union[Bar4, List[Baz4]], PropertyInfo(alias="FOO")] + + +class Bar5(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz5(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_list(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo5, use_async) == {"FOO": {"fooBar": "bar"}} + assert await transform( + { + "foo": [ + {"foo_baz": "baz"}, + {"foo_baz": "baz"}, + ] + }, + Foo5, + use_async, + ) == {"FOO": [{"fooBaz": "baz"}, {"fooBaz": "baz"}]} + + +class Foo6(TypedDict): + bar: Annotated[str, PropertyInfo(alias="Bar")] + + +@parametrize +@pytest.mark.asyncio +async def test_includes_unknown_keys(use_async: bool) -> None: + assert await transform({"bar": "bar", "baz_": {"FOO": 1}}, Foo6, use_async) == { + "Bar": "bar", + "baz_": {"FOO": 1}, + } + + +class Foo7(TypedDict): + bar: Annotated[List[Bar7], PropertyInfo(alias="bAr")] + foo: Bar7 + + +class Bar7(TypedDict): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_ignores_invalid_input(use_async: bool) -> None: + assert await transform({"bar": ""}, Foo7, use_async) == {"bAr": ""} + assert await transform({"foo": ""}, Foo7, use_async) == {"foo": ""} + + +class DatetimeDict(TypedDict, total=False): + foo: Annotated[datetime, PropertyInfo(format="iso8601")] + + bar: Annotated[Optional[datetime], PropertyInfo(format="iso8601")] + + required: Required[Annotated[Optional[datetime], PropertyInfo(format="iso8601")]] + + list_: Required[Annotated[Optional[List[datetime]], PropertyInfo(format="iso8601")]] + + union: Annotated[Union[int, datetime], PropertyInfo(format="iso8601")] + + +class DateDict(TypedDict, total=False): + foo: Annotated[date, PropertyInfo(format="iso8601")] + + +class DatetimeModel(BaseModel): + foo: datetime + + +class DateModel(BaseModel): + foo: Optional[date] + + +@parametrize +@pytest.mark.asyncio +async def test_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + tz = "+00:00" if PYDANTIC_V1 else "Z" + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692" + tz} # type: ignore[comparison-overlap] + + dt = dt.replace(tzinfo=None) + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + + assert await transform({"foo": None}, DateDict, use_async) == {"foo": None} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=None), Any, use_async) == {"foo": None} # type: ignore + assert await transform({"foo": date.fromisoformat("2023-02-23")}, DateDict, use_async) == {"foo": "2023-02-23"} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=date.fromisoformat("2023-02-23")), DateDict, use_async) == { + "foo": "2023-02-23" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_optional_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"bar": dt}, DatetimeDict, use_async) == {"bar": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + + assert await transform({"bar": None}, DatetimeDict, use_async) == {"bar": None} + + +@parametrize +@pytest.mark.asyncio +async def test_required_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"required": dt}, DatetimeDict, use_async) == { + "required": "2023-02-23T14:16:36.337692+00:00" + } # type: ignore[comparison-overlap] + + assert await transform({"required": None}, DatetimeDict, use_async) == {"required": None} + + +@parametrize +@pytest.mark.asyncio +async def test_union_datetime(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"union": dt}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "union": "2023-02-23T14:16:36.337692+00:00" + } + + assert await transform({"union": "foo"}, DatetimeDict, use_async) == {"union": "foo"} + + +@parametrize +@pytest.mark.asyncio +async def test_nested_list_iso6801_format(use_async: bool) -> None: + dt1 = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + dt2 = parse_datetime("2022-01-15T06:34:23Z") + assert await transform({"list_": [dt1, dt2]}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "list_": ["2023-02-23T14:16:36.337692+00:00", "2022-01-15T06:34:23+00:00"] + } + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_custom_format(use_async: bool) -> None: + dt = parse_datetime("2022-01-15T06:34:23Z") + + result = await transform(dt, Annotated[datetime, PropertyInfo(format="custom", format_template="%H")], use_async) + assert result == "06" # type: ignore[comparison-overlap] + + +class DateDictWithRequiredAlias(TypedDict, total=False): + required_prop: Required[Annotated[date, PropertyInfo(format="iso8601", alias="prop")]] + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_with_alias(use_async: bool) -> None: + assert await transform({"required_prop": None}, DateDictWithRequiredAlias, use_async) == {"prop": None} # type: ignore[comparison-overlap] + assert await transform( + {"required_prop": date.fromisoformat("2023-02-23")}, DateDictWithRequiredAlias, use_async + ) == {"prop": "2023-02-23"} # type: ignore[comparison-overlap] + + +class MyModel(BaseModel): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_model_to_dictionary(use_async: bool) -> None: + assert cast(Any, await transform(MyModel(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + assert cast(Any, await transform(MyModel.construct(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_empty_model(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(), Any, use_async)) == {} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_unknown_field(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(my_untyped_field=True), Any, use_async)) == { + "my_untyped_field": True + } + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_types(use_async: bool) -> None: + model = MyModel.construct(foo=True) + if PYDANTIC_V1: + params = await transform(model, Any, use_async) + else: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": True} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_object_type(use_async: bool) -> None: + model = MyModel.construct(foo=MyModel.construct(hello="world")) + if PYDANTIC_V1: + params = await transform(model, Any, use_async) + else: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": {"hello": "world"}} + + +class ModelNestedObjects(BaseModel): + nested: MyModel + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_nested_objects(use_async: bool) -> None: + model = ModelNestedObjects.construct(nested={"foo": "stainless"}) + assert isinstance(model.nested, MyModel) + assert cast(Any, await transform(model, Any, use_async)) == {"nested": {"foo": "stainless"}} + + +class ModelWithDefaultField(BaseModel): + foo: str + with_none_default: Union[str, None] = None + with_str_default: str = "foo" + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_default_field(use_async: bool) -> None: + # should be excluded when defaults are used + model = ModelWithDefaultField.construct() + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {} + + # should be included when the default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default=None, with_str_default="foo") + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": None, "with_str_default": "foo"} + + # should be included when a non-default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default="bar", with_str_default="baz") + assert model.with_none_default == "bar" + assert model.with_str_default == "baz" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": "bar", "with_str_default": "baz"} + + +class TypedDictIterableUnion(TypedDict): + foo: Annotated[Union[Bar8, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +class Bar8(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz8(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_of_dictionaries(use_async: bool) -> None: + assert await transform({"foo": [{"foo_baz": "bar"}]}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "bar"}] + } + assert cast(Any, await transform({"foo": ({"foo_baz": "bar"},)}, TypedDictIterableUnion, use_async)) == { + "FOO": [{"fooBaz": "bar"}] + } + + def my_iter() -> Iterable[Baz8]: + yield {"foo_baz": "hello"} + yield {"foo_baz": "world"} + + assert await transform({"foo": my_iter()}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "hello"}, {"fooBaz": "world"}] + } + + +@parametrize +@pytest.mark.asyncio +async def test_dictionary_items(use_async: bool) -> None: + class DictItems(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + assert await transform({"foo": {"foo_baz": "bar"}}, Dict[str, DictItems], use_async) == {"foo": {"fooBaz": "bar"}} + + +class TypedDictIterableUnionStr(TypedDict): + foo: Annotated[Union[str, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_union_str(use_async: bool) -> None: + assert await transform({"foo": "bar"}, TypedDictIterableUnionStr, use_async) == {"FOO": "bar"} + assert cast(Any, await transform(iter([{"foo_baz": "bar"}]), Union[str, Iterable[Baz8]], use_async)) == [ + {"fooBaz": "bar"} + ] + + +class TypedDictBase64Input(TypedDict): + foo: Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")] + + +@parametrize +@pytest.mark.asyncio +async def test_base64_file_input(use_async: bool) -> None: + # strings are left as-is + assert await transform({"foo": "bar"}, TypedDictBase64Input, use_async) == {"foo": "bar"} + + # pathlib.Path is automatically converted to base64 + assert await transform({"foo": SAMPLE_FILE_PATH}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQo=" + } # type: ignore[comparison-overlap] + + # io instances are automatically converted to base64 + assert await transform({"foo": io.StringIO("Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + assert await transform({"foo": io.BytesIO(b"Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_transform_skipping(use_async: bool) -> None: + # lists of ints are left as-is + data = [1, 2, 3] + assert await transform(data, List[int], use_async) is data + + # iterables of ints are converted to a list + data = iter([1, 2, 3]) + assert await transform(data, Iterable[int], use_async) == [1, 2, 3] + + +@parametrize +@pytest.mark.asyncio +async def test_strips_notgiven(use_async: bool) -> None: + assert await transform({"foo_bar": "bar"}, Foo1, use_async) == {"fooBar": "bar"} + assert await transform({"foo_bar": not_given}, Foo1, use_async) == {} + + +@parametrize +@pytest.mark.asyncio +async def test_strips_omit(use_async: bool) -> None: + assert await transform({"foo_bar": "bar"}, Foo1, use_async) == {"fooBar": "bar"} + assert await transform({"foo_bar": omit}, Foo1, use_async) == {} diff --git a/tests/test_utils/test_datetime_parse.py b/tests/test_utils/test_datetime_parse.py new file mode 100644 index 0000000..de12854 --- /dev/null +++ b/tests/test_utils/test_datetime_parse.py @@ -0,0 +1,110 @@ +""" +Copied from https://github.com/pydantic/pydantic/blob/v1.10.22/tests/test_datetime_parse.py +with modifications so it works without pydantic v1 imports. +""" + +from typing import Type, Union +from datetime import date, datetime, timezone, timedelta + +import pytest + +from oz_agent_sdk._utils import parse_date, parse_datetime + + +def create_tz(minutes: int) -> timezone: + return timezone(timedelta(minutes=minutes)) + + +@pytest.mark.parametrize( + "value,result", + [ + # Valid inputs + ("1494012444.883309", date(2017, 5, 5)), + (b"1494012444.883309", date(2017, 5, 5)), + (1_494_012_444.883_309, date(2017, 5, 5)), + ("1494012444", date(2017, 5, 5)), + (1_494_012_444, date(2017, 5, 5)), + (0, date(1970, 1, 1)), + ("2012-04-23", date(2012, 4, 23)), + (b"2012-04-23", date(2012, 4, 23)), + ("2012-4-9", date(2012, 4, 9)), + (date(2012, 4, 9), date(2012, 4, 9)), + (datetime(2012, 4, 9, 12, 15), date(2012, 4, 9)), + # Invalid inputs + ("x20120423", ValueError), + ("2012-04-56", ValueError), + (19_999_999_999, date(2603, 10, 11)), # just before watershed + (20_000_000_001, date(1970, 8, 20)), # just after watershed + (1_549_316_052, date(2019, 2, 4)), # nowish in s + (1_549_316_052_104, date(2019, 2, 4)), # nowish in ms + (1_549_316_052_104_324, date(2019, 2, 4)), # nowish in μs + (1_549_316_052_104_324_096, date(2019, 2, 4)), # nowish in ns + ("infinity", date(9999, 12, 31)), + ("inf", date(9999, 12, 31)), + (float("inf"), date(9999, 12, 31)), + ("infinity ", date(9999, 12, 31)), + (int("1" + "0" * 100), date(9999, 12, 31)), + (1e1000, date(9999, 12, 31)), + ("-infinity", date(1, 1, 1)), + ("-inf", date(1, 1, 1)), + ("nan", ValueError), + ], +) +def test_date_parsing(value: Union[str, bytes, int, float], result: Union[date, Type[Exception]]) -> None: + if type(result) == type and issubclass(result, Exception): # pyright: ignore[reportUnnecessaryIsInstance] + with pytest.raises(result): + parse_date(value) + else: + assert parse_date(value) == result + + +@pytest.mark.parametrize( + "value,result", + [ + # Valid inputs + # values in seconds + ("1494012444.883309", datetime(2017, 5, 5, 19, 27, 24, 883_309, tzinfo=timezone.utc)), + (1_494_012_444.883_309, datetime(2017, 5, 5, 19, 27, 24, 883_309, tzinfo=timezone.utc)), + ("1494012444", datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + (b"1494012444", datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + (1_494_012_444, datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + # values in ms + ("1494012444000.883309", datetime(2017, 5, 5, 19, 27, 24, 883, tzinfo=timezone.utc)), + ("-1494012444000.883309", datetime(1922, 8, 29, 4, 32, 35, 999117, tzinfo=timezone.utc)), + (1_494_012_444_000, datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + ("2012-04-23T09:15:00", datetime(2012, 4, 23, 9, 15)), + ("2012-4-9 4:8:16", datetime(2012, 4, 9, 4, 8, 16)), + ("2012-04-23T09:15:00Z", datetime(2012, 4, 23, 9, 15, 0, 0, timezone.utc)), + ("2012-4-9 4:8:16-0320", datetime(2012, 4, 9, 4, 8, 16, 0, create_tz(-200))), + ("2012-04-23T10:20:30.400+02:30", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(150))), + ("2012-04-23T10:20:30.400+02", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(120))), + ("2012-04-23T10:20:30.400-02", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(-120))), + (b"2012-04-23T10:20:30.400-02", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(-120))), + (datetime(2017, 5, 5), datetime(2017, 5, 5)), + (0, datetime(1970, 1, 1, 0, 0, 0, tzinfo=timezone.utc)), + # Invalid inputs + ("x20120423091500", ValueError), + ("2012-04-56T09:15:90", ValueError), + ("2012-04-23T11:05:00-25:00", ValueError), + (19_999_999_999, datetime(2603, 10, 11, 11, 33, 19, tzinfo=timezone.utc)), # just before watershed + (20_000_000_001, datetime(1970, 8, 20, 11, 33, 20, 1000, tzinfo=timezone.utc)), # just after watershed + (1_549_316_052, datetime(2019, 2, 4, 21, 34, 12, 0, tzinfo=timezone.utc)), # nowish in s + (1_549_316_052_104, datetime(2019, 2, 4, 21, 34, 12, 104_000, tzinfo=timezone.utc)), # nowish in ms + (1_549_316_052_104_324, datetime(2019, 2, 4, 21, 34, 12, 104_324, tzinfo=timezone.utc)), # nowish in μs + (1_549_316_052_104_324_096, datetime(2019, 2, 4, 21, 34, 12, 104_324, tzinfo=timezone.utc)), # nowish in ns + ("infinity", datetime(9999, 12, 31, 23, 59, 59, 999999)), + ("inf", datetime(9999, 12, 31, 23, 59, 59, 999999)), + ("inf ", datetime(9999, 12, 31, 23, 59, 59, 999999)), + (1e50, datetime(9999, 12, 31, 23, 59, 59, 999999)), + (float("inf"), datetime(9999, 12, 31, 23, 59, 59, 999999)), + ("-infinity", datetime(1, 1, 1, 0, 0)), + ("-inf", datetime(1, 1, 1, 0, 0)), + ("nan", ValueError), + ], +) +def test_datetime_parsing(value: Union[str, bytes, int, float], result: Union[datetime, Type[Exception]]) -> None: + if type(result) == type and issubclass(result, Exception): # pyright: ignore[reportUnnecessaryIsInstance] + with pytest.raises(result): + parse_datetime(value) + else: + assert parse_datetime(value) == result diff --git a/tests/test_utils/test_json.py b/tests/test_utils/test_json.py new file mode 100644 index 0000000..b8a430e --- /dev/null +++ b/tests/test_utils/test_json.py @@ -0,0 +1,126 @@ +from __future__ import annotations + +import datetime +from typing import Union + +import pydantic + +from oz_agent_sdk import _compat +from oz_agent_sdk._utils._json import openapi_dumps + + +class TestOpenapiDumps: + def test_basic(self) -> None: + data = {"key": "value", "number": 42} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"key":"value","number":42}' + + def test_datetime_serialization(self) -> None: + dt = datetime.datetime(2023, 1, 1, 12, 0, 0) + data = {"datetime": dt} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"datetime":"2023-01-01T12:00:00"}' + + def test_pydantic_model_serialization(self) -> None: + class User(pydantic.BaseModel): + first_name: str + last_name: str + age: int + + model_instance = User(first_name="John", last_name="Kramer", age=83) + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"first_name":"John","last_name":"Kramer","age":83}}' + + def test_pydantic_model_with_default_values(self) -> None: + class User(pydantic.BaseModel): + name: str + role: str = "user" + active: bool = True + score: int = 0 + + model_instance = User(name="Alice") + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Alice"}}' + + def test_pydantic_model_with_default_values_overridden(self) -> None: + class User(pydantic.BaseModel): + name: str + role: str = "user" + active: bool = True + + model_instance = User(name="Bob", role="admin", active=False) + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Bob","role":"admin","active":false}}' + + def test_pydantic_model_with_alias(self) -> None: + class User(pydantic.BaseModel): + first_name: str = pydantic.Field(alias="firstName") + last_name: str = pydantic.Field(alias="lastName") + + model_instance = User(firstName="John", lastName="Doe") + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"firstName":"John","lastName":"Doe"}}' + + def test_pydantic_model_with_alias_and_default(self) -> None: + class User(pydantic.BaseModel): + user_name: str = pydantic.Field(alias="userName") + user_role: str = pydantic.Field(default="member", alias="userRole") + is_active: bool = pydantic.Field(default=True, alias="isActive") + + model_instance = User(userName="charlie") + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"userName":"charlie"}}' + + model_with_overrides = User(userName="diana", userRole="admin", isActive=False) + data = {"model": model_with_overrides} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"userName":"diana","userRole":"admin","isActive":false}}' + + def test_pydantic_model_with_nested_models_and_defaults(self) -> None: + class Address(pydantic.BaseModel): + street: str + city: str = "Unknown" + + class User(pydantic.BaseModel): + name: str + address: Address + verified: bool = False + + if _compat.PYDANTIC_V1: + # to handle forward references in Pydantic v1 + User.update_forward_refs(**locals()) # type: ignore[reportDeprecated] + + address = Address(street="123 Main St") + user = User(name="Diana", address=address) + data = {"user": user} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"user":{"name":"Diana","address":{"street":"123 Main St"}}}' + + address_with_city = Address(street="456 Oak Ave", city="Boston") + user_verified = User(name="Eve", address=address_with_city, verified=True) + data = {"user": user_verified} + json_bytes = openapi_dumps(data) + assert ( + json_bytes == b'{"user":{"name":"Eve","address":{"street":"456 Oak Ave","city":"Boston"},"verified":true}}' + ) + + def test_pydantic_model_with_optional_fields(self) -> None: + class User(pydantic.BaseModel): + name: str + email: Union[str, None] + phone: Union[str, None] + + model_with_none = User(name="Eve", email=None, phone=None) + data = {"model": model_with_none} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Eve","email":null,"phone":null}}' + + model_with_values = User(name="Frank", email="frank@example.com", phone=None) + data = {"model": model_with_values} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Frank","email":"frank@example.com","phone":null}}' diff --git a/tests/test_utils/test_path.py b/tests/test_utils/test_path.py new file mode 100644 index 0000000..6d9039f --- /dev/null +++ b/tests/test_utils/test_path.py @@ -0,0 +1,89 @@ +from __future__ import annotations + +from typing import Any + +import pytest + +from oz_agent_sdk._utils._path import path_template + + +@pytest.mark.parametrize( + "template, kwargs, expected", + [ + ("/v1/{id}", dict(id="abc"), "/v1/abc"), + ("/v1/{a}/{b}", dict(a="x", b="y"), "/v1/x/y"), + ("/v1/{a}{b}/path/{c}?val={d}#{e}", dict(a="x", b="y", c="z", d="u", e="v"), "/v1/xy/path/z?val=u#v"), + ("/{w}/{w}", dict(w="echo"), "/echo/echo"), + ("/v1/static", {}, "/v1/static"), + ("", {}, ""), + ("/v1/?q={n}&count=10", dict(n=42), "/v1/?q=42&count=10"), + ("/v1/{v}", dict(v=None), "/v1/null"), + ("/v1/{v}", dict(v=True), "/v1/true"), + ("/v1/{v}", dict(v=False), "/v1/false"), + ("/v1/{v}", dict(v=".hidden"), "/v1/.hidden"), # dot prefix ok + ("/v1/{v}", dict(v="file.txt"), "/v1/file.txt"), # dot in middle ok + ("/v1/{v}", dict(v="..."), "/v1/..."), # triple dot ok + ("/v1/{a}{b}", dict(a=".", b="txt"), "/v1/.txt"), # dot var combining with adjacent to be ok + ("/items?q={v}#{f}", dict(v=".", f=".."), "/items?q=.#.."), # dots in query/fragment are fine + ( + "/v1/{a}?query={b}", + dict(a="../../other/endpoint", b="a&bad=true"), + "/v1/..%2F..%2Fother%2Fendpoint?query=a%26bad%3Dtrue", + ), + ("/v1/{val}", dict(val="a/b/c"), "/v1/a%2Fb%2Fc"), + ("/v1/{val}", dict(val="a/b/c?query=value"), "/v1/a%2Fb%2Fc%3Fquery=value"), + ("/v1/{val}", dict(val="a/b/c?query=value&bad=true"), "/v1/a%2Fb%2Fc%3Fquery=value&bad=true"), + ("/v1/{val}", dict(val="%20"), "/v1/%2520"), # escapes escape sequences in input + # Query: slash and ? are safe, # is not + ("/items?q={v}", dict(v="a/b"), "/items?q=a/b"), + ("/items?q={v}", dict(v="a?b"), "/items?q=a?b"), + ("/items?q={v}", dict(v="a#b"), "/items?q=a%23b"), + ("/items?q={v}", dict(v="a b"), "/items?q=a%20b"), + # Fragment: slash and ? are safe + ("/docs#{v}", dict(v="a/b"), "/docs#a/b"), + ("/docs#{v}", dict(v="a?b"), "/docs#a?b"), + # Path: slash, ? and # are all encoded + ("/v1/{v}", dict(v="a/b"), "/v1/a%2Fb"), + ("/v1/{v}", dict(v="a?b"), "/v1/a%3Fb"), + ("/v1/{v}", dict(v="a#b"), "/v1/a%23b"), + # same var encoded differently by component + ( + "/v1/{v}?q={v}#{v}", + dict(v="a/b?c#d"), + "/v1/a%2Fb%3Fc%23d?q=a/b?c%23d#a/b?c%23d", + ), + ("/v1/{val}", dict(val="x?admin=true"), "/v1/x%3Fadmin=true"), # query injection + ("/v1/{val}", dict(val="x#admin"), "/v1/x%23admin"), # fragment injection + ], +) +def test_interpolation(template: str, kwargs: dict[str, Any], expected: str) -> None: + assert path_template(template, **kwargs) == expected + + +def test_missing_kwarg_raises_key_error() -> None: + with pytest.raises(KeyError, match="org_id"): + path_template("/v1/{org_id}") + + +@pytest.mark.parametrize( + "template, kwargs", + [ + ("{a}/path", dict(a=".")), + ("{a}/path", dict(a="..")), + ("/v1/{a}", dict(a=".")), + ("/v1/{a}", dict(a="..")), + ("/v1/{a}/path", dict(a=".")), + ("/v1/{a}/path", dict(a="..")), + ("/v1/{a}{b}", dict(a=".", b=".")), # adjacent vars → ".." + ("/v1/{a}.", dict(a=".")), # var + static → ".." + ("/v1/{a}{b}", dict(a="", b=".")), # empty + dot → "." + ("/v1/%2e/{x}", dict(x="ok")), # encoded dot in static text + ("/v1/%2e./{x}", dict(x="ok")), # mixed encoded ".." in static + ("/v1/.%2E/{x}", dict(x="ok")), # mixed encoded ".." in static + ("/v1/{v}?q=1", dict(v="..")), + ("/v1/{v}#frag", dict(v="..")), + ], +) +def test_dot_segment_rejected(template: str, kwargs: dict[str, Any]) -> None: + with pytest.raises(ValueError, match="dot-segment"): + path_template(template, **kwargs) diff --git a/tests/test_utils/test_proxy.py b/tests/test_utils/test_proxy.py new file mode 100644 index 0000000..7b3b2ff --- /dev/null +++ b/tests/test_utils/test_proxy.py @@ -0,0 +1,34 @@ +import operator +from typing import Any +from typing_extensions import override + +from oz_agent_sdk._utils import LazyProxy + + +class RecursiveLazyProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + return self + + def __call__(self, *_args: Any, **_kwds: Any) -> Any: + raise RuntimeError("This should never be called!") + + +def test_recursive_proxy() -> None: + proxy = RecursiveLazyProxy() + assert repr(proxy) == "RecursiveLazyProxy" + assert str(proxy) == "RecursiveLazyProxy" + assert dir(proxy) == [] + assert type(proxy).__name__ == "RecursiveLazyProxy" + assert type(operator.attrgetter("name.foo.bar.baz")(proxy)).__name__ == "RecursiveLazyProxy" + + +def test_isinstance_does_not_error() -> None: + class AlwaysErrorProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + raise RuntimeError("Mocking missing dependency") + + proxy = AlwaysErrorProxy() + assert not isinstance(proxy, dict) + assert isinstance(proxy, LazyProxy) diff --git a/tests/test_utils/test_typing.py b/tests/test_utils/test_typing.py new file mode 100644 index 0000000..b55367e --- /dev/null +++ b/tests/test_utils/test_typing.py @@ -0,0 +1,73 @@ +from __future__ import annotations + +from typing import Generic, TypeVar, cast + +from oz_agent_sdk._utils import extract_type_var_from_base + +_T = TypeVar("_T") +_T2 = TypeVar("_T2") +_T3 = TypeVar("_T3") + + +class BaseGeneric(Generic[_T]): ... + + +class SubclassGeneric(BaseGeneric[_T]): ... + + +class BaseGenericMultipleTypeArgs(Generic[_T, _T2, _T3]): ... + + +class SubclassGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T, _T2, _T3]): ... + + +class SubclassDifferentOrderGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T2, _T, _T3]): ... + + +def test_extract_type_var() -> None: + assert ( + extract_type_var_from_base( + BaseGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_generic_subclass() -> None: + assert ( + extract_type_var_from_base( + SubclassGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_multiple() -> None: + typ = BaseGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_multiple() -> None: + typ = SubclassGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_different_ordering_multiple() -> None: + typ = SubclassDifferentOrderGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) diff --git a/tests/utils.py b/tests/utils.py new file mode 100644 index 0000000..3e9d221 --- /dev/null +++ b/tests/utils.py @@ -0,0 +1,167 @@ +from __future__ import annotations + +import os +import inspect +import traceback +import contextlib +from typing import Any, TypeVar, Iterator, Sequence, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, get_origin, assert_type + +from oz_agent_sdk._types import Omit, NoneType +from oz_agent_sdk._utils import ( + is_dict, + is_list, + is_list_type, + is_union_type, + extract_type_arg, + is_sequence_type, + is_annotated_type, + is_type_alias_type, +) +from oz_agent_sdk._compat import PYDANTIC_V1, field_outer_type, get_model_fields +from oz_agent_sdk._models import BaseModel + +BaseModelT = TypeVar("BaseModelT", bound=BaseModel) + + +def assert_matches_model(model: type[BaseModelT], value: BaseModelT, *, path: list[str]) -> bool: + for name, field in get_model_fields(model).items(): + field_value = getattr(value, name) + if PYDANTIC_V1: + # in v1 nullability was structured differently + # https://docs.pydantic.dev/2.0/migration/#required-optional-and-nullable-fields + allow_none = getattr(field, "allow_none", False) + else: + allow_none = False + + assert_matches_type( + field_outer_type(field), + field_value, + path=[*path, name], + allow_none=allow_none, + ) + + return True + + +# Note: the `path` argument is only used to improve error messages when `--showlocals` is used +def assert_matches_type( + type_: Any, + value: object, + *, + path: list[str], + allow_none: bool = False, +) -> None: + if is_type_alias_type(type_): + type_ = type_.__value__ + + # unwrap `Annotated[T, ...]` -> `T` + if is_annotated_type(type_): + type_ = extract_type_arg(type_, 0) + + if allow_none and value is None: + return + + if type_ is None or type_ is NoneType: + assert value is None + return + + origin = get_origin(type_) or type_ + + if is_list_type(type_): + return _assert_list_type(type_, value) + + if is_sequence_type(type_): + assert isinstance(value, Sequence) + inner_type = get_args(type_)[0] + for entry in value: # type: ignore + assert_type(inner_type, entry) # type: ignore + return + + if origin == str: + assert isinstance(value, str) + elif origin == int: + assert isinstance(value, int) + elif origin == bool: + assert isinstance(value, bool) + elif origin == float: + assert isinstance(value, float) + elif origin == bytes: + assert isinstance(value, bytes) + elif origin == datetime: + assert isinstance(value, datetime) + elif origin == date: + assert isinstance(value, date) + elif origin == object: + # nothing to do here, the expected type is unknown + pass + elif origin == Literal: + assert value in get_args(type_) + elif origin == dict: + assert is_dict(value) + + args = get_args(type_) + key_type = args[0] + items_type = args[1] + + for key, item in value.items(): + assert_matches_type(key_type, key, path=[*path, ""]) + assert_matches_type(items_type, item, path=[*path, ""]) + elif is_union_type(type_): + variants = get_args(type_) + + try: + none_index = variants.index(type(None)) + except ValueError: + pass + else: + # special case Optional[T] for better error messages + if len(variants) == 2: + if value is None: + # valid + return + + return assert_matches_type(type_=variants[not none_index], value=value, path=path) + + for i, variant in enumerate(variants): + try: + assert_matches_type(variant, value, path=[*path, f"variant {i}"]) + return + except AssertionError: + traceback.print_exc() + continue + + raise AssertionError("Did not match any variants") + elif issubclass(origin, BaseModel): + assert isinstance(value, type_) + assert assert_matches_model(type_, cast(Any, value), path=path) + elif inspect.isclass(origin) and origin.__name__ == "HttpxBinaryResponseContent": + assert value.__class__.__name__ == "HttpxBinaryResponseContent" + else: + assert None, f"Unhandled field type: {type_}" + + +def _assert_list_type(type_: type[object], value: object) -> None: + assert is_list(value) + + inner_type = get_args(type_)[0] + for entry in value: + assert_type(inner_type, entry) # type: ignore + + +@contextlib.contextmanager +def update_env(**new_env: str | Omit) -> Iterator[None]: + old = os.environ.copy() + + try: + for name, value in new_env.items(): + if isinstance(value, Omit): + os.environ.pop(name, None) + else: + os.environ[name] = value + + yield None + finally: + os.environ.clear() + os.environ.update(old) diff --git a/uv.lock b/uv.lock new file mode 100644 index 0000000..bb16cc1 --- /dev/null +++ b/uv.lock @@ -0,0 +1,1829 @@ +version = 1 +revision = 3 +requires-python = ">=3.9" +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version < '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version < '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version < '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +conflicts = [[ + { package = "oz-agent-sdk", group = "pydantic-v1" }, + { package = "oz-agent-sdk", group = "pydantic-v2" }, +]] + +[[package]] +name = "aiohappyeyeballs" +version = "2.6.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/26/30/f84a107a9c4331c14b2b586036f40965c128aa4fee4dda5d3d51cb14ad54/aiohappyeyeballs-2.6.1.tar.gz", hash = "sha256:c3f9d0113123803ccadfdf3f0faa505bc78e6a72d1cc4806cbd719826e943558", size = 22760, upload-time = "2025-03-12T01:42:48.764Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0f/15/5bf3b99495fb160b63f95972b81750f18f7f4e02ad051373b669d17d44f2/aiohappyeyeballs-2.6.1-py3-none-any.whl", hash = "sha256:f349ba8f4b75cb25c99c5c2d84e997e485204d2902a9597802b0371f09331fb8", size = 15265, upload-time = "2025-03-12T01:42:47.083Z" }, +] + +[[package]] +name = "aiohttp" +version = "3.13.3" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "aiohappyeyeballs" }, + { name = "aiosignal" }, + { name = "async-timeout", marker = "python_full_version < '3.11' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "attrs" }, + { name = "frozenlist" }, + { name = "multidict" }, + { name = "propcache" }, + { name = "yarl" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/50/42/32cf8e7704ceb4481406eb87161349abb46a57fee3f008ba9cb610968646/aiohttp-3.13.3.tar.gz", hash = "sha256:a949eee43d3782f2daae4f4a2819b2cb9b0c5d3b7f7a927067cc84dafdbb9f88", size = 7844556, upload-time = "2026-01-03T17:33:05.204Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/36/d6/5aec9313ee6ea9c7cde8b891b69f4ff4001416867104580670a31daeba5b/aiohttp-3.13.3-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d5a372fd5afd301b3a89582817fdcdb6c34124787c70dbcc616f259013e7eef7", size = 738950, upload-time = "2026-01-03T17:29:13.002Z" }, + { url = "https://files.pythonhosted.org/packages/68/03/8fa90a7e6d11ff20a18837a8e2b5dd23db01aabc475aa9271c8ad33299f5/aiohttp-3.13.3-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:147e422fd1223005c22b4fe080f5d93ced44460f5f9c105406b753612b587821", size = 496099, upload-time = "2026-01-03T17:29:15.268Z" }, + { url = "https://files.pythonhosted.org/packages/d2/23/b81f744d402510a8366b74eb420fc0cc1170d0c43daca12d10814df85f10/aiohttp-3.13.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:859bd3f2156e81dd01432f5849fc73e2243d4a487c4fd26609b1299534ee1845", size = 491072, upload-time = "2026-01-03T17:29:16.922Z" }, + { url = "https://files.pythonhosted.org/packages/d5/e1/56d1d1c0dd334cd203dd97706ce004c1aa24b34a813b0b8daf3383039706/aiohttp-3.13.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:dca68018bf48c251ba17c72ed479f4dafe9dbd5a73707ad8d28a38d11f3d42af", size = 1671588, upload-time = "2026-01-03T17:29:18.539Z" }, + { url = "https://files.pythonhosted.org/packages/5f/34/8d7f962604f4bc2b4e39eb1220dac7d4e4cba91fb9ba0474b4ecd67db165/aiohttp-3.13.3-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:fee0c6bc7db1de362252affec009707a17478a00ec69f797d23ca256e36d5940", size = 1640334, upload-time = "2026-01-03T17:29:21.028Z" }, + { url = "https://files.pythonhosted.org/packages/94/1d/fcccf2c668d87337ddeef9881537baee13c58d8f01f12ba8a24215f2b804/aiohttp-3.13.3-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c048058117fd649334d81b4b526e94bde3ccaddb20463a815ced6ecbb7d11160", size = 1722656, upload-time = "2026-01-03T17:29:22.531Z" }, + { url = "https://files.pythonhosted.org/packages/aa/98/c6f3b081c4c606bc1e5f2ec102e87d6411c73a9ef3616fea6f2d5c98c062/aiohttp-3.13.3-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:215a685b6fbbfcf71dfe96e3eba7a6f58f10da1dfdf4889c7dd856abe430dca7", size = 1817625, upload-time = "2026-01-03T17:29:24.276Z" }, + { url = "https://files.pythonhosted.org/packages/2c/c0/cfcc3d2e11b477f86e1af2863f3858c8850d751ce8dc39c4058a072c9e54/aiohttp-3.13.3-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:de2c184bb1fe2cbd2cefba613e9db29a5ab559323f994b6737e370d3da0ac455", size = 1672604, upload-time = "2026-01-03T17:29:26.099Z" }, + { url = "https://files.pythonhosted.org/packages/1e/77/6b4ffcbcac4c6a5d041343a756f34a6dd26174ae07f977a64fe028dda5b0/aiohttp-3.13.3-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:75ca857eba4e20ce9f546cd59c7007b33906a4cd48f2ff6ccf1ccfc3b646f279", size = 1554370, upload-time = "2026-01-03T17:29:28.121Z" }, + { url = "https://files.pythonhosted.org/packages/f2/f0/e3ddfa93f17d689dbe014ba048f18e0c9f9b456033b70e94349a2e9048be/aiohttp-3.13.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:81e97251d9298386c2b7dbeb490d3d1badbdc69107fb8c9299dd04eb39bddc0e", size = 1642023, upload-time = "2026-01-03T17:29:30.002Z" }, + { url = "https://files.pythonhosted.org/packages/eb/45/c14019c9ec60a8e243d06d601b33dcc4fd92379424bde3021725859d7f99/aiohttp-3.13.3-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:c0e2d366af265797506f0283487223146af57815b388623f0357ef7eac9b209d", size = 1649680, upload-time = "2026-01-03T17:29:31.782Z" }, + { url = "https://files.pythonhosted.org/packages/9c/fd/09c9451dae5aa5c5ed756df95ff9ef549d45d4be663bafd1e4954fd836f0/aiohttp-3.13.3-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:4e239d501f73d6db1522599e14b9b321a7e3b1de66ce33d53a765d975e9f4808", size = 1692407, upload-time = "2026-01-03T17:29:33.392Z" }, + { url = "https://files.pythonhosted.org/packages/a6/81/938bc2ec33c10efd6637ccb3d22f9f3160d08e8f3aa2587a2c2d5ab578eb/aiohttp-3.13.3-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:0db318f7a6f065d84cb1e02662c526294450b314a02bd9e2a8e67f0d8564ce40", size = 1543047, upload-time = "2026-01-03T17:29:34.855Z" }, + { url = "https://files.pythonhosted.org/packages/f7/23/80488ee21c8d567c83045e412e1d9b7077d27171591a4eb7822586e8c06a/aiohttp-3.13.3-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:bfc1cc2fe31a6026a8a88e4ecfb98d7f6b1fec150cfd708adbfd1d2f42257c29", size = 1715264, upload-time = "2026-01-03T17:29:36.389Z" }, + { url = "https://files.pythonhosted.org/packages/e2/83/259a8da6683182768200b368120ab3deff5370bed93880fb9a3a86299f34/aiohttp-3.13.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:af71fff7bac6bb7508956696dce8f6eec2bbb045eceb40343944b1ae62b5ef11", size = 1657275, upload-time = "2026-01-03T17:29:38.162Z" }, + { url = "https://files.pythonhosted.org/packages/3f/4f/2c41f800a0b560785c10fb316216ac058c105f9be50bdc6a285de88db625/aiohttp-3.13.3-cp310-cp310-win32.whl", hash = "sha256:37da61e244d1749798c151421602884db5270faf479cf0ef03af0ff68954c9dd", size = 434053, upload-time = "2026-01-03T17:29:40.074Z" }, + { url = "https://files.pythonhosted.org/packages/80/df/29cd63c7ecfdb65ccc12f7d808cac4fa2a19544660c06c61a4a48462de0c/aiohttp-3.13.3-cp310-cp310-win_amd64.whl", hash = "sha256:7e63f210bc1b57ef699035f2b4b6d9ce096b5914414a49b0997c839b2bd2223c", size = 456687, upload-time = "2026-01-03T17:29:41.819Z" }, + { url = "https://files.pythonhosted.org/packages/f1/4c/a164164834f03924d9a29dc3acd9e7ee58f95857e0b467f6d04298594ebb/aiohttp-3.13.3-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:5b6073099fb654e0a068ae678b10feff95c5cae95bbfcbfa7af669d361a8aa6b", size = 746051, upload-time = "2026-01-03T17:29:43.287Z" }, + { url = "https://files.pythonhosted.org/packages/82/71/d5c31390d18d4f58115037c432b7e0348c60f6f53b727cad33172144a112/aiohttp-3.13.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1cb93e166e6c28716c8c6aeb5f99dfb6d5ccf482d29fe9bf9a794110e6d0ab64", size = 499234, upload-time = "2026-01-03T17:29:44.822Z" }, + { url = "https://files.pythonhosted.org/packages/0e/c9/741f8ac91e14b1d2e7100690425a5b2b919a87a5075406582991fb7de920/aiohttp-3.13.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:28e027cf2f6b641693a09f631759b4d9ce9165099d2b5d92af9bd4e197690eea", size = 494979, upload-time = "2026-01-03T17:29:46.405Z" }, + { url = "https://files.pythonhosted.org/packages/75/b5/31d4d2e802dfd59f74ed47eba48869c1c21552c586d5e81a9d0d5c2ad640/aiohttp-3.13.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3b61b7169ababd7802f9568ed96142616a9118dd2be0d1866e920e77ec8fa92a", size = 1748297, upload-time = "2026-01-03T17:29:48.083Z" }, + { url = "https://files.pythonhosted.org/packages/1a/3e/eefad0ad42959f226bb79664826883f2687d602a9ae2941a18e0484a74d3/aiohttp-3.13.3-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:80dd4c21b0f6237676449c6baaa1039abae86b91636b6c91a7f8e61c87f89540", size = 1707172, upload-time = "2026-01-03T17:29:49.648Z" }, + { url = "https://files.pythonhosted.org/packages/c5/3a/54a64299fac2891c346cdcf2aa6803f994a2e4beeaf2e5a09dcc54acc842/aiohttp-3.13.3-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:65d2ccb7eabee90ce0503c17716fc77226be026dcc3e65cce859a30db715025b", size = 1805405, upload-time = "2026-01-03T17:29:51.244Z" }, + { url = "https://files.pythonhosted.org/packages/6c/70/ddc1b7169cf64075e864f64595a14b147a895a868394a48f6a8031979038/aiohttp-3.13.3-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5b179331a481cb5529fca8b432d8d3c7001cb217513c94cd72d668d1248688a3", size = 1899449, upload-time = "2026-01-03T17:29:53.938Z" }, + { url = "https://files.pythonhosted.org/packages/a1/7e/6815aab7d3a56610891c76ef79095677b8b5be6646aaf00f69b221765021/aiohttp-3.13.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9d4c940f02f49483b18b079d1c27ab948721852b281f8b015c058100e9421dd1", size = 1748444, upload-time = "2026-01-03T17:29:55.484Z" }, + { url = "https://files.pythonhosted.org/packages/6b/f2/073b145c4100da5511f457dc0f7558e99b2987cf72600d42b559db856fbc/aiohttp-3.13.3-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:f9444f105664c4ce47a2a7171a2418bce5b7bae45fb610f4e2c36045d85911d3", size = 1606038, upload-time = "2026-01-03T17:29:57.179Z" }, + { url = "https://files.pythonhosted.org/packages/0a/c1/778d011920cae03ae01424ec202c513dc69243cf2db303965615b81deeea/aiohttp-3.13.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:694976222c711d1d00ba131904beb60534f93966562f64440d0c9d41b8cdb440", size = 1724156, upload-time = "2026-01-03T17:29:58.914Z" }, + { url = "https://files.pythonhosted.org/packages/0e/cb/3419eabf4ec1e9ec6f242c32b689248365a1cf621891f6f0386632525494/aiohttp-3.13.3-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:f33ed1a2bf1997a36661874b017f5c4b760f41266341af36febaf271d179f6d7", size = 1722340, upload-time = "2026-01-03T17:30:01.962Z" }, + { url = "https://files.pythonhosted.org/packages/7a/e5/76cf77bdbc435bf233c1f114edad39ed4177ccbfab7c329482b179cff4f4/aiohttp-3.13.3-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:e636b3c5f61da31a92bf0d91da83e58fdfa96f178ba682f11d24f31944cdd28c", size = 1783041, upload-time = "2026-01-03T17:30:03.609Z" }, + { url = "https://files.pythonhosted.org/packages/9d/d4/dd1ca234c794fd29c057ce8c0566b8ef7fd6a51069de5f06fa84b9a1971c/aiohttp-3.13.3-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:5d2d94f1f5fcbe40838ac51a6ab5704a6f9ea42e72ceda48de5e6b898521da51", size = 1596024, upload-time = "2026-01-03T17:30:05.132Z" }, + { url = "https://files.pythonhosted.org/packages/55/58/4345b5f26661a6180afa686c473620c30a66afdf120ed3dd545bbc809e85/aiohttp-3.13.3-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:2be0e9ccf23e8a94f6f0650ce06042cefc6ac703d0d7ab6c7a917289f2539ad4", size = 1804590, upload-time = "2026-01-03T17:30:07.135Z" }, + { url = "https://files.pythonhosted.org/packages/7b/06/05950619af6c2df7e0a431d889ba2813c9f0129cec76f663e547a5ad56f2/aiohttp-3.13.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:9af5e68ee47d6534d36791bbe9b646d2a7c7deb6fc24d7943628edfbb3581f29", size = 1740355, upload-time = "2026-01-03T17:30:09.083Z" }, + { url = "https://files.pythonhosted.org/packages/3e/80/958f16de79ba0422d7c1e284b2abd0c84bc03394fbe631d0a39ffa10e1eb/aiohttp-3.13.3-cp311-cp311-win32.whl", hash = "sha256:a2212ad43c0833a873d0fb3c63fa1bacedd4cf6af2fee62bf4b739ceec3ab239", size = 433701, upload-time = "2026-01-03T17:30:10.869Z" }, + { url = "https://files.pythonhosted.org/packages/dc/f2/27cdf04c9851712d6c1b99df6821a6623c3c9e55956d4b1e318c337b5a48/aiohttp-3.13.3-cp311-cp311-win_amd64.whl", hash = "sha256:642f752c3eb117b105acbd87e2c143de710987e09860d674e068c4c2c441034f", size = 457678, upload-time = "2026-01-03T17:30:12.719Z" }, + { url = "https://files.pythonhosted.org/packages/a0/be/4fc11f202955a69e0db803a12a062b8379c970c7c84f4882b6da17337cc1/aiohttp-3.13.3-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:b903a4dfee7d347e2d87697d0713be59e0b87925be030c9178c5faa58ea58d5c", size = 739732, upload-time = "2026-01-03T17:30:14.23Z" }, + { url = "https://files.pythonhosted.org/packages/97/2c/621d5b851f94fa0bb7430d6089b3aa970a9d9b75196bc93bb624b0db237a/aiohttp-3.13.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:a45530014d7a1e09f4a55f4f43097ba0fd155089372e105e4bff4ca76cb1b168", size = 494293, upload-time = "2026-01-03T17:30:15.96Z" }, + { url = "https://files.pythonhosted.org/packages/5d/43/4be01406b78e1be8320bb8316dc9c42dbab553d281c40364e0f862d5661c/aiohttp-3.13.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:27234ef6d85c914f9efeb77ff616dbf4ad2380be0cda40b4db086ffc7ddd1b7d", size = 493533, upload-time = "2026-01-03T17:30:17.431Z" }, + { url = "https://files.pythonhosted.org/packages/8d/a8/5a35dc56a06a2c90d4742cbf35294396907027f80eea696637945a106f25/aiohttp-3.13.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d32764c6c9aafb7fb55366a224756387cd50bfa720f32b88e0e6fa45b27dcf29", size = 1737839, upload-time = "2026-01-03T17:30:19.422Z" }, + { url = "https://files.pythonhosted.org/packages/bf/62/4b9eeb331da56530bf2e198a297e5303e1c1ebdceeb00fe9b568a65c5a0c/aiohttp-3.13.3-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:b1a6102b4d3ebc07dad44fbf07b45bb600300f15b552ddf1851b5390202ea2e3", size = 1703932, upload-time = "2026-01-03T17:30:21.756Z" }, + { url = "https://files.pythonhosted.org/packages/7c/f6/af16887b5d419e6a367095994c0b1332d154f647e7dc2bd50e61876e8e3d/aiohttp-3.13.3-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c014c7ea7fb775dd015b2d3137378b7be0249a448a1612268b5a90c2d81de04d", size = 1771906, upload-time = "2026-01-03T17:30:23.932Z" }, + { url = "https://files.pythonhosted.org/packages/ce/83/397c634b1bcc24292fa1e0c7822800f9f6569e32934bdeef09dae7992dfb/aiohttp-3.13.3-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2b8d8ddba8f95ba17582226f80e2de99c7a7948e66490ef8d947e272a93e9463", size = 1871020, upload-time = "2026-01-03T17:30:26Z" }, + { url = "https://files.pythonhosted.org/packages/86/f6/a62cbbf13f0ac80a70f71b1672feba90fdb21fd7abd8dbf25c0105fb6fa3/aiohttp-3.13.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9ae8dd55c8e6c4257eae3a20fd2c8f41edaea5992ed67156642493b8daf3cecc", size = 1755181, upload-time = "2026-01-03T17:30:27.554Z" }, + { url = "https://files.pythonhosted.org/packages/0a/87/20a35ad487efdd3fba93d5843efdfaa62d2f1479eaafa7453398a44faf13/aiohttp-3.13.3-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:01ad2529d4b5035578f5081606a465f3b814c542882804e2e8cda61adf5c71bf", size = 1561794, upload-time = "2026-01-03T17:30:29.254Z" }, + { url = "https://files.pythonhosted.org/packages/de/95/8fd69a66682012f6716e1bc09ef8a1a2a91922c5725cb904689f112309c4/aiohttp-3.13.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:bb4f7475e359992b580559e008c598091c45b5088f28614e855e42d39c2f1033", size = 1697900, upload-time = "2026-01-03T17:30:31.033Z" }, + { url = "https://files.pythonhosted.org/packages/e5/66/7b94b3b5ba70e955ff597672dad1691333080e37f50280178967aff68657/aiohttp-3.13.3-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:c19b90316ad3b24c69cd78d5c9b4f3aa4497643685901185b65166293d36a00f", size = 1728239, upload-time = "2026-01-03T17:30:32.703Z" }, + { url = "https://files.pythonhosted.org/packages/47/71/6f72f77f9f7d74719692ab65a2a0252584bf8d5f301e2ecb4c0da734530a/aiohttp-3.13.3-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:96d604498a7c782cb15a51c406acaea70d8c027ee6b90c569baa6e7b93073679", size = 1740527, upload-time = "2026-01-03T17:30:34.695Z" }, + { url = "https://files.pythonhosted.org/packages/fa/b4/75ec16cbbd5c01bdaf4a05b19e103e78d7ce1ef7c80867eb0ace42ff4488/aiohttp-3.13.3-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:084911a532763e9d3dd95adf78a78f4096cd5f58cdc18e6fdbc1b58417a45423", size = 1554489, upload-time = "2026-01-03T17:30:36.864Z" }, + { url = "https://files.pythonhosted.org/packages/52/8f/bc518c0eea29f8406dcf7ed1f96c9b48e3bc3995a96159b3fc11f9e08321/aiohttp-3.13.3-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:7a4a94eb787e606d0a09404b9c38c113d3b099d508021faa615d70a0131907ce", size = 1767852, upload-time = "2026-01-03T17:30:39.433Z" }, + { url = "https://files.pythonhosted.org/packages/9d/f2/a07a75173124f31f11ea6f863dc44e6f09afe2bca45dd4e64979490deab1/aiohttp-3.13.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:87797e645d9d8e222e04160ee32aa06bc5c163e8499f24db719e7852ec23093a", size = 1722379, upload-time = "2026-01-03T17:30:41.081Z" }, + { url = "https://files.pythonhosted.org/packages/3c/4a/1a3fee7c21350cac78e5c5cef711bac1b94feca07399f3d406972e2d8fcd/aiohttp-3.13.3-cp312-cp312-win32.whl", hash = "sha256:b04be762396457bef43f3597c991e192ee7da460a4953d7e647ee4b1c28e7046", size = 428253, upload-time = "2026-01-03T17:30:42.644Z" }, + { url = "https://files.pythonhosted.org/packages/d9/b7/76175c7cb4eb73d91ad63c34e29fc4f77c9386bba4a65b53ba8e05ee3c39/aiohttp-3.13.3-cp312-cp312-win_amd64.whl", hash = "sha256:e3531d63d3bdfa7e3ac5e9b27b2dd7ec9df3206a98e0b3445fa906f233264c57", size = 455407, upload-time = "2026-01-03T17:30:44.195Z" }, + { url = "https://files.pythonhosted.org/packages/97/8a/12ca489246ca1faaf5432844adbfce7ff2cc4997733e0af120869345643a/aiohttp-3.13.3-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:5dff64413671b0d3e7d5918ea490bdccb97a4ad29b3f311ed423200b2203e01c", size = 734190, upload-time = "2026-01-03T17:30:45.832Z" }, + { url = "https://files.pythonhosted.org/packages/32/08/de43984c74ed1fca5c014808963cc83cb00d7bb06af228f132d33862ca76/aiohttp-3.13.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:87b9aab6d6ed88235aa2970294f496ff1a1f9adcd724d800e9b952395a80ffd9", size = 491783, upload-time = "2026-01-03T17:30:47.466Z" }, + { url = "https://files.pythonhosted.org/packages/17/f8/8dd2cf6112a5a76f81f81a5130c57ca829d101ad583ce57f889179accdda/aiohttp-3.13.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:425c126c0dc43861e22cb1c14ba4c8e45d09516d0a3ae0a3f7494b79f5f233a3", size = 490704, upload-time = "2026-01-03T17:30:49.373Z" }, + { url = "https://files.pythonhosted.org/packages/6d/40/a46b03ca03936f832bc7eaa47cfbb1ad012ba1be4790122ee4f4f8cba074/aiohttp-3.13.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7f9120f7093c2a32d9647abcaf21e6ad275b4fbec5b55969f978b1a97c7c86bf", size = 1720652, upload-time = "2026-01-03T17:30:50.974Z" }, + { url = "https://files.pythonhosted.org/packages/f7/7e/917fe18e3607af92657e4285498f500dca797ff8c918bd7d90b05abf6c2a/aiohttp-3.13.3-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:697753042d57f4bf7122cab985bf15d0cef23c770864580f5af4f52023a56bd6", size = 1692014, upload-time = "2026-01-03T17:30:52.729Z" }, + { url = "https://files.pythonhosted.org/packages/71/b6/cefa4cbc00d315d68973b671cf105b21a609c12b82d52e5d0c9ae61d2a09/aiohttp-3.13.3-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:6de499a1a44e7de70735d0b39f67c8f25eb3d91eb3103be99ca0fa882cdd987d", size = 1759777, upload-time = "2026-01-03T17:30:54.537Z" }, + { url = "https://files.pythonhosted.org/packages/fb/e3/e06ee07b45e59e6d81498b591fc589629be1553abb2a82ce33efe2a7b068/aiohttp-3.13.3-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:37239e9f9a7ea9ac5bf6b92b0260b01f8a22281996da609206a84df860bc1261", size = 1861276, upload-time = "2026-01-03T17:30:56.512Z" }, + { url = "https://files.pythonhosted.org/packages/7c/24/75d274228acf35ceeb2850b8ce04de9dd7355ff7a0b49d607ee60c29c518/aiohttp-3.13.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f76c1e3fe7d7c8afad7ed193f89a292e1999608170dcc9751a7462a87dfd5bc0", size = 1743131, upload-time = "2026-01-03T17:30:58.256Z" }, + { url = "https://files.pythonhosted.org/packages/04/98/3d21dde21889b17ca2eea54fdcff21b27b93f45b7bb94ca029c31ab59dc3/aiohttp-3.13.3-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:fc290605db2a917f6e81b0e1e0796469871f5af381ce15c604a3c5c7e51cb730", size = 1556863, upload-time = "2026-01-03T17:31:00.445Z" }, + { url = "https://files.pythonhosted.org/packages/9e/84/da0c3ab1192eaf64782b03971ab4055b475d0db07b17eff925e8c93b3aa5/aiohttp-3.13.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4021b51936308aeea0367b8f006dc999ca02bc118a0cc78c303f50a2ff6afb91", size = 1682793, upload-time = "2026-01-03T17:31:03.024Z" }, + { url = "https://files.pythonhosted.org/packages/ff/0f/5802ada182f575afa02cbd0ec5180d7e13a402afb7c2c03a9aa5e5d49060/aiohttp-3.13.3-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:49a03727c1bba9a97d3e93c9f93ca03a57300f484b6e935463099841261195d3", size = 1716676, upload-time = "2026-01-03T17:31:04.842Z" }, + { url = "https://files.pythonhosted.org/packages/3f/8c/714d53bd8b5a4560667f7bbbb06b20c2382f9c7847d198370ec6526af39c/aiohttp-3.13.3-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:3d9908a48eb7416dc1f4524e69f1d32e5d90e3981e4e37eb0aa1cd18f9cfa2a4", size = 1733217, upload-time = "2026-01-03T17:31:06.868Z" }, + { url = "https://files.pythonhosted.org/packages/7d/79/e2176f46d2e963facea939f5be2d26368ce543622be6f00a12844d3c991f/aiohttp-3.13.3-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:2712039939ec963c237286113c68dbad80a82a4281543f3abf766d9d73228998", size = 1552303, upload-time = "2026-01-03T17:31:08.958Z" }, + { url = "https://files.pythonhosted.org/packages/ab/6a/28ed4dea1759916090587d1fe57087b03e6c784a642b85ef48217b0277ae/aiohttp-3.13.3-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:7bfdc049127717581866fa4708791220970ce291c23e28ccf3922c700740fdc0", size = 1763673, upload-time = "2026-01-03T17:31:10.676Z" }, + { url = "https://files.pythonhosted.org/packages/e8/35/4a3daeb8b9fab49240d21c04d50732313295e4bd813a465d840236dd0ce1/aiohttp-3.13.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8057c98e0c8472d8846b9c79f56766bcc57e3e8ac7bfd510482332366c56c591", size = 1721120, upload-time = "2026-01-03T17:31:12.575Z" }, + { url = "https://files.pythonhosted.org/packages/bc/9f/d643bb3c5fb99547323e635e251c609fbbc660d983144cfebec529e09264/aiohttp-3.13.3-cp313-cp313-win32.whl", hash = "sha256:1449ceddcdbcf2e0446957863af03ebaaa03f94c090f945411b61269e2cb5daf", size = 427383, upload-time = "2026-01-03T17:31:14.382Z" }, + { url = "https://files.pythonhosted.org/packages/4e/f1/ab0395f8a79933577cdd996dd2f9aa6014af9535f65dddcf88204682fe62/aiohttp-3.13.3-cp313-cp313-win_amd64.whl", hash = "sha256:693781c45a4033d31d4187d2436f5ac701e7bbfe5df40d917736108c1cc7436e", size = 453899, upload-time = "2026-01-03T17:31:15.958Z" }, + { url = "https://files.pythonhosted.org/packages/99/36/5b6514a9f5d66f4e2597e40dea2e3db271e023eb7a5d22defe96ba560996/aiohttp-3.13.3-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:ea37047c6b367fd4bd632bff8077449b8fa034b69e812a18e0132a00fae6e808", size = 737238, upload-time = "2026-01-03T17:31:17.909Z" }, + { url = "https://files.pythonhosted.org/packages/f7/49/459327f0d5bcd8c6c9ca69e60fdeebc3622861e696490d8674a6d0cb90a6/aiohttp-3.13.3-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:6fc0e2337d1a4c3e6acafda6a78a39d4c14caea625124817420abceed36e2415", size = 492292, upload-time = "2026-01-03T17:31:19.919Z" }, + { url = "https://files.pythonhosted.org/packages/e8/0b/b97660c5fd05d3495b4eb27f2d0ef18dc1dc4eff7511a9bf371397ff0264/aiohttp-3.13.3-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c685f2d80bb67ca8c3837823ad76196b3694b0159d232206d1e461d3d434666f", size = 493021, upload-time = "2026-01-03T17:31:21.636Z" }, + { url = "https://files.pythonhosted.org/packages/54/d4/438efabdf74e30aeceb890c3290bbaa449780583b1270b00661126b8aae4/aiohttp-3.13.3-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:48e377758516d262bde50c2584fc6c578af272559c409eecbdd2bae1601184d6", size = 1717263, upload-time = "2026-01-03T17:31:23.296Z" }, + { url = "https://files.pythonhosted.org/packages/71/f2/7bddc7fd612367d1459c5bcf598a9e8f7092d6580d98de0e057eb42697ad/aiohttp-3.13.3-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:34749271508078b261c4abb1767d42b8d0c0cc9449c73a4df494777dc55f0687", size = 1669107, upload-time = "2026-01-03T17:31:25.334Z" }, + { url = "https://files.pythonhosted.org/packages/00/5a/1aeaecca40e22560f97610a329e0e5efef5e0b5afdf9f857f0d93839ab2e/aiohttp-3.13.3-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:82611aeec80eb144416956ec85b6ca45a64d76429c1ed46ae1b5f86c6e0c9a26", size = 1760196, upload-time = "2026-01-03T17:31:27.394Z" }, + { url = "https://files.pythonhosted.org/packages/f8/f8/0ff6992bea7bd560fc510ea1c815f87eedd745fe035589c71ce05612a19a/aiohttp-3.13.3-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2fff83cfc93f18f215896e3a190e8e5cb413ce01553901aca925176e7568963a", size = 1843591, upload-time = "2026-01-03T17:31:29.238Z" }, + { url = "https://files.pythonhosted.org/packages/e3/d1/e30e537a15f53485b61f5be525f2157da719819e8377298502aebac45536/aiohttp-3.13.3-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bbe7d4cecacb439e2e2a8a1a7b935c25b812af7a5fd26503a66dadf428e79ec1", size = 1720277, upload-time = "2026-01-03T17:31:31.053Z" }, + { url = "https://files.pythonhosted.org/packages/84/45/23f4c451d8192f553d38d838831ebbc156907ea6e05557f39563101b7717/aiohttp-3.13.3-cp314-cp314-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b928f30fe49574253644b1ca44b1b8adbd903aa0da4b9054a6c20fc7f4092a25", size = 1548575, upload-time = "2026-01-03T17:31:32.87Z" }, + { url = "https://files.pythonhosted.org/packages/6a/ed/0a42b127a43712eda7807e7892c083eadfaf8429ca8fb619662a530a3aab/aiohttp-3.13.3-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:7b5e8fe4de30df199155baaf64f2fcd604f4c678ed20910db8e2c66dc4b11603", size = 1679455, upload-time = "2026-01-03T17:31:34.76Z" }, + { url = "https://files.pythonhosted.org/packages/2e/b5/c05f0c2b4b4fe2c9d55e73b6d3ed4fd6c9dc2684b1d81cbdf77e7fad9adb/aiohttp-3.13.3-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:8542f41a62bcc58fc7f11cf7c90e0ec324ce44950003feb70640fc2a9092c32a", size = 1687417, upload-time = "2026-01-03T17:31:36.699Z" }, + { url = "https://files.pythonhosted.org/packages/c9/6b/915bc5dad66aef602b9e459b5a973529304d4e89ca86999d9d75d80cbd0b/aiohttp-3.13.3-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:5e1d8c8b8f1d91cd08d8f4a3c2b067bfca6ec043d3ff36de0f3a715feeedf926", size = 1729968, upload-time = "2026-01-03T17:31:38.622Z" }, + { url = "https://files.pythonhosted.org/packages/11/3b/e84581290a9520024a08640b63d07673057aec5ca548177a82026187ba73/aiohttp-3.13.3-cp314-cp314-musllinux_1_2_riscv64.whl", hash = "sha256:90455115e5da1c3c51ab619ac57f877da8fd6d73c05aacd125c5ae9819582aba", size = 1545690, upload-time = "2026-01-03T17:31:40.57Z" }, + { url = "https://files.pythonhosted.org/packages/f5/04/0c3655a566c43fd647c81b895dfe361b9f9ad6d58c19309d45cff52d6c3b/aiohttp-3.13.3-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:042e9e0bcb5fba81886c8b4fbb9a09d6b8a00245fd8d88e4d989c1f96c74164c", size = 1746390, upload-time = "2026-01-03T17:31:42.857Z" }, + { url = "https://files.pythonhosted.org/packages/1f/53/71165b26978f719c3419381514c9690bd5980e764a09440a10bb816ea4ab/aiohttp-3.13.3-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:2eb752b102b12a76ca02dff751a801f028b4ffbbc478840b473597fc91a9ed43", size = 1702188, upload-time = "2026-01-03T17:31:44.984Z" }, + { url = "https://files.pythonhosted.org/packages/29/a7/cbe6c9e8e136314fa1980da388a59d2f35f35395948a08b6747baebb6aa6/aiohttp-3.13.3-cp314-cp314-win32.whl", hash = "sha256:b556c85915d8efaed322bf1bdae9486aa0f3f764195a0fb6ee962e5c71ef5ce1", size = 433126, upload-time = "2026-01-03T17:31:47.463Z" }, + { url = "https://files.pythonhosted.org/packages/de/56/982704adea7d3b16614fc5936014e9af85c0e34b58f9046655817f04306e/aiohttp-3.13.3-cp314-cp314-win_amd64.whl", hash = "sha256:9bf9f7a65e7aa20dd764151fb3d616c81088f91f8df39c3893a536e279b4b984", size = 459128, upload-time = "2026-01-03T17:31:49.2Z" }, + { url = "https://files.pythonhosted.org/packages/6c/2a/3c79b638a9c3d4658d345339d22070241ea341ed4e07b5ac60fb0f418003/aiohttp-3.13.3-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:05861afbbec40650d8a07ea324367cb93e9e8cc7762e04dd4405df99fa65159c", size = 769512, upload-time = "2026-01-03T17:31:51.134Z" }, + { url = "https://files.pythonhosted.org/packages/29/b9/3e5014d46c0ab0db8707e0ac2711ed28c4da0218c358a4e7c17bae0d8722/aiohttp-3.13.3-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:2fc82186fadc4a8316768d61f3722c230e2c1dcab4200d52d2ebdf2482e47592", size = 506444, upload-time = "2026-01-03T17:31:52.85Z" }, + { url = "https://files.pythonhosted.org/packages/90/03/c1d4ef9a054e151cd7839cdc497f2638f00b93cbe8043983986630d7a80c/aiohttp-3.13.3-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:0add0900ff220d1d5c5ebbf99ed88b0c1bbf87aa7e4262300ed1376a6b13414f", size = 510798, upload-time = "2026-01-03T17:31:54.91Z" }, + { url = "https://files.pythonhosted.org/packages/ea/76/8c1e5abbfe8e127c893fe7ead569148a4d5a799f7cf958d8c09f3eedf097/aiohttp-3.13.3-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:568f416a4072fbfae453dcf9a99194bbb8bdeab718e08ee13dfa2ba0e4bebf29", size = 1868835, upload-time = "2026-01-03T17:31:56.733Z" }, + { url = "https://files.pythonhosted.org/packages/8e/ac/984c5a6f74c363b01ff97adc96a3976d9c98940b8969a1881575b279ac5d/aiohttp-3.13.3-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:add1da70de90a2569c5e15249ff76a631ccacfe198375eead4aadf3b8dc849dc", size = 1720486, upload-time = "2026-01-03T17:31:58.65Z" }, + { url = "https://files.pythonhosted.org/packages/b2/9a/b7039c5f099c4eb632138728828b33428585031a1e658d693d41d07d89d1/aiohttp-3.13.3-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:10b47b7ba335d2e9b1239fa571131a87e2d8ec96b333e68b2a305e7a98b0bae2", size = 1847951, upload-time = "2026-01-03T17:32:00.989Z" }, + { url = "https://files.pythonhosted.org/packages/3c/02/3bec2b9a1ba3c19ff89a43a19324202b8eb187ca1e928d8bdac9bbdddebd/aiohttp-3.13.3-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:3dd4dce1c718e38081c8f35f323209d4c1df7d4db4bab1b5c88a6b4d12b74587", size = 1941001, upload-time = "2026-01-03T17:32:03.122Z" }, + { url = "https://files.pythonhosted.org/packages/37/df/d879401cedeef27ac4717f6426c8c36c3091c6e9f08a9178cc87549c537f/aiohttp-3.13.3-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:34bac00a67a812570d4a460447e1e9e06fae622946955f939051e7cc895cfab8", size = 1797246, upload-time = "2026-01-03T17:32:05.255Z" }, + { url = "https://files.pythonhosted.org/packages/8d/15/be122de1f67e6953add23335c8ece6d314ab67c8bebb3f181063010795a7/aiohttp-3.13.3-cp314-cp314t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:a19884d2ee70b06d9204b2727a7b9f983d0c684c650254679e716b0b77920632", size = 1627131, upload-time = "2026-01-03T17:32:07.607Z" }, + { url = "https://files.pythonhosted.org/packages/12/12/70eedcac9134cfa3219ab7af31ea56bc877395b1ac30d65b1bc4b27d0438/aiohttp-3.13.3-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:5f8ca7f2bb6ba8348a3614c7918cc4bb73268c5ac2a207576b7afea19d3d9f64", size = 1795196, upload-time = "2026-01-03T17:32:09.59Z" }, + { url = "https://files.pythonhosted.org/packages/32/11/b30e1b1cd1f3054af86ebe60df96989c6a414dd87e27ad16950eee420bea/aiohttp-3.13.3-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:b0d95340658b9d2f11d9697f59b3814a9d3bb4b7a7c20b131df4bcef464037c0", size = 1782841, upload-time = "2026-01-03T17:32:11.445Z" }, + { url = "https://files.pythonhosted.org/packages/88/0d/d98a9367b38912384a17e287850f5695c528cff0f14f791ce8ee2e4f7796/aiohttp-3.13.3-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:a1e53262fd202e4b40b70c3aff944a8155059beedc8a89bba9dc1f9ef06a1b56", size = 1795193, upload-time = "2026-01-03T17:32:13.705Z" }, + { url = "https://files.pythonhosted.org/packages/43/a5/a2dfd1f5ff5581632c7f6a30e1744deda03808974f94f6534241ef60c751/aiohttp-3.13.3-cp314-cp314t-musllinux_1_2_riscv64.whl", hash = "sha256:d60ac9663f44168038586cab2157e122e46bdef09e9368b37f2d82d354c23f72", size = 1621979, upload-time = "2026-01-03T17:32:15.965Z" }, + { url = "https://files.pythonhosted.org/packages/fa/f0/12973c382ae7c1cccbc4417e129c5bf54c374dfb85af70893646e1f0e749/aiohttp-3.13.3-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:90751b8eed69435bac9ff4e3d2f6b3af1f57e37ecb0fbeee59c0174c9e2d41df", size = 1822193, upload-time = "2026-01-03T17:32:18.219Z" }, + { url = "https://files.pythonhosted.org/packages/3c/5f/24155e30ba7f8c96918af1350eb0663e2430aad9e001c0489d89cd708ab1/aiohttp-3.13.3-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:fc353029f176fd2b3ec6cfc71be166aba1936fe5d73dd1992ce289ca6647a9aa", size = 1769801, upload-time = "2026-01-03T17:32:20.25Z" }, + { url = "https://files.pythonhosted.org/packages/eb/f8/7314031ff5c10e6ece114da79b338ec17eeff3a079e53151f7e9f43c4723/aiohttp-3.13.3-cp314-cp314t-win32.whl", hash = "sha256:2e41b18a58da1e474a057b3d35248d8320029f61d70a37629535b16a0c8f3767", size = 466523, upload-time = "2026-01-03T17:32:22.215Z" }, + { url = "https://files.pythonhosted.org/packages/b4/63/278a98c715ae467624eafe375542d8ba9b4383a016df8fdefe0ae28382a7/aiohttp-3.13.3-cp314-cp314t-win_amd64.whl", hash = "sha256:44531a36aa2264a1860089ffd4dce7baf875ee5a6079d5fb42e261c704ef7344", size = 499694, upload-time = "2026-01-03T17:32:24.546Z" }, + { url = "https://files.pythonhosted.org/packages/bf/79/446655656861d3e7e2c32bfcf160c7aa9e9dc63776a691b124dba65cdd77/aiohttp-3.13.3-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:31a83ea4aead760dfcb6962efb1d861db48c34379f2ff72db9ddddd4cda9ea2e", size = 741433, upload-time = "2026-01-03T17:32:26.453Z" }, + { url = "https://files.pythonhosted.org/packages/cb/49/773c4b310b5140d2fb5e79bb0bf40b7b41dad80a288ca1a8759f5f72bda9/aiohttp-3.13.3-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:988a8c5e317544fdf0d39871559e67b6341065b87fceac641108c2096d5506b7", size = 497332, upload-time = "2026-01-03T17:32:28.37Z" }, + { url = "https://files.pythonhosted.org/packages/bc/31/1dcbc4b83a4e6f76a0ad883f07f21ffbfe29750c89db97381701508c9f45/aiohttp-3.13.3-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:9b174f267b5cfb9a7dba9ee6859cecd234e9a681841eb85068059bc867fb8f02", size = 492365, upload-time = "2026-01-03T17:32:30.234Z" }, + { url = "https://files.pythonhosted.org/packages/5a/b5/b50657496c8754482cd7964e50aaf3aa84b3db61ed45daec4c1aec5b94b4/aiohttp-3.13.3-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:947c26539750deeaee933b000fb6517cc770bbd064bad6033f1cff4803881e43", size = 1660440, upload-time = "2026-01-03T17:32:32.586Z" }, + { url = "https://files.pythonhosted.org/packages/2a/73/9b69e5139d89d75127569298931444ad78ea86a5befd5599780b1e9a6880/aiohttp-3.13.3-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:9ebf57d09e131f5323464bd347135a88622d1c0976e88ce15b670e7ad57e4bd6", size = 1632740, upload-time = "2026-01-03T17:32:34.793Z" }, + { url = "https://files.pythonhosted.org/packages/ef/fe/3ea9b5af694b4e3aec0d0613a806132ca744747146fca68e96bf056f61a7/aiohttp-3.13.3-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:4ae5b5a0e1926e504c81c5b84353e7a5516d8778fbbff00429fe7b05bb25cbce", size = 1719782, upload-time = "2026-01-03T17:32:37.737Z" }, + { url = "https://files.pythonhosted.org/packages/fb/c2/46b3b06e60851cbb71efb0f79a3267279cbef7b12c58e68a1e897f269cca/aiohttp-3.13.3-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2ba0eea45eb5cc3172dbfc497c066f19c41bac70963ea1a67d51fc92e4cf9a80", size = 1813527, upload-time = "2026-01-03T17:32:39.973Z" }, + { url = "https://files.pythonhosted.org/packages/36/23/71ceb78c769ed65fe4c697692de232b63dab399210678d2b00961ccb0619/aiohttp-3.13.3-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bae5c2ed2eae26cc382020edad80d01f36cb8e746da40b292e68fec40421dc6a", size = 1661268, upload-time = "2026-01-03T17:32:42.082Z" }, + { url = "https://files.pythonhosted.org/packages/c4/8d/86e929523d955e85ebab7c0e2b9e0cb63604cfc27dc3280e10d0063cf682/aiohttp-3.13.3-cp39-cp39-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:8a60e60746623925eab7d25823329941aee7242d559baa119ca2b253c88a7bd6", size = 1552742, upload-time = "2026-01-03T17:32:44.622Z" }, + { url = "https://files.pythonhosted.org/packages/3a/ea/3f5987cba1bab6bd151f0d97aa60f0ce04d3c83316692a6bb6ba2fb69f92/aiohttp-3.13.3-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:e50a2e1404f063427c9d027378472316201a2290959a295169bcf25992d04558", size = 1632918, upload-time = "2026-01-03T17:32:46.749Z" }, + { url = "https://files.pythonhosted.org/packages/be/2c/7e1e85121f2e31ee938cb83a8f32dfafd4908530c10fabd6d46761c12ac7/aiohttp-3.13.3-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:9a9dc347e5a3dc7dfdbc1f82da0ef29e388ddb2ed281bfce9dd8248a313e62b7", size = 1644446, upload-time = "2026-01-03T17:32:49.063Z" }, + { url = "https://files.pythonhosted.org/packages/5d/35/ce6133d423ad0e8ca976a7c848f7146bca3520eea4ccf6b95e2d077c9d20/aiohttp-3.13.3-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:b46020d11d23fe16551466c77823df9cc2f2c1e63cc965daf67fa5eec6ca1877", size = 1689487, upload-time = "2026-01-03T17:32:51.113Z" }, + { url = "https://files.pythonhosted.org/packages/50/f7/ff7a27c15603d460fd1366b3c22054f7ae4fa9310aca40b43bde35867fcd/aiohttp-3.13.3-cp39-cp39-musllinux_1_2_riscv64.whl", hash = "sha256:69c56fbc1993fa17043e24a546959c0178fe2b5782405ad4559e6c13975c15e3", size = 1540715, upload-time = "2026-01-03T17:32:53.38Z" }, + { url = "https://files.pythonhosted.org/packages/17/02/053f11346e5b962e6d8a1c4f8c70c29d5970a1b4b8e7894c68e12c27a57f/aiohttp-3.13.3-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:b99281b0704c103d4e11e72a76f1b543d4946fea7dd10767e7e1b5f00d4e5704", size = 1711835, upload-time = "2026-01-03T17:32:56.088Z" }, + { url = "https://files.pythonhosted.org/packages/fb/71/9b9761ddf276fd6708d13720197cbac19b8d67ecfa9116777924056cfcaa/aiohttp-3.13.3-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:40c5e40ecc29ba010656c18052b877a1c28f84344825efa106705e835c28530f", size = 1649593, upload-time = "2026-01-03T17:32:58.181Z" }, + { url = "https://files.pythonhosted.org/packages/ae/72/5d817e9ea218acae12a5e3b9ad1178cf0c12fc3570c0b47eea2daf95f9ea/aiohttp-3.13.3-cp39-cp39-win32.whl", hash = "sha256:56339a36b9f1fc708260c76c87e593e2afb30d26de9ae1eb445b5e051b98a7a1", size = 434831, upload-time = "2026-01-03T17:33:00.577Z" }, + { url = "https://files.pythonhosted.org/packages/39/cb/22659d9bf3149b7a2927bc2769cc9c8f8f5a80eba098398e03c199a43a85/aiohttp-3.13.3-cp39-cp39-win_amd64.whl", hash = "sha256:c6b8568a3bb5819a0ad087f16d40e5a3fb6099f39ea1d5625a3edc1e923fc538", size = 457697, upload-time = "2026-01-03T17:33:03.167Z" }, +] + +[[package]] +name = "aiosignal" +version = "1.4.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "frozenlist" }, + { name = "typing-extensions", marker = "python_full_version < '3.13' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/61/62/06741b579156360248d1ec624842ad0edf697050bbaf7c3e46394e106ad1/aiosignal-1.4.0.tar.gz", hash = "sha256:f47eecd9468083c2029cc99945502cb7708b082c232f9aca65da147157b251c7", size = 25007, upload-time = "2025-07-03T22:54:43.528Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/fb/76/641ae371508676492379f16e2fa48f4e2c11741bd63c48be4b12a6b09cba/aiosignal-1.4.0-py3-none-any.whl", hash = "sha256:053243f8b92b990551949e63930a839ff0cf0b0ebbe0597b0f3fb19e1a0fe82e", size = 7490, upload-time = "2025-07-03T22:54:42.156Z" }, +] + +[[package]] +name = "annotated-types" +version = "0.7.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/ee/67/531ea369ba64dcff5ec9c3402f9f51bf748cec26dde048a2f973a4eea7f5/annotated_types-0.7.0.tar.gz", hash = "sha256:aff07c09a53a08bc8cfccb9c85b05f1aa9a2a6f23728d790723543408344ce89", size = 16081, upload-time = "2024-05-20T21:33:25.928Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/78/b6/6307fbef88d9b5ee7421e68d78a9f162e0da4900bc5f5793f6d3d0e34fb8/annotated_types-0.7.0-py3-none-any.whl", hash = "sha256:1f02e8b43a8fbbc3f3e0d4f0f4bfc8131bcb4eebe8849b8e5c773f3a1c582a53", size = 13643, upload-time = "2024-05-20T21:33:24.1Z" }, +] + +[[package]] +name = "anyio" +version = "4.12.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "exceptiongroup", marker = "python_full_version < '3.11' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "idna" }, + { name = "typing-extensions", marker = "python_full_version < '3.13' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/96/f0/5eb65b2bb0d09ac6776f2eb54adee6abe8228ea05b20a5ad0e4945de8aac/anyio-4.12.1.tar.gz", hash = "sha256:41cfcc3a4c85d3f05c932da7c26d0201ac36f72abd4435ba90d0464a3ffed703", size = 228685, upload-time = "2026-01-06T11:45:21.246Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/38/0e/27be9fdef66e72d64c0cdc3cc2823101b80585f8119b5c112c2e8f5f7dab/anyio-4.12.1-py3-none-any.whl", hash = "sha256:d405828884fc140aa80a3c667b8beed277f1dfedec42ba031bd6ac3db606ab6c", size = 113592, upload-time = "2026-01-06T11:45:19.497Z" }, +] + +[[package]] +name = "async-timeout" +version = "5.0.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a5/ae/136395dfbfe00dfc94da3f3e136d0b13f394cba8f4841120e34226265780/async_timeout-5.0.1.tar.gz", hash = "sha256:d9321a7a3d5a6a5e187e824d2fa0793ce379a202935782d555d6e9d2735677d3", size = 9274, upload-time = "2024-11-06T16:41:39.6Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/fe/ba/e2081de779ca30d473f21f5b30e0e737c438205440784c7dfc81efc2b029/async_timeout-5.0.1-py3-none-any.whl", hash = "sha256:39e3809566ff85354557ec2398b55e096c8364bacac9405a7a1fa429e77fe76c", size = 6233, upload-time = "2024-11-06T16:41:37.9Z" }, +] + +[[package]] +name = "attrs" +version = "25.4.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/6b/5c/685e6633917e101e5dcb62b9dd76946cbb57c26e133bae9e0cd36033c0a9/attrs-25.4.0.tar.gz", hash = "sha256:16d5969b87f0859ef33a48b35d55ac1be6e42ae49d5e853b597db70c35c57e11", size = 934251, upload-time = "2025-10-06T13:54:44.725Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3a/2a/7cc015f5b9f5db42b7d48157e23356022889fc354a2813c15934b7cb5c0e/attrs-25.4.0-py3-none-any.whl", hash = "sha256:adcf7e2a1fb3b36ac48d97835bb6d8ade15b8dcce26aba8bf1d14847b57a3373", size = 67615, upload-time = "2025-10-06T13:54:43.17Z" }, +] + +[[package]] +name = "backports-asyncio-runner" +version = "1.2.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/8e/ff/70dca7d7cb1cbc0edb2c6cc0c38b65cba36cccc491eca64cabd5fe7f8670/backports_asyncio_runner-1.2.0.tar.gz", hash = "sha256:a5aa7b2b7d8f8bfcaa2b57313f70792df84e32a2a746f585213373f900b42162", size = 69893, upload-time = "2025-07-02T02:27:15.685Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a0/59/76ab57e3fe74484f48a53f8e337171b4a2349e506eabe136d7e01d059086/backports_asyncio_runner-1.2.0-py3-none-any.whl", hash = "sha256:0da0a936a8aeb554eccb426dc55af3ba63bcdc69fa1a600b5bb305413a4477b5", size = 12313, upload-time = "2025-07-02T02:27:14.263Z" }, +] + +[[package]] +name = "certifi" +version = "2026.1.4" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/e0/2d/a891ca51311197f6ad14a7ef42e2399f36cf2f9bd44752b3dc4eab60fdc5/certifi-2026.1.4.tar.gz", hash = "sha256:ac726dd470482006e014ad384921ed6438c457018f4b3d204aea4281258b2120", size = 154268, upload-time = "2026-01-04T02:42:41.825Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e6/ad/3cc14f097111b4de0040c83a525973216457bbeeb63739ef1ed275c1c021/certifi-2026.1.4-py3-none-any.whl", hash = "sha256:9943707519e4add1115f44c2bc244f782c0249876bf51b6599fee1ffbedd685c", size = 152900, upload-time = "2026-01-04T02:42:40.15Z" }, +] + +[[package]] +name = "colorama" +version = "0.4.6" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/d8/53/6f443c9a4a8358a93a6792e2acffb9d9d5cb0a5cfd8802644b7b1c9a02e4/colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44", size = 27697, upload-time = "2022-10-25T02:36:22.414Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335, upload-time = "2022-10-25T02:36:20.889Z" }, +] + +[[package]] +name = "dirty-equals" +version = "0.11" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/30/1d/c5913ac9d6615515a00f4bdc71356d302437cb74ff2e9aaccd3c14493b78/dirty_equals-0.11.tar.gz", hash = "sha256:f4ac74ee88f2d11e2fa0f65eb30ee4f07105c5f86f4dc92b09eb1138775027c3", size = 128067, upload-time = "2025-11-17T01:51:24.451Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/bb/8d/dbff05239043271dbeace563a7686212a3dd517864a35623fe4d4a64ca19/dirty_equals-0.11-py3-none-any.whl", hash = "sha256:b1d7093273fc2f9be12f443a8ead954ef6daaf6746fd42ef3a5616433ee85286", size = 28051, upload-time = "2025-11-17T01:51:22.849Z" }, +] + +[[package]] +name = "distro" +version = "1.9.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/fc/f8/98eea607f65de6527f8a2e8885fc8015d3e6f5775df186e443e0964a11c3/distro-1.9.0.tar.gz", hash = "sha256:2fa77c6fd8940f116ee1d6b94a2f90b13b5ea8d019b98bc8bafdcabcdd9bdbed", size = 60722, upload-time = "2023-12-24T09:54:32.31Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/12/b3/231ffd4ab1fc9d679809f356cebee130ac7daa00d6d6f3206dd4fd137e9e/distro-1.9.0-py3-none-any.whl", hash = "sha256:7bffd925d65168f85027d8da9af6bddab658135b840670a223589bc0c8ef02b2", size = 20277, upload-time = "2023-12-24T09:54:30.421Z" }, +] + +[[package]] +name = "exceptiongroup" +version = "1.3.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "typing-extensions", marker = "python_full_version < '3.13' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/50/79/66800aadf48771f6b62f7eb014e352e5d06856655206165d775e675a02c9/exceptiongroup-1.3.1.tar.gz", hash = "sha256:8b412432c6055b0b7d14c310000ae93352ed6754f70fa8f7c34141f91c4e3219", size = 30371, upload-time = "2025-11-21T23:01:54.787Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/8a/0e/97c33bf5009bdbac74fd2beace167cab3f978feb69cc36f1ef79360d6c4e/exceptiongroup-1.3.1-py3-none-any.whl", hash = "sha256:a7a39a3bd276781e98394987d3a5701d0c4edffb633bb7a5144577f82c773598", size = 16740, upload-time = "2025-11-21T23:01:53.443Z" }, +] + +[[package]] +name = "execnet" +version = "2.1.2" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/bf/89/780e11f9588d9e7128a3f87788354c7946a9cbb1401ad38a48c4db9a4f07/execnet-2.1.2.tar.gz", hash = "sha256:63d83bfdd9a23e35b9c6a3261412324f964c2ec8dcd8d3c6916ee9373e0befcd", size = 166622, upload-time = "2025-11-12T09:56:37.75Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ab/84/02fc1827e8cdded4aa65baef11296a9bbe595c474f0d6d758af082d849fd/execnet-2.1.2-py3-none-any.whl", hash = "sha256:67fba928dd5a544b783f6056f449e5e3931a5c378b128bc18501f7ea79e296ec", size = 40708, upload-time = "2025-11-12T09:56:36.333Z" }, +] + +[[package]] +name = "frozenlist" +version = "1.8.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/2d/f5/c831fac6cc817d26fd54c7eaccd04ef7e0288806943f7cc5bbf69f3ac1f0/frozenlist-1.8.0.tar.gz", hash = "sha256:3ede829ed8d842f6cd48fc7081d7a41001a56f1f38603f9d49bf3020d59a31ad", size = 45875, upload-time = "2025-10-06T05:38:17.865Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/83/4a/557715d5047da48d54e659203b9335be7bfaafda2c3f627b7c47e0b3aaf3/frozenlist-1.8.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:b37f6d31b3dcea7deb5e9696e529a6aa4a898adc33db82da12e4c60a7c4d2011", size = 86230, upload-time = "2025-10-06T05:35:23.699Z" }, + { url = "https://files.pythonhosted.org/packages/a2/fb/c85f9fed3ea8fe8740e5b46a59cc141c23b842eca617da8876cfce5f760e/frozenlist-1.8.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:ef2b7b394f208233e471abc541cc6991f907ffd47dc72584acee3147899d6565", size = 49621, upload-time = "2025-10-06T05:35:25.341Z" }, + { url = "https://files.pythonhosted.org/packages/63/70/26ca3f06aace16f2352796b08704338d74b6d1a24ca38f2771afbb7ed915/frozenlist-1.8.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:a88f062f072d1589b7b46e951698950e7da00442fc1cacbe17e19e025dc327ad", size = 49889, upload-time = "2025-10-06T05:35:26.797Z" }, + { url = "https://files.pythonhosted.org/packages/5d/ed/c7895fd2fde7f3ee70d248175f9b6cdf792fb741ab92dc59cd9ef3bd241b/frozenlist-1.8.0-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:f57fb59d9f385710aa7060e89410aeb5058b99e62f4d16b08b91986b9a2140c2", size = 219464, upload-time = "2025-10-06T05:35:28.254Z" }, + { url = "https://files.pythonhosted.org/packages/6b/83/4d587dccbfca74cb8b810472392ad62bfa100bf8108c7223eb4c4fa2f7b3/frozenlist-1.8.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:799345ab092bee59f01a915620b5d014698547afd011e691a208637312db9186", size = 221649, upload-time = "2025-10-06T05:35:29.454Z" }, + { url = "https://files.pythonhosted.org/packages/6a/c6/fd3b9cd046ec5fff9dab66831083bc2077006a874a2d3d9247dea93ddf7e/frozenlist-1.8.0-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:c23c3ff005322a6e16f71bf8692fcf4d5a304aaafe1e262c98c6d4adc7be863e", size = 219188, upload-time = "2025-10-06T05:35:30.951Z" }, + { url = "https://files.pythonhosted.org/packages/ce/80/6693f55eb2e085fc8afb28cf611448fb5b90e98e068fa1d1b8d8e66e5c7d/frozenlist-1.8.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:8a76ea0f0b9dfa06f254ee06053d93a600865b3274358ca48a352ce4f0798450", size = 231748, upload-time = "2025-10-06T05:35:32.101Z" }, + { url = "https://files.pythonhosted.org/packages/97/d6/e9459f7c5183854abd989ba384fe0cc1a0fb795a83c033f0571ec5933ca4/frozenlist-1.8.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:c7366fe1418a6133d5aa824ee53d406550110984de7637d65a178010f759c6ef", size = 236351, upload-time = "2025-10-06T05:35:33.834Z" }, + { url = "https://files.pythonhosted.org/packages/97/92/24e97474b65c0262e9ecd076e826bfd1d3074adcc165a256e42e7b8a7249/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:13d23a45c4cebade99340c4165bd90eeb4a56c6d8a9d8aa49568cac19a6d0dc4", size = 218767, upload-time = "2025-10-06T05:35:35.205Z" }, + { url = "https://files.pythonhosted.org/packages/ee/bf/dc394a097508f15abff383c5108cb8ad880d1f64a725ed3b90d5c2fbf0bb/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:e4a3408834f65da56c83528fb52ce7911484f0d1eaf7b761fc66001db1646eff", size = 235887, upload-time = "2025-10-06T05:35:36.354Z" }, + { url = "https://files.pythonhosted.org/packages/40/90/25b201b9c015dbc999a5baf475a257010471a1fa8c200c843fd4abbee725/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:42145cd2748ca39f32801dad54aeea10039da6f86e303659db90db1c4b614c8c", size = 228785, upload-time = "2025-10-06T05:35:37.949Z" }, + { url = "https://files.pythonhosted.org/packages/84/f4/b5bc148df03082f05d2dd30c089e269acdbe251ac9a9cf4e727b2dbb8a3d/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:e2de870d16a7a53901e41b64ffdf26f2fbb8917b3e6ebf398098d72c5b20bd7f", size = 230312, upload-time = "2025-10-06T05:35:39.178Z" }, + { url = "https://files.pythonhosted.org/packages/db/4b/87e95b5d15097c302430e647136b7d7ab2398a702390cf4c8601975709e7/frozenlist-1.8.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:20e63c9493d33ee48536600d1a5c95eefc870cd71e7ab037763d1fbb89cc51e7", size = 217650, upload-time = "2025-10-06T05:35:40.377Z" }, + { url = "https://files.pythonhosted.org/packages/e5/70/78a0315d1fea97120591a83e0acd644da638c872f142fd72a6cebee825f3/frozenlist-1.8.0-cp310-cp310-win32.whl", hash = "sha256:adbeebaebae3526afc3c96fad434367cafbfd1b25d72369a9e5858453b1bb71a", size = 39659, upload-time = "2025-10-06T05:35:41.863Z" }, + { url = "https://files.pythonhosted.org/packages/66/aa/3f04523fb189a00e147e60c5b2205126118f216b0aa908035c45336e27e4/frozenlist-1.8.0-cp310-cp310-win_amd64.whl", hash = "sha256:667c3777ca571e5dbeb76f331562ff98b957431df140b54c85fd4d52eea8d8f6", size = 43837, upload-time = "2025-10-06T05:35:43.205Z" }, + { url = "https://files.pythonhosted.org/packages/39/75/1135feecdd7c336938bd55b4dc3b0dfc46d85b9be12ef2628574b28de776/frozenlist-1.8.0-cp310-cp310-win_arm64.whl", hash = "sha256:80f85f0a7cc86e7a54c46d99c9e1318ff01f4687c172ede30fd52d19d1da1c8e", size = 39989, upload-time = "2025-10-06T05:35:44.596Z" }, + { url = "https://files.pythonhosted.org/packages/bc/03/077f869d540370db12165c0aa51640a873fb661d8b315d1d4d67b284d7ac/frozenlist-1.8.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:09474e9831bc2b2199fad6da3c14c7b0fbdd377cce9d3d77131be28906cb7d84", size = 86912, upload-time = "2025-10-06T05:35:45.98Z" }, + { url = "https://files.pythonhosted.org/packages/df/b5/7610b6bd13e4ae77b96ba85abea1c8cb249683217ef09ac9e0ae93f25a91/frozenlist-1.8.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:17c883ab0ab67200b5f964d2b9ed6b00971917d5d8a92df149dc2c9779208ee9", size = 50046, upload-time = "2025-10-06T05:35:47.009Z" }, + { url = "https://files.pythonhosted.org/packages/6e/ef/0e8f1fe32f8a53dd26bdd1f9347efe0778b0fddf62789ea683f4cc7d787d/frozenlist-1.8.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:fa47e444b8ba08fffd1c18e8cdb9a75db1b6a27f17507522834ad13ed5922b93", size = 50119, upload-time = "2025-10-06T05:35:48.38Z" }, + { url = "https://files.pythonhosted.org/packages/11/b1/71a477adc7c36e5fb628245dfbdea2166feae310757dea848d02bd0689fd/frozenlist-1.8.0-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:2552f44204b744fba866e573be4c1f9048d6a324dfe14475103fd51613eb1d1f", size = 231067, upload-time = "2025-10-06T05:35:49.97Z" }, + { url = "https://files.pythonhosted.org/packages/45/7e/afe40eca3a2dc19b9904c0f5d7edfe82b5304cb831391edec0ac04af94c2/frozenlist-1.8.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:957e7c38f250991e48a9a73e6423db1bb9dd14e722a10f6b8bb8e16a0f55f695", size = 233160, upload-time = "2025-10-06T05:35:51.729Z" }, + { url = "https://files.pythonhosted.org/packages/a6/aa/7416eac95603ce428679d273255ffc7c998d4132cfae200103f164b108aa/frozenlist-1.8.0-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:8585e3bb2cdea02fc88ffa245069c36555557ad3609e83be0ec71f54fd4abb52", size = 228544, upload-time = "2025-10-06T05:35:53.246Z" }, + { url = "https://files.pythonhosted.org/packages/8b/3d/2a2d1f683d55ac7e3875e4263d28410063e738384d3adc294f5ff3d7105e/frozenlist-1.8.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:edee74874ce20a373d62dc28b0b18b93f645633c2943fd90ee9d898550770581", size = 243797, upload-time = "2025-10-06T05:35:54.497Z" }, + { url = "https://files.pythonhosted.org/packages/78/1e/2d5565b589e580c296d3bb54da08d206e797d941a83a6fdea42af23be79c/frozenlist-1.8.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:c9a63152fe95756b85f31186bddf42e4c02c6321207fd6601a1c89ebac4fe567", size = 247923, upload-time = "2025-10-06T05:35:55.861Z" }, + { url = "https://files.pythonhosted.org/packages/aa/c3/65872fcf1d326a7f101ad4d86285c403c87be7d832b7470b77f6d2ed5ddc/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:b6db2185db9be0a04fecf2f241c70b63b1a242e2805be291855078f2b404dd6b", size = 230886, upload-time = "2025-10-06T05:35:57.399Z" }, + { url = "https://files.pythonhosted.org/packages/a0/76/ac9ced601d62f6956f03cc794f9e04c81719509f85255abf96e2510f4265/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:f4be2e3d8bc8aabd566f8d5b8ba7ecc09249d74ba3c9ed52e54dc23a293f0b92", size = 245731, upload-time = "2025-10-06T05:35:58.563Z" }, + { url = "https://files.pythonhosted.org/packages/b9/49/ecccb5f2598daf0b4a1415497eba4c33c1e8ce07495eb07d2860c731b8d5/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:c8d1634419f39ea6f5c427ea2f90ca85126b54b50837f31497f3bf38266e853d", size = 241544, upload-time = "2025-10-06T05:35:59.719Z" }, + { url = "https://files.pythonhosted.org/packages/53/4b/ddf24113323c0bbcc54cb38c8b8916f1da7165e07b8e24a717b4a12cbf10/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:1a7fa382a4a223773ed64242dbe1c9c326ec09457e6b8428efb4118c685c3dfd", size = 241806, upload-time = "2025-10-06T05:36:00.959Z" }, + { url = "https://files.pythonhosted.org/packages/a7/fb/9b9a084d73c67175484ba2789a59f8eebebd0827d186a8102005ce41e1ba/frozenlist-1.8.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:11847b53d722050808926e785df837353bd4d75f1d494377e59b23594d834967", size = 229382, upload-time = "2025-10-06T05:36:02.22Z" }, + { url = "https://files.pythonhosted.org/packages/95/a3/c8fb25aac55bf5e12dae5c5aa6a98f85d436c1dc658f21c3ac73f9fa95e5/frozenlist-1.8.0-cp311-cp311-win32.whl", hash = "sha256:27c6e8077956cf73eadd514be8fb04d77fc946a7fe9f7fe167648b0b9085cc25", size = 39647, upload-time = "2025-10-06T05:36:03.409Z" }, + { url = "https://files.pythonhosted.org/packages/0a/f5/603d0d6a02cfd4c8f2a095a54672b3cf967ad688a60fb9faf04fc4887f65/frozenlist-1.8.0-cp311-cp311-win_amd64.whl", hash = "sha256:ac913f8403b36a2c8610bbfd25b8013488533e71e62b4b4adce9c86c8cea905b", size = 44064, upload-time = "2025-10-06T05:36:04.368Z" }, + { url = "https://files.pythonhosted.org/packages/5d/16/c2c9ab44e181f043a86f9a8f84d5124b62dbcb3a02c0977ec72b9ac1d3e0/frozenlist-1.8.0-cp311-cp311-win_arm64.whl", hash = "sha256:d4d3214a0f8394edfa3e303136d0575eece0745ff2b47bd2cb2e66dd92d4351a", size = 39937, upload-time = "2025-10-06T05:36:05.669Z" }, + { url = "https://files.pythonhosted.org/packages/69/29/948b9aa87e75820a38650af445d2ef2b6b8a6fab1a23b6bb9e4ef0be2d59/frozenlist-1.8.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:78f7b9e5d6f2fdb88cdde9440dc147259b62b9d3b019924def9f6478be254ac1", size = 87782, upload-time = "2025-10-06T05:36:06.649Z" }, + { url = "https://files.pythonhosted.org/packages/64/80/4f6e318ee2a7c0750ed724fa33a4bdf1eacdc5a39a7a24e818a773cd91af/frozenlist-1.8.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:229bf37d2e4acdaf808fd3f06e854a4a7a3661e871b10dc1f8f1896a3b05f18b", size = 50594, upload-time = "2025-10-06T05:36:07.69Z" }, + { url = "https://files.pythonhosted.org/packages/2b/94/5c8a2b50a496b11dd519f4a24cb5496cf125681dd99e94c604ccdea9419a/frozenlist-1.8.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:f833670942247a14eafbb675458b4e61c82e002a148f49e68257b79296e865c4", size = 50448, upload-time = "2025-10-06T05:36:08.78Z" }, + { url = "https://files.pythonhosted.org/packages/6a/bd/d91c5e39f490a49df14320f4e8c80161cfcce09f1e2cde1edd16a551abb3/frozenlist-1.8.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:494a5952b1c597ba44e0e78113a7266e656b9794eec897b19ead706bd7074383", size = 242411, upload-time = "2025-10-06T05:36:09.801Z" }, + { url = "https://files.pythonhosted.org/packages/8f/83/f61505a05109ef3293dfb1ff594d13d64a2324ac3482be2cedc2be818256/frozenlist-1.8.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:96f423a119f4777a4a056b66ce11527366a8bb92f54e541ade21f2374433f6d4", size = 243014, upload-time = "2025-10-06T05:36:11.394Z" }, + { url = "https://files.pythonhosted.org/packages/d8/cb/cb6c7b0f7d4023ddda30cf56b8b17494eb3a79e3fda666bf735f63118b35/frozenlist-1.8.0-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3462dd9475af2025c31cc61be6652dfa25cbfb56cbbf52f4ccfe029f38decaf8", size = 234909, upload-time = "2025-10-06T05:36:12.598Z" }, + { url = "https://files.pythonhosted.org/packages/31/c5/cd7a1f3b8b34af009fb17d4123c5a778b44ae2804e3ad6b86204255f9ec5/frozenlist-1.8.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c4c800524c9cd9bac5166cd6f55285957fcfc907db323e193f2afcd4d9abd69b", size = 250049, upload-time = "2025-10-06T05:36:14.065Z" }, + { url = "https://files.pythonhosted.org/packages/c0/01/2f95d3b416c584a1e7f0e1d6d31998c4a795f7544069ee2e0962a4b60740/frozenlist-1.8.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d6a5df73acd3399d893dafc71663ad22534b5aa4f94e8a2fabfe856c3c1b6a52", size = 256485, upload-time = "2025-10-06T05:36:15.39Z" }, + { url = "https://files.pythonhosted.org/packages/ce/03/024bf7720b3abaebcff6d0793d73c154237b85bdf67b7ed55e5e9596dc9a/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:405e8fe955c2280ce66428b3ca55e12b3c4e9c336fb2103a4937e891c69a4a29", size = 237619, upload-time = "2025-10-06T05:36:16.558Z" }, + { url = "https://files.pythonhosted.org/packages/69/fa/f8abdfe7d76b731f5d8bd217827cf6764d4f1d9763407e42717b4bed50a0/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:908bd3f6439f2fef9e85031b59fd4f1297af54415fb60e4254a95f75b3cab3f3", size = 250320, upload-time = "2025-10-06T05:36:17.821Z" }, + { url = "https://files.pythonhosted.org/packages/f5/3c/b051329f718b463b22613e269ad72138cc256c540f78a6de89452803a47d/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:294e487f9ec720bd8ffcebc99d575f7eff3568a08a253d1ee1a0378754b74143", size = 246820, upload-time = "2025-10-06T05:36:19.046Z" }, + { url = "https://files.pythonhosted.org/packages/0f/ae/58282e8f98e444b3f4dd42448ff36fa38bef29e40d40f330b22e7108f565/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:74c51543498289c0c43656701be6b077f4b265868fa7f8a8859c197006efb608", size = 250518, upload-time = "2025-10-06T05:36:20.763Z" }, + { url = "https://files.pythonhosted.org/packages/8f/96/007e5944694d66123183845a106547a15944fbbb7154788cbf7272789536/frozenlist-1.8.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:776f352e8329135506a1d6bf16ac3f87bc25b28e765949282dcc627af36123aa", size = 239096, upload-time = "2025-10-06T05:36:22.129Z" }, + { url = "https://files.pythonhosted.org/packages/66/bb/852b9d6db2fa40be96f29c0d1205c306288f0684df8fd26ca1951d461a56/frozenlist-1.8.0-cp312-cp312-win32.whl", hash = "sha256:433403ae80709741ce34038da08511d4a77062aa924baf411ef73d1146e74faf", size = 39985, upload-time = "2025-10-06T05:36:23.661Z" }, + { url = "https://files.pythonhosted.org/packages/b8/af/38e51a553dd66eb064cdf193841f16f077585d4d28394c2fa6235cb41765/frozenlist-1.8.0-cp312-cp312-win_amd64.whl", hash = "sha256:34187385b08f866104f0c0617404c8eb08165ab1272e884abc89c112e9c00746", size = 44591, upload-time = "2025-10-06T05:36:24.958Z" }, + { url = "https://files.pythonhosted.org/packages/a7/06/1dc65480ab147339fecc70797e9c2f69d9cea9cf38934ce08df070fdb9cb/frozenlist-1.8.0-cp312-cp312-win_arm64.whl", hash = "sha256:fe3c58d2f5db5fbd18c2987cba06d51b0529f52bc3a6cdc33d3f4eab725104bd", size = 40102, upload-time = "2025-10-06T05:36:26.333Z" }, + { url = "https://files.pythonhosted.org/packages/2d/40/0832c31a37d60f60ed79e9dfb5a92e1e2af4f40a16a29abcc7992af9edff/frozenlist-1.8.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:8d92f1a84bb12d9e56f818b3a746f3efba93c1b63c8387a73dde655e1e42282a", size = 85717, upload-time = "2025-10-06T05:36:27.341Z" }, + { url = "https://files.pythonhosted.org/packages/30/ba/b0b3de23f40bc55a7057bd38434e25c34fa48e17f20ee273bbde5e0650f3/frozenlist-1.8.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:96153e77a591c8adc2ee805756c61f59fef4cf4073a9275ee86fe8cba41241f7", size = 49651, upload-time = "2025-10-06T05:36:28.855Z" }, + { url = "https://files.pythonhosted.org/packages/0c/ab/6e5080ee374f875296c4243c381bbdef97a9ac39c6e3ce1d5f7d42cb78d6/frozenlist-1.8.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f21f00a91358803399890ab167098c131ec2ddd5f8f5fd5fe9c9f2c6fcd91e40", size = 49417, upload-time = "2025-10-06T05:36:29.877Z" }, + { url = "https://files.pythonhosted.org/packages/d5/4e/e4691508f9477ce67da2015d8c00acd751e6287739123113a9fca6f1604e/frozenlist-1.8.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:fb30f9626572a76dfe4293c7194a09fb1fe93ba94c7d4f720dfae3b646b45027", size = 234391, upload-time = "2025-10-06T05:36:31.301Z" }, + { url = "https://files.pythonhosted.org/packages/40/76/c202df58e3acdf12969a7895fd6f3bc016c642e6726aa63bd3025e0fc71c/frozenlist-1.8.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:eaa352d7047a31d87dafcacbabe89df0aa506abb5b1b85a2fb91bc3faa02d822", size = 233048, upload-time = "2025-10-06T05:36:32.531Z" }, + { url = "https://files.pythonhosted.org/packages/f9/c0/8746afb90f17b73ca5979c7a3958116e105ff796e718575175319b5bb4ce/frozenlist-1.8.0-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:03ae967b4e297f58f8c774c7eabcce57fe3c2434817d4385c50661845a058121", size = 226549, upload-time = "2025-10-06T05:36:33.706Z" }, + { url = "https://files.pythonhosted.org/packages/7e/eb/4c7eefc718ff72f9b6c4893291abaae5fbc0c82226a32dcd8ef4f7a5dbef/frozenlist-1.8.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f6292f1de555ffcc675941d65fffffb0a5bcd992905015f85d0592201793e0e5", size = 239833, upload-time = "2025-10-06T05:36:34.947Z" }, + { url = "https://files.pythonhosted.org/packages/c2/4e/e5c02187cf704224f8b21bee886f3d713ca379535f16893233b9d672ea71/frozenlist-1.8.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:29548f9b5b5e3460ce7378144c3010363d8035cea44bc0bf02d57f5a685e084e", size = 245363, upload-time = "2025-10-06T05:36:36.534Z" }, + { url = "https://files.pythonhosted.org/packages/1f/96/cb85ec608464472e82ad37a17f844889c36100eed57bea094518bf270692/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ec3cc8c5d4084591b4237c0a272cc4f50a5b03396a47d9caaf76f5d7b38a4f11", size = 229314, upload-time = "2025-10-06T05:36:38.582Z" }, + { url = "https://files.pythonhosted.org/packages/5d/6f/4ae69c550e4cee66b57887daeebe006fe985917c01d0fff9caab9883f6d0/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:517279f58009d0b1f2e7c1b130b377a349405da3f7621ed6bfae50b10adf20c1", size = 243365, upload-time = "2025-10-06T05:36:40.152Z" }, + { url = "https://files.pythonhosted.org/packages/7a/58/afd56de246cf11780a40a2c28dc7cbabbf06337cc8ddb1c780a2d97e88d8/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:db1e72ede2d0d7ccb213f218df6a078a9c09a7de257c2fe8fcef16d5925230b1", size = 237763, upload-time = "2025-10-06T05:36:41.355Z" }, + { url = "https://files.pythonhosted.org/packages/cb/36/cdfaf6ed42e2644740d4a10452d8e97fa1c062e2a8006e4b09f1b5fd7d63/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:b4dec9482a65c54a5044486847b8a66bf10c9cb4926d42927ec4e8fd5db7fed8", size = 240110, upload-time = "2025-10-06T05:36:42.716Z" }, + { url = "https://files.pythonhosted.org/packages/03/a8/9ea226fbefad669f11b52e864c55f0bd57d3c8d7eb07e9f2e9a0b39502e1/frozenlist-1.8.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:21900c48ae04d13d416f0e1e0c4d81f7931f73a9dfa0b7a8746fb2fe7dd970ed", size = 233717, upload-time = "2025-10-06T05:36:44.251Z" }, + { url = "https://files.pythonhosted.org/packages/1e/0b/1b5531611e83ba7d13ccc9988967ea1b51186af64c42b7a7af465dcc9568/frozenlist-1.8.0-cp313-cp313-win32.whl", hash = "sha256:8b7b94a067d1c504ee0b16def57ad5738701e4ba10cec90529f13fa03c833496", size = 39628, upload-time = "2025-10-06T05:36:45.423Z" }, + { url = "https://files.pythonhosted.org/packages/d8/cf/174c91dbc9cc49bc7b7aab74d8b734e974d1faa8f191c74af9b7e80848e6/frozenlist-1.8.0-cp313-cp313-win_amd64.whl", hash = "sha256:878be833caa6a3821caf85eb39c5ba92d28e85df26d57afb06b35b2efd937231", size = 43882, upload-time = "2025-10-06T05:36:46.796Z" }, + { url = "https://files.pythonhosted.org/packages/c1/17/502cd212cbfa96eb1388614fe39a3fc9ab87dbbe042b66f97acb57474834/frozenlist-1.8.0-cp313-cp313-win_arm64.whl", hash = "sha256:44389d135b3ff43ba8cc89ff7f51f5a0bb6b63d829c8300f79a2fe4fe61bcc62", size = 39676, upload-time = "2025-10-06T05:36:47.8Z" }, + { url = "https://files.pythonhosted.org/packages/d2/5c/3bbfaa920dfab09e76946a5d2833a7cbdf7b9b4a91c714666ac4855b88b4/frozenlist-1.8.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:e25ac20a2ef37e91c1b39938b591457666a0fa835c7783c3a8f33ea42870db94", size = 89235, upload-time = "2025-10-06T05:36:48.78Z" }, + { url = "https://files.pythonhosted.org/packages/d2/d6/f03961ef72166cec1687e84e8925838442b615bd0b8854b54923ce5b7b8a/frozenlist-1.8.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:07cdca25a91a4386d2e76ad992916a85038a9b97561bf7a3fd12d5d9ce31870c", size = 50742, upload-time = "2025-10-06T05:36:49.837Z" }, + { url = "https://files.pythonhosted.org/packages/1e/bb/a6d12b7ba4c3337667d0e421f7181c82dda448ce4e7ad7ecd249a16fa806/frozenlist-1.8.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:4e0c11f2cc6717e0a741f84a527c52616140741cd812a50422f83dc31749fb52", size = 51725, upload-time = "2025-10-06T05:36:50.851Z" }, + { url = "https://files.pythonhosted.org/packages/bc/71/d1fed0ffe2c2ccd70b43714c6cab0f4188f09f8a67a7914a6b46ee30f274/frozenlist-1.8.0-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:b3210649ee28062ea6099cfda39e147fa1bc039583c8ee4481cb7811e2448c51", size = 284533, upload-time = "2025-10-06T05:36:51.898Z" }, + { url = "https://files.pythonhosted.org/packages/c9/1f/fb1685a7b009d89f9bf78a42d94461bc06581f6e718c39344754a5d9bada/frozenlist-1.8.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:581ef5194c48035a7de2aefc72ac6539823bb71508189e5de01d60c9dcd5fa65", size = 292506, upload-time = "2025-10-06T05:36:53.101Z" }, + { url = "https://files.pythonhosted.org/packages/e6/3b/b991fe1612703f7e0d05c0cf734c1b77aaf7c7d321df4572e8d36e7048c8/frozenlist-1.8.0-cp313-cp313t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3ef2d026f16a2b1866e1d86fc4e1291e1ed8a387b2c333809419a2f8b3a77b82", size = 274161, upload-time = "2025-10-06T05:36:54.309Z" }, + { url = "https://files.pythonhosted.org/packages/ca/ec/c5c618767bcdf66e88945ec0157d7f6c4a1322f1473392319b7a2501ded7/frozenlist-1.8.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5500ef82073f599ac84d888e3a8c1f77ac831183244bfd7f11eaa0289fb30714", size = 294676, upload-time = "2025-10-06T05:36:55.566Z" }, + { url = "https://files.pythonhosted.org/packages/7c/ce/3934758637d8f8a88d11f0585d6495ef54b2044ed6ec84492a91fa3b27aa/frozenlist-1.8.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:50066c3997d0091c411a66e710f4e11752251e6d2d73d70d8d5d4c76442a199d", size = 300638, upload-time = "2025-10-06T05:36:56.758Z" }, + { url = "https://files.pythonhosted.org/packages/fc/4f/a7e4d0d467298f42de4b41cbc7ddaf19d3cfeabaf9ff97c20c6c7ee409f9/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:5c1c8e78426e59b3f8005e9b19f6ff46e5845895adbde20ece9218319eca6506", size = 283067, upload-time = "2025-10-06T05:36:57.965Z" }, + { url = "https://files.pythonhosted.org/packages/dc/48/c7b163063d55a83772b268e6d1affb960771b0e203b632cfe09522d67ea5/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:eefdba20de0d938cec6a89bd4d70f346a03108a19b9df4248d3cf0d88f1b0f51", size = 292101, upload-time = "2025-10-06T05:36:59.237Z" }, + { url = "https://files.pythonhosted.org/packages/9f/d0/2366d3c4ecdc2fd391e0afa6e11500bfba0ea772764d631bbf82f0136c9d/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:cf253e0e1c3ceb4aaff6df637ce033ff6535fb8c70a764a8f46aafd3d6ab798e", size = 289901, upload-time = "2025-10-06T05:37:00.811Z" }, + { url = "https://files.pythonhosted.org/packages/b8/94/daff920e82c1b70e3618a2ac39fbc01ae3e2ff6124e80739ce5d71c9b920/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:032efa2674356903cd0261c4317a561a6850f3ac864a63fc1583147fb05a79b0", size = 289395, upload-time = "2025-10-06T05:37:02.115Z" }, + { url = "https://files.pythonhosted.org/packages/e3/20/bba307ab4235a09fdcd3cc5508dbabd17c4634a1af4b96e0f69bfe551ebd/frozenlist-1.8.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:6da155091429aeba16851ecb10a9104a108bcd32f6c1642867eadaee401c1c41", size = 283659, upload-time = "2025-10-06T05:37:03.711Z" }, + { url = "https://files.pythonhosted.org/packages/fd/00/04ca1c3a7a124b6de4f8a9a17cc2fcad138b4608e7a3fc5877804b8715d7/frozenlist-1.8.0-cp313-cp313t-win32.whl", hash = "sha256:0f96534f8bfebc1a394209427d0f8a63d343c9779cda6fc25e8e121b5fd8555b", size = 43492, upload-time = "2025-10-06T05:37:04.915Z" }, + { url = "https://files.pythonhosted.org/packages/59/5e/c69f733a86a94ab10f68e496dc6b7e8bc078ebb415281d5698313e3af3a1/frozenlist-1.8.0-cp313-cp313t-win_amd64.whl", hash = "sha256:5d63a068f978fc69421fb0e6eb91a9603187527c86b7cd3f534a5b77a592b888", size = 48034, upload-time = "2025-10-06T05:37:06.343Z" }, + { url = "https://files.pythonhosted.org/packages/16/6c/be9d79775d8abe79b05fa6d23da99ad6e7763a1d080fbae7290b286093fd/frozenlist-1.8.0-cp313-cp313t-win_arm64.whl", hash = "sha256:bf0a7e10b077bf5fb9380ad3ae8ce20ef919a6ad93b4552896419ac7e1d8e042", size = 41749, upload-time = "2025-10-06T05:37:07.431Z" }, + { url = "https://files.pythonhosted.org/packages/f1/c8/85da824b7e7b9b6e7f7705b2ecaf9591ba6f79c1177f324c2735e41d36a2/frozenlist-1.8.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:cee686f1f4cadeb2136007ddedd0aaf928ab95216e7691c63e50a8ec066336d0", size = 86127, upload-time = "2025-10-06T05:37:08.438Z" }, + { url = "https://files.pythonhosted.org/packages/8e/e8/a1185e236ec66c20afd72399522f142c3724c785789255202d27ae992818/frozenlist-1.8.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:119fb2a1bd47307e899c2fac7f28e85b9a543864df47aa7ec9d3c1b4545f096f", size = 49698, upload-time = "2025-10-06T05:37:09.48Z" }, + { url = "https://files.pythonhosted.org/packages/a1/93/72b1736d68f03fda5fdf0f2180fb6caaae3894f1b854d006ac61ecc727ee/frozenlist-1.8.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:4970ece02dbc8c3a92fcc5228e36a3e933a01a999f7094ff7c23fbd2beeaa67c", size = 49749, upload-time = "2025-10-06T05:37:10.569Z" }, + { url = "https://files.pythonhosted.org/packages/a7/b2/fabede9fafd976b991e9f1b9c8c873ed86f202889b864756f240ce6dd855/frozenlist-1.8.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:cba69cb73723c3f329622e34bdbf5ce1f80c21c290ff04256cff1cd3c2036ed2", size = 231298, upload-time = "2025-10-06T05:37:11.993Z" }, + { url = "https://files.pythonhosted.org/packages/3a/3b/d9b1e0b0eed36e70477ffb8360c49c85c8ca8ef9700a4e6711f39a6e8b45/frozenlist-1.8.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:778a11b15673f6f1df23d9586f83c4846c471a8af693a22e066508b77d201ec8", size = 232015, upload-time = "2025-10-06T05:37:13.194Z" }, + { url = "https://files.pythonhosted.org/packages/dc/94/be719d2766c1138148564a3960fc2c06eb688da592bdc25adcf856101be7/frozenlist-1.8.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:0325024fe97f94c41c08872db482cf8ac4800d80e79222c6b0b7b162d5b13686", size = 225038, upload-time = "2025-10-06T05:37:14.577Z" }, + { url = "https://files.pythonhosted.org/packages/e4/09/6712b6c5465f083f52f50cf74167b92d4ea2f50e46a9eea0523d658454ae/frozenlist-1.8.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:97260ff46b207a82a7567b581ab4190bd4dfa09f4db8a8b49d1a958f6aa4940e", size = 240130, upload-time = "2025-10-06T05:37:15.781Z" }, + { url = "https://files.pythonhosted.org/packages/f8/d4/cd065cdcf21550b54f3ce6a22e143ac9e4836ca42a0de1022da8498eac89/frozenlist-1.8.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:54b2077180eb7f83dd52c40b2750d0a9f175e06a42e3213ce047219de902717a", size = 242845, upload-time = "2025-10-06T05:37:17.037Z" }, + { url = "https://files.pythonhosted.org/packages/62/c3/f57a5c8c70cd1ead3d5d5f776f89d33110b1addae0ab010ad774d9a44fb9/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:2f05983daecab868a31e1da44462873306d3cbfd76d1f0b5b69c473d21dbb128", size = 229131, upload-time = "2025-10-06T05:37:18.221Z" }, + { url = "https://files.pythonhosted.org/packages/6c/52/232476fe9cb64f0742f3fde2b7d26c1dac18b6d62071c74d4ded55e0ef94/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:33f48f51a446114bc5d251fb2954ab0164d5be02ad3382abcbfe07e2531d650f", size = 240542, upload-time = "2025-10-06T05:37:19.771Z" }, + { url = "https://files.pythonhosted.org/packages/5f/85/07bf3f5d0fb5414aee5f47d33c6f5c77bfe49aac680bfece33d4fdf6a246/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:154e55ec0655291b5dd1b8731c637ecdb50975a2ae70c606d100750a540082f7", size = 237308, upload-time = "2025-10-06T05:37:20.969Z" }, + { url = "https://files.pythonhosted.org/packages/11/99/ae3a33d5befd41ac0ca2cc7fd3aa707c9c324de2e89db0e0f45db9a64c26/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:4314debad13beb564b708b4a496020e5306c7333fa9a3ab90374169a20ffab30", size = 238210, upload-time = "2025-10-06T05:37:22.252Z" }, + { url = "https://files.pythonhosted.org/packages/b2/60/b1d2da22f4970e7a155f0adde9b1435712ece01b3cd45ba63702aea33938/frozenlist-1.8.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:073f8bf8becba60aa931eb3bc420b217bb7d5b8f4750e6f8b3be7f3da85d38b7", size = 231972, upload-time = "2025-10-06T05:37:23.5Z" }, + { url = "https://files.pythonhosted.org/packages/3f/ab/945b2f32de889993b9c9133216c068b7fcf257d8595a0ac420ac8677cab0/frozenlist-1.8.0-cp314-cp314-win32.whl", hash = "sha256:bac9c42ba2ac65ddc115d930c78d24ab8d4f465fd3fc473cdedfccadb9429806", size = 40536, upload-time = "2025-10-06T05:37:25.581Z" }, + { url = "https://files.pythonhosted.org/packages/59/ad/9caa9b9c836d9ad6f067157a531ac48b7d36499f5036d4141ce78c230b1b/frozenlist-1.8.0-cp314-cp314-win_amd64.whl", hash = "sha256:3e0761f4d1a44f1d1a47996511752cf3dcec5bbdd9cc2b4fe595caf97754b7a0", size = 44330, upload-time = "2025-10-06T05:37:26.928Z" }, + { url = "https://files.pythonhosted.org/packages/82/13/e6950121764f2676f43534c555249f57030150260aee9dcf7d64efda11dd/frozenlist-1.8.0-cp314-cp314-win_arm64.whl", hash = "sha256:d1eaff1d00c7751b7c6662e9c5ba6eb2c17a2306ba5e2a37f24ddf3cc953402b", size = 40627, upload-time = "2025-10-06T05:37:28.075Z" }, + { url = "https://files.pythonhosted.org/packages/c0/c7/43200656ecc4e02d3f8bc248df68256cd9572b3f0017f0a0c4e93440ae23/frozenlist-1.8.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:d3bb933317c52d7ea5004a1c442eef86f426886fba134ef8cf4226ea6ee1821d", size = 89238, upload-time = "2025-10-06T05:37:29.373Z" }, + { url = "https://files.pythonhosted.org/packages/d1/29/55c5f0689b9c0fb765055629f472c0de484dcaf0acee2f7707266ae3583c/frozenlist-1.8.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:8009897cdef112072f93a0efdce29cd819e717fd2f649ee3016efd3cd885a7ed", size = 50738, upload-time = "2025-10-06T05:37:30.792Z" }, + { url = "https://files.pythonhosted.org/packages/ba/7d/b7282a445956506fa11da8c2db7d276adcbf2b17d8bb8407a47685263f90/frozenlist-1.8.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:2c5dcbbc55383e5883246d11fd179782a9d07a986c40f49abe89ddf865913930", size = 51739, upload-time = "2025-10-06T05:37:32.127Z" }, + { url = "https://files.pythonhosted.org/packages/62/1c/3d8622e60d0b767a5510d1d3cf21065b9db874696a51ea6d7a43180a259c/frozenlist-1.8.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:39ecbc32f1390387d2aa4f5a995e465e9e2f79ba3adcac92d68e3e0afae6657c", size = 284186, upload-time = "2025-10-06T05:37:33.21Z" }, + { url = "https://files.pythonhosted.org/packages/2d/14/aa36d5f85a89679a85a1d44cd7a6657e0b1c75f61e7cad987b203d2daca8/frozenlist-1.8.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92db2bf818d5cc8d9c1f1fc56b897662e24ea5adb36ad1f1d82875bd64e03c24", size = 292196, upload-time = "2025-10-06T05:37:36.107Z" }, + { url = "https://files.pythonhosted.org/packages/05/23/6bde59eb55abd407d34f77d39a5126fb7b4f109a3f611d3929f14b700c66/frozenlist-1.8.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:2dc43a022e555de94c3b68a4ef0b11c4f747d12c024a520c7101709a2144fb37", size = 273830, upload-time = "2025-10-06T05:37:37.663Z" }, + { url = "https://files.pythonhosted.org/packages/d2/3f/22cff331bfad7a8afa616289000ba793347fcd7bc275f3b28ecea2a27909/frozenlist-1.8.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:cb89a7f2de3602cfed448095bab3f178399646ab7c61454315089787df07733a", size = 294289, upload-time = "2025-10-06T05:37:39.261Z" }, + { url = "https://files.pythonhosted.org/packages/a4/89/5b057c799de4838b6c69aa82b79705f2027615e01be996d2486a69ca99c4/frozenlist-1.8.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:33139dc858c580ea50e7e60a1b0ea003efa1fd42e6ec7fdbad78fff65fad2fd2", size = 300318, upload-time = "2025-10-06T05:37:43.213Z" }, + { url = "https://files.pythonhosted.org/packages/30/de/2c22ab3eb2a8af6d69dc799e48455813bab3690c760de58e1bf43b36da3e/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:168c0969a329b416119507ba30b9ea13688fafffac1b7822802537569a1cb0ef", size = 282814, upload-time = "2025-10-06T05:37:45.337Z" }, + { url = "https://files.pythonhosted.org/packages/59/f7/970141a6a8dbd7f556d94977858cfb36fa9b66e0892c6dd780d2219d8cd8/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:28bd570e8e189d7f7b001966435f9dac6718324b5be2990ac496cf1ea9ddb7fe", size = 291762, upload-time = "2025-10-06T05:37:46.657Z" }, + { url = "https://files.pythonhosted.org/packages/c1/15/ca1adae83a719f82df9116d66f5bb28bb95557b3951903d39135620ef157/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:b2a095d45c5d46e5e79ba1e5b9cb787f541a8dee0433836cea4b96a2c439dcd8", size = 289470, upload-time = "2025-10-06T05:37:47.946Z" }, + { url = "https://files.pythonhosted.org/packages/ac/83/dca6dc53bf657d371fbc88ddeb21b79891e747189c5de990b9dfff2ccba1/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:eab8145831a0d56ec9c4139b6c3e594c7a83c2c8be25d5bcf2d86136a532287a", size = 289042, upload-time = "2025-10-06T05:37:49.499Z" }, + { url = "https://files.pythonhosted.org/packages/96/52/abddd34ca99be142f354398700536c5bd315880ed0a213812bc491cff5e4/frozenlist-1.8.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:974b28cf63cc99dfb2188d8d222bc6843656188164848c4f679e63dae4b0708e", size = 283148, upload-time = "2025-10-06T05:37:50.745Z" }, + { url = "https://files.pythonhosted.org/packages/af/d3/76bd4ed4317e7119c2b7f57c3f6934aba26d277acc6309f873341640e21f/frozenlist-1.8.0-cp314-cp314t-win32.whl", hash = "sha256:342c97bf697ac5480c0a7ec73cd700ecfa5a8a40ac923bd035484616efecc2df", size = 44676, upload-time = "2025-10-06T05:37:52.222Z" }, + { url = "https://files.pythonhosted.org/packages/89/76/c615883b7b521ead2944bb3480398cbb07e12b7b4e4d073d3752eb721558/frozenlist-1.8.0-cp314-cp314t-win_amd64.whl", hash = "sha256:06be8f67f39c8b1dc671f5d83aaefd3358ae5cdcf8314552c57e7ed3e6475bdd", size = 49451, upload-time = "2025-10-06T05:37:53.425Z" }, + { url = "https://files.pythonhosted.org/packages/e0/a3/5982da14e113d07b325230f95060e2169f5311b1017ea8af2a29b374c289/frozenlist-1.8.0-cp314-cp314t-win_arm64.whl", hash = "sha256:102e6314ca4da683dca92e3b1355490fed5f313b768500084fbe6371fddfdb79", size = 42507, upload-time = "2025-10-06T05:37:54.513Z" }, + { url = "https://files.pythonhosted.org/packages/c2/59/ae5cdac87a00962122ea37bb346d41b66aec05f9ce328fa2b9e216f8967b/frozenlist-1.8.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:d8b7138e5cd0647e4523d6685b0eac5d4be9a184ae9634492f25c6eb38c12a47", size = 86967, upload-time = "2025-10-06T05:37:55.607Z" }, + { url = "https://files.pythonhosted.org/packages/8a/10/17059b2db5a032fd9323c41c39e9d1f5f9d0c8f04d1e4e3e788573086e61/frozenlist-1.8.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:a6483e309ca809f1efd154b4d37dc6d9f61037d6c6a81c2dc7a15cb22c8c5dca", size = 49984, upload-time = "2025-10-06T05:37:57.049Z" }, + { url = "https://files.pythonhosted.org/packages/4b/de/ad9d82ca8e5fa8f0c636e64606553c79e2b859ad253030b62a21fe9986f5/frozenlist-1.8.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:1b9290cf81e95e93fdf90548ce9d3c1211cf574b8e3f4b3b7cb0537cf2227068", size = 50240, upload-time = "2025-10-06T05:37:58.145Z" }, + { url = "https://files.pythonhosted.org/packages/4e/45/3dfb7767c2a67d123650122b62ce13c731b6c745bc14424eea67678b508c/frozenlist-1.8.0-cp39-cp39-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:59a6a5876ca59d1b63af8cd5e7ffffb024c3dc1e9cf9301b21a2e76286505c95", size = 219472, upload-time = "2025-10-06T05:37:59.239Z" }, + { url = "https://files.pythonhosted.org/packages/0b/bf/5bf23d913a741b960d5c1dac7c1985d8a2a1d015772b2d18ea168b08e7ff/frozenlist-1.8.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6dc4126390929823e2d2d9dc79ab4046ed74680360fc5f38b585c12c66cdf459", size = 221531, upload-time = "2025-10-06T05:38:00.521Z" }, + { url = "https://files.pythonhosted.org/packages/d0/03/27ec393f3b55860859f4b74cdc8c2a4af3dbf3533305e8eacf48a4fd9a54/frozenlist-1.8.0-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:332db6b2563333c5671fecacd085141b5800cb866be16d5e3eb15a2086476675", size = 219211, upload-time = "2025-10-06T05:38:01.842Z" }, + { url = "https://files.pythonhosted.org/packages/3a/ad/0fd00c404fa73fe9b169429e9a972d5ed807973c40ab6b3cf9365a33d360/frozenlist-1.8.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:9ff15928d62a0b80bb875655c39bf517938c7d589554cbd2669be42d97c2cb61", size = 231775, upload-time = "2025-10-06T05:38:03.384Z" }, + { url = "https://files.pythonhosted.org/packages/8a/c3/86962566154cb4d2995358bc8331bfc4ea19d07db1a96f64935a1607f2b6/frozenlist-1.8.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7bf6cdf8e07c8151fba6fe85735441240ec7f619f935a5205953d58009aef8c6", size = 236631, upload-time = "2025-10-06T05:38:04.609Z" }, + { url = "https://files.pythonhosted.org/packages/ea/9e/6ffad161dbd83782d2c66dc4d378a9103b31770cb1e67febf43aea42d202/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:48e6d3f4ec5c7273dfe83ff27c91083c6c9065af655dc2684d2c200c94308bb5", size = 218632, upload-time = "2025-10-06T05:38:05.917Z" }, + { url = "https://files.pythonhosted.org/packages/58/b2/4677eee46e0a97f9b30735e6ad0bf6aba3e497986066eb68807ac85cf60f/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:1a7607e17ad33361677adcd1443edf6f5da0ce5e5377b798fba20fae194825f3", size = 235967, upload-time = "2025-10-06T05:38:07.614Z" }, + { url = "https://files.pythonhosted.org/packages/05/f3/86e75f8639c5a93745ca7addbbc9de6af56aebb930d233512b17e46f6493/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:5a3a935c3a4e89c733303a2d5a7c257ea44af3a56c8202df486b7f5de40f37e1", size = 228799, upload-time = "2025-10-06T05:38:08.845Z" }, + { url = "https://files.pythonhosted.org/packages/30/00/39aad3a7f0d98f5eb1d99a3c311215674ed87061aecee7851974b335c050/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:940d4a017dbfed9daf46a3b086e1d2167e7012ee297fef9e1c545c4d022f5178", size = 230566, upload-time = "2025-10-06T05:38:10.52Z" }, + { url = "https://files.pythonhosted.org/packages/0d/4d/aa144cac44568d137846ddc4d5210fb5d9719eb1d7ec6fa2728a54b5b94a/frozenlist-1.8.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:b9be22a69a014bc47e78072d0ecae716f5eb56c15238acca0f43d6eb8e4a5bda", size = 217715, upload-time = "2025-10-06T05:38:11.832Z" }, + { url = "https://files.pythonhosted.org/packages/64/4c/8f665921667509d25a0dd72540513bc86b356c95541686f6442a3283019f/frozenlist-1.8.0-cp39-cp39-win32.whl", hash = "sha256:1aa77cb5697069af47472e39612976ed05343ff2e84a3dcf15437b232cbfd087", size = 39933, upload-time = "2025-10-06T05:38:13.061Z" }, + { url = "https://files.pythonhosted.org/packages/79/bd/bcc926f87027fad5e59926ff12d136e1082a115025d33c032d1cd69ab377/frozenlist-1.8.0-cp39-cp39-win_amd64.whl", hash = "sha256:7398c222d1d405e796970320036b1b563892b65809d9e5261487bb2c7f7b5c6a", size = 44121, upload-time = "2025-10-06T05:38:14.572Z" }, + { url = "https://files.pythonhosted.org/packages/4c/07/9c2e4eb7584af4b705237b971b89a4155a8e57599c4483a131a39256a9a0/frozenlist-1.8.0-cp39-cp39-win_arm64.whl", hash = "sha256:b4f3b365f31c6cd4af24545ca0a244a53688cad8834e32f56831c4923b50a103", size = 40312, upload-time = "2025-10-06T05:38:15.699Z" }, + { url = "https://files.pythonhosted.org/packages/9a/9a/e35b4a917281c0b8419d4207f4334c8e8c5dbf4f3f5f9ada73958d937dcc/frozenlist-1.8.0-py3-none-any.whl", hash = "sha256:0c18a16eab41e82c295618a77502e17b195883241c563b00f0aa5106fc4eaa0d", size = 13409, upload-time = "2025-10-06T05:38:16.721Z" }, +] + +[[package]] +name = "h11" +version = "0.16.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/01/ee/02a2c011bdab74c6fb3c75474d40b3052059d95df7e73351460c8588d963/h11-0.16.0.tar.gz", hash = "sha256:4e35b956cf45792e4caa5885e69fba00bdbc6ffafbfa020300e549b208ee5ff1", size = 101250, upload-time = "2025-04-24T03:35:25.427Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/04/4b/29cac41a4d98d144bf5f6d33995617b185d14b22401f75ca86f384e87ff1/h11-0.16.0-py3-none-any.whl", hash = "sha256:63cf8bbe7522de3bf65932fda1d9c2772064ffb3dae62d55932da54b31cb6c86", size = 37515, upload-time = "2025-04-24T03:35:24.344Z" }, +] + +[[package]] +name = "httpcore" +version = "1.0.9" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "certifi" }, + { name = "h11" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/06/94/82699a10bca87a5556c9c59b5963f2d039dbd239f25bc2a63907a05a14cb/httpcore-1.0.9.tar.gz", hash = "sha256:6e34463af53fd2ab5d807f399a9b45ea31c3dfa2276f15a2c3f00afff6e176e8", size = 85484, upload-time = "2025-04-24T22:06:22.219Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7e/f5/f66802a942d491edb555dd61e3a9961140fd64c90bce1eafd741609d334d/httpcore-1.0.9-py3-none-any.whl", hash = "sha256:2d400746a40668fc9dec9810239072b40b4484b640a8c38fd654a024c7a1bf55", size = 78784, upload-time = "2025-04-24T22:06:20.566Z" }, +] + +[[package]] +name = "httpx" +version = "0.28.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "anyio" }, + { name = "certifi" }, + { name = "httpcore" }, + { name = "idna" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/b1/df/48c586a5fe32a0f01324ee087459e112ebb7224f646c0b5023f5e79e9956/httpx-0.28.1.tar.gz", hash = "sha256:75e98c5f16b0f35b567856f597f06ff2270a374470a5c2392242528e3e3e42fc", size = 141406, upload-time = "2024-12-06T15:37:23.222Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2a/39/e50c7c3a983047577ee07d2a9e53faf5a69493943ec3f6a384bdc792deb2/httpx-0.28.1-py3-none-any.whl", hash = "sha256:d909fcccc110f8c7faf814ca82a9a4d816bc5a6dbfea25d6591d6985b8ba59ad", size = 73517, upload-time = "2024-12-06T15:37:21.509Z" }, +] + +[[package]] +name = "httpx-aiohttp" +version = "0.1.12" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "aiohttp" }, + { name = "httpx" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/63/2c/b894861cecf030fb45675ea24aa55b5722e97c602a163d872fca66c5a6d8/httpx_aiohttp-0.1.12.tar.gz", hash = "sha256:81feec51fd82c0ecfa0e9aaf1b1a6c2591260d5e2bcbeb7eb0277a78e610df2c", size = 275945, upload-time = "2025-12-12T10:12:15.283Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/16/8d/85c9701e9af72ca132a1783e2a54364a90c6da832304416a30fc11196ab2/httpx_aiohttp-0.1.12-py3-none-any.whl", hash = "sha256:5b0eac39a7f360fa7867a60bcb46bb1024eada9c01cbfecdb54dc1edb3fb7141", size = 6367, upload-time = "2025-12-12T10:12:14.018Z" }, +] + +[[package]] +name = "idna" +version = "3.11" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/6f/6d/0703ccc57f3a7233505399edb88de3cbd678da106337b9fcde432b65ed60/idna-3.11.tar.gz", hash = "sha256:795dafcc9c04ed0c1fb032c2aa73654d8e8c5023a7df64a53f39190ada629902", size = 194582, upload-time = "2025-10-12T14:55:20.501Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/0e/61/66938bbb5fc52dbdf84594873d5b51fb1f7c7794e9c0f5bd885f30bc507b/idna-3.11-py3-none-any.whl", hash = "sha256:771a87f49d9defaf64091e6e6fe9c18d4833f140bd19464795bc32d966ca37ea", size = 71008, upload-time = "2025-10-12T14:55:18.883Z" }, +] + +[[package]] +name = "importlib-metadata" +version = "8.7.1" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "zipp" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/f3/49/3b30cad09e7771a4982d9975a8cbf64f00d4a1ececb53297f1d9a7be1b10/importlib_metadata-8.7.1.tar.gz", hash = "sha256:49fef1ae6440c182052f407c8d34a68f72efc36db9ca90dc0113398f2fdde8bb", size = 57107, upload-time = "2025-12-21T10:00:19.278Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/fa/5e/f8e9a1d23b9c20a551a8a02ea3637b4642e22c2626e3a13a9a29cdea99eb/importlib_metadata-8.7.1-py3-none-any.whl", hash = "sha256:5a1f80bf1daa489495071efbb095d75a634cf28a8bc299581244063b53176151", size = 27865, upload-time = "2025-12-21T10:00:18.329Z" }, +] + +[[package]] +name = "iniconfig" +version = "2.1.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +sdist = { url = "https://files.pythonhosted.org/packages/f2/97/ebf4da567aa6827c909642694d71c9fcf53e5b504f2d96afea02718862f3/iniconfig-2.1.0.tar.gz", hash = "sha256:3abbd2e30b36733fee78f9c7f7308f2d0050e88f0087fd25c2645f63c773e1c7", size = 4793, upload-time = "2025-03-19T20:09:59.721Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2c/e1/e6716421ea10d38022b952c159d5161ca1193197fb744506875fbb87ea7b/iniconfig-2.1.0-py3-none-any.whl", hash = "sha256:9deba5723312380e77435581c6bf4935c94cbfab9b1ed33ef8d238ea168eb760", size = 6050, upload-time = "2025-03-19T20:10:01.071Z" }, +] + +[[package]] +name = "iniconfig" +version = "2.3.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +sdist = { url = "https://files.pythonhosted.org/packages/72/34/14ca021ce8e5dfedc35312d08ba8bf51fdd999c576889fc2c24cb97f4f10/iniconfig-2.3.0.tar.gz", hash = "sha256:c76315c77db068650d49c5b56314774a7804df16fee4402c1f19d6d15d8c4730", size = 20503, upload-time = "2025-10-18T21:55:43.219Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484, upload-time = "2025-10-18T21:55:41.639Z" }, +] + +[[package]] +name = "markdown-it-py" +version = "3.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +dependencies = [ + { name = "mdurl", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/38/71/3b932df36c1a044d397a1f92d1cf91ee0a503d91e470cbd670aa66b07ed0/markdown-it-py-3.0.0.tar.gz", hash = "sha256:e3f60a94fa066dc52ec76661e37c851cb232d92f9886b15cb560aaada2df8feb", size = 74596, upload-time = "2023-06-03T06:41:14.443Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/42/d7/1ec15b46af6af88f19b8e5ffea08fa375d433c998b8a7639e76935c14f1f/markdown_it_py-3.0.0-py3-none-any.whl", hash = "sha256:355216845c60bd96232cd8d8c40e8f9765cc86f46880e43a8fd22dc1a1a8cab1", size = 87528, upload-time = "2023-06-03T06:41:11.019Z" }, +] + +[[package]] +name = "markdown-it-py" +version = "4.0.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +dependencies = [ + { name = "mdurl", marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/5b/f5/4ec618ed16cc4f8fb3b701563655a69816155e79e24a17b651541804721d/markdown_it_py-4.0.0.tar.gz", hash = "sha256:cb0a2b4aa34f932c007117b194e945bd74e0ec24133ceb5bac59009cda1cb9f3", size = 73070, upload-time = "2025-08-11T12:57:52.854Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/94/54/e7d793b573f298e1c9013b8c4dade17d481164aa517d1d7148619c2cedbf/markdown_it_py-4.0.0-py3-none-any.whl", hash = "sha256:87327c59b172c5011896038353a81343b6754500a08cd7a4973bb48c6d578147", size = 87321, upload-time = "2025-08-11T12:57:51.923Z" }, +] + +[[package]] +name = "mdurl" +version = "0.1.2" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/d6/54/cfe61301667036ec958cb99bd3efefba235e65cdeb9c84d24a8293ba1d90/mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba", size = 8729, upload-time = "2022-08-14T12:40:10.846Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" }, +] + +[[package]] +name = "multidict" +version = "6.7.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "typing-extensions", marker = "python_full_version < '3.11' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/80/1e/5492c365f222f907de1039b91f922b93fa4f764c713ee858d235495d8f50/multidict-6.7.0.tar.gz", hash = "sha256:c6e99d9a65ca282e578dfea819cfa9c0a62b2499d8677392e09feaf305e9e6f5", size = 101834, upload-time = "2025-10-06T14:52:30.657Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a9/63/7bdd4adc330abcca54c85728db2327130e49e52e8c3ce685cec44e0f2e9f/multidict-6.7.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:9f474ad5acda359c8758c8accc22032c6abe6dc87a8be2440d097785e27a9349", size = 77153, upload-time = "2025-10-06T14:48:26.409Z" }, + { url = "https://files.pythonhosted.org/packages/3f/bb/b6c35ff175ed1a3142222b78455ee31be71a8396ed3ab5280fbe3ebe4e85/multidict-6.7.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:4b7a9db5a870f780220e931d0002bbfd88fb53aceb6293251e2c839415c1b20e", size = 44993, upload-time = "2025-10-06T14:48:28.4Z" }, + { url = "https://files.pythonhosted.org/packages/e0/1f/064c77877c5fa6df6d346e68075c0f6998547afe952d6471b4c5f6a7345d/multidict-6.7.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:03ca744319864e92721195fa28c7a3b2bc7b686246b35e4078c1e4d0eb5466d3", size = 44607, upload-time = "2025-10-06T14:48:29.581Z" }, + { url = "https://files.pythonhosted.org/packages/04/7a/bf6aa92065dd47f287690000b3d7d332edfccb2277634cadf6a810463c6a/multidict-6.7.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:f0e77e3c0008bc9316e662624535b88d360c3a5d3f81e15cf12c139a75250046", size = 241847, upload-time = "2025-10-06T14:48:32.107Z" }, + { url = "https://files.pythonhosted.org/packages/94/39/297a8de920f76eda343e4ce05f3b489f0ab3f9504f2576dfb37b7c08ca08/multidict-6.7.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:08325c9e5367aa379a3496aa9a022fe8837ff22e00b94db256d3a1378c76ab32", size = 242616, upload-time = "2025-10-06T14:48:34.054Z" }, + { url = "https://files.pythonhosted.org/packages/39/3a/d0eee2898cfd9d654aea6cb8c4addc2f9756e9a7e09391cfe55541f917f7/multidict-6.7.0-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e2862408c99f84aa571ab462d25236ef9cb12a602ea959ba9c9009a54902fc73", size = 222333, upload-time = "2025-10-06T14:48:35.9Z" }, + { url = "https://files.pythonhosted.org/packages/05/48/3b328851193c7a4240815b71eea165b49248867bbb6153a0aee227a0bb47/multidict-6.7.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:4d72a9a2d885f5c208b0cb91ff2ed43636bb7e345ec839ff64708e04f69a13cc", size = 253239, upload-time = "2025-10-06T14:48:37.302Z" }, + { url = "https://files.pythonhosted.org/packages/b1/ca/0706a98c8d126a89245413225ca4a3fefc8435014de309cf8b30acb68841/multidict-6.7.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:478cc36476687bac1514d651cbbaa94b86b0732fb6855c60c673794c7dd2da62", size = 251618, upload-time = "2025-10-06T14:48:38.963Z" }, + { url = "https://files.pythonhosted.org/packages/5e/4f/9c7992f245554d8b173f6f0a048ad24b3e645d883f096857ec2c0822b8bd/multidict-6.7.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:6843b28b0364dc605f21481c90fadb5f60d9123b442eb8a726bb74feef588a84", size = 241655, upload-time = "2025-10-06T14:48:40.312Z" }, + { url = "https://files.pythonhosted.org/packages/31/79/26a85991ae67efd1c0b1fc2e0c275b8a6aceeb155a68861f63f87a798f16/multidict-6.7.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:23bfeee5316266e5ee2d625df2d2c602b829435fc3a235c2ba2131495706e4a0", size = 239245, upload-time = "2025-10-06T14:48:41.848Z" }, + { url = "https://files.pythonhosted.org/packages/14/1e/75fa96394478930b79d0302eaf9a6c69f34005a1a5251ac8b9c336486ec9/multidict-6.7.0-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:680878b9f3d45c31e1f730eef731f9b0bc1da456155688c6745ee84eb818e90e", size = 233523, upload-time = "2025-10-06T14:48:43.749Z" }, + { url = "https://files.pythonhosted.org/packages/b2/5e/085544cb9f9c4ad2b5d97467c15f856df8d9bac410cffd5c43991a5d878b/multidict-6.7.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:eb866162ef2f45063acc7a53a88ef6fe8bf121d45c30ea3c9cd87ce7e191a8d4", size = 243129, upload-time = "2025-10-06T14:48:45.225Z" }, + { url = "https://files.pythonhosted.org/packages/b9/c3/e9d9e2f20c9474e7a8fcef28f863c5cbd29bb5adce6b70cebe8bdad0039d/multidict-6.7.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:df0e3bf7993bdbeca5ac25aa859cf40d39019e015c9c91809ba7093967f7a648", size = 248999, upload-time = "2025-10-06T14:48:46.703Z" }, + { url = "https://files.pythonhosted.org/packages/b5/3f/df171b6efa3239ae33b97b887e42671cd1d94d460614bfb2c30ffdab3b95/multidict-6.7.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:661709cdcd919a2ece2234f9bae7174e5220c80b034585d7d8a755632d3e2111", size = 243711, upload-time = "2025-10-06T14:48:48.146Z" }, + { url = "https://files.pythonhosted.org/packages/3c/2f/9b5564888c4e14b9af64c54acf149263721a283aaf4aa0ae89b091d5d8c1/multidict-6.7.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:096f52730c3fb8ed419db2d44391932b63891b2c5ed14850a7e215c0ba9ade36", size = 237504, upload-time = "2025-10-06T14:48:49.447Z" }, + { url = "https://files.pythonhosted.org/packages/6c/3a/0bd6ca0f7d96d790542d591c8c3354c1e1b6bfd2024d4d92dc3d87485ec7/multidict-6.7.0-cp310-cp310-win32.whl", hash = "sha256:afa8a2978ec65d2336305550535c9c4ff50ee527914328c8677b3973ade52b85", size = 41422, upload-time = "2025-10-06T14:48:50.789Z" }, + { url = "https://files.pythonhosted.org/packages/00/35/f6a637ea2c75f0d3b7c7d41b1189189acff0d9deeb8b8f35536bb30f5e33/multidict-6.7.0-cp310-cp310-win_amd64.whl", hash = "sha256:b15b3afff74f707b9275d5ba6a91ae8f6429c3ffb29bbfd216b0b375a56f13d7", size = 46050, upload-time = "2025-10-06T14:48:51.938Z" }, + { url = "https://files.pythonhosted.org/packages/e7/b8/f7bf8329b39893d02d9d95cf610c75885d12fc0f402b1c894e1c8e01c916/multidict-6.7.0-cp310-cp310-win_arm64.whl", hash = "sha256:4b73189894398d59131a66ff157837b1fafea9974be486d036bb3d32331fdbf0", size = 43153, upload-time = "2025-10-06T14:48:53.146Z" }, + { url = "https://files.pythonhosted.org/packages/34/9e/5c727587644d67b2ed479041e4b1c58e30afc011e3d45d25bbe35781217c/multidict-6.7.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:4d409aa42a94c0b3fa617708ef5276dfe81012ba6753a0370fcc9d0195d0a1fc", size = 76604, upload-time = "2025-10-06T14:48:54.277Z" }, + { url = "https://files.pythonhosted.org/packages/17/e4/67b5c27bd17c085a5ea8f1ec05b8a3e5cba0ca734bfcad5560fb129e70ca/multidict-6.7.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:14c9e076eede3b54c636f8ce1c9c252b5f057c62131211f0ceeec273810c9721", size = 44715, upload-time = "2025-10-06T14:48:55.445Z" }, + { url = "https://files.pythonhosted.org/packages/4d/e1/866a5d77be6ea435711bef2a4291eed11032679b6b28b56b4776ab06ba3e/multidict-6.7.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4c09703000a9d0fa3c3404b27041e574cc7f4df4c6563873246d0e11812a94b6", size = 44332, upload-time = "2025-10-06T14:48:56.706Z" }, + { url = "https://files.pythonhosted.org/packages/31/61/0c2d50241ada71ff61a79518db85ada85fdabfcf395d5968dae1cbda04e5/multidict-6.7.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:a265acbb7bb33a3a2d626afbe756371dce0279e7b17f4f4eda406459c2b5ff1c", size = 245212, upload-time = "2025-10-06T14:48:58.042Z" }, + { url = "https://files.pythonhosted.org/packages/ac/e0/919666a4e4b57fff1b57f279be1c9316e6cdc5de8a8b525d76f6598fefc7/multidict-6.7.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:51cb455de290ae462593e5b1cb1118c5c22ea7f0d3620d9940bf695cea5a4bd7", size = 246671, upload-time = "2025-10-06T14:49:00.004Z" }, + { url = "https://files.pythonhosted.org/packages/a1/cc/d027d9c5a520f3321b65adea289b965e7bcbd2c34402663f482648c716ce/multidict-6.7.0-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:db99677b4457c7a5c5a949353e125ba72d62b35f74e26da141530fbb012218a7", size = 225491, upload-time = "2025-10-06T14:49:01.393Z" }, + { url = "https://files.pythonhosted.org/packages/75/c4/bbd633980ce6155a28ff04e6a6492dd3335858394d7bb752d8b108708558/multidict-6.7.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f470f68adc395e0183b92a2f4689264d1ea4b40504a24d9882c27375e6662bb9", size = 257322, upload-time = "2025-10-06T14:49:02.745Z" }, + { url = "https://files.pythonhosted.org/packages/4c/6d/d622322d344f1f053eae47e033b0b3f965af01212de21b10bcf91be991fb/multidict-6.7.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0db4956f82723cc1c270de9c6e799b4c341d327762ec78ef82bb962f79cc07d8", size = 254694, upload-time = "2025-10-06T14:49:04.15Z" }, + { url = "https://files.pythonhosted.org/packages/a8/9f/78f8761c2705d4c6d7516faed63c0ebdac569f6db1bef95e0d5218fdc146/multidict-6.7.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3e56d780c238f9e1ae66a22d2adf8d16f485381878250db8d496623cd38b22bd", size = 246715, upload-time = "2025-10-06T14:49:05.967Z" }, + { url = "https://files.pythonhosted.org/packages/78/59/950818e04f91b9c2b95aab3d923d9eabd01689d0dcd889563988e9ea0fd8/multidict-6.7.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:9d14baca2ee12c1a64740d4531356ba50b82543017f3ad6de0deb943c5979abb", size = 243189, upload-time = "2025-10-06T14:49:07.37Z" }, + { url = "https://files.pythonhosted.org/packages/7a/3d/77c79e1934cad2ee74991840f8a0110966d9599b3af95964c0cd79bb905b/multidict-6.7.0-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:295a92a76188917c7f99cda95858c822f9e4aae5824246bba9b6b44004ddd0a6", size = 237845, upload-time = "2025-10-06T14:49:08.759Z" }, + { url = "https://files.pythonhosted.org/packages/63/1b/834ce32a0a97a3b70f86437f685f880136677ac00d8bce0027e9fd9c2db7/multidict-6.7.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:39f1719f57adbb767ef592a50ae5ebb794220d1188f9ca93de471336401c34d2", size = 246374, upload-time = "2025-10-06T14:49:10.574Z" }, + { url = "https://files.pythonhosted.org/packages/23/ef/43d1c3ba205b5dec93dc97f3fba179dfa47910fc73aaaea4f7ceb41cec2a/multidict-6.7.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:0a13fb8e748dfc94749f622de065dd5c1def7e0d2216dba72b1d8069a389c6ff", size = 253345, upload-time = "2025-10-06T14:49:12.331Z" }, + { url = "https://files.pythonhosted.org/packages/6b/03/eaf95bcc2d19ead522001f6a650ef32811aa9e3624ff0ad37c445c7a588c/multidict-6.7.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:e3aa16de190d29a0ea1b48253c57d99a68492c8dd8948638073ab9e74dc9410b", size = 246940, upload-time = "2025-10-06T14:49:13.821Z" }, + { url = "https://files.pythonhosted.org/packages/e8/df/ec8a5fd66ea6cd6f525b1fcbb23511b033c3e9bc42b81384834ffa484a62/multidict-6.7.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:a048ce45dcdaaf1defb76b2e684f997fb5abf74437b6cb7b22ddad934a964e34", size = 242229, upload-time = "2025-10-06T14:49:15.603Z" }, + { url = "https://files.pythonhosted.org/packages/8a/a2/59b405d59fd39ec86d1142630e9049243015a5f5291ba49cadf3c090c541/multidict-6.7.0-cp311-cp311-win32.whl", hash = "sha256:a90af66facec4cebe4181b9e62a68be65e45ac9b52b67de9eec118701856e7ff", size = 41308, upload-time = "2025-10-06T14:49:16.871Z" }, + { url = "https://files.pythonhosted.org/packages/32/0f/13228f26f8b882c34da36efa776c3b7348455ec383bab4a66390e42963ae/multidict-6.7.0-cp311-cp311-win_amd64.whl", hash = "sha256:95b5ffa4349df2887518bb839409bcf22caa72d82beec453216802f475b23c81", size = 46037, upload-time = "2025-10-06T14:49:18.457Z" }, + { url = "https://files.pythonhosted.org/packages/84/1f/68588e31b000535a3207fd3c909ebeec4fb36b52c442107499c18a896a2a/multidict-6.7.0-cp311-cp311-win_arm64.whl", hash = "sha256:329aa225b085b6f004a4955271a7ba9f1087e39dcb7e65f6284a988264a63912", size = 43023, upload-time = "2025-10-06T14:49:19.648Z" }, + { url = "https://files.pythonhosted.org/packages/c2/9e/9f61ac18d9c8b475889f32ccfa91c9f59363480613fc807b6e3023d6f60b/multidict-6.7.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:8a3862568a36d26e650a19bb5cbbba14b71789032aebc0423f8cc5f150730184", size = 76877, upload-time = "2025-10-06T14:49:20.884Z" }, + { url = "https://files.pythonhosted.org/packages/38/6f/614f09a04e6184f8824268fce4bc925e9849edfa654ddd59f0b64508c595/multidict-6.7.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:960c60b5849b9b4f9dcc9bea6e3626143c252c74113df2c1540aebce70209b45", size = 45467, upload-time = "2025-10-06T14:49:22.054Z" }, + { url = "https://files.pythonhosted.org/packages/b3/93/c4f67a436dd026f2e780c433277fff72be79152894d9fc36f44569cab1a6/multidict-6.7.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:2049be98fb57a31b4ccf870bf377af2504d4ae35646a19037ec271e4c07998aa", size = 43834, upload-time = "2025-10-06T14:49:23.566Z" }, + { url = "https://files.pythonhosted.org/packages/7f/f5/013798161ca665e4a422afbc5e2d9e4070142a9ff8905e482139cd09e4d0/multidict-6.7.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:0934f3843a1860dd465d38895c17fce1f1cb37295149ab05cd1b9a03afacb2a7", size = 250545, upload-time = "2025-10-06T14:49:24.882Z" }, + { url = "https://files.pythonhosted.org/packages/71/2f/91dbac13e0ba94669ea5119ba267c9a832f0cb65419aca75549fcf09a3dc/multidict-6.7.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b3e34f3a1b8131ba06f1a73adab24f30934d148afcd5f5de9a73565a4404384e", size = 258305, upload-time = "2025-10-06T14:49:26.778Z" }, + { url = "https://files.pythonhosted.org/packages/ef/b0/754038b26f6e04488b48ac621f779c341338d78503fb45403755af2df477/multidict-6.7.0-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:efbb54e98446892590dc2458c19c10344ee9a883a79b5cec4bc34d6656e8d546", size = 242363, upload-time = "2025-10-06T14:49:28.562Z" }, + { url = "https://files.pythonhosted.org/packages/87/15/9da40b9336a7c9fa606c4cf2ed80a649dffeb42b905d4f63a1d7eb17d746/multidict-6.7.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a35c5fc61d4f51eb045061e7967cfe3123d622cd500e8868e7c0c592a09fedc4", size = 268375, upload-time = "2025-10-06T14:49:29.96Z" }, + { url = "https://files.pythonhosted.org/packages/82/72/c53fcade0cc94dfaad583105fd92b3a783af2091eddcb41a6d5a52474000/multidict-6.7.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:29fe6740ebccba4175af1b9b87bf553e9c15cd5868ee967e010efcf94e4fd0f1", size = 269346, upload-time = "2025-10-06T14:49:31.404Z" }, + { url = "https://files.pythonhosted.org/packages/0d/e2/9baffdae21a76f77ef8447f1a05a96ec4bc0a24dae08767abc0a2fe680b8/multidict-6.7.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:123e2a72e20537add2f33a79e605f6191fba2afda4cbb876e35c1a7074298a7d", size = 256107, upload-time = "2025-10-06T14:49:32.974Z" }, + { url = "https://files.pythonhosted.org/packages/3c/06/3f06f611087dc60d65ef775f1fb5aca7c6d61c6db4990e7cda0cef9b1651/multidict-6.7.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:b284e319754366c1aee2267a2036248b24eeb17ecd5dc16022095e747f2f4304", size = 253592, upload-time = "2025-10-06T14:49:34.52Z" }, + { url = "https://files.pythonhosted.org/packages/20/24/54e804ec7945b6023b340c412ce9c3f81e91b3bf5fa5ce65558740141bee/multidict-6.7.0-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:803d685de7be4303b5a657b76e2f6d1240e7e0a8aa2968ad5811fa2285553a12", size = 251024, upload-time = "2025-10-06T14:49:35.956Z" }, + { url = "https://files.pythonhosted.org/packages/14/48/011cba467ea0b17ceb938315d219391d3e421dfd35928e5dbdc3f4ae76ef/multidict-6.7.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:c04a328260dfd5db8c39538f999f02779012268f54614902d0afc775d44e0a62", size = 251484, upload-time = "2025-10-06T14:49:37.631Z" }, + { url = "https://files.pythonhosted.org/packages/0d/2f/919258b43bb35b99fa127435cfb2d91798eb3a943396631ef43e3720dcf4/multidict-6.7.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:8a19cdb57cd3df4cd865849d93ee14920fb97224300c88501f16ecfa2604b4e0", size = 263579, upload-time = "2025-10-06T14:49:39.502Z" }, + { url = "https://files.pythonhosted.org/packages/31/22/a0e884d86b5242b5a74cf08e876bdf299e413016b66e55511f7a804a366e/multidict-6.7.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:9b2fd74c52accced7e75de26023b7dccee62511a600e62311b918ec5c168fc2a", size = 259654, upload-time = "2025-10-06T14:49:41.32Z" }, + { url = "https://files.pythonhosted.org/packages/b2/e5/17e10e1b5c5f5a40f2fcbb45953c9b215f8a4098003915e46a93f5fcaa8f/multidict-6.7.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:3e8bfdd0e487acf992407a140d2589fe598238eaeffa3da8448d63a63cd363f8", size = 251511, upload-time = "2025-10-06T14:49:46.021Z" }, + { url = "https://files.pythonhosted.org/packages/e3/9a/201bb1e17e7af53139597069c375e7b0dcbd47594604f65c2d5359508566/multidict-6.7.0-cp312-cp312-win32.whl", hash = "sha256:dd32a49400a2c3d52088e120ee00c1e3576cbff7e10b98467962c74fdb762ed4", size = 41895, upload-time = "2025-10-06T14:49:48.718Z" }, + { url = "https://files.pythonhosted.org/packages/46/e2/348cd32faad84eaf1d20cce80e2bb0ef8d312c55bca1f7fa9865e7770aaf/multidict-6.7.0-cp312-cp312-win_amd64.whl", hash = "sha256:92abb658ef2d7ef22ac9f8bb88e8b6c3e571671534e029359b6d9e845923eb1b", size = 46073, upload-time = "2025-10-06T14:49:50.28Z" }, + { url = "https://files.pythonhosted.org/packages/25/ec/aad2613c1910dce907480e0c3aa306905830f25df2e54ccc9dea450cb5aa/multidict-6.7.0-cp312-cp312-win_arm64.whl", hash = "sha256:490dab541a6a642ce1a9d61a4781656b346a55c13038f0b1244653828e3a83ec", size = 43226, upload-time = "2025-10-06T14:49:52.304Z" }, + { url = "https://files.pythonhosted.org/packages/d2/86/33272a544eeb36d66e4d9a920602d1a2f57d4ebea4ef3cdfe5a912574c95/multidict-6.7.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:bee7c0588aa0076ce77c0ea5d19a68d76ad81fcd9fe8501003b9a24f9d4000f6", size = 76135, upload-time = "2025-10-06T14:49:54.26Z" }, + { url = "https://files.pythonhosted.org/packages/91/1c/eb97db117a1ebe46d457a3d235a7b9d2e6dcab174f42d1b67663dd9e5371/multidict-6.7.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:7ef6b61cad77091056ce0e7ce69814ef72afacb150b7ac6a3e9470def2198159", size = 45117, upload-time = "2025-10-06T14:49:55.82Z" }, + { url = "https://files.pythonhosted.org/packages/f1/d8/6c3442322e41fb1dd4de8bd67bfd11cd72352ac131f6368315617de752f1/multidict-6.7.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:9c0359b1ec12b1d6849c59f9d319610b7f20ef990a6d454ab151aa0e3b9f78ca", size = 43472, upload-time = "2025-10-06T14:49:57.048Z" }, + { url = "https://files.pythonhosted.org/packages/75/3f/e2639e80325af0b6c6febdf8e57cc07043ff15f57fa1ef808f4ccb5ac4cd/multidict-6.7.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:cd240939f71c64bd658f186330603aac1a9a81bf6273f523fca63673cb7378a8", size = 249342, upload-time = "2025-10-06T14:49:58.368Z" }, + { url = "https://files.pythonhosted.org/packages/5d/cc/84e0585f805cbeaa9cbdaa95f9a3d6aed745b9d25700623ac89a6ecff400/multidict-6.7.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a60a4d75718a5efa473ebd5ab685786ba0c67b8381f781d1be14da49f1a2dc60", size = 257082, upload-time = "2025-10-06T14:49:59.89Z" }, + { url = "https://files.pythonhosted.org/packages/b0/9c/ac851c107c92289acbbf5cfb485694084690c1b17e555f44952c26ddc5bd/multidict-6.7.0-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:53a42d364f323275126aff81fb67c5ca1b7a04fda0546245730a55c8c5f24bc4", size = 240704, upload-time = "2025-10-06T14:50:01.485Z" }, + { url = "https://files.pythonhosted.org/packages/50/cc/5f93e99427248c09da95b62d64b25748a5f5c98c7c2ab09825a1d6af0e15/multidict-6.7.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:3b29b980d0ddbecb736735ee5bef69bb2ddca56eff603c86f3f29a1128299b4f", size = 266355, upload-time = "2025-10-06T14:50:02.955Z" }, + { url = "https://files.pythonhosted.org/packages/ec/0c/2ec1d883ceb79c6f7f6d7ad90c919c898f5d1c6ea96d322751420211e072/multidict-6.7.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:f8a93b1c0ed2d04b97a5e9336fd2d33371b9a6e29ab7dd6503d63407c20ffbaf", size = 267259, upload-time = "2025-10-06T14:50:04.446Z" }, + { url = "https://files.pythonhosted.org/packages/c6/2d/f0b184fa88d6630aa267680bdb8623fb69cb0d024b8c6f0d23f9a0f406d3/multidict-6.7.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9ff96e8815eecacc6645da76c413eb3b3d34cfca256c70b16b286a687d013c32", size = 254903, upload-time = "2025-10-06T14:50:05.98Z" }, + { url = "https://files.pythonhosted.org/packages/06/c9/11ea263ad0df7dfabcad404feb3c0dd40b131bc7f232d5537f2fb1356951/multidict-6.7.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:7516c579652f6a6be0e266aec0acd0db80829ca305c3d771ed898538804c2036", size = 252365, upload-time = "2025-10-06T14:50:07.511Z" }, + { url = "https://files.pythonhosted.org/packages/41/88/d714b86ee2c17d6e09850c70c9d310abac3d808ab49dfa16b43aba9d53fd/multidict-6.7.0-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:040f393368e63fb0f3330e70c26bfd336656bed925e5cbe17c9da839a6ab13ec", size = 250062, upload-time = "2025-10-06T14:50:09.074Z" }, + { url = "https://files.pythonhosted.org/packages/15/fe/ad407bb9e818c2b31383f6131ca19ea7e35ce93cf1310fce69f12e89de75/multidict-6.7.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b3bc26a951007b1057a1c543af845f1c7e3e71cc240ed1ace7bf4484aa99196e", size = 249683, upload-time = "2025-10-06T14:50:10.714Z" }, + { url = "https://files.pythonhosted.org/packages/8c/a4/a89abdb0229e533fb925e7c6e5c40201c2873efebc9abaf14046a4536ee6/multidict-6.7.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:7b022717c748dd1992a83e219587aabe45980d88969f01b316e78683e6285f64", size = 261254, upload-time = "2025-10-06T14:50:12.28Z" }, + { url = "https://files.pythonhosted.org/packages/8d/aa/0e2b27bd88b40a4fb8dc53dd74eecac70edaa4c1dd0707eb2164da3675b3/multidict-6.7.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:9600082733859f00d79dee64effc7aef1beb26adb297416a4ad2116fd61374bd", size = 257967, upload-time = "2025-10-06T14:50:14.16Z" }, + { url = "https://files.pythonhosted.org/packages/d0/8e/0c67b7120d5d5f6d874ed85a085f9dc770a7f9d8813e80f44a9fec820bb7/multidict-6.7.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:94218fcec4d72bc61df51c198d098ce2b378e0ccbac41ddbed5ef44092913288", size = 250085, upload-time = "2025-10-06T14:50:15.639Z" }, + { url = "https://files.pythonhosted.org/packages/ba/55/b73e1d624ea4b8fd4dd07a3bb70f6e4c7c6c5d9d640a41c6ffe5cdbd2a55/multidict-6.7.0-cp313-cp313-win32.whl", hash = "sha256:a37bd74c3fa9d00be2d7b8eca074dc56bd8077ddd2917a839bd989612671ed17", size = 41713, upload-time = "2025-10-06T14:50:17.066Z" }, + { url = "https://files.pythonhosted.org/packages/32/31/75c59e7d3b4205075b4c183fa4ca398a2daf2303ddf616b04ae6ef55cffe/multidict-6.7.0-cp313-cp313-win_amd64.whl", hash = "sha256:30d193c6cc6d559db42b6bcec8a5d395d34d60c9877a0b71ecd7c204fcf15390", size = 45915, upload-time = "2025-10-06T14:50:18.264Z" }, + { url = "https://files.pythonhosted.org/packages/31/2a/8987831e811f1184c22bc2e45844934385363ee61c0a2dcfa8f71b87e608/multidict-6.7.0-cp313-cp313-win_arm64.whl", hash = "sha256:ea3334cabe4d41b7ccd01e4d349828678794edbc2d3ae97fc162a3312095092e", size = 43077, upload-time = "2025-10-06T14:50:19.853Z" }, + { url = "https://files.pythonhosted.org/packages/e8/68/7b3a5170a382a340147337b300b9eb25a9ddb573bcdfff19c0fa3f31ffba/multidict-6.7.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:ad9ce259f50abd98a1ca0aa6e490b58c316a0fce0617f609723e40804add2c00", size = 83114, upload-time = "2025-10-06T14:50:21.223Z" }, + { url = "https://files.pythonhosted.org/packages/55/5c/3fa2d07c84df4e302060f555bbf539310980362236ad49f50eeb0a1c1eb9/multidict-6.7.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:07f5594ac6d084cbb5de2df218d78baf55ef150b91f0ff8a21cc7a2e3a5a58eb", size = 48442, upload-time = "2025-10-06T14:50:22.871Z" }, + { url = "https://files.pythonhosted.org/packages/fc/56/67212d33239797f9bd91962bb899d72bb0f4c35a8652dcdb8ed049bef878/multidict-6.7.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:0591b48acf279821a579282444814a2d8d0af624ae0bc600aa4d1b920b6e924b", size = 46885, upload-time = "2025-10-06T14:50:24.258Z" }, + { url = "https://files.pythonhosted.org/packages/46/d1/908f896224290350721597a61a69cd19b89ad8ee0ae1f38b3f5cd12ea2ac/multidict-6.7.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:749a72584761531d2b9467cfbdfd29487ee21124c304c4b6cb760d8777b27f9c", size = 242588, upload-time = "2025-10-06T14:50:25.716Z" }, + { url = "https://files.pythonhosted.org/packages/ab/67/8604288bbd68680eee0ab568fdcb56171d8b23a01bcd5cb0c8fedf6e5d99/multidict-6.7.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b4c3d199f953acd5b446bf7c0de1fe25d94e09e79086f8dc2f48a11a129cdf1", size = 249966, upload-time = "2025-10-06T14:50:28.192Z" }, + { url = "https://files.pythonhosted.org/packages/20/33/9228d76339f1ba51e3efef7da3ebd91964d3006217aae13211653193c3ff/multidict-6.7.0-cp313-cp313t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:9fb0211dfc3b51efea2f349ec92c114d7754dd62c01f81c3e32b765b70c45c9b", size = 228618, upload-time = "2025-10-06T14:50:29.82Z" }, + { url = "https://files.pythonhosted.org/packages/f8/2d/25d9b566d10cab1c42b3b9e5b11ef79c9111eaf4463b8c257a3bd89e0ead/multidict-6.7.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a027ec240fe73a8d6281872690b988eed307cd7d91b23998ff35ff577ca688b5", size = 257539, upload-time = "2025-10-06T14:50:31.731Z" }, + { url = "https://files.pythonhosted.org/packages/b6/b1/8d1a965e6637fc33de3c0d8f414485c2b7e4af00f42cab3d84e7b955c222/multidict-6.7.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d1d964afecdf3a8288789df2f5751dc0a8261138c3768d9af117ed384e538fad", size = 256345, upload-time = "2025-10-06T14:50:33.26Z" }, + { url = "https://files.pythonhosted.org/packages/ba/0c/06b5a8adbdeedada6f4fb8d8f193d44a347223b11939b42953eeb6530b6b/multidict-6.7.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:caf53b15b1b7df9fbd0709aa01409000a2b4dd03a5f6f5cc548183c7c8f8b63c", size = 247934, upload-time = "2025-10-06T14:50:34.808Z" }, + { url = "https://files.pythonhosted.org/packages/8f/31/b2491b5fe167ca044c6eb4b8f2c9f3b8a00b24c432c365358eadac5d7625/multidict-6.7.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:654030da3197d927f05a536a66186070e98765aa5142794c9904555d3a9d8fb5", size = 245243, upload-time = "2025-10-06T14:50:36.436Z" }, + { url = "https://files.pythonhosted.org/packages/61/1a/982913957cb90406c8c94f53001abd9eafc271cb3e70ff6371590bec478e/multidict-6.7.0-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:2090d3718829d1e484706a2f525e50c892237b2bf9b17a79b059cb98cddc2f10", size = 235878, upload-time = "2025-10-06T14:50:37.953Z" }, + { url = "https://files.pythonhosted.org/packages/be/c0/21435d804c1a1cf7a2608593f4d19bca5bcbd7a81a70b253fdd1c12af9c0/multidict-6.7.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:2d2cfeec3f6f45651b3d408c4acec0ebf3daa9bc8a112a084206f5db5d05b754", size = 243452, upload-time = "2025-10-06T14:50:39.574Z" }, + { url = "https://files.pythonhosted.org/packages/54/0a/4349d540d4a883863191be6eb9a928846d4ec0ea007d3dcd36323bb058ac/multidict-6.7.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:4ef089f985b8c194d341eb2c24ae6e7408c9a0e2e5658699c92f497437d88c3c", size = 252312, upload-time = "2025-10-06T14:50:41.612Z" }, + { url = "https://files.pythonhosted.org/packages/26/64/d5416038dbda1488daf16b676e4dbfd9674dde10a0cc8f4fc2b502d8125d/multidict-6.7.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:e93a0617cd16998784bf4414c7e40f17a35d2350e5c6f0bd900d3a8e02bd3762", size = 246935, upload-time = "2025-10-06T14:50:43.972Z" }, + { url = "https://files.pythonhosted.org/packages/9f/8c/8290c50d14e49f35e0bd4abc25e1bc7711149ca9588ab7d04f886cdf03d9/multidict-6.7.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:f0feece2ef8ebc42ed9e2e8c78fc4aa3cf455733b507c09ef7406364c94376c6", size = 243385, upload-time = "2025-10-06T14:50:45.648Z" }, + { url = "https://files.pythonhosted.org/packages/ef/a0/f83ae75e42d694b3fbad3e047670e511c138be747bc713cf1b10d5096416/multidict-6.7.0-cp313-cp313t-win32.whl", hash = "sha256:19a1d55338ec1be74ef62440ca9e04a2f001a04d0cc49a4983dc320ff0f3212d", size = 47777, upload-time = "2025-10-06T14:50:47.154Z" }, + { url = "https://files.pythonhosted.org/packages/dc/80/9b174a92814a3830b7357307a792300f42c9e94664b01dee8e457551fa66/multidict-6.7.0-cp313-cp313t-win_amd64.whl", hash = "sha256:3da4fb467498df97e986af166b12d01f05d2e04f978a9c1c680ea1988e0bc4b6", size = 53104, upload-time = "2025-10-06T14:50:48.851Z" }, + { url = "https://files.pythonhosted.org/packages/cc/28/04baeaf0428d95bb7a7bea0e691ba2f31394338ba424fb0679a9ed0f4c09/multidict-6.7.0-cp313-cp313t-win_arm64.whl", hash = "sha256:b4121773c49a0776461f4a904cdf6264c88e42218aaa8407e803ca8025872792", size = 45503, upload-time = "2025-10-06T14:50:50.16Z" }, + { url = "https://files.pythonhosted.org/packages/e2/b1/3da6934455dd4b261d4c72f897e3a5728eba81db59959f3a639245891baa/multidict-6.7.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3bab1e4aff7adaa34410f93b1f8e57c4b36b9af0426a76003f441ee1d3c7e842", size = 75128, upload-time = "2025-10-06T14:50:51.92Z" }, + { url = "https://files.pythonhosted.org/packages/14/2c/f069cab5b51d175a1a2cb4ccdf7a2c2dabd58aa5bd933fa036a8d15e2404/multidict-6.7.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:b8512bac933afc3e45fb2b18da8e59b78d4f408399a960339598374d4ae3b56b", size = 44410, upload-time = "2025-10-06T14:50:53.275Z" }, + { url = "https://files.pythonhosted.org/packages/42/e2/64bb41266427af6642b6b128e8774ed84c11b80a90702c13ac0a86bb10cc/multidict-6.7.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:79dcf9e477bc65414ebfea98ffd013cb39552b5ecd62908752e0e413d6d06e38", size = 43205, upload-time = "2025-10-06T14:50:54.911Z" }, + { url = "https://files.pythonhosted.org/packages/02/68/6b086fef8a3f1a8541b9236c594f0c9245617c29841f2e0395d979485cde/multidict-6.7.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:31bae522710064b5cbeddaf2e9f32b1abab70ac6ac91d42572502299e9953128", size = 245084, upload-time = "2025-10-06T14:50:56.369Z" }, + { url = "https://files.pythonhosted.org/packages/15/ee/f524093232007cd7a75c1d132df70f235cfd590a7c9eaccd7ff422ef4ae8/multidict-6.7.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4a0df7ff02397bb63e2fd22af2c87dfa39e8c7f12947bc524dbdc528282c7e34", size = 252667, upload-time = "2025-10-06T14:50:57.991Z" }, + { url = "https://files.pythonhosted.org/packages/02/a5/eeb3f43ab45878f1895118c3ef157a480db58ede3f248e29b5354139c2c9/multidict-6.7.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:7a0222514e8e4c514660e182d5156a415c13ef0aabbd71682fc714e327b95e99", size = 233590, upload-time = "2025-10-06T14:50:59.589Z" }, + { url = "https://files.pythonhosted.org/packages/6a/1e/76d02f8270b97269d7e3dbd45644b1785bda457b474315f8cf999525a193/multidict-6.7.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:2397ab4daaf2698eb51a76721e98db21ce4f52339e535725de03ea962b5a3202", size = 264112, upload-time = "2025-10-06T14:51:01.183Z" }, + { url = "https://files.pythonhosted.org/packages/76/0b/c28a70ecb58963847c2a8efe334904cd254812b10e535aefb3bcce513918/multidict-6.7.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:8891681594162635948a636c9fe0ff21746aeb3dd5463f6e25d9bea3a8a39ca1", size = 261194, upload-time = "2025-10-06T14:51:02.794Z" }, + { url = "https://files.pythonhosted.org/packages/b4/63/2ab26e4209773223159b83aa32721b4021ffb08102f8ac7d689c943fded1/multidict-6.7.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:18706cc31dbf402a7945916dd5cddf160251b6dab8a2c5f3d6d5a55949f676b3", size = 248510, upload-time = "2025-10-06T14:51:04.724Z" }, + { url = "https://files.pythonhosted.org/packages/93/cd/06c1fa8282af1d1c46fd55c10a7930af652afdce43999501d4d68664170c/multidict-6.7.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:f844a1bbf1d207dd311a56f383f7eda2d0e134921d45751842d8235e7778965d", size = 248395, upload-time = "2025-10-06T14:51:06.306Z" }, + { url = "https://files.pythonhosted.org/packages/99/ac/82cb419dd6b04ccf9e7e61befc00c77614fc8134362488b553402ecd55ce/multidict-6.7.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:d4393e3581e84e5645506923816b9cc81f5609a778c7e7534054091acc64d1c6", size = 239520, upload-time = "2025-10-06T14:51:08.091Z" }, + { url = "https://files.pythonhosted.org/packages/fa/f3/a0f9bf09493421bd8716a362e0cd1d244f5a6550f5beffdd6b47e885b331/multidict-6.7.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:fbd18dc82d7bf274b37aa48d664534330af744e03bccf696d6f4c6042e7d19e7", size = 245479, upload-time = "2025-10-06T14:51:10.365Z" }, + { url = "https://files.pythonhosted.org/packages/8d/01/476d38fc73a212843f43c852b0eee266b6971f0e28329c2184a8df90c376/multidict-6.7.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:b6234e14f9314731ec45c42fc4554b88133ad53a09092cc48a88e771c125dadb", size = 258903, upload-time = "2025-10-06T14:51:12.466Z" }, + { url = "https://files.pythonhosted.org/packages/49/6d/23faeb0868adba613b817d0e69c5f15531b24d462af8012c4f6de4fa8dc3/multidict-6.7.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:08d4379f9744d8f78d98c8673c06e202ffa88296f009c71bbafe8a6bf847d01f", size = 252333, upload-time = "2025-10-06T14:51:14.48Z" }, + { url = "https://files.pythonhosted.org/packages/1e/cc/48d02ac22b30fa247f7dad82866e4b1015431092f4ba6ebc7e77596e0b18/multidict-6.7.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:9fe04da3f79387f450fd0061d4dd2e45a72749d31bf634aecc9e27f24fdc4b3f", size = 243411, upload-time = "2025-10-06T14:51:16.072Z" }, + { url = "https://files.pythonhosted.org/packages/4a/03/29a8bf5a18abf1fe34535c88adbdfa88c9fb869b5a3b120692c64abe8284/multidict-6.7.0-cp314-cp314-win32.whl", hash = "sha256:fbafe31d191dfa7c4c51f7a6149c9fb7e914dcf9ffead27dcfd9f1ae382b3885", size = 40940, upload-time = "2025-10-06T14:51:17.544Z" }, + { url = "https://files.pythonhosted.org/packages/82/16/7ed27b680791b939de138f906d5cf2b4657b0d45ca6f5dd6236fdddafb1a/multidict-6.7.0-cp314-cp314-win_amd64.whl", hash = "sha256:2f67396ec0310764b9222a1728ced1ab638f61aadc6226f17a71dd9324f9a99c", size = 45087, upload-time = "2025-10-06T14:51:18.875Z" }, + { url = "https://files.pythonhosted.org/packages/cd/3c/e3e62eb35a1950292fe39315d3c89941e30a9d07d5d2df42965ab041da43/multidict-6.7.0-cp314-cp314-win_arm64.whl", hash = "sha256:ba672b26069957ee369cfa7fc180dde1fc6f176eaf1e6beaf61fbebbd3d9c000", size = 42368, upload-time = "2025-10-06T14:51:20.225Z" }, + { url = "https://files.pythonhosted.org/packages/8b/40/cd499bd0dbc5f1136726db3153042a735fffd0d77268e2ee20d5f33c010f/multidict-6.7.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:c1dcc7524066fa918c6a27d61444d4ee7900ec635779058571f70d042d86ed63", size = 82326, upload-time = "2025-10-06T14:51:21.588Z" }, + { url = "https://files.pythonhosted.org/packages/13/8a/18e031eca251c8df76daf0288e6790561806e439f5ce99a170b4af30676b/multidict-6.7.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:27e0b36c2d388dc7b6ced3406671b401e84ad7eb0656b8f3a2f46ed0ce483718", size = 48065, upload-time = "2025-10-06T14:51:22.93Z" }, + { url = "https://files.pythonhosted.org/packages/40/71/5e6701277470a87d234e433fb0a3a7deaf3bcd92566e421e7ae9776319de/multidict-6.7.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:2a7baa46a22e77f0988e3b23d4ede5513ebec1929e34ee9495be535662c0dfe2", size = 46475, upload-time = "2025-10-06T14:51:24.352Z" }, + { url = "https://files.pythonhosted.org/packages/fe/6a/bab00cbab6d9cfb57afe1663318f72ec28289ea03fd4e8236bb78429893a/multidict-6.7.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:7bf77f54997a9166a2f5675d1201520586439424c2511723a7312bdb4bcc034e", size = 239324, upload-time = "2025-10-06T14:51:25.822Z" }, + { url = "https://files.pythonhosted.org/packages/2a/5f/8de95f629fc22a7769ade8b41028e3e5a822c1f8904f618d175945a81ad3/multidict-6.7.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e011555abada53f1578d63389610ac8a5400fc70ce71156b0aa30d326f1a5064", size = 246877, upload-time = "2025-10-06T14:51:27.604Z" }, + { url = "https://files.pythonhosted.org/packages/23/b4/38881a960458f25b89e9f4a4fdcb02ac101cfa710190db6e5528841e67de/multidict-6.7.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:28b37063541b897fd6a318007373930a75ca6d6ac7c940dbe14731ffdd8d498e", size = 225824, upload-time = "2025-10-06T14:51:29.664Z" }, + { url = "https://files.pythonhosted.org/packages/1e/39/6566210c83f8a261575f18e7144736059f0c460b362e96e9cf797a24b8e7/multidict-6.7.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:05047ada7a2fde2631a0ed706f1fd68b169a681dfe5e4cf0f8e4cb6618bbc2cd", size = 253558, upload-time = "2025-10-06T14:51:31.684Z" }, + { url = "https://files.pythonhosted.org/packages/00/a3/67f18315100f64c269f46e6c0319fa87ba68f0f64f2b8e7fd7c72b913a0b/multidict-6.7.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:716133f7d1d946a4e1b91b1756b23c088881e70ff180c24e864c26192ad7534a", size = 252339, upload-time = "2025-10-06T14:51:33.699Z" }, + { url = "https://files.pythonhosted.org/packages/c8/2a/1cb77266afee2458d82f50da41beba02159b1d6b1f7973afc9a1cad1499b/multidict-6.7.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d1bed1b467ef657f2a0ae62844a607909ef1c6889562de5e1d505f74457d0b96", size = 244895, upload-time = "2025-10-06T14:51:36.189Z" }, + { url = "https://files.pythonhosted.org/packages/dd/72/09fa7dd487f119b2eb9524946ddd36e2067c08510576d43ff68469563b3b/multidict-6.7.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:ca43bdfa5d37bd6aee89d85e1d0831fb86e25541be7e9d376ead1b28974f8e5e", size = 241862, upload-time = "2025-10-06T14:51:41.291Z" }, + { url = "https://files.pythonhosted.org/packages/65/92/bc1f8bd0853d8669300f732c801974dfc3702c3eeadae2f60cef54dc69d7/multidict-6.7.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:44b546bd3eb645fd26fb949e43c02a25a2e632e2ca21a35e2e132c8105dc8599", size = 232376, upload-time = "2025-10-06T14:51:43.55Z" }, + { url = "https://files.pythonhosted.org/packages/09/86/ac39399e5cb9d0c2ac8ef6e10a768e4d3bc933ac808d49c41f9dc23337eb/multidict-6.7.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:a6ef16328011d3f468e7ebc326f24c1445f001ca1dec335b2f8e66bed3006394", size = 240272, upload-time = "2025-10-06T14:51:45.265Z" }, + { url = "https://files.pythonhosted.org/packages/3d/b6/fed5ac6b8563ec72df6cb1ea8dac6d17f0a4a1f65045f66b6d3bf1497c02/multidict-6.7.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:5aa873cbc8e593d361ae65c68f85faadd755c3295ea2c12040ee146802f23b38", size = 248774, upload-time = "2025-10-06T14:51:46.836Z" }, + { url = "https://files.pythonhosted.org/packages/6b/8d/b954d8c0dc132b68f760aefd45870978deec6818897389dace00fcde32ff/multidict-6.7.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:3d7b6ccce016e29df4b7ca819659f516f0bc7a4b3efa3bb2012ba06431b044f9", size = 242731, upload-time = "2025-10-06T14:51:48.541Z" }, + { url = "https://files.pythonhosted.org/packages/16/9d/a2dac7009125d3540c2f54e194829ea18ac53716c61b655d8ed300120b0f/multidict-6.7.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:171b73bd4ee683d307599b66793ac80981b06f069b62eea1c9e29c9241aa66b0", size = 240193, upload-time = "2025-10-06T14:51:50.355Z" }, + { url = "https://files.pythonhosted.org/packages/39/ca/c05f144128ea232ae2178b008d5011d4e2cea86e4ee8c85c2631b1b94802/multidict-6.7.0-cp314-cp314t-win32.whl", hash = "sha256:b2d7f80c4e1fd010b07cb26820aae86b7e73b681ee4889684fb8d2d4537aab13", size = 48023, upload-time = "2025-10-06T14:51:51.883Z" }, + { url = "https://files.pythonhosted.org/packages/ba/8f/0a60e501584145588be1af5cc829265701ba3c35a64aec8e07cbb71d39bb/multidict-6.7.0-cp314-cp314t-win_amd64.whl", hash = "sha256:09929cab6fcb68122776d575e03c6cc64ee0b8fca48d17e135474b042ce515cd", size = 53507, upload-time = "2025-10-06T14:51:53.672Z" }, + { url = "https://files.pythonhosted.org/packages/7f/ae/3148b988a9c6239903e786eac19c889fab607c31d6efa7fb2147e5680f23/multidict-6.7.0-cp314-cp314t-win_arm64.whl", hash = "sha256:cc41db090ed742f32bd2d2c721861725e6109681eddf835d0a82bd3a5c382827", size = 44804, upload-time = "2025-10-06T14:51:55.415Z" }, + { url = "https://files.pythonhosted.org/packages/90/d7/4cf84257902265c4250769ac49f4eaab81c182ee9aff8bf59d2714dbb174/multidict-6.7.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:363eb68a0a59bd2303216d2346e6c441ba10d36d1f9969fcb6f1ba700de7bb5c", size = 77073, upload-time = "2025-10-06T14:51:57.386Z" }, + { url = "https://files.pythonhosted.org/packages/6d/51/194e999630a656e76c2965a1590d12faa5cd528170f2abaa04423e09fe8d/multidict-6.7.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:d874eb056410ca05fed180b6642e680373688efafc7f077b2a2f61811e873a40", size = 44928, upload-time = "2025-10-06T14:51:58.791Z" }, + { url = "https://files.pythonhosted.org/packages/e5/6b/2a195373c33068c9158e0941d0b46cfcc9c1d894ca2eb137d1128081dff0/multidict-6.7.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:8b55d5497b51afdfde55925e04a022f1de14d4f4f25cdfd4f5d9b0aa96166851", size = 44581, upload-time = "2025-10-06T14:52:00.174Z" }, + { url = "https://files.pythonhosted.org/packages/69/7b/7f4f2e644b6978bf011a5fd9a5ebb7c21de3f38523b1f7897d36a1ac1311/multidict-6.7.0-cp39-cp39-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:f8e5c0031b90ca9ce555e2e8fd5c3b02a25f14989cbc310701823832c99eb687", size = 239901, upload-time = "2025-10-06T14:52:02.416Z" }, + { url = "https://files.pythonhosted.org/packages/3c/b5/952c72786710a031aa204a9adf7db66d7f97a2c6573889d58b9e60fe6702/multidict-6.7.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9cf41880c991716f3c7cec48e2f19ae4045fc9db5fc9cff27347ada24d710bb5", size = 240534, upload-time = "2025-10-06T14:52:04.105Z" }, + { url = "https://files.pythonhosted.org/packages/f3/ef/109fe1f2471e4c458c74242c7e4a833f2d9fc8a6813cd7ee345b0bad18f9/multidict-6.7.0-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:8cfc12a8630a29d601f48d47787bd7eb730e475e83edb5d6c5084317463373eb", size = 219545, upload-time = "2025-10-06T14:52:06.208Z" }, + { url = "https://files.pythonhosted.org/packages/42/bd/327d91288114967f9fe90dc53de70aa3fec1b9073e46aa32c4828f771a87/multidict-6.7.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:3996b50c3237c4aec17459217c1e7bbdead9a22a0fcd3c365564fbd16439dde6", size = 251187, upload-time = "2025-10-06T14:52:08.049Z" }, + { url = "https://files.pythonhosted.org/packages/f4/13/a8b078ebbaceb7819fd28cd004413c33b98f1b70d542a62e6a00b74fb09f/multidict-6.7.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:7f5170993a0dd3ab871c74f45c0a21a4e2c37a2f2b01b5f722a2ad9c6650469e", size = 249379, upload-time = "2025-10-06T14:52:09.831Z" }, + { url = "https://files.pythonhosted.org/packages/e3/6d/ab12e1246be4d65d1f55de1e6f6aaa9b8120eddcfdd1d290439c7833d5ce/multidict-6.7.0-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ec81878ddf0e98817def1e77d4f50dae5ef5b0e4fe796fae3bd674304172416e", size = 239241, upload-time = "2025-10-06T14:52:11.561Z" }, + { url = "https://files.pythonhosted.org/packages/bb/d7/079a93625208c173b8fa756396814397c0fd9fee61ef87b75a748820b86e/multidict-6.7.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:9281bf5b34f59afbc6b1e477a372e9526b66ca446f4bf62592839c195a718b32", size = 237418, upload-time = "2025-10-06T14:52:13.671Z" }, + { url = "https://files.pythonhosted.org/packages/c9/29/03777c2212274aa9440918d604dc9d6af0e6b4558c611c32c3dcf1a13870/multidict-6.7.0-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:68af405971779d8b37198726f2b6fe3955db846fee42db7a4286fc542203934c", size = 232987, upload-time = "2025-10-06T14:52:15.708Z" }, + { url = "https://files.pythonhosted.org/packages/d9/00/11188b68d85a84e8050ee34724d6ded19ad03975caebe0c8dcb2829b37bf/multidict-6.7.0-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:3ba3ef510467abb0667421a286dc906e30eb08569365f5cdb131d7aff7c2dd84", size = 240985, upload-time = "2025-10-06T14:52:17.317Z" }, + { url = "https://files.pythonhosted.org/packages/df/0c/12eef6aeda21859c6cdf7d75bd5516d83be3efe3d8cc45fd1a3037f5b9dc/multidict-6.7.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:b61189b29081a20c7e4e0b49b44d5d44bb0dc92be3c6d06a11cc043f81bf9329", size = 246855, upload-time = "2025-10-06T14:52:19.096Z" }, + { url = "https://files.pythonhosted.org/packages/69/f6/076120fd8bb3975f09228e288e08bff6b9f1bfd5166397c7ba284f622ab2/multidict-6.7.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:fb287618b9c7aa3bf8d825f02d9201b2f13078a5ed3b293c8f4d953917d84d5e", size = 241804, upload-time = "2025-10-06T14:52:21.166Z" }, + { url = "https://files.pythonhosted.org/packages/5f/51/41bb950c81437b88a93e6ddfca1d8763569ae861e638442838c4375f7497/multidict-6.7.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:521f33e377ff64b96c4c556b81c55d0cfffb96a11c194fd0c3f1e56f3d8dd5a4", size = 235321, upload-time = "2025-10-06T14:52:23.208Z" }, + { url = "https://files.pythonhosted.org/packages/5a/cf/5bbd31f055199d56c1f6b04bbadad3ccb24e6d5d4db75db774fc6d6674b8/multidict-6.7.0-cp39-cp39-win32.whl", hash = "sha256:ce8fdc2dca699f8dbf055a61d73eaa10482569ad20ee3c36ef9641f69afa8c91", size = 41435, upload-time = "2025-10-06T14:52:24.735Z" }, + { url = "https://files.pythonhosted.org/packages/af/01/547ffe9c2faec91c26965c152f3fea6cff068b6037401f61d310cc861ff4/multidict-6.7.0-cp39-cp39-win_amd64.whl", hash = "sha256:7e73299c99939f089dd9b2120a04a516b95cdf8c1cd2b18c53ebf0de80b1f18f", size = 46193, upload-time = "2025-10-06T14:52:26.101Z" }, + { url = "https://files.pythonhosted.org/packages/27/77/cfa5461d1d2651d6fc24216c92b4a21d4e385a41c46e0d9f3b070675167b/multidict-6.7.0-cp39-cp39-win_arm64.whl", hash = "sha256:6bdce131e14b04fd34a809b6380dbfd826065c3e2fe8a50dbae659fa0c390546", size = 43118, upload-time = "2025-10-06T14:52:27.876Z" }, + { url = "https://files.pythonhosted.org/packages/b7/da/7d22601b625e241d4f23ef1ebff8acfc60da633c9e7e7922e24d10f592b3/multidict-6.7.0-py3-none-any.whl", hash = "sha256:394fc5c42a333c9ffc3e421a4c85e08580d990e08b99f6bf35b4132114c5dcb3", size = 12317, upload-time = "2025-10-06T14:52:29.272Z" }, +] + +[[package]] +name = "mypy" +version = "1.17.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "mypy-extensions" }, + { name = "pathspec" }, + { name = "tomli", marker = "python_full_version < '3.11' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "typing-extensions" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/1e/e3/034322d5a779685218ed69286c32faa505247f1f096251ef66c8fd203b08/mypy-1.17.0.tar.gz", hash = "sha256:e5d7ccc08ba089c06e2f5629c660388ef1fee708444f1dee0b9203fa031dee03", size = 3352114, upload-time = "2025-07-14T20:34:30.181Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6a/31/e762baa3b73905c856d45ab77b4af850e8159dffffd86a52879539a08c6b/mypy-1.17.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:f8e08de6138043108b3b18f09d3f817a4783912e48828ab397ecf183135d84d6", size = 10998313, upload-time = "2025-07-14T20:33:24.519Z" }, + { url = "https://files.pythonhosted.org/packages/1c/c1/25b2f0d46fb7e0b5e2bee61ec3a47fe13eff9e3c2f2234f144858bbe6485/mypy-1.17.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ce4a17920ec144647d448fc43725b5873548b1aae6c603225626747ededf582d", size = 10128922, upload-time = "2025-07-14T20:34:06.414Z" }, + { url = "https://files.pythonhosted.org/packages/02/78/6d646603a57aa8a2886df1b8881fe777ea60f28098790c1089230cd9c61d/mypy-1.17.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6ff25d151cc057fdddb1cb1881ef36e9c41fa2a5e78d8dd71bee6e4dcd2bc05b", size = 11913524, upload-time = "2025-07-14T20:33:19.109Z" }, + { url = "https://files.pythonhosted.org/packages/4f/19/dae6c55e87ee426fb76980f7e78484450cad1c01c55a1dc4e91c930bea01/mypy-1.17.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:93468cf29aa9a132bceb103bd8475f78cacde2b1b9a94fd978d50d4bdf616c9a", size = 12650527, upload-time = "2025-07-14T20:32:44.095Z" }, + { url = "https://files.pythonhosted.org/packages/86/e1/f916845a235235a6c1e4d4d065a3930113767001d491b8b2e1b61ca56647/mypy-1.17.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:98189382b310f16343151f65dd7e6867386d3e35f7878c45cfa11383d175d91f", size = 12897284, upload-time = "2025-07-14T20:33:38.168Z" }, + { url = "https://files.pythonhosted.org/packages/ae/dc/414760708a4ea1b096bd214d26a24e30ac5e917ef293bc33cdb6fe22d2da/mypy-1.17.0-cp310-cp310-win_amd64.whl", hash = "sha256:c004135a300ab06a045c1c0d8e3f10215e71d7b4f5bb9a42ab80236364429937", size = 9506493, upload-time = "2025-07-14T20:34:01.093Z" }, + { url = "https://files.pythonhosted.org/packages/d4/24/82efb502b0b0f661c49aa21cfe3e1999ddf64bf5500fc03b5a1536a39d39/mypy-1.17.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:9d4fe5c72fd262d9c2c91c1117d16aac555e05f5beb2bae6a755274c6eec42be", size = 10914150, upload-time = "2025-07-14T20:31:51.985Z" }, + { url = "https://files.pythonhosted.org/packages/03/96/8ef9a6ff8cedadff4400e2254689ca1dc4b420b92c55255b44573de10c54/mypy-1.17.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d96b196e5c16f41b4f7736840e8455958e832871990c7ba26bf58175e357ed61", size = 10039845, upload-time = "2025-07-14T20:32:30.527Z" }, + { url = "https://files.pythonhosted.org/packages/df/32/7ce359a56be779d38021d07941cfbb099b41411d72d827230a36203dbb81/mypy-1.17.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:73a0ff2dd10337ceb521c080d4147755ee302dcde6e1a913babd59473904615f", size = 11837246, upload-time = "2025-07-14T20:32:01.28Z" }, + { url = "https://files.pythonhosted.org/packages/82/16/b775047054de4d8dbd668df9137707e54b07fe18c7923839cd1e524bf756/mypy-1.17.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:24cfcc1179c4447854e9e406d3af0f77736d631ec87d31c6281ecd5025df625d", size = 12571106, upload-time = "2025-07-14T20:34:26.942Z" }, + { url = "https://files.pythonhosted.org/packages/a1/cf/fa33eaf29a606102c8d9ffa45a386a04c2203d9ad18bf4eef3e20c43ebc8/mypy-1.17.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3c56f180ff6430e6373db7a1d569317675b0a451caf5fef6ce4ab365f5f2f6c3", size = 12759960, upload-time = "2025-07-14T20:33:42.882Z" }, + { url = "https://files.pythonhosted.org/packages/94/75/3f5a29209f27e739ca57e6350bc6b783a38c7621bdf9cac3ab8a08665801/mypy-1.17.0-cp311-cp311-win_amd64.whl", hash = "sha256:eafaf8b9252734400f9b77df98b4eee3d2eecab16104680d51341c75702cad70", size = 9503888, upload-time = "2025-07-14T20:32:34.392Z" }, + { url = "https://files.pythonhosted.org/packages/12/e9/e6824ed620bbf51d3bf4d6cbbe4953e83eaf31a448d1b3cfb3620ccb641c/mypy-1.17.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:f986f1cab8dbec39ba6e0eaa42d4d3ac6686516a5d3dccd64be095db05ebc6bb", size = 11086395, upload-time = "2025-07-14T20:34:11.452Z" }, + { url = "https://files.pythonhosted.org/packages/ba/51/a4afd1ae279707953be175d303f04a5a7bd7e28dc62463ad29c1c857927e/mypy-1.17.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:51e455a54d199dd6e931cd7ea987d061c2afbaf0960f7f66deef47c90d1b304d", size = 10120052, upload-time = "2025-07-14T20:33:09.897Z" }, + { url = "https://files.pythonhosted.org/packages/8a/71/19adfeac926ba8205f1d1466d0d360d07b46486bf64360c54cb5a2bd86a8/mypy-1.17.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3204d773bab5ff4ebbd1f8efa11b498027cd57017c003ae970f310e5b96be8d8", size = 11861806, upload-time = "2025-07-14T20:32:16.028Z" }, + { url = "https://files.pythonhosted.org/packages/0b/64/d6120eca3835baf7179e6797a0b61d6c47e0bc2324b1f6819d8428d5b9ba/mypy-1.17.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1051df7ec0886fa246a530ae917c473491e9a0ba6938cfd0ec2abc1076495c3e", size = 12744371, upload-time = "2025-07-14T20:33:33.503Z" }, + { url = "https://files.pythonhosted.org/packages/1f/dc/56f53b5255a166f5bd0f137eed960e5065f2744509dfe69474ff0ba772a5/mypy-1.17.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:f773c6d14dcc108a5b141b4456b0871df638eb411a89cd1c0c001fc4a9d08fc8", size = 12914558, upload-time = "2025-07-14T20:33:56.961Z" }, + { url = "https://files.pythonhosted.org/packages/69/ac/070bad311171badc9add2910e7f89271695a25c136de24bbafc7eded56d5/mypy-1.17.0-cp312-cp312-win_amd64.whl", hash = "sha256:1619a485fd0e9c959b943c7b519ed26b712de3002d7de43154a489a2d0fd817d", size = 9585447, upload-time = "2025-07-14T20:32:20.594Z" }, + { url = "https://files.pythonhosted.org/packages/be/7b/5f8ab461369b9e62157072156935cec9d272196556bdc7c2ff5f4c7c0f9b/mypy-1.17.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:2c41aa59211e49d717d92b3bb1238c06d387c9325d3122085113c79118bebb06", size = 11070019, upload-time = "2025-07-14T20:32:07.99Z" }, + { url = "https://files.pythonhosted.org/packages/9c/f8/c49c9e5a2ac0badcc54beb24e774d2499748302c9568f7f09e8730e953fa/mypy-1.17.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:0e69db1fb65b3114f98c753e3930a00514f5b68794ba80590eb02090d54a5d4a", size = 10114457, upload-time = "2025-07-14T20:33:47.285Z" }, + { url = "https://files.pythonhosted.org/packages/89/0c/fb3f9c939ad9beed3e328008b3fb90b20fda2cddc0f7e4c20dbefefc3b33/mypy-1.17.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:03ba330b76710f83d6ac500053f7727270b6b8553b0423348ffb3af6f2f7b889", size = 11857838, upload-time = "2025-07-14T20:33:14.462Z" }, + { url = "https://files.pythonhosted.org/packages/4c/66/85607ab5137d65e4f54d9797b77d5a038ef34f714929cf8ad30b03f628df/mypy-1.17.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:037bc0f0b124ce46bfde955c647f3e395c6174476a968c0f22c95a8d2f589bba", size = 12731358, upload-time = "2025-07-14T20:32:25.579Z" }, + { url = "https://files.pythonhosted.org/packages/73/d0/341dbbfb35ce53d01f8f2969facbb66486cee9804048bf6c01b048127501/mypy-1.17.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:c38876106cb6132259683632b287238858bd58de267d80defb6f418e9ee50658", size = 12917480, upload-time = "2025-07-14T20:34:21.868Z" }, + { url = "https://files.pythonhosted.org/packages/64/63/70c8b7dbfc520089ac48d01367a97e8acd734f65bd07813081f508a8c94c/mypy-1.17.0-cp313-cp313-win_amd64.whl", hash = "sha256:d30ba01c0f151998f367506fab31c2ac4527e6a7b2690107c7a7f9e3cb419a9c", size = 9589666, upload-time = "2025-07-14T20:34:16.841Z" }, + { url = "https://files.pythonhosted.org/packages/9f/a0/6263dd11941231f688f0a8f2faf90ceac1dc243d148d314a089d2fe25108/mypy-1.17.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:63e751f1b5ab51d6f3d219fe3a2fe4523eaa387d854ad06906c63883fde5b1ab", size = 10988185, upload-time = "2025-07-14T20:33:04.797Z" }, + { url = "https://files.pythonhosted.org/packages/02/13/b8f16d6b0dc80277129559c8e7dbc9011241a0da8f60d031edb0e6e9ac8f/mypy-1.17.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:f7fb09d05e0f1c329a36dcd30e27564a3555717cde87301fae4fb542402ddfad", size = 10120169, upload-time = "2025-07-14T20:32:38.84Z" }, + { url = "https://files.pythonhosted.org/packages/14/ef/978ba79df0d65af680e20d43121363cf643eb79b04bf3880d01fc8afeb6f/mypy-1.17.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b72c34ce05ac3a1361ae2ebb50757fb6e3624032d91488d93544e9f82db0ed6c", size = 11918121, upload-time = "2025-07-14T20:33:52.328Z" }, + { url = "https://files.pythonhosted.org/packages/f4/10/55ef70b104151a0d8280474f05268ff0a2a79be8d788d5e647257d121309/mypy-1.17.0-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:434ad499ad8dde8b2f6391ddfa982f41cb07ccda8e3c67781b1bfd4e5f9450a8", size = 12648821, upload-time = "2025-07-14T20:32:59.631Z" }, + { url = "https://files.pythonhosted.org/packages/26/8c/7781fcd2e1eef48fbedd3a422c21fe300a8e03ed5be2eb4bd10246a77f4e/mypy-1.17.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:f105f61a5eff52e137fd73bee32958b2add9d9f0a856f17314018646af838e97", size = 12896955, upload-time = "2025-07-14T20:32:49.543Z" }, + { url = "https://files.pythonhosted.org/packages/78/13/03ac759dabe86e98ca7b6681f114f90ee03f3ff8365a57049d311bd4a4e3/mypy-1.17.0-cp39-cp39-win_amd64.whl", hash = "sha256:ba06254a5a22729853209550d80f94e28690d5530c661f9416a68ac097b13fc4", size = 9512957, upload-time = "2025-07-14T20:33:28.619Z" }, + { url = "https://files.pythonhosted.org/packages/e3/fc/ee058cc4316f219078464555873e99d170bde1d9569abd833300dbeb484a/mypy-1.17.0-py3-none-any.whl", hash = "sha256:15d9d0018237ab058e5de3d8fce61b6fa72cc59cc78fd91f1b474bce12abf496", size = 2283195, upload-time = "2025-07-14T20:31:54.753Z" }, +] + +[[package]] +name = "mypy-extensions" +version = "1.1.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343, upload-time = "2025-04-22T14:54:24.164Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963, upload-time = "2025-04-22T14:54:22.983Z" }, +] + +[[package]] +name = "nodeenv" +version = "1.10.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/24/bf/d1bda4f6168e0b2e9e5958945e01910052158313224ada5ce1fb2e1113b8/nodeenv-1.10.0.tar.gz", hash = "sha256:996c191ad80897d076bdfba80a41994c2b47c68e224c542b48feba42ba00f8bb", size = 55611, upload-time = "2025-12-20T14:08:54.006Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/88/b2/d0896bdcdc8d28a7fc5717c305f1a861c26e18c05047949fb371034d98bd/nodeenv-1.10.0-py2.py3-none-any.whl", hash = "sha256:5bb13e3eed2923615535339b3c620e76779af4cb4c6a90deccc9e36b274d3827", size = 23438, upload-time = "2025-12-20T14:08:52.782Z" }, +] + +[[package]] +name = "oz-agent-sdk" +version = "0.10.1" +source = { editable = "." } +dependencies = [ + { name = "anyio" }, + { name = "distro" }, + { name = "httpx" }, + { name = "pydantic", version = "1.10.26", source = { registry = "https://pypi.org/simple" }, marker = "extra == 'group-12-oz-agent-sdk-pydantic-v1'" }, + { name = "pydantic", version = "2.12.5", source = { registry = "https://pypi.org/simple" }, marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, + { name = "sniffio" }, + { name = "typing-extensions" }, +] + +[package.optional-dependencies] +aiohttp = [ + { name = "aiohttp" }, + { name = "httpx-aiohttp" }, +] + +[package.dev-dependencies] +dev = [ + { name = "dirty-equals" }, + { name = "importlib-metadata" }, + { name = "mypy" }, + { name = "pyright" }, + { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest", version = "9.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest-asyncio", version = "1.2.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest-asyncio", version = "1.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest-xdist" }, + { name = "respx" }, + { name = "rich" }, + { name = "ruff" }, + { name = "time-machine", version = "2.19.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "time-machine", version = "3.2.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +pydantic-v1 = [ + { name = "pydantic", version = "1.10.26", source = { registry = "https://pypi.org/simple" } }, +] +pydantic-v2 = [ + { name = "pydantic", version = "2.12.5", source = { registry = "https://pypi.org/simple" } }, +] + +[package.metadata] +requires-dist = [ + { name = "aiohttp", marker = "extra == 'aiohttp'" }, + { name = "anyio", specifier = ">=3.5.0,<5" }, + { name = "distro", specifier = ">=1.7.0,<2" }, + { name = "httpx", specifier = ">=0.23.0,<1" }, + { name = "httpx-aiohttp", marker = "extra == 'aiohttp'", specifier = ">=0.1.9" }, + { name = "pydantic", specifier = ">=1.9.0,<3" }, + { name = "sniffio" }, + { name = "typing-extensions", specifier = ">=4.14,<5" }, +] +provides-extras = ["aiohttp"] + +[package.metadata.requires-dev] +dev = [ + { name = "dirty-equals", specifier = ">=0.6.0" }, + { name = "importlib-metadata", specifier = ">=6.7.0" }, + { name = "mypy", specifier = "==1.17" }, + { name = "pyright", specifier = "==1.1.399" }, + { name = "pytest" }, + { name = "pytest-asyncio" }, + { name = "pytest-xdist", specifier = ">=3.6.1" }, + { name = "respx" }, + { name = "rich", specifier = ">=13.7.1" }, + { name = "ruff" }, + { name = "time-machine" }, +] +pydantic-v1 = [{ name = "pydantic", specifier = ">=1.9.0,<2" }] +pydantic-v2 = [ + { name = "pydantic", marker = "python_full_version < '3.14'", specifier = "~=2.0" }, + { name = "pydantic", marker = "python_full_version >= '3.14'", specifier = "~=2.12" }, +] + +[[package]] +name = "packaging" +version = "25.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a1/d4/1fc4078c65507b51b96ca8f8c3ba19e6a61c8253c72794544580a7b6c24d/packaging-25.0.tar.gz", hash = "sha256:d443872c98d677bf60f6a1f2f8c1cb748e8fe762d2bf9d3148b5599295b0fc4f", size = 165727, upload-time = "2025-04-19T11:48:59.673Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/20/12/38679034af332785aac8774540895e234f4d07f7545804097de4b666afd8/packaging-25.0-py3-none-any.whl", hash = "sha256:29572ef2b1f17581046b3a2227d5c611fb25ec70ca1ba8554b24b0e69331a484", size = 66469, upload-time = "2025-04-19T11:48:57.875Z" }, +] + +[[package]] +name = "pathspec" +version = "1.0.3" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/4c/b2/bb8e495d5262bfec41ab5cb18f522f1012933347fb5d9e62452d446baca2/pathspec-1.0.3.tar.gz", hash = "sha256:bac5cf97ae2c2876e2d25ebb15078eb04d76e4b98921ee31c6f85ade8b59444d", size = 130841, upload-time = "2026-01-09T15:46:46.009Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/32/2b/121e912bd60eebd623f873fd090de0e84f322972ab25a7f9044c056804ed/pathspec-1.0.3-py3-none-any.whl", hash = "sha256:e80767021c1cc524aa3fb14bedda9c34406591343cc42797b386ce7b9354fb6c", size = 55021, upload-time = "2026-01-09T15:46:44.652Z" }, +] + +[[package]] +name = "pluggy" +version = "1.6.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412, upload-time = "2025-05-15T12:30:07.975Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538, upload-time = "2025-05-15T12:30:06.134Z" }, +] + +[[package]] +name = "propcache" +version = "0.4.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/9e/da/e9fc233cf63743258bff22b3dfa7ea5baef7b5bc324af47a0ad89b8ffc6f/propcache-0.4.1.tar.gz", hash = "sha256:f48107a8c637e80362555f37ecf49abe20370e557cc4ab374f04ec4423c97c3d", size = 46442, upload-time = "2025-10-08T19:49:02.291Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3c/0e/934b541323035566a9af292dba85a195f7b78179114f2c6ebb24551118a9/propcache-0.4.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7c2d1fa3201efaf55d730400d945b5b3ab6e672e100ba0f9a409d950ab25d7db", size = 79534, upload-time = "2025-10-08T19:46:02.083Z" }, + { url = "https://files.pythonhosted.org/packages/a1/6b/db0d03d96726d995dc7171286c6ba9d8d14251f37433890f88368951a44e/propcache-0.4.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:1eb2994229cc8ce7fe9b3db88f5465f5fd8651672840b2e426b88cdb1a30aac8", size = 45526, upload-time = "2025-10-08T19:46:03.884Z" }, + { url = "https://files.pythonhosted.org/packages/e4/c3/82728404aea669e1600f304f2609cde9e665c18df5a11cdd57ed73c1dceb/propcache-0.4.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:66c1f011f45a3b33d7bcb22daed4b29c0c9e2224758b6be00686731e1b46f925", size = 47263, upload-time = "2025-10-08T19:46:05.405Z" }, + { url = "https://files.pythonhosted.org/packages/df/1b/39313ddad2bf9187a1432654c38249bab4562ef535ef07f5eb6eb04d0b1b/propcache-0.4.1-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9a52009f2adffe195d0b605c25ec929d26b36ef986ba85244891dee3b294df21", size = 201012, upload-time = "2025-10-08T19:46:07.165Z" }, + { url = "https://files.pythonhosted.org/packages/5b/01/f1d0b57d136f294a142acf97f4ed58c8e5b974c21e543000968357115011/propcache-0.4.1-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5d4e2366a9c7b837555cf02fb9be2e3167d333aff716332ef1b7c3a142ec40c5", size = 209491, upload-time = "2025-10-08T19:46:08.909Z" }, + { url = "https://files.pythonhosted.org/packages/a1/c8/038d909c61c5bb039070b3fb02ad5cccdb1dde0d714792e251cdb17c9c05/propcache-0.4.1-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:9d2b6caef873b4f09e26ea7e33d65f42b944837563a47a94719cc3544319a0db", size = 215319, upload-time = "2025-10-08T19:46:10.7Z" }, + { url = "https://files.pythonhosted.org/packages/08/57/8c87e93142b2c1fa2408e45695205a7ba05fb5db458c0bf5c06ba0e09ea6/propcache-0.4.1-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2b16ec437a8c8a965ecf95739448dd938b5c7f56e67ea009f4300d8df05f32b7", size = 196856, upload-time = "2025-10-08T19:46:12.003Z" }, + { url = "https://files.pythonhosted.org/packages/42/df/5615fec76aa561987a534759b3686008a288e73107faa49a8ae5795a9f7a/propcache-0.4.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:296f4c8ed03ca7476813fe666c9ea97869a8d7aec972618671b33a38a5182ef4", size = 193241, upload-time = "2025-10-08T19:46:13.495Z" }, + { url = "https://files.pythonhosted.org/packages/d5/21/62949eb3a7a54afe8327011c90aca7e03547787a88fb8bd9726806482fea/propcache-0.4.1-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:1f0978529a418ebd1f49dad413a2b68af33f85d5c5ca5c6ca2a3bed375a7ac60", size = 190552, upload-time = "2025-10-08T19:46:14.938Z" }, + { url = "https://files.pythonhosted.org/packages/30/ee/ab4d727dd70806e5b4de96a798ae7ac6e4d42516f030ee60522474b6b332/propcache-0.4.1-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:fd138803047fb4c062b1c1dd95462f5209456bfab55c734458f15d11da288f8f", size = 200113, upload-time = "2025-10-08T19:46:16.695Z" }, + { url = "https://files.pythonhosted.org/packages/8a/0b/38b46208e6711b016aa8966a3ac793eee0d05c7159d8342aa27fc0bc365e/propcache-0.4.1-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:8c9b3cbe4584636d72ff556d9036e0c9317fa27b3ac1f0f558e7e84d1c9c5900", size = 200778, upload-time = "2025-10-08T19:46:18.023Z" }, + { url = "https://files.pythonhosted.org/packages/cf/81/5abec54355ed344476bee711e9f04815d4b00a311ab0535599204eecc257/propcache-0.4.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f93243fdc5657247533273ac4f86ae106cc6445a0efacb9a1bfe982fcfefd90c", size = 193047, upload-time = "2025-10-08T19:46:19.449Z" }, + { url = "https://files.pythonhosted.org/packages/ec/b6/1f237c04e32063cb034acd5f6ef34ef3a394f75502e72703545631ab1ef6/propcache-0.4.1-cp310-cp310-win32.whl", hash = "sha256:a0ee98db9c5f80785b266eb805016e36058ac72c51a064040f2bc43b61101cdb", size = 38093, upload-time = "2025-10-08T19:46:20.643Z" }, + { url = "https://files.pythonhosted.org/packages/a6/67/354aac4e0603a15f76439caf0427781bcd6797f370377f75a642133bc954/propcache-0.4.1-cp310-cp310-win_amd64.whl", hash = "sha256:1cdb7988c4e5ac7f6d175a28a9aa0c94cb6f2ebe52756a3c0cda98d2809a9e37", size = 41638, upload-time = "2025-10-08T19:46:21.935Z" }, + { url = "https://files.pythonhosted.org/packages/e0/e1/74e55b9fd1a4c209ff1a9a824bf6c8b3d1fc5a1ac3eabe23462637466785/propcache-0.4.1-cp310-cp310-win_arm64.whl", hash = "sha256:d82ad62b19645419fe79dd63b3f9253e15b30e955c0170e5cebc350c1844e581", size = 38229, upload-time = "2025-10-08T19:46:23.368Z" }, + { url = "https://files.pythonhosted.org/packages/8c/d4/4e2c9aaf7ac2242b9358f98dccd8f90f2605402f5afeff6c578682c2c491/propcache-0.4.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:60a8fda9644b7dfd5dece8c61d8a85e271cb958075bfc4e01083c148b61a7caf", size = 80208, upload-time = "2025-10-08T19:46:24.597Z" }, + { url = "https://files.pythonhosted.org/packages/c2/21/d7b68e911f9c8e18e4ae43bdbc1e1e9bbd971f8866eb81608947b6f585ff/propcache-0.4.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:c30b53e7e6bda1d547cabb47c825f3843a0a1a42b0496087bb58d8fedf9f41b5", size = 45777, upload-time = "2025-10-08T19:46:25.733Z" }, + { url = "https://files.pythonhosted.org/packages/d3/1d/11605e99ac8ea9435651ee71ab4cb4bf03f0949586246476a25aadfec54a/propcache-0.4.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:6918ecbd897443087a3b7cd978d56546a812517dcaaca51b49526720571fa93e", size = 47647, upload-time = "2025-10-08T19:46:27.304Z" }, + { url = "https://files.pythonhosted.org/packages/58/1a/3c62c127a8466c9c843bccb503d40a273e5cc69838805f322e2826509e0d/propcache-0.4.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3d902a36df4e5989763425a8ab9e98cd8ad5c52c823b34ee7ef307fd50582566", size = 214929, upload-time = "2025-10-08T19:46:28.62Z" }, + { url = "https://files.pythonhosted.org/packages/56/b9/8fa98f850960b367c4b8fe0592e7fc341daa7a9462e925228f10a60cf74f/propcache-0.4.1-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a9695397f85973bb40427dedddf70d8dc4a44b22f1650dd4af9eedf443d45165", size = 221778, upload-time = "2025-10-08T19:46:30.358Z" }, + { url = "https://files.pythonhosted.org/packages/46/a6/0ab4f660eb59649d14b3d3d65c439421cf2f87fe5dd68591cbe3c1e78a89/propcache-0.4.1-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2bb07ffd7eaad486576430c89f9b215f9e4be68c4866a96e97db9e97fead85dc", size = 228144, upload-time = "2025-10-08T19:46:32.607Z" }, + { url = "https://files.pythonhosted.org/packages/52/6a/57f43e054fb3d3a56ac9fc532bc684fc6169a26c75c353e65425b3e56eef/propcache-0.4.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fd6f30fdcf9ae2a70abd34da54f18da086160e4d7d9251f81f3da0ff84fc5a48", size = 210030, upload-time = "2025-10-08T19:46:33.969Z" }, + { url = "https://files.pythonhosted.org/packages/40/e2/27e6feebb5f6b8408fa29f5efbb765cd54c153ac77314d27e457a3e993b7/propcache-0.4.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:fc38cba02d1acba4e2869eef1a57a43dfbd3d49a59bf90dda7444ec2be6a5570", size = 208252, upload-time = "2025-10-08T19:46:35.309Z" }, + { url = "https://files.pythonhosted.org/packages/9e/f8/91c27b22ccda1dbc7967f921c42825564fa5336a01ecd72eb78a9f4f53c2/propcache-0.4.1-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:67fad6162281e80e882fb3ec355398cf72864a54069d060321f6cd0ade95fe85", size = 202064, upload-time = "2025-10-08T19:46:36.993Z" }, + { url = "https://files.pythonhosted.org/packages/f2/26/7f00bd6bd1adba5aafe5f4a66390f243acab58eab24ff1a08bebb2ef9d40/propcache-0.4.1-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:f10207adf04d08bec185bae14d9606a1444715bc99180f9331c9c02093e1959e", size = 212429, upload-time = "2025-10-08T19:46:38.398Z" }, + { url = "https://files.pythonhosted.org/packages/84/89/fd108ba7815c1117ddca79c228f3f8a15fc82a73bca8b142eb5de13b2785/propcache-0.4.1-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:e9b0d8d0845bbc4cfcdcbcdbf5086886bc8157aa963c31c777ceff7846c77757", size = 216727, upload-time = "2025-10-08T19:46:39.732Z" }, + { url = "https://files.pythonhosted.org/packages/79/37/3ec3f7e3173e73f1d600495d8b545b53802cbf35506e5732dd8578db3724/propcache-0.4.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:981333cb2f4c1896a12f4ab92a9cc8f09ea664e9b7dbdc4eff74627af3a11c0f", size = 205097, upload-time = "2025-10-08T19:46:41.025Z" }, + { url = "https://files.pythonhosted.org/packages/61/b0/b2631c19793f869d35f47d5a3a56fb19e9160d3c119f15ac7344fc3ccae7/propcache-0.4.1-cp311-cp311-win32.whl", hash = "sha256:f1d2f90aeec838a52f1c1a32fe9a619fefd5e411721a9117fbf82aea638fe8a1", size = 38084, upload-time = "2025-10-08T19:46:42.693Z" }, + { url = "https://files.pythonhosted.org/packages/f4/78/6cce448e2098e9f3bfc91bb877f06aa24b6ccace872e39c53b2f707c4648/propcache-0.4.1-cp311-cp311-win_amd64.whl", hash = "sha256:364426a62660f3f699949ac8c621aad6977be7126c5807ce48c0aeb8e7333ea6", size = 41637, upload-time = "2025-10-08T19:46:43.778Z" }, + { url = "https://files.pythonhosted.org/packages/9c/e9/754f180cccd7f51a39913782c74717c581b9cc8177ad0e949f4d51812383/propcache-0.4.1-cp311-cp311-win_arm64.whl", hash = "sha256:e53f3a38d3510c11953f3e6a33f205c6d1b001129f972805ca9b42fc308bc239", size = 38064, upload-time = "2025-10-08T19:46:44.872Z" }, + { url = "https://files.pythonhosted.org/packages/a2/0f/f17b1b2b221d5ca28b4b876e8bb046ac40466513960646bda8e1853cdfa2/propcache-0.4.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:e153e9cd40cc8945138822807139367f256f89c6810c2634a4f6902b52d3b4e2", size = 80061, upload-time = "2025-10-08T19:46:46.075Z" }, + { url = "https://files.pythonhosted.org/packages/76/47/8ccf75935f51448ba9a16a71b783eb7ef6b9ee60f5d14c7f8a8a79fbeed7/propcache-0.4.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:cd547953428f7abb73c5ad82cbb32109566204260d98e41e5dfdc682eb7f8403", size = 46037, upload-time = "2025-10-08T19:46:47.23Z" }, + { url = "https://files.pythonhosted.org/packages/0a/b6/5c9a0e42df4d00bfb4a3cbbe5cf9f54260300c88a0e9af1f47ca5ce17ac0/propcache-0.4.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:f048da1b4f243fc44f205dfd320933a951b8d89e0afd4c7cacc762a8b9165207", size = 47324, upload-time = "2025-10-08T19:46:48.384Z" }, + { url = "https://files.pythonhosted.org/packages/9e/d3/6c7ee328b39a81ee877c962469f1e795f9db87f925251efeb0545e0020d0/propcache-0.4.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ec17c65562a827bba85e3872ead335f95405ea1674860d96483a02f5c698fa72", size = 225505, upload-time = "2025-10-08T19:46:50.055Z" }, + { url = "https://files.pythonhosted.org/packages/01/5d/1c53f4563490b1d06a684742cc6076ef944bc6457df6051b7d1a877c057b/propcache-0.4.1-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:405aac25c6394ef275dee4c709be43745d36674b223ba4eb7144bf4d691b7367", size = 230242, upload-time = "2025-10-08T19:46:51.815Z" }, + { url = "https://files.pythonhosted.org/packages/20/e1/ce4620633b0e2422207c3cb774a0ee61cac13abc6217763a7b9e2e3f4a12/propcache-0.4.1-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:0013cb6f8dde4b2a2f66903b8ba740bdfe378c943c4377a200551ceb27f379e4", size = 238474, upload-time = "2025-10-08T19:46:53.208Z" }, + { url = "https://files.pythonhosted.org/packages/46/4b/3aae6835b8e5f44ea6a68348ad90f78134047b503765087be2f9912140ea/propcache-0.4.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:15932ab57837c3368b024473a525e25d316d8353016e7cc0e5ba9eb343fbb1cf", size = 221575, upload-time = "2025-10-08T19:46:54.511Z" }, + { url = "https://files.pythonhosted.org/packages/6e/a5/8a5e8678bcc9d3a1a15b9a29165640d64762d424a16af543f00629c87338/propcache-0.4.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:031dce78b9dc099f4c29785d9cf5577a3faf9ebf74ecbd3c856a7b92768c3df3", size = 216736, upload-time = "2025-10-08T19:46:56.212Z" }, + { url = "https://files.pythonhosted.org/packages/f1/63/b7b215eddeac83ca1c6b934f89d09a625aa9ee4ba158338854c87210cc36/propcache-0.4.1-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:ab08df6c9a035bee56e31af99be621526bd237bea9f32def431c656b29e41778", size = 213019, upload-time = "2025-10-08T19:46:57.595Z" }, + { url = "https://files.pythonhosted.org/packages/57/74/f580099a58c8af587cac7ba19ee7cb418506342fbbe2d4a4401661cca886/propcache-0.4.1-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:4d7af63f9f93fe593afbf104c21b3b15868efb2c21d07d8732c0c4287e66b6a6", size = 220376, upload-time = "2025-10-08T19:46:59.067Z" }, + { url = "https://files.pythonhosted.org/packages/c4/ee/542f1313aff7eaf19c2bb758c5d0560d2683dac001a1c96d0774af799843/propcache-0.4.1-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:cfc27c945f422e8b5071b6e93169679e4eb5bf73bbcbf1ba3ae3a83d2f78ebd9", size = 226988, upload-time = "2025-10-08T19:47:00.544Z" }, + { url = "https://files.pythonhosted.org/packages/8f/18/9c6b015dd9c6930f6ce2229e1f02fb35298b847f2087ea2b436a5bfa7287/propcache-0.4.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:35c3277624a080cc6ec6f847cbbbb5b49affa3598c4535a0a4682a697aaa5c75", size = 215615, upload-time = "2025-10-08T19:47:01.968Z" }, + { url = "https://files.pythonhosted.org/packages/80/9e/e7b85720b98c45a45e1fca6a177024934dc9bc5f4d5dd04207f216fc33ed/propcache-0.4.1-cp312-cp312-win32.whl", hash = "sha256:671538c2262dadb5ba6395e26c1731e1d52534bfe9ae56d0b5573ce539266aa8", size = 38066, upload-time = "2025-10-08T19:47:03.503Z" }, + { url = "https://files.pythonhosted.org/packages/54/09/d19cff2a5aaac632ec8fc03737b223597b1e347416934c1b3a7df079784c/propcache-0.4.1-cp312-cp312-win_amd64.whl", hash = "sha256:cb2d222e72399fcf5890d1d5cc1060857b9b236adff2792ff48ca2dfd46c81db", size = 41655, upload-time = "2025-10-08T19:47:04.973Z" }, + { url = "https://files.pythonhosted.org/packages/68/ab/6b5c191bb5de08036a8c697b265d4ca76148efb10fa162f14af14fb5f076/propcache-0.4.1-cp312-cp312-win_arm64.whl", hash = "sha256:204483131fb222bdaaeeea9f9e6c6ed0cac32731f75dfc1d4a567fc1926477c1", size = 37789, upload-time = "2025-10-08T19:47:06.077Z" }, + { url = "https://files.pythonhosted.org/packages/bf/df/6d9c1b6ac12b003837dde8a10231a7344512186e87b36e855bef32241942/propcache-0.4.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:43eedf29202c08550aac1d14e0ee619b0430aaef78f85864c1a892294fbc28cf", size = 77750, upload-time = "2025-10-08T19:47:07.648Z" }, + { url = "https://files.pythonhosted.org/packages/8b/e8/677a0025e8a2acf07d3418a2e7ba529c9c33caf09d3c1f25513023c1db56/propcache-0.4.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:d62cdfcfd89ccb8de04e0eda998535c406bf5e060ffd56be6c586cbcc05b3311", size = 44780, upload-time = "2025-10-08T19:47:08.851Z" }, + { url = "https://files.pythonhosted.org/packages/89/a4/92380f7ca60f99ebae761936bc48a72a639e8a47b29050615eef757cb2a7/propcache-0.4.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:cae65ad55793da34db5f54e4029b89d3b9b9490d8abe1b4c7ab5d4b8ec7ebf74", size = 46308, upload-time = "2025-10-08T19:47:09.982Z" }, + { url = "https://files.pythonhosted.org/packages/2d/48/c5ac64dee5262044348d1d78a5f85dd1a57464a60d30daee946699963eb3/propcache-0.4.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:333ddb9031d2704a301ee3e506dc46b1fe5f294ec198ed6435ad5b6a085facfe", size = 208182, upload-time = "2025-10-08T19:47:11.319Z" }, + { url = "https://files.pythonhosted.org/packages/c6/0c/cd762dd011a9287389a6a3eb43aa30207bde253610cca06824aeabfe9653/propcache-0.4.1-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:fd0858c20f078a32cf55f7e81473d96dcf3b93fd2ccdb3d40fdf54b8573df3af", size = 211215, upload-time = "2025-10-08T19:47:13.146Z" }, + { url = "https://files.pythonhosted.org/packages/30/3e/49861e90233ba36890ae0ca4c660e95df565b2cd15d4a68556ab5865974e/propcache-0.4.1-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:678ae89ebc632c5c204c794f8dab2837c5f159aeb59e6ed0539500400577298c", size = 218112, upload-time = "2025-10-08T19:47:14.913Z" }, + { url = "https://files.pythonhosted.org/packages/f1/8b/544bc867e24e1bd48f3118cecd3b05c694e160a168478fa28770f22fd094/propcache-0.4.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d472aeb4fbf9865e0c6d622d7f4d54a4e101a89715d8904282bb5f9a2f476c3f", size = 204442, upload-time = "2025-10-08T19:47:16.277Z" }, + { url = "https://files.pythonhosted.org/packages/50/a6/4282772fd016a76d3e5c0df58380a5ea64900afd836cec2c2f662d1b9bb3/propcache-0.4.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4d3df5fa7e36b3225954fba85589da77a0fe6a53e3976de39caf04a0db4c36f1", size = 199398, upload-time = "2025-10-08T19:47:17.962Z" }, + { url = "https://files.pythonhosted.org/packages/3e/ec/d8a7cd406ee1ddb705db2139f8a10a8a427100347bd698e7014351c7af09/propcache-0.4.1-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:ee17f18d2498f2673e432faaa71698032b0127ebf23ae5974eeaf806c279df24", size = 196920, upload-time = "2025-10-08T19:47:19.355Z" }, + { url = "https://files.pythonhosted.org/packages/f6/6c/f38ab64af3764f431e359f8baf9e0a21013e24329e8b85d2da32e8ed07ca/propcache-0.4.1-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:580e97762b950f993ae618e167e7be9256b8353c2dcd8b99ec100eb50f5286aa", size = 203748, upload-time = "2025-10-08T19:47:21.338Z" }, + { url = "https://files.pythonhosted.org/packages/d6/e3/fa846bd70f6534d647886621388f0a265254d30e3ce47e5c8e6e27dbf153/propcache-0.4.1-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:501d20b891688eb8e7aa903021f0b72d5a55db40ffaab27edefd1027caaafa61", size = 205877, upload-time = "2025-10-08T19:47:23.059Z" }, + { url = "https://files.pythonhosted.org/packages/e2/39/8163fc6f3133fea7b5f2827e8eba2029a0277ab2c5beee6c1db7b10fc23d/propcache-0.4.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9a0bd56e5b100aef69bd8562b74b46254e7c8812918d3baa700c8a8009b0af66", size = 199437, upload-time = "2025-10-08T19:47:24.445Z" }, + { url = "https://files.pythonhosted.org/packages/93/89/caa9089970ca49c7c01662bd0eeedfe85494e863e8043565aeb6472ce8fe/propcache-0.4.1-cp313-cp313-win32.whl", hash = "sha256:bcc9aaa5d80322bc2fb24bb7accb4a30f81e90ab8d6ba187aec0744bc302ad81", size = 37586, upload-time = "2025-10-08T19:47:25.736Z" }, + { url = "https://files.pythonhosted.org/packages/f5/ab/f76ec3c3627c883215b5c8080debb4394ef5a7a29be811f786415fc1e6fd/propcache-0.4.1-cp313-cp313-win_amd64.whl", hash = "sha256:381914df18634f5494334d201e98245c0596067504b9372d8cf93f4bb23e025e", size = 40790, upload-time = "2025-10-08T19:47:26.847Z" }, + { url = "https://files.pythonhosted.org/packages/59/1b/e71ae98235f8e2ba5004d8cb19765a74877abf189bc53fc0c80d799e56c3/propcache-0.4.1-cp313-cp313-win_arm64.whl", hash = "sha256:8873eb4460fd55333ea49b7d189749ecf6e55bf85080f11b1c4530ed3034cba1", size = 37158, upload-time = "2025-10-08T19:47:27.961Z" }, + { url = "https://files.pythonhosted.org/packages/83/ce/a31bbdfc24ee0dcbba458c8175ed26089cf109a55bbe7b7640ed2470cfe9/propcache-0.4.1-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:92d1935ee1f8d7442da9c0c4fa7ac20d07e94064184811b685f5c4fada64553b", size = 81451, upload-time = "2025-10-08T19:47:29.445Z" }, + { url = "https://files.pythonhosted.org/packages/25/9c/442a45a470a68456e710d96cacd3573ef26a1d0a60067e6a7d5e655621ed/propcache-0.4.1-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:473c61b39e1460d386479b9b2f337da492042447c9b685f28be4f74d3529e566", size = 46374, upload-time = "2025-10-08T19:47:30.579Z" }, + { url = "https://files.pythonhosted.org/packages/f4/bf/b1d5e21dbc3b2e889ea4327044fb16312a736d97640fb8b6aa3f9c7b3b65/propcache-0.4.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:c0ef0aaafc66fbd87842a3fe3902fd889825646bc21149eafe47be6072725835", size = 48396, upload-time = "2025-10-08T19:47:31.79Z" }, + { url = "https://files.pythonhosted.org/packages/f4/04/5b4c54a103d480e978d3c8a76073502b18db0c4bc17ab91b3cb5092ad949/propcache-0.4.1-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f95393b4d66bfae908c3ca8d169d5f79cd65636ae15b5e7a4f6e67af675adb0e", size = 275950, upload-time = "2025-10-08T19:47:33.481Z" }, + { url = "https://files.pythonhosted.org/packages/b4/c1/86f846827fb969c4b78b0af79bba1d1ea2156492e1b83dea8b8a6ae27395/propcache-0.4.1-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c07fda85708bc48578467e85099645167a955ba093be0a2dcba962195676e859", size = 273856, upload-time = "2025-10-08T19:47:34.906Z" }, + { url = "https://files.pythonhosted.org/packages/36/1d/fc272a63c8d3bbad6878c336c7a7dea15e8f2d23a544bda43205dfa83ada/propcache-0.4.1-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:af223b406d6d000830c6f65f1e6431783fc3f713ba3e6cc8c024d5ee96170a4b", size = 280420, upload-time = "2025-10-08T19:47:36.338Z" }, + { url = "https://files.pythonhosted.org/packages/07/0c/01f2219d39f7e53d52e5173bcb09c976609ba30209912a0680adfb8c593a/propcache-0.4.1-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a78372c932c90ee474559c5ddfffd718238e8673c340dc21fe45c5b8b54559a0", size = 263254, upload-time = "2025-10-08T19:47:37.692Z" }, + { url = "https://files.pythonhosted.org/packages/2d/18/cd28081658ce597898f0c4d174d4d0f3c5b6d4dc27ffafeef835c95eb359/propcache-0.4.1-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:564d9f0d4d9509e1a870c920a89b2fec951b44bf5ba7d537a9e7c1ccec2c18af", size = 261205, upload-time = "2025-10-08T19:47:39.659Z" }, + { url = "https://files.pythonhosted.org/packages/7a/71/1f9e22eb8b8316701c2a19fa1f388c8a3185082607da8e406a803c9b954e/propcache-0.4.1-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:17612831fda0138059cc5546f4d12a2aacfb9e47068c06af35c400ba58ba7393", size = 247873, upload-time = "2025-10-08T19:47:41.084Z" }, + { url = "https://files.pythonhosted.org/packages/4a/65/3d4b61f36af2b4eddba9def857959f1016a51066b4f1ce348e0cf7881f58/propcache-0.4.1-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:41a89040cb10bd345b3c1a873b2bf36413d48da1def52f268a055f7398514874", size = 262739, upload-time = "2025-10-08T19:47:42.51Z" }, + { url = "https://files.pythonhosted.org/packages/2a/42/26746ab087faa77c1c68079b228810436ccd9a5ce9ac85e2b7307195fd06/propcache-0.4.1-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:e35b88984e7fa64aacecea39236cee32dd9bd8c55f57ba8a75cf2399553f9bd7", size = 263514, upload-time = "2025-10-08T19:47:43.927Z" }, + { url = "https://files.pythonhosted.org/packages/94/13/630690fe201f5502d2403dd3cfd451ed8858fe3c738ee88d095ad2ff407b/propcache-0.4.1-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:6f8b465489f927b0df505cbe26ffbeed4d6d8a2bbc61ce90eb074ff129ef0ab1", size = 257781, upload-time = "2025-10-08T19:47:45.448Z" }, + { url = "https://files.pythonhosted.org/packages/92/f7/1d4ec5841505f423469efbfc381d64b7b467438cd5a4bbcbb063f3b73d27/propcache-0.4.1-cp313-cp313t-win32.whl", hash = "sha256:2ad890caa1d928c7c2965b48f3a3815c853180831d0e5503d35cf00c472f4717", size = 41396, upload-time = "2025-10-08T19:47:47.202Z" }, + { url = "https://files.pythonhosted.org/packages/48/f0/615c30622316496d2cbbc29f5985f7777d3ada70f23370608c1d3e081c1f/propcache-0.4.1-cp313-cp313t-win_amd64.whl", hash = "sha256:f7ee0e597f495cf415bcbd3da3caa3bd7e816b74d0d52b8145954c5e6fd3ff37", size = 44897, upload-time = "2025-10-08T19:47:48.336Z" }, + { url = "https://files.pythonhosted.org/packages/fd/ca/6002e46eccbe0e33dcd4069ef32f7f1c9e243736e07adca37ae8c4830ec3/propcache-0.4.1-cp313-cp313t-win_arm64.whl", hash = "sha256:929d7cbe1f01bb7baffb33dc14eb5691c95831450a26354cd210a8155170c93a", size = 39789, upload-time = "2025-10-08T19:47:49.876Z" }, + { url = "https://files.pythonhosted.org/packages/8e/5c/bca52d654a896f831b8256683457ceddd490ec18d9ec50e97dfd8fc726a8/propcache-0.4.1-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3f7124c9d820ba5548d431afb4632301acf965db49e666aa21c305cbe8c6de12", size = 78152, upload-time = "2025-10-08T19:47:51.051Z" }, + { url = "https://files.pythonhosted.org/packages/65/9b/03b04e7d82a5f54fb16113d839f5ea1ede58a61e90edf515f6577c66fa8f/propcache-0.4.1-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:c0d4b719b7da33599dfe3b22d3db1ef789210a0597bc650b7cee9c77c2be8c5c", size = 44869, upload-time = "2025-10-08T19:47:52.594Z" }, + { url = "https://files.pythonhosted.org/packages/b2/fa/89a8ef0468d5833a23fff277b143d0573897cf75bd56670a6d28126c7d68/propcache-0.4.1-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:9f302f4783709a78240ebc311b793f123328716a60911d667e0c036bc5dcbded", size = 46596, upload-time = "2025-10-08T19:47:54.073Z" }, + { url = "https://files.pythonhosted.org/packages/86/bd/47816020d337f4a746edc42fe8d53669965138f39ee117414c7d7a340cfe/propcache-0.4.1-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c80ee5802e3fb9ea37938e7eecc307fb984837091d5fd262bb37238b1ae97641", size = 206981, upload-time = "2025-10-08T19:47:55.715Z" }, + { url = "https://files.pythonhosted.org/packages/df/f6/c5fa1357cc9748510ee55f37173eb31bfde6d94e98ccd9e6f033f2fc06e1/propcache-0.4.1-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ed5a841e8bb29a55fb8159ed526b26adc5bdd7e8bd7bf793ce647cb08656cdf4", size = 211490, upload-time = "2025-10-08T19:47:57.499Z" }, + { url = "https://files.pythonhosted.org/packages/80/1e/e5889652a7c4a3846683401a48f0f2e5083ce0ec1a8a5221d8058fbd1adf/propcache-0.4.1-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:55c72fd6ea2da4c318e74ffdf93c4fe4e926051133657459131a95c846d16d44", size = 215371, upload-time = "2025-10-08T19:47:59.317Z" }, + { url = "https://files.pythonhosted.org/packages/b2/f2/889ad4b2408f72fe1a4f6a19491177b30ea7bf1a0fd5f17050ca08cfc882/propcache-0.4.1-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8326e144341460402713f91df60ade3c999d601e7eb5ff8f6f7862d54de0610d", size = 201424, upload-time = "2025-10-08T19:48:00.67Z" }, + { url = "https://files.pythonhosted.org/packages/27/73/033d63069b57b0812c8bd19f311faebeceb6ba31b8f32b73432d12a0b826/propcache-0.4.1-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:060b16ae65bc098da7f6d25bf359f1f31f688384858204fe5d652979e0015e5b", size = 197566, upload-time = "2025-10-08T19:48:02.604Z" }, + { url = "https://files.pythonhosted.org/packages/dc/89/ce24f3dc182630b4e07aa6d15f0ff4b14ed4b9955fae95a0b54c58d66c05/propcache-0.4.1-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:89eb3fa9524f7bec9de6e83cf3faed9d79bffa560672c118a96a171a6f55831e", size = 193130, upload-time = "2025-10-08T19:48:04.499Z" }, + { url = "https://files.pythonhosted.org/packages/a9/24/ef0d5fd1a811fb5c609278d0209c9f10c35f20581fcc16f818da959fc5b4/propcache-0.4.1-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:dee69d7015dc235f526fe80a9c90d65eb0039103fe565776250881731f06349f", size = 202625, upload-time = "2025-10-08T19:48:06.213Z" }, + { url = "https://files.pythonhosted.org/packages/f5/02/98ec20ff5546f68d673df2f7a69e8c0d076b5abd05ca882dc7ee3a83653d/propcache-0.4.1-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:5558992a00dfd54ccbc64a32726a3357ec93825a418a401f5cc67df0ac5d9e49", size = 204209, upload-time = "2025-10-08T19:48:08.432Z" }, + { url = "https://files.pythonhosted.org/packages/a0/87/492694f76759b15f0467a2a93ab68d32859672b646aa8a04ce4864e7932d/propcache-0.4.1-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:c9b822a577f560fbd9554812526831712c1436d2c046cedee4c3796d3543b144", size = 197797, upload-time = "2025-10-08T19:48:09.968Z" }, + { url = "https://files.pythonhosted.org/packages/ee/36/66367de3575db1d2d3f3d177432bd14ee577a39d3f5d1b3d5df8afe3b6e2/propcache-0.4.1-cp314-cp314-win32.whl", hash = "sha256:ab4c29b49d560fe48b696cdcb127dd36e0bc2472548f3bf56cc5cb3da2b2984f", size = 38140, upload-time = "2025-10-08T19:48:11.232Z" }, + { url = "https://files.pythonhosted.org/packages/0c/2a/a758b47de253636e1b8aef181c0b4f4f204bf0dd964914fb2af90a95b49b/propcache-0.4.1-cp314-cp314-win_amd64.whl", hash = "sha256:5a103c3eb905fcea0ab98be99c3a9a5ab2de60228aa5aceedc614c0281cf6153", size = 41257, upload-time = "2025-10-08T19:48:12.707Z" }, + { url = "https://files.pythonhosted.org/packages/34/5e/63bd5896c3fec12edcbd6f12508d4890d23c265df28c74b175e1ef9f4f3b/propcache-0.4.1-cp314-cp314-win_arm64.whl", hash = "sha256:74c1fb26515153e482e00177a1ad654721bf9207da8a494a0c05e797ad27b992", size = 38097, upload-time = "2025-10-08T19:48:13.923Z" }, + { url = "https://files.pythonhosted.org/packages/99/85/9ff785d787ccf9bbb3f3106f79884a130951436f58392000231b4c737c80/propcache-0.4.1-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:824e908bce90fb2743bd6b59db36eb4f45cd350a39637c9f73b1c1ea66f5b75f", size = 81455, upload-time = "2025-10-08T19:48:15.16Z" }, + { url = "https://files.pythonhosted.org/packages/90/85/2431c10c8e7ddb1445c1f7c4b54d886e8ad20e3c6307e7218f05922cad67/propcache-0.4.1-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:c2b5e7db5328427c57c8e8831abda175421b709672f6cfc3d630c3b7e2146393", size = 46372, upload-time = "2025-10-08T19:48:16.424Z" }, + { url = "https://files.pythonhosted.org/packages/01/20/b0972d902472da9bcb683fa595099911f4d2e86e5683bcc45de60dd05dc3/propcache-0.4.1-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:6f6ff873ed40292cd4969ef5310179afd5db59fdf055897e282485043fc80ad0", size = 48411, upload-time = "2025-10-08T19:48:17.577Z" }, + { url = "https://files.pythonhosted.org/packages/e2/e3/7dc89f4f21e8f99bad3d5ddb3a3389afcf9da4ac69e3deb2dcdc96e74169/propcache-0.4.1-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:49a2dc67c154db2c1463013594c458881a069fcf98940e61a0569016a583020a", size = 275712, upload-time = "2025-10-08T19:48:18.901Z" }, + { url = "https://files.pythonhosted.org/packages/20/67/89800c8352489b21a8047c773067644e3897f02ecbbd610f4d46b7f08612/propcache-0.4.1-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:005f08e6a0529984491e37d8dbc3dd86f84bd78a8ceb5fa9a021f4c48d4984be", size = 273557, upload-time = "2025-10-08T19:48:20.762Z" }, + { url = "https://files.pythonhosted.org/packages/e2/a1/b52b055c766a54ce6d9c16d9aca0cad8059acd9637cdf8aa0222f4a026ef/propcache-0.4.1-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5c3310452e0d31390da9035c348633b43d7e7feb2e37be252be6da45abd1abcc", size = 280015, upload-time = "2025-10-08T19:48:22.592Z" }, + { url = "https://files.pythonhosted.org/packages/48/c8/33cee30bd890672c63743049f3c9e4be087e6780906bfc3ec58528be59c1/propcache-0.4.1-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4c3c70630930447f9ef1caac7728c8ad1c56bc5015338b20fed0d08ea2480b3a", size = 262880, upload-time = "2025-10-08T19:48:23.947Z" }, + { url = "https://files.pythonhosted.org/packages/0c/b1/8f08a143b204b418285c88b83d00edbd61afbc2c6415ffafc8905da7038b/propcache-0.4.1-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:8e57061305815dfc910a3634dcf584f08168a8836e6999983569f51a8544cd89", size = 260938, upload-time = "2025-10-08T19:48:25.656Z" }, + { url = "https://files.pythonhosted.org/packages/cf/12/96e4664c82ca2f31e1c8dff86afb867348979eb78d3cb8546a680287a1e9/propcache-0.4.1-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:521a463429ef54143092c11a77e04056dd00636f72e8c45b70aaa3140d639726", size = 247641, upload-time = "2025-10-08T19:48:27.207Z" }, + { url = "https://files.pythonhosted.org/packages/18/ed/e7a9cfca28133386ba52278136d42209d3125db08d0a6395f0cba0c0285c/propcache-0.4.1-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:120c964da3fdc75e3731aa392527136d4ad35868cc556fd09bb6d09172d9a367", size = 262510, upload-time = "2025-10-08T19:48:28.65Z" }, + { url = "https://files.pythonhosted.org/packages/f5/76/16d8bf65e8845dd62b4e2b57444ab81f07f40caa5652b8969b87ddcf2ef6/propcache-0.4.1-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:d8f353eb14ee3441ee844ade4277d560cdd68288838673273b978e3d6d2c8f36", size = 263161, upload-time = "2025-10-08T19:48:30.133Z" }, + { url = "https://files.pythonhosted.org/packages/e7/70/c99e9edb5d91d5ad8a49fa3c1e8285ba64f1476782fed10ab251ff413ba1/propcache-0.4.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:ab2943be7c652f09638800905ee1bab2c544e537edb57d527997a24c13dc1455", size = 257393, upload-time = "2025-10-08T19:48:31.567Z" }, + { url = "https://files.pythonhosted.org/packages/08/02/87b25304249a35c0915d236575bc3574a323f60b47939a2262b77632a3ee/propcache-0.4.1-cp314-cp314t-win32.whl", hash = "sha256:05674a162469f31358c30bcaa8883cb7829fa3110bf9c0991fe27d7896c42d85", size = 42546, upload-time = "2025-10-08T19:48:32.872Z" }, + { url = "https://files.pythonhosted.org/packages/cb/ef/3c6ecf8b317aa982f309835e8f96987466123c6e596646d4e6a1dfcd080f/propcache-0.4.1-cp314-cp314t-win_amd64.whl", hash = "sha256:990f6b3e2a27d683cb7602ed6c86f15ee6b43b1194736f9baaeb93d0016633b1", size = 46259, upload-time = "2025-10-08T19:48:34.226Z" }, + { url = "https://files.pythonhosted.org/packages/c4/2d/346e946d4951f37eca1e4f55be0f0174c52cd70720f84029b02f296f4a38/propcache-0.4.1-cp314-cp314t-win_arm64.whl", hash = "sha256:ecef2343af4cc68e05131e45024ba34f6095821988a9d0a02aa7c73fcc448aa9", size = 40428, upload-time = "2025-10-08T19:48:35.441Z" }, + { url = "https://files.pythonhosted.org/packages/9b/01/0ebaec9003f5d619a7475165961f8e3083cf8644d704b60395df3601632d/propcache-0.4.1-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:3d233076ccf9e450c8b3bc6720af226b898ef5d051a2d145f7d765e6e9f9bcff", size = 80277, upload-time = "2025-10-08T19:48:36.647Z" }, + { url = "https://files.pythonhosted.org/packages/34/58/04af97ac586b4ef6b9026c3fd36ee7798b737a832f5d3440a4280dcebd3a/propcache-0.4.1-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:357f5bb5c377a82e105e44bd3d52ba22b616f7b9773714bff93573988ef0a5fb", size = 45865, upload-time = "2025-10-08T19:48:37.859Z" }, + { url = "https://files.pythonhosted.org/packages/7c/19/b65d98ae21384518b291d9939e24a8aeac4fdb5101b732576f8f7540e834/propcache-0.4.1-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:cbc3b6dfc728105b2a57c06791eb07a94229202ea75c59db644d7d496b698cac", size = 47636, upload-time = "2025-10-08T19:48:39.038Z" }, + { url = "https://files.pythonhosted.org/packages/b3/0f/317048c6d91c356c7154dca5af019e6effeb7ee15fa6a6db327cc19e12b4/propcache-0.4.1-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:182b51b421f0501952d938dc0b0eb45246a5b5153c50d42b495ad5fb7517c888", size = 201126, upload-time = "2025-10-08T19:48:40.774Z" }, + { url = "https://files.pythonhosted.org/packages/71/69/0b2a7a5a6ee83292b4b997dbd80549d8ce7d40b6397c1646c0d9495f5a85/propcache-0.4.1-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:4b536b39c5199b96fc6245eb5fb796c497381d3942f169e44e8e392b29c9ebcc", size = 209837, upload-time = "2025-10-08T19:48:42.167Z" }, + { url = "https://files.pythonhosted.org/packages/a5/92/c699ac495a6698df6e497fc2de27af4b6ace10d8e76528357ce153722e45/propcache-0.4.1-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:db65d2af507bbfbdcedb254a11149f894169d90488dd3e7190f7cdcb2d6cd57a", size = 215578, upload-time = "2025-10-08T19:48:43.56Z" }, + { url = "https://files.pythonhosted.org/packages/b3/ee/14de81c5eb02c0ee4f500b4e39c4e1bd0677c06e72379e6ab18923c773fc/propcache-0.4.1-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:fd2dbc472da1f772a4dae4fa24be938a6c544671a912e30529984dd80400cd88", size = 197187, upload-time = "2025-10-08T19:48:45.309Z" }, + { url = "https://files.pythonhosted.org/packages/1d/94/48dce9aaa6d8dd5a0859bad75158ec522546d4ac23f8e2f05fac469477dd/propcache-0.4.1-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:daede9cd44e0f8bdd9e6cc9a607fc81feb80fae7a5fc6cecaff0e0bb32e42d00", size = 193478, upload-time = "2025-10-08T19:48:47.743Z" }, + { url = "https://files.pythonhosted.org/packages/60/b5/0516b563e801e1ace212afde869a0596a0d7115eec0b12d296d75633fb29/propcache-0.4.1-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:71b749281b816793678ae7f3d0d84bd36e694953822eaad408d682efc5ca18e0", size = 190650, upload-time = "2025-10-08T19:48:49.373Z" }, + { url = "https://files.pythonhosted.org/packages/24/89/e0f7d4a5978cd56f8cd67735f74052f257dc471ec901694e430f0d1572fe/propcache-0.4.1-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:0002004213ee1f36cfb3f9a42b5066100c44276b9b72b4e1504cddd3d692e86e", size = 200251, upload-time = "2025-10-08T19:48:51.4Z" }, + { url = "https://files.pythonhosted.org/packages/06/7d/a1fac863d473876ed4406c914f2e14aa82d2f10dd207c9e16fc383cc5a24/propcache-0.4.1-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:fe49d0a85038f36ba9e3ffafa1103e61170b28e95b16622e11be0a0ea07c6781", size = 200919, upload-time = "2025-10-08T19:48:53.227Z" }, + { url = "https://files.pythonhosted.org/packages/c3/4e/f86a256ff24944cf5743e4e6c6994e3526f6acfcfb55e21694c2424f758c/propcache-0.4.1-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:99d43339c83aaf4d32bda60928231848eee470c6bda8d02599cc4cebe872d183", size = 193211, upload-time = "2025-10-08T19:48:55.027Z" }, + { url = "https://files.pythonhosted.org/packages/6e/3f/3fbad5f4356b068f1b047d300a6ff2c66614d7030f078cd50be3fec04228/propcache-0.4.1-cp39-cp39-win32.whl", hash = "sha256:a129e76735bc792794d5177069691c3217898b9f5cee2b2661471e52ffe13f19", size = 38314, upload-time = "2025-10-08T19:48:56.792Z" }, + { url = "https://files.pythonhosted.org/packages/a4/45/d78d136c3a3d215677abb886785aae744da2c3005bcb99e58640c56529b1/propcache-0.4.1-cp39-cp39-win_amd64.whl", hash = "sha256:948dab269721ae9a87fd16c514a0a2c2a1bdb23a9a61b969b0f9d9ee2968546f", size = 41912, upload-time = "2025-10-08T19:48:57.995Z" }, + { url = "https://files.pythonhosted.org/packages/fc/2a/b0632941f25139f4e58450b307242951f7c2717a5704977c6d5323a800af/propcache-0.4.1-cp39-cp39-win_arm64.whl", hash = "sha256:5fd37c406dd6dc85aa743e214cef35dc54bbdd1419baac4f6ae5e5b1a2976938", size = 38450, upload-time = "2025-10-08T19:48:59.349Z" }, + { url = "https://files.pythonhosted.org/packages/5b/5a/bc7b4a4ef808fa59a816c17b20c4bef6884daebbdf627ff2a161da67da19/propcache-0.4.1-py3-none-any.whl", hash = "sha256:af2a6052aeb6cf17d3e46ee169099044fd8224cbaf75c76a2ef596e8163e2237", size = 13305, upload-time = "2025-10-08T19:49:00.792Z" }, +] + +[[package]] +name = "pydantic" +version = "1.10.26" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.10'", + "python_full_version < '3.10'", +] +dependencies = [ + { name = "typing-extensions", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v1'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/7b/da/fd89f987a376c807cd81ea0eff4589aade783bbb702637b4734ef2c743a2/pydantic-1.10.26.tar.gz", hash = "sha256:8c6aa39b494c5af092e690127c283d84f363ac36017106a9e66cb33a22ac412e", size = 357906, upload-time = "2025-12-18T15:47:46.557Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/71/08/2587a6d4314e7539eec84acd062cb7b037638edb57a0335d20e4c5b8878c/pydantic-1.10.26-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:f7ae36fa0ecef8d39884120f212e16c06bb096a38f523421278e2f39c1784546", size = 2444588, upload-time = "2025-12-18T15:46:28.882Z" }, + { url = "https://files.pythonhosted.org/packages/47/e6/10df5f08c105bcbb4adbee7d1108ff4b347702b110fed058f6a03f1c6b73/pydantic-1.10.26-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:d95a76cf503f0f72ed7812a91de948440b2bf564269975738a4751e4fadeb572", size = 2255972, upload-time = "2025-12-18T15:46:31.72Z" }, + { url = "https://files.pythonhosted.org/packages/ba/7d/fdb961e7adc2c31f394feba6f560ef2c74c446f0285e2c2eb87d2b7206c7/pydantic-1.10.26-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a943ce8e00ad708ed06a1d9df5b4fd28f5635a003b82a4908ece6f24c0b18464", size = 2857175, upload-time = "2025-12-18T15:46:34Z" }, + { url = "https://files.pythonhosted.org/packages/8f/6c/f21e27dda475d4c562bd01b5874284dd3180f336c1e669413b743ca8b278/pydantic-1.10.26-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:465ad8edb29b15c10b779b16431fe8e77c380098badf6db367b7a1d3e572cf53", size = 2947001, upload-time = "2025-12-18T15:46:35.922Z" }, + { url = "https://files.pythonhosted.org/packages/6d/f6/27ea206232cbb6ec24dc4e4e8888a9a734f96a1eaf13504be4b30ef26aa7/pydantic-1.10.26-cp310-cp310-win_amd64.whl", hash = "sha256:80e6be6272839c8a7641d26ad569ab77772809dd78f91d0068dc0fc97f071945", size = 2066217, upload-time = "2025-12-18T15:46:37.614Z" }, + { url = "https://files.pythonhosted.org/packages/1d/c1/d521e64c8130e1ad9d22c270bed3fabcc0940c9539b076b639c88fd32a8d/pydantic-1.10.26-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:116233e53889bcc536f617e38c1b8337d7fa9c280f0fd7a4045947515a785637", size = 2428347, upload-time = "2025-12-18T15:46:39.41Z" }, + { url = "https://files.pythonhosted.org/packages/2c/08/f4b804a00c16e3ea994cb640a7c25c579b4f1fa674cde6a19fa0dfb0ae4f/pydantic-1.10.26-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:c3cfdd361addb6eb64ccd26ac356ad6514cee06a61ab26b27e16b5ed53108f77", size = 2212605, upload-time = "2025-12-18T15:46:41.006Z" }, + { url = "https://files.pythonhosted.org/packages/5d/78/0df4b9efef29bbc5e39f247fcba99060d15946b4463d82a5589cf7923d71/pydantic-1.10.26-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0e4451951a9a93bf9a90576f3e25240b47ee49ab5236adccb8eff6ac943adf0f", size = 2753560, upload-time = "2025-12-18T15:46:43.215Z" }, + { url = "https://files.pythonhosted.org/packages/68/66/6ab6c1d3a116d05d2508fce64f96e35242938fac07544d611e11d0d363a0/pydantic-1.10.26-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:9858ed44c6bea5f29ffe95308db9e62060791c877766c67dd5f55d072c8612b5", size = 2859235, upload-time = "2025-12-18T15:46:45.112Z" }, + { url = "https://files.pythonhosted.org/packages/61/4e/f1676bb0fcdf6ed2ce4670d7d1fc1d6c3a06d84497644acfbe02649503f1/pydantic-1.10.26-cp311-cp311-win_amd64.whl", hash = "sha256:ac1089f723e2106ebde434377d31239e00870a7563245072968e5af5cc4d33df", size = 2066646, upload-time = "2025-12-18T15:46:46.816Z" }, + { url = "https://files.pythonhosted.org/packages/02/6c/cd97a5a776c4515e6ee2ae81c2f2c5be51376dda6c31f965d7746ce0019f/pydantic-1.10.26-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:468d5b9cacfcaadc76ed0a4645354ab6f263ec01a63fb6d05630ea1df6ae453f", size = 2433795, upload-time = "2025-12-18T15:46:49.321Z" }, + { url = "https://files.pythonhosted.org/packages/47/12/de20affa30dcef728fcf9cc98e13ff4438c7a630de8d2f90eb38eba0891c/pydantic-1.10.26-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:2c1b0b914be31671000ca25cf7ea17fcaaa68cfeadf6924529c5c5aa24b7ab1f", size = 2227387, upload-time = "2025-12-18T15:46:50.877Z" }, + { url = "https://files.pythonhosted.org/packages/7b/1d/9d65dcc5b8c17ba590f1f9f486e9306346831902318b7ee93f63516f4003/pydantic-1.10.26-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:15b13b9f8ba8867095769e1156e0d7fbafa1f65b898dd40fd1c02e34430973cb", size = 2629594, upload-time = "2025-12-18T15:46:53.42Z" }, + { url = "https://files.pythonhosted.org/packages/3f/76/acb41409356789e23e1a7ef58f93821410c96409183ce314ddb58d97f23e/pydantic-1.10.26-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ad7025ca324ae263d4313998e25078dcaec5f9ed0392c06dedb57e053cc8086b", size = 2745305, upload-time = "2025-12-18T15:46:55.987Z" }, + { url = "https://files.pythonhosted.org/packages/22/72/a98c0c5e527a66057d969fedd61675223c7975ade61acebbca9f1abd6dc0/pydantic-1.10.26-cp312-cp312-win_amd64.whl", hash = "sha256:4482b299874dabb88a6c3759e3d85c6557c407c3b586891f7d808d8a38b66b9c", size = 1937647, upload-time = "2025-12-18T15:46:57.905Z" }, + { url = "https://files.pythonhosted.org/packages/28/b9/17a5a5a421c23ac27486b977724a42c9d5f8b7f0f4aab054251066223900/pydantic-1.10.26-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:1ae7913bb40a96c87e3d3f6fe4e918ef53bf181583de4e71824360a9b11aef1c", size = 2494599, upload-time = "2025-12-18T15:47:00.209Z" }, + { url = "https://files.pythonhosted.org/packages/e6/8e/6e3bd4241076cf227b443d7577245dd5d181ecf40b3182fcb908bc8c197d/pydantic-1.10.26-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:8154c13f58d4de5d3a856bb6c909c7370f41fb876a5952a503af6b975265f4ba", size = 2254391, upload-time = "2025-12-18T15:47:02.268Z" }, + { url = "https://files.pythonhosted.org/packages/a8/30/a1c4092eda2145ecbead6c92db489b223e101e1ba0da82576d0cf73dd422/pydantic-1.10.26-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f8af0507bf6118b054a9765fb2e402f18a8b70c964f420d95b525eb711122d62", size = 2609445, upload-time = "2025-12-18T15:47:04.909Z" }, + { url = "https://files.pythonhosted.org/packages/3a/2a/0491f1729ee4b7b6bc859ec22f69752f0c09bee1b66ac6f5f701136f34c3/pydantic-1.10.26-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:dcb5a7318fb43189fde6af6f21ac7149c4bcbcfffc54bc87b5becddc46084847", size = 2732124, upload-time = "2025-12-18T15:47:07.464Z" }, + { url = "https://files.pythonhosted.org/packages/2a/56/b59f3b2f84e1df2b04ae768a1bb04d9f0288ff71b67cdcbb07683757b2c0/pydantic-1.10.26-cp313-cp313-win_amd64.whl", hash = "sha256:71cde228bc0600cf8619f0ee62db050d1880dcc477eba0e90b23011b4ee0f314", size = 1939888, upload-time = "2025-12-18T15:47:09.618Z" }, + { url = "https://files.pythonhosted.org/packages/d2/8b/0c3dc02d4b97790b0f199bf933f677c14e7be4a8d21307c5f2daae06aa41/pydantic-1.10.26-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:6b40730cc81d53d515dc0b8bb5c9b43fadb9bed46de4a3c03bd95e8571616dba", size = 2502689, upload-time = "2025-12-18T15:47:12.308Z" }, + { url = "https://files.pythonhosted.org/packages/d4/9d/d31aeea45542b2ae4b09ecba92b88aaba696b801c31919811aa979a1242d/pydantic-1.10.26-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c3bbb9c0eecdf599e4db9b372fa9cc55be12e80a0d9c6d307950a39050cb0e37", size = 2269494, upload-time = "2025-12-18T15:47:14.53Z" }, + { url = "https://files.pythonhosted.org/packages/78/c1/3a4d069593283ca4dd0006039ba33644e21e432cddc09da706ac50441610/pydantic-1.10.26-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:cc2e3fe7bc4993626ef6b6fa855defafa1d6f8996aa1caef2deb83c5ac4d043a", size = 2620047, upload-time = "2025-12-18T15:47:17.089Z" }, + { url = "https://files.pythonhosted.org/packages/e0/0e/340c3d29197d99c15ab04093d43bb9c9d0fd17c2a34b80cb9d36ed732b09/pydantic-1.10.26-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:36d9e46b588aaeb1dcd2409fa4c467fe0b331f3cc9f227b03a7a00643704e962", size = 2747625, upload-time = "2025-12-18T15:47:19.21Z" }, + { url = "https://files.pythonhosted.org/packages/1e/58/f12ab3727339b172c830b32151919456b67787cdfe8808b2568b322fb15c/pydantic-1.10.26-cp314-cp314-win_amd64.whl", hash = "sha256:81ce3c8616d12a7be31b4aadfd3434f78f6b44b75adbfaec2fe1ad4f7f999b8c", size = 1976436, upload-time = "2025-12-18T15:47:21.384Z" }, + { url = "https://files.pythonhosted.org/packages/e1/8a/3a5a6267d5f03617b5c0f1985aa9fdfbafd33a50ef6dadd866a15ed4d123/pydantic-1.10.26-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:502b9d30d18a2dfaf81b7302f6ba0e5853474b1c96212449eb4db912cb604b7d", size = 2457039, upload-time = "2025-12-18T15:47:34.584Z" }, + { url = "https://files.pythonhosted.org/packages/f3/fa/343ac0db26918a033ac6256c036d72c3b6eb1196b7de622e2e8a94b19079/pydantic-1.10.26-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:0d8f6087bf697dec3bf7ffcd7fe8362674f16519f3151789f33cbe8f1d19fc15", size = 2266441, upload-time = "2025-12-18T15:47:36.807Z" }, + { url = "https://files.pythonhosted.org/packages/fc/36/1ab48136578608dba2f2a62e452f3db2083b474d4e49be5749c6ae0c123c/pydantic-1.10.26-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:dd40a99c358419910c85e6f5d22f9c56684c25b5e7abc40879b3b4a52f34ae90", size = 2869383, upload-time = "2025-12-18T15:47:38.883Z" }, + { url = "https://files.pythonhosted.org/packages/a2/25/41dbf1bffc31eb242cece8080561a4133eaeb513372dec36a84477a3fb71/pydantic-1.10.26-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:ce3293b86ca9f4125df02ff0a70be91bc7946522467cbd98e7f1493f340616ba", size = 2963582, upload-time = "2025-12-18T15:47:40.854Z" }, + { url = "https://files.pythonhosted.org/packages/61/2f/f072ae160a300c85eb9f059915101fd33dacf12d8df08c2b804acb3b95d1/pydantic-1.10.26-cp39-cp39-win_amd64.whl", hash = "sha256:1a4e3062b71ab1d5df339ba12c48f9ed5817c5de6cb92a961dd5c64bb32e7b96", size = 2075530, upload-time = "2025-12-18T15:47:43.181Z" }, + { url = "https://files.pythonhosted.org/packages/1f/98/556e82f00b98486def0b8af85da95e69d2be7e367cf2431408e108bc3095/pydantic-1.10.26-py3-none-any.whl", hash = "sha256:c43ad70dc3ce7787543d563792426a16fd7895e14be4b194b5665e36459dd917", size = 166975, upload-time = "2025-12-18T15:47:44.927Z" }, +] + +[[package]] +name = "pydantic" +version = "2.12.5" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version < '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version < '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +dependencies = [ + { name = "annotated-types", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, + { name = "pydantic-core", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, + { name = "typing-extensions", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, + { name = "typing-inspection", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/69/44/36f1a6e523abc58ae5f928898e4aca2e0ea509b5aa6f6f392a5d882be928/pydantic-2.12.5.tar.gz", hash = "sha256:4d351024c75c0f085a9febbb665ce8c0c6ec5d30e903bdb6394b7ede26aebb49", size = 821591, upload-time = "2025-11-26T15:11:46.471Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5a/87/b70ad306ebb6f9b585f114d0ac2137d792b48be34d732d60e597c2f8465a/pydantic-2.12.5-py3-none-any.whl", hash = "sha256:e561593fccf61e8a20fc46dfc2dfe075b8be7d0188df33f221ad1f0139180f9d", size = 463580, upload-time = "2025-11-26T15:11:44.605Z" }, +] + +[[package]] +name = "pydantic-core" +version = "2.41.5" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "typing-extensions", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/71/70/23b021c950c2addd24ec408e9ab05d59b035b39d97cdc1130e1bce647bb6/pydantic_core-2.41.5.tar.gz", hash = "sha256:08daa51ea16ad373ffd5e7606252cc32f07bc72b28284b6bc9c6df804816476e", size = 460952, upload-time = "2025-11-04T13:43:49.098Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c6/90/32c9941e728d564b411d574d8ee0cf09b12ec978cb22b294995bae5549a5/pydantic_core-2.41.5-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:77b63866ca88d804225eaa4af3e664c5faf3568cea95360d21f4725ab6e07146", size = 2107298, upload-time = "2025-11-04T13:39:04.116Z" }, + { url = "https://files.pythonhosted.org/packages/fb/a8/61c96a77fe28993d9a6fb0f4127e05430a267b235a124545d79fea46dd65/pydantic_core-2.41.5-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:dfa8a0c812ac681395907e71e1274819dec685fec28273a28905df579ef137e2", size = 1901475, upload-time = "2025-11-04T13:39:06.055Z" }, + { url = "https://files.pythonhosted.org/packages/5d/b6/338abf60225acc18cdc08b4faef592d0310923d19a87fba1faf05af5346e/pydantic_core-2.41.5-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5921a4d3ca3aee735d9fd163808f5e8dd6c6972101e4adbda9a4667908849b97", size = 1918815, upload-time = "2025-11-04T13:39:10.41Z" }, + { url = "https://files.pythonhosted.org/packages/d1/1c/2ed0433e682983d8e8cba9c8d8ef274d4791ec6a6f24c58935b90e780e0a/pydantic_core-2.41.5-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e25c479382d26a2a41b7ebea1043564a937db462816ea07afa8a44c0866d52f9", size = 2065567, upload-time = "2025-11-04T13:39:12.244Z" }, + { url = "https://files.pythonhosted.org/packages/b3/24/cf84974ee7d6eae06b9e63289b7b8f6549d416b5c199ca2d7ce13bbcf619/pydantic_core-2.41.5-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:f547144f2966e1e16ae626d8ce72b4cfa0caedc7fa28052001c94fb2fcaa1c52", size = 2230442, upload-time = "2025-11-04T13:39:13.962Z" }, + { url = "https://files.pythonhosted.org/packages/fd/21/4e287865504b3edc0136c89c9c09431be326168b1eb7841911cbc877a995/pydantic_core-2.41.5-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:6f52298fbd394f9ed112d56f3d11aabd0d5bd27beb3084cc3d8ad069483b8941", size = 2350956, upload-time = "2025-11-04T13:39:15.889Z" }, + { url = "https://files.pythonhosted.org/packages/a8/76/7727ef2ffa4b62fcab916686a68a0426b9b790139720e1934e8ba797e238/pydantic_core-2.41.5-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:100baa204bb412b74fe285fb0f3a385256dad1d1879f0a5cb1499ed2e83d132a", size = 2068253, upload-time = "2025-11-04T13:39:17.403Z" }, + { url = "https://files.pythonhosted.org/packages/d5/8c/a4abfc79604bcb4c748e18975c44f94f756f08fb04218d5cb87eb0d3a63e/pydantic_core-2.41.5-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:05a2c8852530ad2812cb7914dc61a1125dc4e06252ee98e5638a12da6cc6fb6c", size = 2177050, upload-time = "2025-11-04T13:39:19.351Z" }, + { url = "https://files.pythonhosted.org/packages/67/b1/de2e9a9a79b480f9cb0b6e8b6ba4c50b18d4e89852426364c66aa82bb7b3/pydantic_core-2.41.5-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:29452c56df2ed968d18d7e21f4ab0ac55e71dc59524872f6fc57dcf4a3249ed2", size = 2147178, upload-time = "2025-11-04T13:39:21Z" }, + { url = "https://files.pythonhosted.org/packages/16/c1/dfb33f837a47b20417500efaa0378adc6635b3c79e8369ff7a03c494b4ac/pydantic_core-2.41.5-cp310-cp310-musllinux_1_1_armv7l.whl", hash = "sha256:d5160812ea7a8a2ffbe233d8da666880cad0cbaf5d4de74ae15c313213d62556", size = 2341833, upload-time = "2025-11-04T13:39:22.606Z" }, + { url = "https://files.pythonhosted.org/packages/47/36/00f398642a0f4b815a9a558c4f1dca1b4020a7d49562807d7bc9ff279a6c/pydantic_core-2.41.5-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:df3959765b553b9440adfd3c795617c352154e497a4eaf3752555cfb5da8fc49", size = 2321156, upload-time = "2025-11-04T13:39:25.843Z" }, + { url = "https://files.pythonhosted.org/packages/7e/70/cad3acd89fde2010807354d978725ae111ddf6d0ea46d1ea1775b5c1bd0c/pydantic_core-2.41.5-cp310-cp310-win32.whl", hash = "sha256:1f8d33a7f4d5a7889e60dc39856d76d09333d8a6ed0f5f1190635cbec70ec4ba", size = 1989378, upload-time = "2025-11-04T13:39:27.92Z" }, + { url = "https://files.pythonhosted.org/packages/76/92/d338652464c6c367e5608e4488201702cd1cbb0f33f7b6a85a60fe5f3720/pydantic_core-2.41.5-cp310-cp310-win_amd64.whl", hash = "sha256:62de39db01b8d593e45871af2af9e497295db8d73b085f6bfd0b18c83c70a8f9", size = 2013622, upload-time = "2025-11-04T13:39:29.848Z" }, + { url = "https://files.pythonhosted.org/packages/e8/72/74a989dd9f2084b3d9530b0915fdda64ac48831c30dbf7c72a41a5232db8/pydantic_core-2.41.5-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:a3a52f6156e73e7ccb0f8cced536adccb7042be67cb45f9562e12b319c119da6", size = 2105873, upload-time = "2025-11-04T13:39:31.373Z" }, + { url = "https://files.pythonhosted.org/packages/12/44/37e403fd9455708b3b942949e1d7febc02167662bf1a7da5b78ee1ea2842/pydantic_core-2.41.5-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:7f3bf998340c6d4b0c9a2f02d6a400e51f123b59565d74dc60d252ce888c260b", size = 1899826, upload-time = "2025-11-04T13:39:32.897Z" }, + { url = "https://files.pythonhosted.org/packages/33/7f/1d5cab3ccf44c1935a359d51a8a2a9e1a654b744b5e7f80d41b88d501eec/pydantic_core-2.41.5-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:378bec5c66998815d224c9ca994f1e14c0c21cb95d2f52b6021cc0b2a58f2a5a", size = 1917869, upload-time = "2025-11-04T13:39:34.469Z" }, + { url = "https://files.pythonhosted.org/packages/6e/6a/30d94a9674a7fe4f4744052ed6c5e083424510be1e93da5bc47569d11810/pydantic_core-2.41.5-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e7b576130c69225432866fe2f4a469a85a54ade141d96fd396dffcf607b558f8", size = 2063890, upload-time = "2025-11-04T13:39:36.053Z" }, + { url = "https://files.pythonhosted.org/packages/50/be/76e5d46203fcb2750e542f32e6c371ffa9b8ad17364cf94bb0818dbfb50c/pydantic_core-2.41.5-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:6cb58b9c66f7e4179a2d5e0f849c48eff5c1fca560994d6eb6543abf955a149e", size = 2229740, upload-time = "2025-11-04T13:39:37.753Z" }, + { url = "https://files.pythonhosted.org/packages/d3/ee/fed784df0144793489f87db310a6bbf8118d7b630ed07aa180d6067e653a/pydantic_core-2.41.5-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:88942d3a3dff3afc8288c21e565e476fc278902ae4d6d134f1eeda118cc830b1", size = 2350021, upload-time = "2025-11-04T13:39:40.94Z" }, + { url = "https://files.pythonhosted.org/packages/c8/be/8fed28dd0a180dca19e72c233cbf58efa36df055e5b9d90d64fd1740b828/pydantic_core-2.41.5-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f31d95a179f8d64d90f6831d71fa93290893a33148d890ba15de25642c5d075b", size = 2066378, upload-time = "2025-11-04T13:39:42.523Z" }, + { url = "https://files.pythonhosted.org/packages/b0/3b/698cf8ae1d536a010e05121b4958b1257f0b5522085e335360e53a6b1c8b/pydantic_core-2.41.5-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:c1df3d34aced70add6f867a8cf413e299177e0c22660cc767218373d0779487b", size = 2175761, upload-time = "2025-11-04T13:39:44.553Z" }, + { url = "https://files.pythonhosted.org/packages/b8/ba/15d537423939553116dea94ce02f9c31be0fa9d0b806d427e0308ec17145/pydantic_core-2.41.5-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:4009935984bd36bd2c774e13f9a09563ce8de4abaa7226f5108262fa3e637284", size = 2146303, upload-time = "2025-11-04T13:39:46.238Z" }, + { url = "https://files.pythonhosted.org/packages/58/7f/0de669bf37d206723795f9c90c82966726a2ab06c336deba4735b55af431/pydantic_core-2.41.5-cp311-cp311-musllinux_1_1_armv7l.whl", hash = "sha256:34a64bc3441dc1213096a20fe27e8e128bd3ff89921706e83c0b1ac971276594", size = 2340355, upload-time = "2025-11-04T13:39:48.002Z" }, + { url = "https://files.pythonhosted.org/packages/e5/de/e7482c435b83d7e3c3ee5ee4451f6e8973cff0eb6007d2872ce6383f6398/pydantic_core-2.41.5-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:c9e19dd6e28fdcaa5a1de679aec4141f691023916427ef9bae8584f9c2fb3b0e", size = 2319875, upload-time = "2025-11-04T13:39:49.705Z" }, + { url = "https://files.pythonhosted.org/packages/fe/e6/8c9e81bb6dd7560e33b9053351c29f30c8194b72f2d6932888581f503482/pydantic_core-2.41.5-cp311-cp311-win32.whl", hash = "sha256:2c010c6ded393148374c0f6f0bf89d206bf3217f201faa0635dcd56bd1520f6b", size = 1987549, upload-time = "2025-11-04T13:39:51.842Z" }, + { url = "https://files.pythonhosted.org/packages/11/66/f14d1d978ea94d1bc21fc98fcf570f9542fe55bfcc40269d4e1a21c19bf7/pydantic_core-2.41.5-cp311-cp311-win_amd64.whl", hash = "sha256:76ee27c6e9c7f16f47db7a94157112a2f3a00e958bc626e2f4ee8bec5c328fbe", size = 2011305, upload-time = "2025-11-04T13:39:53.485Z" }, + { url = "https://files.pythonhosted.org/packages/56/d8/0e271434e8efd03186c5386671328154ee349ff0354d83c74f5caaf096ed/pydantic_core-2.41.5-cp311-cp311-win_arm64.whl", hash = "sha256:4bc36bbc0b7584de96561184ad7f012478987882ebf9f9c389b23f432ea3d90f", size = 1972902, upload-time = "2025-11-04T13:39:56.488Z" }, + { url = "https://files.pythonhosted.org/packages/5f/5d/5f6c63eebb5afee93bcaae4ce9a898f3373ca23df3ccaef086d0233a35a7/pydantic_core-2.41.5-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:f41a7489d32336dbf2199c8c0a215390a751c5b014c2c1c5366e817202e9cdf7", size = 2110990, upload-time = "2025-11-04T13:39:58.079Z" }, + { url = "https://files.pythonhosted.org/packages/aa/32/9c2e8ccb57c01111e0fd091f236c7b371c1bccea0fa85247ac55b1e2b6b6/pydantic_core-2.41.5-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:070259a8818988b9a84a449a2a7337c7f430a22acc0859c6b110aa7212a6d9c0", size = 1896003, upload-time = "2025-11-04T13:39:59.956Z" }, + { url = "https://files.pythonhosted.org/packages/68/b8/a01b53cb0e59139fbc9e4fda3e9724ede8de279097179be4ff31f1abb65a/pydantic_core-2.41.5-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e96cea19e34778f8d59fe40775a7a574d95816eb150850a85a7a4c8f4b94ac69", size = 1919200, upload-time = "2025-11-04T13:40:02.241Z" }, + { url = "https://files.pythonhosted.org/packages/38/de/8c36b5198a29bdaade07b5985e80a233a5ac27137846f3bc2d3b40a47360/pydantic_core-2.41.5-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:ed2e99c456e3fadd05c991f8f437ef902e00eedf34320ba2b0842bd1c3ca3a75", size = 2052578, upload-time = "2025-11-04T13:40:04.401Z" }, + { url = "https://files.pythonhosted.org/packages/00/b5/0e8e4b5b081eac6cb3dbb7e60a65907549a1ce035a724368c330112adfdd/pydantic_core-2.41.5-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:65840751b72fbfd82c3c640cff9284545342a4f1eb1586ad0636955b261b0b05", size = 2208504, upload-time = "2025-11-04T13:40:06.072Z" }, + { url = "https://files.pythonhosted.org/packages/77/56/87a61aad59c7c5b9dc8caad5a41a5545cba3810c3e828708b3d7404f6cef/pydantic_core-2.41.5-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:e536c98a7626a98feb2d3eaf75944ef6f3dbee447e1f841eae16f2f0a72d8ddc", size = 2335816, upload-time = "2025-11-04T13:40:07.835Z" }, + { url = "https://files.pythonhosted.org/packages/0d/76/941cc9f73529988688a665a5c0ecff1112b3d95ab48f81db5f7606f522d3/pydantic_core-2.41.5-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:eceb81a8d74f9267ef4081e246ffd6d129da5d87e37a77c9bde550cb04870c1c", size = 2075366, upload-time = "2025-11-04T13:40:09.804Z" }, + { url = "https://files.pythonhosted.org/packages/d3/43/ebef01f69baa07a482844faaa0a591bad1ef129253ffd0cdaa9d8a7f72d3/pydantic_core-2.41.5-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:d38548150c39b74aeeb0ce8ee1d8e82696f4a4e16ddc6de7b1d8823f7de4b9b5", size = 2171698, upload-time = "2025-11-04T13:40:12.004Z" }, + { url = "https://files.pythonhosted.org/packages/b1/87/41f3202e4193e3bacfc2c065fab7706ebe81af46a83d3e27605029c1f5a6/pydantic_core-2.41.5-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:c23e27686783f60290e36827f9c626e63154b82b116d7fe9adba1fda36da706c", size = 2132603, upload-time = "2025-11-04T13:40:13.868Z" }, + { url = "https://files.pythonhosted.org/packages/49/7d/4c00df99cb12070b6bccdef4a195255e6020a550d572768d92cc54dba91a/pydantic_core-2.41.5-cp312-cp312-musllinux_1_1_armv7l.whl", hash = "sha256:482c982f814460eabe1d3bb0adfdc583387bd4691ef00b90575ca0d2b6fe2294", size = 2329591, upload-time = "2025-11-04T13:40:15.672Z" }, + { url = "https://files.pythonhosted.org/packages/cc/6a/ebf4b1d65d458f3cda6a7335d141305dfa19bdc61140a884d165a8a1bbc7/pydantic_core-2.41.5-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:bfea2a5f0b4d8d43adf9d7b8bf019fb46fdd10a2e5cde477fbcb9d1fa08c68e1", size = 2319068, upload-time = "2025-11-04T13:40:17.532Z" }, + { url = "https://files.pythonhosted.org/packages/49/3b/774f2b5cd4192d5ab75870ce4381fd89cf218af999515baf07e7206753f0/pydantic_core-2.41.5-cp312-cp312-win32.whl", hash = "sha256:b74557b16e390ec12dca509bce9264c3bbd128f8a2c376eaa68003d7f327276d", size = 1985908, upload-time = "2025-11-04T13:40:19.309Z" }, + { url = "https://files.pythonhosted.org/packages/86/45/00173a033c801cacf67c190fef088789394feaf88a98a7035b0e40d53dc9/pydantic_core-2.41.5-cp312-cp312-win_amd64.whl", hash = "sha256:1962293292865bca8e54702b08a4f26da73adc83dd1fcf26fbc875b35d81c815", size = 2020145, upload-time = "2025-11-04T13:40:21.548Z" }, + { url = "https://files.pythonhosted.org/packages/f9/22/91fbc821fa6d261b376a3f73809f907cec5ca6025642c463d3488aad22fb/pydantic_core-2.41.5-cp312-cp312-win_arm64.whl", hash = "sha256:1746d4a3d9a794cacae06a5eaaccb4b8643a131d45fbc9af23e353dc0a5ba5c3", size = 1976179, upload-time = "2025-11-04T13:40:23.393Z" }, + { url = "https://files.pythonhosted.org/packages/87/06/8806241ff1f70d9939f9af039c6c35f2360cf16e93c2ca76f184e76b1564/pydantic_core-2.41.5-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:941103c9be18ac8daf7b7adca8228f8ed6bb7a1849020f643b3a14d15b1924d9", size = 2120403, upload-time = "2025-11-04T13:40:25.248Z" }, + { url = "https://files.pythonhosted.org/packages/94/02/abfa0e0bda67faa65fef1c84971c7e45928e108fe24333c81f3bfe35d5f5/pydantic_core-2.41.5-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:112e305c3314f40c93998e567879e887a3160bb8689ef3d2c04b6cc62c33ac34", size = 1896206, upload-time = "2025-11-04T13:40:27.099Z" }, + { url = "https://files.pythonhosted.org/packages/15/df/a4c740c0943e93e6500f9eb23f4ca7ec9bf71b19e608ae5b579678c8d02f/pydantic_core-2.41.5-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0cbaad15cb0c90aa221d43c00e77bb33c93e8d36e0bf74760cd00e732d10a6a0", size = 1919307, upload-time = "2025-11-04T13:40:29.806Z" }, + { url = "https://files.pythonhosted.org/packages/9a/e3/6324802931ae1d123528988e0e86587c2072ac2e5394b4bc2bc34b61ff6e/pydantic_core-2.41.5-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:03ca43e12fab6023fc79d28ca6b39b05f794ad08ec2feccc59a339b02f2b3d33", size = 2063258, upload-time = "2025-11-04T13:40:33.544Z" }, + { url = "https://files.pythonhosted.org/packages/c9/d4/2230d7151d4957dd79c3044ea26346c148c98fbf0ee6ebd41056f2d62ab5/pydantic_core-2.41.5-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:dc799088c08fa04e43144b164feb0c13f9a0bc40503f8df3e9fde58a3c0c101e", size = 2214917, upload-time = "2025-11-04T13:40:35.479Z" }, + { url = "https://files.pythonhosted.org/packages/e6/9f/eaac5df17a3672fef0081b6c1bb0b82b33ee89aa5cec0d7b05f52fd4a1fa/pydantic_core-2.41.5-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:97aeba56665b4c3235a0e52b2c2f5ae9cd071b8a8310ad27bddb3f7fb30e9aa2", size = 2332186, upload-time = "2025-11-04T13:40:37.436Z" }, + { url = "https://files.pythonhosted.org/packages/cf/4e/35a80cae583a37cf15604b44240e45c05e04e86f9cfd766623149297e971/pydantic_core-2.41.5-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:406bf18d345822d6c21366031003612b9c77b3e29ffdb0f612367352aab7d586", size = 2073164, upload-time = "2025-11-04T13:40:40.289Z" }, + { url = "https://files.pythonhosted.org/packages/bf/e3/f6e262673c6140dd3305d144d032f7bd5f7497d3871c1428521f19f9efa2/pydantic_core-2.41.5-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:b93590ae81f7010dbe380cdeab6f515902ebcbefe0b9327cc4804d74e93ae69d", size = 2179146, upload-time = "2025-11-04T13:40:42.809Z" }, + { url = "https://files.pythonhosted.org/packages/75/c7/20bd7fc05f0c6ea2056a4565c6f36f8968c0924f19b7d97bbfea55780e73/pydantic_core-2.41.5-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:01a3d0ab748ee531f4ea6c3e48ad9dac84ddba4b0d82291f87248f2f9de8d740", size = 2137788, upload-time = "2025-11-04T13:40:44.752Z" }, + { url = "https://files.pythonhosted.org/packages/3a/8d/34318ef985c45196e004bc46c6eab2eda437e744c124ef0dbe1ff2c9d06b/pydantic_core-2.41.5-cp313-cp313-musllinux_1_1_armv7l.whl", hash = "sha256:6561e94ba9dacc9c61bce40e2d6bdc3bfaa0259d3ff36ace3b1e6901936d2e3e", size = 2340133, upload-time = "2025-11-04T13:40:46.66Z" }, + { url = "https://files.pythonhosted.org/packages/9c/59/013626bf8c78a5a5d9350d12e7697d3d4de951a75565496abd40ccd46bee/pydantic_core-2.41.5-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:915c3d10f81bec3a74fbd4faebe8391013ba61e5a1a8d48c4455b923bdda7858", size = 2324852, upload-time = "2025-11-04T13:40:48.575Z" }, + { url = "https://files.pythonhosted.org/packages/1a/d9/c248c103856f807ef70c18a4f986693a46a8ffe1602e5d361485da502d20/pydantic_core-2.41.5-cp313-cp313-win32.whl", hash = "sha256:650ae77860b45cfa6e2cdafc42618ceafab3a2d9a3811fcfbd3bbf8ac3c40d36", size = 1994679, upload-time = "2025-11-04T13:40:50.619Z" }, + { url = "https://files.pythonhosted.org/packages/9e/8b/341991b158ddab181cff136acd2552c9f35bd30380422a639c0671e99a91/pydantic_core-2.41.5-cp313-cp313-win_amd64.whl", hash = "sha256:79ec52ec461e99e13791ec6508c722742ad745571f234ea6255bed38c6480f11", size = 2019766, upload-time = "2025-11-04T13:40:52.631Z" }, + { url = "https://files.pythonhosted.org/packages/73/7d/f2f9db34af103bea3e09735bb40b021788a5e834c81eedb541991badf8f5/pydantic_core-2.41.5-cp313-cp313-win_arm64.whl", hash = "sha256:3f84d5c1b4ab906093bdc1ff10484838aca54ef08de4afa9de0f5f14d69639cd", size = 1981005, upload-time = "2025-11-04T13:40:54.734Z" }, + { url = "https://files.pythonhosted.org/packages/ea/28/46b7c5c9635ae96ea0fbb779e271a38129df2550f763937659ee6c5dbc65/pydantic_core-2.41.5-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:3f37a19d7ebcdd20b96485056ba9e8b304e27d9904d233d7b1015db320e51f0a", size = 2119622, upload-time = "2025-11-04T13:40:56.68Z" }, + { url = "https://files.pythonhosted.org/packages/74/1a/145646e5687e8d9a1e8d09acb278c8535ebe9e972e1f162ed338a622f193/pydantic_core-2.41.5-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:1d1d9764366c73f996edd17abb6d9d7649a7eb690006ab6adbda117717099b14", size = 1891725, upload-time = "2025-11-04T13:40:58.807Z" }, + { url = "https://files.pythonhosted.org/packages/23/04/e89c29e267b8060b40dca97bfc64a19b2a3cf99018167ea1677d96368273/pydantic_core-2.41.5-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:25e1c2af0fce638d5f1988b686f3b3ea8cd7de5f244ca147c777769e798a9cd1", size = 1915040, upload-time = "2025-11-04T13:41:00.853Z" }, + { url = "https://files.pythonhosted.org/packages/84/a3/15a82ac7bd97992a82257f777b3583d3e84bdb06ba6858f745daa2ec8a85/pydantic_core-2.41.5-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:506d766a8727beef16b7adaeb8ee6217c64fc813646b424d0804d67c16eddb66", size = 2063691, upload-time = "2025-11-04T13:41:03.504Z" }, + { url = "https://files.pythonhosted.org/packages/74/9b/0046701313c6ef08c0c1cf0e028c67c770a4e1275ca73131563c5f2a310a/pydantic_core-2.41.5-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:4819fa52133c9aa3c387b3328f25c1facc356491e6135b459f1de698ff64d869", size = 2213897, upload-time = "2025-11-04T13:41:05.804Z" }, + { url = "https://files.pythonhosted.org/packages/8a/cd/6bac76ecd1b27e75a95ca3a9a559c643b3afcd2dd62086d4b7a32a18b169/pydantic_core-2.41.5-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:2b761d210c9ea91feda40d25b4efe82a1707da2ef62901466a42492c028553a2", size = 2333302, upload-time = "2025-11-04T13:41:07.809Z" }, + { url = "https://files.pythonhosted.org/packages/4c/d2/ef2074dc020dd6e109611a8be4449b98cd25e1b9b8a303c2f0fca2f2bcf7/pydantic_core-2.41.5-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:22f0fb8c1c583a3b6f24df2470833b40207e907b90c928cc8d3594b76f874375", size = 2064877, upload-time = "2025-11-04T13:41:09.827Z" }, + { url = "https://files.pythonhosted.org/packages/18/66/e9db17a9a763d72f03de903883c057b2592c09509ccfe468187f2a2eef29/pydantic_core-2.41.5-cp314-cp314-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:2782c870e99878c634505236d81e5443092fba820f0373997ff75f90f68cd553", size = 2180680, upload-time = "2025-11-04T13:41:12.379Z" }, + { url = "https://files.pythonhosted.org/packages/d3/9e/3ce66cebb929f3ced22be85d4c2399b8e85b622db77dad36b73c5387f8f8/pydantic_core-2.41.5-cp314-cp314-musllinux_1_1_aarch64.whl", hash = "sha256:0177272f88ab8312479336e1d777f6b124537d47f2123f89cb37e0accea97f90", size = 2138960, upload-time = "2025-11-04T13:41:14.627Z" }, + { url = "https://files.pythonhosted.org/packages/a6/62/205a998f4327d2079326b01abee48e502ea739d174f0a89295c481a2272e/pydantic_core-2.41.5-cp314-cp314-musllinux_1_1_armv7l.whl", hash = "sha256:63510af5e38f8955b8ee5687740d6ebf7c2a0886d15a6d65c32814613681bc07", size = 2339102, upload-time = "2025-11-04T13:41:16.868Z" }, + { url = "https://files.pythonhosted.org/packages/3c/0d/f05e79471e889d74d3d88f5bd20d0ed189ad94c2423d81ff8d0000aab4ff/pydantic_core-2.41.5-cp314-cp314-musllinux_1_1_x86_64.whl", hash = "sha256:e56ba91f47764cc14f1daacd723e3e82d1a89d783f0f5afe9c364b8bb491ccdb", size = 2326039, upload-time = "2025-11-04T13:41:18.934Z" }, + { url = "https://files.pythonhosted.org/packages/ec/e1/e08a6208bb100da7e0c4b288eed624a703f4d129bde2da475721a80cab32/pydantic_core-2.41.5-cp314-cp314-win32.whl", hash = "sha256:aec5cf2fd867b4ff45b9959f8b20ea3993fc93e63c7363fe6851424c8a7e7c23", size = 1995126, upload-time = "2025-11-04T13:41:21.418Z" }, + { url = "https://files.pythonhosted.org/packages/48/5d/56ba7b24e9557f99c9237e29f5c09913c81eeb2f3217e40e922353668092/pydantic_core-2.41.5-cp314-cp314-win_amd64.whl", hash = "sha256:8e7c86f27c585ef37c35e56a96363ab8de4e549a95512445b85c96d3e2f7c1bf", size = 2015489, upload-time = "2025-11-04T13:41:24.076Z" }, + { url = "https://files.pythonhosted.org/packages/4e/bb/f7a190991ec9e3e0ba22e4993d8755bbc4a32925c0b5b42775c03e8148f9/pydantic_core-2.41.5-cp314-cp314-win_arm64.whl", hash = "sha256:e672ba74fbc2dc8eea59fb6d4aed6845e6905fc2a8afe93175d94a83ba2a01a0", size = 1977288, upload-time = "2025-11-04T13:41:26.33Z" }, + { url = "https://files.pythonhosted.org/packages/92/ed/77542d0c51538e32e15afe7899d79efce4b81eee631d99850edc2f5e9349/pydantic_core-2.41.5-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:8566def80554c3faa0e65ac30ab0932b9e3a5cd7f8323764303d468e5c37595a", size = 2120255, upload-time = "2025-11-04T13:41:28.569Z" }, + { url = "https://files.pythonhosted.org/packages/bb/3d/6913dde84d5be21e284439676168b28d8bbba5600d838b9dca99de0fad71/pydantic_core-2.41.5-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:b80aa5095cd3109962a298ce14110ae16b8c1aece8b72f9dafe81cf597ad80b3", size = 1863760, upload-time = "2025-11-04T13:41:31.055Z" }, + { url = "https://files.pythonhosted.org/packages/5a/f0/e5e6b99d4191da102f2b0eb9687aaa7f5bea5d9964071a84effc3e40f997/pydantic_core-2.41.5-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3006c3dd9ba34b0c094c544c6006cc79e87d8612999f1a5d43b769b89181f23c", size = 1878092, upload-time = "2025-11-04T13:41:33.21Z" }, + { url = "https://files.pythonhosted.org/packages/71/48/36fb760642d568925953bcc8116455513d6e34c4beaa37544118c36aba6d/pydantic_core-2.41.5-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:72f6c8b11857a856bcfa48c86f5368439f74453563f951e473514579d44aa612", size = 2053385, upload-time = "2025-11-04T13:41:35.508Z" }, + { url = "https://files.pythonhosted.org/packages/20/25/92dc684dd8eb75a234bc1c764b4210cf2646479d54b47bf46061657292a8/pydantic_core-2.41.5-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:5cb1b2f9742240e4bb26b652a5aeb840aa4b417c7748b6f8387927bc6e45e40d", size = 2218832, upload-time = "2025-11-04T13:41:37.732Z" }, + { url = "https://files.pythonhosted.org/packages/e2/09/f53e0b05023d3e30357d82eb35835d0f6340ca344720a4599cd663dca599/pydantic_core-2.41.5-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:bd3d54f38609ff308209bd43acea66061494157703364ae40c951f83ba99a1a9", size = 2327585, upload-time = "2025-11-04T13:41:40Z" }, + { url = "https://files.pythonhosted.org/packages/aa/4e/2ae1aa85d6af35a39b236b1b1641de73f5a6ac4d5a7509f77b814885760c/pydantic_core-2.41.5-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2ff4321e56e879ee8d2a879501c8e469414d948f4aba74a2d4593184eb326660", size = 2041078, upload-time = "2025-11-04T13:41:42.323Z" }, + { url = "https://files.pythonhosted.org/packages/cd/13/2e215f17f0ef326fc72afe94776edb77525142c693767fc347ed6288728d/pydantic_core-2.41.5-cp314-cp314t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:d0d2568a8c11bf8225044aa94409e21da0cb09dcdafe9ecd10250b2baad531a9", size = 2173914, upload-time = "2025-11-04T13:41:45.221Z" }, + { url = "https://files.pythonhosted.org/packages/02/7a/f999a6dcbcd0e5660bc348a3991c8915ce6599f4f2c6ac22f01d7a10816c/pydantic_core-2.41.5-cp314-cp314t-musllinux_1_1_aarch64.whl", hash = "sha256:a39455728aabd58ceabb03c90e12f71fd30fa69615760a075b9fec596456ccc3", size = 2129560, upload-time = "2025-11-04T13:41:47.474Z" }, + { url = "https://files.pythonhosted.org/packages/3a/b1/6c990ac65e3b4c079a4fb9f5b05f5b013afa0f4ed6780a3dd236d2cbdc64/pydantic_core-2.41.5-cp314-cp314t-musllinux_1_1_armv7l.whl", hash = "sha256:239edca560d05757817c13dc17c50766136d21f7cd0fac50295499ae24f90fdf", size = 2329244, upload-time = "2025-11-04T13:41:49.992Z" }, + { url = "https://files.pythonhosted.org/packages/d9/02/3c562f3a51afd4d88fff8dffb1771b30cfdfd79befd9883ee094f5b6c0d8/pydantic_core-2.41.5-cp314-cp314t-musllinux_1_1_x86_64.whl", hash = "sha256:2a5e06546e19f24c6a96a129142a75cee553cc018ffee48a460059b1185f4470", size = 2331955, upload-time = "2025-11-04T13:41:54.079Z" }, + { url = "https://files.pythonhosted.org/packages/5c/96/5fb7d8c3c17bc8c62fdb031c47d77a1af698f1d7a406b0f79aaa1338f9ad/pydantic_core-2.41.5-cp314-cp314t-win32.whl", hash = "sha256:b4ececa40ac28afa90871c2cc2b9ffd2ff0bf749380fbdf57d165fd23da353aa", size = 1988906, upload-time = "2025-11-04T13:41:56.606Z" }, + { url = "https://files.pythonhosted.org/packages/22/ed/182129d83032702912c2e2d8bbe33c036f342cc735737064668585dac28f/pydantic_core-2.41.5-cp314-cp314t-win_amd64.whl", hash = "sha256:80aa89cad80b32a912a65332f64a4450ed00966111b6615ca6816153d3585a8c", size = 1981607, upload-time = "2025-11-04T13:41:58.889Z" }, + { url = "https://files.pythonhosted.org/packages/9f/ed/068e41660b832bb0b1aa5b58011dea2a3fe0ba7861ff38c4d4904c1c1a99/pydantic_core-2.41.5-cp314-cp314t-win_arm64.whl", hash = "sha256:35b44f37a3199f771c3eaa53051bc8a70cd7b54f333531c59e29fd4db5d15008", size = 1974769, upload-time = "2025-11-04T13:42:01.186Z" }, + { url = "https://files.pythonhosted.org/packages/54/db/160dffb57ed9a3705c4cbcbff0ac03bdae45f1ca7d58ab74645550df3fbd/pydantic_core-2.41.5-cp39-cp39-macosx_10_12_x86_64.whl", hash = "sha256:8bfeaf8735be79f225f3fefab7f941c712aaca36f1128c9d7e2352ee1aa87bdf", size = 2107999, upload-time = "2025-11-04T13:42:03.885Z" }, + { url = "https://files.pythonhosted.org/packages/a3/7d/88e7de946f60d9263cc84819f32513520b85c0f8322f9b8f6e4afc938383/pydantic_core-2.41.5-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:346285d28e4c8017da95144c7f3acd42740d637ff41946af5ce6e5e420502dd5", size = 1929745, upload-time = "2025-11-04T13:42:06.075Z" }, + { url = "https://files.pythonhosted.org/packages/d5/c2/aef51e5b283780e85e99ff19db0f05842d2d4a8a8cd15e63b0280029b08f/pydantic_core-2.41.5-cp39-cp39-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a75dafbf87d6276ddc5b2bf6fae5254e3d0876b626eb24969a574fff9149ee5d", size = 1920220, upload-time = "2025-11-04T13:42:08.457Z" }, + { url = "https://files.pythonhosted.org/packages/c7/97/492ab10f9ac8695cd76b2fdb24e9e61f394051df71594e9bcc891c9f586e/pydantic_core-2.41.5-cp39-cp39-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:7b93a4d08587e2b7e7882de461e82b6ed76d9026ce91ca7915e740ecc7855f60", size = 2067296, upload-time = "2025-11-04T13:42:10.817Z" }, + { url = "https://files.pythonhosted.org/packages/ec/23/984149650e5269c59a2a4c41d234a9570adc68ab29981825cfaf4cfad8f4/pydantic_core-2.41.5-cp39-cp39-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e8465ab91a4bd96d36dde3263f06caa6a8a6019e4113f24dc753d79a8b3a3f82", size = 2231548, upload-time = "2025-11-04T13:42:13.843Z" }, + { url = "https://files.pythonhosted.org/packages/71/0c/85bcbb885b9732c28bec67a222dbed5ed2d77baee1f8bba2002e8cd00c5c/pydantic_core-2.41.5-cp39-cp39-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:299e0a22e7ae2b85c1a57f104538b2656e8ab1873511fd718a1c1c6f149b77b5", size = 2362571, upload-time = "2025-11-04T13:42:16.208Z" }, + { url = "https://files.pythonhosted.org/packages/c0/4a/412d2048be12c334003e9b823a3fa3d038e46cc2d64dd8aab50b31b65499/pydantic_core-2.41.5-cp39-cp39-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:707625ef0983fcfb461acfaf14de2067c5942c6bb0f3b4c99158bed6fedd3cf3", size = 2068175, upload-time = "2025-11-04T13:42:18.911Z" }, + { url = "https://files.pythonhosted.org/packages/73/f4/c58b6a776b502d0a5540ad02e232514285513572060f0d78f7832ca3c98b/pydantic_core-2.41.5-cp39-cp39-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:f41eb9797986d6ebac5e8edff36d5cef9de40def462311b3eb3eeded1431e425", size = 2177203, upload-time = "2025-11-04T13:42:22.578Z" }, + { url = "https://files.pythonhosted.org/packages/ed/ae/f06ea4c7e7a9eead3d165e7623cd2ea0cb788e277e4f935af63fc98fa4e6/pydantic_core-2.41.5-cp39-cp39-musllinux_1_1_aarch64.whl", hash = "sha256:0384e2e1021894b1ff5a786dbf94771e2986ebe2869533874d7e43bc79c6f504", size = 2148191, upload-time = "2025-11-04T13:42:24.89Z" }, + { url = "https://files.pythonhosted.org/packages/c1/57/25a11dcdc656bf5f8b05902c3c2934ac3ea296257cc4a3f79a6319e61856/pydantic_core-2.41.5-cp39-cp39-musllinux_1_1_armv7l.whl", hash = "sha256:f0cd744688278965817fd0839c4a4116add48d23890d468bc436f78beb28abf5", size = 2343907, upload-time = "2025-11-04T13:42:27.683Z" }, + { url = "https://files.pythonhosted.org/packages/96/82/e33d5f4933d7a03327c0c43c65d575e5919d4974ffc026bc917a5f7b9f61/pydantic_core-2.41.5-cp39-cp39-musllinux_1_1_x86_64.whl", hash = "sha256:753e230374206729bf0a807954bcc6c150d3743928a73faffee51ac6557a03c3", size = 2322174, upload-time = "2025-11-04T13:42:30.776Z" }, + { url = "https://files.pythonhosted.org/packages/81/45/4091be67ce9f469e81656f880f3506f6a5624121ec5eb3eab37d7581897d/pydantic_core-2.41.5-cp39-cp39-win32.whl", hash = "sha256:873e0d5b4fb9b89ef7c2d2a963ea7d02879d9da0da8d9d4933dee8ee86a8b460", size = 1990353, upload-time = "2025-11-04T13:42:33.111Z" }, + { url = "https://files.pythonhosted.org/packages/44/8a/a98aede18db6e9cd5d66bcacd8a409fcf8134204cdede2e7de35c5a2c5ef/pydantic_core-2.41.5-cp39-cp39-win_amd64.whl", hash = "sha256:e4f4a984405e91527a0d62649ee21138f8e3d0ef103be488c1dc11a80d7f184b", size = 2015698, upload-time = "2025-11-04T13:42:35.484Z" }, + { url = "https://files.pythonhosted.org/packages/11/72/90fda5ee3b97e51c494938a4a44c3a35a9c96c19bba12372fb9c634d6f57/pydantic_core-2.41.5-graalpy311-graalpy242_311_native-macosx_10_12_x86_64.whl", hash = "sha256:b96d5f26b05d03cc60f11a7761a5ded1741da411e7fe0909e27a5e6a0cb7b034", size = 2115441, upload-time = "2025-11-04T13:42:39.557Z" }, + { url = "https://files.pythonhosted.org/packages/1f/53/8942f884fa33f50794f119012dc6a1a02ac43a56407adaac20463df8e98f/pydantic_core-2.41.5-graalpy311-graalpy242_311_native-macosx_11_0_arm64.whl", hash = "sha256:634e8609e89ceecea15e2d61bc9ac3718caaaa71963717bf3c8f38bfde64242c", size = 1930291, upload-time = "2025-11-04T13:42:42.169Z" }, + { url = "https://files.pythonhosted.org/packages/79/c8/ecb9ed9cd942bce09fc888ee960b52654fbdbede4ba6c2d6e0d3b1d8b49c/pydantic_core-2.41.5-graalpy311-graalpy242_311_native-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:93e8740d7503eb008aa2df04d3b9735f845d43ae845e6dcd2be0b55a2da43cd2", size = 1948632, upload-time = "2025-11-04T13:42:44.564Z" }, + { url = "https://files.pythonhosted.org/packages/2e/1b/687711069de7efa6af934e74f601e2a4307365e8fdc404703afc453eab26/pydantic_core-2.41.5-graalpy311-graalpy242_311_native-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f15489ba13d61f670dcc96772e733aad1a6f9c429cc27574c6cdaed82d0146ad", size = 2138905, upload-time = "2025-11-04T13:42:47.156Z" }, + { url = "https://files.pythonhosted.org/packages/09/32/59b0c7e63e277fa7911c2fc70ccfb45ce4b98991e7ef37110663437005af/pydantic_core-2.41.5-graalpy312-graalpy250_312_native-macosx_10_12_x86_64.whl", hash = "sha256:7da7087d756b19037bc2c06edc6c170eeef3c3bafcb8f532ff17d64dc427adfd", size = 2110495, upload-time = "2025-11-04T13:42:49.689Z" }, + { url = "https://files.pythonhosted.org/packages/aa/81/05e400037eaf55ad400bcd318c05bb345b57e708887f07ddb2d20e3f0e98/pydantic_core-2.41.5-graalpy312-graalpy250_312_native-macosx_11_0_arm64.whl", hash = "sha256:aabf5777b5c8ca26f7824cb4a120a740c9588ed58df9b2d196ce92fba42ff8dc", size = 1915388, upload-time = "2025-11-04T13:42:52.215Z" }, + { url = "https://files.pythonhosted.org/packages/6e/0d/e3549b2399f71d56476b77dbf3cf8937cec5cd70536bdc0e374a421d0599/pydantic_core-2.41.5-graalpy312-graalpy250_312_native-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:c007fe8a43d43b3969e8469004e9845944f1a80e6acd47c150856bb87f230c56", size = 1942879, upload-time = "2025-11-04T13:42:56.483Z" }, + { url = "https://files.pythonhosted.org/packages/f7/07/34573da085946b6a313d7c42f82f16e8920bfd730665de2d11c0c37a74b5/pydantic_core-2.41.5-graalpy312-graalpy250_312_native-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:76d0819de158cd855d1cbb8fcafdf6f5cf1eb8e470abe056d5d161106e38062b", size = 2139017, upload-time = "2025-11-04T13:42:59.471Z" }, + { url = "https://files.pythonhosted.org/packages/e6/b0/1a2aa41e3b5a4ba11420aba2d091b2d17959c8d1519ece3627c371951e73/pydantic_core-2.41.5-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:b5819cd790dbf0c5eb9f82c73c16b39a65dd6dd4d1439dcdea7816ec9adddab8", size = 2103351, upload-time = "2025-11-04T13:43:02.058Z" }, + { url = "https://files.pythonhosted.org/packages/a4/ee/31b1f0020baaf6d091c87900ae05c6aeae101fa4e188e1613c80e4f1ea31/pydantic_core-2.41.5-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:5a4e67afbc95fa5c34cf27d9089bca7fcab4e51e57278d710320a70b956d1b9a", size = 1925363, upload-time = "2025-11-04T13:43:05.159Z" }, + { url = "https://files.pythonhosted.org/packages/e1/89/ab8e86208467e467a80deaca4e434adac37b10a9d134cd2f99b28a01e483/pydantic_core-2.41.5-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ece5c59f0ce7d001e017643d8d24da587ea1f74f6993467d85ae8a5ef9d4f42b", size = 2135615, upload-time = "2025-11-04T13:43:08.116Z" }, + { url = "https://files.pythonhosted.org/packages/99/0a/99a53d06dd0348b2008f2f30884b34719c323f16c3be4e6cc1203b74a91d/pydantic_core-2.41.5-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:16f80f7abe3351f8ea6858914ddc8c77e02578544a0ebc15b4c2e1a0e813b0b2", size = 2175369, upload-time = "2025-11-04T13:43:12.49Z" }, + { url = "https://files.pythonhosted.org/packages/6d/94/30ca3b73c6d485b9bb0bc66e611cff4a7138ff9736b7e66bcf0852151636/pydantic_core-2.41.5-pp310-pypy310_pp73-musllinux_1_1_aarch64.whl", hash = "sha256:33cb885e759a705b426baada1fe68cbb0a2e68e34c5d0d0289a364cf01709093", size = 2144218, upload-time = "2025-11-04T13:43:15.431Z" }, + { url = "https://files.pythonhosted.org/packages/87/57/31b4f8e12680b739a91f472b5671294236b82586889ef764b5fbc6669238/pydantic_core-2.41.5-pp310-pypy310_pp73-musllinux_1_1_armv7l.whl", hash = "sha256:c8d8b4eb992936023be7dee581270af5c6e0697a8559895f527f5b7105ecd36a", size = 2329951, upload-time = "2025-11-04T13:43:18.062Z" }, + { url = "https://files.pythonhosted.org/packages/7d/73/3c2c8edef77b8f7310e6fb012dbc4b8551386ed575b9eb6fb2506e28a7eb/pydantic_core-2.41.5-pp310-pypy310_pp73-musllinux_1_1_x86_64.whl", hash = "sha256:242a206cd0318f95cd21bdacff3fcc3aab23e79bba5cac3db5a841c9ef9c6963", size = 2318428, upload-time = "2025-11-04T13:43:20.679Z" }, + { url = "https://files.pythonhosted.org/packages/2f/02/8559b1f26ee0d502c74f9cca5c0d2fd97e967e083e006bbbb4e97f3a043a/pydantic_core-2.41.5-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:d3a978c4f57a597908b7e697229d996d77a6d3c94901e9edee593adada95ce1a", size = 2147009, upload-time = "2025-11-04T13:43:23.286Z" }, + { url = "https://files.pythonhosted.org/packages/5f/9b/1b3f0e9f9305839d7e84912f9e8bfbd191ed1b1ef48083609f0dabde978c/pydantic_core-2.41.5-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:b2379fa7ed44ddecb5bfe4e48577d752db9fc10be00a6b7446e9663ba143de26", size = 2101980, upload-time = "2025-11-04T13:43:25.97Z" }, + { url = "https://files.pythonhosted.org/packages/a4/ed/d71fefcb4263df0da6a85b5d8a7508360f2f2e9b3bf5814be9c8bccdccc1/pydantic_core-2.41.5-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:266fb4cbf5e3cbd0b53669a6d1b039c45e3ce651fd5442eff4d07c2cc8d66808", size = 1923865, upload-time = "2025-11-04T13:43:28.763Z" }, + { url = "https://files.pythonhosted.org/packages/ce/3a/626b38db460d675f873e4444b4bb030453bbe7b4ba55df821d026a0493c4/pydantic_core-2.41.5-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:58133647260ea01e4d0500089a8c4f07bd7aa6ce109682b1426394988d8aaacc", size = 2134256, upload-time = "2025-11-04T13:43:31.71Z" }, + { url = "https://files.pythonhosted.org/packages/83/d9/8412d7f06f616bbc053d30cb4e5f76786af3221462ad5eee1f202021eb4e/pydantic_core-2.41.5-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:287dad91cfb551c363dc62899a80e9e14da1f0e2b6ebde82c806612ca2a13ef1", size = 2174762, upload-time = "2025-11-04T13:43:34.744Z" }, + { url = "https://files.pythonhosted.org/packages/55/4c/162d906b8e3ba3a99354e20faa1b49a85206c47de97a639510a0e673f5da/pydantic_core-2.41.5-pp311-pypy311_pp73-musllinux_1_1_aarch64.whl", hash = "sha256:03b77d184b9eb40240ae9fd676ca364ce1085f203e1b1256f8ab9984dca80a84", size = 2143141, upload-time = "2025-11-04T13:43:37.701Z" }, + { url = "https://files.pythonhosted.org/packages/1f/f2/f11dd73284122713f5f89fc940f370d035fa8e1e078d446b3313955157fe/pydantic_core-2.41.5-pp311-pypy311_pp73-musllinux_1_1_armv7l.whl", hash = "sha256:a668ce24de96165bb239160b3d854943128f4334822900534f2fe947930e5770", size = 2330317, upload-time = "2025-11-04T13:43:40.406Z" }, + { url = "https://files.pythonhosted.org/packages/88/9d/b06ca6acfe4abb296110fb1273a4d848a0bfb2ff65f3ee92127b3244e16b/pydantic_core-2.41.5-pp311-pypy311_pp73-musllinux_1_1_x86_64.whl", hash = "sha256:f14f8f046c14563f8eb3f45f499cc658ab8d10072961e07225e507adb700e93f", size = 2316992, upload-time = "2025-11-04T13:43:43.602Z" }, + { url = "https://files.pythonhosted.org/packages/36/c7/cfc8e811f061c841d7990b0201912c3556bfeb99cdcb7ed24adc8d6f8704/pydantic_core-2.41.5-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:56121965f7a4dc965bff783d70b907ddf3d57f6eba29b6d2e5dabfaf07799c51", size = 2145302, upload-time = "2025-11-04T13:43:46.64Z" }, +] + +[[package]] +name = "pygments" +version = "2.19.2" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/b0/77/a5b8c569bf593b0140bde72ea885a803b82086995367bf2037de0159d924/pygments-2.19.2.tar.gz", hash = "sha256:636cb2477cec7f8952536970bc533bc43743542f70392ae026374600add5b887", size = 4968631, upload-time = "2025-06-21T13:39:12.283Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c7/21/705964c7812476f378728bdf590ca4b771ec72385c533964653c68e86bdc/pygments-2.19.2-py3-none-any.whl", hash = "sha256:86540386c03d588bb81d44bc3928634ff26449851e99741617ecb9037ee5ec0b", size = 1225217, upload-time = "2025-06-21T13:39:07.939Z" }, +] + +[[package]] +name = "pyright" +version = "1.1.399" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "nodeenv" }, + { name = "typing-extensions" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/db/9d/d91d5f6d26b2db95476fefc772e2b9a16d54c6bd0ea6bb5c1b6d635ab8b4/pyright-1.1.399.tar.gz", hash = "sha256:439035d707a36c3d1b443aec980bc37053fbda88158eded24b8eedcf1c7b7a1b", size = 3856954, upload-time = "2025-04-10T04:40:25.703Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2f/b5/380380c9e7a534cb1783c70c3e8ac6d1193c599650a55838d0557586796e/pyright-1.1.399-py3-none-any.whl", hash = "sha256:55f9a875ddf23c9698f24208c764465ffdfd38be6265f7faf9a176e1dc549f3b", size = 5592584, upload-time = "2025-04-10T04:40:23.502Z" }, +] + +[[package]] +name = "pytest" +version = "8.4.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +dependencies = [ + { name = "colorama", marker = "(python_full_version < '3.10' and sys_platform == 'win32') or (python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2') or (sys_platform != 'win32' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "exceptiongroup", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "iniconfig", version = "2.1.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "packaging", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pluggy", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pygments", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "tomli", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/a3/5c/00a0e072241553e1a7496d638deababa67c5058571567b92a7eaa258397c/pytest-8.4.2.tar.gz", hash = "sha256:86c0d0b93306b961d58d62a4db4879f27fe25513d4b969df351abdddb3c30e01", size = 1519618, upload-time = "2025-09-04T14:34:22.711Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/a8/a4/20da314d277121d6534b3a980b29035dcd51e6744bd79075a6ce8fa4eb8d/pytest-8.4.2-py3-none-any.whl", hash = "sha256:872f880de3fc3a5bdc88a11b39c9710c3497a547cfa9320bc3c5e62fbf272e79", size = 365750, upload-time = "2025-09-04T14:34:20.226Z" }, +] + +[[package]] +name = "pytest" +version = "9.0.2" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +dependencies = [ + { name = "colorama", marker = "(python_full_version >= '3.10' and sys_platform == 'win32') or (python_full_version < '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2') or (sys_platform != 'win32' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "exceptiongroup", marker = "python_full_version == '3.10.*' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "iniconfig", version = "2.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "packaging", marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pluggy", marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pygments", marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "tomli", marker = "python_full_version == '3.10.*' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/d1/db/7ef3487e0fb0049ddb5ce41d3a49c235bf9ad299b6a25d5780a89f19230f/pytest-9.0.2.tar.gz", hash = "sha256:75186651a92bd89611d1d9fc20f0b4345fd827c41ccd5c299a868a05d70edf11", size = 1568901, upload-time = "2025-12-06T21:30:51.014Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3b/ab/b3226f0bd7cdcf710fbede2b3548584366da3b19b5021e74f5bde2a8fa3f/pytest-9.0.2-py3-none-any.whl", hash = "sha256:711ffd45bf766d5264d487b917733b453d917afd2b0ad65223959f59089f875b", size = 374801, upload-time = "2025-12-06T21:30:49.154Z" }, +] + +[[package]] +name = "pytest-asyncio" +version = "1.2.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +dependencies = [ + { name = "backports-asyncio-runner", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "typing-extensions", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/42/86/9e3c5f48f7b7b638b216e4b9e645f54d199d7abbbab7a64a13b4e12ba10f/pytest_asyncio-1.2.0.tar.gz", hash = "sha256:c609a64a2a8768462d0c99811ddb8bd2583c33fd33cf7f21af1c142e824ffb57", size = 50119, upload-time = "2025-09-12T07:33:53.816Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/04/93/2fa34714b7a4ae72f2f8dad66ba17dd9a2c793220719e736dda28b7aec27/pytest_asyncio-1.2.0-py3-none-any.whl", hash = "sha256:8e17ae5e46d8e7efe51ab6494dd2010f4ca8dae51652aa3c8d55acf50bfb2e99", size = 15095, upload-time = "2025-09-12T07:33:52.639Z" }, +] + +[[package]] +name = "pytest-asyncio" +version = "1.3.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +dependencies = [ + { name = "backports-asyncio-runner", marker = "python_full_version == '3.10.*' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest", version = "9.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "typing-extensions", marker = "(python_full_version >= '3.10' and python_full_version < '3.13') or (python_full_version < '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2') or (python_full_version >= '3.13' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/90/2c/8af215c0f776415f3590cac4f9086ccefd6fd463befeae41cd4d3f193e5a/pytest_asyncio-1.3.0.tar.gz", hash = "sha256:d7f52f36d231b80ee124cd216ffb19369aa168fc10095013c6b014a34d3ee9e5", size = 50087, upload-time = "2025-11-10T16:07:47.256Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e5/35/f8b19922b6a25bc0880171a2f1a003eaeb93657475193ab516fd87cac9da/pytest_asyncio-1.3.0-py3-none-any.whl", hash = "sha256:611e26147c7f77640e6d0a92a38ed17c3e9848063698d5c93d5aa7aa11cebff5", size = 15075, upload-time = "2025-11-10T16:07:45.537Z" }, +] + +[[package]] +name = "pytest-xdist" +version = "3.8.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "execnet" }, + { name = "pytest", version = "8.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pytest", version = "9.0.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/78/b4/439b179d1ff526791eb921115fca8e44e596a13efeda518b9d845a619450/pytest_xdist-3.8.0.tar.gz", hash = "sha256:7e578125ec9bc6050861aa93f2d59f1d8d085595d6551c2c90b6f4fad8d3a9f1", size = 88069, upload-time = "2025-07-01T13:30:59.346Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ca/31/d4e37e9e550c2b92a9cbc2e4d0b7420a27224968580b5a447f420847c975/pytest_xdist-3.8.0-py3-none-any.whl", hash = "sha256:202ca578cfeb7370784a8c33d6d05bc6e13b4f25b5053c30a152269fd10f0b88", size = 46396, upload-time = "2025-07-01T13:30:56.632Z" }, +] + +[[package]] +name = "python-dateutil" +version = "2.9.0.post0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "six", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/66/c0/0c8b6ad9f17a802ee498c46e004a0eb49bc148f2fd230864601a86dcf6db/python-dateutil-2.9.0.post0.tar.gz", hash = "sha256:37dd54208da7e1cd875388217d5e00ebd4179249f90fb72437e91a35459a0ad3", size = 342432, upload-time = "2024-03-01T18:36:20.211Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/ec/57/56b9bcc3c9c6a792fcbaf139543cee77261f3651ca9da0c93f5c1221264b/python_dateutil-2.9.0.post0-py2.py3-none-any.whl", hash = "sha256:a8b2bc7bffae282281c8140a97d3aa9c14da0b136dfe83f850eea9a5f7470427", size = 229892, upload-time = "2024-03-01T18:36:18.57Z" }, +] + +[[package]] +name = "respx" +version = "0.22.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "httpx" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/f4/7c/96bd0bc759cf009675ad1ee1f96535edcb11e9666b985717eb8c87192a95/respx-0.22.0.tar.gz", hash = "sha256:3c8924caa2a50bd71aefc07aa812f2466ff489f1848c96e954a5362d17095d91", size = 28439, upload-time = "2024-12-19T22:33:59.374Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/8e/67/afbb0978d5399bc9ea200f1d4489a23c9a1dad4eee6376242b8182389c79/respx-0.22.0-py2.py3-none-any.whl", hash = "sha256:631128d4c9aba15e56903fb5f66fb1eff412ce28dd387ca3a81339e52dbd3ad0", size = 25127, upload-time = "2024-12-19T22:33:57.837Z" }, +] + +[[package]] +name = "rich" +version = "14.2.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "markdown-it-py", version = "3.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "markdown-it-py", version = "4.0.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, + { name = "pygments" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/fb/d2/8920e102050a0de7bfabeb4c4614a49248cf8d5d7a8d01885fbb24dc767a/rich-14.2.0.tar.gz", hash = "sha256:73ff50c7c0c1c77c8243079283f4edb376f0f6442433aecb8ce7e6d0b92d1fe4", size = 219990, upload-time = "2025-10-09T14:16:53.064Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/25/7a/b0178788f8dc6cafce37a212c99565fa1fe7872c70c6c9c1e1a372d9d88f/rich-14.2.0-py3-none-any.whl", hash = "sha256:76bc51fe2e57d2b1be1f96c524b890b816e334ab4c1e45888799bfaab0021edd", size = 243393, upload-time = "2025-10-09T14:16:51.245Z" }, +] + +[[package]] +name = "ruff" +version = "0.14.13" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/50/0a/1914efb7903174b381ee2ffeebb4253e729de57f114e63595114c8ca451f/ruff-0.14.13.tar.gz", hash = "sha256:83cd6c0763190784b99650a20fec7633c59f6ebe41c5cc9d45ee42749563ad47", size = 6059504, upload-time = "2026-01-15T20:15:16.918Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c3/ae/0deefbc65ca74b0ab1fd3917f94dc3b398233346a74b8bbb0a916a1a6bf6/ruff-0.14.13-py3-none-linux_armv6l.whl", hash = "sha256:76f62c62cd37c276cb03a275b198c7c15bd1d60c989f944db08a8c1c2dbec18b", size = 13062418, upload-time = "2026-01-15T20:14:50.779Z" }, + { url = "https://files.pythonhosted.org/packages/47/df/5916604faa530a97a3c154c62a81cb6b735c0cb05d1e26d5ad0f0c8ac48a/ruff-0.14.13-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:914a8023ece0528d5cc33f5a684f5f38199bbb566a04815c2c211d8f40b5d0ed", size = 13442344, upload-time = "2026-01-15T20:15:07.94Z" }, + { url = "https://files.pythonhosted.org/packages/4c/f3/e0e694dd69163c3a1671e102aa574a50357536f18a33375050334d5cd517/ruff-0.14.13-py3-none-macosx_11_0_arm64.whl", hash = "sha256:d24899478c35ebfa730597a4a775d430ad0d5631b8647a3ab368c29b7e7bd063", size = 12354720, upload-time = "2026-01-15T20:15:09.854Z" }, + { url = "https://files.pythonhosted.org/packages/c3/e8/67f5fcbbaee25e8fc3b56cc33e9892eca7ffe09f773c8e5907757a7e3bdb/ruff-0.14.13-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9aaf3870f14d925bbaf18b8a2347ee0ae7d95a2e490e4d4aea6813ed15ebc80e", size = 12774493, upload-time = "2026-01-15T20:15:20.908Z" }, + { url = "https://files.pythonhosted.org/packages/6b/ce/d2e9cb510870b52a9565d885c0d7668cc050e30fa2c8ac3fb1fda15c083d/ruff-0.14.13-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:ac5b7f63dd3b27cc811850f5ffd8fff845b00ad70e60b043aabf8d6ecc304e09", size = 12815174, upload-time = "2026-01-15T20:15:05.74Z" }, + { url = "https://files.pythonhosted.org/packages/88/00/c38e5da58beebcf4fa32d0ddd993b63dfacefd02ab7922614231330845bf/ruff-0.14.13-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:78d2b1097750d90ba82ce4ba676e85230a0ed694178ca5e61aa9b459970b3eb9", size = 13680909, upload-time = "2026-01-15T20:15:14.537Z" }, + { url = "https://files.pythonhosted.org/packages/61/61/cd37c9dd5bd0a3099ba79b2a5899ad417d8f3b04038810b0501a80814fd7/ruff-0.14.13-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:7d0bf87705acbbcb8d4c24b2d77fbb73d40210a95c3903b443cd9e30824a5032", size = 15144215, upload-time = "2026-01-15T20:15:22.886Z" }, + { url = "https://files.pythonhosted.org/packages/56/8a/85502d7edbf98c2df7b8876f316c0157359165e16cdf98507c65c8d07d3d/ruff-0.14.13-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:a3eb5da8e2c9e9f13431032fdcbe7681de9ceda5835efee3269417c13f1fed5c", size = 14706067, upload-time = "2026-01-15T20:14:48.271Z" }, + { url = "https://files.pythonhosted.org/packages/7e/2f/de0df127feb2ee8c1e54354dc1179b4a23798f0866019528c938ba439aca/ruff-0.14.13-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:642442b42957093811cd8d2140dfadd19c7417030a7a68cf8d51fcdd5f217427", size = 14133916, upload-time = "2026-01-15T20:14:57.357Z" }, + { url = "https://files.pythonhosted.org/packages/0d/77/9b99686bb9fe07a757c82f6f95e555c7a47801a9305576a9c67e0a31d280/ruff-0.14.13-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4acdf009f32b46f6e8864af19cbf6841eaaed8638e65c8dac845aea0d703c841", size = 13859207, upload-time = "2026-01-15T20:14:55.111Z" }, + { url = "https://files.pythonhosted.org/packages/7d/46/2bdcb34a87a179a4d23022d818c1c236cb40e477faf0d7c9afb6813e5876/ruff-0.14.13-py3-none-manylinux_2_31_riscv64.whl", hash = "sha256:591a7f68860ea4e003917d19b5c4f5ac39ff558f162dc753a2c5de897fd5502c", size = 14043686, upload-time = "2026-01-15T20:14:52.841Z" }, + { url = "https://files.pythonhosted.org/packages/1a/a9/5c6a4f56a0512c691cf143371bcf60505ed0f0860f24a85da8bd123b2bf1/ruff-0.14.13-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:774c77e841cc6e046fc3e91623ce0903d1cd07e3a36b1a9fe79b81dab3de506b", size = 12663837, upload-time = "2026-01-15T20:15:18.921Z" }, + { url = "https://files.pythonhosted.org/packages/fe/bb/b920016ece7651fa7fcd335d9d199306665486694d4361547ccb19394c44/ruff-0.14.13-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:61f4e40077a1248436772bb6512db5fc4457fe4c49e7a94ea7c5088655dd21ae", size = 12805867, upload-time = "2026-01-15T20:14:59.272Z" }, + { url = "https://files.pythonhosted.org/packages/7d/b3/0bd909851e5696cd21e32a8fc25727e5f58f1934b3596975503e6e85415c/ruff-0.14.13-py3-none-musllinux_1_2_i686.whl", hash = "sha256:6d02f1428357fae9e98ac7aa94b7e966fd24151088510d32cf6f902d6c09235e", size = 13208528, upload-time = "2026-01-15T20:15:03.732Z" }, + { url = "https://files.pythonhosted.org/packages/3b/3b/e2d94cb613f6bbd5155a75cbe072813756363eba46a3f2177a1fcd0cd670/ruff-0.14.13-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:e399341472ce15237be0c0ae5fbceca4b04cd9bebab1a2b2c979e015455d8f0c", size = 13929242, upload-time = "2026-01-15T20:15:11.918Z" }, + { url = "https://files.pythonhosted.org/packages/6a/c5/abd840d4132fd51a12f594934af5eba1d5d27298a6f5b5d6c3be45301caf/ruff-0.14.13-py3-none-win32.whl", hash = "sha256:ef720f529aec113968b45dfdb838ac8934e519711da53a0456038a0efecbd680", size = 12919024, upload-time = "2026-01-15T20:14:43.647Z" }, + { url = "https://files.pythonhosted.org/packages/c2/55/6384b0b8ce731b6e2ade2b5449bf07c0e4c31e8a2e68ea65b3bafadcecc5/ruff-0.14.13-py3-none-win_amd64.whl", hash = "sha256:6070bd026e409734b9257e03e3ef18c6e1a216f0435c6751d7a8ec69cb59abef", size = 14097887, upload-time = "2026-01-15T20:15:01.48Z" }, + { url = "https://files.pythonhosted.org/packages/4d/e1/7348090988095e4e39560cfc2f7555b1b2a7357deba19167b600fdf5215d/ruff-0.14.13-py3-none-win_arm64.whl", hash = "sha256:7ab819e14f1ad9fe39f246cfcc435880ef7a9390d81a2b6ac7e01039083dd247", size = 13080224, upload-time = "2026-01-15T20:14:45.853Z" }, +] + +[[package]] +name = "six" +version = "1.17.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/94/e7/b2c673351809dca68a0e064b6af791aa332cf192da575fd474ed7d6f16a2/six-1.17.0.tar.gz", hash = "sha256:ff70335d468e7eb6ec65b95b99d3a2836546063f63acc5171de367e834932a81", size = 34031, upload-time = "2024-12-04T17:35:28.174Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b7/ce/149a00dd41f10bc29e5921b496af8b574d8413afcd5e30dfa0ed46c2cc5e/six-1.17.0-py2.py3-none-any.whl", hash = "sha256:4721f391ed90541fddacab5acf947aa0d3dc7d27b2e1e8eda2be8970586c3274", size = 11050, upload-time = "2024-12-04T17:35:26.475Z" }, +] + +[[package]] +name = "sniffio" +version = "1.3.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/87/a6771e1546d97e7e041b6ae58d80074f81b7d5121207425c964ddf5cfdbd/sniffio-1.3.1.tar.gz", hash = "sha256:f4324edc670a0f49750a81b895f35c3adb843cca46f0530f79fc1babb23789dc", size = 20372, upload-time = "2024-02-25T23:20:04.057Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e9/44/75a9c9421471a6c4805dbf2356f7c181a29c1879239abab1ea2cc8f38b40/sniffio-1.3.1-py3-none-any.whl", hash = "sha256:2f6da418d1f1e0fddd844478f41680e794e6051915791a034ff65e5f100525a2", size = 10235, upload-time = "2024-02-25T23:20:01.196Z" }, +] + +[[package]] +name = "time-machine" +version = "2.19.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.10'", +] +dependencies = [ + { name = "python-dateutil", marker = "python_full_version < '3.10' or (extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2')" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/f8/a4/1b5fdd165f61b67f445fac2a7feb0c655118edef429cd09ff5a8067f7f1d/time_machine-2.19.0.tar.gz", hash = "sha256:7c5065a8b3f2bbb449422c66ef71d114d3f909c276a6469642ecfffb6a0fcd29", size = 14576, upload-time = "2025-08-19T17:22:08.402Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9d/8f/19125611ebbcb3a14da14cd982b9eb4573e2733db60c9f1fbf6a39534f40/time_machine-2.19.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:b5169018ef47206997b46086ce01881cd3a4666fd2998c9d76a87858ca3e49e9", size = 19659, upload-time = "2025-08-19T17:20:30.062Z" }, + { url = "https://files.pythonhosted.org/packages/74/da/9b0a928321e7822a3ff96dbd1eae089883848e30e9e1b149b85fb96ba56b/time_machine-2.19.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:85bb7ed440fccf6f6d0c8f7d68d849e7c3d1f771d5e0b2cdf871fa6561da569f", size = 15157, upload-time = "2025-08-19T17:20:31.931Z" }, + { url = "https://files.pythonhosted.org/packages/36/ff/d7e943422038f5f2161fe2c2d791e64a45be691ef946020b20f3a6efc4d4/time_machine-2.19.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:a3b12028af1cdc09ccd595be2168b7b26f206c1e190090b048598fbe278beb8e", size = 32860, upload-time = "2025-08-19T17:20:33.241Z" }, + { url = "https://files.pythonhosted.org/packages/fc/80/2b0f1070ed9808ee7da7a6da62a4a0b776957cb4d861578348f86446e778/time_machine-2.19.0-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:c261f073086cf081d1443cbf7684148c662659d3d139d06b772bfe3fe7cc71a6", size = 34510, upload-time = "2025-08-19T17:20:34.221Z" }, + { url = "https://files.pythonhosted.org/packages/ef/b4/48038691c8d89924b36c83335a73adeeb68c884f5a1da08a5b17b8a956f3/time_machine-2.19.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:011954d951230a9f1079f22b39ed1a3a9abb50ee297dfb8c557c46351659d94d", size = 36204, upload-time = "2025-08-19T17:20:35.163Z" }, + { url = "https://files.pythonhosted.org/packages/37/2e/60e8adb541df195e83cb74b720b2cfb1f22ed99c5a7f8abf2a9ab3442cb5/time_machine-2.19.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:b0f83308b29c7872006803f2e77318874eb84d0654f2afe0e48e3822e7a2e39b", size = 34936, upload-time = "2025-08-19T17:20:36.61Z" }, + { url = "https://files.pythonhosted.org/packages/5e/72/e8cee59c6cd99dd3b25b8001a0253e779a286aa8f44d5b40777cbd66210b/time_machine-2.19.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:39733ef844e2984620ec9382a42d00cccc4757d75a5dd572be8c2572e86e50b9", size = 32932, upload-time = "2025-08-19T17:20:37.901Z" }, + { url = "https://files.pythonhosted.org/packages/2c/eb/83f300d93c1504965d944e03679f1c943a923bce2d0fdfadef0e2e22cc13/time_machine-2.19.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f8db99f6334432e9ffbf00c215caf2ae9773f17cec08304d77e9e90febc3507b", size = 34010, upload-time = "2025-08-19T17:20:39.202Z" }, + { url = "https://files.pythonhosted.org/packages/e1/77/f35f2500e04daac5033a22fbfd17e68467822b8406ee77966bf222ccaa26/time_machine-2.19.0-cp310-cp310-win32.whl", hash = "sha256:72bf66cd19e27ffd26516b9cbe676d50c2e0b026153289765dfe0cf406708128", size = 17121, upload-time = "2025-08-19T17:20:40.108Z" }, + { url = "https://files.pythonhosted.org/packages/db/df/32d3e0404be1760a64a44caab2af34b07e952bfe00a23134fea9ddba3e8a/time_machine-2.19.0-cp310-cp310-win_amd64.whl", hash = "sha256:46f1c945934ce3d6b4f388b8e581fce7f87ec891ea90d7128e19520e434f96f0", size = 17957, upload-time = "2025-08-19T17:20:41.079Z" }, + { url = "https://files.pythonhosted.org/packages/66/df/598a71a1afb4b509a4587273b76590b16d9110a3e9106f01eedc68d02bb2/time_machine-2.19.0-cp310-cp310-win_arm64.whl", hash = "sha256:fb4897c7a5120a4fd03f0670f332d83b7e55645886cd8864a71944c4c2e5b35b", size = 16821, upload-time = "2025-08-19T17:20:41.967Z" }, + { url = "https://files.pythonhosted.org/packages/1d/ed/4815ebcc9b6c14273f692b9be38a9b09eae52a7e532407cc61a51912b121/time_machine-2.19.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:5ee91664880434d98e41585c3446dac7180ec408c786347451ddfca110d19296", size = 19342, upload-time = "2025-08-19T17:20:43.207Z" }, + { url = "https://files.pythonhosted.org/packages/ee/08/154cce8b11b60d8238b0b751b8901d369999f4e8f7c3a5f917caa5d95b0b/time_machine-2.19.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:ed3732b83a893d1c7b8cabde762968b4dc5680ee0d305b3ecca9bb516f4e3862", size = 14978, upload-time = "2025-08-19T17:20:44.134Z" }, + { url = "https://files.pythonhosted.org/packages/c7/b7/b689d8c8eeca7af375cfcd64973e49e83aa817cc00f80f98548d42c0eb50/time_machine-2.19.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:6ba0303e9cc9f7f947e344f501e26bedfb68fab521e3c2729d370f4f332d2d55", size = 30964, upload-time = "2025-08-19T17:20:45.366Z" }, + { url = "https://files.pythonhosted.org/packages/80/91/38bf9c79674e95ce32e23c267055f281dff651eec77ed32a677db3dc011a/time_machine-2.19.0-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:2851825b524a988ee459c37c1c26bdfaa7eff78194efb2b562ea497a6f375b0a", size = 32606, upload-time = "2025-08-19T17:20:46.693Z" }, + { url = "https://files.pythonhosted.org/packages/19/4a/e9222d85d4de68975a5e799f539a9d32f3a134a9101fca0a61fa6aa33d68/time_machine-2.19.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:68d32b09ecfd7fef59255c091e8e7c24dd117f882c4880b5c7ab8c5c32a98f89", size = 34405, upload-time = "2025-08-19T17:20:48.032Z" }, + { url = "https://files.pythonhosted.org/packages/14/e2/09480d608d42d6876f9ff74593cfc9197a7eb2c31381a74fb2b145575b65/time_machine-2.19.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:60c46ab527bf2fa144b530f639cc9e12803524c9e1f111dc8c8f493bb6586eeb", size = 33181, upload-time = "2025-08-19T17:20:48.937Z" }, + { url = "https://files.pythonhosted.org/packages/84/64/f9359e000fad32d9066305c48abc527241d608bcdf77c19d67d66e268455/time_machine-2.19.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:56f26ab9f0201c453d18fe76bb7d1cf05fe58c1b9d9cb0c7d243d05132e01292", size = 31036, upload-time = "2025-08-19T17:20:50.276Z" }, + { url = "https://files.pythonhosted.org/packages/71/0d/fab2aacec71e3e482bd7fce0589381f9414a4a97f8766bddad04ad047b7b/time_machine-2.19.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:6c806cf3c1185baa1d807b7f51bed0db7a6506832c961d5d1b4c94c775749bc0", size = 32145, upload-time = "2025-08-19T17:20:51.449Z" }, + { url = "https://files.pythonhosted.org/packages/44/fb/faeba2405fb27553f7b28db441a500e2064ffdb2dcba001ee315fdd2c121/time_machine-2.19.0-cp311-cp311-win32.whl", hash = "sha256:b30039dfd89855c12138095bee39c540b4633cbc3684580d684ef67a99a91587", size = 17004, upload-time = "2025-08-19T17:20:52.38Z" }, + { url = "https://files.pythonhosted.org/packages/2f/84/87e483d660ca669426192969280366635c845c3154a9fe750be546ed3afc/time_machine-2.19.0-cp311-cp311-win_amd64.whl", hash = "sha256:13ed8b34430f1de79905877f5600adffa626793ab4546a70a99fb72c6a3350d8", size = 17822, upload-time = "2025-08-19T17:20:53.348Z" }, + { url = "https://files.pythonhosted.org/packages/41/f4/ebf7bbf5047854a528adaf54a5e8780bc5f7f0104c298ab44566a3053bf8/time_machine-2.19.0-cp311-cp311-win_arm64.whl", hash = "sha256:cc29a50a0257d8750b08056b66d7225daab47606832dea1a69e8b017323bf511", size = 16680, upload-time = "2025-08-19T17:20:54.26Z" }, + { url = "https://files.pythonhosted.org/packages/9b/aa/7e00614d339e4d687f6e96e312a1566022528427d237ec639df66c4547bc/time_machine-2.19.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:c85cf437dc3c07429456d8d6670ac90ecbd8241dcd0fbf03e8db2800576f91ff", size = 19308, upload-time = "2025-08-19T17:20:55.25Z" }, + { url = "https://files.pythonhosted.org/packages/ab/3c/bde3c757394f5bca2fbc1528d4117960a26c38f9b160bf471b38d2378d8f/time_machine-2.19.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d9238897e8ef54acdf59f5dff16f59ca0720e7c02d820c56b4397c11db5d3eb9", size = 15019, upload-time = "2025-08-19T17:20:56.204Z" }, + { url = "https://files.pythonhosted.org/packages/c8/e0/8ca916dd918018352d377f1f5226ee071cfbeb7dbbde2b03d14a411ac2b1/time_machine-2.19.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:e312c7d5d6bfffb96c6a7b39ff29e3046de100d7efaa3c01552654cfbd08f14c", size = 33079, upload-time = "2025-08-19T17:20:57.166Z" }, + { url = "https://files.pythonhosted.org/packages/48/69/184a0209f02dd0cb5e01e8d13cd4c97a5f389c4e3d09b95160dd676ad1e7/time_machine-2.19.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:714c40b2c90d1c57cc403382d5a9cf16e504cb525bfe9650095317da3c3d62b5", size = 34925, upload-time = "2025-08-19T17:20:58.117Z" }, + { url = "https://files.pythonhosted.org/packages/43/42/4bbf4309e8e57cea1086eb99052d97ff6ddecc1ab6a3b07aa4512f8bf963/time_machine-2.19.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2eaa1c675d500dc3ccae19e9fb1feff84458a68c132bbea47a80cc3dd2df7072", size = 36384, upload-time = "2025-08-19T17:20:59.108Z" }, + { url = "https://files.pythonhosted.org/packages/b1/af/9f510dc1719157348c1a2e87423aed406589070b54b503cb237d9bf3a4fe/time_machine-2.19.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:e77a414e9597988af53b2b2e67242c9d2f409769df0d264b6d06fda8ca3360d4", size = 34881, upload-time = "2025-08-19T17:21:00.116Z" }, + { url = "https://files.pythonhosted.org/packages/ca/28/61764a635c70cc76c76ba582dfdc1a84834cddaeb96789023af5214426b2/time_machine-2.19.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:cd93996970e11c382b04d4937c3cd0b0167adeef14725ece35aae88d8a01733c", size = 32931, upload-time = "2025-08-19T17:21:01.095Z" }, + { url = "https://files.pythonhosted.org/packages/b6/e0/f028d93b266e6ade8aca5851f76ebbc605b2905cdc29981a2943b43e1a6c/time_machine-2.19.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:8e20a6d8d6e23174bd7e931e134d9610b136db460b249d07e84ecdad029ec352", size = 34241, upload-time = "2025-08-19T17:21:02.052Z" }, + { url = "https://files.pythonhosted.org/packages/7d/a6/36d1950ed1d3f613158024cf1dcc73db1d9ef0b9117cf51ef2e37dc06499/time_machine-2.19.0-cp312-cp312-win32.whl", hash = "sha256:95afc9bc65228b27be80c2756799c20b8eb97c4ef382a9b762b6d7888bc84099", size = 17021, upload-time = "2025-08-19T17:21:03.374Z" }, + { url = "https://files.pythonhosted.org/packages/b1/0d/e2dce93355abda3cac69e77fe96566757e98b8fe7fdcbddce89c9ced3f5f/time_machine-2.19.0-cp312-cp312-win_amd64.whl", hash = "sha256:e84909af950e2448f4e2562ea5759c946248c99ab380d2b47d79b62bd76fa236", size = 17857, upload-time = "2025-08-19T17:21:04.331Z" }, + { url = "https://files.pythonhosted.org/packages/eb/28/50ae6fb83b7feeeca7a461c0dc156cf7ef5e6ef594a600d06634fde6a2cb/time_machine-2.19.0-cp312-cp312-win_arm64.whl", hash = "sha256:0390a1ea9fa7e9d772a39b7c61b34fdcca80eb9ffac339cc0441c6c714c81470", size = 16677, upload-time = "2025-08-19T17:21:05.39Z" }, + { url = "https://files.pythonhosted.org/packages/a9/b8/24ebce67aa531bae2cbe164bb3f4abc6467dc31f3aead35e77f5a075ea3e/time_machine-2.19.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:5e172866753e6041d3b29f3037dc47c20525176a494a71bbd0998dfdc4f11f2f", size = 19373, upload-time = "2025-08-19T17:21:06.701Z" }, + { url = "https://files.pythonhosted.org/packages/53/a5/c9a5240fd2f845d3ff9fa26f8c8eaa29f7239af9d65007e61d212250f15b/time_machine-2.19.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f70f68379bd6f542ae6775cce9a4fa3dcc20bf7959c42eaef871c14469e18097", size = 15056, upload-time = "2025-08-19T17:21:07.667Z" }, + { url = "https://files.pythonhosted.org/packages/b9/92/66cce5d2fb2a5e68459aca85fd18a7e2d216f725988940cd83f96630f2f1/time_machine-2.19.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:e69e0b0f694728a00e72891ef8dd00c7542952cb1c87237db594b6b27d504a96", size = 33172, upload-time = "2025-08-19T17:21:08.619Z" }, + { url = "https://files.pythonhosted.org/packages/ae/20/b499e9ab4364cd466016c33dcdf4f56629ca4c20b865bd4196d229f31d92/time_machine-2.19.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:3ae0a8b869574301ec5637e32c270c7384cca5cd6e230f07af9d29271a7fa293", size = 35042, upload-time = "2025-08-19T17:21:09.622Z" }, + { url = "https://files.pythonhosted.org/packages/41/32/b252d3d32791eb16c07d553c820dbc33d9c7fa771de3d1c602190bded2b7/time_machine-2.19.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:554e4317de90e2f7605ff80d153c8bb56b38c0d0c0279feb17e799521e987b8c", size = 36535, upload-time = "2025-08-19T17:21:10.571Z" }, + { url = "https://files.pythonhosted.org/packages/98/cf/4d0470062b9742e1b040ab81bad04d1a5d1de09806507bb6188989cfa1a7/time_machine-2.19.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6567a5ec5538ed550539ac29be11b3cb36af1f9894e2a72940cba0292cc7c3c9", size = 34945, upload-time = "2025-08-19T17:21:11.538Z" }, + { url = "https://files.pythonhosted.org/packages/24/71/2f741b29d98b1c18f6777a32236497c3d3264b6077e431cea4695684c8a1/time_machine-2.19.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:82e9ffe8dfff07b0d810a2ad015a82cd78c6a237f6c7cf185fa7f747a3256f8a", size = 33014, upload-time = "2025-08-19T17:21:12.858Z" }, + { url = "https://files.pythonhosted.org/packages/e8/83/ca8dba6106562843fd99f672e5aaf95badbc10f4f13f7cfe8d8640a7019d/time_machine-2.19.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7e1c4e578cdd69b3531d8dd3fbcb92a0cd879dadb912ee37af99c3a9e3c0d285", size = 34350, upload-time = "2025-08-19T17:21:13.923Z" }, + { url = "https://files.pythonhosted.org/packages/21/7f/34fe540450e18d0a993240100e4b86e8d03d831b92af8bb6ddb2662dc6fc/time_machine-2.19.0-cp313-cp313-win32.whl", hash = "sha256:72dbd4cbc3d96dec9dd281ddfbb513982102776b63e4e039f83afb244802a9e5", size = 17047, upload-time = "2025-08-19T17:21:14.874Z" }, + { url = "https://files.pythonhosted.org/packages/bf/5d/c8be73df82c7ebe7cd133279670e89b8b110af3ce1412c551caa9d08e625/time_machine-2.19.0-cp313-cp313-win_amd64.whl", hash = "sha256:e17e3e089ac95f9a145ce07ff615e3c85674f7de36f2d92aaf588493a23ffb4b", size = 17868, upload-time = "2025-08-19T17:21:15.819Z" }, + { url = "https://files.pythonhosted.org/packages/92/13/2dfd3b8fb285308f61cd7aa9bfa96f46ddf916e3549a0f0afd094c556599/time_machine-2.19.0-cp313-cp313-win_arm64.whl", hash = "sha256:149072aff8e3690e14f4916103d898ea0d5d9c95531b6aa0995251c299533f7b", size = 16710, upload-time = "2025-08-19T17:21:16.748Z" }, + { url = "https://files.pythonhosted.org/packages/05/c1/deebb361727d2c5790f9d4d874be1b19afd41f4375581df465e6718b46a2/time_machine-2.19.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:f3589fee1ed0ab6ee424a55b0ea1ec694c4ba64cc26895bcd7d99f3d1bc6a28a", size = 20053, upload-time = "2025-08-19T17:21:17.704Z" }, + { url = "https://files.pythonhosted.org/packages/45/e8/fe3376951e6118d8ec1d1f94066a169b791424fe4a26c7dfc069b153ee08/time_machine-2.19.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:7887e85275c4975fe54df03dcdd5f38bd36be973adc68a8c77e17441c3b443d6", size = 15423, upload-time = "2025-08-19T17:21:18.668Z" }, + { url = "https://files.pythonhosted.org/packages/9c/c7/f88d95cd1a87c650cf3749b4d64afdaf580297aa18ad7f4b44ec9d252dfc/time_machine-2.19.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:ce0be294c209928563fcce1c587963e60ec803436cf1e181acd5bc1e425d554b", size = 39630, upload-time = "2025-08-19T17:21:19.645Z" }, + { url = "https://files.pythonhosted.org/packages/cc/5d/65a5c48a65357e56ec6f032972e4abd1c02d4fca4b0717a3aaefd19014d4/time_machine-2.19.0-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:a62fd1ab380012c86f4c042010418ed45eb31604f4bf4453e17c9fa60bc56a29", size = 41242, upload-time = "2025-08-19T17:21:20.979Z" }, + { url = "https://files.pythonhosted.org/packages/f6/f9/fe5209e1615fde0a8cad6c4e857157b150333ed1fe31a7632b08cfe0ebdd/time_machine-2.19.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b25ec853a4530a5800731257f93206b12cbdee85ede964ebf8011b66086a7914", size = 44278, upload-time = "2025-08-19T17:21:21.984Z" }, + { url = "https://files.pythonhosted.org/packages/4a/3a/a5e5fe9c5d614cde0a9387ff35e8dfd12c5ef6384e4c1a21b04e6e0b905d/time_machine-2.19.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a430e4d0e0556f021a9c78e9b9f68e5e8910bdace4aa34ed4d1a73e239ed9384", size = 42321, upload-time = "2025-08-19T17:21:23.755Z" }, + { url = "https://files.pythonhosted.org/packages/a1/c5/56eca774e9162bc1ce59111d2bd69140dc8908c9478c92ec7bd15d547600/time_machine-2.19.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:2415b7495ec4364c8067071e964fbadfe746dd4cdb43983f2f0bd6ebed13315c", size = 39270, upload-time = "2025-08-19T17:21:26.009Z" }, + { url = "https://files.pythonhosted.org/packages/9b/69/5dd0c420667578169a12acc8c8fd7452e8cfb181e41c9b4ac7e88fa36686/time_machine-2.19.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:dbfc6b90c10f288594e1bf89a728a98cc0030791fd73541bbdc6b090aff83143", size = 40193, upload-time = "2025-08-19T17:21:27.054Z" }, + { url = "https://files.pythonhosted.org/packages/75/a7/de974d421bd55c9355583427c2a38fb0237bb5fd6614af492ba89dacb2f9/time_machine-2.19.0-cp313-cp313t-win32.whl", hash = "sha256:16f5d81f650c0a4d117ab08036dc30b5f8b262e11a4a0becc458e7f1c011b228", size = 17542, upload-time = "2025-08-19T17:21:28.674Z" }, + { url = "https://files.pythonhosted.org/packages/76/0a/aa0d05becd5d06ae8d3f16d657dc8cc9400c8d79aef80299de196467ff12/time_machine-2.19.0-cp313-cp313t-win_amd64.whl", hash = "sha256:645699616ec14e147094f601e6ab9553ff6cea37fad9c42720a6d7ed04bcd5dc", size = 18703, upload-time = "2025-08-19T17:21:29.663Z" }, + { url = "https://files.pythonhosted.org/packages/1f/c0/f785a4c7c73aa176510f7c48b84b49c26be84af0d534deb222e0327f750e/time_machine-2.19.0-cp313-cp313t-win_arm64.whl", hash = "sha256:b32daa965d13237536ea3afaa5ad61ade2b2d9314bc3a20196a0d2e1d7b57c6a", size = 17020, upload-time = "2025-08-19T17:21:30.653Z" }, + { url = "https://files.pythonhosted.org/packages/ed/97/c5fb51def06c0b2b6735332ad118ab35b4d9b85368792e5b638e99b1b686/time_machine-2.19.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:31cb43c8fd2d961f31bed0ff4e0026964d2b35e5de9e0fabbfecf756906d3612", size = 19360, upload-time = "2025-08-19T17:21:31.94Z" }, + { url = "https://files.pythonhosted.org/packages/2d/4e/2d795f7d6b7f5205ffe737a05bb1cf19d8038233b797062b2ef412b8512b/time_machine-2.19.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:bdf481a75afc6bff3e520db594501975b652f7def21cd1de6aa971d35ba644e6", size = 15033, upload-time = "2025-08-19T17:21:32.934Z" }, + { url = "https://files.pythonhosted.org/packages/dd/32/9bad501e360b4e758c58fae616ca5f8c7ad974b343f2463a15b2bf77a366/time_machine-2.19.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:00bee4bb950ac6a08d62af78e4da0cf2b4fc2abf0de2320d0431bf610db06e7c", size = 33379, upload-time = "2025-08-19T17:21:33.925Z" }, + { url = "https://files.pythonhosted.org/packages/a3/45/eda0ca4d793dfd162478d6163759b1c6ce7f6e61daa7fd7d62b31f21f87f/time_machine-2.19.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:9f02199490906582302ce09edd32394fb393271674c75d7aa76c7a3245f16003", size = 35123, upload-time = "2025-08-19T17:21:34.945Z" }, + { url = "https://files.pythonhosted.org/packages/f0/5a/97e16325442ae5731fcaac794f0a1ef9980eff8a5491e58201d7eb814a34/time_machine-2.19.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e35726c7ba625f844c13b1fc0d4f81f394eefaee1d3a094a9093251521f2ef15", size = 36588, upload-time = "2025-08-19T17:21:35.975Z" }, + { url = "https://files.pythonhosted.org/packages/e8/9d/bf0b2ccc930cc4a316f26f1c78d3f313cd0fa13bb7480369b730a8f129db/time_machine-2.19.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:304315023999cd401ff02698870932b893369e1cfeb2248d09f6490507a92e97", size = 35013, upload-time = "2025-08-19T17:21:37.017Z" }, + { url = "https://files.pythonhosted.org/packages/f0/5a/39ac6a3078174f9715d88364871348b249631f12e76de1b862433b3f8862/time_machine-2.19.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:9765d4f003f263ea8bfd90d2d15447ca4b3dfa181922cf6cf808923b02ac180a", size = 33303, upload-time = "2025-08-19T17:21:38.352Z" }, + { url = "https://files.pythonhosted.org/packages/b3/ac/d8646baf9f95f2e792a6d7a7b35e92fca253c4a992afff801beafae0e5c2/time_machine-2.19.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:7837ef3fd5911eb9b480909bb93d922737b6bdecea99dfcedb0a03807de9b2d3", size = 34440, upload-time = "2025-08-19T17:21:39.382Z" }, + { url = "https://files.pythonhosted.org/packages/ce/8b/8b6568c5ae966d80ead03ab537be3c6acf2af06fb501c2d466a3162c6295/time_machine-2.19.0-cp314-cp314-win32.whl", hash = "sha256:4bb5bd43b1bdfac3007b920b51d8e761f024ed465cfeec63ac4296922a4ec428", size = 17162, upload-time = "2025-08-19T17:21:40.381Z" }, + { url = "https://files.pythonhosted.org/packages/46/a5/211c1ab4566eba5308b2dc001b6349e3a032e3f6afa67ca2f27ea6b27af5/time_machine-2.19.0-cp314-cp314-win_amd64.whl", hash = "sha256:f583bbd0aa8ab4a7c45a684bf636d9e042d466e30bcbae1d13e7541e2cbe7207", size = 18040, upload-time = "2025-08-19T17:21:41.363Z" }, + { url = "https://files.pythonhosted.org/packages/b8/fc/4c2fb705f6371cb83824da45a8b967514a922fc092a0ef53979334d97a70/time_machine-2.19.0-cp314-cp314-win_arm64.whl", hash = "sha256:f379c6f8a6575a8284592179cf528ce89373f060301323edcc44f1fa1d37be12", size = 16752, upload-time = "2025-08-19T17:21:42.336Z" }, + { url = "https://files.pythonhosted.org/packages/79/ab/6437d18f31c666b5116c97572a282ac2590a82a0a9867746a6647eaf4613/time_machine-2.19.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:a3b8981f9c663b0906b05ab4d0ca211fae4b63b47c6ec26de5374fe56c836162", size = 20057, upload-time = "2025-08-19T17:21:43.35Z" }, + { url = "https://files.pythonhosted.org/packages/6c/a2/e03639ec2ba7200328bbcad8a2b2b1d5fccca9cceb9481b164a1cabdcb33/time_machine-2.19.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:8e9c6363893e7f52c226afbebb23e825259222d100e67dfd24c8a6d35f1a1907", size = 15430, upload-time = "2025-08-19T17:21:44.725Z" }, + { url = "https://files.pythonhosted.org/packages/5d/ff/39e63a48e840f3e36ce24846ee51dd99c6dba635659b1750a2993771e88e/time_machine-2.19.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:206fcd6c9a6f00cac83db446ad1effc530a8cec244d2780af62db3a2d0a9871b", size = 39622, upload-time = "2025-08-19T17:21:45.821Z" }, + { url = "https://files.pythonhosted.org/packages/9a/2e/ee5ac79c4954768705801e54817c7d58e07e25a0bb227e775f501f3e2122/time_machine-2.19.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:bf33016a1403c123373ffaeff25e26e69d63bf2c63b6163932efed94160db7ef", size = 41235, upload-time = "2025-08-19T17:21:46.783Z" }, + { url = "https://files.pythonhosted.org/packages/3a/3e/9af5f39525e779185c77285b8bbae15340eeeaa0afb33d458bc8b47d459b/time_machine-2.19.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9247c4bb9bbd3ff584ef4efbdec8efd9f37aa08bcfc4728bde1e489c2cb445bd", size = 44276, upload-time = "2025-08-19T17:21:47.759Z" }, + { url = "https://files.pythonhosted.org/packages/59/fe/572c7443cc27140bbeae3947279bbd4a120f9e8622253a20637f260b7813/time_machine-2.19.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:77f9bb0b86758d1f2d9352642c874946ad5815df53ef4ca22eb9d532179fe50d", size = 42330, upload-time = "2025-08-19T17:21:48.881Z" }, + { url = "https://files.pythonhosted.org/packages/cf/24/1a81c2e08ee7dae13ec8ceed27a29afa980c3d63852e42f1e023bf0faa03/time_machine-2.19.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:0b529e262df3b9c449f427385f4d98250828c879168c2e00eec844439f40b370", size = 39281, upload-time = "2025-08-19T17:21:49.907Z" }, + { url = "https://files.pythonhosted.org/packages/d2/60/6f0d6e5108978ca1a2a4ffb4d1c7e176d9199bb109fd44efe2680c60b52a/time_machine-2.19.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:9199246e31cdc810e5d89cb71d09144c4d745960fdb0824da4994d152aca3303", size = 40201, upload-time = "2025-08-19T17:21:50.953Z" }, + { url = "https://files.pythonhosted.org/packages/73/b9/3ea4951e8293b0643feb98c0b9a176fa822154f1810835db3f282968ab10/time_machine-2.19.0-cp314-cp314t-win32.whl", hash = "sha256:0fe81bae55b7aefc2c2a34eb552aa82e6c61a86b3353a3c70df79b9698cb02ca", size = 17743, upload-time = "2025-08-19T17:21:51.948Z" }, + { url = "https://files.pythonhosted.org/packages/e4/8b/cd802884ca8a98e2b6cdc2397d57dd12ff8a7d1481e06fc3fad3d4e7e5ff/time_machine-2.19.0-cp314-cp314t-win_amd64.whl", hash = "sha256:7253791b8d7e7399fbeed7a8193cb01bc004242864306288797056badbdaf80b", size = 18956, upload-time = "2025-08-19T17:21:52.997Z" }, + { url = "https://files.pythonhosted.org/packages/c6/49/cabb1593896082fd55e34768029b8b0ca23c9be8b2dc127e0fc14796d33e/time_machine-2.19.0-cp314-cp314t-win_arm64.whl", hash = "sha256:536bd1ac31ab06a1522e7bf287602188f502dc19d122b1502c4f60b1e8efac79", size = 17068, upload-time = "2025-08-19T17:21:54.064Z" }, + { url = "https://files.pythonhosted.org/packages/d6/05/0608376c3167afe6cf7cdfd2b05c142ea4c42616eee9ba06d1799965806a/time_machine-2.19.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:d8bb00b30ec9fe56d01e9812df1ffe39f331437cef9bfaebcc81c83f7f8f8ee2", size = 19659, upload-time = "2025-08-19T17:21:55.426Z" }, + { url = "https://files.pythonhosted.org/packages/11/c4/72eb8c7b36830cf36c51d7bc2f1ac313d68881c3a58040fb6b42c4523d20/time_machine-2.19.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:d821c60efc08a97cc11e5482798e6fd5eba5c0f22a02db246b50895dbdc0de41", size = 15153, upload-time = "2025-08-19T17:21:56.505Z" }, + { url = "https://files.pythonhosted.org/packages/89/1a/0782e1f5c8ab8809ebd992709e1bb69d67600191baa023af7a5d32023a3c/time_machine-2.19.0-cp39-cp39-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:fb051aec7b3b6e96a200d911c225901e6133ff3da11e470e24111a53bbc13637", size = 32555, upload-time = "2025-08-19T17:21:57.74Z" }, + { url = "https://files.pythonhosted.org/packages/94/b0/8ef58e2f6321851d5900ca3d18044938832c2ed42a2ac7570ca6aa29768a/time_machine-2.19.0-cp39-cp39-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:fe59909d95a2ef5e01ce3354fdea3908404c2932c2069f00f66dff6f27e9363e", size = 34185, upload-time = "2025-08-19T17:21:59.361Z" }, + { url = "https://files.pythonhosted.org/packages/82/74/ce0c9867f788c1fb22c417ec1aae47a24117e53d51f6ff97d7c6ca5392f6/time_machine-2.19.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:29e84b8682645b16eb6f9e8ec11c35324ad091841a11cf4fc3fc7f6119094c89", size = 35917, upload-time = "2025-08-19T17:22:00.421Z" }, + { url = "https://files.pythonhosted.org/packages/d2/70/6f97a8f552dbaa66feb10170b5726dab74bc531673d1ed9d6f271547e54c/time_machine-2.19.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:4a11f1c0e0d06023dc01614c964e256138913551d3ae6dca5148f79081156336", size = 34584, upload-time = "2025-08-19T17:22:01.447Z" }, + { url = "https://files.pythonhosted.org/packages/48/c8/cf139088ce537c15d7f03cf56ec317d3a5cfb520e30aa711ea0248d0ae8a/time_machine-2.19.0-cp39-cp39-musllinux_1_2_i686.whl", hash = "sha256:57a235a6307c54df50e69f1906e2f199e47da91bde4b886ee05aff57fe4b6bf6", size = 32608, upload-time = "2025-08-19T17:22:02.548Z" }, + { url = "https://files.pythonhosted.org/packages/b1/17/0ec41ef7a30c6753fb226a28b74162b264b35724905ced4098f2f5076ded/time_machine-2.19.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:426aba552f7af9604adad9ef570c859af7c1081d878db78089fac159cd911b0a", size = 33686, upload-time = "2025-08-19T17:22:03.606Z" }, + { url = "https://files.pythonhosted.org/packages/b0/19/586f15159083ec84f178d494c60758c46603b00c9641b04deb63f1950128/time_machine-2.19.0-cp39-cp39-win32.whl", hash = "sha256:67772c7197a3a712d1b970ed545c6e98db73524bd90e245fd3c8fa7ad7630768", size = 17133, upload-time = "2025-08-19T17:22:04.989Z" }, + { url = "https://files.pythonhosted.org/packages/6a/c2/bfe4b906a9fe0bf2d011534314212ed752d6b8f392c9c82f6ac63dccc5ab/time_machine-2.19.0-cp39-cp39-win_amd64.whl", hash = "sha256:011d7859089263204dc5fdf83dce7388f986fe833c9381d6106b4edfda2ebd3e", size = 17972, upload-time = "2025-08-19T17:22:06.026Z" }, + { url = "https://files.pythonhosted.org/packages/5d/73/182343eba05aa5787732aaa68f3b3feb5e40ddf86b928ae941be45646393/time_machine-2.19.0-cp39-cp39-win_arm64.whl", hash = "sha256:e1af66550fa4685434f00002808a525f176f1f92746646c0019bb86fbff48b27", size = 16820, upload-time = "2025-08-19T17:22:07.227Z" }, +] + +[[package]] +name = "time-machine" +version = "3.2.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and python_full_version < '3.14' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra == 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra == 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", + "python_full_version >= '3.10' and extra != 'group-12-oz-agent-sdk-pydantic-v1' and extra != 'group-12-oz-agent-sdk-pydantic-v2'", +] +sdist = { url = "https://files.pythonhosted.org/packages/02/fc/37b02f6094dbb1f851145330460532176ed2f1dc70511a35828166c41e52/time_machine-3.2.0.tar.gz", hash = "sha256:a4ddd1cea17b8950e462d1805a42b20c81eb9aafc8f66b392dd5ce997e037d79", size = 14804, upload-time = "2025-12-17T23:33:02.599Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9c/31/6bf41cb4a326230518d9b76c910dfc11d4fc23444d1cbfdf2d7652bd99f4/time_machine-3.2.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:68142c070e78b62215d8029ec7394905083a4f9aacb0a2a11514ce70b5951b13", size = 19447, upload-time = "2025-12-17T23:31:30.181Z" }, + { url = "https://files.pythonhosted.org/packages/fa/14/d71ce771712e1cbfa15d8c24452225109262b16cb6caaf967e9f60662b67/time_machine-3.2.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:161bbd0648802ffdfcb4bb297ecb26b3009684a47d3a4dedb90bc549df4fa2ad", size = 15432, upload-time = "2025-12-17T23:31:31.381Z" }, + { url = "https://files.pythonhosted.org/packages/8b/d6/dcb43a11f8029561996fad58ff9d3dc5e6d7f32b74f0745a2965d7e4b4f3/time_machine-3.2.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:1359ba8c258be695ba69253bc84db882fd616fe69b426cc6056536da2c7bf68e", size = 32956, upload-time = "2025-12-17T23:31:32.469Z" }, + { url = "https://files.pythonhosted.org/packages/77/da/d802cd3c335c414f9b11b479f7459aa72df5de6485c799966cfdf8856d53/time_machine-3.2.0-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:c85b169998ca2c24a78fb214586ec11c4cad56d9c38f55ad8326235cb481c884", size = 34556, upload-time = "2025-12-17T23:31:33.946Z" }, + { url = "https://files.pythonhosted.org/packages/85/ee/51ad553514ab0b940c7c82c6e1519dd10fd06ac07b32039a1d153ef09c88/time_machine-3.2.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:65b9367cb8a10505bc8f67da0da514ba20fa816fc47e11f434f7c60350322b4c", size = 36101, upload-time = "2025-12-17T23:31:35.462Z" }, + { url = "https://files.pythonhosted.org/packages/11/39/938b111b5bb85a2b07502d0f9d8a704fc75bd760d62e76bce23c89ed16c9/time_machine-3.2.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:9faca6a0f1973d7df3233c951fc2a11ff0c54df74087d8aaf41ae3deb19d0893", size = 34905, upload-time = "2025-12-17T23:31:36.543Z" }, + { url = "https://files.pythonhosted.org/packages/dd/50/0951f73b23e76455de0b4a3a58ac5a24bd8d10489624b1c5e03f10c6fc0b/time_machine-3.2.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:213b1ada7f385d467e598999b642eda4a8e89ae10ad5dc4f5d8f672cbf604261", size = 33012, upload-time = "2025-12-17T23:31:37.967Z" }, + { url = "https://files.pythonhosted.org/packages/4f/95/5304912d3dcecc4e14ed222dbe0396352efdf8497534abc3c9edd67a7528/time_machine-3.2.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:160b6afd94c39855af04d39c58e4cf602406abd6d79427ab80e830ea71789cfb", size = 34104, upload-time = "2025-12-17T23:31:39.449Z" }, + { url = "https://files.pythonhosted.org/packages/d4/1c/af56518652ec7adac4ced193b7a42c4ff354fef28a412b3b5ffa5763aead/time_machine-3.2.0-cp310-cp310-win32.whl", hash = "sha256:c15d9ac257c78c124d112e4fc91fa9f3dcb004bdda913c19f0e7368d713cf080", size = 17468, upload-time = "2025-12-17T23:31:40.432Z" }, + { url = "https://files.pythonhosted.org/packages/48/15/0213f00ca3cf6fe1c9fdbd7fd467e801052fc85534f30c0e4684bd474190/time_machine-3.2.0-cp310-cp310-win_amd64.whl", hash = "sha256:3bf0f428487f93b8fe9d27aa01eccc817885da3290b467341b4a4a795e1d1891", size = 18313, upload-time = "2025-12-17T23:31:41.617Z" }, + { url = "https://files.pythonhosted.org/packages/77/e4/811f96aa7a634b2b264d9a476f3400e710744dda503b4ad87a5c76db32c9/time_machine-3.2.0-cp310-cp310-win_arm64.whl", hash = "sha256:347f6be2129fcd35b1c94b9387fcb2cbe7949b1e649228c5f22949a811b78976", size = 17037, upload-time = "2025-12-17T23:31:42.924Z" }, + { url = "https://files.pythonhosted.org/packages/f5/e1/03aae5fbaa53859f665094af696338fc7cae733d926a024af69982712350/time_machine-3.2.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:c188a9dda9fcf975022f1b325b466651b96a4dfc223c523ed7ed8d979f9bf3e8", size = 19143, upload-time = "2025-12-17T23:31:44.258Z" }, + { url = "https://files.pythonhosted.org/packages/75/8f/98cb17bebb52b22ff4ec26984dd44280f9c71353c3bae0640a470e6683e5/time_machine-3.2.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:17245f1cc2dd13f9d63a174be59bb2684a9e5e0a112ab707e37be92068cd655f", size = 15273, upload-time = "2025-12-17T23:31:45.246Z" }, + { url = "https://files.pythonhosted.org/packages/dd/2f/ca11e4a7897234bb9331fcc5f4ed4714481ba4012370cc79a0ae8c42ea0a/time_machine-3.2.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:d9bd1de1996e76efd36ae15970206c5089fb3728356794455bd5cd8d392b5537", size = 31049, upload-time = "2025-12-17T23:31:46.613Z" }, + { url = "https://files.pythonhosted.org/packages/cf/ad/d17d83a59943094e6b6c6a3743caaf6811b12203c3e07a30cc7bcc2ab7ee/time_machine-3.2.0-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:98493cd50e8b7f941eab69b9e18e697ad69db1a0ec1959f78f3d7b0387107e5c", size = 32632, upload-time = "2025-12-17T23:31:47.72Z" }, + { url = "https://files.pythonhosted.org/packages/71/50/d60576d047a0dfb5638cdfb335e9c3deb6e8528544fa0b3966a8480f72b7/time_machine-3.2.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:31f2a33d595d9f91eb9bc7f157f0dc5721f5789f4c4a9e8b852cdedb2a7d9b16", size = 34289, upload-time = "2025-12-17T23:31:48.913Z" }, + { url = "https://files.pythonhosted.org/packages/fa/fe/4afa602dbdebddde6d0ea4a7fe849e49b9bb85dc3fb415725a87ccb4b471/time_machine-3.2.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:9f78ac4213c10fbc44283edd1a29cfb7d3382484f4361783ddc057292aaa1889", size = 33175, upload-time = "2025-12-17T23:31:50.611Z" }, + { url = "https://files.pythonhosted.org/packages/0d/87/c152e23977c1d7d7c94eb3ed3ea45cc55971796205125c6fdff40db2c60f/time_machine-3.2.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:c1326b09e947b360926d529a96d1d9e126ce120359b63b506ecdc6ee20755c23", size = 31170, upload-time = "2025-12-17T23:31:51.645Z" }, + { url = "https://files.pythonhosted.org/packages/80/af/54acf51d0f3ade3b51eab73df6192937c9a938753ef5456dff65eb8630be/time_machine-3.2.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:9f2949f03d15264cc15c38918a2cda8966001f0f4ebe190cbfd9c56d91aed8ac", size = 32292, upload-time = "2025-12-17T23:31:52.803Z" }, + { url = "https://files.pythonhosted.org/packages/cc/bc/3745963f36e75661a807196428639327a366f4332f35f1f775c074d4062f/time_machine-3.2.0-cp311-cp311-win32.whl", hash = "sha256:6dfe48e0499e6e16751476b9799e67be7514e6ef04cdf39571ef95a279645831", size = 17349, upload-time = "2025-12-17T23:31:54.19Z" }, + { url = "https://files.pythonhosted.org/packages/82/a2/057469232a99d1f5a0160ae7c5bae7b095c9168b333dd598fcbcfbc1c87b/time_machine-3.2.0-cp311-cp311-win_amd64.whl", hash = "sha256:809bdf267a29189c304154873620fe0bcc0c9513295fa46b19e21658231c4915", size = 18191, upload-time = "2025-12-17T23:31:55.472Z" }, + { url = "https://files.pythonhosted.org/packages/79/d8/bf9c8de57262ee7130d92a6ed49ed6a6e40a36317e46979428d373630c12/time_machine-3.2.0-cp311-cp311-win_arm64.whl", hash = "sha256:a3f4c17fa90f54902a3f8692c75caf67be87edc3429eeb71cb4595da58198f8e", size = 16905, upload-time = "2025-12-17T23:31:56.658Z" }, + { url = "https://files.pythonhosted.org/packages/71/8b/080c8eedcd67921a52ba5bd0e075362062509ab63c86fc1a0442fad241a6/time_machine-3.2.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:cc4bee5b0214d7dc4ebc91f4a4c600f1a598e9b5606ac751f42cb6f6740b1dbb", size = 19255, upload-time = "2025-12-17T23:31:58.057Z" }, + { url = "https://files.pythonhosted.org/packages/66/17/0e5291e9eb705bf8a5a1305f826e979af307bbeb79def4ddbf4b3f9a81e0/time_machine-3.2.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:3ca036304b4460ae2fdc1b52dd8b1fa7cf1464daa427fc49567413c09aa839c1", size = 15360, upload-time = "2025-12-17T23:31:59.048Z" }, + { url = "https://files.pythonhosted.org/packages/8b/e8/9ab87b71d2e2b62463b9b058b7ae7ac09fb57f8fcd88729dec169d304340/time_machine-3.2.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5442735b41d7a2abc2f04579b4ca6047ed4698a8338a4fec92c7c9423e7938cb", size = 33029, upload-time = "2025-12-17T23:32:00.413Z" }, + { url = "https://files.pythonhosted.org/packages/4b/26/b5ca19da6f25ea905b3e10a0ea95d697c1aeba0404803a43c68f1af253e6/time_machine-3.2.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:97da3e971e505cb637079fb07ab0bcd36e33279f8ecac888ff131f45ef1e4d8d", size = 34579, upload-time = "2025-12-17T23:32:01.431Z" }, + { url = "https://files.pythonhosted.org/packages/79/ca/6ac7ad5f10ea18cc1d9de49716ba38c32132c7b64532430d92ef240c116b/time_machine-3.2.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3cdda6dee4966e38aeb487309bb414c6cb23a81fc500291c77a8fcd3098832e7", size = 35961, upload-time = "2025-12-17T23:32:02.521Z" }, + { url = "https://files.pythonhosted.org/packages/33/67/390dd958bed395ab32d79a9fe61fe111825c0dd4ded54dbba7e867f171e6/time_machine-3.2.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:33d9efd302a6998bcc8baa4d84f259f8a4081105bd3d7f7af7f1d0abd3b1c8aa", size = 34668, upload-time = "2025-12-17T23:32:03.585Z" }, + { url = "https://files.pythonhosted.org/packages/da/57/c88fff034a4e9538b3ae7c68c9cfb283670b14d17522c5a8bc17d29f9a4b/time_machine-3.2.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:3a0b0a33971f14145853c9bd95a6ab0353cf7e0019fa2a7aa1ae9fddfe8eab50", size = 32891, upload-time = "2025-12-17T23:32:04.656Z" }, + { url = "https://files.pythonhosted.org/packages/2d/70/ebbb76022dba0fec8f9156540fc647e4beae1680c787c01b1b6200e56d70/time_machine-3.2.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:2d0be9e5f22c38082d247a2cdcd8a936504e9db60b7b3606855fb39f299e9548", size = 34080, upload-time = "2025-12-17T23:32:06.146Z" }, + { url = "https://files.pythonhosted.org/packages/db/9a/2ca9e7af3df540dc1c79e3de588adeddb7dcc2107829248e6969c4f14167/time_machine-3.2.0-cp312-cp312-win32.whl", hash = "sha256:3f74623648b936fdce5f911caf386c0a0b579456410975de8c0dfeaaffece1d8", size = 17371, upload-time = "2025-12-17T23:32:07.164Z" }, + { url = "https://files.pythonhosted.org/packages/d8/ce/21d23efc9c2151939af1b7ee4e60d86d661b74ef32b8eaa148f6fe8c899c/time_machine-3.2.0-cp312-cp312-win_amd64.whl", hash = "sha256:34e26a41d994b5e4b205136a90e9578470386749cc9a2ecf51ca18f83ce25e23", size = 18132, upload-time = "2025-12-17T23:32:08.447Z" }, + { url = "https://files.pythonhosted.org/packages/2f/34/c2b70be483accf6db9e5d6c3139bce3c38fe51f898ccf64e8d3fe14fbf4d/time_machine-3.2.0-cp312-cp312-win_arm64.whl", hash = "sha256:0615d3d82c418d6293f271c348945c5091a71f37e37173653d5c26d0e74b13a8", size = 16930, upload-time = "2025-12-17T23:32:09.477Z" }, + { url = "https://files.pythonhosted.org/packages/ee/cd/43ad5efc88298af3c59b66769cea7f055567a85071579ed40536188530c1/time_machine-3.2.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:c421a8eb85a4418a7675a41bf8660224318c46cc62e4751c8f1ceca752059090", size = 19318, upload-time = "2025-12-17T23:32:10.518Z" }, + { url = "https://files.pythonhosted.org/packages/b0/f6/084010ef7f4a3f38b5a4900923d7c85b29e797655c4f6ee4ce54d903cca8/time_machine-3.2.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:8f4e758f7727d0058c4950c66b58200c187072122d6f7a98b610530a4233ea7b", size = 15390, upload-time = "2025-12-17T23:32:11.625Z" }, + { url = "https://files.pythonhosted.org/packages/25/aa/1cabb74134f492270dc6860cb7865859bf40ecf828be65972827646e91ad/time_machine-3.2.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:154bd3f75c81f70218b2585cc12b60762fb2665c507eec5ec5037d8756d9b4e0", size = 33115, upload-time = "2025-12-17T23:32:13.219Z" }, + { url = "https://files.pythonhosted.org/packages/5e/03/78c5d7dfa366924eb4dbfcc3fc917c39a4280ca234b12819cc1f16c03d88/time_machine-3.2.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:d50cfe5ebea422c896ad8d278af9648412b7533b8ea6adeeee698a3fd9b1d3b7", size = 34705, upload-time = "2025-12-17T23:32:14.29Z" }, + { url = "https://files.pythonhosted.org/packages/86/93/d5e877c24541f674c6869ff6e9c56833369796010190252e92c9d7ae5f0f/time_machine-3.2.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:636576501724bd6a9124e69d86e5aef263479e89ef739c5db361469f0463a0a1", size = 36104, upload-time = "2025-12-17T23:32:15.354Z" }, + { url = "https://files.pythonhosted.org/packages/22/1c/d4bae72f388f67efc9609f89b012e434bb19d9549c7a7b47d6c7d9e5c55d/time_machine-3.2.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:40e6f40c57197fcf7ec32d2c563f4df0a82c42cdcc3cab27f688e98f6060df10", size = 34765, upload-time = "2025-12-17T23:32:16.434Z" }, + { url = "https://files.pythonhosted.org/packages/1d/c3/ac378cf301d527d8dfad2f0db6bad0dfb1ab73212eaa56d6b96ee5d9d20b/time_machine-3.2.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:a1bcf0b846bbfc19a79bc19e3fa04d8c7b1e8101c1b70340ffdb689cd801ea53", size = 33010, upload-time = "2025-12-17T23:32:17.532Z" }, + { url = "https://files.pythonhosted.org/packages/06/35/7ce897319accda7a6970b288a9a8c52d25227342a7508505a2b3d235b649/time_machine-3.2.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ae55a56c179f4fe7a62575ad5148b6ed82f6c7e5cf2f9a9ec65f2f5b067db5f5", size = 34185, upload-time = "2025-12-17T23:32:18.566Z" }, + { url = "https://files.pythonhosted.org/packages/bf/28/f922022269749cb02eee2b62919671153c4088994fa955a6b0e50327ff81/time_machine-3.2.0-cp313-cp313-win32.whl", hash = "sha256:a66fe55a107e46916007a391d4030479df8864ec6ad6f6a6528221befc5c886e", size = 17397, upload-time = "2025-12-17T23:32:19.605Z" }, + { url = "https://files.pythonhosted.org/packages/ee/dc/fd87cde397f4a7bea493152f0aca8fd569ec709cad9e0f2ca7011eb8c7f7/time_machine-3.2.0-cp313-cp313-win_amd64.whl", hash = "sha256:30c9ce57165df913e4f74e285a8ab829ff9b7aa3e5ec0973f88f642b9a7b3d15", size = 18139, upload-time = "2025-12-17T23:32:20.991Z" }, + { url = "https://files.pythonhosted.org/packages/75/81/b8ce58233addc5d7d54d2fabc49dcbc02d79e3f079d150aa1bec3d5275ef/time_machine-3.2.0-cp313-cp313-win_arm64.whl", hash = "sha256:89cad7e179e9bdcc84dcf09efe52af232c4cc7a01b3de868356bbd59d95bd9b8", size = 16964, upload-time = "2025-12-17T23:32:22.075Z" }, + { url = "https://files.pythonhosted.org/packages/67/e7/487f0ba5fe6c58186a5e1af2a118dfa2c160fedb37ef53a7e972d410408e/time_machine-3.2.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:59d71545e62525a4b85b6de9ab5c02ee3c61110fd7f636139914a2335dcbfc9c", size = 20000, upload-time = "2025-12-17T23:32:23.058Z" }, + { url = "https://files.pythonhosted.org/packages/e1/17/eb2c0054c8d44dd42df84ccd434539249a9c7d0b8eb53f799be2102500ab/time_machine-3.2.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:999672c621c35362bc28e03ca0c7df21500195540773c25993421fd8d6cc5003", size = 15657, upload-time = "2025-12-17T23:32:24.125Z" }, + { url = "https://files.pythonhosted.org/packages/43/21/93443b5d1dd850f8bb9442e90d817a9033dcce6bfbdd3aabbb9786251c80/time_machine-3.2.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5faf7397f0580c7b9d67288522c8d7863e85f0cffadc0f1fccdb2c3dfce5783e", size = 39216, upload-time = "2025-12-17T23:32:25.542Z" }, + { url = "https://files.pythonhosted.org/packages/9f/9e/18544cf8acc72bb1dc03762231c82ecc259733f4bb6770a7bbe5cd138603/time_machine-3.2.0-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:d3dd886ec49f1fa5a00e844f5947e5c0f98ce574750c24b7424c6f77fc1c3e87", size = 40764, upload-time = "2025-12-17T23:32:26.643Z" }, + { url = "https://files.pythonhosted.org/packages/27/f7/9fe9ce2795636a3a7467307af6bdf38bb613ddb701a8a5cd50ec713beb5e/time_machine-3.2.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:da0ecd96bc7bbe450acaaabe569d84e81688f1be8ad58d1470e42371d145fb53", size = 43526, upload-time = "2025-12-17T23:32:27.693Z" }, + { url = "https://files.pythonhosted.org/packages/03/c1/a93e975ba9dec22e87ec92d18c28e67d36bd536f9119ffa439b2892b0c9c/time_machine-3.2.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:158220e946c1c4fb8265773a0282c88c35a7e3bb5d78e3561214e3b3231166f3", size = 41727, upload-time = "2025-12-17T23:32:28.985Z" }, + { url = "https://files.pythonhosted.org/packages/5f/fb/e3633e5a6bbed1c76bb2e9810dabc2f8467532ffcd29b9aed404b473061a/time_machine-3.2.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:8c1aee29bc54356f248d5d7dfdd131e12ca825e850a08c0ebdb022266d073013", size = 38952, upload-time = "2025-12-17T23:32:30.031Z" }, + { url = "https://files.pythonhosted.org/packages/82/3d/02e9fb2526b3d6b1b45bc8e4d912d95d1cd699d1a3f6df985817d37a0600/time_machine-3.2.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:c8ed2224f09d25b1c2fc98683613aca12f90f682a427eabb68fc824d27014e4a", size = 39829, upload-time = "2025-12-17T23:32:31.075Z" }, + { url = "https://files.pythonhosted.org/packages/85/c8/c14265212436da8e0814c45463987b3f57de3eca4de023cc2eabb0c62ef3/time_machine-3.2.0-cp313-cp313t-win32.whl", hash = "sha256:3498719f8dab51da76d29a20c1b5e52ee7db083dddf3056af7fa69c1b94e1fe6", size = 17852, upload-time = "2025-12-17T23:32:32.079Z" }, + { url = "https://files.pythonhosted.org/packages/1d/bc/8acb13cf6149f47508097b158a9a8bec9ec4530a70cb406124e8023581f5/time_machine-3.2.0-cp313-cp313t-win_amd64.whl", hash = "sha256:e0d90bee170b219e1d15e6a58164aa808f5170090e4f090bd0670303e34181b1", size = 18918, upload-time = "2025-12-17T23:32:33.106Z" }, + { url = "https://files.pythonhosted.org/packages/24/87/c443ee508c2708fd2514ccce9052f5e48888783ce690506919629ebc8eb0/time_machine-3.2.0-cp313-cp313t-win_arm64.whl", hash = "sha256:051de220fdb6e20d648111bbad423d9506fdbb2e44d4429cef3dc0382abf1fc2", size = 17261, upload-time = "2025-12-17T23:32:34.446Z" }, + { url = "https://files.pythonhosted.org/packages/61/70/b4b980d126ed155c78d1879c50d60c8dcbd47bd11cb14ee7be50e0dfc07f/time_machine-3.2.0-cp314-cp314-macosx_10_15_universal2.whl", hash = "sha256:1398980c017fe5744d66f419e0115ee48a53b00b146d738e1416c225eb610b82", size = 19303, upload-time = "2025-12-17T23:32:35.796Z" }, + { url = "https://files.pythonhosted.org/packages/73/73/eaa33603c69a68fe2b6f54f9dd75481693d62f1d29676531002be06e2d1c/time_machine-3.2.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:4f8f4e35f4191ef70c2ab8ff490761ee9051b891afce2bf86dde3918eb7b537b", size = 15431, upload-time = "2025-12-17T23:32:37.244Z" }, + { url = "https://files.pythonhosted.org/packages/76/10/b81e138e86cc7bab40cdb59d294b341e172201f4a6c84bb0ec080407977a/time_machine-3.2.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:6db498686ecf6163c5aa8cf0bcd57bbe0f4081184f247edf3ee49a2612b584f9", size = 33206, upload-time = "2025-12-17T23:32:38.713Z" }, + { url = "https://files.pythonhosted.org/packages/d3/72/4deab446b579e8bd5dca91de98595c5d6bd6a17ce162abf5c5f2ce40d3d8/time_machine-3.2.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:027c1807efb74d0cd58ad16524dec94212fbe900115d70b0123399883657ac0f", size = 34792, upload-time = "2025-12-17T23:32:40.223Z" }, + { url = "https://files.pythonhosted.org/packages/2c/39/439c6b587ddee76d533fe972289d0646e0a5520e14dc83d0a30aeb5565f7/time_machine-3.2.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:92432610c05676edd5e6946a073c6f0c926923123ce7caee1018dc10782c713d", size = 36187, upload-time = "2025-12-17T23:32:41.705Z" }, + { url = "https://files.pythonhosted.org/packages/4b/db/2da4368db15180989bab83746a857bde05ad16e78f326801c142bb747a06/time_machine-3.2.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:c25586b62480eb77ef3d953fba273209478e1ef49654592cd6a52a68dfe56a67", size = 34855, upload-time = "2025-12-17T23:32:42.817Z" }, + { url = "https://files.pythonhosted.org/packages/88/84/120a431fee50bc4c241425bee4d3a4910df4923b7ab5f7dff1bf0c772f08/time_machine-3.2.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:6bf3a2fa738d15e0b95d14469a0b8ea42635467408d8b490e263d5d45c9a177f", size = 33222, upload-time = "2025-12-17T23:32:43.94Z" }, + { url = "https://files.pythonhosted.org/packages/f9/ea/89cfda82bb8c57ff91bb9a26751aa234d6d90e9b4d5ab0ad9dce0f9f0329/time_machine-3.2.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:ce76b82276d7ad2a66cdc85dad4df19d1422b69183170a34e8fbc4c3f35502f7", size = 34270, upload-time = "2025-12-17T23:32:45.037Z" }, + { url = "https://files.pythonhosted.org/packages/8a/aa/235357da4f69a51a8d35fcbfcfa77cdc7dc24f62ae54025006570bda7e2d/time_machine-3.2.0-cp314-cp314-win32.whl", hash = "sha256:14d6778273c543441863dff712cd1d7803dee946b18de35921eb8df10714539d", size = 17544, upload-time = "2025-12-17T23:32:46.099Z" }, + { url = "https://files.pythonhosted.org/packages/7b/51/6c8405a7276be79693b792cff22ce41067ec05db26a7d02f2d5b06324434/time_machine-3.2.0-cp314-cp314-win_amd64.whl", hash = "sha256:cbf821da96dbc80d349fa9e7c36e670b41d68a878d28c8850057992fed430eef", size = 18423, upload-time = "2025-12-17T23:32:47.468Z" }, + { url = "https://files.pythonhosted.org/packages/d9/03/a3cf419e20c35fc203c6e4fed48b5b667c1a2b4da456d9971e605f73ecef/time_machine-3.2.0-cp314-cp314-win_arm64.whl", hash = "sha256:71c75d71f8e68abc8b669bca26ed2ddd558430a6c171e32b8620288565f18c0e", size = 17050, upload-time = "2025-12-17T23:32:48.91Z" }, + { url = "https://files.pythonhosted.org/packages/86/a1/142de946dc4393f910bf4564b5c3ba819906e1f49b06c9cb557519c849e4/time_machine-3.2.0-cp314-cp314t-macosx_10_15_universal2.whl", hash = "sha256:4e374779021446fc2b5c29d80457ec9a3b1a5df043dc2aae07d7c1415d52323c", size = 19991, upload-time = "2025-12-17T23:32:49.933Z" }, + { url = "https://files.pythonhosted.org/packages/ee/62/7f17def6289901f94726921811a16b9adce46e666362c75d45730c60274f/time_machine-3.2.0-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:122310a6af9c36e9a636da32830e591e7923e8a07bdd0a43276c3a36c6821c90", size = 15707, upload-time = "2025-12-17T23:32:50.969Z" }, + { url = "https://files.pythonhosted.org/packages/5d/d3/3502fb9bd3acb159c18844b26c43220201a0d4a622c0c853785d07699a92/time_machine-3.2.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:ba3eeb0f018cc362dd8128befa3426696a2e16dd223c3fb695fde184892d4d8c", size = 39207, upload-time = "2025-12-17T23:32:52.033Z" }, + { url = "https://files.pythonhosted.org/packages/5a/be/8b27f4aa296fda14a5a2ad7f588ddd450603c33415ab3f8e85b2f1a44678/time_machine-3.2.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:77d38ba664b381a7793f8786efc13b5004f0d5f672dae814430445b8202a67a6", size = 40764, upload-time = "2025-12-17T23:32:53.167Z" }, + { url = "https://files.pythonhosted.org/packages/42/cd/fe4c4e5c8ab6d48fab3624c32be9116fb120173a35fe67e482e5cf68b3d2/time_machine-3.2.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f09abeb8f03f044d72712207e0489a62098ad3ad16dac38927fcf80baca4d6a7", size = 43508, upload-time = "2025-12-17T23:32:54.597Z" }, + { url = "https://files.pythonhosted.org/packages/b4/28/5a3ba2fce85b97655a425d6bb20a441550acd2b304c96b2c19d3839f721a/time_machine-3.2.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:6b28367ce4f73987a55e230e1d30a57a3af85da8eb1a140074eb6e8c7e6ef19f", size = 41712, upload-time = "2025-12-17T23:32:55.781Z" }, + { url = "https://files.pythonhosted.org/packages/81/58/e38084be7fdabb4835db68a3a47e58c34182d79fc35df1ecbe0db2c5359f/time_machine-3.2.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:903c7751c904581da9f7861c3015bed7cdc40047321291d3694a3cdc783bbca3", size = 38939, upload-time = "2025-12-17T23:32:56.867Z" }, + { url = "https://files.pythonhosted.org/packages/40/d0/ad3feb0a392ef4e0c08bc32024950373ddc0669002cbdcbb9f3bf0c2d114/time_machine-3.2.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:528217cad85ede5f85c8bc78b0341868d3c3cfefc6ecb5b622e1cacb6c73247b", size = 39837, upload-time = "2025-12-17T23:32:58.283Z" }, + { url = "https://files.pythonhosted.org/packages/5b/9e/5f4b2ea63b267bd78f3245e76f5528836611b5f2d30b5e7300a722fe4428/time_machine-3.2.0-cp314-cp314t-win32.whl", hash = "sha256:75724762ffd517e7e80aaec1fad1ff5a7414bd84e2b3ee7a0bacfeb67c14926e", size = 18091, upload-time = "2025-12-17T23:32:59.403Z" }, + { url = "https://files.pythonhosted.org/packages/39/6f/456b1f4d2700ae02b19eba830f870596a4b89b74bac3b6c80666f1b108c5/time_machine-3.2.0-cp314-cp314t-win_amd64.whl", hash = "sha256:2526abbd053c5bca898d1b3e7898eec34626b12206718d8c7ce88fd12c1c9c5c", size = 19208, upload-time = "2025-12-17T23:33:00.488Z" }, + { url = "https://files.pythonhosted.org/packages/2f/22/8063101427ecd3d2652aada4d21d0876b07a3dc789125bca2ee858fec3ed/time_machine-3.2.0-cp314-cp314t-win_arm64.whl", hash = "sha256:7f2fb6784b414edbe2c0b558bfaab0c251955ba27edd62946cce4a01675a992c", size = 17359, upload-time = "2025-12-17T23:33:01.54Z" }, +] + +[[package]] +name = "tomli" +version = "2.4.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/82/30/31573e9457673ab10aa432461bee537ce6cef177667deca369efb79df071/tomli-2.4.0.tar.gz", hash = "sha256:aa89c3f6c277dd275d8e243ad24f3b5e701491a860d5121f2cdd399fbb31fc9c", size = 17477, upload-time = "2026-01-11T11:22:38.165Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3c/d9/3dc2289e1f3b32eb19b9785b6a006b28ee99acb37d1d47f78d4c10e28bf8/tomli-2.4.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:b5ef256a3fd497d4973c11bf142e9ed78b150d36f5773f1ca6088c230ffc5867", size = 153663, upload-time = "2026-01-11T11:21:45.27Z" }, + { url = "https://files.pythonhosted.org/packages/51/32/ef9f6845e6b9ca392cd3f64f9ec185cc6f09f0a2df3db08cbe8809d1d435/tomli-2.4.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:5572e41282d5268eb09a697c89a7bee84fae66511f87533a6f88bd2f7b652da9", size = 148469, upload-time = "2026-01-11T11:21:46.873Z" }, + { url = "https://files.pythonhosted.org/packages/d6/c2/506e44cce89a8b1b1e047d64bd495c22c9f71f21e05f380f1a950dd9c217/tomli-2.4.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:551e321c6ba03b55676970b47cb1b73f14a0a4dce6a3e1a9458fd6d921d72e95", size = 236039, upload-time = "2026-01-11T11:21:48.503Z" }, + { url = "https://files.pythonhosted.org/packages/b3/40/e1b65986dbc861b7e986e8ec394598187fa8aee85b1650b01dd925ca0be8/tomli-2.4.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5e3f639a7a8f10069d0e15408c0b96a2a828cfdec6fca05296ebcdcc28ca7c76", size = 243007, upload-time = "2026-01-11T11:21:49.456Z" }, + { url = "https://files.pythonhosted.org/packages/9c/6f/6e39ce66b58a5b7ae572a0f4352ff40c71e8573633deda43f6a379d56b3e/tomli-2.4.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1b168f2731796b045128c45982d3a4874057626da0e2ef1fdd722848b741361d", size = 240875, upload-time = "2026-01-11T11:21:50.755Z" }, + { url = "https://files.pythonhosted.org/packages/aa/ad/cb089cb190487caa80204d503c7fd0f4d443f90b95cf4ef5cf5aa0f439b0/tomli-2.4.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:133e93646ec4300d651839d382d63edff11d8978be23da4cc106f5a18b7d0576", size = 246271, upload-time = "2026-01-11T11:21:51.81Z" }, + { url = "https://files.pythonhosted.org/packages/0b/63/69125220e47fd7a3a27fd0de0c6398c89432fec41bc739823bcc66506af6/tomli-2.4.0-cp311-cp311-win32.whl", hash = "sha256:b6c78bdf37764092d369722d9946cb65b8767bfa4110f902a1b2542d8d173c8a", size = 96770, upload-time = "2026-01-11T11:21:52.647Z" }, + { url = "https://files.pythonhosted.org/packages/1e/0d/a22bb6c83f83386b0008425a6cd1fa1c14b5f3dd4bad05e98cf3dbbf4a64/tomli-2.4.0-cp311-cp311-win_amd64.whl", hash = "sha256:d3d1654e11d724760cdb37a3d7691f0be9db5fbdaef59c9f532aabf87006dbaa", size = 107626, upload-time = "2026-01-11T11:21:53.459Z" }, + { url = "https://files.pythonhosted.org/packages/2f/6d/77be674a3485e75cacbf2ddba2b146911477bd887dda9d8c9dfb2f15e871/tomli-2.4.0-cp311-cp311-win_arm64.whl", hash = "sha256:cae9c19ed12d4e8f3ebf46d1a75090e4c0dc16271c5bce1c833ac168f08fb614", size = 94842, upload-time = "2026-01-11T11:21:54.831Z" }, + { url = "https://files.pythonhosted.org/packages/3c/43/7389a1869f2f26dba52404e1ef13b4784b6b37dac93bac53457e3ff24ca3/tomli-2.4.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:920b1de295e72887bafa3ad9f7a792f811847d57ea6b1215154030cf131f16b1", size = 154894, upload-time = "2026-01-11T11:21:56.07Z" }, + { url = "https://files.pythonhosted.org/packages/e9/05/2f9bf110b5294132b2edf13fe6ca6ae456204f3d749f623307cbb7a946f2/tomli-2.4.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:7d6d9a4aee98fac3eab4952ad1d73aee87359452d1c086b5ceb43ed02ddb16b8", size = 149053, upload-time = "2026-01-11T11:21:57.467Z" }, + { url = "https://files.pythonhosted.org/packages/e8/41/1eda3ca1abc6f6154a8db4d714a4d35c4ad90adc0bcf700657291593fbf3/tomli-2.4.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:36b9d05b51e65b254ea6c2585b59d2c4cb91c8a3d91d0ed0f17591a29aaea54a", size = 243481, upload-time = "2026-01-11T11:21:58.661Z" }, + { url = "https://files.pythonhosted.org/packages/d2/6d/02ff5ab6c8868b41e7d4b987ce2b5f6a51d3335a70aa144edd999e055a01/tomli-2.4.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1c8a885b370751837c029ef9bc014f27d80840e48bac415f3412e6593bbc18c1", size = 251720, upload-time = "2026-01-11T11:22:00.178Z" }, + { url = "https://files.pythonhosted.org/packages/7b/57/0405c59a909c45d5b6f146107c6d997825aa87568b042042f7a9c0afed34/tomli-2.4.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:8768715ffc41f0008abe25d808c20c3d990f42b6e2e58305d5da280ae7d1fa3b", size = 247014, upload-time = "2026-01-11T11:22:01.238Z" }, + { url = "https://files.pythonhosted.org/packages/2c/0e/2e37568edd944b4165735687cbaf2fe3648129e440c26d02223672ee0630/tomli-2.4.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:7b438885858efd5be02a9a133caf5812b8776ee0c969fea02c45e8e3f296ba51", size = 251820, upload-time = "2026-01-11T11:22:02.727Z" }, + { url = "https://files.pythonhosted.org/packages/5a/1c/ee3b707fdac82aeeb92d1a113f803cf6d0f37bdca0849cb489553e1f417a/tomli-2.4.0-cp312-cp312-win32.whl", hash = "sha256:0408e3de5ec77cc7f81960c362543cbbd91ef883e3138e81b729fc3eea5b9729", size = 97712, upload-time = "2026-01-11T11:22:03.777Z" }, + { url = "https://files.pythonhosted.org/packages/69/13/c07a9177d0b3bab7913299b9278845fc6eaaca14a02667c6be0b0a2270c8/tomli-2.4.0-cp312-cp312-win_amd64.whl", hash = "sha256:685306e2cc7da35be4ee914fd34ab801a6acacb061b6a7abca922aaf9ad368da", size = 108296, upload-time = "2026-01-11T11:22:04.86Z" }, + { url = "https://files.pythonhosted.org/packages/18/27/e267a60bbeeee343bcc279bb9e8fbed0cbe224bc7b2a3dc2975f22809a09/tomli-2.4.0-cp312-cp312-win_arm64.whl", hash = "sha256:5aa48d7c2356055feef06a43611fc401a07337d5b006be13a30f6c58f869e3c3", size = 94553, upload-time = "2026-01-11T11:22:05.854Z" }, + { url = "https://files.pythonhosted.org/packages/34/91/7f65f9809f2936e1f4ce6268ae1903074563603b2a2bd969ebbda802744f/tomli-2.4.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:84d081fbc252d1b6a982e1870660e7330fb8f90f676f6e78b052ad4e64714bf0", size = 154915, upload-time = "2026-01-11T11:22:06.703Z" }, + { url = "https://files.pythonhosted.org/packages/20/aa/64dd73a5a849c2e8f216b755599c511badde80e91e9bc2271baa7b2cdbb1/tomli-2.4.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:9a08144fa4cba33db5255f9b74f0b89888622109bd2776148f2597447f92a94e", size = 149038, upload-time = "2026-01-11T11:22:07.56Z" }, + { url = "https://files.pythonhosted.org/packages/9e/8a/6d38870bd3d52c8d1505ce054469a73f73a0fe62c0eaf5dddf61447e32fa/tomli-2.4.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c73add4bb52a206fd0c0723432db123c0c75c280cbd67174dd9d2db228ebb1b4", size = 242245, upload-time = "2026-01-11T11:22:08.344Z" }, + { url = "https://files.pythonhosted.org/packages/59/bb/8002fadefb64ab2669e5b977df3f5e444febea60e717e755b38bb7c41029/tomli-2.4.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1fb2945cbe303b1419e2706e711b7113da57b7db31ee378d08712d678a34e51e", size = 250335, upload-time = "2026-01-11T11:22:09.951Z" }, + { url = "https://files.pythonhosted.org/packages/a5/3d/4cdb6f791682b2ea916af2de96121b3cb1284d7c203d97d92d6003e91c8d/tomli-2.4.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:bbb1b10aa643d973366dc2cb1ad94f99c1726a02343d43cbc011edbfac579e7c", size = 245962, upload-time = "2026-01-11T11:22:11.27Z" }, + { url = "https://files.pythonhosted.org/packages/f2/4a/5f25789f9a460bd858ba9756ff52d0830d825b458e13f754952dd15fb7bb/tomli-2.4.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:4cbcb367d44a1f0c2be408758b43e1ffb5308abe0ea222897d6bfc8e8281ef2f", size = 250396, upload-time = "2026-01-11T11:22:12.325Z" }, + { url = "https://files.pythonhosted.org/packages/aa/2f/b73a36fea58dfa08e8b3a268750e6853a6aac2a349241a905ebd86f3047a/tomli-2.4.0-cp313-cp313-win32.whl", hash = "sha256:7d49c66a7d5e56ac959cb6fc583aff0651094ec071ba9ad43df785abc2320d86", size = 97530, upload-time = "2026-01-11T11:22:13.865Z" }, + { url = "https://files.pythonhosted.org/packages/3b/af/ca18c134b5d75de7e8dc551c5234eaba2e8e951f6b30139599b53de9c187/tomli-2.4.0-cp313-cp313-win_amd64.whl", hash = "sha256:3cf226acb51d8f1c394c1b310e0e0e61fecdd7adcb78d01e294ac297dd2e7f87", size = 108227, upload-time = "2026-01-11T11:22:15.224Z" }, + { url = "https://files.pythonhosted.org/packages/22/c3/b386b832f209fee8073c8138ec50f27b4460db2fdae9ffe022df89a57f9b/tomli-2.4.0-cp313-cp313-win_arm64.whl", hash = "sha256:d20b797a5c1ad80c516e41bc1fb0443ddb5006e9aaa7bda2d71978346aeb9132", size = 94748, upload-time = "2026-01-11T11:22:16.009Z" }, + { url = "https://files.pythonhosted.org/packages/f3/c4/84047a97eb1004418bc10bdbcfebda209fca6338002eba2dc27cc6d13563/tomli-2.4.0-cp314-cp314-macosx_10_15_x86_64.whl", hash = "sha256:26ab906a1eb794cd4e103691daa23d95c6919cc2fa9160000ac02370cc9dd3f6", size = 154725, upload-time = "2026-01-11T11:22:17.269Z" }, + { url = "https://files.pythonhosted.org/packages/a8/5d/d39038e646060b9d76274078cddf146ced86dc2b9e8bbf737ad5983609a0/tomli-2.4.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:20cedb4ee43278bc4f2fee6cb50daec836959aadaf948db5172e776dd3d993fc", size = 148901, upload-time = "2026-01-11T11:22:18.287Z" }, + { url = "https://files.pythonhosted.org/packages/73/e5/383be1724cb30f4ce44983d249645684a48c435e1cd4f8b5cded8a816d3c/tomli-2.4.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:39b0b5d1b6dd03684b3fb276407ebed7090bbec989fa55838c98560c01113b66", size = 243375, upload-time = "2026-01-11T11:22:19.154Z" }, + { url = "https://files.pythonhosted.org/packages/31/f0/bea80c17971c8d16d3cc109dc3585b0f2ce1036b5f4a8a183789023574f2/tomli-2.4.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a26d7ff68dfdb9f87a016ecfd1e1c2bacbe3108f4e0f8bcd2228ef9a766c787d", size = 250639, upload-time = "2026-01-11T11:22:20.168Z" }, + { url = "https://files.pythonhosted.org/packages/2c/8f/2853c36abbb7608e3f945d8a74e32ed3a74ee3a1f468f1ffc7d1cb3abba6/tomli-2.4.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:20ffd184fb1df76a66e34bd1b36b4a4641bd2b82954befa32fe8163e79f1a702", size = 246897, upload-time = "2026-01-11T11:22:21.544Z" }, + { url = "https://files.pythonhosted.org/packages/49/f0/6c05e3196ed5337b9fe7ea003e95fd3819a840b7a0f2bf5a408ef1dad8ed/tomli-2.4.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:75c2f8bbddf170e8effc98f5e9084a8751f8174ea6ccf4fca5398436e0320bc8", size = 254697, upload-time = "2026-01-11T11:22:23.058Z" }, + { url = "https://files.pythonhosted.org/packages/f3/f5/2922ef29c9f2951883525def7429967fc4d8208494e5ab524234f06b688b/tomli-2.4.0-cp314-cp314-win32.whl", hash = "sha256:31d556d079d72db7c584c0627ff3a24c5d3fb4f730221d3444f3efb1b2514776", size = 98567, upload-time = "2026-01-11T11:22:24.033Z" }, + { url = "https://files.pythonhosted.org/packages/7b/31/22b52e2e06dd2a5fdbc3ee73226d763b184ff21fc24e20316a44ccc4d96b/tomli-2.4.0-cp314-cp314-win_amd64.whl", hash = "sha256:43e685b9b2341681907759cf3a04e14d7104b3580f808cfde1dfdb60ada85475", size = 108556, upload-time = "2026-01-11T11:22:25.378Z" }, + { url = "https://files.pythonhosted.org/packages/48/3d/5058dff3255a3d01b705413f64f4306a141a8fd7a251e5a495e3f192a998/tomli-2.4.0-cp314-cp314-win_arm64.whl", hash = "sha256:3d895d56bd3f82ddd6faaff993c275efc2ff38e52322ea264122d72729dca2b2", size = 96014, upload-time = "2026-01-11T11:22:26.138Z" }, + { url = "https://files.pythonhosted.org/packages/b8/4e/75dab8586e268424202d3a1997ef6014919c941b50642a1682df43204c22/tomli-2.4.0-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:5b5807f3999fb66776dbce568cc9a828544244a8eb84b84b9bafc080c99597b9", size = 163339, upload-time = "2026-01-11T11:22:27.143Z" }, + { url = "https://files.pythonhosted.org/packages/06/e3/b904d9ab1016829a776d97f163f183a48be6a4deb87304d1e0116a349519/tomli-2.4.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:c084ad935abe686bd9c898e62a02a19abfc9760b5a79bc29644463eaf2840cb0", size = 159490, upload-time = "2026-01-11T11:22:28.399Z" }, + { url = "https://files.pythonhosted.org/packages/e3/5a/fc3622c8b1ad823e8ea98a35e3c632ee316d48f66f80f9708ceb4f2a0322/tomli-2.4.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0f2e3955efea4d1cfbcb87bc321e00dc08d2bcb737fd1d5e398af111d86db5df", size = 269398, upload-time = "2026-01-11T11:22:29.345Z" }, + { url = "https://files.pythonhosted.org/packages/fd/33/62bd6152c8bdd4c305ad9faca48f51d3acb2df1f8791b1477d46ff86e7f8/tomli-2.4.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0e0fe8a0b8312acf3a88077a0802565cb09ee34107813bba1c7cd591fa6cfc8d", size = 276515, upload-time = "2026-01-11T11:22:30.327Z" }, + { url = "https://files.pythonhosted.org/packages/4b/ff/ae53619499f5235ee4211e62a8d7982ba9e439a0fb4f2f351a93d67c1dd2/tomli-2.4.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:413540dce94673591859c4c6f794dfeaa845e98bf35d72ed59636f869ef9f86f", size = 273806, upload-time = "2026-01-11T11:22:32.56Z" }, + { url = "https://files.pythonhosted.org/packages/47/71/cbca7787fa68d4d0a9f7072821980b39fbb1b6faeb5f5cf02f4a5559fa28/tomli-2.4.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:0dc56fef0e2c1c470aeac5b6ca8cc7b640bb93e92d9803ddaf9ea03e198f5b0b", size = 281340, upload-time = "2026-01-11T11:22:33.505Z" }, + { url = "https://files.pythonhosted.org/packages/f5/00/d595c120963ad42474cf6ee7771ad0d0e8a49d0f01e29576ee9195d9ecdf/tomli-2.4.0-cp314-cp314t-win32.whl", hash = "sha256:d878f2a6707cc9d53a1be1414bbb419e629c3d6e67f69230217bb663e76b5087", size = 108106, upload-time = "2026-01-11T11:22:34.451Z" }, + { url = "https://files.pythonhosted.org/packages/de/69/9aa0c6a505c2f80e519b43764f8b4ba93b5a0bbd2d9a9de6e2b24271b9a5/tomli-2.4.0-cp314-cp314t-win_amd64.whl", hash = "sha256:2add28aacc7425117ff6364fe9e06a183bb0251b03f986df0e78e974047571fd", size = 120504, upload-time = "2026-01-11T11:22:35.764Z" }, + { url = "https://files.pythonhosted.org/packages/b3/9f/f1668c281c58cfae01482f7114a4b88d345e4c140386241a1a24dcc9e7bc/tomli-2.4.0-cp314-cp314t-win_arm64.whl", hash = "sha256:2b1e3b80e1d5e52e40e9b924ec43d81570f0e7d09d11081b797bc4692765a3d4", size = 99561, upload-time = "2026-01-11T11:22:36.624Z" }, + { url = "https://files.pythonhosted.org/packages/23/d1/136eb2cb77520a31e1f64cbae9d33ec6df0d78bdf4160398e86eec8a8754/tomli-2.4.0-py3-none-any.whl", hash = "sha256:1f776e7d669ebceb01dee46484485f43a4048746235e683bcdffacdf1fb4785a", size = 14477, upload-time = "2026-01-11T11:22:37.446Z" }, +] + +[[package]] +name = "typing-extensions" +version = "4.15.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/72/94/1a15dd82efb362ac84269196e94cf00f187f7ed21c242792a923cdb1c61f/typing_extensions-4.15.0.tar.gz", hash = "sha256:0cea48d173cc12fa28ecabc3b837ea3cf6f38c6d1136f85cbaaf598984861466", size = 109391, upload-time = "2025-08-25T13:49:26.313Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/18/67/36e9267722cc04a6b9f15c7f3441c2363321a3ea07da7ae0c0707beb2a9c/typing_extensions-4.15.0-py3-none-any.whl", hash = "sha256:f0fa19c6845758ab08074a0cfa8b7aecb71c999ca73d62883bc25cc018c4e548", size = 44614, upload-time = "2025-08-25T13:49:24.86Z" }, +] + +[[package]] +name = "typing-inspection" +version = "0.4.2" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "typing-extensions", marker = "extra == 'group-12-oz-agent-sdk-pydantic-v2' or extra != 'group-12-oz-agent-sdk-pydantic-v1'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/55/e3/70399cb7dd41c10ac53367ae42139cf4b1ca5f36bb3dc6c9d33acdb43655/typing_inspection-0.4.2.tar.gz", hash = "sha256:ba561c48a67c5958007083d386c3295464928b01faa735ab8547c5692e87f464", size = 75949, upload-time = "2025-10-01T02:14:41.687Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/dc/9b/47798a6c91d8bdb567fe2698fe81e0c6b7cb7ef4d13da4114b41d239f65d/typing_inspection-0.4.2-py3-none-any.whl", hash = "sha256:4ed1cacbdc298c220f1bd249ed5287caa16f34d44ef4e9c3d0cbad5b521545e7", size = 14611, upload-time = "2025-10-01T02:14:40.154Z" }, +] + +[[package]] +name = "yarl" +version = "1.22.0" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "idna" }, + { name = "multidict" }, + { name = "propcache" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/57/63/0c6ebca57330cd313f6102b16dd57ffaf3ec4c83403dcb45dbd15c6f3ea1/yarl-1.22.0.tar.gz", hash = "sha256:bebf8557577d4401ba8bd9ff33906f1376c877aa78d1fe216ad01b4d6745af71", size = 187169, upload-time = "2025-10-06T14:12:55.963Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/d1/43/a2204825342f37c337f5edb6637040fa14e365b2fcc2346960201d457579/yarl-1.22.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:c7bd6683587567e5a49ee6e336e0612bec8329be1b7d4c8af5687dcdeb67ee1e", size = 140517, upload-time = "2025-10-06T14:08:42.494Z" }, + { url = "https://files.pythonhosted.org/packages/44/6f/674f3e6f02266428c56f704cd2501c22f78e8b2eeb23f153117cc86fb28a/yarl-1.22.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:5cdac20da754f3a723cceea5b3448e1a2074866406adeb4ef35b469d089adb8f", size = 93495, upload-time = "2025-10-06T14:08:46.2Z" }, + { url = "https://files.pythonhosted.org/packages/b8/12/5b274d8a0f30c07b91b2f02cba69152600b47830fcfb465c108880fcee9c/yarl-1.22.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:07a524d84df0c10f41e3ee918846e1974aba4ec017f990dc735aad487a0bdfdf", size = 94400, upload-time = "2025-10-06T14:08:47.855Z" }, + { url = "https://files.pythonhosted.org/packages/e2/7f/df1b6949b1fa1aa9ff6de6e2631876ad4b73c4437822026e85d8acb56bb1/yarl-1.22.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e1b329cb8146d7b736677a2440e422eadd775d1806a81db2d4cded80a48efc1a", size = 347545, upload-time = "2025-10-06T14:08:49.683Z" }, + { url = "https://files.pythonhosted.org/packages/84/09/f92ed93bd6cd77872ab6c3462df45ca45cd058d8f1d0c9b4f54c1704429f/yarl-1.22.0-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:75976c6945d85dbb9ee6308cd7ff7b1fb9409380c82d6119bd778d8fcfe2931c", size = 319598, upload-time = "2025-10-06T14:08:51.215Z" }, + { url = "https://files.pythonhosted.org/packages/c3/97/ac3f3feae7d522cf7ccec3d340bb0b2b61c56cb9767923df62a135092c6b/yarl-1.22.0-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:80ddf7a5f8c86cb3eb4bc9028b07bbbf1f08a96c5c0bc1244be5e8fefcb94147", size = 363893, upload-time = "2025-10-06T14:08:53.144Z" }, + { url = "https://files.pythonhosted.org/packages/06/49/f3219097403b9c84a4d079b1d7bda62dd9b86d0d6e4428c02d46ab2c77fc/yarl-1.22.0-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d332fc2e3c94dad927f2112395772a4e4fedbcf8f80efc21ed7cdfae4d574fdb", size = 371240, upload-time = "2025-10-06T14:08:55.036Z" }, + { url = "https://files.pythonhosted.org/packages/35/9f/06b765d45c0e44e8ecf0fe15c9eacbbde342bb5b7561c46944f107bfb6c3/yarl-1.22.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0cf71bf877efeac18b38d3930594c0948c82b64547c1cf420ba48722fe5509f6", size = 346965, upload-time = "2025-10-06T14:08:56.722Z" }, + { url = "https://files.pythonhosted.org/packages/c5/69/599e7cea8d0fcb1694323b0db0dda317fa3162f7b90166faddecf532166f/yarl-1.22.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:663e1cadaddae26be034a6ab6072449a8426ddb03d500f43daf952b74553bba0", size = 342026, upload-time = "2025-10-06T14:08:58.563Z" }, + { url = "https://files.pythonhosted.org/packages/95/6f/9dfd12c8bc90fea9eab39832ee32ea48f8e53d1256252a77b710c065c89f/yarl-1.22.0-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:6dcbb0829c671f305be48a7227918cfcd11276c2d637a8033a99a02b67bf9eda", size = 335637, upload-time = "2025-10-06T14:09:00.506Z" }, + { url = "https://files.pythonhosted.org/packages/57/2e/34c5b4eb9b07e16e873db5b182c71e5f06f9b5af388cdaa97736d79dd9a6/yarl-1.22.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:f0d97c18dfd9a9af4490631905a3f131a8e4c9e80a39353919e2cfed8f00aedc", size = 359082, upload-time = "2025-10-06T14:09:01.936Z" }, + { url = "https://files.pythonhosted.org/packages/31/71/fa7e10fb772d273aa1f096ecb8ab8594117822f683bab7d2c5a89914c92a/yarl-1.22.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:437840083abe022c978470b942ff832c3940b2ad3734d424b7eaffcd07f76737", size = 357811, upload-time = "2025-10-06T14:09:03.445Z" }, + { url = "https://files.pythonhosted.org/packages/26/da/11374c04e8e1184a6a03cf9c8f5688d3e5cec83ed6f31ad3481b3207f709/yarl-1.22.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:a899cbd98dce6f5d8de1aad31cb712ec0a530abc0a86bd6edaa47c1090138467", size = 351223, upload-time = "2025-10-06T14:09:05.401Z" }, + { url = "https://files.pythonhosted.org/packages/82/8f/e2d01f161b0c034a30410e375e191a5d27608c1f8693bab1a08b089ca096/yarl-1.22.0-cp310-cp310-win32.whl", hash = "sha256:595697f68bd1f0c1c159fcb97b661fc9c3f5db46498043555d04805430e79bea", size = 82118, upload-time = "2025-10-06T14:09:11.148Z" }, + { url = "https://files.pythonhosted.org/packages/62/46/94c76196642dbeae634c7a61ba3da88cd77bed875bf6e4a8bed037505aa6/yarl-1.22.0-cp310-cp310-win_amd64.whl", hash = "sha256:cb95a9b1adaa48e41815a55ae740cfda005758104049a640a398120bf02515ca", size = 86852, upload-time = "2025-10-06T14:09:12.958Z" }, + { url = "https://files.pythonhosted.org/packages/af/af/7df4f179d3b1a6dcb9a4bd2ffbc67642746fcafdb62580e66876ce83fff4/yarl-1.22.0-cp310-cp310-win_arm64.whl", hash = "sha256:b85b982afde6df99ecc996990d4ad7ccbdbb70e2a4ba4de0aecde5922ba98a0b", size = 82012, upload-time = "2025-10-06T14:09:14.664Z" }, + { url = "https://files.pythonhosted.org/packages/4d/27/5ab13fc84c76a0250afd3d26d5936349a35be56ce5785447d6c423b26d92/yarl-1.22.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:1ab72135b1f2db3fed3997d7e7dc1b80573c67138023852b6efb336a5eae6511", size = 141607, upload-time = "2025-10-06T14:09:16.298Z" }, + { url = "https://files.pythonhosted.org/packages/6a/a1/d065d51d02dc02ce81501d476b9ed2229d9a990818332242a882d5d60340/yarl-1.22.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:669930400e375570189492dc8d8341301578e8493aec04aebc20d4717f899dd6", size = 94027, upload-time = "2025-10-06T14:09:17.786Z" }, + { url = "https://files.pythonhosted.org/packages/c1/da/8da9f6a53f67b5106ffe902c6fa0164e10398d4e150d85838b82f424072a/yarl-1.22.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:792a2af6d58177ef7c19cbf0097aba92ca1b9cb3ffdd9c7470e156c8f9b5e028", size = 94963, upload-time = "2025-10-06T14:09:19.662Z" }, + { url = "https://files.pythonhosted.org/packages/68/fe/2c1f674960c376e29cb0bec1249b117d11738db92a6ccc4a530b972648db/yarl-1.22.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3ea66b1c11c9150f1372f69afb6b8116f2dd7286f38e14ea71a44eee9ec51b9d", size = 368406, upload-time = "2025-10-06T14:09:21.402Z" }, + { url = "https://files.pythonhosted.org/packages/95/26/812a540e1c3c6418fec60e9bbd38e871eaba9545e94fa5eff8f4a8e28e1e/yarl-1.22.0-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3e2daa88dc91870215961e96a039ec73e4937da13cf77ce17f9cad0c18df3503", size = 336581, upload-time = "2025-10-06T14:09:22.98Z" }, + { url = "https://files.pythonhosted.org/packages/0b/f5/5777b19e26fdf98563985e481f8be3d8a39f8734147a6ebf459d0dab5a6b/yarl-1.22.0-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ba440ae430c00eee41509353628600212112cd5018d5def7e9b05ea7ac34eb65", size = 388924, upload-time = "2025-10-06T14:09:24.655Z" }, + { url = "https://files.pythonhosted.org/packages/86/08/24bd2477bd59c0bbd994fe1d93b126e0472e4e3df5a96a277b0a55309e89/yarl-1.22.0-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:e6438cc8f23a9c1478633d216b16104a586b9761db62bfacb6425bac0a36679e", size = 392890, upload-time = "2025-10-06T14:09:26.617Z" }, + { url = "https://files.pythonhosted.org/packages/46/00/71b90ed48e895667ecfb1eaab27c1523ee2fa217433ed77a73b13205ca4b/yarl-1.22.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4c52a6e78aef5cf47a98ef8e934755abf53953379b7d53e68b15ff4420e6683d", size = 365819, upload-time = "2025-10-06T14:09:28.544Z" }, + { url = "https://files.pythonhosted.org/packages/30/2d/f715501cae832651d3282387c6a9236cd26bd00d0ff1e404b3dc52447884/yarl-1.22.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:3b06bcadaac49c70f4c88af4ffcfbe3dc155aab3163e75777818092478bcbbe7", size = 363601, upload-time = "2025-10-06T14:09:30.568Z" }, + { url = "https://files.pythonhosted.org/packages/f8/f9/a678c992d78e394e7126ee0b0e4e71bd2775e4334d00a9278c06a6cce96a/yarl-1.22.0-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:6944b2dc72c4d7f7052683487e3677456050ff77fcf5e6204e98caf785ad1967", size = 358072, upload-time = "2025-10-06T14:09:32.528Z" }, + { url = "https://files.pythonhosted.org/packages/2c/d1/b49454411a60edb6fefdcad4f8e6dbba7d8019e3a508a1c5836cba6d0781/yarl-1.22.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:d5372ca1df0f91a86b047d1277c2aaf1edb32d78bbcefffc81b40ffd18f027ed", size = 385311, upload-time = "2025-10-06T14:09:34.634Z" }, + { url = "https://files.pythonhosted.org/packages/87/e5/40d7a94debb8448c7771a916d1861d6609dddf7958dc381117e7ba36d9e8/yarl-1.22.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:51af598701f5299012b8416486b40fceef8c26fc87dc6d7d1f6fc30609ea0aa6", size = 381094, upload-time = "2025-10-06T14:09:36.268Z" }, + { url = "https://files.pythonhosted.org/packages/35/d8/611cc282502381ad855448643e1ad0538957fc82ae83dfe7762c14069e14/yarl-1.22.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:b266bd01fedeffeeac01a79ae181719ff848a5a13ce10075adbefc8f1daee70e", size = 370944, upload-time = "2025-10-06T14:09:37.872Z" }, + { url = "https://files.pythonhosted.org/packages/2d/df/fadd00fb1c90e1a5a8bd731fa3d3de2e165e5a3666a095b04e31b04d9cb6/yarl-1.22.0-cp311-cp311-win32.whl", hash = "sha256:a9b1ba5610a4e20f655258d5a1fdc7ebe3d837bb0e45b581398b99eb98b1f5ca", size = 81804, upload-time = "2025-10-06T14:09:39.359Z" }, + { url = "https://files.pythonhosted.org/packages/b5/f7/149bb6f45f267cb5c074ac40c01c6b3ea6d8a620d34b337f6321928a1b4d/yarl-1.22.0-cp311-cp311-win_amd64.whl", hash = "sha256:078278b9b0b11568937d9509b589ee83ef98ed6d561dfe2020e24a9fd08eaa2b", size = 86858, upload-time = "2025-10-06T14:09:41.068Z" }, + { url = "https://files.pythonhosted.org/packages/2b/13/88b78b93ad3f2f0b78e13bfaaa24d11cbc746e93fe76d8c06bf139615646/yarl-1.22.0-cp311-cp311-win_arm64.whl", hash = "sha256:b6a6f620cfe13ccec221fa312139135166e47ae169f8253f72a0abc0dae94376", size = 81637, upload-time = "2025-10-06T14:09:42.712Z" }, + { url = "https://files.pythonhosted.org/packages/75/ff/46736024fee3429b80a165a732e38e5d5a238721e634ab41b040d49f8738/yarl-1.22.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:e340382d1afa5d32b892b3ff062436d592ec3d692aeea3bef3a5cfe11bbf8c6f", size = 142000, upload-time = "2025-10-06T14:09:44.631Z" }, + { url = "https://files.pythonhosted.org/packages/5a/9a/b312ed670df903145598914770eb12de1bac44599549b3360acc96878df8/yarl-1.22.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:f1e09112a2c31ffe8d80be1b0988fa6a18c5d5cad92a9ffbb1c04c91bfe52ad2", size = 94338, upload-time = "2025-10-06T14:09:46.372Z" }, + { url = "https://files.pythonhosted.org/packages/ba/f5/0601483296f09c3c65e303d60c070a5c19fcdbc72daa061e96170785bc7d/yarl-1.22.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:939fe60db294c786f6b7c2d2e121576628468f65453d86b0fe36cb52f987bd74", size = 94909, upload-time = "2025-10-06T14:09:48.648Z" }, + { url = "https://files.pythonhosted.org/packages/60/41/9a1fe0b73dbcefce72e46cf149b0e0a67612d60bfc90fb59c2b2efdfbd86/yarl-1.22.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e1651bf8e0398574646744c1885a41198eba53dc8a9312b954073f845c90a8df", size = 372940, upload-time = "2025-10-06T14:09:50.089Z" }, + { url = "https://files.pythonhosted.org/packages/17/7a/795cb6dfee561961c30b800f0ed616b923a2ec6258b5def2a00bf8231334/yarl-1.22.0-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:b8a0588521a26bf92a57a1705b77b8b59044cdceccac7151bd8d229e66b8dedb", size = 345825, upload-time = "2025-10-06T14:09:52.142Z" }, + { url = "https://files.pythonhosted.org/packages/d7/93/a58f4d596d2be2ae7bab1a5846c4d270b894958845753b2c606d666744d3/yarl-1.22.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:42188e6a615c1a75bcaa6e150c3fe8f3e8680471a6b10150c5f7e83f47cc34d2", size = 386705, upload-time = "2025-10-06T14:09:54.128Z" }, + { url = "https://files.pythonhosted.org/packages/61/92/682279d0e099d0e14d7fd2e176bd04f48de1484f56546a3e1313cd6c8e7c/yarl-1.22.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:f6d2cb59377d99718913ad9a151030d6f83ef420a2b8f521d94609ecc106ee82", size = 396518, upload-time = "2025-10-06T14:09:55.762Z" }, + { url = "https://files.pythonhosted.org/packages/db/0f/0d52c98b8a885aeda831224b78f3be7ec2e1aa4a62091f9f9188c3c65b56/yarl-1.22.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:50678a3b71c751d58d7908edc96d332af328839eea883bb554a43f539101277a", size = 377267, upload-time = "2025-10-06T14:09:57.958Z" }, + { url = "https://files.pythonhosted.org/packages/22/42/d2685e35908cbeaa6532c1fc73e89e7f2efb5d8a7df3959ea8e37177c5a3/yarl-1.22.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1e8fbaa7cec507aa24ea27a01456e8dd4b6fab829059b69844bd348f2d467124", size = 365797, upload-time = "2025-10-06T14:09:59.527Z" }, + { url = "https://files.pythonhosted.org/packages/a2/83/cf8c7bcc6355631762f7d8bdab920ad09b82efa6b722999dfb05afa6cfac/yarl-1.22.0-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:433885ab5431bc3d3d4f2f9bd15bfa1614c522b0f1405d62c4f926ccd69d04fa", size = 365535, upload-time = "2025-10-06T14:10:01.139Z" }, + { url = "https://files.pythonhosted.org/packages/25/e1/5302ff9b28f0c59cac913b91fe3f16c59a033887e57ce9ca5d41a3a94737/yarl-1.22.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:b790b39c7e9a4192dc2e201a282109ed2985a1ddbd5ac08dc56d0e121400a8f7", size = 382324, upload-time = "2025-10-06T14:10:02.756Z" }, + { url = "https://files.pythonhosted.org/packages/bf/cd/4617eb60f032f19ae3a688dc990d8f0d89ee0ea378b61cac81ede3e52fae/yarl-1.22.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:31f0b53913220599446872d757257be5898019c85e7971599065bc55065dc99d", size = 383803, upload-time = "2025-10-06T14:10:04.552Z" }, + { url = "https://files.pythonhosted.org/packages/59/65/afc6e62bb506a319ea67b694551dab4a7e6fb7bf604e9bd9f3e11d575fec/yarl-1.22.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a49370e8f711daec68d09b821a34e1167792ee2d24d405cbc2387be4f158b520", size = 374220, upload-time = "2025-10-06T14:10:06.489Z" }, + { url = "https://files.pythonhosted.org/packages/e7/3d/68bf18d50dc674b942daec86a9ba922d3113d8399b0e52b9897530442da2/yarl-1.22.0-cp312-cp312-win32.whl", hash = "sha256:70dfd4f241c04bd9239d53b17f11e6ab672b9f1420364af63e8531198e3f5fe8", size = 81589, upload-time = "2025-10-06T14:10:09.254Z" }, + { url = "https://files.pythonhosted.org/packages/c8/9a/6ad1a9b37c2f72874f93e691b2e7ecb6137fb2b899983125db4204e47575/yarl-1.22.0-cp312-cp312-win_amd64.whl", hash = "sha256:8884d8b332a5e9b88e23f60bb166890009429391864c685e17bd73a9eda9105c", size = 87213, upload-time = "2025-10-06T14:10:11.369Z" }, + { url = "https://files.pythonhosted.org/packages/44/c5/c21b562d1680a77634d748e30c653c3ca918beb35555cff24986fff54598/yarl-1.22.0-cp312-cp312-win_arm64.whl", hash = "sha256:ea70f61a47f3cc93bdf8b2f368ed359ef02a01ca6393916bc8ff877427181e74", size = 81330, upload-time = "2025-10-06T14:10:13.112Z" }, + { url = "https://files.pythonhosted.org/packages/ea/f3/d67de7260456ee105dc1d162d43a019ecad6b91e2f51809d6cddaa56690e/yarl-1.22.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:8dee9c25c74997f6a750cd317b8ca63545169c098faee42c84aa5e506c819b53", size = 139980, upload-time = "2025-10-06T14:10:14.601Z" }, + { url = "https://files.pythonhosted.org/packages/01/88/04d98af0b47e0ef42597b9b28863b9060bb515524da0a65d5f4db160b2d5/yarl-1.22.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:01e73b85a5434f89fc4fe27dcda2aff08ddf35e4d47bbbea3bdcd25321af538a", size = 93424, upload-time = "2025-10-06T14:10:16.115Z" }, + { url = "https://files.pythonhosted.org/packages/18/91/3274b215fd8442a03975ce6bee5fe6aa57a8326b29b9d3d56234a1dca244/yarl-1.22.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:22965c2af250d20c873cdbee8ff958fb809940aeb2e74ba5f20aaf6b7ac8c70c", size = 93821, upload-time = "2025-10-06T14:10:17.993Z" }, + { url = "https://files.pythonhosted.org/packages/61/3a/caf4e25036db0f2da4ca22a353dfeb3c9d3c95d2761ebe9b14df8fc16eb0/yarl-1.22.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b4f15793aa49793ec8d1c708ab7f9eded1aa72edc5174cae703651555ed1b601", size = 373243, upload-time = "2025-10-06T14:10:19.44Z" }, + { url = "https://files.pythonhosted.org/packages/6e/9e/51a77ac7516e8e7803b06e01f74e78649c24ee1021eca3d6a739cb6ea49c/yarl-1.22.0-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e5542339dcf2747135c5c85f68680353d5cb9ffd741c0f2e8d832d054d41f35a", size = 342361, upload-time = "2025-10-06T14:10:21.124Z" }, + { url = "https://files.pythonhosted.org/packages/d4/f8/33b92454789dde8407f156c00303e9a891f1f51a0330b0fad7c909f87692/yarl-1.22.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5c401e05ad47a75869c3ab3e35137f8468b846770587e70d71e11de797d113df", size = 387036, upload-time = "2025-10-06T14:10:22.902Z" }, + { url = "https://files.pythonhosted.org/packages/d9/9a/c5db84ea024f76838220280f732970aa4ee154015d7f5c1bfb60a267af6f/yarl-1.22.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:243dda95d901c733f5b59214d28b0120893d91777cb8aa043e6ef059d3cddfe2", size = 397671, upload-time = "2025-10-06T14:10:24.523Z" }, + { url = "https://files.pythonhosted.org/packages/11/c9/cd8538dc2e7727095e0c1d867bad1e40c98f37763e6d995c1939f5fdc7b1/yarl-1.22.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bec03d0d388060058f5d291a813f21c011041938a441c593374da6077fe21b1b", size = 377059, upload-time = "2025-10-06T14:10:26.406Z" }, + { url = "https://files.pythonhosted.org/packages/a1/b9/ab437b261702ced75122ed78a876a6dec0a1b0f5e17a4ac7a9a2482d8abe/yarl-1.22.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:b0748275abb8c1e1e09301ee3cf90c8a99678a4e92e4373705f2a2570d581273", size = 365356, upload-time = "2025-10-06T14:10:28.461Z" }, + { url = "https://files.pythonhosted.org/packages/b2/9d/8e1ae6d1d008a9567877b08f0ce4077a29974c04c062dabdb923ed98e6fe/yarl-1.22.0-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:47fdb18187e2a4e18fda2c25c05d8251a9e4a521edaed757fef033e7d8498d9a", size = 361331, upload-time = "2025-10-06T14:10:30.541Z" }, + { url = "https://files.pythonhosted.org/packages/ca/5a/09b7be3905962f145b73beb468cdd53db8aa171cf18c80400a54c5b82846/yarl-1.22.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:c7044802eec4524fde550afc28edda0dd5784c4c45f0be151a2d3ba017daca7d", size = 382590, upload-time = "2025-10-06T14:10:33.352Z" }, + { url = "https://files.pythonhosted.org/packages/aa/7f/59ec509abf90eda5048b0bc3e2d7b5099dffdb3e6b127019895ab9d5ef44/yarl-1.22.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:139718f35149ff544caba20fce6e8a2f71f1e39b92c700d8438a0b1d2a631a02", size = 385316, upload-time = "2025-10-06T14:10:35.034Z" }, + { url = "https://files.pythonhosted.org/packages/e5/84/891158426bc8036bfdfd862fabd0e0fa25df4176ec793e447f4b85cf1be4/yarl-1.22.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:e1b51bebd221006d3d2f95fbe124b22b247136647ae5dcc8c7acafba66e5ee67", size = 374431, upload-time = "2025-10-06T14:10:37.76Z" }, + { url = "https://files.pythonhosted.org/packages/bb/49/03da1580665baa8bef5e8ed34c6df2c2aca0a2f28bf397ed238cc1bbc6f2/yarl-1.22.0-cp313-cp313-win32.whl", hash = "sha256:d3e32536234a95f513bd374e93d717cf6b2231a791758de6c509e3653f234c95", size = 81555, upload-time = "2025-10-06T14:10:39.649Z" }, + { url = "https://files.pythonhosted.org/packages/9a/ee/450914ae11b419eadd067c6183ae08381cfdfcb9798b90b2b713bbebddda/yarl-1.22.0-cp313-cp313-win_amd64.whl", hash = "sha256:47743b82b76d89a1d20b83e60d5c20314cbd5ba2befc9cda8f28300c4a08ed4d", size = 86965, upload-time = "2025-10-06T14:10:41.313Z" }, + { url = "https://files.pythonhosted.org/packages/98/4d/264a01eae03b6cf629ad69bae94e3b0e5344741e929073678e84bf7a3e3b/yarl-1.22.0-cp313-cp313-win_arm64.whl", hash = "sha256:5d0fcda9608875f7d052eff120c7a5da474a6796fe4d83e152e0e4d42f6d1a9b", size = 81205, upload-time = "2025-10-06T14:10:43.167Z" }, + { url = "https://files.pythonhosted.org/packages/88/fc/6908f062a2f77b5f9f6d69cecb1747260831ff206adcbc5b510aff88df91/yarl-1.22.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:719ae08b6972befcba4310e49edb1161a88cdd331e3a694b84466bd938a6ab10", size = 146209, upload-time = "2025-10-06T14:10:44.643Z" }, + { url = "https://files.pythonhosted.org/packages/65/47/76594ae8eab26210b4867be6f49129861ad33da1f1ebdf7051e98492bf62/yarl-1.22.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:47d8a5c446df1c4db9d21b49619ffdba90e77c89ec6e283f453856c74b50b9e3", size = 95966, upload-time = "2025-10-06T14:10:46.554Z" }, + { url = "https://files.pythonhosted.org/packages/ab/ce/05e9828a49271ba6b5b038b15b3934e996980dd78abdfeb52a04cfb9467e/yarl-1.22.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:cfebc0ac8333520d2d0423cbbe43ae43c8838862ddb898f5ca68565e395516e9", size = 97312, upload-time = "2025-10-06T14:10:48.007Z" }, + { url = "https://files.pythonhosted.org/packages/d1/c5/7dffad5e4f2265b29c9d7ec869c369e4223166e4f9206fc2243ee9eea727/yarl-1.22.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4398557cbf484207df000309235979c79c4356518fd5c99158c7d38203c4da4f", size = 361967, upload-time = "2025-10-06T14:10:49.997Z" }, + { url = "https://files.pythonhosted.org/packages/50/b2/375b933c93a54bff7fc041e1a6ad2c0f6f733ffb0c6e642ce56ee3b39970/yarl-1.22.0-cp313-cp313t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:2ca6fd72a8cd803be290d42f2dec5cdcd5299eeb93c2d929bf060ad9efaf5de0", size = 323949, upload-time = "2025-10-06T14:10:52.004Z" }, + { url = "https://files.pythonhosted.org/packages/66/50/bfc2a29a1d78644c5a7220ce2f304f38248dc94124a326794e677634b6cf/yarl-1.22.0-cp313-cp313t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:ca1f59c4e1ab6e72f0a23c13fca5430f889634166be85dbf1013683e49e3278e", size = 361818, upload-time = "2025-10-06T14:10:54.078Z" }, + { url = "https://files.pythonhosted.org/packages/46/96/f3941a46af7d5d0f0498f86d71275696800ddcdd20426298e572b19b91ff/yarl-1.22.0-cp313-cp313t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:6c5010a52015e7c70f86eb967db0f37f3c8bd503a695a49f8d45700144667708", size = 372626, upload-time = "2025-10-06T14:10:55.767Z" }, + { url = "https://files.pythonhosted.org/packages/c1/42/8b27c83bb875cd89448e42cd627e0fb971fa1675c9ec546393d18826cb50/yarl-1.22.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9d7672ecf7557476642c88497c2f8d8542f8e36596e928e9bcba0e42e1e7d71f", size = 341129, upload-time = "2025-10-06T14:10:57.985Z" }, + { url = "https://files.pythonhosted.org/packages/49/36/99ca3122201b382a3cf7cc937b95235b0ac944f7e9f2d5331d50821ed352/yarl-1.22.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:3b7c88eeef021579d600e50363e0b6ee4f7f6f728cd3486b9d0f3ee7b946398d", size = 346776, upload-time = "2025-10-06T14:10:59.633Z" }, + { url = "https://files.pythonhosted.org/packages/85/b4/47328bf996acd01a4c16ef9dcd2f59c969f495073616586f78cd5f2efb99/yarl-1.22.0-cp313-cp313t-musllinux_1_2_armv7l.whl", hash = "sha256:f4afb5c34f2c6fecdcc182dfcfc6af6cccf1aa923eed4d6a12e9d96904e1a0d8", size = 334879, upload-time = "2025-10-06T14:11:01.454Z" }, + { url = "https://files.pythonhosted.org/packages/c2/ad/b77d7b3f14a4283bffb8e92c6026496f6de49751c2f97d4352242bba3990/yarl-1.22.0-cp313-cp313t-musllinux_1_2_ppc64le.whl", hash = "sha256:59c189e3e99a59cf8d83cbb31d4db02d66cda5a1a4374e8a012b51255341abf5", size = 350996, upload-time = "2025-10-06T14:11:03.452Z" }, + { url = "https://files.pythonhosted.org/packages/81/c8/06e1d69295792ba54d556f06686cbd6a7ce39c22307100e3fb4a2c0b0a1d/yarl-1.22.0-cp313-cp313t-musllinux_1_2_s390x.whl", hash = "sha256:5a3bf7f62a289fa90f1990422dc8dff5a458469ea71d1624585ec3a4c8d6960f", size = 356047, upload-time = "2025-10-06T14:11:05.115Z" }, + { url = "https://files.pythonhosted.org/packages/4b/b8/4c0e9e9f597074b208d18cef227d83aac36184bfbc6eab204ea55783dbc5/yarl-1.22.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:de6b9a04c606978fdfe72666fa216ffcf2d1a9f6a381058d4378f8d7b1e5de62", size = 342947, upload-time = "2025-10-06T14:11:08.137Z" }, + { url = "https://files.pythonhosted.org/packages/e0/e5/11f140a58bf4c6ad7aca69a892bff0ee638c31bea4206748fc0df4ebcb3a/yarl-1.22.0-cp313-cp313t-win32.whl", hash = "sha256:1834bb90991cc2999f10f97f5f01317f99b143284766d197e43cd5b45eb18d03", size = 86943, upload-time = "2025-10-06T14:11:10.284Z" }, + { url = "https://files.pythonhosted.org/packages/31/74/8b74bae38ed7fe6793d0c15a0c8207bbb819cf287788459e5ed230996cdd/yarl-1.22.0-cp313-cp313t-win_amd64.whl", hash = "sha256:ff86011bd159a9d2dfc89c34cfd8aff12875980e3bd6a39ff097887520e60249", size = 93715, upload-time = "2025-10-06T14:11:11.739Z" }, + { url = "https://files.pythonhosted.org/packages/69/66/991858aa4b5892d57aef7ee1ba6b4d01ec3b7eb3060795d34090a3ca3278/yarl-1.22.0-cp313-cp313t-win_arm64.whl", hash = "sha256:7861058d0582b847bc4e3a4a4c46828a410bca738673f35a29ba3ca5db0b473b", size = 83857, upload-time = "2025-10-06T14:11:13.586Z" }, + { url = "https://files.pythonhosted.org/packages/46/b3/e20ef504049f1a1c54a814b4b9bed96d1ac0e0610c3b4da178f87209db05/yarl-1.22.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:34b36c2c57124530884d89d50ed2c1478697ad7473efd59cfd479945c95650e4", size = 140520, upload-time = "2025-10-06T14:11:15.465Z" }, + { url = "https://files.pythonhosted.org/packages/e4/04/3532d990fdbab02e5ede063676b5c4260e7f3abea2151099c2aa745acc4c/yarl-1.22.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:0dd9a702591ca2e543631c2a017e4a547e38a5c0f29eece37d9097e04a7ac683", size = 93504, upload-time = "2025-10-06T14:11:17.106Z" }, + { url = "https://files.pythonhosted.org/packages/11/63/ff458113c5c2dac9a9719ac68ee7c947cb621432bcf28c9972b1c0e83938/yarl-1.22.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:594fcab1032e2d2cc3321bb2e51271e7cd2b516c7d9aee780ece81b07ff8244b", size = 94282, upload-time = "2025-10-06T14:11:19.064Z" }, + { url = "https://files.pythonhosted.org/packages/a7/bc/315a56aca762d44a6aaaf7ad253f04d996cb6b27bad34410f82d76ea8038/yarl-1.22.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f3d7a87a78d46a2e3d5b72587ac14b4c16952dd0887dbb051451eceac774411e", size = 372080, upload-time = "2025-10-06T14:11:20.996Z" }, + { url = "https://files.pythonhosted.org/packages/3f/3f/08e9b826ec2e099ea6e7c69a61272f4f6da62cb5b1b63590bb80ca2e4a40/yarl-1.22.0-cp314-cp314-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:852863707010316c973162e703bddabec35e8757e67fcb8ad58829de1ebc8590", size = 338696, upload-time = "2025-10-06T14:11:22.847Z" }, + { url = "https://files.pythonhosted.org/packages/e3/9f/90360108e3b32bd76789088e99538febfea24a102380ae73827f62073543/yarl-1.22.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:131a085a53bfe839a477c0845acf21efc77457ba2bcf5899618136d64f3303a2", size = 387121, upload-time = "2025-10-06T14:11:24.889Z" }, + { url = "https://files.pythonhosted.org/packages/98/92/ab8d4657bd5b46a38094cfaea498f18bb70ce6b63508fd7e909bd1f93066/yarl-1.22.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:078a8aefd263f4d4f923a9677b942b445a2be970ca24548a8102689a3a8ab8da", size = 394080, upload-time = "2025-10-06T14:11:27.307Z" }, + { url = "https://files.pythonhosted.org/packages/f5/e7/d8c5a7752fef68205296201f8ec2bf718f5c805a7a7e9880576c67600658/yarl-1.22.0-cp314-cp314-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bca03b91c323036913993ff5c738d0842fc9c60c4648e5c8d98331526df89784", size = 372661, upload-time = "2025-10-06T14:11:29.387Z" }, + { url = "https://files.pythonhosted.org/packages/b6/2e/f4d26183c8db0bb82d491b072f3127fb8c381a6206a3a56332714b79b751/yarl-1.22.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:68986a61557d37bb90d3051a45b91fa3d5c516d177dfc6dd6f2f436a07ff2b6b", size = 364645, upload-time = "2025-10-06T14:11:31.423Z" }, + { url = "https://files.pythonhosted.org/packages/80/7c/428e5812e6b87cd00ee8e898328a62c95825bf37c7fa87f0b6bb2ad31304/yarl-1.22.0-cp314-cp314-musllinux_1_2_armv7l.whl", hash = "sha256:4792b262d585ff0dff6bcb787f8492e40698443ec982a3568c2096433660c694", size = 355361, upload-time = "2025-10-06T14:11:33.055Z" }, + { url = "https://files.pythonhosted.org/packages/ec/2a/249405fd26776f8b13c067378ef4d7dd49c9098d1b6457cdd152a99e96a9/yarl-1.22.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:ebd4549b108d732dba1d4ace67614b9545b21ece30937a63a65dd34efa19732d", size = 381451, upload-time = "2025-10-06T14:11:35.136Z" }, + { url = "https://files.pythonhosted.org/packages/67/a8/fb6b1adbe98cf1e2dd9fad71003d3a63a1bc22459c6e15f5714eb9323b93/yarl-1.22.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:f87ac53513d22240c7d59203f25cc3beac1e574c6cd681bbfd321987b69f95fd", size = 383814, upload-time = "2025-10-06T14:11:37.094Z" }, + { url = "https://files.pythonhosted.org/packages/d9/f9/3aa2c0e480fb73e872ae2814c43bc1e734740bb0d54e8cb2a95925f98131/yarl-1.22.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:22b029f2881599e2f1b06f8f1db2ee63bd309e2293ba2d566e008ba12778b8da", size = 370799, upload-time = "2025-10-06T14:11:38.83Z" }, + { url = "https://files.pythonhosted.org/packages/50/3c/af9dba3b8b5eeb302f36f16f92791f3ea62e3f47763406abf6d5a4a3333b/yarl-1.22.0-cp314-cp314-win32.whl", hash = "sha256:6a635ea45ba4ea8238463b4f7d0e721bad669f80878b7bfd1f89266e2ae63da2", size = 82990, upload-time = "2025-10-06T14:11:40.624Z" }, + { url = "https://files.pythonhosted.org/packages/ac/30/ac3a0c5bdc1d6efd1b41fa24d4897a4329b3b1e98de9449679dd327af4f0/yarl-1.22.0-cp314-cp314-win_amd64.whl", hash = "sha256:0d6e6885777af0f110b0e5d7e5dda8b704efed3894da26220b7f3d887b839a79", size = 88292, upload-time = "2025-10-06T14:11:42.578Z" }, + { url = "https://files.pythonhosted.org/packages/df/0a/227ab4ff5b998a1b7410abc7b46c9b7a26b0ca9e86c34ba4b8d8bc7c63d5/yarl-1.22.0-cp314-cp314-win_arm64.whl", hash = "sha256:8218f4e98d3c10d683584cb40f0424f4b9fd6e95610232dd75e13743b070ee33", size = 82888, upload-time = "2025-10-06T14:11:44.863Z" }, + { url = "https://files.pythonhosted.org/packages/06/5e/a15eb13db90abd87dfbefb9760c0f3f257ac42a5cac7e75dbc23bed97a9f/yarl-1.22.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:45c2842ff0e0d1b35a6bf1cd6c690939dacb617a70827f715232b2e0494d55d1", size = 146223, upload-time = "2025-10-06T14:11:46.796Z" }, + { url = "https://files.pythonhosted.org/packages/18/82/9665c61910d4d84f41a5bf6837597c89e665fa88aa4941080704645932a9/yarl-1.22.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:d947071e6ebcf2e2bee8fce76e10faca8f7a14808ca36a910263acaacef08eca", size = 95981, upload-time = "2025-10-06T14:11:48.845Z" }, + { url = "https://files.pythonhosted.org/packages/5d/9a/2f65743589809af4d0a6d3aa749343c4b5f4c380cc24a8e94a3c6625a808/yarl-1.22.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:334b8721303e61b00019474cc103bdac3d7b1f65e91f0bfedeec2d56dfe74b53", size = 97303, upload-time = "2025-10-06T14:11:50.897Z" }, + { url = "https://files.pythonhosted.org/packages/b0/ab/5b13d3e157505c43c3b43b5a776cbf7b24a02bc4cccc40314771197e3508/yarl-1.22.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1e7ce67c34138a058fd092f67d07a72b8e31ff0c9236e751957465a24b28910c", size = 361820, upload-time = "2025-10-06T14:11:52.549Z" }, + { url = "https://files.pythonhosted.org/packages/fb/76/242a5ef4677615cf95330cfc1b4610e78184400699bdda0acb897ef5e49a/yarl-1.22.0-cp314-cp314t-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:d77e1b2c6d04711478cb1c4ab90db07f1609ccf06a287d5607fcd90dc9863acf", size = 323203, upload-time = "2025-10-06T14:11:54.225Z" }, + { url = "https://files.pythonhosted.org/packages/8c/96/475509110d3f0153b43d06164cf4195c64d16999e0c7e2d8a099adcd6907/yarl-1.22.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c4647674b6150d2cae088fc07de2738a84b8bcedebef29802cf0b0a82ab6face", size = 363173, upload-time = "2025-10-06T14:11:56.069Z" }, + { url = "https://files.pythonhosted.org/packages/c9/66/59db471aecfbd559a1fd48aedd954435558cd98c7d0da8b03cc6c140a32c/yarl-1.22.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:efb07073be061c8f79d03d04139a80ba33cbd390ca8f0297aae9cce6411e4c6b", size = 373562, upload-time = "2025-10-06T14:11:58.783Z" }, + { url = "https://files.pythonhosted.org/packages/03/1f/c5d94abc91557384719da10ff166b916107c1b45e4d0423a88457071dd88/yarl-1.22.0-cp314-cp314t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e51ac5435758ba97ad69617e13233da53908beccc6cfcd6c34bbed8dcbede486", size = 339828, upload-time = "2025-10-06T14:12:00.686Z" }, + { url = "https://files.pythonhosted.org/packages/5f/97/aa6a143d3afba17b6465733681c70cf175af89f76ec8d9286e08437a7454/yarl-1.22.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:33e32a0dd0c8205efa8e83d04fc9f19313772b78522d1bdc7d9aed706bfd6138", size = 347551, upload-time = "2025-10-06T14:12:02.628Z" }, + { url = "https://files.pythonhosted.org/packages/43/3c/45a2b6d80195959239a7b2a8810506d4eea5487dce61c2a3393e7fc3c52e/yarl-1.22.0-cp314-cp314t-musllinux_1_2_armv7l.whl", hash = "sha256:bf4a21e58b9cde0e401e683ebd00f6ed30a06d14e93f7c8fd059f8b6e8f87b6a", size = 334512, upload-time = "2025-10-06T14:12:04.871Z" }, + { url = "https://files.pythonhosted.org/packages/86/a0/c2ab48d74599c7c84cb104ebd799c5813de252bea0f360ffc29d270c2caa/yarl-1.22.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:e4b582bab49ac33c8deb97e058cd67c2c50dac0dd134874106d9c774fd272529", size = 352400, upload-time = "2025-10-06T14:12:06.624Z" }, + { url = "https://files.pythonhosted.org/packages/32/75/f8919b2eafc929567d3d8411f72bdb1a2109c01caaab4ebfa5f8ffadc15b/yarl-1.22.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:0b5bcc1a9c4839e7e30b7b30dd47fe5e7e44fb7054ec29b5bb8d526aa1041093", size = 357140, upload-time = "2025-10-06T14:12:08.362Z" }, + { url = "https://files.pythonhosted.org/packages/cf/72/6a85bba382f22cf78add705d8c3731748397d986e197e53ecc7835e76de7/yarl-1.22.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:c0232bce2170103ec23c454e54a57008a9a72b5d1c3105dc2496750da8cfa47c", size = 341473, upload-time = "2025-10-06T14:12:10.994Z" }, + { url = "https://files.pythonhosted.org/packages/35/18/55e6011f7c044dc80b98893060773cefcfdbf60dfefb8cb2f58b9bacbd83/yarl-1.22.0-cp314-cp314t-win32.whl", hash = "sha256:8009b3173bcd637be650922ac455946197d858b3630b6d8787aa9e5c4564533e", size = 89056, upload-time = "2025-10-06T14:12:13.317Z" }, + { url = "https://files.pythonhosted.org/packages/f9/86/0f0dccb6e59a9e7f122c5afd43568b1d31b8ab7dda5f1b01fb5c7025c9a9/yarl-1.22.0-cp314-cp314t-win_amd64.whl", hash = "sha256:9fb17ea16e972c63d25d4a97f016d235c78dd2344820eb35bc034bc32012ee27", size = 96292, upload-time = "2025-10-06T14:12:15.398Z" }, + { url = "https://files.pythonhosted.org/packages/48/b7/503c98092fb3b344a179579f55814b613c1fbb1c23b3ec14a7b008a66a6e/yarl-1.22.0-cp314-cp314t-win_arm64.whl", hash = "sha256:9f6d73c1436b934e3f01df1e1b21ff765cd1d28c77dfb9ace207f746d4610ee1", size = 85171, upload-time = "2025-10-06T14:12:16.935Z" }, + { url = "https://files.pythonhosted.org/packages/94/fd/6480106702a79bcceda5fd9c63cb19a04a6506bd5ce7fd8d9b63742f0021/yarl-1.22.0-cp39-cp39-macosx_10_9_universal2.whl", hash = "sha256:3aa27acb6de7a23785d81557577491f6c38a5209a254d1191519d07d8fe51748", size = 141301, upload-time = "2025-10-06T14:12:19.01Z" }, + { url = "https://files.pythonhosted.org/packages/42/e1/6d95d21b17a93e793e4ec420a925fe1f6a9342338ca7a563ed21129c0990/yarl-1.22.0-cp39-cp39-macosx_10_9_x86_64.whl", hash = "sha256:af74f05666a5e531289cb1cc9c883d1de2088b8e5b4de48004e5ca8a830ac859", size = 93864, upload-time = "2025-10-06T14:12:21.05Z" }, + { url = "https://files.pythonhosted.org/packages/32/58/b8055273c203968e89808413ea4c984988b6649baabf10f4522e67c22d2f/yarl-1.22.0-cp39-cp39-macosx_11_0_arm64.whl", hash = "sha256:62441e55958977b8167b2709c164c91a6363e25da322d87ae6dd9c6019ceecf9", size = 94706, upload-time = "2025-10-06T14:12:23.287Z" }, + { url = "https://files.pythonhosted.org/packages/18/91/d7bfbc28a88c2895ecd0da6a874def0c147de78afc52c773c28e1aa233a3/yarl-1.22.0-cp39-cp39-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b580e71cac3f8113d3135888770903eaf2f507e9421e5697d6ee6d8cd1c7f054", size = 347100, upload-time = "2025-10-06T14:12:28.527Z" }, + { url = "https://files.pythonhosted.org/packages/bd/e8/37a1e7b99721c0564b1fc7b0a4d1f595ef6fb8060d82ca61775b644185f7/yarl-1.22.0-cp39-cp39-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:e81fda2fb4a07eda1a2252b216aa0df23ebcd4d584894e9612e80999a78fd95b", size = 318902, upload-time = "2025-10-06T14:12:30.528Z" }, + { url = "https://files.pythonhosted.org/packages/1c/ef/34724449d7ef2db4f22df644f2dac0b8a275d20f585e526937b3ae47b02d/yarl-1.22.0-cp39-cp39-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:99b6fc1d55782461b78221e95fc357b47ad98b041e8e20f47c1411d0aacddc60", size = 363302, upload-time = "2025-10-06T14:12:32.295Z" }, + { url = "https://files.pythonhosted.org/packages/8a/04/88a39a5dad39889f192cce8d66cc4c58dbeca983e83f9b6bf23822a7ed91/yarl-1.22.0-cp39-cp39-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:088e4e08f033db4be2ccd1f34cf29fe994772fb54cfe004bbf54db320af56890", size = 370816, upload-time = "2025-10-06T14:12:34.01Z" }, + { url = "https://files.pythonhosted.org/packages/6b/1f/5e895e547129413f56c76be2c3ce4b96c797d2d0ff3e16a817d9269b12e6/yarl-1.22.0-cp39-cp39-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:2e4e1f6f0b4da23e61188676e3ed027ef0baa833a2e633c29ff8530800edccba", size = 346465, upload-time = "2025-10-06T14:12:35.977Z" }, + { url = "https://files.pythonhosted.org/packages/11/13/a750e9fd6f9cc9ed3a52a70fe58ffe505322f0efe0d48e1fd9ffe53281f5/yarl-1.22.0-cp39-cp39-musllinux_1_2_aarch64.whl", hash = "sha256:84fc3ec96fce86ce5aa305eb4aa9358279d1aa644b71fab7b8ed33fe3ba1a7ca", size = 341506, upload-time = "2025-10-06T14:12:37.788Z" }, + { url = "https://files.pythonhosted.org/packages/3c/67/bb6024de76e7186611ebe626aec5b71a2d2ecf9453e795f2dbd80614784c/yarl-1.22.0-cp39-cp39-musllinux_1_2_armv7l.whl", hash = "sha256:5dbeefd6ca588b33576a01b0ad58aa934bc1b41ef89dee505bf2932b22ddffba", size = 335030, upload-time = "2025-10-06T14:12:39.775Z" }, + { url = "https://files.pythonhosted.org/packages/a2/be/50b38447fd94a7992996a62b8b463d0579323fcfc08c61bdba949eef8a5d/yarl-1.22.0-cp39-cp39-musllinux_1_2_ppc64le.whl", hash = "sha256:14291620375b1060613f4aab9ebf21850058b6b1b438f386cc814813d901c60b", size = 358560, upload-time = "2025-10-06T14:12:41.547Z" }, + { url = "https://files.pythonhosted.org/packages/e2/89/c020b6f547578c4e3dbb6335bf918f26e2f34ad0d1e515d72fd33ac0c635/yarl-1.22.0-cp39-cp39-musllinux_1_2_s390x.whl", hash = "sha256:a4fcfc8eb2c34148c118dfa02e6427ca278bfd0f3df7c5f99e33d2c0e81eae3e", size = 357290, upload-time = "2025-10-06T14:12:43.861Z" }, + { url = "https://files.pythonhosted.org/packages/8c/52/c49a619ee35a402fa3a7019a4fa8d26878fec0d1243f6968bbf516789578/yarl-1.22.0-cp39-cp39-musllinux_1_2_x86_64.whl", hash = "sha256:029866bde8d7b0878b9c160e72305bbf0a7342bcd20b9999381704ae03308dc8", size = 350700, upload-time = "2025-10-06T14:12:46.868Z" }, + { url = "https://files.pythonhosted.org/packages/ab/c9/f5042d87777bf6968435f04a2bbb15466b2f142e6e47fa4f34d1a3f32f0c/yarl-1.22.0-cp39-cp39-win32.whl", hash = "sha256:4dcc74149ccc8bba31ce1944acee24813e93cfdee2acda3c172df844948ddf7b", size = 82323, upload-time = "2025-10-06T14:12:48.633Z" }, + { url = "https://files.pythonhosted.org/packages/fd/58/d00f7cad9eba20c4eefac2682f34661d1d1b3a942fc0092eb60e78cfb733/yarl-1.22.0-cp39-cp39-win_amd64.whl", hash = "sha256:10619d9fdee46d20edc49d3479e2f8269d0779f1b031e6f7c2aa1c76be04b7ed", size = 87145, upload-time = "2025-10-06T14:12:50.241Z" }, + { url = "https://files.pythonhosted.org/packages/c2/a3/70904f365080780d38b919edd42d224b8c4ce224a86950d2eaa2a24366ad/yarl-1.22.0-cp39-cp39-win_arm64.whl", hash = "sha256:dd7afd3f8b0bfb4e0d9fc3c31bfe8a4ec7debe124cfd90619305def3c8ca8cd2", size = 82173, upload-time = "2025-10-06T14:12:51.869Z" }, + { url = "https://files.pythonhosted.org/packages/73/ae/b48f95715333080afb75a4504487cbe142cae1268afc482d06692d605ae6/yarl-1.22.0-py3-none-any.whl", hash = "sha256:1380560bdba02b6b6c90de54133c81c9f2a453dee9912fe58c1dcced1edb7cff", size = 46814, upload-time = "2025-10-06T14:12:53.872Z" }, +] + +[[package]] +name = "zipp" +version = "3.23.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/e3/02/0f2892c661036d50ede074e376733dca2ae7c6eb617489437771209d4180/zipp-3.23.0.tar.gz", hash = "sha256:a07157588a12518c9d4034df3fbbee09c814741a33ff63c05fa29d26a2404166", size = 25547, upload-time = "2025-06-08T17:06:39.4Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2e/54/647ade08bf0db230bfea292f893923872fd20be6ac6f53b2b936ba839d75/zipp-3.23.0-py3-none-any.whl", hash = "sha256:071652d6115ed432f5ce1d34c336c0adfd6a884660d1e9712a256d3d3bd4b14e", size = 10276, upload-time = "2025-06-08T17:06:38.034Z" }, +]