diff --git a/.buildinfo b/.buildinfo new file mode 100644 index 00000000..c15fb941 --- /dev/null +++ b/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: cf9f84adef08026bb3b96c31bc9ca37d +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/.codespellrc b/.codespellrc deleted file mode 100644 index c86b9efd..00000000 --- a/.codespellrc +++ /dev/null @@ -1,5 +0,0 @@ -[codespell] -skip = .git,*.bib,*.ps,*.js,*.pdf,_build,*.fodp,*.fods,other,*.sty -ignore-words = .codespell-ignore-words - - diff --git a/.github/dependabot.yml b/.github/dependabot.yml deleted file mode 100644 index 5d808809..00000000 --- a/.github/dependabot.yml +++ /dev/null @@ -1,13 +0,0 @@ -# Dependabot configuration -# ref: https://docs.github.com/en/code-security/supply-chain-security/keeping-your-dependencies-updated-automatically/configuration-options-for-dependency-updates -version: 2 -updates: - - package-ecosystem: "github-actions" - directory: "/" - schedule: - interval: "weekly" - - - package-ecosystem: "pip" - directory: "/" - schedule: - interval: "weekly" diff --git a/.github/workflows/codespell.yml b/.github/workflows/codespell.yml deleted file mode 100644 index 98ecd5cf..00000000 --- a/.github/workflows/codespell.yml +++ /dev/null @@ -1,33 +0,0 @@ -name: codespell - -on: - push: - branches: - - main - pull_request: - branches: - - main - -jobs: - codespell: - runs-on: ubuntu-latest - - steps: - - uses: actions/checkout@v6 - - - name: Setup Python - uses: actions/setup-python@v6 - with: - python-version: '3.14' - cache: "pip" - - - name: Install codespell - run: pip install codespell jupyterlab nbconvert - - - name: Preprocess notebooks - run: for i in $(find . -name "*.ipynb"); do jupyter nbconvert --clear-output --inplace $i; done - - - name: Run codespell - run: | - codespell content - diff --git a/.github/workflows/docs-test.yml b/.github/workflows/docs-test.yml deleted file mode 100644 index b3b2de60..00000000 --- a/.github/workflows/docs-test.yml +++ /dev/null @@ -1,33 +0,0 @@ -name: Doc test - -on: - push: - branches: - - main - pull_request: - branches: - - main - -jobs: - doc-test: - runs-on: ubuntu-latest - - steps: - - uses: actions/checkout@v6 - - - name: Set up Python - uses: actions/setup-python@v6 - with: - python-version: "3.14" - cache: "pip" - - - name: Install Python dependencies - run: | - sudo apt-get install python3-pip graphviz - pip install -r requirements.txt - pip install ghp-import - PATH="${PATH}:${HOME}/.local/bin" - - - name: Build book HTML - run: | - ./build_and_process.sh diff --git a/.github/workflows/main.yml b/.github/workflows/main.yml deleted file mode 100644 index 720016c8..00000000 --- a/.github/workflows/main.yml +++ /dev/null @@ -1,39 +0,0 @@ -name: Publish JupyterBook to GitHub Pages - -on: - push: # trigger build only when push to main - branches: - - main - -jobs: - build: - runs-on: ubuntu-latest - - steps: - - uses: actions/checkout@v6 - - - name: Set up Python - uses: actions/setup-python@v6 - with: - python-version: "3.14" - cache: "pip" - - - name: Install Python dependencies - run: | - sudo apt-get install python3-pip graphviz - pip install -r requirements.txt - pip install ghp-import - PATH="${PATH}:${HOME}/.local/bin" - - - name: Build book HTML - run: | - ./build_and_process.sh - - - name: Push _build/html to gh-pages - run: | - sudo chown -R $(whoami):$(whoami) . - git config --global user.email "$GITHUB_ACTOR@users.noreply.github.com" - git config --global user.name "$GITHUB_ACTOR" - git remote set-url origin "https://$GITHUB_ACTOR:${{ secrets.GITHUB_TOKEN }}@github.com/$GITHUB_REPOSITORY" - - ghp-import ./content/_build/html -f -p -n diff --git a/.gitignore b/.gitignore deleted file mode 100644 index 0045a3f3..00000000 --- a/.gitignore +++ /dev/null @@ -1,22 +0,0 @@ -*.log -*.aux -*.pyc -*~ - -.ipynb_checkpoints/ -Untitled*.ipynb - -\#* - -syllabus.pdf -syllabus.out - -.cache - -*egg-info - -.~lock* - -*.fodp - -_build diff --git a/.codespell-ignore-words b/.nojekyll similarity index 100% rename from .codespell-ignore-words rename to .nojekyll diff --git a/01-python/basics.html b/01-python/basics.html new file mode 100644 index 00000000..2ccc6409 --- /dev/null +++ b/01-python/basics.html @@ -0,0 +1,673 @@ + + + + + + + + + + + Python Basics — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Python Basics

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Python Basics#

+

The following references give helpful introductions to python:

+ +
+

Practicing#

+

Some resources for practicing on your own:

+ +
+
+

Online books:#

+ +
+
+

Domain-specific libraries#

+ +
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/functions-classes.html b/01-python/functions-classes.html new file mode 100644 index 00000000..f0da7f47 --- /dev/null +++ b/01-python/functions-classes.html @@ -0,0 +1,607 @@ + + + + + + + + + + + Functions and Classes — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Functions and Classes

+ +
+
+ +
+
+
+ + + + +
+ +
+

Functions and Classes#

+

Functions and classes are the building blocks of complex programs. +These allow you to organize your code into logical units that can +reused.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/installing.html b/01-python/installing.html new file mode 100644 index 00000000..ffd435bd --- /dev/null +++ b/01-python/installing.html @@ -0,0 +1,658 @@ + + + + + + + + + + + Introduction — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Introduction

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Introduction#

+

This class will introduce the basics of the python programming +language and the libraries used for scientific computing.

+
+

Tip

+

To get the most from this class, you should work on your own laptop. That +way you practice using python and the scientific libraries on the in the +environment you are most comfortable with.

+
+
+

Getting python#

+

You will want to install python and the associated libraries on your +laptop that you can bring to the seminar.

+

On Linux machines, you probably already have python and you can get +the needed libraries through your system package manager.

+

For Mac and Windows, I recommend the free Anaconda distribution:

+

https://www.anaconda.com/products/individual

+

This will install everything that you need.

+
+

Tip

+

If you have trouble getting a local install working, most of the class +material will work automatically in the cloud, either on +binder or google +colab.

+
+

If you have python successfully installed, you should be able to start +the python interpreter at the command line as: python. A shell will +come up, and you can try out your first program:

+
print("hello, world")
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/misc.html b/01-python/misc.html new file mode 100644 index 00000000..231a46ce --- /dev/null +++ b/01-python/misc.html @@ -0,0 +1,605 @@ + + + + + + + + + + + Miscellaneous — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Miscellaneous

+ +
+
+ +
+
+
+ + + + +
+ +
+

Miscellaneous#

+

There are a lot of topics that we didn’t cover, as well as a lot of +the python standard library that we won’t address. Here we introduce +a few more concepts.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/python-io.html b/01-python/python-io.html new file mode 100644 index 00000000..f91dad58 --- /dev/null +++ b/01-python/python-io.html @@ -0,0 +1,952 @@ + + + + + + + + + + + Print — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Print

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+
+
from __future__ import print_function
+
+
+
+
+

One of the main things that we want to do in scientific computing is get data into and out of our programs. In addition to plain text files, there are modules that can read lots of different data formats we might encounter.

+
+

Print#

+

We’ve already been using print quite a bit, but now we’ll look at how to control how information is printed. Note that there is an older and newer way to format print statements – we’ll focus only on the newer way (it’s nicer).

+

This is compatible with both python 2 and 3

+
+
+
x = 1
+y = 0.0000354
+z = 3.0
+s = "my string"
+
+
+
+
+
+
+
print(x)
+
+
+
+
+
1
+
+
+
+
+

We write a string with {} embedded to indicate where variables are to be inserted. Note that {} can take arguments. We use the format() method on the string to match the variables to the {}.

+
+
+
print("x = {}, y = {}, z = {}, s = {}".format(x, y, z, s))
+
+
+
+
+
x = 1, y = 3.54e-05, z = 3.0, s = my string
+
+
+
+
+

Before a semi-colon, we can give an optional index/position/descriptor of the value we want to print.

+

After the semi-colon we give a format specifier. It has a number field and a type, like f and g to describe how floating point numbers appear and how much precision to show. Other bits are possible as well (like justification).

+
+
+
print("x = {0}, y = {1:10.5g}, z = {2:.3f}, s = {3}".format(x, y, z, s))
+
+
+
+
+
x = 1, y =   3.54e-05, z = 3.000, s = my string
+
+
+
+
+

there are other formatting things, like justification, etc. See the tutorial

+
+
+
print("{:^80}".format("centered string"))
+
+
+
+
+
                                centered string                                 
+
+
+
+
+
+
+

File I/O#

+

as expected, a file is an object. Here we’ll use the try, except block to capture exceptions (like if the file cannot be opened).

+
+
+
try: f = open("./sample.txt", "w")   # open for writing -- any file of the same name will be overwritten
+except: 
+    print("cannot open the file")
+
+print(f)
+
+
+
+
+
<_io.TextIOWrapper name='./sample.txt' mode='w' encoding='UTF-8'>
+
+
+
+
+
+
+
f.write("this is my first write\n")
+f.close()
+
+
+
+
+

we can easily loop over the lines in a file

+
+
+
try: 
+    f = open("./test.txt", "r")
+except:
+    print("error: cannot open the file")
+    
+for line in f:
+    print(line.split())
+    
+f.close()
+
+
+
+
+
['Lorem', 'ipsum', 'dolor', 'sit', 'amet,', 'consectetur', 'adipisicing', 'elit,', 'sed', 'do']
+['eiusmod', 'tempor', 'incididunt', 'ut', 'labore', 'et', 'dolore', 'magna', 'aliqua.', 'Ut', 'enim', 'ad']
+['minim', 'veniam,', 'quis', 'nostrud', 'exercitation', 'ullamco', 'laboris', 'nisi', 'ut']
+['aliquip', 'ex', 'ea', 'commodo', 'consequat.', 'Duis', 'aute', 'irure', 'dolor', 'in']
+['reprehenderit', 'in', 'voluptate', 'velit', 'esse', 'cillum', 'dolore', 'eu', 'fugiat', 'nulla']
+['pariatur.', 'Excepteur', 'sint', 'occaecat', 'cupidatat', 'non', 'proident,', 'sunt', 'in']
+['culpa', 'qui', 'officia', 'deserunt', 'mollit', 'anim', 'id', 'est', 'laborum.']
+[]
+
+
+
+
+

as mentioned earlier, there are lots of string functions. Above we used strip() to remove the trailing whitespace and returns

+
+
+

CSV Files#

+

comma-separated values are an easy way to exchange data – you can generate these from a spreadsheet program. In the example below, we are assuming that the first line of the spreadsheet/csv file gives the headings that identify the columns.

+

Note that there is an amazing amount of variation in terms of what can be in a CSV file and what the format is – the csv module does a good job sorting this all out for you.

+
+
+
class Item(object):
+    def __init__(self):
+        self.name = ""
+        self.quantity = 0
+        self.unitprice = 0.0
+        self.total = 0.0
+    
+import csv
+
+reader = csv.reader(open("shopping.csv", "r"))
+
+headings = None
+
+shopping_list = []
+
+for row in reader:
+    if headings == None:
+        # first row
+        headings = row
+    else:
+        my_item = Item()
+        my_item.name = row[headings.index("item")]
+        my_item.quantity = row[headings.index("quantity")]
+        my_item.unitprice = row[headings.index("unit price")]
+        my_item.total = row[headings.index("total")]
+        shopping_list.append(my_item)
+    
+
+for i in shopping_list:
+    print ("item: {}, quantity: {}, unit price: {}, total: {}".format(i.name, i.quantity, i.unitprice, i.total))
+
+
+
+
+
item: apples, quantity: 2, unit price: 0.33, total: 0.66
+item: bananas, quantity: 5, unit price: 0.1, total: 0.5
+item: milk, quantity: 1, unit price: 2.5, total: 2.5
+item: soda, quantity: 3, unit price: 1, total: 3
+item: rolls, quantity: 12, unit price: 0.33, total: 3.96
+item: eggs, quantity: 1, unit price: 2.5, total: 2.5
+
+
+
+
+
+
+

INI Files#

+

INI or Config files are a common way of specifying options to a program. They can take the form (from the ConfigParser page):

+
[My Section]
+foodir: %(dir)s/whatever
+dir=frob
+long: this value continues
+   in the next line
+
+
+

Here we look at how to read in options and store them in a dictionary of the +form dict["sec.option"] = value

+

We’ll use a sample .ini file from a regression test suite (VARDEN-tests.ini)

+

(Note: the name of the module is ConfigParser in python 2 but configparser in python 3 – the latter confirms to the python style guidelines.)

+
+
+
import configparser
+
+options = {}
+
+
+cp = configparser.ConfigParser()
+cp.optionxform = str    # this makes options case-sensitive
+cp.read("VARDEN-tests.ini")
+
+for sec in cp.sections():
+    for opt in cp.options(sec):
+        key = str(sec) + "." + str(opt)
+        value = cp.get(sec,opt)
+        options[key] = value
+    
+for k, v in options.items():
+    print("{:32s}: {}".format(k, v))
+
+
+
+
+
main.boxLibDir                  : /home/regtester/RegTesting/BoxLib/
+main.sourceDir                  : /home/regtester/RegTesting/VARDEN/
+main.testTopDir                 : /home/regtester/RegTesting/rt-VARDEN/
+main.webTopDir                  : /home/regtester/RegTesting/rt-VARDEN/web
+main.compareToolDir             : /home/regtester/RegTesting/AmrPostprocessing/F_Src
+main.MAKE                       : make
+main.sourceTree                 : F_Src
+main.numMakeJobs                : 8
+main.COMP                       : g++
+main.FCOMP                      : gfortran
+main.suiteName                  : VARDEN
+main.reportActiveTestsOnly      : 1
+main.goUpLink                   : 1
+main.MPIcommand                 : /usr/local/bin/mpiexec -n @nprocs@ @command@
+main.MPIhost                    : 
+bubble-2d.buildDir              : varden/test
+bubble-2d.inputFile             : inputs_2d-regt
+bubble-2d.dim                   : 2
+bubble-2d.restartTest           : 0
+bubble-2d.useMPI                : 1
+bubble-2d.numprocs              : 2
+bubble-2d.useOMP                : 0
+bubble-2d.numthreads            : 2
+bubble-2d.compileTest           : 0
+bubble-2d.doVis                 : 0
+bubble-3d.buildDir              : varden/test
+bubble-3d.inputFile             : inputs_3d-regt
+bubble-3d.dim                   : 3
+bubble-3d.restartTest           : 0
+bubble-3d.useMPI                : 1
+bubble-3d.numprocs              : 3
+bubble-3d.useOMP                : 1
+bubble-3d.numthreads            : 2
+bubble-3d.compileTest           : 0
+bubble-3d.doVis                 : 0
+bubble-restart.buildDir         : varden/test
+bubble-restart.inputFile        : inputs-restart-regt
+bubble-restart.dim              : 3
+bubble-restart.restartTest      : 1
+bubble-restart.restartFileNum   : 4
+bubble-restart.useMPI           : 1
+bubble-restart.numprocs         : 3
+bubble-restart.useOMP           : 1
+bubble-restart.numthreads       : 2
+bubble-restart.compileTest      : 0
+bubble-restart.doVis            : 0
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/python.html b/01-python/python.html new file mode 100644 index 00000000..2c0756e4 --- /dev/null +++ b/01-python/python.html @@ -0,0 +1,583 @@ + + + + + + + + + + + python — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

python

+ +
+
+ +
+
+
+ + + + +
+ +
+

python#

+

These notebooks introduce the core python language

+
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/using.html b/01-python/using.html new file mode 100644 index 00000000..7877ee36 --- /dev/null +++ b/01-python/using.html @@ -0,0 +1,668 @@ + + + + + + + + + + + Using These Notes — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Using These Notes

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Using These Notes#

+

These notes are built via Jupyter book, as +a collection of Jupyter notebooks and markdown +pages.

+

The course is on Github at: +sbu-python-class/python-science, and the course +website is built automatically via a Github action each time a change +is pushed.

+

If you find any problems or have suggestions for improving the notes, +feel free to create an issue or pull request at the Github repo.

+
+

Interactive Usage#

+

For the Jupyter notebooks in this collection, there are a few ways to +access them to run them on your own.

+
    +
  • clicking on the icon in the upper right let’s +you download the raw notebook so you can run it on your local +computer.

  • +
  • clicking on the icon in the upper right will allow +you to run the notebook directly in the cloud. There are 2 different +compute clouds:

    +
      +
    • mybinder : this is an open project with +ties to the Jupyter project. It can take a few minutes for the +page to appear if it hasn’t been accessed recently, but then it +will give you the standard Jupyter experience.

    • +
    • Google colab : this is +Google’s version of an online notebook, which runs directly in +Google’s cloud. This starts up almost instantly.

    • +
    +
  • +
+
+

Note

+

Some notebooks use MyST Markdown to +allow for more styling. To see these styles, you need to install jupyterlab-myst, which +can be done via:

+
pip install jupyterlab_myst
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w1-jupyter.html b/01-python/w1-jupyter.html new file mode 100644 index 00000000..c08b85e5 --- /dev/null +++ b/01-python/w1-jupyter.html @@ -0,0 +1,726 @@ + + + + + + + + + + + Jupyter — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Jupyter

+ +
+
+ +
+
+
+ + + + +
+ +
+

Jupyter#

+

We’ll be using Jupyter for all of our examples – this allows us to run python in a web-based notebook, keeping a history of input and output, along with text and images.

+

For Jupyter help, visit: +https://jupyter.readthedocs.io/en/latest/content-quickstart.html

+
+

Note

+

There are several interfaces to Jupyter.

+

We will use JupyterLab, which is traditionally started at the command line via:

+
jupyter lab
+
+
+

The older (classic) interface is Jupyter Notebook, which can be started via:

+
jupyter notebook
+
+
+
+

We interact with python by typing into cells in the notebook.

+

By default, a cell is a code cell, which means that you can enter any valid python code into it and run it.

+

Another important type of cell is a markdown cell. This lets you put text, with different formatting (italics, bold, etc) that describes what the notebook is doing.

+

A “markdown cell” enables you to typeset LaTeX equations right in your notebook. Just put them in $ or $$:

+
+\[\frac{\partial \rho}{\partial t} + \nabla \cdot (\rho U) = 0\]
+
+

Tip

+

You can change the cell type via the menu at the top, or using the shortcuts:

+
    +
  • ctrl-m m : mark down cell

  • +
  • ctrl-m y : code cell

  • +
+
+

Some useful short-cuts:

+
    +
  • shift+enter = run cell and jump to the next (creating a new cell if there is no other new one)

  • +
  • ctrl+enter = run cell-in place

  • +
  • alt+enter = run cell and insert a new one below

  • +
+
+

Warning

+

When you work through a notebook, everything you did in previous cells is still in memory and known by python, so you can refer to functions and variables that were previously defined. Even if you go up to the top of a notebook and insert a cell, all the information done earlier in your notebook session is still defined – it doesn’t matter where physically you are in the notebook. If you want to reset things, you can use the options under the Kernel menu.

+
+
+

Quick Exercise

+

Create a new cell below this one. Make sure that it is a code cell, and enter the following code and run it:

+

+ print("Hello, World")
+ 
+
+
+
+

print() is a function in python that takes arguments (in the ()) and outputs to the screen. You can print multiple quantities at once like:

+
+
+
print(1, 2, 3)
+
+
+
+
+
1 2 3
+
+
+
+
+

Note that the default behavior in Jupyter is to print the return value from the last statement in a cell, so we don’t need to print if we just want the value of something like:

+
+
+
a = 10
+a
+
+
+
+
+
10
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w1-python-datatypes.html b/01-python/w1-python-datatypes.html new file mode 100644 index 00000000..8a776352 --- /dev/null +++ b/01-python/w1-python-datatypes.html @@ -0,0 +1,1355 @@ + + + + + + + + + + + Basic Python Datatypes — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Basic Python Datatypes

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Basic Python Datatypes#

+

Python is a dynamically typed language – this means that you don’t +need to specify ahead of time what kind of data you are going to store +in a variable. Nevertheless, there are some core datatypes that we +need to become familiar with as we use the language.

+

The first set of datatypes are similar to those found in other +languages (like C/C++ and Fortran): floating point numbers, integers, +and strings.

+
+

Tip

+

Floating point is essential for computational science. A great +introduction to floating point and its limitations is: What every +computer scientist should know about floating-point +arithmetic by +D. Goldberg.

+
+

The next set of datatypes are containers. In python, unlike some +languages, these are built into the language and make it very easy to +do complex operations. We’ll look at these later.

+

Some examples come from the python tutorial: +http://docs.python.org/3/tutorial/

+
+

integers#

+

Integers are numbers without a decimal point. They can be positive or negative. Most programming languages use a finite-amount of memory to store a single integer, but in python will expand the amount of memory as necessary to store large integers.

+

The basic operators, +, -, *, and / work with integers

+
+
+
2+2+3
+
+
+
+
+
7
+
+
+
+
+
+
+
2*-4
+
+
+
+
+
-8
+
+
+
+
+
+

Note

+

Integer division is one place where python and other programming languages differ. +In python, dividing two integers results in a float. In C/C++/Fortran, dividing two integers results in an integer, so 1/2 = 0.

+
+
+
+
1/2
+
+
+
+
+
0.5
+
+
+
+
+

To get an integer result, we can use the // operator.

+
+
+
1//2
+
+
+
+
+
0
+
+
+
+
+

Python is a dynamically-typed language—this means that we do not need to declare the datatype of a variable before initializing it.

+

Here we’ll create a variable (think of it as a descriptive label that can refer to some piece of data). The = operator assigns a value to a variable.

+
+
+
a = 1
+b = 2
+
+
+
+
+

Functions operate on variables and return a result. Here, print() will output to the screen.

+
+
+
a + b
+
+
+
+
+
3
+
+
+
+
+
+
+
a * b
+
+
+
+
+
2
+
+
+
+
+

Note that variable names are case sensitive, so a and A are different

+
+
+
A = 2048
+
+
+
+
+
+
+
print(a, A)
+
+
+
+
+
1 2048
+
+
+
+
+

Here we initialize 3 variable all to 0, but these are still distinct variables, so we can change one without affecting the others.

+
+
+
x = y = z = 0
+
+
+
+
+
+
+
print(x, y, z)
+
+
+
+
+
0 0 0
+
+
+
+
+
+
+
z = 1
+
+
+
+
+
+
+
z
+
+
+
+
+
1
+
+
+
+
+

Python has some built in help (and Jupyter/ipython has even more)

+

try doing:

+
help(x)
+
+
+

alternatively, try:

+
x?
+
+
+

(this only works in Jupyter)

+

Another function, type() returns the data type of a variable

+
+
+
type(x)
+
+
+
+
+
int
+
+
+
+
+
+

Note

+

In languages like Fortran and C, you specify the amount of memory an integer can take (usually 2 or 4 bytes). This puts a restriction on the largest size integer that can be represented. Python will adapt the size of the integer so you don’t overflow

+
+
+
+
a = 12345678901234567890123456789012345123456789012345678901234567890
+print(a)
+print(a.bit_length())
+print(type(a))
+
+
+
+
+
12345678901234567890123456789012345123456789012345678901234567890
+213
+<class 'int'>
+
+
+
+
+
+
+

floating point#

+

when operating with both floating point and integers, the result is promoted to a float.

+
+
+
1. + 2
+
+
+
+
+
3.0
+
+
+
+
+

but note the special integer division operator

+
+
+
1.//2
+
+
+
+
+
0.0
+
+
+
+
+
+

Important

+

Not every number can be represented in floating point. Since there are infinitely many real numbers between any two bounds but we are using a finite amount of memory, on a computer we have to approximate numbers. There is an IEEE standard for floating point that pretty much all languages and processors follow.

+

The means two things

+
    +
  • not every real number will have an exact representation in floating point

  • +
  • there is a finite precision to numbers – below this we lose track of differences (this is usually called roundoff error)

  • +
+
+

Consider the following expression, for example:

+
+
+
0.3/0.1 - 3
+
+
+
+
+
-4.440892098500626e-16
+
+
+
+
+

Here’s another example: The number 0.1 cannot be exactly represented on a computer. In our print, we use a format specifier (the stuff inside of the {}) to ask for more precision to be shown:

+
+
+
a = 0.1
+print("{:30.20}".format(a))
+
+
+
+
+
        0.10000000000000000555
+
+
+
+
+

we can ask python to report the limits on floating point

+
+
+
import sys
+sys.float_info
+
+
+
+
+
sys.float_info(max=1.7976931348623157e+308, max_exp=1024, max_10_exp=308, min=2.2250738585072014e-308, min_exp=-1021, min_10_exp=-307, dig=15, mant_dig=53, epsilon=2.220446049250313e-16, radix=2, rounds=1)
+
+
+
+
+

Note that this says that we can only store numbers between 2.2250738585072014e-308 and 1.7976931348623157e+308

+

We also see that the precision is 2.220446049250313e-16 (this is commonly called machine epsilon). To see this, consider adding a small number to 1.0. We’ll use the equality operator (==) to test if two numbers are equal:

+
+

Quick Exercise

+

Define two variables, \(a = 1\), and \(e = 10^{-16}\).

+

Now define a third variable, b = a + e

+

We can use the python == operator to test for equality. What do you expect b == a to return? run it an see if it agrees with your guess.

+
+
+
+

modules#

+

The core python language is extended by a standard library that provides additional functionality. These added pieces are in the form of modules that we can import into our python session (or program).

+

The math module provides functions that do the basic mathematical operations as well as provide constants (note there is a separate cmath module for complex numbers).

+

In python, you import a module. The functions are then defined in a separate namespace—this is a separate region that defines names and variables, etc. A variable in one namespace can have the same name as a variable in a different namespace, and they don’t clash. You use the “.” operator to access a member of a namespace.

+

By default, when you type stuff into the python interpreter or here in the Jupyter notebook, or in a script, it is in its own default namespace, and you don’t need to prefix any of the variables with a namespace indicator.

+
+
+
import math
+
+
+
+
+

math provides the value of pi

+
+
+
math.pi
+
+
+
+
+
3.141592653589793
+
+
+
+
+

This is distinct from any variable pi we might define here

+
+
+
pi = 3
+
+
+
+
+
+
+
print(pi, math.pi)
+
+
+
+
+
3 3.141592653589793
+
+
+
+
+

Note here that pi and math.pi are distinct from one another—they are in different namespaces.

+
+

floating point operations#

+

The same operators, +, -, *, / work are usual for floating point numbers. To raise an number to a power, we use the ** operator (this is the same as Fortran)

+
+
+
R = 2.0
+
+
+
+
+
+
+
math.pi * R**2
+
+
+
+
+
12.566370614359172
+
+
+
+
+

operator precedence follows that of most languages. See

+

https://docs.python.org/3/reference/expressions.html#operator-precedence

+

in order of precedence:

+
    +
  • quantities in ()

  • +
  • slicing, calls, subscripts

  • +
  • exponentiation (**)

  • +
  • +x, -x, ~x

  • +
  • *, @, /, //, %

  • +
  • +, -

  • +
+

(after this are bitwise operations and comparisons)

+

Parentheses can be used to override the precedence.

+
+

Quick Exercise

+

Consider the following expressions. Using the ideas of precedence, think about what value will result, then try it out in the cell below to see if you were right.

+
    +
  • 1 + 3*2**2

  • +
  • 1 + (3*2)**2

  • +
  • 2**3**2

  • +
+
+

The math module provides a lot of the standard math functions we might want to use.

+

For the trig functions, the expectation is that the argument to the function is in radians—you can use math.radians() to convert from degrees to radians, ex:

+
+
+
math.cos(math.radians(45))
+
+
+
+
+
0.7071067811865476
+
+
+
+
+

Notice that in that statement we are feeding the output of one function (math.radians()) into a second function, math.cos()

+

When in doubt, as for help to discover all of the things a module provides:

+
+
+
help(math.sin)
+
+
+
+
+
Help on built-in function sin in module math:
+
+sin(x, /)
+    Return the sine of x (measured in radians).
+
+
+
+
+
+
+
+

strings#

+

python doesn’t care if you use single or double quotes for strings:

+
+
+
a = "this is my string"
+b = 'another string'
+
+
+
+
+
+
+
print(a)
+print(b)
+
+
+
+
+
this is my string
+another string
+
+
+
+
+

Many of the usual mathematical operators are defined for strings as well. For example to concatenate or duplicate:

+
+
+
a + b
+
+
+
+
+
'this is my stringanother string'
+
+
+
+
+
+
+
a + ". " + b
+
+
+
+
+
'this is my string. another string'
+
+
+
+
+
+
+
a * 2
+
+
+
+
+
'this is my stringthis is my string'
+
+
+
+
+

There are several escape codes that are interpreted in strings. These start with a backwards-slash, \. E.g., you can use \n for new line

+
+
+
a = a + "\n"
+print(a)
+
+
+
+
+
this is my string
+
+
+
+
+
+

Quick Exercise

+

The input() function can be used to ask the user for input.

+
    +
  • Use help(input) to see how it works.

  • +
  • Write code to ask for input and store the result in a variable. input() will return a string.

  • +
  • Use the float() function to convert a number entered as input to a floating point variable.

  • +
  • Check to see if the conversion worked using the type() function.

  • +
+
+

“”” can enclose multiline strings. This is useful for docstrings at the start of functions (more on that later…)

+
+
+
c = """
+Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor 
+incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis 
+nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. 
+Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore 
+eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt 
+in culpa qui officia deserunt mollit anim id est laborum."""
+
+
+
+
+
+
+
print(c)
+
+
+
+
+
Lorem ipsum dolor sit amet, consectetur adipisicing elit, sed do eiusmod tempor 
+incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis 
+nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. 
+Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore 
+eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt 
+in culpa qui officia deserunt mollit anim id est laborum.
+
+
+
+
+

a raw string does not replace escape sequences (like \n). Just put a r before the first quote:

+
+
+
d = r"this is a raw string\n"
+d
+
+
+
+
+
'this is a raw string\\n'
+
+
+
+
+

slicing is used to access a portion of a string.

+

slicing a string can seem a bit counterintuitive if you are coming from Fortran. The trick is to think of the index as representing the left edge of a character in the string. When we do arrays later, the same will apply.

+

Also note that python (like C) uses 0-based indexing

+

Negative indices count from the right.

+
+
+
a = "this is my string"
+print(a)
+print(a[5:7])
+print(a[0])
+print(d)
+print(d[-2])
+
+
+
+
+
this is my string
+is
+t
+this is a raw string\n
+\
+
+
+
+
+
+

Quick Exercise:

+

Strings have a lot of methods (functions that know how to work with a particular datatype, in this case strings). A useful method is .find(). For a string a, +a.find(s) will return the index of the first occurrence of s.

+

For our string c above, find the first . (identifying the first full sentence), and print out just the first sentence in c using this result

+
+

there are also a number of methods and functions that work with strings. Here are some examples:

+
+
+
print(a.replace("this", "that"))
+print(len(a))
+print(a.strip())    # Also notice that strip removes the \n
+print(a.strip()[-1])
+
+
+
+
+
that is my string
+17
+this is my string
+g
+
+
+
+
+

Note that our original string, a, has not changed. In python, strings are immutable. Operations on strings return a new string.

+
+
+
a
+
+
+
+
+
'this is my string'
+
+
+
+
+
+
+
type(a)
+
+
+
+
+
str
+
+
+
+
+

We can format strings when we are printing to insert quantities in particular places in the string. A {} serves as a placeholder for a quantity and is replaced using the .format() method:

+
+
+
a = 1
+b = 2.0
+c = "test"
+print("a = {}; b = {}; c = {}".format(a, b, c))
+
+
+
+
+
a = 1; b = 2.0; c = test
+
+
+
+
+

But the more modern way to do this is to use f-strings

+
+
+
print(f"a = {a}; b = {b}; c = {c}")
+
+
+
+
+
a = 1; b = 2.0; c = test
+
+
+
+
+

Note the f preceding the starting "

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w2-python-advanced-datatypes.html b/01-python/w2-python-advanced-datatypes.html new file mode 100644 index 00000000..456d52f6 --- /dev/null +++ b/01-python/w2-python-advanced-datatypes.html @@ -0,0 +1,1130 @@ + + + + + + + + + + + Advanced Datatypes — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Advanced Datatypes

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Advanced Datatypes#

+

These notes follow the official python tutorial pretty closely: http://docs.python.org/3/tutorial/

+
+

Lists#

+

Lists group together data. Many languages have arrays (we’ll look at those in a bit in python). But unlike arrays in most languages, lists can hold data of all different types – they don’t need to be homogeneos. The data can be a mix of integers, floating point or complex #s, strings, or other objects (including other lists).

+

A list is defined using square brackets:

+
+
+
a = [1, 2.0, "my list", 4]
+
+
+
+
+
+
+
a
+
+
+
+
+
[1, 2.0, 'my list', 4]
+
+
+
+
+

We can index a list to get a single element – remember that python starts counting at 0:

+
+
+
a[2]
+
+
+
+
+
'my list'
+
+
+
+
+

Like with strings, mathematical operators are defined on lists:

+
+
+
a*2
+
+
+
+
+
[1, 2.0, 'my list', 4, 1, 2.0, 'my list', 4]
+
+
+
+
+

The len() function returns the length of a list

+
+
+
len(a)
+
+
+
+
+
4
+
+
+
+
+

Unlike strings, lists are mutable – you can change elements in a list easily

+
+
+
a[1] = -2.0
+a
+
+
+
+
+
[1, -2.0, 'my list', 4]
+
+
+
+
+

Just like everything else in python, a list is an object that is the instance of a class. Classes have methods (functions) that know how to operate on an object of that class.

+

There are lots of methods that work on lists. Two of the most useful are append, to add to the end of a list, and pop, to remove the last element:

+
+
+
a.append(6)
+a
+
+
+
+
+
[1, -2.0, 'my list', 4, 6]
+
+
+
+
+
+
+
a.pop()
+
+
+
+
+
6
+
+
+
+
+
+
+
a
+
+
+
+
+
[1, -2.0, 'my list', 4]
+
+
+
+
+
+

Quick Exercise

+

An operation we’ll see a lot is to begin with an empty list and add elements to it. An empty list is created as:

+

+ a = []
+ 
+
+
+
    +
  • Create an empty list

  • +
  • Append the integers 1 through 5 to it.

  • +
  • Now pop them out of the list one by one.

  • +
+
+
+

copying lists#

+

copying may seem a little counterintuitive at first. The best way to think about this is that your list lives in memory somewhere and when you do

+
a = [1, 2, 3, 4]
+
+
+

then the variable a is set to point to that location in memory, so it refers to the list.

+

If we then do

+
b = a
+
+
+

then b will also point to that same location in memory – the exact same list object.

+

Since these are both pointing to the same location in memory, if we change the list through a, the change is reflected in b as well:

+
+
+
a = [1, 2, 3, 4]
+b = a  # both a and b refer to the same list object in memory
+print(a)
+a[0] = "changed"
+print(b)
+
+
+
+
+
[1, 2, 3, 4]
+['changed', 2, 3, 4]
+
+
+
+
+

if you want to create a new object in memory that is a copy of another, then you can either index the list, using : to get all the elements, or use the list() function:

+
+
+
c = list(a)   # you can also do c = a[:], which basically slices the entire list
+a[1] = "two"
+print(a)
+print(c)
+
+
+
+
+
['changed', 'two', 3, 4]
+['changed', 2, 3, 4]
+
+
+
+
+

Things get a little complicated when a list contains another mutable object, like another list. Then the copy we looked at above is only a shallow copy.

+

When in doubt, use the id() function to figure out where in memory an object lies (you shouldn’t worry about the what value of the numbers you get from id mean, but just whether they are the same as those for another object)

+
+
+
print(id(a), id(b), id(c))
+
+
+
+
+
139879917535808 139879917535808 139879913031680
+
+
+
+
+

Or use the is operator

+
+
+
a is b
+
+
+
+
+
True
+
+
+
+
+
+
+
a is c
+
+
+
+
+
False
+
+
+
+
+

There are lots of other methods that work on lists (remember, ask for help)

+
+
+
my_list = [10, -1, 5, 24, 2, -1, 9]
+my_list.sort()
+my_list
+
+
+
+
+
[-1, -1, 2, 5, 9, 10, 24]
+
+
+
+
+
+
+
my_list.count(-1)
+
+
+
+
+
2
+
+
+
+
+

We can also insert elements

+
+
+
a.insert(3, "my inserted element")
+a
+
+
+
+
+
['changed', 'two', 3, 'my inserted element', 4]
+
+
+
+
+

joining two lists is simple. Like with strings, the + operator concatenates:

+
+
+
b = [1, 2, 3]
+c = [4, 5, 6]
+d = b + c
+d
+
+
+
+
+
[1, 2, 3, 4, 5, 6]
+
+
+
+
+
+
+
+

Dictionaries#

+

A dictionary stores data as a key:value pair. Unlike a list where you have a particular order, the keys in a dictionary allow you to access information anywhere easily:

+
+
+
my_dict = {"key1":1, "key2":2, "key3":3}
+
+
+
+
+
+
+
my_dict["key1"]
+
+
+
+
+
1
+
+
+
+
+

you can add a new key:pair easily, and it can be of any type

+
+
+
my_dict["newkey"] = "new"
+my_dict
+
+
+
+
+
{'key1': 1, 'key2': 2, 'key3': 3, 'newkey': 'new'}
+
+
+
+
+

You can also easily get the list of keys that are defined in a dictionary

+
+
+
keys = list(my_dict.keys())
+keys
+
+
+
+
+
['key1', 'key2', 'key3', 'newkey']
+
+
+
+
+

and check easily whether a key exists in the dictionary using the in operator

+
+
+
print("key1" in my_dict)
+print("invalidKey" in my_dict)
+
+
+
+
+
True
+False
+
+
+
+
+
+

Quick Exercise

+

Create a dictionary where the keys are the string names of the numbers zero to nine and the values are their numeric representation (0, 1, … , 5)

+
+
+
+

Tuples#

+

tuples are immutable – they cannot be changed, but they are useful for organizing data in some situations. We use () to indicate a tuple:

+
+
+
a = (1, 2, 3, 4)
+a
+
+
+
+
+
(1, 2, 3, 4)
+
+
+
+
+

We can unpack a tuple:

+
+
+
w, x, y, z = a
+
+
+
+
+
+
+
w
+
+
+
+
+
1
+
+
+
+
+

Since a tuple is immutable, we cannot change an element:

+
+
+
a[0] = 2
+
+
+
+
+
---------------------------------------------------------------------------
+TypeError                                 Traceback (most recent call last)
+Cell In[27], line 1
+----> 1 a[0] = 2
+
+TypeError: 'tuple' object does not support item assignment
+
+
+
+
+

But we can turn it into a list, and then we can change it

+
+
+
z = list(a)
+
+
+
+
+
+
+
z[0] = "new"
+
+
+
+
+
+
+
z
+
+
+
+
+
['new', 2, 3, 4]
+
+
+
+
+

It is often not clear how tuples differ from lists. The most obvious way is that they are immutable. Often we’ll see tuples used to store related data that should all be interpreted together. A good example is a Cartesian point, (x, y). Here is a list of points:

+
+
+
points = []
+points.append((1,2))
+points.append((2,3))
+points.append((3,4))
+points
+
+
+
+
+
[(1, 2), (2, 3), (3, 4)]
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w2-python-control-flow.html b/01-python/w2-python-control-flow.html new file mode 100644 index 00000000..efb8ec13 --- /dev/null +++ b/01-python/w2-python-control-flow.html @@ -0,0 +1,933 @@ + + + + + + + + + + + Control Flow — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Control Flow

+ +
+ +
+
+ + + + +
+ +
+

Control Flow#

+

These notes follow the official python tutorial pretty closely: http://docs.python.org/3/tutorial/

+

To write a program, we need the ability to iterate and take action based on the values of a variable. This includes if-tests and loops.

+

Python uses whitespace to denote a block of code.

+
+

While loop#

+

A simple while loop—notice the indentation to denote the block that is part of the loop.

+

Here we also use the compact += operator: n += 1 is the same as n = n + 1

+
+
+
n = 0
+while n < 10:
+    print(n)
+    n += 1
+
+
+
+
+
0
+1
+2
+3
+4
+5
+6
+7
+8
+9
+
+
+
+
+

This was a very simple example. But often we’ll use the range() function in this situation. Note that range() can take a stride.

+
+
+
for n in range(2, 10, 2):
+    print(n)
+
+
+
+
+
2
+4
+6
+8
+
+
+
+
+
+
+

if statements#

+

if allows for branching. python does not have a select/case statement like some other languages, but if, elif, and else can reproduce any branching functionality you might need.

+
+
+
x = 0
+
+if x < 0:
+    print("negative")
+elif x == 0:
+    print("zero")
+else:
+    print("positive")
+
+
+
+
+
zero
+
+
+
+
+
+
+

Iterating over elements#

+

it’s easy to loop over items in a list or any iterable object. The in operator is the key here.

+
+
+
alist = [1, 2.0, "three", 4]
+for a in alist:
+    print(a)
+
+
+
+
+
1
+2.0
+three
+4
+
+
+
+
+
+
+
for c in "this is a string":
+    print(c)
+
+
+
+
+
t
+h
+i
+s
+ 
+i
+s
+ 
+a
+ 
+s
+t
+r
+i
+n
+g
+
+
+
+
+

We can combine loops and if-tests to do more complex logic, like break out of the loop when you find what you’re looking for

+
+
+
n = 0
+for a in alist:
+    if a == "three":
+        break
+    else:
+        n += 1
+
+print(n)
+
+
+
+
+
2
+
+
+
+
+

(for that example, however, there is a simpler way)

+
+
+
alist.index("three")
+
+
+
+
+
2
+
+
+
+
+

for dictionaries, you can also loop over the elements

+
+
+
my_dict = {"key1":1, "key2":2, "key3":3}
+
+for k, v in my_dict.items():
+    print(f"key = {k}, value = {v}")
+
+
+
+
+
key = key1, value = 1
+key = key2, value = 2
+key = key3, value = 3
+
+
+
+
+
+
+
for k in sorted(my_dict):
+    print(k, my_dict[k])
+
+
+
+
+
key1 1
+key2 2
+key3 3
+
+
+
+
+

sometimes we want to loop over a list element and know its index – enumerate() helps here:

+
+
+
for n, a in enumerate(alist):
+    print(n, a)
+
+
+
+
+
0 1
+1 2.0
+2 three
+3 4
+
+
+
+
+
+

Quick Exercise

+

zip() allows us to loop over two iterables at the same time. Consider the following two +lists:

+

+ a = [1, 2, 3, 4, 5, 6, 7, 8]
+ b = ["a", "b", "c", "d", "e", "f", "g", "h"]
+ 
+
+
+

zip(a, b) will act like a list with each element a tuple with one item from a and the corresponding element from b.

+

Try looping over these lists together (using zip()) and print the corresponding elements from each list together on a single line.

+
+
+

Quick Exercise

+

The .split() function on a string can split it into words (separating on spaces).

+

Using .split(), loop over the words in the string

+

a = "The quick brown fox jumped over the lazy dog"

+

and print one word per line

+
+
+
+

List Comprehensions#

+

list comprehensions provide a compact way to initialize lists. Some examples from the tutorial

+
+
+
squares = [x**2 for x in range(10)]
+
+
+
+
+
+
+
squares
+
+
+
+
+
[0, 1, 4, 9, 16, 25, 36, 49, 64, 81]
+
+
+
+
+
+

Quick Exercise

+

Use a list comprehension to create a new list from squares containing only the even numbers. It might be helpful to use the modulus operator, %

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w2-python-exercises.html b/01-python/w2-python-exercises.html new file mode 100644 index 00000000..8fa52f84 --- /dev/null +++ b/01-python/w2-python-exercises.html @@ -0,0 +1,1507 @@ + + + + + + + + + + + Exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Exercises

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Exercises#

+
+

Q 1#

+

When talking about floating point, we discussed machine epsilon, \(\epsilon\)—this is the smallest number that when added to 1 is still different from 1.

+

We’ll compute \(\epsilon\) here:

+
    +
  • Pick an initial guess for \(\epsilon\) of eps = 1.

  • +
  • Create a loop that checks whether 1 + eps is different from 1

  • +
  • Each loop iteration, cut the value of eps in half

  • +
+

What value of \(\epsilon\) do you find?

+
+
+

Q 2#

+

To iterate over the tuples, where the i-th tuple contains the i-th elements of certain sequences, we can use zip(*sequences) function.

+

We will iterate over two lists, names and age, and print out the resulting tuples.

+
    +
  • Start by initializing lists names = ["Mary", "John", "Sarah"] and age = [21, 56, 98].

  • +
  • Iterate over the tuples containing a name and an age, the zip(list1, list2) function might be useful here.

  • +
  • Print out formatted strings of the type “NAME is AGE years old”.

  • +
+
+
+

Q 3#

+

The function enumerate(sequence) returns tuples containing indices of objects in the sequence, and the objects.

+

The random module provides tools for working with the random numbers. In particular, random.randint(start, end) generates a random number not smaller than start, and not bigger than end.

+
    +
  • Generate a list of 10 random numbers from 0 to 9.

  • +
  • Using the enumerate(random_list) function, iterate over the tuples of random numbers and their indices, and print out “Match: NUMBER and INDEX” if the random number and its index in the list match.

  • +
+
+
+
import random
+
+random_number = random.randint(0,9)
+print(random_number)
+
+
+
+
+
4
+
+
+
+
+
+
+

Q 4#

+

The Fibbonacci sequence is a numerical sequence where each number is the sum of the 2 preceding numbers, e.g., 1, 1, 2, 3, 5, 8, 13, …

+

Create a list where the elements are the terms in the Fibbonacci sequence:

+
    +
  • Start with the list fib = [1, 1]

  • +
  • Loop 25 times, compute the next term as the sum of the previous 2 terms and append to the list

  • +
  • After the loop is complete, print out the terms

  • +
+

You may find it useful to use fib[-1] and fib[-2] to access the last to items in the list

+
+
+

Q 5#

+

We can use the input() function to ask for input from the prompt (note: in python 2 the function was called raw_input()).

+

Create an empty list and use a while loop to ask the user for input and append their input to the list. Keep looping until 10 items are added to the list

+
+
+

Q 6#

+

Here is a list of book titles (from http://thegreatestbooks.org). Loop through the list and capitalize each word in each title. You might find the .capitalize() method that works on strings useful.

+
+
+
titles = ["don quixote", 
+          "in search of lost time", 
+          "ulysses", 
+          "the odyssey", 
+          "war and piece", 
+          "moby dick", 
+          "the divine comedy", 
+          "hamlet", 
+          "the adventures of huckleberry finn", 
+          "the great gatsby"]
+
+
+
+
+
+
+

Q 7#

+

Here’s some text (the Gettysburg Address). Our goal is to count how many times each word repeats. We’ll do a brute force method first, and then we’ll look a ways to do it more efficiently (and compactly).

+
+
+
gettysburg_address = """
+Four score and seven years ago our fathers brought forth on this continent, 
+a new nation, conceived in Liberty, and dedicated to the proposition that 
+all men are created equal.
+
+Now we are engaged in a great civil war, testing whether that nation, or 
+any nation so conceived and so dedicated, can long endure. We are met on
+a great battle-field of that war. We have come to dedicate a portion of
+that field, as a final resting place for those who here gave their lives
+that that nation might live. It is altogether fitting and proper that we
+should do this.
+
+But, in a larger sense, we can not dedicate -- we can not consecrate -- we
+can not hallow -- this ground. The brave men, living and dead, who struggled
+here, have consecrated it, far above our poor power to add or detract.  The
+world will little note, nor long remember what we say here, but it can never
+forget what they did here. It is for us the living, rather, to be dedicated
+here to the unfinished work which they who fought here have thus far so nobly
+advanced. It is rather for us to be here dedicated to the great task remaining
+before us -- that from these honored dead we take increased devotion to that
+cause for which they gave the last full measure of devotion -- that we here
+highly resolve that these dead shall not have died in vain -- that this
+nation, under God, shall have a new birth of freedom -- and that government
+of the people, by the people, for the people, shall not perish from the earth.
+"""
+
+
+
+
+

We’ve already seen the .split() method will, by default, split by spaces, so it will split this into words, producing a list:

+
+
+
ga = gettysburg_address.split()
+
+
+
+
+
+
+
ga
+
+
+
+
+
['Four',
+ 'score',
+ 'and',
+ 'seven',
+ 'years',
+ 'ago',
+ 'our',
+ 'fathers',
+ 'brought',
+ 'forth',
+ 'on',
+ 'this',
+ 'continent,',
+ 'a',
+ 'new',
+ 'nation,',
+ 'conceived',
+ 'in',
+ 'Liberty,',
+ 'and',
+ 'dedicated',
+ 'to',
+ 'the',
+ 'proposition',
+ 'that',
+ 'all',
+ 'men',
+ 'are',
+ 'created',
+ 'equal.',
+ 'Now',
+ 'we',
+ 'are',
+ 'engaged',
+ 'in',
+ 'a',
+ 'great',
+ 'civil',
+ 'war,',
+ 'testing',
+ 'whether',
+ 'that',
+ 'nation,',
+ 'or',
+ 'any',
+ 'nation',
+ 'so',
+ 'conceived',
+ 'and',
+ 'so',
+ 'dedicated,',
+ 'can',
+ 'long',
+ 'endure.',
+ 'We',
+ 'are',
+ 'met',
+ 'on',
+ 'a',
+ 'great',
+ 'battle-field',
+ 'of',
+ 'that',
+ 'war.',
+ 'We',
+ 'have',
+ 'come',
+ 'to',
+ 'dedicate',
+ 'a',
+ 'portion',
+ 'of',
+ 'that',
+ 'field,',
+ 'as',
+ 'a',
+ 'final',
+ 'resting',
+ 'place',
+ 'for',
+ 'those',
+ 'who',
+ 'here',
+ 'gave',
+ 'their',
+ 'lives',
+ 'that',
+ 'that',
+ 'nation',
+ 'might',
+ 'live.',
+ 'It',
+ 'is',
+ 'altogether',
+ 'fitting',
+ 'and',
+ 'proper',
+ 'that',
+ 'we',
+ 'should',
+ 'do',
+ 'this.',
+ 'But,',
+ 'in',
+ 'a',
+ 'larger',
+ 'sense,',
+ 'we',
+ 'can',
+ 'not',
+ 'dedicate',
+ '--',
+ 'we',
+ 'can',
+ 'not',
+ 'consecrate',
+ '--',
+ 'we',
+ 'can',
+ 'not',
+ 'hallow',
+ '--',
+ 'this',
+ 'ground.',
+ 'The',
+ 'brave',
+ 'men,',
+ 'living',
+ 'and',
+ 'dead,',
+ 'who',
+ 'struggled',
+ 'here,',
+ 'have',
+ 'consecrated',
+ 'it,',
+ 'far',
+ 'above',
+ 'our',
+ 'poor',
+ 'power',
+ 'to',
+ 'add',
+ 'or',
+ 'detract.',
+ 'The',
+ 'world',
+ 'will',
+ 'little',
+ 'note,',
+ 'nor',
+ 'long',
+ 'remember',
+ 'what',
+ 'we',
+ 'say',
+ 'here,',
+ 'but',
+ 'it',
+ 'can',
+ 'never',
+ 'forget',
+ 'what',
+ 'they',
+ 'did',
+ 'here.',
+ 'It',
+ 'is',
+ 'for',
+ 'us',
+ 'the',
+ 'living,',
+ 'rather,',
+ 'to',
+ 'be',
+ 'dedicated',
+ 'here',
+ 'to',
+ 'the',
+ 'unfinished',
+ 'work',
+ 'which',
+ 'they',
+ 'who',
+ 'fought',
+ 'here',
+ 'have',
+ 'thus',
+ 'far',
+ 'so',
+ 'nobly',
+ 'advanced.',
+ 'It',
+ 'is',
+ 'rather',
+ 'for',
+ 'us',
+ 'to',
+ 'be',
+ 'here',
+ 'dedicated',
+ 'to',
+ 'the',
+ 'great',
+ 'task',
+ 'remaining',
+ 'before',
+ 'us',
+ '--',
+ 'that',
+ 'from',
+ 'these',
+ 'honored',
+ 'dead',
+ 'we',
+ 'take',
+ 'increased',
+ 'devotion',
+ 'to',
+ 'that',
+ 'cause',
+ 'for',
+ 'which',
+ 'they',
+ 'gave',
+ 'the',
+ 'last',
+ 'full',
+ 'measure',
+ 'of',
+ 'devotion',
+ '--',
+ 'that',
+ 'we',
+ 'here',
+ 'highly',
+ 'resolve',
+ 'that',
+ 'these',
+ 'dead',
+ 'shall',
+ 'not',
+ 'have',
+ 'died',
+ 'in',
+ 'vain',
+ '--',
+ 'that',
+ 'this',
+ 'nation,',
+ 'under',
+ 'God,',
+ 'shall',
+ 'have',
+ 'a',
+ 'new',
+ 'birth',
+ 'of',
+ 'freedom',
+ '--',
+ 'and',
+ 'that',
+ 'government',
+ 'of',
+ 'the',
+ 'people,',
+ 'by',
+ 'the',
+ 'people,',
+ 'for',
+ 'the',
+ 'people,',
+ 'shall',
+ 'not',
+ 'perish',
+ 'from',
+ 'the',
+ 'earth.']
+
+
+
+
+

Now, the next problem is that some of these still have punctuation. In particular, we see “.”, “,”, and “--“.

+

When considering a word, we can get rid of these by using the replace() method:

+
+
+
a = "end.,"
+b = a.replace(".", "").replace(",", "")
+b
+
+
+
+
+
'end'
+
+
+
+
+

Another problem is case—we want to count “but” and “But” as the same. Strings have a lower() method that can be used to convert a string:

+
+
+
a = "But"
+b = "but"
+a == b
+
+
+
+
+
False
+
+
+
+
+
+
+
a.lower() == b.lower()
+
+
+
+
+
True
+
+
+
+
+

Recall that strings are immutable, so replace() produces a new string on output.

+
+
+

your task#

+

Create a dictionary that uses the unique words as keys and has as a value the number of times that word appears.

+

Write a loop over the words in the string (using our split version) and do the following:

+
    +
  • remove any punctuation

  • +
  • convert to lowercase

  • +
  • test if the word is already a key in the dictionary (using the in operator)

    +
      +
    • if the key exists, increment the word count for that key

    • +
    • otherwise, add it to the dictionary with the appropriate count of 1.

    • +
    +
  • +
+

At the end, print out the words and a count of how many times they appear

+
+
+
# your code here
+
+
+
+
+
+
+

More compact way#

+

We can actually do this a lot more compactly by using another list comprehensions and another python datatype called a set. A set is a group of items, where each item is unique (e.g., no repetitions).

+

Here’s a list comprehension that removes all the punctuation and converts to lower case:

+
+
+
words = [q.lower().replace(".", "").replace(",", "") for q in ga]
+
+
+
+
+

and by using the set() function, we turn the list into a set, removing any duplicates:

+
+
+
unique_words = set(words)
+
+
+
+
+

now we can loop over the unique words and use the count method of a list to find how many there are

+
+
+
count = {}
+for uw in unique_words:
+    count[uw] = words.count(uw)
+    
+count
+
+
+
+
+
{'vain': 1,
+ 'fathers': 1,
+ 'died': 1,
+ 'birth': 1,
+ 'us': 3,
+ 'battle-field': 1,
+ 'great': 3,
+ 'or': 2,
+ 'brought': 1,
+ 'and': 6,
+ 'should': 1,
+ 'resolve': 1,
+ 'as': 1,
+ 'are': 3,
+ 'final': 1,
+ 'live': 1,
+ 'we': 10,
+ 'remaining': 1,
+ 'whether': 1,
+ 'now': 1,
+ 'consecrate': 1,
+ 'rather': 2,
+ 'far': 2,
+ 'a': 7,
+ 'which': 2,
+ 'honored': 1,
+ 'little': 1,
+ 'consecrated': 1,
+ 'but': 2,
+ 'freedom': 1,
+ 'endure': 1,
+ 'government': 1,
+ 'fought': 1,
+ 'who': 3,
+ 'unfinished': 1,
+ 'poor': 1,
+ 'detract': 1,
+ 'under': 1,
+ 'people': 3,
+ 'before': 1,
+ 'lives': 1,
+ 'dead': 3,
+ 'above': 1,
+ 'nobly': 1,
+ 'can': 5,
+ 'increased': 1,
+ 'forget': 1,
+ 'proposition': 1,
+ 'proper': 1,
+ 'fitting': 1,
+ 'all': 1,
+ 'sense': 1,
+ 'engaged': 1,
+ 'portion': 1,
+ 'gave': 2,
+ 'did': 1,
+ 'come': 1,
+ 'for': 5,
+ 'long': 2,
+ 'perish': 1,
+ 'devotion': 2,
+ 'to': 8,
+ 'work': 1,
+ 'field': 1,
+ 'do': 1,
+ 'measure': 1,
+ 'forth': 1,
+ 'add': 1,
+ 'earth': 1,
+ 'continent': 1,
+ 'it': 5,
+ 'advanced': 1,
+ '--': 7,
+ 'highly': 1,
+ 'years': 1,
+ 'altogether': 1,
+ 'cause': 1,
+ 'equal': 1,
+ 'any': 1,
+ 'struggled': 1,
+ 'god': 1,
+ 'remember': 1,
+ 'seven': 1,
+ 'what': 2,
+ 'nor': 1,
+ 'the': 11,
+ 'they': 3,
+ 'might': 1,
+ 'note': 1,
+ 'new': 2,
+ 'score': 1,
+ 'larger': 1,
+ 'never': 1,
+ 'dedicate': 2,
+ 'their': 1,
+ 'be': 2,
+ 'shall': 3,
+ 'that': 13,
+ 'met': 1,
+ 'in': 4,
+ 'our': 2,
+ 'so': 3,
+ 'full': 1,
+ 'place': 1,
+ 'say': 1,
+ 'world': 1,
+ 'by': 1,
+ 'task': 1,
+ 'ago': 1,
+ 'on': 2,
+ 'not': 5,
+ 'living': 2,
+ 'conceived': 2,
+ 'hallow': 1,
+ 'testing': 1,
+ 'will': 1,
+ 'take': 1,
+ 'is': 3,
+ 'power': 1,
+ 'of': 5,
+ 'this': 4,
+ 'resting': 1,
+ 'last': 1,
+ 'four': 1,
+ 'have': 5,
+ 'these': 2,
+ 'created': 1,
+ 'brave': 1,
+ 'from': 2,
+ 'war': 2,
+ 'ground': 1,
+ 'those': 1,
+ 'civil': 1,
+ 'here': 8,
+ 'liberty': 1,
+ 'thus': 1,
+ 'men': 2,
+ 'nation': 5,
+ 'dedicated': 4}
+
+
+
+
+

Even shorter – we can use a dictionary comprehension, like a list comprehension

+
+
+
c = {uw: count[uw] for uw in unique_words}
+
+
+
+
+
+
+
c
+
+
+
+
+
{'vain': 1,
+ 'fathers': 1,
+ 'died': 1,
+ 'birth': 1,
+ 'us': 3,
+ 'battle-field': 1,
+ 'great': 3,
+ 'or': 2,
+ 'brought': 1,
+ 'and': 6,
+ 'should': 1,
+ 'resolve': 1,
+ 'as': 1,
+ 'are': 3,
+ 'final': 1,
+ 'live': 1,
+ 'we': 10,
+ 'remaining': 1,
+ 'whether': 1,
+ 'now': 1,
+ 'consecrate': 1,
+ 'rather': 2,
+ 'far': 2,
+ 'a': 7,
+ 'which': 2,
+ 'honored': 1,
+ 'little': 1,
+ 'consecrated': 1,
+ 'but': 2,
+ 'freedom': 1,
+ 'endure': 1,
+ 'government': 1,
+ 'fought': 1,
+ 'who': 3,
+ 'unfinished': 1,
+ 'poor': 1,
+ 'detract': 1,
+ 'under': 1,
+ 'people': 3,
+ 'before': 1,
+ 'lives': 1,
+ 'dead': 3,
+ 'above': 1,
+ 'nobly': 1,
+ 'can': 5,
+ 'increased': 1,
+ 'forget': 1,
+ 'proposition': 1,
+ 'proper': 1,
+ 'fitting': 1,
+ 'all': 1,
+ 'sense': 1,
+ 'engaged': 1,
+ 'portion': 1,
+ 'gave': 2,
+ 'did': 1,
+ 'come': 1,
+ 'for': 5,
+ 'long': 2,
+ 'perish': 1,
+ 'devotion': 2,
+ 'to': 8,
+ 'work': 1,
+ 'field': 1,
+ 'do': 1,
+ 'measure': 1,
+ 'forth': 1,
+ 'add': 1,
+ 'earth': 1,
+ 'continent': 1,
+ 'it': 5,
+ 'advanced': 1,
+ '--': 7,
+ 'highly': 1,
+ 'years': 1,
+ 'altogether': 1,
+ 'cause': 1,
+ 'equal': 1,
+ 'any': 1,
+ 'struggled': 1,
+ 'god': 1,
+ 'remember': 1,
+ 'seven': 1,
+ 'what': 2,
+ 'nor': 1,
+ 'the': 11,
+ 'they': 3,
+ 'might': 1,
+ 'note': 1,
+ 'new': 2,
+ 'score': 1,
+ 'larger': 1,
+ 'never': 1,
+ 'dedicate': 2,
+ 'their': 1,
+ 'be': 2,
+ 'shall': 3,
+ 'that': 13,
+ 'met': 1,
+ 'in': 4,
+ 'our': 2,
+ 'so': 3,
+ 'full': 1,
+ 'place': 1,
+ 'say': 1,
+ 'world': 1,
+ 'by': 1,
+ 'task': 1,
+ 'ago': 1,
+ 'on': 2,
+ 'not': 5,
+ 'living': 2,
+ 'conceived': 2,
+ 'hallow': 1,
+ 'testing': 1,
+ 'will': 1,
+ 'take': 1,
+ 'is': 3,
+ 'power': 1,
+ 'of': 5,
+ 'this': 4,
+ 'resting': 1,
+ 'last': 1,
+ 'four': 1,
+ 'have': 5,
+ 'these': 2,
+ 'created': 1,
+ 'brave': 1,
+ 'from': 2,
+ 'war': 2,
+ 'ground': 1,
+ 'those': 1,
+ 'civil': 1,
+ 'here': 8,
+ 'liberty': 1,
+ 'thus': 1,
+ 'men': 2,
+ 'nation': 5,
+ 'dedicated': 4}
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w3-python-exceptions.html b/01-python/w3-python-exceptions.html new file mode 100644 index 00000000..2b371e7d --- /dev/null +++ b/01-python/w3-python-exceptions.html @@ -0,0 +1,744 @@ + + + + + + + + + + + Exceptions — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Exceptions

+ +
+
+ +
+
+
+ + + + +
+ +
+

Exceptions#

+

Python raises exceptions when it encounters an error. The idea is that you can trap these exceptions and take an appropriate action instead of causing the code to crash. The mechanism for this is try / except. Here’s an example that causes an exception, ZeroDivisionError:

+
+
+
a = 1/0
+
+
+
+
+
---------------------------------------------------------------------------
+ZeroDivisionError                         Traceback (most recent call last)
+Cell In[1], line 1
+----> 1 a = 1/0
+
+ZeroDivisionError: division by zero
+
+
+
+
+

and here we handle this

+
+
+
try:
+    a = 1/0
+except ZeroDivisionError:
+    print("warning: you divided by zero")
+    a = 1
+
+a
+
+
+
+
+
warning: you divided by zero
+
+
+
1
+
+
+
+
+

another example—trying to access a key that doesn’t exist in a dictionary:

+
+
+
dict = {"a":1, "b":2, "c":3}
+print(dict["d"])
+
+
+
+
+
---------------------------------------------------------------------------
+KeyError                                  Traceback (most recent call last)
+Cell In[3], line 2
+      1 dict = {"a":1, "b":2, "c":3}
+----> 2 print(dict["d"])
+
+KeyError: 'd'
+
+
+
+
+

KeyError is the exception that was raised. We can check for this and take the appropriate action instead

+
+
+
try:
+    val = dict["d"]
+except KeyError:
+    val = None
+
+print(val)
+
+
+
+
+
None
+
+
+
+
+

We haven’t talked about I/O yet, but as you might expect, when you open a file, you get an object which you can then interact with. Here we try to open a file for reading that does not already exist.

+
+
+
try:
+    f = open("file.txt", "r")
+except IOError:
+    print("error: that file does not exist")
+
+
+
+
+
error: that file does not exist
+
+
+
+
+

There are a lot of different types of exceptions that you can catch, and you can catch multiple ones per except clause or have multiple except clauses. You probably won’t be able to anticipate every failure mode in advance. In that case, when you run and your code crashes because of an exception, the python interpreter will print out the name of the exception and you can then modify your code to take the appropriate action.

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w3-python-exercises.html b/01-python/w3-python-exercises.html new file mode 100644 index 00000000..090fc982 --- /dev/null +++ b/01-python/w3-python-exercises.html @@ -0,0 +1,983 @@ + + + + + + + + + + + Exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

Exercises#

+
+

Q 1 (function practice)#

+

Let’s practice functions. Here’s a simple function that takes a string and returns a list of all the 4 letter words:

+
+
+
def four_letter_words(message):
+    words = message.split()
+    four_letters = [w for w in words if len(w) == 4]
+    return four_letters
+
+
+
+
+
+
+
message = "The quick brown fox jumps over the lazy dog"
+print(four_letter_words(message))
+
+
+
+
+
['over', 'lazy']
+
+
+
+
+

Write a version of this function that takes a second argument, n, that is the word length we want to search for

+
+
+

Q 2 (primes)#

+

A prime number is divisible only by 1 and itself. We want to write a function that takes a positive integer, n, and finds all of the primes up to that number.

+

A simple (although not very fast) way to find the primes is to start at 1, and build a list of primes by checking if the current number is divisible by any of the previously found primes. If it is not divisible by any earlier primes, then it is a prime.

+

The modulus operator, % could be helpful here.

+
+
+

Q 3 (exceptions for error handling)#

+

We want to safely convert a string into a float, int, or leave it as a string, depending on its contents. As we’ve already seen, python provides float() and int() functions for this:

+
+
+
a = "2.0"
+b = float(a)
+print(b, type(b))
+
+
+
+
+
2.0 <class 'float'>
+
+
+
+
+

But these throw exceptions if the conversion is not possible

+
+
+
a = "this is a string"
+b = float(a)
+
+
+
+
+
---------------------------------------------------------------------------
+ValueError                                Traceback (most recent call last)
+Cell In[4], line 2
+      1 a = "this is a string"
+----> 2 b = float(a)
+
+ValueError: could not convert string to float: 'this is a string'
+
+
+
+
+
+
+
a = "1.2345"
+b = int(a)
+print(b, type(b))
+
+
+
+
+
---------------------------------------------------------------------------
+ValueError                                Traceback (most recent call last)
+Cell In[5], line 2
+      1 a = "1.2345"
+----> 2 b = int(a)
+      3 print(b, type(b))
+
+ValueError: invalid literal for int() with base 10: '1.2345'
+
+
+
+
+
+
+
b = float(a)
+print(b, type(b))
+
+
+
+
+
1.2345 <class 'float'>
+
+
+
+
+

Notice that an int can be converted to a float, but if you convert a float to an int, you rise losing significant digits. A string cannot be converted to either.

+
+

your task#

+

Write a function, convert_type(a) that takes a string a, and converts it to a float if it is a number with a decimal point, an int if it is an integer, or leaves it as a string otherwise, and returns the result. You’ll want to use exceptions to prevent the code from aborting.

+
+
+
+

Q 4 (tic-tac-toe)#

+

Here we’ll write a simple tic-tac-toe game that 2 players can play. First we’ll create a string that represents our game board:

+
+
+
board = """
+ {s1:^3} | {s2:^3} | {s3:^3}
+-----+-----+-----
+ {s4:^3} | {s5:^3} | {s6:^3}
+-----+-----+-----      123
+ {s7:^3} | {s8:^3} | {s9:^3}       456
+                       789  
+"""
+
+
+
+
+

This board will look a little funny if we just print it—the spacing is set to look right when we replace the {} with x or o

+
+
+
print(board)
+
+
+
+
+
 {s1:^3} | {s2:^3} | {s3:^3}
+-----+-----+-----
+ {s4:^3} | {s5:^3} | {s6:^3}
+-----+-----+-----      123
+ {s7:^3} | {s8:^3} | {s9:^3}       456
+                       789  
+
+
+
+
+

and well use a dictionary to denote the status of each square, “x”, “o”, or empty, “”

+
+
+
play = {}
+
+def initialize_board(play):
+    for n in range(9):
+        play[f"s{n+1}"] = ""
+
+initialize_board(play)
+play
+
+
+
+
+
{'s1': '',
+ 's2': '',
+ 's3': '',
+ 's4': '',
+ 's5': '',
+ 's6': '',
+ 's7': '',
+ 's8': '',
+ 's9': ''}
+
+
+
+
+

Note that our {} placeholders in the board string have identifiers (the numbers in the {}). We can use these to match the variables we want to print to the placeholder in the string, regardless of the order in the format()

+
+
+
a = "{s1:} {s2:}".format(s2=1, s1=2)
+a
+
+
+
+
+
'2 1'
+
+
+
+
+

Here’s an easy way to add the values of our dictionary to the appropriate squares in our game board. First note that each of the {} is labeled with a number that matches the keys in our dictionary. Python provides a way to unpack a dictionary into labeled arguments, using **

+

This lets us to write a function to show the tic-tac-toe board.

+
+
+
def show_board(play):
+    """ display the playing board.  We take a dictionary with the current state of the board
+    We rely on the board string to be a global variable"""
+    print(board.format(**play))
+    
+show_board(play)
+
+
+
+
+
     |     |    
+-----+-----+-----
+     |     |    
+-----+-----+-----      123
+     |     |           456
+                       789  
+
+
+
+
+

Now we need a function that asks a player for a move:

+
+
+
def get_move(n, xo, play):
+    """ ask the current player, n, to make a move -- make sure the square was not 
+        already played.  xo is a string of the character (x or o) we will place in
+        the desired square """
+    valid_move = False
+    while not valid_move:
+        idx = input(f"player {n}, enter your move (1-9)")
+        if play[f"s{idx}"] == "":
+            valid_move = True
+        else:
+            print("invalid move")
+            
+    play[f"s{idx}"] = xo
+
+
+
+
+
+
+
help(get_move)
+
+
+
+
+
Help on function get_move in module __main__:
+
+get_move(n, xo, play)
+    ask the current player, n, to make a move -- make sure the square was not
+    already played.  xo is a string of the character (x or o) we will place in
+    the desired square
+
+
+
+
+
+

your task#

+

Using the functions defined above,

+
    +
  • initialize_board()

  • +
  • show_board()

  • +
  • get_move()

  • +
+

fill in the function play_game() below to complete the game, asking for the moves one at a time, alternating between player 1 and 2

+
+
+
def play_game():
+    """ play a game of tic-tac-toe """
+    
+    play ={}
+    initialize_board(play)
+    show_board(play)
+
+
+
+
+
+
+
play_game()
+
+
+
+
+
     |     |    
+-----+-----+-----
+     |     |    
+-----+-----+-----      123
+     |     |           456
+                       789  
+
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w3-python-functions.html b/01-python/w3-python-functions.html new file mode 100644 index 00000000..c88b32e4 --- /dev/null +++ b/01-python/w3-python-functions.html @@ -0,0 +1,990 @@ + + + + + + + + + + + Functions — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Functions

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Functions#

+

Functions are used to organize program flow, especially to allow us to easily do commonly needed tasks over and over again. We’ve already used a lot of functions, such as those that work on lists (append() and pop()) or strings (like replace()). Here we see how to write our own functions

+

A function takes arguments, listed in the () and returns a value. Even if you don’t explicitly give a return value, one will be return (e.g., None).

+

Here’s a simple example of a function that takes a single argument, i

+
+
+
def my_fun(i):
+    print(f"in the function, i = {i}")
+
+
+
+
+
+
+
my_fun(10)
+my_fun(5)
+
+
+
+
+
in the function, i = 10
+in the function, i = 5
+
+
+
+
+
+

Note

+

Functions are one place where scope comes into play. A function has its own namespace. If a variable is not defined in that function, then it will look to the namespace from where it was called to see if that variable exists there.

+

However, you should avoid this as much as possible (variables that persist across namespaces are called global variables).

+
+

Functions always return a value—if one is not explicitly given, then they return None, otherwise, they can return values (even multiple values) of any type

+
+
+
a = my_fun(10)
+a
+
+
+
+
+
in the function, i = 10
+
+
+
+
+

Here’s a simple function that takes two numbers and returns their product.

+
+
+
def multiply(a, b):
+    return a*b
+
+c = multiply(3, 4)
+c
+
+
+
+
+
12
+
+
+
+
+
+

Quick Exercise

+

Write a simple function that takes a sentence (as a string) and returns an integer equal to the length of the longest word in the sentence. The len() function and the .split() methods will be useful here.

+
+

None is a special quantity in python (analogous to null in some other languages). We can test on None—the preferred manner is to use is:

+
+
+
def do_nothing():
+    pass
+
+
+
+
+
+
+
a = do_nothing()
+if a is None:
+    print("we didn't do anything")
+
+
+
+
+
we didn't do anything
+
+
+
+
+
+
+
a is None
+
+
+
+
+
True
+
+
+
+
+
+

Keyword arguments#

+

You can have optional arguments which provide defaults. Here’s a simple function that computes \(\sin(\theta)\) where \(\theta\) can optionally be in degrees.

+
+
+
import math
+
+
+
+
+
+
+
def my_sin(theta, in_degrees=False):
+    if in_degrees:
+        return math.sin(math.radians(theta))
+    return math.sin(theta)
+
+
+
+
+
+
+
my_sin(math.pi/4), my_sin(45, in_degrees=True)                    
+
+
+
+
+
(0.7071067811865475, 0.7071067811865475)
+
+
+
+
+
+

Important

+

It is important to note that python evaluates the optional arguments once—when the function is defined. This means that if you make the default an empty object, for instance, it will persist across all call.

+

This leads to one of the most common errors for beginners

+
+

Here’s an example of trying to initialize to an empty list:

+
+
+
def f(a, L=[]):
+    L.append(a)
+    return L
+
+
+
+
+
+
+
print(f(1))
+print(f(2))
+print(f(3))
+
+
+
+
+
[1]
+[1, 2]
+[1, 2, 3]
+
+
+
+
+

Notice that each call does not create its own separate list. Instead a single empty list was created when the function was first processed, and this list persists in memory as the default value for the optional argument L.

+

If we want a unique list created each time (e.g., a separate place in memory), we instead initialize the argument’s value to None and then check its actual value and create an empty list in the function body itself if the default value was unchanged.

+
+
+
def fnew(a, L=None):
+    if L is None:
+        L = []
+    L.append(a)
+    return L
+
+
+
+
+
+
+
print(fnew(1))
+print(fnew(2))
+print(fnew(3))
+
+
+
+
+
[1]
+[2]
+[3]
+
+
+
+
+
+
+
L = fnew(1)
+print(fnew(2, L=L))
+
+
+
+
+
[1, 2]
+
+
+
+
+

Notice that the same None that we saw previously comes into play here.

+
+
+
L
+
+
+
+
+
[1, 2]
+
+
+
+
+
+
+

Lambdas#

+

Lambdas are “disposible” functions. These are small, nameless functions that are often used as arguments in other functions.

+

Ex, from the official tutorial: we have a list of tuples. We want to sort the list based on the second item in the tuple. The sort method can take a key optional argument that tells us how to interpret the list item for sorting

+
+
+
pairs = [(1, 'one'), (2, 'two'), (3, 'three'), (4, 'four')]
+pairs.sort(key=lambda p: p[1])
+
+
+
+
+
+
+
pairs
+
+
+
+
+
[(4, 'four'), (1, 'one'), (3, 'three'), (2, 'two')]
+
+
+
+
+

Here we use a lambda in an extract from a list (with the filter function)

+
+
+
squares = [x**2 for x in range(100)]
+sq = list(filter(lambda x : x%2 == 0 and x%3 == 0, squares))
+sq
+
+
+
+
+
[0,
+ 36,
+ 144,
+ 324,
+ 576,
+ 900,
+ 1296,
+ 1764,
+ 2304,
+ 2916,
+ 3600,
+ 4356,
+ 5184,
+ 6084,
+ 7056,
+ 8100,
+ 9216]
+
+
+
+
+
+
+
help(filter)
+
+
+
+
+
Help on class filter in module builtins:
+
+class filter(object)
+ |  filter(function, iterable, /)
+ |
+ |  Return an iterator yielding those items of iterable for which function(item)
+ |  is true. If function is None, return the items that are true.
+ |
+ |  Methods defined here:
+ |
+ |  __iter__(self, /)
+ |      Implement iter(self).
+ |
+ |  __next__(self, /)
+ |      Implement next(self).
+ |
+ |  __reduce__(self, /)
+ |      Return state information for pickling.
+ |
+ |  ----------------------------------------------------------------------
+ |  Static methods defined here:
+ |
+ |  __new__(*args, **kwargs)
+ |      Create and return a new object.  See help(type) for accurate signature.
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w4-python-classes.html b/01-python/w4-python-classes.html new file mode 100644 index 00000000..e1da0766 --- /dev/null +++ b/01-python/w4-python-classes.html @@ -0,0 +1,1306 @@ + + + + + + + + + + + Classes — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Classes

+ +
+ +
+
+ + + + +
+ +
+

Classes#

+

Classes are the fundamental concept for object oriented programming. A class defines a data type with both data and functions that can operate on the data. An object is an instance of a class. Each object will have its own namespace (separate from other instances of the class and other functions, etc. in your program).

+

We use the dot operator, ., to access members of the class (data or functions). We’ve already been doing this a lot, strings, ints, lists, … are all objects in python.

+
+

Naming conventions#

+

The python community has some naming convections, defined in PEP-8:

+

https://www.python.org/dev/peps/pep-0008/

+

The widely adopted ones are:

+
    +
  • class names start with an uppercase, and use “camelcase” for multiword names, e.g. ShoppingCart

  • +
  • variable names (including objects which are instances of a class) are lowercase and use underscores to separate words, e.g., shopping_cart

  • +
  • module names should be lowercase with underscores

  • +
+
+
+

A simple class#

+

Here’s a class that holds some student info

+
+
+
class Student:
+    def __init__(self, name, grade=None):
+        self.name = name
+        self.grade = grade
+
+
+
+
+

This has a function, __init__() which is called automatically when we create an instance of the class.

+

The argument self refers to the object that we will create, and points to the memory that they object will use to store the class’s contents.

+
+
+
a = Student("Mike")
+print(a.name)
+print(a.grade)
+
+
+
+
+
Mike
+None
+
+
+
+
+

Let’s create a bunch of them, stored in a list

+
+
+
students = []
+students.append(Student("fry", "F-"))
+students.append(Student("leela", "A"))
+students.append(Student("zoidberg", "F"))
+students.append(Student("hubert", "C+"))
+students.append(Student("bender", "B"))
+students.append(Student("calculon", "C"))
+students.append(Student("amy", "A"))
+students.append(Student("hermes", "A"))
+students.append(Student("scruffy", "D"))
+students.append(Student("flexo", "F"))
+students.append(Student("morbo", "D"))
+students.append(Student("hypnotoad", "A+"))
+students.append(Student("zapp", "Q"))
+
+
+
+
+
+

Quick Exercise

+

Loop over the students in the students list and print out the name and grade of each student, one per line.

+
+

We can use list comprehensions with our list of objects. For example, let’s find all the students who have A’s

+
+
+
As = [q.name for q in students if q.grade.startswith("A")]
+As
+
+
+
+
+
['leela', 'amy', 'hermes', 'hypnotoad']
+
+
+
+
+
+
+

Playing Cards#

+

Here’s a more complicated class that represents a playing card. Notice that we are using unicode to represent the suits.

+
+
+
class Card:
+    
+    def __init__(self, suit=1, rank=2):
+        if suit < 1 or suit > 4:
+            print("invalid suit, setting to 1")
+            suit = 1
+            
+        self.suit = suit
+        self.rank = rank
+        
+    def value(self):
+        """ we want things order primarily by rank then suit """
+        return self.suit + (self.rank-1)*14
+    
+    # we include this to allow for comparisons with < and > between cards 
+    def __lt__(self, other):
+        return self.value() < other.value()
+
+    def __eq__(self, other):
+        return self.rank == other.rank and self.suit == other.suit
+    
+    def __repr__(self):
+        return self.__str__()
+    
+    def __str__(self):
+        suits = [u"\u2660",  # spade
+                 u"\u2665",  # heart
+                 u"\u2666",  # diamond
+                 u"\u2663"]  # club
+        
+        r = str(self.rank)
+        if self.rank == 11:
+            r = "J"
+        elif self.rank == 12:
+            r = "Q"
+        elif self.rank == 13:
+            r = "K"
+        elif self.rank == 14:
+            r = "A"
+                
+        return r +':'+suits[self.suit-1]
+
+
+
+
+

we can create a card easily.

+
+
+
c1 = Card()
+
+
+
+
+

We can pass arguments to __init__ in when we setup the class:

+
+
+
c2 = Card(suit=2, rank=2)
+
+
+
+
+

Once we have our object, we can access any of the functions in the class using the dot operator

+
+
+
c2.value()
+
+
+
+
+
16
+
+
+
+
+
+
+
c3 = Card(suit=0, rank=4)
+
+
+
+
+
invalid suit, setting to 1
+
+
+
+
+

The __str__ method converts the object into a string that can be printed.

+
+
+
print(c1)
+print(c2)
+
+
+
+
+
2:♠
+2:♥
+
+
+
+
+

the value method assigns a value to the object that can be used in comparisons, and the __lt__ method is what does the actual comparing

+
+
+
print(c1 > c2)
+print(c1 < c2)
+
+
+
+
+
False
+True
+
+
+
+
+

Note that not every operator is defined for our class, so, for instance, we cannot add two cards together:

+
+
+
c1 + c2
+
+
+
+
+
---------------------------------------------------------------------------
+TypeError                                 Traceback (most recent call last)
+Cell In[12], line 1
+----> 1 c1 + c2
+
+TypeError: unsupported operand type(s) for +: 'Card' and 'Card'
+
+
+
+
+
+

Quick Exercise

+
    +
  • Create a “hand” corresponding to a straight (5 cards of any suite, but in sequence of rank)

  • +
  • Create another hand corresponding to a flush (5 cards all of the same suit, of any rank)

  • +
  • Finally create a hand with one of the cards duplicated—this should not be allowed in a standard deck of cards. How would you check for this?

  • +
+
+
+
+

Operators#

+

We can define operations like + and - that work on our objects. Here’s a simple example of currency—we keep track of the country and the amount

+
+
+
class Currency:
+    """ a simple class to hold foreign currency """
+    
+    def __init__(self, amount, country="US"):
+        self.amount = amount
+        self.country = country
+        
+    def __add__(self, other):
+        return Currency(self.amount + other.amount, country=self.country)
+
+    def __sub__(self, other):
+        return Currency(self.amount - other.amount, country=self.country)
+
+    def __str__(self):
+        return f"{self.amount} {self.country}"
+
+
+
+
+

We can now create some monetary amounts for different countries

+
+
+
d1 = Currency(10, "US")
+d2 = Currency(15, "US")
+print(d2 - d1)
+
+
+
+
+
5 US
+
+
+
+
+
+

Quick Exercise

+

As written, our Currency class has a bug—it does not check whether the amounts are in the same country before adding. Modify the __add__ method to first check if the countries are the same. If they are, return the new Currency object with the sum, otherwise, return None.

+
+
+
+

Vectors Example#

+

Here we write a class to represent 2-d vectors. Vectors have a direction and a magnitude. We can represent them as a pair of numbers, representing the x and y lengths. We’ll use a tuple internally for this

+

We want our class to do all the basic operations we do with vectors: add them, multiply by a scalar, cross product, dot product, return the magnitude, etc.

+

We’ll use the math module to provide some basic functions we might need (like sqrt)

+

This example will show us how to overload the standard operations in python. Here’s a list of the builtin methods:

+

https://docs.python.org/3/reference/datamodel.html

+

To make it really clear what’s being called when, I’ve added prints in each of the functions

+
+
+
import math
+
+
+
+
+
+
+
class Vector:
+    """ a general two-dimensional vector """
+    
+    def __init__(self, x, y):
+        print("in __init__")
+        self.x = x
+        self.y = y
+        
+    def __str__(self):
+        print("in __str__")        
+        return f"({self.x} î + {self.y} ĵ)"
+    
+    def __repr__(self):
+        print("in __repr__")        
+        return f"Vector({self.x}, {self.y})"
+
+    def __add__(self, other):
+        print("in __add__")        
+        if isinstance(other, Vector):
+            return Vector(self.x + other.x, self.y + other.y)
+        else:
+            # it doesn't make sense to add anything but two vectors
+            print(f"we don't know how to add a {type(other)} to a Vector")
+            raise NotImplementedError
+
+    def __sub__(self, other):
+        print("in __sub__")        
+        if isinstance(other, Vector):
+            return Vector(self.x - other.x, self.y - other.y)
+        else:
+            # it doesn't make sense to add anything but two vectors
+            print(f"we don't know how to add a {type(other)} to a Vector")
+            raise NotImplementedError
+
+    def __mul__(self, other):
+        print("in __mul__")        
+        if isinstance(other, int) or isinstance(other, float):
+            # scalar multiplication changes the magnitude
+            return Vector(other*self.x, other*self.y)
+        else:
+            print("we don't know how to multiply two Vectors")
+            raise NotImplementedError
+
+    def __matmul__(self, other):
+        print("in __matmul__")
+        # a dot product
+        if isinstance(other, Vector):
+            return self.x*other.x + self.y*other.y
+        else:
+            print("matrix multiplication not defined")
+            raise NotImplementedError
+
+    def __rmul__(self, other):
+        print("in __rmul__")        
+        return self.__mul__(other)
+
+    def __truediv__(self, other):
+        print("in __truediv__")        
+        # we only know how to multiply by a scalar
+        if isinstance(other, int) or isinstance(other, float):
+            return Vector(self.x/other, self.y/other)
+
+    def __abs__(self):
+        print("in __abs__")        
+        return math.sqrt(self.x**2 + self.y**2)
+
+    def __neg__(self):
+        print("in __neg__")        
+        return Vector(-self.x, -self.y)
+
+    def cross(self, other):
+        # a vector cross product -- we return the magnitude, since it will
+        # be in the z-direction, but we are only 2-d 
+        return abs(self.x*other.y - self.y*other.x)
+
+
+
+
+

This is a basic class that provides two methods __str__ and __repr__ to show a representation of it. There was some discussion of this on slack. These two functions provide a readable version of our object.

+

The convection is what __str__ is human readable while __repr__ should be a form that can be used to recreate the object (e.g., via eval()). See:

+

http://stackoverflow.com/questions/1436703/difference-between-str-and-repr-in-python

+
+
+
v = Vector(1,2)
+v
+
+
+
+
+
in __init__
+in __repr__
+
+
+
Vector(1, 2)
+
+
+
+
+
+
+
print(v)
+
+
+
+
+
in __str__
+(1 î + 2 ĵ)
+
+
+
+
+

Vectors have a length, and we’ll use the abs() builtin to provide the magnitude. For a vector:

+
+\[\vec{v} = \alpha \hat{i} + \beta \hat{j}\]
+

we have

+
+\[|\vec{v}| = \sqrt{\alpha^2 + \beta^2}\]
+
+
+
abs(v)
+
+
+
+
+
in __abs__
+
+
+
2.23606797749979
+
+
+
+
+

Let’s look at mathematical operations on vectors now. We want to be able to add and subtract two vectors as well as multiply and divide by a scalar.

+
+
+
u = Vector(3,5)
+
+
+
+
+
in __init__
+
+
+
+
+
+
+
w = u + v
+print(w)
+
+
+
+
+
in __add__
+in __init__
+in __str__
+(4 î + 7 ĵ)
+
+
+
+
+
+
+
u - v
+
+
+
+
+
in __sub__
+in __init__
+in __repr__
+
+
+
Vector(2, 3)
+
+
+
+
+

It doesn’t make sense to add a scalar to a vector, so we didn’t implement this – what happens?

+
+
+
u + 2.0
+
+
+
+
+
in __add__
+we don't know how to add a <class 'float'> to a Vector
+
+
+
---------------------------------------------------------------------------
+NotImplementedError                       Traceback (most recent call last)
+Cell In[23], line 1
+----> 1 u + 2.0
+
+Cell In[16], line 24, in Vector.__add__(self, other)
+     20             return Vector(self.x + other.x, self.y + other.y)
+     21         else:
+     22             # it doesn't make sense to add anything but two vectors
+     23             print(f"we don't know how to add a {type(other)} to a Vector")
+---> 24             raise NotImplementedError
+
+NotImplementedError: 
+
+
+
+
+

Now multiplication. It makes sense to multiply by a scalar, but there are multiple ways to define multiplication of two vectors.

+

Note that python provides both a __mul__ and a __rmul__ function to define what happens when we multiply a vector by a quantity and what happens when we multiply something else by a vector.

+
+
+
u*2.0
+
+
+
+
+
in __mul__
+in __init__
+in __repr__
+
+
+
Vector(6.0, 10.0)
+
+
+
+
+
+
+
2.0*u
+
+
+
+
+
in __rmul__
+in __mul__
+in __init__
+in __repr__
+
+
+
Vector(6.0, 10.0)
+
+
+
+
+

and division: __truediv__ is the python 3 way of division /, while __floordiv__ is the old python 2 way, also enabled via //.

+

Dividing a scalar by a vector doesn’t make sense:

+
+
+
u/5.0
+
+
+
+
+
in __truediv__
+in __init__
+in __repr__
+
+
+
Vector(0.6, 1.0)
+
+
+
+
+
+
+
5.0/u
+
+
+
+
+
---------------------------------------------------------------------------
+TypeError                                 Traceback (most recent call last)
+Cell In[27], line 1
+----> 1 5.0/u
+
+TypeError: unsupported operand type(s) for /: 'float' and 'Vector'
+
+
+
+
+

Python 3.5 introduced a new matrix multiplication operator, @ – we’ll use this to implement a dot product between two vectors:

+
+
+
u @ v
+
+
+
+
+
in __matmul__
+
+
+
13
+
+
+
+
+

For a cross product, we don’t have an obvious operator, so we’ll use a function. For 2-d vectors, this will result in a scalar

+
+
+
u.cross(v)
+
+
+
+
+
1
+
+
+
+
+

Finally, negation is a separate operation:

+
+
+
-u
+
+
+
+
+
in __neg__
+in __init__
+in __repr__
+
+
+
Vector(-3, -5)
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w4-python-exercises.html b/01-python/w4-python-exercises.html new file mode 100644 index 00000000..1b8ec517 --- /dev/null +++ b/01-python/w4-python-exercises.html @@ -0,0 +1,1038 @@ + + + + + + + + + + + Practicing Classes — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Practicing Classes

+ +
+ +
+
+ + + + +
+ +
+

Practicing Classes#

+
+

Exercise 1 (shopping cart)#

+

Let’s write a simple shopping cart class – this will hold items that you intend to purchase as well as the amount, etc. And allow you to add / remove items, get a subtotal, etc.

+

We’ll use two classes: Item will be a single item and ShoppingCart will be the collection of items you wish to purchase.

+

First, our store needs an inventory – here’s what we have for sale:

+
+
+
INVENTORY_TEXT = """
+apple, 0.60
+banana, 0.20
+grapefruit, 0.75
+grapes, 1.99
+kiwi, 0.50
+lemon, 0.20
+lime, 0.25
+mango, 1.50
+papaya, 2.95
+pineapple, 3.50
+blueberries, 1.99
+blackberries, 2.50
+peach, 0.50
+plum, 0.33
+clementine, 0.25
+cantaloupe, 3.25
+pear, 1.25
+quince, 0.45
+orange, 0.60
+"""
+
+# this will be a global -- convention is all caps
+INVENTORY = {}
+for line in INVENTORY_TEXT.splitlines():
+    if line.strip() == "":
+        continue
+    item, price = line.split(",")
+    INVENTORY[item] = float(price)
+
+
+
+
+
+
+
INVENTORY
+
+
+
+
+
{'apple': 0.6,
+ 'banana': 0.2,
+ 'grapefruit': 0.75,
+ 'grapes': 1.99,
+ 'kiwi': 0.5,
+ 'lemon': 0.2,
+ 'lime': 0.25,
+ 'mango': 1.5,
+ 'papaya': 2.95,
+ 'pineapple': 3.5,
+ 'blueberries': 1.99,
+ 'blackberries': 2.5,
+ 'peach': 0.5,
+ 'plum': 0.33,
+ 'clementine': 0.25,
+ 'cantaloupe': 3.25,
+ 'pear': 1.25,
+ 'quince': 0.45,
+ 'orange': 0.6}
+
+
+
+
+
+

Item#

+

Here’s the start of an item class – we want it to hold the name and quantity.

+

You should have the following features:

+
    +
  • the name should be something in our inventory

  • +
  • Our shopping cart will include a list of all the items we want to buy, so we want to be able to check for duplicates. Implement the equal test, ==, using __eq__

  • +
  • we’ll want to consolidate dupes, so implement the + operator, using __add__ so we can add items together in our shopping cart. Note, add should raise a ValueError if you try to add two Items that don’t have the same name.

  • +
+

Here’s a start:

+
+
+
class Item:
+    """ an item to buy """
+    
+    def __init__(self, name, quantity=1):
+        """keep track of an item that is in our inventory"""
+        if name not in INVENTORY:
+            raise ValueError("invalid item name")
+        self.name = name
+        self.quantity = quantity
+        
+    def __repr__(self):
+        return f"{self.name}: {self.quantity}"
+        
+    def __eq__(self, other):
+        """check if the items have the same name"""
+        return self.name == other.name
+    
+    def __add__(self, other):
+        """add two items together if they are the same type"""
+        if self.name == other.name:
+            return Item(self.name, self.quantity + other.quantity)
+        else:
+            raise ValueError("names don't match")
+
+
+
+
+

Here are some tests your code should pass:

+
+
+
a = Item("apple", 10)
+b = Item("banana", 20)
+
+
+
+
+
+
+
c = Item("apple", 20)
+
+
+
+
+
+
+
# won't work
+a + b
+
+
+
+
+
---------------------------------------------------------------------------
+ValueError                                Traceback (most recent call last)
+Cell In[6], line 2
+      1 # won't work
+----> 2 a + b
+
+Cell In[3], line 23, in Item.__add__(self, other)
+     19         """add two items together if they are the same type"""
+     20         if self.name == other.name:
+     21             return Item(self.name, self.quantity + other.quantity)
+     22         else:
+---> 23             raise ValueError("names don't match")
+
+ValueError: names don't match
+
+
+
+
+
+
+
# will work
+a += c
+print(a)
+
+
+
+
+
apple: 30
+
+
+
+
+
+
+
d = Item("dog")
+
+
+
+
+
---------------------------------------------------------------------------
+ValueError                                Traceback (most recent call last)
+Cell In[8], line 1
+----> 1 d = Item("dog")
+
+Cell In[3], line 7, in Item.__init__(self, name, quantity)
+      4     def __init__(self, name, quantity=1):
+      5         """keep track of an item that is in our inventory"""
+      6         if name not in INVENTORY:
+----> 7             raise ValueError("invalid item name")
+      8         self.name = name
+      9         self.quantity = quantity
+
+ValueError: invalid item name
+
+
+
+
+
+
+
# should be False
+a == b
+
+
+
+
+
False
+
+
+
+
+
+
+
# should be True -- they have the same name
+a == c
+
+
+
+
+
True
+
+
+
+
+

How do they behave in a list?

+
+
+
items = []
+items.append(a)
+items.append(b)
+items
+
+
+
+
+
[apple: 30, banana: 20]
+
+
+
+
+
+
+
# should be True -- they have the same name
+c in items
+
+
+
+
+
True
+
+
+
+
+
+
+

ShoppingCart#

+

Now we want to create a shopping cart. The main thing it will do is hold a list of items.

+
+
+
class ShoppingCart:
+    
+    def __init__(self):
+        # the list of items we control
+        self.items = []
+        
+    def subtotal(self):
+        """ return a subtotal of our items """
+        pass
+
+    def add(self, name, quantity):
+        """ add an item to our cart -- the an item of the same name already
+        exists, then increment the quantity.  Otherwise, add a new item
+        to the cart with the desired quantity."""
+        pass
+        
+    def remove(self, name):
+        """ remove all of item name from the cart """
+        pass
+        
+    def report(self):
+        """ print a summary of the cart """
+        for item in self.items:
+            print(f"{item.name} : {item.quantity}")
+
+
+
+
+

Here are some tests

+
+
+
sc = ShoppingCart()
+sc.add("orange", 19)
+
+
+
+
+
+
+
sc.add("apple", 2)
+
+
+
+
+
+
+
sc.report()
+
+
+
+
+
+
+
sc.add("apple", 9)
+
+
+
+
+
+
+
# apple should only be listed once in the report, with a quantity of 11
+sc.report()
+
+
+
+
+
+
+
sc.subtotal()
+
+
+
+
+
+
+
sc.remove("apple")
+
+
+
+
+
+
+
# apple should no longer be listed
+sc.report()
+
+
+
+
+
+
+
+

Exercise 2: Poker Odds#

+

Use the deck of cards class from the notebook we worked through outside of class to write a Monte Carlo code that plays a lot of hands of straight poker (like 100,000). Count how many of these hands has a particular poker hand (like 3-of-a-kind). The ratio of # of hands with 3-of-a-kind to total hands is an approximation to the odds of getting a 3-of-a-kind in poker.

+

You’ll want to copy-paste those classes into a .py file to allow you to import and reuse them here

+
+
+

Exercise 3: Tic-Tac-Toe#

+

Revisit the tic-tac-toe game you developed in the functions exercises but now write it as a class with methods to do each of the main steps.

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w4-python-modules.html b/01-python/w4-python-modules.html new file mode 100644 index 00000000..a083a954 --- /dev/null +++ b/01-python/w4-python-modules.html @@ -0,0 +1,790 @@ + + + + + + + + + + + Modules — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Modules

+ +
+
+ +
+
+
+ + + + +
+ +
+

Modules#

+

Here we import our own module called myprofile (we have it in the same directory as this notebook)

+
+
+
import myprofile
+
+
+
+
+

We have a docstring at the top – the comments there are what appear when we ask for help

+
+
+
help(myprofile)
+
+
+
+
+
Help on module myprofile:
+
+NAME
+    myprofile
+
+DESCRIPTION
+    A very simple profiling class.  Define some timers and methods
+    to start and stop them.  Nesting of timers is tracked so we can
+    pretty print the profiling information.
+
+    # define a timer object, labeled 'my timer'
+    a = timer('my timer')
+
+    This will add 'my timer' to the list of keys in the 'my timer'
+    dictionary.  Subsequent calls to the timer class constructor
+    will have no effect.
+
+    # start timing the 'my timer' block of code
+    a.begin()
+
+    ... do stuff here ...
+
+    # end the timing of the 'my timer' block of code
+    a.end()
+
+    for best results, the block of code timed should be large
+    enough to offset the overhead of the timer class method
+    calls.
+
+    Multiple timers can be instantiated and nested.  The stackCount
+    global parameter keeps count of the level of nesting, and the
+    timerNesting data structure stores the nesting level for each
+    defined timer.
+
+    timeReport() is called at the end to print out a summary of the
+    timing.
+
+    At present, no enforcement is done to ensure proper nesting.
+
+CLASSES
+    builtins.object
+        Timer
+
+    class Timer(builtins.object)
+     |  Timer(name)
+     |
+     |  Methods defined here:
+     |
+     |  __init__(self, name)
+     |      Initialize self.  See help(type(self)) for accurate signature.
+     |
+     |  begin(self)
+     |
+     |  end(self)
+     |
+     |  ----------------------------------------------------------------------
+     |  Data descriptors defined here:
+     |
+     |  __dict__
+     |      dictionary for instance variables
+     |
+     |  __weakref__
+     |      list of weak references to the object
+
+FUNCTIONS
+    time_report()
+
+DATA
+    stack_count = 0
+    timer_nesting = {}
+    timer_order = []
+    timers = {}
+
+FILE
+    /home/runner/work/python-science/python-science/content/01-python/myprofile.py
+
+
+
+
+

This module simply provides a way to time routines (python and ipython have built-in methods for this too)

+
+
+
t = myprofile.Timer("main loop")
+t.begin()
+
+sum = 0.0
+for n in range(1000):
+    sum += n**2
+
+
+t.end()
+myprofile.time_report()
+
+print(sum)
+
+
+
+
+
main loop:  0.00022029876708984375
+332833500.0
+
+
+
+
+

In the file myprofile.py, you will see a block of code under

+
if __name__ == "__main__":
+
+
+

That code is executed if the file is run directly, either from the commandline as:

+

python myprofile.py

+

for through the %run magic

+
+
+
%run myprofile
+
+
+
+
+
1:  10.000158309936523
+2:  25.00032067298889
+   3:  20.000181436538696
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/01-python/w5-python-more-examples.html b/01-python/w5-python-more-examples.html new file mode 100644 index 00000000..13b16258 --- /dev/null +++ b/01-python/w5-python-more-examples.html @@ -0,0 +1,762 @@ + + + + + + + + + + + Exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

Exercises#

+
+

Exercise 1: Rock-Paper-Scissors#

+

Implement a set of games of rock-paper-scissors against the computer.

+
    +
  • Ask for input from the user (“rock”, “paper”, or “scissors”) and the randomly select one of these for the computer’s play.

  • +
  • Announce who won.

  • +
  • Keep playing until a player says that they no longer want to play.

  • +
  • When all games are done, print out how many games were won by the player and by the computer

  • +
+
+
+

Exercise 2: Pascal’s triangle#

+

Pascal’s triangle is created such that each layer has 1 more element than the previous, with 1s on the side and in the interior, the numbers are the sum of the two above it, e.g.,:

+
            1
+          1   1
+        1   2   1
+      1   3   3   1
+    1   4   6   4   1
+  1   5   10  10  5   1
+
+
+

Write a function to return the first n rows of Pascal’s triangle. The return should be a list of length n, with each element itself a list containing the numbers for that row.

+

If you want to add complexity, write a function to print out Pascal’s triangle with proper formatting, so the numbers in each row are centered between the ones in the row above

+
+
+

Exercise 3: Panagrams#

+

A panagram is a sentence that includes all 26 letters of the alphabet, e.g., “The quick brown fox jumps over the lazy dog.”

+

Write a function that takes as an argument a sentence and returns True or False, indicating whether the sentence is a panagram.

+
+
+

Exercise 4: Math practice#

+

We want to make a simple table of trigonometric functions for different angles. Write a code that outputs in columns, the following data:

+
angle (degrees)    angle (radians)     sin(angle)     cos(angle)    sin(angle)**2 + cos(angle)**2
+
+
+

For all angles spaced 30 degrees apart in the range 0 to 360 degrees.

+

Keep in mind that the trig functions expect the input in radians.

+
+
+

Exercise 5: Calendar events#

+

We want to keep a schedule of events. We will do this by creating a class called Day. It is sketched out below. A Day holds a list of events and has methods that allow you to add an delete events. Our events will be instances of a class Event, which holds the time, location, and description of the event.

+

Finally, we can keep track of a list of all the Days for which we have events to make our schedule.

+

Fill in these classes and write some code to demonstrate their use:

+
    +
  • Create a full week of days in your calendar

  • +
  • Add an event every day at noon called “lunch”

  • +
  • Randomly add some other events to fill out your calendar

  • +
  • Write some code that tells you the start time of your first meeting and the end time of your last meeting (this is the length of your work day)

  • +
+
+
+
class Day:
+    """a single day keeping track of the events scheduled"""
+    def __init__(month, day, year):
+        # store the month, day, and year as data in the class
+        
+        # keep track of the events
+        self.events = []
+    
+    def add_event(name, time=None, location=None):
+        pass
+    
+    def delete_event(name):
+        pass
+    
+    
+class Event:
+    """a single event in our calendar"""
+    def __init__(name, time=9, location=None, duration=1):
+        self.name = name
+        self.time = time
+        self.location = location
+        self.duration = duration
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/02-numpy/numpy-advanced.html b/02-numpy/numpy-advanced.html new file mode 100644 index 00000000..83f53570 --- /dev/null +++ b/02-numpy/numpy-advanced.html @@ -0,0 +1,1226 @@ + + + + + + + + + + + NumPy Advanced Operations — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

NumPy Advanced Operations

+ +
+ +
+
+ + + + +
+ +
+

NumPy Advanced Operations#

+
+
+
import numpy as np
+
+
+
+
+
+

Copying Arrays#

+
+

Important

+

Simply using = does not make a copy, but much like with lists, you will just have multiple names pointing to the same ndarray object

+

Therefore, we need to understand if two arrays, A and B point to:

+
    +
  • the same array, including shape and data/memory space

  • +
  • the same data/memory space, but perhaps different shapes (a view)

  • +
  • a separate copy of the data (i.e. stored completely separately in memory)

  • +
+

All of these are possible.

+
+

All of these are possible:

+
    +
  • B = A

    +

    this is assignment. No copy is made. A and B point to the same data in memory and share the same shape, etc. They are just two different labels for the same object in memory

    +
  • +
  • B = A[:]

    +

    this is a view or shallow copy. The shape info for A and B are stored independently, but both point to the same memory location for data

    +
  • +
  • B = A.copy()

    +

    this is a deep copy. A completely separate object will be created in memory, with a completely separate location in memory.

    +
  • +
+

Let’s look at examples

+
+
+
a = np.arange(10)
+a
+
+
+
+
+
array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9])
+
+
+
+
+

Here is assignment—we can just use the is operator to test for equality

+
+
+
b = a
+b is a
+
+
+
+
+
True
+
+
+
+
+

Since b and a are the same, changes to the shape of one are reflected in the other—no copy is made.

+
+
+
b.shape = (2, 5)
+print(b)
+a.shape
+
+
+
+
+
[[0 1 2 3 4]
+ [5 6 7 8 9]]
+
+
+
(2, 5)
+
+
+
+
+
+
+
b is a
+
+
+
+
+
True
+
+
+
+
+
+
+
a
+
+
+
+
+
array([[0, 1, 2, 3, 4],
+       [5, 6, 7, 8, 9]])
+
+
+
+
+

a shallow copy creates a new view into the array—the data is the same, but the array properties can be different

+
+
+
a = np.arange(12)
+c = a[:]
+a.shape = (3,4)
+
+print(a)
+print(c)
+
+
+
+
+
[[ 0  1  2  3]
+ [ 4  5  6  7]
+ [ 8  9 10 11]]
+[ 0  1  2  3  4  5  6  7  8  9 10 11]
+
+
+
+
+

since the underlying data is the same memory, changing an element of one is reflected in the other

+
+
+
c[1] = -1
+a
+
+
+
+
+
array([[ 0, -1,  2,  3],
+       [ 4,  5,  6,  7],
+       [ 8,  9, 10, 11]])
+
+
+
+
+

Even slices into an array are just views, still pointing to the same memory

+
+
+
d = c[3:8]
+d
+
+
+
+
+
array([3, 4, 5, 6, 7])
+
+
+
+
+
+
+
d[:] = 0 
+
+
+
+
+
+
+
print(a)
+print(c)
+print(d)
+
+
+
+
+
[[ 0 -1  2  0]
+ [ 0  0  0  0]
+ [ 8  9 10 11]]
+[ 0 -1  2  0  0  0  0  0  8  9 10 11]
+[0 0 0 0 0]
+
+
+
+
+

There are lots of ways to inquire if two arrays are the same, views, own their own data, etc

+
+
+
print(c is a)
+print(c.base is a)
+print(c.flags.owndata)
+print(a.flags.owndata)
+
+
+
+
+
False
+True
+False
+True
+
+
+
+
+

to make a copy of the data of the array that you can deal with independently of the original, you need a deep copy

+
+
+
d = a.copy()
+d[:,:] = 0.0
+
+print(a)
+print(d)
+
+
+
+
+
[[ 0 -1  2  0]
+ [ 0  0  0  0]
+ [ 8  9 10 11]]
+[[0 0 0 0]
+ [0 0 0 0]
+ [0 0 0 0]]
+
+
+
+
+
+
+

Boolean Indexing#

+

There are lots of fun ways to index arrays to access only those elements that meet a certain condition

+
+
+
a = np.arange(12).reshape(3,4)
+a
+
+
+
+
+
array([[ 0,  1,  2,  3],
+       [ 4,  5,  6,  7],
+       [ 8,  9, 10, 11]])
+
+
+
+
+

Here we set all the elements in the array that are > 4 to zero

+
+
+
a[a > 4] = 0
+a
+
+
+
+
+
array([[0, 1, 2, 3],
+       [4, 0, 0, 0],
+       [0, 0, 0, 0]])
+
+
+
+
+

and now, all the zeros to -1

+
+
+
a[a == 0] = -1
+a
+
+
+
+
+
array([[-1,  1,  2,  3],
+       [ 4, -1, -1, -1],
+       [-1, -1, -1, -1]])
+
+
+
+
+
+
+
a == -1
+
+
+
+
+
array([[ True, False, False, False],
+       [False,  True,  True,  True],
+       [ True,  True,  True,  True]])
+
+
+
+
+

if we have 2 tests, we need to use logical_and() or logical_or()

+
+
+
a = np.arange(12).reshape(3,4)
+a
+
+
+
+
+
array([[ 0,  1,  2,  3],
+       [ 4,  5,  6,  7],
+       [ 8,  9, 10, 11]])
+
+
+
+
+
+
+
a[np.logical_or(a == 0, np.logical_and(a > 3, a <= 9))] = 100.0
+a
+
+
+
+
+
array([[100,   1,   2,   3],
+       [100, 100, 100, 100],
+       [100, 100,  10,  11]])
+
+
+
+
+

Our test that we index the array with returns a boolean array of the same shape:

+
+
+
a > 4
+
+
+
+
+
array([[ True, False, False, False],
+       [ True,  True,  True,  True],
+       [ True,  True,  True,  True]])
+
+
+
+
+
+
+

Avoiding Loops#

+

In general, you want to avoid loops over elements on an array.

+

Here, let’s create 1-d x and y coordinates and then try to fill some larger array

+
+
+
M = 128
+N = 256
+xmin = ymin = 0.0
+xmax = ymax = 1.0
+
+x = np.linspace(xmin, xmax, M, endpoint=False)
+y = np.linspace(ymin, ymax, N, endpoint=False)
+
+print(x.shape)
+print(y.shape)
+
+
+
+
+
(128,)
+(256,)
+
+
+
+
+

we’ll time out code

+
+
+
import time
+
+
+
+
+
+
+
t0 = time.time()
+
+g = np.zeros((M, N))
+
+for j in range(N):
+    for i in range(M):
+
+        g[i,j] = np.sin(2.0*np.pi*x[i]*y[j])
+        
+t1 = time.time()
+print(f"time elapsed: {t1-t0} s")
+
+
+
+
+
time elapsed: 0.02727198600769043 s
+
+
+
+
+

Now let’s instead do this using all array syntax.

+
+

Tip

+

First will extend our 1-d coordinate arrays to be 2-d.
+NumPy has a function for this (meshgrid())

+
+

Let’s look at how meshgrid() works first

+
+
+
x2d, y2d = np.meshgrid([0, 1, 2, 3], [10, 20, 30], indexing="ij")
+x2d
+
+
+
+
+
array([[0, 0, 0],
+       [1, 1, 1],
+       [2, 2, 2],
+       [3, 3, 3]])
+
+
+
+
+
+
+
y2d
+
+
+
+
+
array([[10, 20, 30],
+       [10, 20, 30],
+       [10, 20, 30],
+       [10, 20, 30]])
+
+
+
+
+

We see that this creates 2 two-dimensional arrays, one with the x-values changing across rows and one with y-values changing across columns. This means we can index all points +(x[i], y[j]) through the pair x2d, y2d

+

Now let’s do our same example this method.

+
+
+
t0 = time.time()
+x2d, y2d = np.meshgrid(x, y, indexing="ij")
+g2 = np.sin(2.0*np.pi*x2d*y2d)
+t1 = time.time()
+print(f"time elapsed: {t1-t0} s")
+
+
+
+
+
time elapsed: 0.0014095306396484375 s
+
+
+
+
+

A final check to make sure they give the same answer

+
+
+
print(np.max(np.abs(g2-g)))
+
+
+
+
+
0.0
+
+
+
+
+
+
+

Numerical differencing on NumPy arrays#

+

Now we want to construct a derivative,

+
+\[ +\frac{d f}{dx} +\]
+
+
+
x = np.linspace(0, 2*np.pi, 25)
+f = np.sin(x)
+
+
+
+
+

We want to do this without loops—we’ll use views into arrays offset from one another. Recall from calculus that a derivative is approximately:

+
+\[ +\frac{df}{dx} = \frac{f(x+h) - f(x)}{h} +\]
+

Here, we’ll take \(h\) to be a single adjacent element

+
+
+
dx = x[1] - x[0]
+dfdx = (f[1:] - f[:-1])/dx
+
+
+
+
+
+
+
dfdx
+
+
+
+
+
array([ 0.98861593,  0.92124339,  0.79108963,  0.60702442,  0.38159151,
+        0.13015376, -0.13015376, -0.38159151, -0.60702442, -0.79108963,
+       -0.92124339, -0.98861593, -0.98861593, -0.92124339, -0.79108963,
+       -0.60702442, -0.38159151, -0.13015376,  0.13015376,  0.38159151,
+        0.60702442,  0.79108963,  0.92124339,  0.98861593])
+
+
+
+
+
+
+
for i in range(len(x)-1):
+    print((f[i+1] - f[i]) / dx)
+
+
+
+
+
0.9886159294653692
+0.9212433876373748
+0.7910896313685742
+0.6070244240594342
+0.38159150540593506
+0.13015375626880096
+-0.13015375626880055
+-0.38159150540593506
+-0.6070244240594342
+-0.7910896313685731
+-0.9212433876373752
+-0.9886159294653699
+-0.9886159294653681
+-0.9212433876373755
+-0.7910896313685738
+-0.6070244240594346
+-0.38159150540593545
+-0.1301537562688014
+0.13015375626880013
+0.3815915054059342
+0.607024424059435
+0.7910896313685731
+0.9212433876373736
+0.9886159294653716
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/02-numpy/numpy-basics.html b/02-numpy/numpy-basics.html new file mode 100644 index 00000000..8bf628ad --- /dev/null +++ b/02-numpy/numpy-basics.html @@ -0,0 +1,1295 @@ + + + + + + + + + + + NumPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

NumPy#

+

This notebook is based on the SciPy NumPy tutorial

+
+

Note

+

Note that the traditional way to import numpy is to rename it np. This saves on typing and makes your code a little more compact.

+
+
+
+
import numpy as np
+
+
+
+
+

NumPy provides a multidimensional array class as well as a large number of functions that operate on arrays.

+

NumPy arrays allow you to write fast (optimized) code that works on arrays of data. To do this, there are some restrictions on arrays:

+
    +
  • all elements are of the same data type (e.g. float)

  • +
  • the size of the array is fixed in memory, and specified when you create the array (e.g., you cannot grow the array like you do with lists)

  • +
+

The nice part is that arithmetic operations work on entire arrays—this means that you can avoid writing loops in python (which tend to be slow). Instead the “looping” is done in the underlying compiled code

+
+

Array Creation and Properties#

+

There are a lot of ways to create arrays. Let’s look at a few

+

Here we create an array using arange and then change its shape to be 3 rows and 5 columns. Note the row-major ordering—you’ll see that the rows are together in the inner [] (more on this in a bit)

+
+
+
a = np.arange(15)
+
+
+
+
+
+
+
a
+
+
+
+
+
array([ 0,  1,  2,  3,  4,  5,  6,  7,  8,  9, 10, 11, 12, 13, 14])
+
+
+
+
+
+
+
a = np.arange(15).reshape(3,5)
+
+print(a)
+
+
+
+
+
[[ 0  1  2  3  4]
+ [ 5  6  7  8  9]
+ [10 11 12 13 14]]
+
+
+
+
+

an array is an object of the ndarray class, and it has methods that know how to work on the array data. Here, .reshape() is one of the many methods.

+

A NumPy array has a lot of meta-data associated with it describing its shape, datatype, etc.

+
+
+
print(a.ndim)
+print(a.shape)
+print(a.size)
+print(a.dtype)
+print(a.itemsize)
+print(type(a))
+
+
+
+
+
2
+(3, 5)
+15
+int64
+8
+<class 'numpy.ndarray'>
+
+
+
+
+
+
+
#help(a)
+
+
+
+
+

we can also create an array from a list

+
+
+
b = np.array( [1.0, 2.0, 3.0, 4.0] )
+print(b)
+print(b.dtype)
+print(type(b))
+
+
+
+
+
[1. 2. 3. 4.]
+float64
+<class 'numpy.ndarray'>
+
+
+
+
+

we can create a multi-dimensional array of a specified size initialized all to 0 easily, using the zeros() function.

+
+
+
b = np.zeros((10,8))
+b
+
+
+
+
+
array([[0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0.]])
+
+
+
+
+

There is also an analogous ones() and empty() array routine. Note that here we can explicitly set the datatype for the array in this function if we wish.

+

Unlike lists in python, all of the elements of a numpy array are of the same datatype

+
+
+
c = np.eye(10, dtype=np.float64)
+c
+
+
+
+
+
array([[1., 0., 0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 1., 0., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 1., 0., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 1., 0., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 1., 0., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 1., 0., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 1., 0., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 1., 0., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0., 1., 0.],
+       [0., 0., 0., 0., 0., 0., 0., 0., 0., 1.]])
+
+
+
+
+

linspace creates an array with evenly space numbers. The endpoint optional argument specifies whether the upper range is in the array or not

+
+
+
d = np.linspace(0, 1, 10, endpoint=False)
+print(d)
+
+
+
+
+
[0.  0.1 0.2 0.3 0.4 0.5 0.6 0.7 0.8 0.9]
+
+
+
+
+
+

Quick Exercise

+

Analogous to linspace(), there is a logspace() function that creates an array with elements equally spaced in log. Use help(np.logspace) to see the arguments, and create an array with 10 elements from \(10^{-6}\) to \(10^3\).

+
+
+
+

Array Operations#

+

most operations (+, -, *, /) will work on an entire array at once, element-by-element.

+

Note that that the multiplication operator is not a matrix multiply, but @ will do matrix multiplication.

+

Let’s create a simply array to start with

+
+
+
a = np.arange(12).reshape(3,4)
+print(a)
+
+
+
+
+
[[ 0  1  2  3]
+ [ 4  5  6  7]
+ [ 8  9 10 11]]
+
+
+
+
+

Multiplication by a scalar multiplies every element

+
+
+
a*2
+
+
+
+
+
array([[ 0,  2,  4,  6],
+       [ 8, 10, 12, 14],
+       [16, 18, 20, 22]])
+
+
+
+
+

adding two arrays adds element-by-element

+
+
+
a + a
+
+
+
+
+
array([[ 0,  2,  4,  6],
+       [ 8, 10, 12, 14],
+       [16, 18, 20, 22]])
+
+
+
+
+

multiplying two arrays multiplies element-by-element

+
+
+
a*a
+
+
+
+
+
array([[  0,   1,   4,   9],
+       [ 16,  25,  36,  49],
+       [ 64,  81, 100, 121]])
+
+
+
+
+
+

Quick Exercise

+

What do you think 1./a will do? Try it and see

+
+

We can think of our 2-d array as a 3 x 4 matrix (3 rows, 4 columns). We can take the transpose to geta 4 x 3 matrix, and then we can do a matrix multiplication

+

We can do some basic linear algebra operations on arrays. The operator @ is a matrix multiplication / dot-product operator

+
+
+
b = a.transpose()
+b
+
+
+
+
+
array([[ 0,  4,  8],
+       [ 1,  5,  9],
+       [ 2,  6, 10],
+       [ 3,  7, 11]])
+
+
+
+
+
+
+
a @ b
+
+
+
+
+
array([[ 14,  38,  62],
+       [ 38, 126, 214],
+       [ 62, 214, 366]])
+
+
+
+
+

We can sum the elements of an array:

+
+
+
a.sum()
+
+
+
+
+
np.int64(66)
+
+
+
+
+
+

Quick Exercise

+

sum() takes an optional argument, axis=N, where N is the axis to sum over. Sum the elements of a across rows to create an array with just the sum along each column of a.

+
+

We can also easily get the extrema

+
+
+
print(a.min(), a.max())
+
+
+
+
+
0 11
+
+
+
+
+
+
+

universal functions#

+

universal functions work element-by-element. Let’s create a new array scaled by pi / 12

+
+
+
b = a*np.pi/12.0
+print(b)
+
+
+
+
+
[[0.         0.26179939 0.52359878 0.78539816]
+ [1.04719755 1.30899694 1.57079633 1.83259571]
+ [2.0943951  2.35619449 2.61799388 2.87979327]]
+
+
+
+
+
+
+
c = np.cos(b)
+print(c)
+
+
+
+
+
[[ 1.00000000e+00  9.65925826e-01  8.66025404e-01  7.07106781e-01]
+ [ 5.00000000e-01  2.58819045e-01  6.12323400e-17 -2.58819045e-01]
+ [-5.00000000e-01 -7.07106781e-01 -8.66025404e-01 -9.65925826e-01]]
+
+
+
+
+
+
+
d = b + c 
+
+
+
+
+
+
+
print(d)
+
+
+
+
+
[[1.         1.22772521 1.38962418 1.49250494]
+ [1.54719755 1.56781598 1.57079633 1.57377667]
+ [1.5943951  1.64908771 1.75196847 1.91386744]]
+
+
+
+
+
+

Quick Exercise

+

We will often want to write our own function that operates on an array and returns a new array. We can do this just like we did with functions previously—the key is to use the methods from the np module to do any operations, since they work on, and return, arrays.

+

Write a simple function that returns \(\sin(2\pi x)\) for an input array x. Then test it +by passing in an array x that you create via linspace()

+
+
+
+

Slicing#

+

slicing works very similarly to how we saw with strings. Remember, python uses 0-based indexing

+

Consider the following array:

+
+
+
a = np.arange(9)
+a
+
+
+
+
+
array([0, 1, 2, 3, 4, 5, 6, 7, 8])
+
+
+
+
+

Now look at accessing a single element vs. a range (using slicing)

+

Giving a single (0-based) index just references a single value

+
+
+
a[2]
+
+
+
+
+
np.int64(2)
+
+
+
+
+

When we do a range, like a[2:5], then we get the elements starting at index 2 and up to, but not including index 5.

+

That is, slicing uses the interval: [begin, end)

+
+
+
a[2:5]
+
+
+
+
+
array([2, 3, 4])
+
+
+
+
+
+
+
a[2:4]
+
+
+
+
+
array([2, 3])
+
+
+
+
+

The : can be used to specify all of the elements in that dimension

+
+
+
a[:]
+
+
+
+
+
array([0, 1, 2, 3, 4, 5, 6, 7, 8])
+
+
+
+
+
+
+

Multidimensional Arrays#

+

Multidimensional arrays are stored in a contiguous space in memory – this means that the columns / rows need to be unraveled (flattened) so that it can be thought of as a single one-dimensional array. Different programming languages do this via different conventions:

+

multidimensional array formatting, row-major vs. column-major

+

Storage order:

+
    +
  • Python/C use row-major storage: rows are stored one after the other

  • +
  • Fortran/matlab use column-major storage: columns are stored one after another

  • +
+

The ordering matters when

+
    +
  • passing arrays between languages (we’ll talk about this later this semester)

  • +
  • looping over arrays – you want to access elements that are next to one-another in memory

    +
      +
    • e.g, in Fortran:

      +
      double precision :: A(M,N)
      +do j = 1, N
      +   do i = 1, M
      +      A(i,j) = …
      +   enddo
      +enddo
      +
      +
      +
    • +
    • in C

      +
      double A[M][N];
      +for (i = 0; i < M; i++) {
      +   for (j = 0; j < N; j++) {
      +      A[i][j] = …
      +   }
      +}  
      +
      +
      +
    • +
    +
  • +
+

In python, using NumPy, we’ll try to avoid explicit loops over elements as much as possible

+

Let’s look at multidimensional arrays:

+
+
+
a = np.arange(15).reshape(3,5)
+a
+
+
+
+
+
array([[ 0,  1,  2,  3,  4],
+       [ 5,  6,  7,  8,  9],
+       [10, 11, 12, 13, 14]])
+
+
+
+
+

Notice that the output of a shows the row-major storage. The rows are grouped together in the inner [...]

+

Giving a single index (0-based) for each dimension just references a single value in the array

+
+
+
a[1,1]
+
+
+
+
+
np.int64(6)
+
+
+
+
+

Doing slices will access a range of elements. Think of the start and stop in the slice as referencing the left-edge of the slots in the array.

+
+
+
a[0:2,0:2]
+
+
+
+
+
array([[0, 1],
+       [5, 6]])
+
+
+
+
+

Access a specific column

+
+
+
a[:,1]
+
+
+
+
+
array([ 1,  6, 11])
+
+
+
+
+

Sometimes we want a one-dimensional view into the array – here we see the memory layout (row-major) more explicitly

+
+
+
a.flatten()
+
+
+
+
+
array([ 0,  1,  2,  3,  4,  5,  6,  7,  8,  9, 10, 11, 12, 13, 14])
+
+
+
+
+

we can also iterate – this is done over the first axis (rows)

+
+
+
for row in a:
+    print(row)
+
+
+
+
+
[0 1 2 3 4]
+[5 6 7 8 9]
+[10 11 12 13 14]
+
+
+
+
+

or element by element

+
+
+
for e in a.flat:
+    print(e)
+
+
+
+
+
0
+1
+2
+3
+4
+5
+6
+7
+8
+9
+10
+11
+12
+13
+14
+
+
+
+
+

Generally speaking, we want to avoid looping over the elements of an array in python—this is slow. Instead we want to write and use functions that operate on the entire array at once.

+
+

Quick Exercise

+

Consider the array defined as:

+

+ q = np.array([[1, 2, 3, 2, 1],
+               [2, 4, 4, 4, 2],
+               [3, 4, 4, 4, 3],
+               [2, 4, 4, 4, 2],
+               [1, 2, 3, 2, 1]])
+ 
+
+
+
    +
  • using slice notation, create an array that consists of only the 4’s in q (this will be called a view, as we’ll see shortly)

  • +
  • zero out all of the elements in your view

  • +
  • how does q change?

  • +
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/02-numpy/numpy-exercises.html b/02-numpy/numpy-exercises.html new file mode 100644 index 00000000..1ad8bb45 --- /dev/null +++ b/02-numpy/numpy-exercises.html @@ -0,0 +1,776 @@ + + + + + + + + + + + NumPy exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

NumPy exercises

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

NumPy exercises#

+

Some of these come from / are inspired from rougier/numpy-100 and http://www.scipy-lectures.org/intro/numpy/exercises.html

+

You might want to look over these lists as well.

+
+
+
import numpy as np
+
+
+
+
+
+

Q1#

+

We can use np.random.random_sample() to create an array with random values. By default, these will be in the range [0.0, 1.0). You can +multiple the output and add a scalar to it to get it to be in a different range.

+

Create a 10 x 10 array initialized with random numbers that lie between 0 and 10.

+

Then compute the average of the array (there is a numpy function for this, np.mean()).

+
+
+

Q2#

+

Create the array:

+
[[1,  6, 11],
+ [2,  7, 12],
+ [3,  8, 13],
+ [4,  9, 14],
+ [5, 10, 15]]
+
+
+

with out explicitly typing it in.

+

Now create a new array containing only its 2nd and 4th rows.

+
+
+

Q3#

+

Create a 2d array with 1 on the border and 0 on the inside, e.g., like:

+
1 1 1 1 1
+1 0 0 0 1
+1 0 0 0 1
+1 1 1 1 1
+
+
+

Do this using array slice notation to let it work for an arbitrary-sized array

+
+
+

Q4#

+
    +
  • Create an array with angles in degrees 0, 15, 30, … 90 (i.e., every 15 degrees up to 90).

  • +
  • Now create 3 new arrays with the sine, cosine, and tangent of the elements of the first array

  • +
  • Finally, calculate the inverse sine, inverse cosine, and inverse tangent the arrays above and compare to the original angles

  • +
+
+
+

Q5#

+

Given the array:

+
x = np.array([1, -1, 2, 5, 8, 4, 10, 12, 3])
+
+
+

calculate the difference of each element with its neighbor.

+
+
+

Q6#

+

Here we will read in columns of numbers from a file and create a histogram, using NumPy routines. Make sure you have the data file +“sample.txt” in the same directory as this notebook (you can download it from https://raw.githubusercontent.com/sbu-python-summer/python-tutorial/master/day-3/sample.txt

+
    +
  • Use np.loadtxt() to read this file in.

  • +
  • Next, use np.histogram() to create a histogram array. The output returns both the count and an array of edges.

  • +
  • Finally, loop over the bins and print out the bin center (averaging the left and right edges of the bin) and the count for that bin.

  • +
+
+
+

Q7#

+

NumPy has a standard deviation function, np.std(), but here we’ll write our own that works on a 1-d array (vector). The standard +deviation is a measure of the “width” of the distribution of numbers +in the vector.

+

Given an array, \(a\), and an average \(\bar{a}\), the standard deviation +is:

+
+\[ +\sigma = \left [ \frac{1}{N} \sum_{i=1}^N (a_i - \bar{a})^2 \right ]^{1/2} +\]
+

Write a function to calculate the standard deviation for an input array, a:

+
    +
  • First compute the average of the elements in a to define \(\bar{a}\)

  • +
  • Next compute the sum over the squares of \(a - \bar{a}\)

  • +
  • Then divide the sum by the number of elements in the array

  • +
  • Finally take the square root (you can use np.sqrt())

  • +
+

Test your function on a random array, and compare to the built-in np.std()

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/02-numpy/numpy.html b/02-numpy/numpy.html new file mode 100644 index 00000000..9906ea38 --- /dev/null +++ b/02-numpy/numpy.html @@ -0,0 +1,605 @@ + + + + + + + + + + + NumPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

NumPy

+ +
+
+ +
+
+
+ + + + +
+ +
+

NumPy#

+

The NumPy library provides a class for n-dimensional arrays of data.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/03-practices/git-single.html b/03-practices/git-single.html new file mode 100644 index 00000000..d684c3f7 --- /dev/null +++ b/03-practices/git-single.html @@ -0,0 +1,730 @@ + + + + + + + + + + + <no title> — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +

A single-user interaction with git:

+
    +
  • Make your project

    +

    We’ll start by making our project directory and moving into it:

    +
    $ mkdir myproject
    +$ cd myproject/
    +
    +
    +
  • +
  • Now have git track this

    +

    Now we do git init . – this tells git to initialize this +directory under version control

    +
    $ git init .
    +
    +
    +

    If we do ls at this point, we see nothing. However, there is a +“hidden” directory called .git/ which we can see by passing -a +to ls:

    +
    $ ls -al
    +$ ls -l .git
    +
    +
    +

    In that directory are the files that git uses to keep track of +changes and the history.

    +
  • +
  • Create a file

    +

    We’ll create a file called README (use whatever editor you like, +I’ll use emacs):

    +
    $ emacs -nw README
    +
    +
    +

    Add some descriptive text to the file and save it. At the moment, +git doesn’t know about this file – you can see this via git status:

    +
    $ git status
    +
    +
    +
  • +
  • Tell git about the file

    +

    Now we need to tell git to start tracking the file. We use +git add for this. Then we need to tell git to store the current +state of the file – we use git commit for this:

    +
    $ git add README
    +$ git commit README
    +
    +
    +

    Notice that an editor window pops up – take the time to give a +descriptive message about the changes.

    +

    If you make more changes to the file, git won’t store them until +you commit them. So you’ll commit the same file over and over as +it changes, but only add it once.

    +
  • +
  • Create another file

    +

    Let’s create a python program, awesome.py with the line:

    +
    print("hello")
    +
    +
    +

    Now add that file and commit it too

    +
    $ git add awesome.py
    +$ git commit .
    +
    +
    +
  • +
  • Look at your log

    +

    git log will show you all the commits, the message you entered +when you made the commit (that helps you understand what was done). +It will also have a “hash” next to the commit (like +dbc2916bb609759d54ca7668558bc639bab9b60b)

    +
    $ git log
    +
    +
    +
  • +
  • Add to you code

    +

    Edit awesome.py and make it a function and have your program call +the function. Now we need to commit this again:

    +
    $ git commit awesome.py 
    +
    +
    +

    And git log will show this commit as separate from the one we made +when we created the file.

    +
  • +
  • Go back in time

    +

    Suppose our code is not working anymore, and we know it was in the +past. We can go back to any previous version of the code by using +checkout and the hash next to that commit (note: your hashes will +be different than mine).

    +
    $ git log
    +$ git checkout dbc2916bb609759d54ca7668558bc639bab9b60b
    +
    +
    +

    Look at the file, and you’ll see it is different.

    +

    If you want to go back to the latest version, you can checkout master +– that’s the name of the main “branch” git recognizes.

    +
    git checkout master
    +
    +
    +
  • +
  • Working with branches

    +

    Suppose we want to do some development that might be invasive and we +don’t want to break the working code on “master”. We can use a +branch for this – thing of this as a parallel development that can +track the master branch and merge back and forth with it. We can +work on this new branch until we are happy, and then incorporate our +changes back to master.

    +

    Here we’ll create a new branch called development:

    +
    $ git checkout -b development
    +
    +
    +

    Now make some changes to awesome.py and commit them.

    +
    $ emacs -nw awesome.py
    +$ git commit awesome.py
    +
    +
    +

    If you go back to master, you won’t see these changes:

    +
    $ git checkout master
    +$ more awesome.py
    +
    +
    +

    If you are happy with the changes, you can do a merge. While on +master, merge development into master with:

    +
    $ git merge development
    +
    +
    +
  • +
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/03-practices/python-style.html b/03-practices/python-style.html new file mode 100644 index 00000000..f2945c81 --- /dev/null +++ b/03-practices/python-style.html @@ -0,0 +1,683 @@ + + + + + + + + + + + Python Style (from the PEP-0008) — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Python Style (from the PEP-0008)

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Python Style (from the PEP-0008)#

+

This notebook shows the various code snippets from the PEP-0008 style guide: http://legacy.python.org/dev/peps/pep-0008/

+
+

code lay-out#

+
+

indentation#

+

Indentation should use 4 spaces per indentation level (and NOT tabs). Python 3 does not allow for a mixture of tabs and spaces. Note that a lot of editors will map the tab key into a sequence of spaces

+

Continuation lines should align wrapped elements either vertically inside parentheses, brackets, or braces, or using a hanging indent (with no arguments on the first line)

+

note: to prevent ipython from throwing errors that some things are not defined, not all the code is in a code cell.

+
+
+

line length#

+

Lines should be a maximum of 79 characters.

+

The 80-column terminal goes back to the early terminals and page-widths for printers and is pretty much a good standard for any language.

+

Comments and docstrings should be limited to 72-characters

+

Implied line continuation is automatic inside parenthesis, brackets

+
+
+
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/04-matplotlib/ipyvolume-example.html b/04-matplotlib/ipyvolume-example.html new file mode 100644 index 00000000..4c8db4ca --- /dev/null +++ b/04-matplotlib/ipyvolume-example.html @@ -0,0 +1,759 @@ + + + + + + + + + + + <no title> — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+
+
import numpy as np
+import ipyvolume
+
+
+
+
+
---------------------------------------------------------------------------
+ModuleNotFoundError                       Traceback (most recent call last)
+Cell In[1], line 2
+      1 import numpy as np
+----> 2 import ipyvolume
+
+ModuleNotFoundError: No module named 'ipyvolume'
+
+
+
+
+
+
+
N = 64
+x = np.linspace(0.0, 1.0, N)
+y = np.linspace(0.0, 1.0, N)
+z = np.linspace(0.0, 1.0, N)
+
+x3d, y3d, z3d = np.meshgrid(x, y, z, indexing="ij")
+
+r = np.sqrt((x3d - 0.5)**2 + (y3d - 0.5)**2 + (z3d - 0.5)**2)
+
+
+
+
+
+
+
f = 1.0 + np.sin(x3d*np.pi*5)*np.sin(y3d*np.pi*7)*np.cos(z3d*np.pi*2) * np.exp(-r**2/0.25**2)
+
+
+
+
+
+
+
a = ipyvolume.volshow(f)
+
+
+
+
+
---------------------------------------------------------------------------
+NameError                                 Traceback (most recent call last)
+Cell In[4], line 1
+----> 1 a = ipyvolume.volshow(f)
+
+NameError: name 'ipyvolume' is not defined
+
+
+
+
+
+
+
a
+
+
+
+
+
---------------------------------------------------------------------------
+NameError                                 Traceback (most recent call last)
+Cell In[5], line 1
+----> 1 a
+
+NameError: name 'a' is not defined
+
+
+
+
+
+
+
import numpy as np
+import ipyvolume as ipv
+V = np.zeros((128,128,128)) # our 3d array
+# outer box
+V[30:-30,30:-30,30:-30] = 0.75
+V[35:-35,35:-35,35:-35] = 0.0
+# inner box
+V[50:-50,50:-50,50:-50] = 0.25
+V[55:-55,55:-55,55:-55] = 0.0
+ipv.quickvolshow(V, level=[0.25, 0.75], opacity=0.03, level_width=0.1, data_min=0, data_max=1)
+
+
+
+
+
---------------------------------------------------------------------------
+ModuleNotFoundError                       Traceback (most recent call last)
+Cell In[6], line 2
+      1 import numpy as np
+----> 2 import ipyvolume as ipv
+      3 V = np.zeros((128,128,128)) # our 3d array
+      4 # outer box
+      5 V[30:-30,30:-30,30:-30] = 0.75
+
+ModuleNotFoundError: No module named 'ipyvolume'
+
+
+
+
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/04-matplotlib/matplotlib-basics.html b/04-matplotlib/matplotlib-basics.html new file mode 100644 index 00000000..d6b99630 --- /dev/null +++ b/04-matplotlib/matplotlib-basics.html @@ -0,0 +1,1222 @@ + + + + + + + + + + + matplotlib — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

matplotlib#

+

Matplotlib is the core plotting package in scientific python. There are others to explore as well (which we’ll chat about on slack).

+
+

Note

+

There are different interfaces for interacting with matplotlib, an interactive, function-driven (state machine) command-set and an object-oriented version. We’ll focus on the OO interface.

+
+
+

Tip

+

To enable interactivity in the plots, install the ipympl package and then +in a cell, run:

+
%matplotlib widget
+
+
+
+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Matplotlib concepts#

+

Matplotlib was designed with the following goals (from mpl docs):

+
    +
  • Plots should look great—publication quality (e.g. antialiased)

  • +
  • Postscript/PDF output for inclusion with TeX documents

  • +
  • Embeddable in a graphical user interface for application development

  • +
  • Code should be easy to understand it and extend

  • +
  • Making plots should be easy

  • +
+

Matplotlib is mostly for 2-d data, but there are some basic 3-d (surface) interfaces.

+

Volumetric data requires a different approach

+ +
+

Importing#

+

There are several different interfaces for matplotlib (see https://matplotlib.org/3.1.1/faq/index.html)

+

Basic ideas:

+
    +
  • matplotlib is the entire package

  • +
  • matplotlib.pyplot is a module within matplotlib that provides easy access to the core plotting routines

  • +
  • pylab combines pyplot and numpy into a single namespace to give a MatLab like interface. You should avoid this—it might be removed in the future.

  • +
+

There are a number of modules that extend its behavior, e.g. basemap for plotting on a sphere, mplot3d for 3-d surfaces

+
+
+

Anatomy of a figure#

+

Figures are the highest level object and can include multiple axes +anatomy of a matplotlib figure showing the different components

+

(figure from: http://matplotlib.org/faq/usage_faq.html#parts-of-a-figure )

+
+
+

Backends#

+

Interactive backends: pygtk, wxpython, tkinter, …

+

Hardcopy backends: PNG, PDF, PS, SVG, …

+
+
+
+
+

Basic plotting#

+
+
+
x = np.linspace(0.0, 2.0*np.pi, 50)
+y = np.cos(x)
+
+
+
+
+

plot() is the most basic command.

+

We’ll use plt.subplots() to create a Figure and Axis object

+
+
+
fig, ax = plt.subplots()
+
+ax.plot(x, y)
+ax.set_xlabel(r"$x$")
+ax.set_ylabel(r"$\cos(x)$")
+ax.set_xlim(0, 2*np.pi)
+
+
+
+
+
(0.0, 6.283185307179586)
+
+
+a plot of a cosine function +
+
+

Here we also see that we can use LaTeX notation for the axes.

+
+

Quick Exercise

+

We can plot 2 lines on a plot simply by calling plot twice. Make a plot with both sin(x) and cos(x) drawn

+
+

we can use symbols instead of lines pretty easily too—and label them

+
+
+
fig, ax = plt.subplots()
+
+ax.plot(x, np.sin(x), marker="o", label="sine")
+ax.plot(x, np.cos(x), marker="x", label="cosine")
+ax.set_xlim(0.0, 2.0*np.pi)
+ax.legend()
+
+
+
+
+
<matplotlib.legend.Legend at 0x7fab3fa21550>
+
+
+a plot of sine and cosine functions +
+
+
+

Tip

+

We can also specify basic style using a “format string” (see https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.plot.html)

+

This has the form '[marker][line][color]'

+
+

Here we can change the linestyle and thickness

+
+
+
fig, ax = plt.subplots()
+ax.plot(x, np.sin(x), linestyle="--", linewidth=3.0)
+ax.plot(x, np.cos(x), linestyle="-")
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fab3f903cb0>]
+
+
+sine and cosine functions now with the sine using a dotted line +
+
+

There are predefined styles that can be used too. Generally you need to start from the figure creation for these to take effect

+
+
+
plt.style.available
+
+
+
+
+
['Solarize_Light2',
+ '_classic_test_patch',
+ '_mpl-gallery',
+ '_mpl-gallery-nogrid',
+ 'bmh',
+ 'classic',
+ 'dark_background',
+ 'fast',
+ 'fivethirtyeight',
+ 'ggplot',
+ 'grayscale',
+ 'petroff10',
+ 'seaborn-v0_8',
+ 'seaborn-v0_8-bright',
+ 'seaborn-v0_8-colorblind',
+ 'seaborn-v0_8-dark',
+ 'seaborn-v0_8-dark-palette',
+ 'seaborn-v0_8-darkgrid',
+ 'seaborn-v0_8-deep',
+ 'seaborn-v0_8-muted',
+ 'seaborn-v0_8-notebook',
+ 'seaborn-v0_8-paper',
+ 'seaborn-v0_8-pastel',
+ 'seaborn-v0_8-poster',
+ 'seaborn-v0_8-talk',
+ 'seaborn-v0_8-ticks',
+ 'seaborn-v0_8-white',
+ 'seaborn-v0_8-whitegrid',
+ 'tableau-colorblind10']
+
+
+
+
+
+
+
plt.style.use("fivethirtyeight")
+
+fig = plt.figure()
+ax = fig.add_subplot(111)
+ax.plot(x, np.sin(x), linestyle="--", linewidth=3.0)
+ax.plot(x, np.cos(x), linestyle="-")
+ax.set_xlim(0.0, 2.0*np.pi)
+
+
+
+
+
(0.0, 6.283185307179586)
+
+
+a different theme -- now the figure background is gray and the font and colors are different +
+
+
+
+
plt.style.use("default")
+
+
+
+
+
+
+

Multiple axes#

+

There are a wide range of methods for putting multiple axes on a grid. We’ll look at the simplest method.

+

The add_subplot() method we’ve been using can take 3 numbers: the number of rows, number of columns, and current index

+
+
+
fig = plt.figure()
+
+ax1 = fig.add_subplot(211)
+
+x = np.linspace(0,5, 100)
+ax1.plot(x, x**3 - 4*x)
+ax1.set_xlabel("x")
+ax1.set_ylabel(r"$x^3 - 4x$", fontsize="large")
+
+ax2 = fig.add_subplot(212)
+
+ax2.plot(x, np.exp(-x**2))
+ax2.set_xlabel("x")
+ax2.set_ylabel("Gaussian")
+
+# log scale
+ax2.set_yscale("log")
+
+# tight_layout() makes sure things don't overlap
+fig.tight_layout()
+
+
+
+
+two axes stacked vertically, with a cubic function drawn on the top and a Gaussian (log-scale) on the bottom +
+
+
+
+

Visualizing 2-d array data#

+

2-d datasets consist of (x, y) pairs and a value associated with that point. Here we create a 2-d Gaussian, using the meshgrid() function to define a rectangular set of points.

+
+
+
def g(x, y):
+    return np.exp(-((x-0.5)**2)/0.1**2 - ((y-0.5)**2)/0.2**2)
+
+N = 100
+
+x = np.linspace(0.0, 1.0, N)
+y = x.copy()
+
+xv, yv = np.meshgrid(x, y)
+
+
+
+
+

A “heatmap” style plot assigns colors to the data values. A lot of work has gone into the latest matplotlib to define a colormap that works good for colorblindness and black-white printing.

+
+
+
fig, ax = plt.subplots()
+
+im = ax.imshow(g(xv, yv), origin="lower")
+fig.colorbar(im, ax=ax)
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fab3f537620>
+
+
+a heat-map of a 2D Gaussian +
+
+

Sometimes we want to show just contour lines—like on a topographic map. The contour() function does this for us.

+
+
+
fig, ax = plt.subplots()
+
+contours = ax.contour(g(xv, yv))
+ax.axis("equal")   # this adjusts the size of image to make x and y lengths equal
+
+
+
+
+
(np.float64(0.0), np.float64(99.0), np.float64(0.0), np.float64(99.0))
+
+
+contour plot of a 2D Gaussian +
+
+
+

Quick Exercise

+

Contour plots can label the contours, using the ax.clabel() function. +Try adding labels to this contour plot.

+
+
+
+

Error bars#

+

For experiments, we often have errors associated with the \(y\) values. Here we create some data and add some noise to it, then plot it with errors.

+
+
+
def y_experiment(a1, a2, sigma, x):
+    """ return the experimental data in a linear + random fashion a1
+        is the intercept, a2 is the slope, and sigma is the error """
+
+    N = len(x)
+
+    # standard_normal gives samples from the "standard normal" distribution
+    rng = np.random.default_rng()
+    r = rng.standard_normal(N)
+    y = a1 + a2*x + sigma*r
+    return y
+
+N = 40
+x = np.linspace(0.0, 100.0, N)
+sigma = 25.0*np.ones(N)
+y = y_experiment(10.0, 3.0, sigma, x)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.errorbar(x, y, yerr=sigma, fmt="o")
+
+
+
+
+
<ErrorbarContainer object of 3 artists>
+
+
+a plot showing data points with vertical error bars +
+
+
+
+

Annotations#

+

adding text and annotations is easy

+
+
+
xx = np.linspace(0, 2.0*np.pi, 1000)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(xx, np.sin(xx))
+ax.text(np.pi/2, np.sin(np.pi/2), r"maximum")
+
+
+
+
+
Text(1.5707963267948966, 1.0, 'maximum')
+
+
+a sine wave with the peak labeled "maximum" +
+
+

we can also turn off the top and right “splines”

+
+
+
ax.spines['right'].set_visible(False)
+ax.spines['top'].set_visible(False)
+ax.xaxis.set_ticks_position('bottom')                                           
+ax.yaxis.set_ticks_position('left') 
+fig
+
+
+
+
+a sine wave with the peak labeled "maximum" and only the left and lower axes drawn +
+
+

Annotations with an arrow are also possible

+
+
+
#example from http://matplotlib.org/examples/pylab_examples/annotation_demo.html
+fig = plt.figure()
+ax = fig.add_subplot(111, projection='polar')
+r = np.arange(0, 1, 0.001)
+theta = 2*2*np.pi*r
+line, = ax.plot(theta, r, color='#ee8d18', lw=3)
+
+ind = 800
+thisr, thistheta = r[ind], theta[ind]
+ax.plot([thistheta], [thisr], 'o')
+ax.annotate('a polar annotation',
+            xy=(thistheta, thisr),  # theta, radius
+            xytext=(0.05, 0.05),    # fraction, fraction
+            textcoords='figure fraction',
+            arrowprops=dict(facecolor='black', shrink=0.05),
+            horizontalalignment='left',
+            verticalalignment='bottom',
+            )
+
+
+
+
+
Text(0.05, 0.05, 'a polar annotation')
+
+
+a polar plot of a spiral with a point labeled +
+
+
+
+

Surface plots#

+

matplotlib can’t deal with true 3-d data (i.e., x,y,z + a value), but it can plot 2-d surfaces and lines in 3-d.

+
+
+
from mpl_toolkits.mplot3d import Axes3D
+fig = plt.figure()
+ax = plt.axes(projection="3d")
+
+# parametric curves
+N = 100
+theta = np.linspace(-4*np.pi, 4*np.pi, N)
+z = np.linspace(-2, 2, N)
+r = z**2 + 1
+
+x = r*np.sin(theta)
+y = r*np.cos(theta)
+
+ax.plot(x,y,z)
+
+
+
+
+
[<mpl_toolkits.mplot3d.art3d.Line3D at 0x7fab3ed13770>]
+
+
+a 3D plot of a curve that spirals around the vertical axis +
+
+
+
+
fig = plt.figure()
+ax = plt.axes(projection="3d")
+
+X = np.arange(-5,5, 0.25)
+Y = np.arange(-5,5, 0.25)
+X, Y = np.meshgrid(X, Y)
+R = np.sqrt(X**2 + Y**2)
+Z = np.sin(R)
+
+surf = ax.plot_surface(X, Y, Z, rstride=1, cstride=1, cmap="coolwarm")
+
+# and the view (note: most interactive backends will allow you to rotate this freely)
+ax.azim = 90
+ax.elev = 40
+
+
+
+
+a surface plot of a function colored by z value +
+
+
+
+

Histograms#

+

here we generate a bunch of gaussian-normalized random numbers and make a histogram. The probability distribution should match +$\(y(x) = \frac{1}{\sigma \sqrt{2\pi}} e^{-x^2/(2\sigma^2)}\)$

+
+
+
N = 10000
+rng = np.random.default_rng()
+r = rng.standard_normal(N)
+
+fig, ax = plt.subplots()
+ax.hist(r, density=True, bins=20)
+
+x = np.linspace(-5,5,200)
+sigma = 1.0
+ax.plot(x, np.exp(-x**2/(2*sigma**2)) / (sigma*np.sqrt(2.0*np.pi)),
+        c="C1", lw=2)
+ax.set_xlabel("x")
+
+
+
+
+
Text(0.5, 0, 'x')
+
+
+a histogram of Gaussian random numbers, with a Gaussian function plotted matching it well +
+
+
+
+

Final fun#

+

if you want to make things look hand-drawn in the style of xkcd, rerun these examples after doing +plt.xkcd()

+
+
+
plt.xkcd()
+
+
+
+
+
<contextlib.ExitStack at 0x7fab3cc96760>
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/04-matplotlib/matplotlib-basics.html.backup b/04-matplotlib/matplotlib-basics.html.backup new file mode 100644 index 00000000..3495a1a3 --- /dev/null +++ b/04-matplotlib/matplotlib-basics.html.backup @@ -0,0 +1,1236 @@ + + + + + + + + + + + matplotlib — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

matplotlib#

+

Matplotlib is the core plotting package in scientific python. There are others to explore as well (which we’ll chat about on slack).

+
+

Note

+

There are different interfaces for interacting with matplotlib, an interactive, function-driven (state machine) command-set and an object-oriented version. We’ll focus on the OO interface.

+
+
+

Tip

+

To enable interactivity in the plots, install the ipympl package and then +in a cell, run:

+
%matplotlib widget
+
+
+
+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Matplotlib concepts#

+

Matplotlib was designed with the following goals (from mpl docs):

+
    +
  • Plots should look great—publication quality (e.g. antialiased)

  • +
  • Postscript/PDF output for inclusion with TeX documents

  • +
  • Embeddable in a graphical user interface for application development

  • +
  • Code should be easy to understand it and extend

  • +
  • Making plots should be easy

  • +
+

Matplotlib is mostly for 2-d data, but there are some basic 3-d (surface) interfaces.

+

Volumetric data requires a different approach

+ +
+

Importing#

+

There are several different interfaces for matplotlib (see https://matplotlib.org/3.1.1/faq/index.html)

+

Basic ideas:

+
    +
  • matplotlib is the entire package

  • +
  • matplotlib.pyplot is a module within matplotlib that provides easy access to the core plotting routines

  • +
  • pylab combines pyplot and numpy into a single namespace to give a MatLab like interface. You should avoid this—it might be removed in the future.

  • +
+

There are a number of modules that extend its behavior, e.g. basemap for plotting on a sphere, mplot3d for 3-d surfaces

+
+
+

Anatomy of a figure#

+

Figures are the highest level object and can include multiple axes +anatomy of a matplotlib figure showing the different components

+

(figure from: http://matplotlib.org/faq/usage_faq.html#parts-of-a-figure )

+
+
+

Backends#

+

Interactive backends: pygtk, wxpython, tkinter, …

+

Hardcopy backends: PNG, PDF, PS, SVG, …

+
+
+
+
+

Basic plotting#

+
+
+
x = np.linspace(0.0, 2.0*np.pi, 50)
+y = np.cos(x)
+
+
+
+
+

plot() is the most basic command.

+

We’ll use plt.subplots() to create a Figure and Axis object

+
+
+
fig, ax = plt.subplots()
+
+ax.plot(x, y)
+ax.set_xlabel(r"$x$")
+ax.set_ylabel(r"$\cos(x)$")
+ax.set_xlim(0, 2*np.pi)
+# alt-text: a plot of a cosine function
+
+
+
+
+
(0.0, 6.283185307179586)
+
+
+../_images/9231241e6bd766784356e576c64f4a902c6f34847590b61274f8a9b8380916b1.png +
+
+

Here we also see that we can use LaTeX notation for the axes.

+
+

Quick Exercise

+

We can plot 2 lines on a plot simply by calling plot twice. Make a plot with both sin(x) and cos(x) drawn

+
+

we can use symbols instead of lines pretty easily too—and label them

+
+
+
fig, ax = plt.subplots()
+
+ax.plot(x, np.sin(x), marker="o", label="sine")
+ax.plot(x, np.cos(x), marker="x", label="cosine")
+ax.set_xlim(0.0, 2.0*np.pi)
+ax.legend()
+# alt-text: a plot of sine and cosine functions
+
+
+
+
+
<matplotlib.legend.Legend at 0x7fab3fa21550>
+
+
+../_images/ea36916fe87eb56d146e30bc3732345060fe752538e655250838ad92c5d3b836.png +
+
+
+

Tip

+

We can also specify basic style using a “format string” (see https://matplotlib.org/3.1.1/api/_as_gen/matplotlib.pyplot.plot.html)

+

This has the form '[marker][line][color]'

+
+

Here we can change the linestyle and thickness

+
+
+
fig, ax = plt.subplots()
+ax.plot(x, np.sin(x), linestyle="--", linewidth=3.0)
+ax.plot(x, np.cos(x), linestyle="-")
+# alt-text: sine and cosine functions now with the sine using a dotted line
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fab3f903cb0>]
+
+
+../_images/c5438daabd7e7caf26009be4c16d43bb4bc5a754ef48f6b7a6a16440848bdb20.png +
+
+

There are predefined styles that can be used too. Generally you need to start from the figure creation for these to take effect

+
+
+
plt.style.available
+
+
+
+
+
['Solarize_Light2',
+ '_classic_test_patch',
+ '_mpl-gallery',
+ '_mpl-gallery-nogrid',
+ 'bmh',
+ 'classic',
+ 'dark_background',
+ 'fast',
+ 'fivethirtyeight',
+ 'ggplot',
+ 'grayscale',
+ 'petroff10',
+ 'seaborn-v0_8',
+ 'seaborn-v0_8-bright',
+ 'seaborn-v0_8-colorblind',
+ 'seaborn-v0_8-dark',
+ 'seaborn-v0_8-dark-palette',
+ 'seaborn-v0_8-darkgrid',
+ 'seaborn-v0_8-deep',
+ 'seaborn-v0_8-muted',
+ 'seaborn-v0_8-notebook',
+ 'seaborn-v0_8-paper',
+ 'seaborn-v0_8-pastel',
+ 'seaborn-v0_8-poster',
+ 'seaborn-v0_8-talk',
+ 'seaborn-v0_8-ticks',
+ 'seaborn-v0_8-white',
+ 'seaborn-v0_8-whitegrid',
+ 'tableau-colorblind10']
+
+
+
+
+
+
+
plt.style.use("fivethirtyeight")
+
+fig = plt.figure()
+ax = fig.add_subplot(111)
+ax.plot(x, np.sin(x), linestyle="--", linewidth=3.0)
+ax.plot(x, np.cos(x), linestyle="-")
+ax.set_xlim(0.0, 2.0*np.pi)
+# alt-text: a different theme -- now the figure background is gray and the font and colors are different
+
+
+
+
+
(0.0, 6.283185307179586)
+
+
+../_images/5617d55160afd4564a01ed069520d3f30915b23d9d997f8675ac844c00e19c29.png +
+
+
+
+
plt.style.use("default")
+
+
+
+
+
+
+

Multiple axes#

+

There are a wide range of methods for putting multiple axes on a grid. We’ll look at the simplest method.

+

The add_subplot() method we’ve been using can take 3 numbers: the number of rows, number of columns, and current index

+
+
+
fig = plt.figure()
+
+ax1 = fig.add_subplot(211)
+
+x = np.linspace(0,5, 100)
+ax1.plot(x, x**3 - 4*x)
+ax1.set_xlabel("x")
+ax1.set_ylabel(r"$x^3 - 4x$", fontsize="large")
+
+ax2 = fig.add_subplot(212)
+
+ax2.plot(x, np.exp(-x**2))
+ax2.set_xlabel("x")
+ax2.set_ylabel("Gaussian")
+
+# log scale
+ax2.set_yscale("log")
+
+# tight_layout() makes sure things don't overlap
+fig.tight_layout()
+# alt-text: two axes stacked vertically, with a cubic function drawn on the top and a Gaussian (log-scale) on the bottom
+
+
+
+
+../_images/05b93724c7fe07ec65ef5c1c21c6785ef2c54d0a8ded3cc3d404a1d49e57ead3.png +
+
+
+
+

Visualizing 2-d array data#

+

2-d datasets consist of (x, y) pairs and a value associated with that point. Here we create a 2-d Gaussian, using the meshgrid() function to define a rectangular set of points.

+
+
+
def g(x, y):
+    return np.exp(-((x-0.5)**2)/0.1**2 - ((y-0.5)**2)/0.2**2)
+
+N = 100
+
+x = np.linspace(0.0, 1.0, N)
+y = x.copy()
+
+xv, yv = np.meshgrid(x, y)
+
+
+
+
+

A “heatmap” style plot assigns colors to the data values. A lot of work has gone into the latest matplotlib to define a colormap that works good for colorblindness and black-white printing.

+
+
+
fig, ax = plt.subplots()
+
+im = ax.imshow(g(xv, yv), origin="lower")
+fig.colorbar(im, ax=ax)
+# alt-text: a heat-map of a 2D Gaussian
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fab3f537620>
+
+
+../_images/9ad115d2a594e0d189e996c0204cda78b2df12f8e9d61a968cab4d3ecaecd970.png +
+
+

Sometimes we want to show just contour lines—like on a topographic map. The contour() function does this for us.

+
+
+
fig, ax = plt.subplots()
+
+contours = ax.contour(g(xv, yv))
+ax.axis("equal")   # this adjusts the size of image to make x and y lengths equal
+# alt-text: contour plot of a 2D Gaussian
+
+
+
+
+
(np.float64(0.0), np.float64(99.0), np.float64(0.0), np.float64(99.0))
+
+
+../_images/18bb87f4a28b0bb4588355d6203a23546722fd40585a27f99318e66e528bee84.png +
+
+
+

Quick Exercise

+

Contour plots can label the contours, using the ax.clabel() function. +Try adding labels to this contour plot.

+
+
+
+

Error bars#

+

For experiments, we often have errors associated with the \(y\) values. Here we create some data and add some noise to it, then plot it with errors.

+
+
+
def y_experiment(a1, a2, sigma, x):
+    """ return the experimental data in a linear + random fashion a1
+        is the intercept, a2 is the slope, and sigma is the error """
+
+    N = len(x)
+
+    # standard_normal gives samples from the "standard normal" distribution
+    rng = np.random.default_rng()
+    r = rng.standard_normal(N)
+    y = a1 + a2*x + sigma*r
+    return y
+
+N = 40
+x = np.linspace(0.0, 100.0, N)
+sigma = 25.0*np.ones(N)
+y = y_experiment(10.0, 3.0, sigma, x)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.errorbar(x, y, yerr=sigma, fmt="o")
+# alt-text: a plot showing data points with vertical error bars
+
+
+
+
+
<ErrorbarContainer object of 3 artists>
+
+
+../_images/248d017378fc7c24dd754d652d9a91c009464062c1c98c72944cc2ad5b5dd486.png +
+
+
+
+

Annotations#

+

adding text and annotations is easy

+
+
+
xx = np.linspace(0, 2.0*np.pi, 1000)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(xx, np.sin(xx))
+ax.text(np.pi/2, np.sin(np.pi/2), r"maximum")
+# alt-text: a sine wave with the peak labeled "maximum"
+
+
+
+
+
Text(1.5707963267948966, 1.0, 'maximum')
+
+
+../_images/9117b21318fe3c3165d87c5d4c46d5a1b3c429cc8cf31bebed9c203fda6b40d9.png +
+
+

we can also turn off the top and right “splines”

+
+
+
ax.spines['right'].set_visible(False)
+ax.spines['top'].set_visible(False)
+ax.xaxis.set_ticks_position('bottom')                                           
+ax.yaxis.set_ticks_position('left') 
+fig
+# alt-text: a sine wave with the peak labeled "maximum" and only the left and lower axes drawn
+
+
+
+
+../_images/3ec9e8820552c29bedb8733a09eef410e319daa5f2f917b9366051c4e9f6b13d.png +
+
+

Annotations with an arrow are also possible

+
+
+
#example from http://matplotlib.org/examples/pylab_examples/annotation_demo.html
+fig = plt.figure()
+ax = fig.add_subplot(111, projection='polar')
+r = np.arange(0, 1, 0.001)
+theta = 2*2*np.pi*r
+line, = ax.plot(theta, r, color='#ee8d18', lw=3)
+
+ind = 800
+thisr, thistheta = r[ind], theta[ind]
+ax.plot([thistheta], [thisr], 'o')
+ax.annotate('a polar annotation',
+            xy=(thistheta, thisr),  # theta, radius
+            xytext=(0.05, 0.05),    # fraction, fraction
+            textcoords='figure fraction',
+            arrowprops=dict(facecolor='black', shrink=0.05),
+            horizontalalignment='left',
+            verticalalignment='bottom',
+            )
+# alt-text: a polar plot of a spiral with a point labeled 
+
+
+
+
+
Text(0.05, 0.05, 'a polar annotation')
+
+
+../_images/567340fd5c0f4220f685c50adc59432167e90edc971cdc98c37610d9cc7e7f4c.png +
+
+
+
+

Surface plots#

+

matplotlib can’t deal with true 3-d data (i.e., x,y,z + a value), but it can plot 2-d surfaces and lines in 3-d.

+
+
+
from mpl_toolkits.mplot3d import Axes3D
+fig = plt.figure()
+ax = plt.axes(projection="3d")
+
+# parametric curves
+N = 100
+theta = np.linspace(-4*np.pi, 4*np.pi, N)
+z = np.linspace(-2, 2, N)
+r = z**2 + 1
+
+x = r*np.sin(theta)
+y = r*np.cos(theta)
+
+ax.plot(x,y,z)
+# alt-text: a 3D plot of a curve that spirals around the vertical axis
+
+
+
+
+
[<mpl_toolkits.mplot3d.art3d.Line3D at 0x7fab3ed13770>]
+
+
+../_images/cff06e6db54c63aafc594447299f1f54fa904a8c1ffdcd6337a6f738f0d98336.png +
+
+
+
+
fig = plt.figure()
+ax = plt.axes(projection="3d")
+
+X = np.arange(-5,5, 0.25)
+Y = np.arange(-5,5, 0.25)
+X, Y = np.meshgrid(X, Y)
+R = np.sqrt(X**2 + Y**2)
+Z = np.sin(R)
+
+surf = ax.plot_surface(X, Y, Z, rstride=1, cstride=1, cmap="coolwarm")
+
+# and the view (note: most interactive backends will allow you to rotate this freely)
+ax.azim = 90
+ax.elev = 40
+# alt-text: a surface plot of a function colored by z value
+
+
+
+
+../_images/fb0a6c80516310178afbce3044be9cff9c3d04e75390440cb7f125480aa50ee5.png +
+
+
+
+

Histograms#

+

here we generate a bunch of gaussian-normalized random numbers and make a histogram. The probability distribution should match +$\(y(x) = \frac{1}{\sigma \sqrt{2\pi}} e^{-x^2/(2\sigma^2)}\)$

+
+
+
N = 10000
+rng = np.random.default_rng()
+r = rng.standard_normal(N)
+
+fig, ax = plt.subplots()
+ax.hist(r, density=True, bins=20)
+
+x = np.linspace(-5,5,200)
+sigma = 1.0
+ax.plot(x, np.exp(-x**2/(2*sigma**2)) / (sigma*np.sqrt(2.0*np.pi)),
+        c="C1", lw=2)
+ax.set_xlabel("x")
+# alt-text: a histogram of Gaussian random numbers, with a Gaussian function plotted matching it well
+
+
+
+
+
Text(0.5, 0, 'x')
+
+
+../_images/34e1da86c9edd98931cacd10bfecba95f96f423142d61cbe2e13833a93adf48f.png +
+
+
+
+

Final fun#

+

if you want to make things look hand-drawn in the style of xkcd, rerun these examples after doing +plt.xkcd()

+
+
+
plt.xkcd()
+
+
+
+
+
<contextlib.ExitStack at 0x7fab3cc96760>
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/04-matplotlib/matplotlib-exercises.html b/04-matplotlib/matplotlib-exercises.html new file mode 100644 index 00000000..a161564d --- /dev/null +++ b/04-matplotlib/matplotlib-exercises.html @@ -0,0 +1,835 @@ + + + + + + + + + + + matplotlib exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

matplotlib exercises#

+
+
+
import matplotlib.pyplot as plt
+import numpy as np
+
+
+
+
+
+

Q1: planetary positions#

+

The distances of the planets from the Sun (technically, their semi-major axes) are:

+
+
+
a = np.array([0.39, 0.72, 1.00, 1.52, 5.20, 9.54, 19.22, 30.06, 39.48])
+
+
+
+
+

These are in units where the Earth-Sun distance is 1 (astronomical units).

+

The corresponding periods of their orbits (how long they take to go once around the Sun) are, in years

+
+
+
P = np.array([0.24, 0.62, 1.00, 1.88, 11.86, 29.46, 84.01, 164.8, 248.09])
+
+
+
+
+

Finally, the names of the planets corresponding to these are:

+
+
+
names = ["Mercury", "Venus", "Earth", "Mars", "Jupiter", "Saturn", 
+         "Uranus", "Neptune", "Pluto"]
+
+
+
+
+

(technically, pluto isn’t a planet anymore, but we still love it :)

+
    +
  • Plot as points, the periods vs. distances for each planet on a log-log plot.

  • +
  • Write the name of the planet next to the point for that planet on the plot

  • +
+
+
+

Q2: drawing a circle#

+

For an angle \(\theta\) in the range \(\theta \in [0, 2\pi]\), the polar equations of a circle of radius \(R\) are:

+
+\[x = R\cos(\theta)\]
+
+\[y = R\sin(\theta)\]
+

We want to draw a circle.

+
    +
  • Create an array to hold the theta values—the more we use, the smoother the circle will be

  • +
  • Create x and y arrays from theta for your choice of \(R\)

  • +
  • Plot y vs. x

  • +
+

Now, look up the matplotlib fill() function, and draw a circle filled in with a solid color.

+
+
+

Q3: Circles, circles, circles…#

+

Generalize your circle drawing commands to produce a function,

+
draw_circle(x0, y0, R, color)
+
+
+

that draws the circle. Here, (x0, y0) is the center of the circle, R is the radius, and color is the color of the circle.

+

Now randomly draw 10 circles at different locations, with random radii, and random colors on the same plot.

+
+
+

Q4: Climate#

+

Download the data file of global surface air temperature averages from here: +https://raw.githubusercontent.com/sbu-python-summer/python-tutorial/master/day-4/nasa-giss.txt

+

(this data comes from: https://data.giss.nasa.gov/gistemp/graphs/)

+

There are 3 columns here: the year, the temperature change, and a smoothed representation of the temperature change.

+
    +
  • Read in this data using np.loadtxt().

  • +
  • Plot as a line the smoothed representation of the temperature changes.

  • +
  • Plot as points the temperature change (no smoothing). Color the points blue if they are < 0 and color them red if they are >= 0

  • +
+

You might find the NumPy where() function useful.

+
+
+

Q5: subplots#

+

matplotlib has a number of ways to create multiple axes in a figure – look at plt.subplots() (http://matplotlib.org/api/pyplot_api.html#matplotlib.pyplot.subplot)

+

Create an x array using NumPy with a number of points, spanning from \([0, 2\pi]\).

+

Create 3 axes vertically, and do the following:

+
    +
  • Define a new numpy array f initialized to a function of your choice.

  • +
  • Plot f in the top axes

  • +
  • Compute a numerical derivative of f, +$\( f' = \frac{f_{i+1} - f_i}{\Delta x}\)$ +and plot this in the middle axes

  • +
  • Do this again, this time on \(f'\) to compute the second derivative and plot that in the bottom axes

  • +
+
+
+

Q6: Mandelbrot set#

+

The Mandelbrot set is defined such that \(z_{k+1} = z_k^2 + c\) +remains bounded, which is usually taken as \(|z_{k+1}| \le 2\) +where \(c\) is a complex number and we start with \(z_0 = 0\)

+

We want to consider a range of \(c\), as complex numbers \(c = x + iy\), +where \(-2 < x < 2\) and \(-2 < y < 2\).

+

For each \(c\), identify its position on a Cartesian grid as \((x,y)\) and +assign a value \(N\) that is the number of iterations, \(k\), required for \(|z_{k+1}|\) to become greater than \(2\).

+

The plot of this function is called the Mandelbrot set.

+

Here’s a simple implementation that just does a fixed number of iterations and then colors points in Z depending on whether they satisfy \(|z| \le 2\).

+

Your task is to extend this to record the number of iterations it takes for each point in the Z-plane to violate that constraint, +and then plot that data – it will show more structure

+
+
+
N = 256
+x = np.linspace(-2, 2, N)
+y = np.linspace(-2, 2, N)
+
+xv, yv = np.meshgrid(x, y, indexing="ij")
+
+
+
+
+
+
+
c = xv + 1j*y
+
+z = np.zeros((N, N), dtype=np.complex128)
+
+for i in range(10):
+    z = z**2 + c
+    
+m = np.ones((N, N))
+m[np.abs(z) <= 2] = 0.0
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.imshow(m)
+
+
+
+
+
<matplotlib.image.AxesImage at 0x7f20c82a63c0>
+
+
+a plot of the Mandelbrot set +
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/04-matplotlib/matplotlib-exercises.html.backup b/04-matplotlib/matplotlib-exercises.html.backup new file mode 100644 index 00000000..c660c270 --- /dev/null +++ b/04-matplotlib/matplotlib-exercises.html.backup @@ -0,0 +1,836 @@ + + + + + + + + + + + matplotlib exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

matplotlib exercises#

+
+
+
import matplotlib.pyplot as plt
+import numpy as np
+
+
+
+
+
+

Q1: planetary positions#

+

The distances of the planets from the Sun (technically, their semi-major axes) are:

+
+
+
a = np.array([0.39, 0.72, 1.00, 1.52, 5.20, 9.54, 19.22, 30.06, 39.48])
+
+
+
+
+

These are in units where the Earth-Sun distance is 1 (astronomical units).

+

The corresponding periods of their orbits (how long they take to go once around the Sun) are, in years

+
+
+
P = np.array([0.24, 0.62, 1.00, 1.88, 11.86, 29.46, 84.01, 164.8, 248.09])
+
+
+
+
+

Finally, the names of the planets corresponding to these are:

+
+
+
names = ["Mercury", "Venus", "Earth", "Mars", "Jupiter", "Saturn", 
+         "Uranus", "Neptune", "Pluto"]
+
+
+
+
+

(technically, pluto isn’t a planet anymore, but we still love it :)

+
    +
  • Plot as points, the periods vs. distances for each planet on a log-log plot.

  • +
  • Write the name of the planet next to the point for that planet on the plot

  • +
+
+
+

Q2: drawing a circle#

+

For an angle \(\theta\) in the range \(\theta \in [0, 2\pi]\), the polar equations of a circle of radius \(R\) are:

+
+\[x = R\cos(\theta)\]
+
+\[y = R\sin(\theta)\]
+

We want to draw a circle.

+
    +
  • Create an array to hold the theta values—the more we use, the smoother the circle will be

  • +
  • Create x and y arrays from theta for your choice of \(R\)

  • +
  • Plot y vs. x

  • +
+

Now, look up the matplotlib fill() function, and draw a circle filled in with a solid color.

+
+
+

Q3: Circles, circles, circles…#

+

Generalize your circle drawing commands to produce a function,

+
draw_circle(x0, y0, R, color)
+
+
+

that draws the circle. Here, (x0, y0) is the center of the circle, R is the radius, and color is the color of the circle.

+

Now randomly draw 10 circles at different locations, with random radii, and random colors on the same plot.

+
+
+

Q4: Climate#

+

Download the data file of global surface air temperature averages from here: +https://raw.githubusercontent.com/sbu-python-summer/python-tutorial/master/day-4/nasa-giss.txt

+

(this data comes from: https://data.giss.nasa.gov/gistemp/graphs/)

+

There are 3 columns here: the year, the temperature change, and a smoothed representation of the temperature change.

+
    +
  • Read in this data using np.loadtxt().

  • +
  • Plot as a line the smoothed representation of the temperature changes.

  • +
  • Plot as points the temperature change (no smoothing). Color the points blue if they are < 0 and color them red if they are >= 0

  • +
+

You might find the NumPy where() function useful.

+
+
+

Q5: subplots#

+

matplotlib has a number of ways to create multiple axes in a figure – look at plt.subplots() (http://matplotlib.org/api/pyplot_api.html#matplotlib.pyplot.subplot)

+

Create an x array using NumPy with a number of points, spanning from \([0, 2\pi]\).

+

Create 3 axes vertically, and do the following:

+
    +
  • Define a new numpy array f initialized to a function of your choice.

  • +
  • Plot f in the top axes

  • +
  • Compute a numerical derivative of f, +$\( f' = \frac{f_{i+1} - f_i}{\Delta x}\)$ +and plot this in the middle axes

  • +
  • Do this again, this time on \(f'\) to compute the second derivative and plot that in the bottom axes

  • +
+
+
+

Q6: Mandelbrot set#

+

The Mandelbrot set is defined such that \(z_{k+1} = z_k^2 + c\) +remains bounded, which is usually taken as \(|z_{k+1}| \le 2\) +where \(c\) is a complex number and we start with \(z_0 = 0\)

+

We want to consider a range of \(c\), as complex numbers \(c = x + iy\), +where \(-2 < x < 2\) and \(-2 < y < 2\).

+

For each \(c\), identify its position on a Cartesian grid as \((x,y)\) and +assign a value \(N\) that is the number of iterations, \(k\), required for \(|z_{k+1}|\) to become greater than \(2\).

+

The plot of this function is called the Mandelbrot set.

+

Here’s a simple implementation that just does a fixed number of iterations and then colors points in Z depending on whether they satisfy \(|z| \le 2\).

+

Your task is to extend this to record the number of iterations it takes for each point in the Z-plane to violate that constraint, +and then plot that data – it will show more structure

+
+
+
N = 256
+x = np.linspace(-2, 2, N)
+y = np.linspace(-2, 2, N)
+
+xv, yv = np.meshgrid(x, y, indexing="ij")
+
+
+
+
+
+
+
c = xv + 1j*y
+
+z = np.zeros((N, N), dtype=np.complex128)
+
+for i in range(10):
+    z = z**2 + c
+    
+m = np.ones((N, N))
+m[np.abs(z) <= 2] = 0.0
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.imshow(m)
+# alt-text: a plot of the Mandelbrot set
+
+
+
+
+
<matplotlib.image.AxesImage at 0x7f20c82a63c0>
+
+
+../_images/6bc78f3fe2a9e65e3d606852a276b997d3deff24f08686a8548303dc6c3d334c.png +
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/04-matplotlib/matplotlib.html b/04-matplotlib/matplotlib.html new file mode 100644 index 00000000..714889aa --- /dev/null +++ b/04-matplotlib/matplotlib.html @@ -0,0 +1,605 @@ + + + + + + + + + + + matplotlib — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

matplotlib

+ +
+
+ +
+
+
+ + + + +
+ +
+

matplotlib#

+

matplotlib is the core plotting library for python.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-basics-2.html b/05-scipy/scipy-basics-2.html new file mode 100644 index 00000000..5f630724 --- /dev/null +++ b/05-scipy/scipy-basics-2.html @@ -0,0 +1,1476 @@ + + + + + + + + + + + More SciPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

More SciPy#

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Fitting#

+

Fitting is used to match a model to experimental data. E.g. we have N points of \((x_i, y_i)\) with associated errors, \(\sigma_i\), and we want to find a simple function that best represents the data.

+

Usually this means that we will need to define a metric, often called the residual, for how well our function matches the data, and then minimize this residual. Least-squares fitting is a popular formulation.

+

We want to fit our data to a function \(Y(x, \{a_j\})\), where \(a_j\) are model parameters we can adjust. We want to find the optimal \(a_j\) to minimize the distance of \(Y\) from our data, measured parallel to the \(y\)-axis:

+
+\[\Delta_i = Y(x_i, \{a_j\}) - y_i\]
+

Least-squares minimizes the distance between the +data points and the model line parallel to the \(y\)-axis. We write this as \(\chi^2\):

+
+\[\chi^2(\{a_j\}) = \sum_{i=1}^N \left ( \frac{\Delta_i}{\sigma_i} \right )^2\]
+
+
+
from scipy import optimize
+
+
+
+
+
+

general linear least squares#

+

First we’ll make some experimental data (a quadratic with random fashion). We use the standard_normal function to provide Gaussian normalized errors.

+
+
+
def y_experiment2(a1, a2, a3, sigma, x):
+    """ return the experimental data in a quadratic + random fashion,                              
+        with a1, a2, a3 the coefficients of the quadratic and sigma is                             
+        the error.  This will be poorly matched to a linear fit for                                
+        a3 != 0 """
+
+    N = len(x)
+
+    # standard_normal gives samples from the "standard normal" distribution
+    rng = np.random.default_rng()
+    r = rng.standard_normal(N)
+
+    y = a1 + a2*x + a3*x*x + sigma*r
+
+    return y
+
+
+
+
+
+
+
N = 40
+sigma = 5.0*np.ones(N)
+
+x = np.linspace(0, 100.0, N)
+y = y_experiment2(2.0, 1.50, -0.02, sigma, x)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.scatter(x,y)
+ax.errorbar(x, y, yerr=sigma, fmt="o")
+
+
+
+
+
<ErrorbarContainer object of 3 artists>
+
+
+a plot showing data points with vertical error bars +
+
+
+

Note

+

“linear” in general linear least squares means that the fit parameters enter into the fitting function linearly, +the function itself can be nonlinear in \(x\).

+
+

We’ll use the leastsq() function to minimize the square of the residual.

+

First our function to compute the residual.

+
+
+
def resid(avec, x, y, sigma):
+    """ the residual function -- this is what will be minimized by the
+        scipy.optimize.leastsq() routine.  avec is the parameters we
+        are optimizing -- they are packed in here, so we unpack to
+        begin.  (x, y) are the data points 
+
+        scipy.optimize.leastsq() minimizes:
+
+           x = arg min(sum(func(y)**2,axis=0))
+                    y
+
+        so this should just be the distance from a point to the curve,
+        and it will square it and sum over the points
+        """
+
+    a0, a1, a2 = avec
+    
+    return (y - (a0 + a1*x + a2*x**2))/sigma
+
+
+
+
+
+
+
# initial guesses
+a0, a1, a2 = 1, 1, 1
+
+afit, flag = optimize.leastsq(resid, [a0, a1, a2], args=(x, y, sigma))
+
+print(afit)
+
+
+
+
+
[ 2.87612049  1.34072165 -0.01813152]
+
+
+
+
+
+
+
ax.plot(x, afit[0] + afit[1]*x + afit[2]*x*x )
+fig
+
+
+
+
+a plot showing data points with error bars and a quadratic fit to them +
+
+

We see that we represent the data quite well.

+

We can compute the reduced \(\chi^2\)

+
+
+
chisq = sum(np.power(resid(afit, x, y, sigma),2))
+normalization = len(x)-len(afit)
+print(chisq/normalization)
+
+
+
+
+
1.1857487998866727
+
+
+
+
+

In general a (reduced) \(\chi^2 < 1\) indicates a good fit.

+
+
+

a nonlinear example#

+

The same interface works with nonlinear data.

+

We’ll create a new set of experimental data—an exponential

+
+
+
a0 = 2.5
+a1 = 2./3.
+sigma = 5.0
+
+a0_orig, a1_orig = a0, a1
+
+rng = np.random.default_rng()
+
+x = np.linspace(0.0, 4.0, 25)
+y = a0*np.exp(a1*x) + sigma * rng.standard_normal(len(x))
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.scatter(x,y)
+ax.errorbar(x, y, yerr=sigma, fmt="o", label="_nolegend_")
+
+
+
+
+
<ErrorbarContainer object of 3 artists>
+
+
+a plot showing a noisy exponential dataset with error bars +
+
+

our function to minimize

+
+
+
def resid(avec, x, y):
+
+    a0, a1 = avec
+
+    # note: if we wanted to deal with error bars, we would weight each                             
+    # residual accordingly                                                                         
+    return y - a0*np.exp(a1*x)
+
+
+
+
+
+
+
a0, a1 = 1, 1
+afit, flag = optimize.leastsq(resid, [a0, a1], args=(x, y))
+
+print(flag)
+print(afit)
+
+
+
+
+
1
+[1.78835232 0.78372487]
+
+
+
+
+
+
+
ax.plot(x, afit[0]*np.exp(afit[1]*x),
+           label=r"$a_0 = $ %f; $a_1 = $ %f" % (afit[0], afit[1]))
+ax.plot(x, a0_orig*np.exp(a1_orig*x), ":", label="original function")
+ax.legend(numpoints=1, frameon=False)
+fig
+
+
+
+
+a plot showing noisy exponential data points, a fit, and the original function +
+
+
+

Note

+

What about uncertainties in both \(x\) and \(y\)? SciPy has an +orthogonal distance regression implementation based on ODRPACK for this.

+
+
+
+
+

FFTs#

+

Fourier transforms convert a physical-space (or time series) representation of a function into frequency space. This provides an equivalent representation of the data with a new view.

+

The FFT and its inverse in NumPy use:

+
+\[F_k = \sum_{n=0}^{N-1} f_n e^{-2\pi i nk/N}\]
+
+\[f_n = \frac{1}{N} \sum_{k=0}^{N-1} F_k + e^{2\pi i n k/N}\]
+

Both NumPy and SciPy have FFT routines that are similar. However, the NumPy version returns the data in a more convenient form.

+
+

Tip

+

It’s always best to start with something you understand—let’s do a simple sine wave. Since our function is real, we can use the rfft routines in NumPy—the understand that we are working with real data and they don’t return the negative frequency components.

+
+
+

Important

+

FFTs assume that you are periodic. If you include both endpoints of the domain in the points that comprise your sample then you will not match this assumption. Here we use endpoint=False with linspace()

+
+
+

Note

+

For real-valued data, we’ll use np.fft.rfft(), which will return N/2 complex values given N real samples.

+

To get the frequencies, we can use np.fft.rfftfreq(), which will return dimensionless frequencies of the form +\(0, 1/N, 2/N, 3/N, ...\). We know that the shortest lowest frequency corresponds to a single wavelength in the domain, so physically, \(1/N\) corresponds to a frequency \(1/L\), where \(L\) is the domain size. This means that +we can convert the frequencies by dividing by \(\Delta x = L/N\). This scaling is accomplished by passing the +d parameter to rfftfreq.

+
+

To make our life easier, we’ll define a function that plots all the stages of the FFT process

+
+
+
def plot_FFT(xx, f):
+
+    npts = len(xx)
+    dx = xx[1] - xx[0]
+
+    # Forward transform: f(x) -> F(k)
+    fk = np.fft.rfft(f)
+
+    # Normalization -- the '2' here comes from the fact that we are
+    # neglecting the negative portion of the frequency space, since
+    # the FFT of a real function contains redundant information, so
+    # we are only dealing with 1/2 of the frequency space.
+    #
+    # technically, we should only scale the 0 bin by N, since k=0 is
+    # not duplicated -- we won't worry about that for these plots
+    norm = 2.0 / npts
+
+    fk = fk * norm
+
+    # rfftfreq returns the frequencies as 0, 1/N, 2/N, 3/N, ...
+    kfreq = np.fft.rfftfreq(npts, d=dx)
+
+    # Inverse transform: F(k) -> f(x) -- without the normalization
+    fkinv = np.fft.irfft(fk/norm)
+
+    # plots
+    fig, ax = plt.subplots(nrows=4, ncols=1)
+    
+    ax[0].plot(xx, f)
+    ax[0].set_xlabel("x")
+    ax[0].set_ylabel("f(x)")
+
+    ax[1].plot(kfreq, fk.real, label=r"Re($\mathcal{F}$)")
+    ax[1].plot(kfreq, fk.imag, ls=":", label=r"Im($\mathcal{F}$)")
+    ax[1].set_xlabel(r"$\nu_k$")
+    ax[1].set_ylabel("F(k)")
+
+    ax[1].legend(fontsize="small", frameon=False)
+
+    ax[2].plot(kfreq, np.abs(fk))
+    ax[2].set_xlabel(r"$\nu_k$")
+    ax[2].set_ylabel(r"|F(k)|")
+
+    ax[3].plot(xx, fkinv.real)
+    ax[3].set_xlabel(r"$\nu_k$")
+    ax[3].set_ylabel(r"inverse F(k)")
+
+    fig.set_size_inches(10,8)
+    fig.tight_layout()
+
+
+
+
+

Now we’ll test it on \(f(x) = \sin(2\pi \nu_0 x)\), where \(\nu_0\) is a frequency we set.

+
+
+
def single_freq_sine(npts):
+
+    # a pure sine with no phase shift will result in pure imaginary
+    # signal
+    f_0 = 0.2
+
+    xmax = 10.0/f_0
+    
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = np.sin(2.0*np.pi*f_0*xx)
+
+    return xx, f
+
+
+
+
+
+
+
npts = 128
+xx, f = single_freq_sine(npts)
+plot_FFT(xx, f)
+
+
+
+
+a plot with 4 vertical panels showing (1) a sine (2) the Fourier transform of the sine (3) the power in Fourier space (4) the data transformed back to real space +
+
+

Notice that all of the power is at our single frequency, and it is all in the imaginary components, which is expected since \(e^{ix} = \cos(x) + i\sin(x)\)

+

Next, we can try \(f(x) = \cos(2\pi\nu_0 x)\), and we know that a cosine is just a sine shifted in phase by \(\pi/2\).

+
+
+
def single_freq_cosine(npts):
+
+    # a pure cosine with no phase shift will result in pure real
+    # signal
+    f_0 = 0.2
+
+    xmax = 10.0/f_0
+
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = np.cos(2.0*np.pi*f_0*xx)
+
+    return xx, f
+
+
+
+
+
+
+
xx, f = single_freq_cosine(npts)
+plot_FFT(xx, f)
+
+
+
+
+a plot with 4 vertical panes showing a single-mode cosine transformed to Fourier space and back +
+
+

Now, as expected, all of the power is in the real component.

+

Now let’s look at a sine with a \(\pi/4\) phase shift

+
+
+
def single_freq_sine_plus_shift(npts):
+
+    # a pure sine with no phase shift will result in pure imaginary
+    # signal
+    f_0 = 0.2
+
+    xmax = 10.0/f_0
+
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = np.sin(2.0*np.pi*f_0*xx + np.pi/4)
+
+    return xx, f
+
+
+
+
+
+
+
xx, f = single_freq_sine_plus_shift(npts)
+plot_FFT(xx, f)
+
+
+
+
+a plot with 4 vertical panes showing a single-mode sine with a phase shift transformed to Fourier space and back +
+
+

No surprise—the power is now equally in the real and imaginary parts.

+
+

A frequency filter#

+

we’ll setup a simple two-frequency sine wave and filter a component

+
+
+
def two_freq_sine(npts):
+
+    # a pure sine with no phase shift will result in pure imaginary             
+    # signal                                                                    
+    f_0 = 0.2
+    f_1 = 0.5
+
+    xmax = 10.0/f_0
+
+    # we call with endpoint=False -- if we include the endpoint, then for       
+    # a periodic function, the first and last point are identical -- this       
+    # shows up as a signal in the FFT.                                          
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = 0.5*(np.sin(2.0*np.pi*f_0*xx) + np.sin(2.0*np.pi*f_1*xx))
+
+    return xx, f
+
+
+
+
+
+
+
npts = 256
+
+xx, f = two_freq_sine(npts)
+
+fig, ax = plt.subplots()
+ax.plot(xx, f)
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7f3c48dddbe0>]
+
+
+a plot showing a two-mode sine wave +
+
+

we’ll take the transform: \(f(x) \rightarrow F(k)\)

+
+
+
# normalization factor: the 2 here comes from the fact that we neglect          
+# the negative portion of frequency space because our input function            
+# is real                                                                       
+norm = 2.0/npts
+fk = norm*np.fft.rfft(f)
+
+ofk_r = fk.real.copy()
+ofk_i = fk.imag.copy()
+
+# get the frequencies
+k = np.fft.rfftfreq(len(xx))
+
+# since we don't include the endpoint in xx, to normalize things, we need       
+# max(xx) + dx to get the true length of the domain
+#
+# This makes the frequencies essentially multiples of 1/dx
+kfreq = k*npts/(max(xx) + xx[1])
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(kfreq, fk.real, label="real")
+ax.plot(kfreq, fk.imag, ":", label="imaginary")
+ax.legend(frameon=False)
+
+
+
+
+
<matplotlib.legend.Legend at 0x7f3c48986e40>
+
+
+the FFT of our two-mode sine-wave showing two spikes +
+
+

Now we can filter out the higher frequencies—this is done in Fourier space.

+
+
+
fk[kfreq > 0.4] = 0.0
+
+
+
+
+

Finally, transform back.

+
+
+
# Inverse transform: F(k) -> f(x)                                               
+fkinv = np.fft.irfft(fk/norm)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(xx, fkinv.real)
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7f3c4886c050>]
+
+
+a plot of a single-mode sine wave +
+
+
+
+
+

Linear Algebra#

+
+

general manipulations of matrices#

+

You can use regular NumPy arrays or you can use a special matrix class that offers some short cuts.

+
+

Tip

+

Since the introduction of the matrix multiplication operator, @, using the numpy matrix class is no longer recommended.

+
+

Let’s create a simply 2x2 matrix, \({\bf A}\)

+
+
+
a = np.array([[1.0, 2.0],
+              [3.0, 4.0]])
+
+
+
+
+
+
+
print(a)
+print(a.transpose())
+print(a.T)
+
+
+
+
+
[[1. 2.]
+ [3. 4.]]
+[[1. 3.]
+ [2. 4.]]
+[[1. 3.]
+ [2. 4.]]
+
+
+
+
+

We can solve for the inverse

+
+
+
ainv = np.linalg.inv(a)
+print(ainv)
+
+
+
+
+
[[-2.   1. ]
+ [ 1.5 -0.5]]
+
+
+
+
+

And multiply \({\bf A}\) by its inverse, \({\bf A}^{-1}\)

+
+
+
a @ ainv
+
+
+
+
+
array([[1.0000000e+00, 0.0000000e+00],
+       [8.8817842e-16, 1.0000000e+00]])
+
+
+
+
+

the eye() function will generate an identity matrix (as will the identity())

+
+
+
print(np.eye(2))
+print(np.identity(2))
+
+
+
+
+
[[1. 0.]
+ [0. 1.]]
+[[1. 0.]
+ [0. 1.]]
+
+
+
+
+
+
+

Linear systems#

+

we can solve \({\bf A}{\bf x} = {\bf b}\) easily.

+
+

Note

+

Linear system solvers don’t usually compute the inverse first and then multiply +by it. It is much cheaper to solve the system directly (e.g., via Gaussian elimination) +than to first compute the inverse.

+
+
+
+
b = np.array([5, 7])
+x = np.linalg.solve(a, b)
+print(x)
+
+
+
+
+
[-3.  4.]
+
+
+
+
+
+
+

tridiagonal matrix solve#

+

Here we’ll solve the Poisson problem:

+
+\[f^{\prime\prime} = g(x)\]
+

with \(g(x) = \sin(x)\), and the domain \(x \in [0, 2\pi]\), with boundary conditions \(f(0) = f(2\pi) = 0\).

+

The solution is simply \(f(x) = -\sin(x)\).

+

We’ll use a grid of \(N\) points with \(x_0\) on the left boundary and \(x_{N-1}\) on the right boundary.

+

We difference our equation as:

+
+\[f_{i+1} - 2 f_i + f_{i-1} = \Delta x^2 g_i\]
+

We keep the boundary points fixed, so we only need to solve for the \(N-2\) interior points. Near the boundaries, our difference is:

+
+\[f_2 - 2 f_1 = \Delta x^2 g_1\]
+

and

+
+\[-2f_{N-1} + f_{N-2} = \Delta x^2 g_{N-1}\]
+

We can write the system of equations for solving for the \(N-2\) interior points as:

+
+\[{\bf A} = \left ( +\begin{array}{ccccccc} +-2 & 1 & & & & & \newline +1 & -2 & 1 & & & & \newline + & 1 & -2 & 1 & & & \newline + & & \ddots & \ddots & \ddots & & \newline + & & & \ddots & \ddots & \ddots & \newline + & & & & 1 & -2 & 1 \newline + & & & & & 1 & -2 \newline +\end{array} +\right ) +\]
+
+\[\begin{split} +{\bf x} = \left ( +\begin{array}{c} +f_\mathrm{1} \\\ +f_\mathrm{2} \\\ +f_\mathrm{3} \\\ +\vdots \\\ +\vdots \\\ +f_\mathrm{N-2} \\\ +f_\mathrm{N-1} \\\ +\end{array} +\right ) +\end{split}\]
+
+\[\begin{split} +{\bf b} = \Delta x^2 \left ( +\begin{array}{c} +g_\mathrm{1} \\\ +g_\mathrm{2} \\\ +g_\mathrm{3} \\\ +\vdots \\\ +\vdots \\\ +g_\mathrm{N-2} \\\ +g_\mathrm{N-1}\\\ +\end{array} +\right ) +\end{split}\]
+

Then we just solve \({\bf A}{\bf x} = {\bf b}\)

+
+

Note

+

SciPy has banded solvers that work with banded matrices like we have above. They +will be much more efficient than using a solver based on a dense matrix

+
+
+
+
import scipy.linalg as linalg
+
+# our grid -- including endpoints
+N = 100
+x = np.linspace(0.0, 2.0*np.pi, N, endpoint=True)
+dx = x[1] - x[0]
+
+# our source
+g = np.sin(x)
+
+# our matrix will be tridiagonal, with [1, -2, 1] on the diagonals
+# we only solve for the N-2 interior points
+
+# diagonal
+d = -2 * np.ones(N-2)
+
+# upper -- note that the upper diagonal has 1 less element than the
+# main diagonal.  The SciPy banded solver wants the matrix in the 
+# form:
+#
+# *    a01  a12  a23  a34  a45    <- upper diagonal
+# a00  a11  a22  a33  a44  a55    <- diagonal
+# a10  a21  a32  a43  a54   *     <- lower diagonal
+#
+
+u = np.ones(N-2)
+u[0] = 0.0
+
+# lower
+l = np.ones(N-2)
+l[N-3] = 0.0
+
+# put the upper, diagonal, and lower parts together as a banded matrix
+A = np.matrix([u, d, l])
+
+# solve A sol = dx**2 g for the inner N-2 points
+sol = linalg.solve_banded((1,1), A, dx**2*g[1:N-1])
+
+
+
+
+

Let’s plot the solution

+
+
+
fig, ax = plt.subplots()
+ax.plot(x[1:N-1], sol)
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7f3c488e4590>]
+
+
+a plot showing a function that looks approximately like -sin(x) +
+
+

This looks like \(-\sin(x)\), as expected.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-basics-2.html.backup b/05-scipy/scipy-basics-2.html.backup new file mode 100644 index 00000000..01eaa996 --- /dev/null +++ b/05-scipy/scipy-basics-2.html.backup @@ -0,0 +1,1487 @@ + + + + + + + + + + + More SciPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

More SciPy#

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Fitting#

+

Fitting is used to match a model to experimental data. E.g. we have N points of \((x_i, y_i)\) with associated errors, \(\sigma_i\), and we want to find a simple function that best represents the data.

+

Usually this means that we will need to define a metric, often called the residual, for how well our function matches the data, and then minimize this residual. Least-squares fitting is a popular formulation.

+

We want to fit our data to a function \(Y(x, \{a_j\})\), where \(a_j\) are model parameters we can adjust. We want to find the optimal \(a_j\) to minimize the distance of \(Y\) from our data, measured parallel to the \(y\)-axis:

+
+\[\Delta_i = Y(x_i, \{a_j\}) - y_i\]
+

Least-squares minimizes the distance between the +data points and the model line parallel to the \(y\)-axis. We write this as \(\chi^2\):

+
+\[\chi^2(\{a_j\}) = \sum_{i=1}^N \left ( \frac{\Delta_i}{\sigma_i} \right )^2\]
+
+
+
from scipy import optimize
+
+
+
+
+
+

general linear least squares#

+

First we’ll make some experimental data (a quadratic with random fashion). We use the standard_normal function to provide Gaussian normalized errors.

+
+
+
def y_experiment2(a1, a2, a3, sigma, x):
+    """ return the experimental data in a quadratic + random fashion,                              
+        with a1, a2, a3 the coefficients of the quadratic and sigma is                             
+        the error.  This will be poorly matched to a linear fit for                                
+        a3 != 0 """
+
+    N = len(x)
+
+    # standard_normal gives samples from the "standard normal" distribution
+    rng = np.random.default_rng()
+    r = rng.standard_normal(N)
+
+    y = a1 + a2*x + a3*x*x + sigma*r
+
+    return y
+
+
+
+
+
+
+
N = 40
+sigma = 5.0*np.ones(N)
+
+x = np.linspace(0, 100.0, N)
+y = y_experiment2(2.0, 1.50, -0.02, sigma, x)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.scatter(x,y)
+ax.errorbar(x, y, yerr=sigma, fmt="o")
+# alt-text: a plot showing data points with vertical error bars
+
+
+
+
+
<ErrorbarContainer object of 3 artists>
+
+
+../_images/dddbe10d121cc0b0be544e8b7ba4bf180995b70c69b599294cde933d0725396f.png +
+
+
+

Note

+

“linear” in general linear least squares means that the fit parameters enter into the fitting function linearly, +the function itself can be nonlinear in \(x\).

+
+

We’ll use the leastsq() function to minimize the square of the residual.

+

First our function to compute the residual.

+
+
+
def resid(avec, x, y, sigma):
+    """ the residual function -- this is what will be minimized by the
+        scipy.optimize.leastsq() routine.  avec is the parameters we
+        are optimizing -- they are packed in here, so we unpack to
+        begin.  (x, y) are the data points 
+
+        scipy.optimize.leastsq() minimizes:
+
+           x = arg min(sum(func(y)**2,axis=0))
+                    y
+
+        so this should just be the distance from a point to the curve,
+        and it will square it and sum over the points
+        """
+
+    a0, a1, a2 = avec
+    
+    return (y - (a0 + a1*x + a2*x**2))/sigma
+
+
+
+
+
+
+
# initial guesses
+a0, a1, a2 = 1, 1, 1
+
+afit, flag = optimize.leastsq(resid, [a0, a1, a2], args=(x, y, sigma))
+
+print(afit)
+
+
+
+
+
[ 2.87612049  1.34072165 -0.01813152]
+
+
+
+
+
+
+
ax.plot(x, afit[0] + afit[1]*x + afit[2]*x*x )
+fig
+# alt-text: a plot showing data points with error bars and a quadratic fit to them
+
+
+
+
+../_images/98a22dc806bbeee37742184bb9a747cd2a055fa0b69409bda8bc9e42c6e3327a.png +
+
+

We see that we represent the data quite well.

+

We can compute the reduced \(\chi^2\)

+
+
+
chisq = sum(np.power(resid(afit, x, y, sigma),2))
+normalization = len(x)-len(afit)
+print(chisq/normalization)
+
+
+
+
+
1.1857487998866727
+
+
+
+
+

In general a (reduced) \(\chi^2 < 1\) indicates a good fit.

+
+
+

a nonlinear example#

+

The same interface works with nonlinear data.

+

We’ll create a new set of experimental data—an exponential

+
+
+
a0 = 2.5
+a1 = 2./3.
+sigma = 5.0
+
+a0_orig, a1_orig = a0, a1
+
+rng = np.random.default_rng()
+
+x = np.linspace(0.0, 4.0, 25)
+y = a0*np.exp(a1*x) + sigma * rng.standard_normal(len(x))
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.scatter(x,y)
+ax.errorbar(x, y, yerr=sigma, fmt="o", label="_nolegend_")
+# alt-text: a plot showing a noisy exponential dataset with error bars
+
+
+
+
+
<ErrorbarContainer object of 3 artists>
+
+
+../_images/14611db2c48172b619658b4c708e37334a568f90b7b23798503295f6e80077db.png +
+
+

our function to minimize

+
+
+
def resid(avec, x, y):
+
+    a0, a1 = avec
+
+    # note: if we wanted to deal with error bars, we would weight each                             
+    # residual accordingly                                                                         
+    return y - a0*np.exp(a1*x)
+
+
+
+
+
+
+
a0, a1 = 1, 1
+afit, flag = optimize.leastsq(resid, [a0, a1], args=(x, y))
+
+print(flag)
+print(afit)
+
+
+
+
+
1
+[1.78835232 0.78372487]
+
+
+
+
+
+
+
ax.plot(x, afit[0]*np.exp(afit[1]*x),
+           label=r"$a_0 = $ %f; $a_1 = $ %f" % (afit[0], afit[1]))
+ax.plot(x, a0_orig*np.exp(a1_orig*x), ":", label="original function")
+ax.legend(numpoints=1, frameon=False)
+fig
+# alt-text: a plot showing noisy exponential data points, a fit, and the original function
+
+
+
+
+../_images/830fb17c4921139b0db9b82b1fff526ef6074e98449be40a24780a60c5f1957d.png +
+
+
+

Note

+

What about uncertainties in both \(x\) and \(y\)? SciPy has an +orthogonal distance regression implementation based on ODRPACK for this.

+
+
+
+
+

FFTs#

+

Fourier transforms convert a physical-space (or time series) representation of a function into frequency space. This provides an equivalent representation of the data with a new view.

+

The FFT and its inverse in NumPy use:

+
+\[F_k = \sum_{n=0}^{N-1} f_n e^{-2\pi i nk/N}\]
+
+\[f_n = \frac{1}{N} \sum_{k=0}^{N-1} F_k + e^{2\pi i n k/N}\]
+

Both NumPy and SciPy have FFT routines that are similar. However, the NumPy version returns the data in a more convenient form.

+
+

Tip

+

It’s always best to start with something you understand—let’s do a simple sine wave. Since our function is real, we can use the rfft routines in NumPy—the understand that we are working with real data and they don’t return the negative frequency components.

+
+
+

Important

+

FFTs assume that you are periodic. If you include both endpoints of the domain in the points that comprise your sample then you will not match this assumption. Here we use endpoint=False with linspace()

+
+
+

Note

+

For real-valued data, we’ll use np.fft.rfft(), which will return N/2 complex values given N real samples.

+

To get the frequencies, we can use np.fft.rfftfreq(), which will return dimensionless frequencies of the form +\(0, 1/N, 2/N, 3/N, ...\). We know that the shortest lowest frequency corresponds to a single wavelength in the domain, so physically, \(1/N\) corresponds to a frequency \(1/L\), where \(L\) is the domain size. This means that +we can convert the frequencies by dividing by \(\Delta x = L/N\). This scaling is accomplished by passing the +d parameter to rfftfreq.

+
+

To make our life easier, we’ll define a function that plots all the stages of the FFT process

+
+
+
def plot_FFT(xx, f):
+
+    npts = len(xx)
+    dx = xx[1] - xx[0]
+
+    # Forward transform: f(x) -> F(k)
+    fk = np.fft.rfft(f)
+
+    # Normalization -- the '2' here comes from the fact that we are
+    # neglecting the negative portion of the frequency space, since
+    # the FFT of a real function contains redundant information, so
+    # we are only dealing with 1/2 of the frequency space.
+    #
+    # technically, we should only scale the 0 bin by N, since k=0 is
+    # not duplicated -- we won't worry about that for these plots
+    norm = 2.0 / npts
+
+    fk = fk * norm
+
+    # rfftfreq returns the frequencies as 0, 1/N, 2/N, 3/N, ...
+    kfreq = np.fft.rfftfreq(npts, d=dx)
+
+    # Inverse transform: F(k) -> f(x) -- without the normalization
+    fkinv = np.fft.irfft(fk/norm)
+
+    # plots
+    fig, ax = plt.subplots(nrows=4, ncols=1)
+    
+    ax[0].plot(xx, f)
+    ax[0].set_xlabel("x")
+    ax[0].set_ylabel("f(x)")
+
+    ax[1].plot(kfreq, fk.real, label=r"Re($\mathcal{F}$)")
+    ax[1].plot(kfreq, fk.imag, ls=":", label=r"Im($\mathcal{F}$)")
+    ax[1].set_xlabel(r"$\nu_k$")
+    ax[1].set_ylabel("F(k)")
+
+    ax[1].legend(fontsize="small", frameon=False)
+
+    ax[2].plot(kfreq, np.abs(fk))
+    ax[2].set_xlabel(r"$\nu_k$")
+    ax[2].set_ylabel(r"|F(k)|")
+
+    ax[3].plot(xx, fkinv.real)
+    ax[3].set_xlabel(r"$\nu_k$")
+    ax[3].set_ylabel(r"inverse F(k)")
+
+    fig.set_size_inches(10,8)
+    fig.tight_layout()
+
+
+
+
+

Now we’ll test it on \(f(x) = \sin(2\pi \nu_0 x)\), where \(\nu_0\) is a frequency we set.

+
+
+
def single_freq_sine(npts):
+
+    # a pure sine with no phase shift will result in pure imaginary
+    # signal
+    f_0 = 0.2
+
+    xmax = 10.0/f_0
+    
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = np.sin(2.0*np.pi*f_0*xx)
+
+    return xx, f
+
+
+
+
+
+
+
npts = 128
+xx, f = single_freq_sine(npts)
+plot_FFT(xx, f)
+# alt-text: a plot with 4 vertical panels showing (1) a sine (2) the Fourier transform of the sine (3) the power in Fourier space (4) the data transformed back to real space
+
+
+
+
+../_images/8f22444e032fd5b8480eb4e0752cbffe2ed935ab38ea9d30bcfe690d80c847f3.png +
+
+

Notice that all of the power is at our single frequency, and it is all in the imaginary components, which is expected since \(e^{ix} = \cos(x) + i\sin(x)\)

+

Next, we can try \(f(x) = \cos(2\pi\nu_0 x)\), and we know that a cosine is just a sine shifted in phase by \(\pi/2\).

+
+
+
def single_freq_cosine(npts):
+
+    # a pure cosine with no phase shift will result in pure real
+    # signal
+    f_0 = 0.2
+
+    xmax = 10.0/f_0
+
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = np.cos(2.0*np.pi*f_0*xx)
+
+    return xx, f
+
+
+
+
+
+
+
xx, f = single_freq_cosine(npts)
+plot_FFT(xx, f)
+# alt-text: a plot with 4 vertical panes showing a single-mode cosine transformed to Fourier space and back
+
+
+
+
+../_images/5707a02e8cca32ab41ddc3e507473f33e404efe75b61045d1b311ea520450202.png +
+
+

Now, as expected, all of the power is in the real component.

+

Now let’s look at a sine with a \(\pi/4\) phase shift

+
+
+
def single_freq_sine_plus_shift(npts):
+
+    # a pure sine with no phase shift will result in pure imaginary
+    # signal
+    f_0 = 0.2
+
+    xmax = 10.0/f_0
+
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = np.sin(2.0*np.pi*f_0*xx + np.pi/4)
+
+    return xx, f
+
+
+
+
+
+
+
xx, f = single_freq_sine_plus_shift(npts)
+plot_FFT(xx, f)
+# alt-text: a plot with 4 vertical panes showing a single-mode sine with a phase shift transformed to Fourier space and back
+
+
+
+
+../_images/c62cb3987d333d4e135d6e54b6380771dd67af5d0377162c755c8a723636c989.png +
+
+

No surprise—the power is now equally in the real and imaginary parts.

+
+

A frequency filter#

+

we’ll setup a simple two-frequency sine wave and filter a component

+
+
+
def two_freq_sine(npts):
+
+    # a pure sine with no phase shift will result in pure imaginary             
+    # signal                                                                    
+    f_0 = 0.2
+    f_1 = 0.5
+
+    xmax = 10.0/f_0
+
+    # we call with endpoint=False -- if we include the endpoint, then for       
+    # a periodic function, the first and last point are identical -- this       
+    # shows up as a signal in the FFT.                                          
+    xx = np.linspace(0.0, xmax, npts, endpoint=False)
+
+    f = 0.5*(np.sin(2.0*np.pi*f_0*xx) + np.sin(2.0*np.pi*f_1*xx))
+
+    return xx, f
+
+
+
+
+
+
+
npts = 256
+
+xx, f = two_freq_sine(npts)
+
+fig, ax = plt.subplots()
+ax.plot(xx, f)
+# alt-text: a plot showing a two-mode sine wave
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7f3c48dddbe0>]
+
+
+../_images/29b1ce756a8461259f118d9cc3963ee84959a0af7c2bf3aed56d12b9d0dc4fa4.png +
+
+

we’ll take the transform: \(f(x) \rightarrow F(k)\)

+
+
+
# normalization factor: the 2 here comes from the fact that we neglect          
+# the negative portion of frequency space because our input function            
+# is real                                                                       
+norm = 2.0/npts
+fk = norm*np.fft.rfft(f)
+
+ofk_r = fk.real.copy()
+ofk_i = fk.imag.copy()
+
+# get the frequencies
+k = np.fft.rfftfreq(len(xx))
+
+# since we don't include the endpoint in xx, to normalize things, we need       
+# max(xx) + dx to get the true length of the domain
+#
+# This makes the frequencies essentially multiples of 1/dx
+kfreq = k*npts/(max(xx) + xx[1])
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(kfreq, fk.real, label="real")
+ax.plot(kfreq, fk.imag, ":", label="imaginary")
+ax.legend(frameon=False)
+# alt-text: the FFT of our two-mode sine-wave showing two spikes
+
+
+
+
+
<matplotlib.legend.Legend at 0x7f3c48986e40>
+
+
+../_images/ac8d3ce8eecdd5cb24b438db7ea2a2d517d57d84887392d87efab1d8f9d5fd94.png +
+
+

Now we can filter out the higher frequencies—this is done in Fourier space.

+
+
+
fk[kfreq > 0.4] = 0.0
+
+
+
+
+

Finally, transform back.

+
+
+
# Inverse transform: F(k) -> f(x)                                               
+fkinv = np.fft.irfft(fk/norm)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(xx, fkinv.real)
+# alt-text: a plot of a single-mode sine wave
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7f3c4886c050>]
+
+
+../_images/12158ea15c928d43a30e2afd5fbc1c6444e47d37058e3182be60f71a63af8fa5.png +
+
+
+
+
+

Linear Algebra#

+
+

general manipulations of matrices#

+

You can use regular NumPy arrays or you can use a special matrix class that offers some short cuts.

+
+

Tip

+

Since the introduction of the matrix multiplication operator, @, using the numpy matrix class is no longer recommended.

+
+

Let’s create a simply 2x2 matrix, \({\bf A}\)

+
+
+
a = np.array([[1.0, 2.0],
+              [3.0, 4.0]])
+
+
+
+
+
+
+
print(a)
+print(a.transpose())
+print(a.T)
+
+
+
+
+
[[1. 2.]
+ [3. 4.]]
+[[1. 3.]
+ [2. 4.]]
+[[1. 3.]
+ [2. 4.]]
+
+
+
+
+

We can solve for the inverse

+
+
+
ainv = np.linalg.inv(a)
+print(ainv)
+
+
+
+
+
[[-2.   1. ]
+ [ 1.5 -0.5]]
+
+
+
+
+

And multiply \({\bf A}\) by its inverse, \({\bf A}^{-1}\)

+
+
+
a @ ainv
+
+
+
+
+
array([[1.0000000e+00, 0.0000000e+00],
+       [8.8817842e-16, 1.0000000e+00]])
+
+
+
+
+

the eye() function will generate an identity matrix (as will the identity())

+
+
+
print(np.eye(2))
+print(np.identity(2))
+
+
+
+
+
[[1. 0.]
+ [0. 1.]]
+[[1. 0.]
+ [0. 1.]]
+
+
+
+
+
+
+

Linear systems#

+

we can solve \({\bf A}{\bf x} = {\bf b}\) easily.

+
+

Note

+

Linear system solvers don’t usually compute the inverse first and then multiply +by it. It is much cheaper to solve the system directly (e.g., via Gaussian elimination) +than to first compute the inverse.

+
+
+
+
b = np.array([5, 7])
+x = np.linalg.solve(a, b)
+print(x)
+
+
+
+
+
[-3.  4.]
+
+
+
+
+
+
+

tridiagonal matrix solve#

+

Here we’ll solve the Poisson problem:

+
+\[f^{\prime\prime} = g(x)\]
+

with \(g(x) = \sin(x)\), and the domain \(x \in [0, 2\pi]\), with boundary conditions \(f(0) = f(2\pi) = 0\).

+

The solution is simply \(f(x) = -\sin(x)\).

+

We’ll use a grid of \(N\) points with \(x_0\) on the left boundary and \(x_{N-1}\) on the right boundary.

+

We difference our equation as:

+
+\[f_{i+1} - 2 f_i + f_{i-1} = \Delta x^2 g_i\]
+

We keep the boundary points fixed, so we only need to solve for the \(N-2\) interior points. Near the boundaries, our difference is:

+
+\[f_2 - 2 f_1 = \Delta x^2 g_1\]
+

and

+
+\[-2f_{N-1} + f_{N-2} = \Delta x^2 g_{N-1}\]
+

We can write the system of equations for solving for the \(N-2\) interior points as:

+
+\[{\bf A} = \left ( +\begin{array}{ccccccc} +-2 & 1 & & & & & \newline +1 & -2 & 1 & & & & \newline + & 1 & -2 & 1 & & & \newline + & & \ddots & \ddots & \ddots & & \newline + & & & \ddots & \ddots & \ddots & \newline + & & & & 1 & -2 & 1 \newline + & & & & & 1 & -2 \newline +\end{array} +\right ) +\]
+
+\[\begin{split} +{\bf x} = \left ( +\begin{array}{c} +f_\mathrm{1} \\\ +f_\mathrm{2} \\\ +f_\mathrm{3} \\\ +\vdots \\\ +\vdots \\\ +f_\mathrm{N-2} \\\ +f_\mathrm{N-1} \\\ +\end{array} +\right ) +\end{split}\]
+
+\[\begin{split} +{\bf b} = \Delta x^2 \left ( +\begin{array}{c} +g_\mathrm{1} \\\ +g_\mathrm{2} \\\ +g_\mathrm{3} \\\ +\vdots \\\ +\vdots \\\ +g_\mathrm{N-2} \\\ +g_\mathrm{N-1}\\\ +\end{array} +\right ) +\end{split}\]
+

Then we just solve \({\bf A}{\bf x} = {\bf b}\)

+
+

Note

+

SciPy has banded solvers that work with banded matrices like we have above. They +will be much more efficient than using a solver based on a dense matrix

+
+
+
+
import scipy.linalg as linalg
+
+# our grid -- including endpoints
+N = 100
+x = np.linspace(0.0, 2.0*np.pi, N, endpoint=True)
+dx = x[1] - x[0]
+
+# our source
+g = np.sin(x)
+
+# our matrix will be tridiagonal, with [1, -2, 1] on the diagonals
+# we only solve for the N-2 interior points
+
+# diagonal
+d = -2 * np.ones(N-2)
+
+# upper -- note that the upper diagonal has 1 less element than the
+# main diagonal.  The SciPy banded solver wants the matrix in the 
+# form:
+#
+# *    a01  a12  a23  a34  a45    <- upper diagonal
+# a00  a11  a22  a33  a44  a55    <- diagonal
+# a10  a21  a32  a43  a54   *     <- lower diagonal
+#
+
+u = np.ones(N-2)
+u[0] = 0.0
+
+# lower
+l = np.ones(N-2)
+l[N-3] = 0.0
+
+# put the upper, diagonal, and lower parts together as a banded matrix
+A = np.matrix([u, d, l])
+
+# solve A sol = dx**2 g for the inner N-2 points
+sol = linalg.solve_banded((1,1), A, dx**2*g[1:N-1])
+
+
+
+
+

Let’s plot the solution

+
+
+
fig, ax = plt.subplots()
+ax.plot(x[1:N-1], sol)
+# alt-text: a plot showing a function that looks approximately like -sin(x)
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7f3c488e4590>]
+
+
+../_images/9464b0c0bcee714b070f959c01ff09c68008dbf76d6bcb101f395150b9d6b153.png +
+
+

This looks like \(-\sin(x)\), as expected.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-basics.html b/05-scipy/scipy-basics.html new file mode 100644 index 00000000..983e6a25 --- /dev/null +++ b/05-scipy/scipy-basics.html @@ -0,0 +1,2249 @@ + + + + + + + + + + + SciPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

SciPy#

+

SciPy is a collection of numerical algorithms with python interfaces. In many cases, these interfaces are wrappers around standard numerical libraries that have been developed in the community and are used with other languages. Usually detailed references are available to explain the implementation.

+
+

Note

+

There are many subpackages generally, you load the subpackages separately, e.g.

+
from scipy import linalg, optimize
+
+
+

then you have access to the methods in those namespaces

+
+
+

Important

+

One thing to keep in mind—all numerical methods have strengths and weaknesses, and make assumptions. You should always do some research into the method to understand what it is doing.

+
+
+

Tip

+

It is also always a good idea to run a new method on some test where you know the answer, to make sure it is behaving as expected.

+
+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Integration#

+

we’ll do some integrals of the form

+
+\[I = \int_a^b f(x) dx\]
+

We can imagine two situations:

+
    +
  • our function \(f(x)\) is given by an analytic expression. This gives us the freedom to pick our integration points, and in general can allow us to optimize our result and get high accuracy

  • +
  • our function \(f(x)\) is defined on at a set of (possibly regular spaced) points.

  • +
+
+

Note

+

In numerical analysis, the term quadrature is used to describe any integration method that represents the integral as the weighted sum of a discrete number of points.

+
+
+
+
from scipy import integrate
+#help(integrate)
+
+
+
+
+

Let’s consider integrating

+
+\[I = \int_0^{2\pi} \sin^2(x) dx\]
+

quad() is the basic integrator for a general (not sampled) function. It uses a general-interface from the Fortran package QUADPACK (QAGS or QAGI). It will return the integral in an interval and an estimate of the error in the approximation

+
+
+
def f(x):
+    return np.sin(x)**2
+
+
+
+
+
+
+
help(integrate.quad)
+
+
+
+
+
Help on function quad in module scipy.integrate._quadpack_py:
+
+quad(
+    func,
+    a,
+    b,
+    args=(),
+    full_output=0,
+    epsabs=1.49e-08,
+    epsrel=1.49e-08,
+    limit=50,
+    points=None,
+    weight=None,
+    wvar=None,
+    wopts=None,
+    maxp1=50,
+    limlst=50,
+    complex_func=False
+)
+    Compute a definite integral.
+
+    Integrate func from `a` to `b` (possibly infinite interval) using a
+    technique from the Fortran library QUADPACK.
+
+    Parameters
+    ----------
+    func : {function, scipy.LowLevelCallable}
+        A Python function or method to integrate. If `func` takes many
+        arguments, it is integrated along the axis corresponding to the
+        first argument.
+
+        If the user desires improved integration performance, then `f` may
+        be a `scipy.LowLevelCallable` with one of the signatures::
+
+            double func(double x)
+            double func(double x, void *user_data)
+            double func(int n, double *xx)
+            double func(int n, double *xx, void *user_data)
+
+        The ``user_data`` is the data contained in the `scipy.LowLevelCallable`.
+        In the call forms with ``xx``,  ``n`` is the length of the ``xx``
+        array which contains ``xx[0] == x`` and the rest of the items are
+        numbers contained in the ``args`` argument of quad.
+
+        In addition, certain ctypes call signatures are supported for
+        backward compatibility, but those should not be used in new code.
+    a : float
+        Lower limit of integration (use -numpy.inf for -infinity).
+    b : float
+        Upper limit of integration (use numpy.inf for +infinity).
+    args : tuple, optional
+        Extra arguments to pass to `func`.
+    full_output : int, optional
+        Non-zero to return a dictionary of integration information.
+        If non-zero, warning messages are also suppressed and the
+        message is appended to the output tuple.
+    complex_func : bool, optional
+        Indicate if the function's (`func`) return type is real
+        (``complex_func=False``: default) or complex (``complex_func=True``).
+        In both cases, the function's argument is real.
+        If full_output is also non-zero, the `infodict`, `message`, and
+        `explain` for the real and complex components are returned in
+        a dictionary with keys "real output" and "imag output".
+
+    Returns
+    -------
+    y : float
+        The integral of func from `a` to `b`.
+    abserr : float
+        An estimate of the absolute error in the result.
+    infodict : dict
+        A dictionary containing additional information.
+    message
+        A convergence message.
+    explain
+        Appended only with 'cos' or 'sin' weighting and infinite
+        integration limits, it contains an explanation of the codes in
+        infodict['ierlst']
+
+    Other Parameters
+    ----------------
+    epsabs : float or int, optional
+        Absolute error tolerance. Default is 1.49e-8. `quad` tries to obtain
+        an accuracy of ``abs(i-result) <= max(epsabs, epsrel*abs(i))``
+        where ``i`` = integral of `func` from `a` to `b`, and ``result`` is the
+        numerical approximation. See `epsrel` below.
+    epsrel : float or int, optional
+        Relative error tolerance. Default is 1.49e-8.
+        If ``epsabs <= 0``, `epsrel` must be greater than both 5e-29
+        and ``50 * (machine epsilon)``. See `epsabs` above.
+    limit : float or int, optional
+        An upper bound on the number of subintervals used in the adaptive
+        algorithm.
+    points : (sequence of floats,ints), optional
+        A sequence of break points in the bounded integration interval
+        where local difficulties of the integrand may occur (e.g.,
+        singularities, discontinuities). The sequence does not have
+        to be sorted. Note that this option cannot be used in conjunction
+        with ``weight``.
+    weight : float or int, optional
+        String indicating weighting function. Full explanation for this
+        and the remaining arguments can be found below.
+    wvar : optional
+        Variables for use with weighting functions.
+    wopts : optional
+        Optional input for reusing Chebyshev moments.
+    maxp1 : float or int, optional
+        An upper bound on the number of Chebyshev moments.
+    limlst : int, optional
+        Upper bound on the number of cycles (>=3) for use with a sinusoidal
+        weighting and an infinite end-point.
+
+    See Also
+    --------
+
+    :func:`dblquad`
+        double integral
+    :func:`tplquad`
+        triple integral
+    :func:`nquad`
+        n-dimensional integrals (uses `quad` recursively)
+    :func:`fixed_quad`
+        fixed-order Gaussian quadrature
+    :func:`simpson`
+        integrator for sampled data
+    :func:`romb`
+        integrator for sampled data
+    :func:`scipy.special`
+        for coefficients and roots of orthogonal polynomials
+
+
+    Notes
+    -----
+    For valid results, the integral must converge; behavior for divergent
+    integrals is not guaranteed.
+
+    **Extra information for quad() inputs and outputs**
+
+    If full_output is non-zero, then the third output argument
+    (infodict) is a dictionary with entries as tabulated below. For
+    infinite limits, the range is transformed to (0,1) and the
+    optional outputs are given with respect to this transformed range.
+    Let M be the input argument limit and let K be infodict['last'].
+    The entries are:
+
+    'neval'
+        The number of function evaluations.
+    'last'
+        The number, K, of subintervals produced in the subdivision process.
+    'alist'
+        A rank-1 array of length M, the first K elements of which are the
+        left end points of the subintervals in the partition of the
+        integration range.
+    'blist'
+        A rank-1 array of length M, the first K elements of which are the
+        right end points of the subintervals.
+    'rlist'
+        A rank-1 array of length M, the first K elements of which are the
+        integral approximations on the subintervals.
+    'elist'
+        A rank-1 array of length M, the first K elements of which are the
+        moduli of the absolute error estimates on the subintervals.
+    'iord'
+        A rank-1 integer array of length M, the first L elements of
+        which are pointers to the error estimates over the subintervals
+        with ``L=K`` if ``K<=M/2+2`` or ``L=M+1-K`` otherwise. Let I be the
+        sequence ``infodict['iord']`` and let E be the sequence
+        ``infodict['elist']``.  Then ``E[I[1]], ..., E[I[L]]`` forms a
+        decreasing sequence.
+
+    If the input argument points is provided (i.e., it is not None),
+    the following additional outputs are placed in the output
+    dictionary. Assume the points sequence is of length P.
+
+    'pts'
+        A rank-1 array of length P+2 containing the integration limits
+        and the break points of the intervals in ascending order.
+        This is an array giving the subintervals over which integration
+        will occur.
+    'level'
+        A rank-1 integer array of length M (=limit), containing the
+        subdivision levels of the subintervals, i.e., if (aa,bb) is a
+        subinterval of ``(pts[1], pts[2])`` where ``pts[0]`` and ``pts[2]``
+        are adjacent elements of ``infodict['pts']``, then (aa,bb) has level l
+        if ``|bb-aa| = |pts[2]-pts[1]| * 2**(-l)``.
+    'ndin'
+        A rank-1 integer array of length P+2. After the first integration
+        over the intervals (pts[1], pts[2]), the error estimates over some
+        of the intervals may have been increased artificially in order to
+        put their subdivision forward. This array has ones in slots
+        corresponding to the subintervals for which this happens.
+
+    **Weighting the integrand**
+
+    The input variables, *weight* and *wvar*, are used to weight the
+    integrand by a select list of functions. Different integration
+    methods are used to compute the integral with these weighting
+    functions, and these do not support specifying break points. The
+    possible values of weight and the corresponding weighting functions are.
+
+    ==========  ===================================   =====================
+    ``weight``  Weight function used                  ``wvar``
+    ==========  ===================================   =====================
+    'cos'       cos(w*x)                              wvar = w
+    'sin'       sin(w*x)                              wvar = w
+    'alg'       g(x) = ((x-a)**alpha)*((b-x)**beta)   wvar = (alpha, beta)
+    'alg-loga'  g(x)*log(x-a)                         wvar = (alpha, beta)
+    'alg-logb'  g(x)*log(b-x)                         wvar = (alpha, beta)
+    'alg-log'   g(x)*log(x-a)*log(b-x)                wvar = (alpha, beta)
+    'cauchy'    1/(x-c)                               wvar = c
+    ==========  ===================================   =====================
+
+    wvar holds the parameter w, (alpha, beta), or c depending on the weight
+    selected. In these expressions, a and b are the integration limits.
+
+    For the 'cos' and 'sin' weighting, additional inputs and outputs are
+    available.
+
+    For weighted integrals with finite integration limits, the integration
+    is performed using a Clenshaw-Curtis method, which uses Chebyshev moments.
+    For repeated calculations, these moments are saved in the output dictionary:
+
+    'momcom'
+        The maximum level of Chebyshev moments that have been computed,
+        i.e., if ``M_c`` is ``infodict['momcom']`` then the moments have been
+        computed for intervals of length ``|b-a| * 2**(-l)``,
+        ``l=0,1,...,M_c``.
+    'nnlog'
+        A rank-1 integer array of length M(=limit), containing the
+        subdivision levels of the subintervals, i.e., an element of this
+        array is equal to l if the corresponding subinterval is
+        ``|b-a|* 2**(-l)``.
+    'chebmo'
+        A rank-2 array of shape (25, maxp1) containing the computed
+        Chebyshev moments. These can be passed on to an integration
+        over the same interval by passing this array as the second
+        element of the sequence wopts and passing infodict['momcom'] as
+        the first element.
+
+    If one of the integration limits is infinite, then a Fourier integral is
+    computed (assuming w neq 0). If full_output is 1 and a numerical error
+    is encountered, besides the error message attached to the output tuple,
+    a dictionary is also appended to the output tuple which translates the
+    error codes in the array ``info['ierlst']`` to English messages. The
+    output information dictionary contains the following entries instead of
+    'last', 'alist', 'blist', 'rlist', and 'elist':
+
+    'lst'
+        The number of subintervals needed for the integration (call it ``K_f``).
+    'rslst'
+        A rank-1 array of length M_f=limlst, whose first ``K_f`` elements
+        contain the integral contribution over the interval
+        ``(a+(k-1)c, a+kc)`` where ``c = (2*floor(|w|) + 1) * pi / |w|``
+        and ``k=1,2,...,K_f``.
+    'erlst'
+        A rank-1 array of length ``M_f`` containing the error estimate
+        corresponding to the interval in the same position in
+        ``infodict['rslist']``.
+    'ierlst'
+        A rank-1 integer array of length ``M_f`` containing an error flag
+        corresponding to the interval in the same position in
+        ``infodict['rslist']``.  See the explanation dictionary (last entry
+        in the output tuple) for the meaning of the codes.
+
+    **Details of QUADPACK level routines**
+
+    `quad` calls routines from the FORTRAN library QUADPACK. This section
+    provides details on the conditions for each routine to be called and a
+    short description of each routine. The routine called depends on
+    `weight`, `points` and the integration limits `a` and `b`.
+
+    ================  ==============  ==========  =====================
+    QUADPACK routine  `weight`        `points`    infinite bounds
+    ================  ==============  ==========  =====================
+    qagse             None            No          No
+    qagie             None            No          Yes
+    qagpe             None            Yes         No
+    qawoe             'sin', 'cos'    No          No
+    qawfe             'sin', 'cos'    No          either `a` or `b`
+    qawse             'alg*'          No          No
+    qawce             'cauchy'        No          No
+    ================  ==============  ==========  =====================
+
+    The following provides a short description from [1]_ for each
+    routine.
+
+    qagse
+        is an integrator based on globally adaptive interval
+        subdivision in connection with extrapolation, which will
+        eliminate the effects of integrand singularities of
+        several types. The integration is performed using a 21-point Gauss-Kronrod
+        quadrature within each subinterval.
+    qagie
+        handles integration over infinite intervals. The infinite range is
+        mapped onto a finite interval and subsequently the same strategy as
+        in ``QAGS`` is applied.
+    qagpe
+        serves the same purposes as QAGS, but also allows the
+        user to provide explicit information about the location
+        and type of trouble-spots i.e. the abscissae of internal
+        singularities, discontinuities and other difficulties of
+        the integrand function.
+    qawoe
+        is an integrator for the evaluation of
+        :math:`\int^b_a \cos(\omega x)f(x)dx` or
+        :math:`\int^b_a \sin(\omega x)f(x)dx`
+        over a finite interval [a,b], where :math:`\omega` and :math:`f`
+        are specified by the user. The rule evaluation component is based
+        on the modified Clenshaw-Curtis technique
+
+        An adaptive subdivision scheme is used in connection
+        with an extrapolation procedure, which is a modification
+        of that in ``QAGS`` and allows the algorithm to deal with
+        singularities in :math:`f(x)`.
+    qawfe
+        calculates the Fourier transform
+        :math:`\int^\infty_a \cos(\omega x)f(x)dx` or
+        :math:`\int^\infty_a \sin(\omega x)f(x)dx`
+        for user-provided :math:`\omega` and :math:`f`. The procedure of
+        ``QAWO`` is applied on successive finite intervals, and convergence
+        acceleration by means of the :math:`\varepsilon`-algorithm is applied
+        to the series of integral approximations.
+    qawse
+        approximate :math:`\int^b_a w(x)f(x)dx`, with :math:`a < b` where
+        :math:`w(x) = (x-a)^{\alpha}(b-x)^{\beta}v(x)` with
+        :math:`\alpha,\beta > -1`, where :math:`v(x)` may be one of the
+        following functions: :math:`1`, :math:`\log(x-a)`, :math:`\log(b-x)`,
+        :math:`\log(x-a)\log(b-x)`.
+
+        The user specifies :math:`\alpha`, :math:`\beta` and the type of the
+        function :math:`v`. A globally adaptive subdivision strategy is
+        applied, with modified Clenshaw-Curtis integration on those
+        subintervals which contain `a` or `b`.
+    qawce
+        compute :math:`\int^b_a f(x) / (x-c)dx` where the integral must be
+        interpreted as a Cauchy principal value integral, for user specified
+        :math:`c` and :math:`f`. The strategy is globally adaptive. Modified
+        Clenshaw-Curtis integration is used on those intervals containing the
+        point :math:`x = c`.
+
+    **Integration of Complex Function of a Real Variable**
+
+    A complex valued function, :math:`f`, of a real variable can be written as
+    :math:`f = g + ih`.  Similarly, the integral of :math:`f` can be
+    written as
+
+    .. math::
+        \int_a^b f(x) dx = \int_a^b g(x) dx + i\int_a^b h(x) dx
+
+    assuming that the integrals of :math:`g` and :math:`h` exist
+    over the interval :math:`[a,b]` [2]_. Therefore, ``quad`` integrates
+    complex-valued functions by integrating the real and imaginary components
+    separately.
+
+    **Array API Standard Support**
+
+    `quad` has experimental support for Python Array API Standard compatible
+    backends in addition to NumPy. Please consider testing these features
+    by setting an environment variable ``SCIPY_ARRAY_API=1`` and providing
+    CuPy, PyTorch, JAX, or Dask arrays as array arguments. The following
+    combinations of backend and device (or other capability) are supported.
+
+    ====================  ====================  ====================
+    Library               CPU                   GPU
+    ====================  ====================  ====================
+    NumPy                 ✅                     n/a
+    CuPy                  n/a                   ⛔
+    PyTorch               ⛔                     ⛔
+    JAX                   ⛔                     ⛔
+    Dask                  ⛔                     n/a
+    ====================  ====================  ====================
+
+        See :ref:`dev-arrayapi` for more information.
+
+    References
+    ----------
+    .. [1] Piessens, Robert; de Doncker-Kapenga, Elise;
+           Überhuber, Christoph W.; Kahaner, David (1983).
+           QUADPACK: A subroutine package for automatic integration.
+           Springer-Verlag.
+           ISBN 978-3-540-12553-2.
+
+    .. [2] McCullough, Thomas; Phillips, Keith (1973).
+           Foundations of Analysis in the Complex Plane.
+           Holt Rinehart Winston.
+           ISBN 0-03-086370-8
+
+    Examples
+    --------
+    Calculate :math:`\int^4_0 x^2 dx` and compare with an analytic result
+
+    >>> from scipy import integrate
+    >>> import numpy as np
+    >>> x2 = lambda x: x**2
+    >>> integrate.quad(x2, 0, 4)
+    (21.333333333333332, 2.3684757858670003e-13)
+    >>> print(4**3 / 3.)  # analytical result
+    21.3333333333
+
+    Calculate :math:`\int^\infty_0 e^{-x} dx`
+
+    >>> invexp = lambda x: np.exp(-x)
+    >>> integrate.quad(invexp, 0, np.inf)
+    (1.0, 5.842605999138044e-11)
+
+    Calculate :math:`\int^1_0 a x \,dx` for :math:`a = 1, 3`
+
+    >>> f = lambda x, a: a*x
+    >>> y, err = integrate.quad(f, 0, 1, args=(1,))
+    >>> y
+    0.5
+    >>> y, err = integrate.quad(f, 0, 1, args=(3,))
+    >>> y
+    1.5
+
+    Calculate :math:`\int^1_0 x^2 + y^2 dx` with ctypes, holding
+    y parameter as 1::
+
+        testlib.c =>
+            double func(int n, double args[n]){
+                return args[0]*args[0] + args[1]*args[1];}
+        compile to library testlib.*
+
+    ::
+
+       from scipy import integrate
+       import ctypes
+       lib = ctypes.CDLL('/home/.../testlib.*') #use absolute path
+       lib.func.restype = ctypes.c_double
+       lib.func.argtypes = (ctypes.c_int,ctypes.c_double)
+       integrate.quad(lib.func,0,1,(1))
+       #(1.3333333333333333, 1.4802973661668752e-14)
+       print((1.0**3/3.0 + 1.0) - (0.0**3/3.0 + 0.0)) #Analytic result
+       # 1.3333333333333333
+
+    Be aware that pulse shapes and other sharp features as compared to the
+    size of the integration interval may not be integrated correctly using
+    this method. A simplified example of this limitation is integrating a
+    y-axis reflected step function with many zero values within the integrals
+    bounds.
+
+    >>> y = lambda x: 1 if x<=0 else 0
+    >>> integrate.quad(y, -1, 1)
+    (1.0, 1.1102230246251565e-14)
+    >>> integrate.quad(y, -1, 100)
+    (1.0000000002199108, 1.0189464580163188e-08)
+    >>> integrate.quad(y, -1, 10000)
+    (0.0, 0.0)
+
+
+
+
+

quad will return the integral and an estimate of the error. We can seek more accuracy by setting epsabs and epsrel, +but remember that we can’t do better than roundoff error.

+
+
+
I, err = integrate.quad(f, 0.0, 2.0*np.pi, epsabs=1.e-16, epsrel=1.e-16)
+print(I)
+print(err)
+
+
+
+
+
3.141592653589793
+3.4878684980086318e-15
+
+
+
/tmp/ipykernel_3232/932417219.py:1: IntegrationWarning: The occurrence of roundoff error is detected, which prevents 
+  the requested tolerance from being achieved.  The error may be 
+  underestimated.
+  I, err = integrate.quad(f, 0.0, 2.0*np.pi, epsabs=1.e-16, epsrel=1.e-16)
+
+
+
+
+
+
+
#help(integrate.quad)
+
+
+
+
+
+

Additional arguments#

+

Sometimes our integrand function takes optional arguments. Let’s consider integrating

+
+\[g(x) = A e^{-(x/\sigma)^2}\]
+

now we want to be able to define the amplitude, \(A\), and width, \(\sigma\) as part of the function.

+
+
+
def g(x, A, sigma):
+    return A*np.exp(-x**2/sigma**2)
+
+
+
+
+
+
+
I, err = integrate.quad(g, -1.0, 1.0, args=(1.0, 2.0))
+print(I, err)
+
+
+
+
+
1.8451240256511698 2.0484991765669867e-14
+
+
+
+
+
+
+

Integrating to infinity#

+

numpy defines the inf quantity which can be used in the integration limits. We can integrate a Gaussian over \([-\infty, \infty]\) (we know the answer +is \(\sqrt{\pi}\)).

+
+

Note

+

Behind the scenes, what the integration function does is do a variable transform like: \(t = x/(c +x)\). This works when one limit is \(\infty\), giving, e.g.,

+
+\[\int_a^\infty f(x) dx = c \int_{a/(c + a)}^1 f\left (c\frac{t}{1-t}\right) (1 - t)^{-2} dt\]
+
+
+
+
I, err = integrate.quad(g, -np.inf, np.inf, args=(1.0, 1.0))
+print(I, err)
+
+
+
+
+
1.7724538509055159 1.4202636780944923e-08
+
+
+
+
+
+
+

Multidimensional integrals#

+

Multidimensional integration can be done with successive calls to quad(), but there are wrappers that help

+

Let’s compute

+
+\[I = \int_{y=0}^{1/2} \int_{x=0}^{1-2y} xy dxdy = \frac{1}{96}\]
+

(this example comes from the SciPy tutorial)

+

Notice that the limits of integration in \(x\) depend on \(y\). This means that we need to do the \(x\) +integration first, which gives:

+
+\[I = \int_{y=0}^{1/2} \int_{x=0}^{1-2y} xy \,dxdy = \frac{1}{2} \int_{y=0}^{1/2} y \left [ x^2 \right |_0^{1-2y} dy = \frac{1}{2} \int_0^{1/2} (1-2y)^2 y \, dy = \frac{1}{96}\]
+

Note the form of the function:

+
dblquad(f, a, b, xlo, xhi)
+
+
+

where f = f(y, x) – the y argument is first to indicate that the \(y\) integration is done first and +then the \(x\) and \([a, b]\) are the limits of the \(x\) integration. We want the opposite in this example, +so we’ll switch the meaning of \(x\) and \(y\) in our example below.

+

The integral will be from: \(y = [0, 1/2]\), and \(x\) = xlo(y), \(x\) = xhi(y)

+
+
+
def integrand(x, y):
+    return x*y
+
+def x_lower_lim(y):
+    return 0
+    
+def x_upper_lim(y):
+    return 1-2*y
+
+# we change the definitions of x and y in this call
+I, err = integrate.dblquad(integrand, 0.0, 0.5, x_lower_lim, x_upper_lim)
+print(I, 1.0/I)
+
+
+
+
+
0.010416666666666668 95.99999999999999
+
+
+
+
+

If you remember the python lambda functions (one expression functions), you can do this more compactly:

+
+
+
I, err = integrate.dblquad(lambda x, y: x*y, 0.0, 0.5, lambda y: 0, lambda y: 1-2*y)
+print(I)
+
+
+
+
+
0.010416666666666668
+
+
+
+
+
+
+

Integration of a sampled function#

+

Here we integrate a function that is defined only at a sequence of points. A popular method +is Simpson’s rule which fits a parabola to 3 consecutive points +and integrates under the parabola.

+

Let’s compute

+
+\[I = \int_0^{2\pi} f(x_i) dx\]
+

with \(x_i = 0, \ldots, 2\pi\) defined at \(N\) points

+
+
+
N = 17
+x = np.linspace(0.0, 2.0*np.pi, N, endpoint=True)
+y = np.sin(x)**2
+
+I = integrate.simpson(y, x=x)
+print(I)
+
+
+
+
+
3.141592653589793
+
+
+
+
+

Romberg integration is specific to equally-spaced samples, where \(N = 2^k + 1\) and can be more converge faster (it uses extrapolation of coarser integration results to achieve higher accuracy)

+
+
+
N = 17
+x = np.linspace(0.0, 2.0*np.pi, N, endpoint=True)
+y = np.sin(x)**2
+
+I = integrate.romb(y, dx=x[1]-x[0])
+print(I)
+
+
+
+
+
3.1430658353300385
+
+
+
+
+
+
+
+

Interpolation#

+

Interpolation fills in the gaps between a discrete number of points by making an assumption about the behavior of the functional form of the data.

+

Many different types of interpolation exist

+
    +
  • some ensure no new extrema are introduced

  • +
  • some conserve the quantity being interpolated

  • +
  • some match derivative at end points

  • +
+
+

Caution

+

Pathologies exist—it is not always best to use a high-order polynomial to pass through all of the points in your dataset.

+
+

The interp1d() function allows for a variety of 1-d interpolation methods. It returns an object that acts as a function, which can be evaluated at any point.

+
+
+
import scipy.interpolate as interpolate
+
+
+
+
+
+
+
#help(interpolate.interp1d)
+
+
+
+
+

Let’s sample

+
+\[f(x) = x \sin(x)\]
+

and try to interpolate it.

+
+
+
def f_exact(x):
+    return np.sin(x)*x
+
+
+
+
+
+
+
N = 10
+x = np.linspace(0, 20, N)
+
+y = f_exact(x)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+
+x_fine = np.linspace(0, 20, 10*N)
+
+ax.scatter(x, y)
+ax.plot(x_fine, f_exact(x_fine), ls=":", label="original function")
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fc65d190ec0>]
+
+
+a figure showing data points and an interpolant passing through them +
+
+

When we create an interpolant via interp1d, it creates a function object

+
+
+
help(interpolate.interp1d)
+
+
+
+
+
Help on class interp1d in module scipy.interpolate._interpolate:
+
+class interp1d(scipy.interpolate._polyint._Interpolator1D)
+ |  interp1d(
+ |      x,
+ |      y,
+ |      kind='linear',
+ |      axis=-1,
+ |      copy=True,
+ |      bounds_error=None,
+ |      fill_value=nan,
+ |      assume_sorted=False
+ |  )
+ |
+ |  Interpolate a 1-D function (legacy).
+ |
+ |  .. legacy:: class
+ |
+ |      For a guide to the intended replacements for `interp1d` see
+ |      :ref:`tutorial-interpolate_1Dsection`.
+ |
+ |  `x` and `y` are arrays of values used to approximate some function f:
+ |  ``y = f(x)``. This class returns a function whose call method uses
+ |  interpolation to find the value of new points.
+ |
+ |  Parameters
+ |  ----------
+ |  x : (npoints, ) array_like
+ |      A 1-D array of real values.
+ |  y : (..., npoints, ...) array_like
+ |      An N-D array of real values. The length of `y` along the interpolation
+ |      axis must be equal to the length of `x`. Use the ``axis`` parameter
+ |      to select correct axis. Unlike other interpolators, the default
+ |      interpolation axis is the last axis of `y`.
+ |  kind : str or int, optional
+ |      Specifies the kind of interpolation as a string or as an integer
+ |      specifying the order of the spline interpolator to use.
+ |      The string has to be one of 'linear', 'nearest', 'nearest-up', 'zero',
+ |      'slinear', 'quadratic', 'cubic', 'previous', or 'next'. 'zero',
+ |      'slinear', 'quadratic' and 'cubic' refer to a spline interpolation of
+ |      zeroth, first, second or third order; 'previous' and 'next' simply
+ |      return the previous or next value of the point; 'nearest-up' and
+ |      'nearest' differ when interpolating half-integers (e.g. 0.5, 1.5)
+ |      in that 'nearest-up' rounds up and 'nearest' rounds down. Default
+ |      is 'linear'.
+ |  axis : int, optional
+ |      Axis in the ``y`` array corresponding to the x-coordinate values. Unlike
+ |      other interpolators, defaults to ``axis=-1``.
+ |  copy : bool, optional
+ |      If ``True``, the class makes internal copies of x and y. If ``False``,
+ |      references to ``x`` and ``y`` are used if possible. The default is to copy.
+ |  bounds_error : bool, optional
+ |      If True, a ValueError is raised any time interpolation is attempted on
+ |      a value outside of the range of x (where extrapolation is
+ |      necessary). If False, out of bounds values are assigned `fill_value`.
+ |      By default, an error is raised unless ``fill_value="extrapolate"``.
+ |  fill_value : array-like or (array-like, array_like) or "extrapolate", optional
+ |      - if a ndarray (or float), this value will be used to fill in for
+ |        requested points outside of the data range. If not provided, then
+ |        the default is NaN. The array-like must broadcast properly to the
+ |        dimensions of the non-interpolation axes.
+ |      - If a two-element tuple, then the first element is used as a
+ |        fill value for ``x_new < x[0]`` and the second element is used for
+ |        ``x_new > x[-1]``. Anything that is not a 2-element tuple (e.g.,
+ |        list or ndarray, regardless of shape) is taken to be a single
+ |        array-like argument meant to be used for both bounds as
+ |        ``below, above = fill_value, fill_value``. Using a two-element tuple
+ |        or ndarray requires ``bounds_error=False``.
+ |
+ |        .. versionadded:: 0.17.0
+ |      - If "extrapolate", then points outside the data range will be
+ |        extrapolated.
+ |
+ |        .. versionadded:: 0.17.0
+ |  assume_sorted : bool, optional
+ |      If False, values of `x` can be in any order and they are sorted first.
+ |      If True, `x` has to be an array of monotonically increasing values.
+ |
+ |  Attributes
+ |  ----------
+ |  fill_value
+ |
+ |  Methods
+ |  -------
+ |  __call__
+ |
+ |  See Also
+ |  --------
+ |
+ |  :func:`splrep`, :func:`splev`
+ |      Spline interpolation/smoothing based on FITPACK.
+ |  :func:`UnivariateSpline`
+ |      An object-oriented wrapper of the FITPACK routines.
+ |  :func:`interp2d`
+ |      2-D interpolation
+ |
+ |
+ |  Notes
+ |  -----
+ |  Calling `interp1d` with NaNs present in input values results in
+ |  undefined behaviour.
+ |
+ |  Input values `x` and `y` must be convertible to `float` values like
+ |  `int` or `float`.
+ |
+ |  If the values in `x` are not unique, the resulting behavior is
+ |  undefined and specific to the choice of `kind`, i.e., changing
+ |  `kind` will change the behavior for duplicates.
+ |
+ |  **Array API Standard Support**
+ |
+ |  `interp1d` is not in-scope for support of Python Array API Standard compatible
+ |  backends other than NumPy.
+ |
+ |  See :ref:`dev-arrayapi` for more information.
+ |
+ |
+ |  Examples
+ |  --------
+ |  >>> import numpy as np
+ |  >>> import matplotlib.pyplot as plt
+ |  >>> from scipy import interpolate
+ |  >>> x = np.arange(0, 10)
+ |  >>> y = np.exp(-x/3.0)
+ |  >>> f = interpolate.interp1d(x, y)
+ |
+ |  >>> xnew = np.arange(0, 9, 0.1)
+ |  >>> ynew = f(xnew)   # use interpolation function returned by `interp1d`
+ |  >>> plt.plot(x, y, 'o', xnew, ynew, '-')
+ |  >>> plt.show()
+ |
+ |  Method resolution order:
+ |      interp1d
+ |      scipy.interpolate._polyint._Interpolator1D
+ |      builtins.object
+ |
+ |  Methods defined here:
+ |
+ |  __init__(
+ |      self,
+ |      x,
+ |      y,
+ |      kind='linear',
+ |      axis=-1,
+ |      copy=True,
+ |      bounds_error=None,
+ |      fill_value=nan,
+ |      assume_sorted=False
+ |  )
+ |      Initialize a 1-D linear interpolation class.
+ |
+ |  ----------------------------------------------------------------------
+ |  Data descriptors defined here:
+ |
+ |  __dict__
+ |      dictionary for instance variables
+ |
+ |  __weakref__
+ |      list of weak references to the object
+ |
+ |  fill_value
+ |      The fill value.
+ |
+ |  ----------------------------------------------------------------------
+ |  Methods inherited from scipy.interpolate._polyint._Interpolator1D:
+ |
+ |  __call__(self, x)
+ |      Evaluate the interpolant
+ |
+ |      Parameters
+ |      ----------
+ |      x : array_like
+ |          Point or points at which to evaluate the interpolant.
+ |
+ |      Returns
+ |      -------
+ |      y : array_like
+ |          Interpolated values. Shape is determined by replacing
+ |          the interpolation axis in the original array with the shape of `x`.
+ |
+ |      Notes
+ |      -----
+ |      Input values `x` must be convertible to `float` values like `int`
+ |      or `float`.
+ |
+ |  ----------------------------------------------------------------------
+ |  Class methods inherited from scipy.interpolate._polyint._Interpolator1D:
+ |
+ |  __class_getitem__ = GenericAlias(args, /)
+ |      Represent a PEP 585 generic type
+ |
+ |      E.g. for t = list[int], t.__origin__ is list and t.__args__ is (int,).
+ |
+ |  ----------------------------------------------------------------------
+ |  Data descriptors inherited from scipy.interpolate._polyint._Interpolator1D:
+ |
+ |  dtype
+
+
+
+
+
+
+
f_interp = interpolate.interp1d(x, y, kind="nearest")
+
+
+
+
+
+
+
ax.plot(x_fine, f_interp(x_fine), label="nearest")
+
+ax.legend(frameon=False, loc="best")
+fig
+
+
+
+
+a figure showing data points, an interpolant to them, and the original function we sampled +
+
+
+

Multi-d interpolation#

+

Here’s an example of mult-d interpolation from the official tutorial.

+

First we define the “answer”—this is the true function that we will sample at a number of points and then try to use interpolation to recover

+
+
+
def func(x, y):
+    return x*(1-x)*np.cos(4*np.pi*x) * np.sin(4*np.pi*y**2)**2
+
+
+
+
+

We’ll use np.meshgrid() to create the two-dimensional rectangular grid of points were we define our data.

+
+
+
nx = 100
+ny = 200
+
+x = np.linspace(0, 1, nx)
+y = np.linspace(0, 1, ny)
+
+x, y = np.meshgrid(x, y, indexing="ij")
+
+
+
+
+

here’s what the exact function looks like—note that our function is defined in x,y, but imshow is meant for plotting an array, so the first index is the row. We take the transpose when plotting

+
+
+
fig, ax = plt.subplots()
+data = func(x, y)
+im = ax.imshow(data.T, extent=(0, 1, 0, 1), origin="lower")
+fig.colorbar(im, ax=ax)
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc65cfe9400>
+
+
+a heat-map figure showing a function with small-amplitude ripples +
+
+

Now we’ll coarsen it by taking only every 4th point

+
+
+
coarse = data[::4, ::4]
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+im = ax.imshow(coarse.T, extent=(0, 1, 0, 1), origin="lower")
+fig.colorbar(im, ax=ax)
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc65ced4d70>
+
+
+a heat-map showing coarsened representation of our function +
+
+

Let’s now use interpolation to try to recover the look of the original data.

+
+

Note

+

This is considered structured grid interpolation, and SciPy has the RegularGridInterpolator() class for this type of data.

+

If the data were unstructured, then you should explore griddata() instead.

+
+
+
+
from scipy import interpolate
+
+
+
+
+
+
+
x_coarse = np.linspace(0, 1, nx//4)
+y_coarse = np.linspace(0, 1, ny//4)
+
+interp = interpolate.RegularGridInterpolator((x_coarse, y_coarse), coarse, method="cubic")
+
+
+
+
+

Now interp() is a function that we can use to sample the coarsened data.

+

Now interpolate it onto the original grid

+
+
+
new_data = interp((x, y))
+new_data.shape
+
+
+
+
+
(100, 200)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+im = ax.imshow(new_data.T, extent=(0, 1, 0, 1), origin="lower")
+fig.colorbar(im, ax=ax)
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc65cf37cb0>
+
+
+a heat-map showing the reconstructed function via interpolation +
+
+

and let’s plot the difference

+
+
+
diff = new_data - data
+fig, ax = plt.subplots()
+im = ax.imshow(diff.T, origin="lower", extent=(0, 1, 0, 1))
+fig.colorbar(im, ax=ax)
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc659e32a50>
+
+
+a heat-map showing the error in our interpolation.  It is better than 10% +
+
+
+
+
+

Root Finding#

+

Often we need to find a value of a variable that zeros a function – this is root finding. Sometimes, this is a multidimensional problem.

+

The brentq() method offers a very robust method for find roots from a scalar function. You do need to provide an interval that bounds the root.

+
+

Tip

+

It’s a good idea to plot the function, if you can, so you can learn how the function behaves +in the vicinity of a root (and how many roots there might be)

+
+

Let’s consider:

+

\(f(x) = \frac{x e^x}{e^x - 1} - 5\)

+
+
+
import scipy.optimize as optimize
+
+
+
+
+
+
+
def f(x):
+    return (x*np.exp(x)/(np.exp(x) - 1.0) - 5.0)
+
+
+
+
+
+
+
root, r = optimize.brentq(f, 0.1, 10.0, full_output=True)
+
+print(root)
+print(r.converged)
+
+
+
+
+
4.965114231744287
+True
+
+
+
+
+
+
+
x = np.linspace(0.1, 10.0, 1000)
+fig, ax = plt.subplots()
+ax.plot(x, f(x))
+ax.scatter(np.array([root]), np.array([f(root)]))
+ax.grid()
+
+
+
+
+a plot of our function with the root represented as a point +
+
+
+
+

ODEs#

+

Many methods exist for integrating ordinary differential equations. Most will want you to write your ODEs as a system of first order equations.

+

The Lorenz system is a very simple +model of convection in our atmosphere, but demonstrates the idea of chaos well.

+

This system of ODEs for the Lorenz system is:

+
+\[\frac{dx}{dt} = \sigma (y - x)\]
+
+\[\frac{dy}{dt} = rx - y - xz\]
+
+\[\frac{dz}{dt} = xy - bz\]
+

the steady states of this system correspond to:

+
+\[\begin{split}{\bf f}({\bf x}) = +\left ( +\begin{array}{c} +\sigma (y -x) \\ +rx - y -xz \\ +xy - bz +\end{array} +\right ) += 0\end{split}\]
+
+
+
# system parameters
+sigma = 10.0
+b = 8./3.
+r = 28.0
+
+def rhs(t, x):
+    xdot = sigma*(x[1] - x[0])
+    ydot = r*x[0] - x[1] - x[0]*x[2]
+    zdot = x[0]*x[1] - b*x[2]
+
+    return np.array([xdot, ydot, zdot])
+
+def jac(t, x):
+
+    return np.array(
+        [ [-sigma, sigma, 0.0], 
+          [r - x[2], -1.0, -x[0]],
+          [x[1], x[0], -b] ])
+
+def f(x):
+    return rhs(0.,x), jac(0.,x)
+
+
+
+
+

SciPy has a uniform interface to the different ODE solvers, solve_ivp()—we use that here.

+

These integrators will do error estimation along the way and adapt the stepsize to ensure that the accuracy +you request is met.

+
+
+
def ode_integrate(X0, dt, tmax):
+    """ integrate using the VODE method, storing the solution each dt """
+
+    r = integrate.solve_ivp(rhs, (0.0, tmax), X0,
+                            method="RK45", dense_output=True)
+
+    # get the solution at intermediate times
+    ts = np.arange(0.0, tmax, dt)
+    
+    Xs = r.sol(ts)
+    return ts, Xs
+
+
+
+
+
+

Tip

+

Execute

+
%matplotlib widget
+
+
+

in a cell before making this 3D plot and you will be able to interactively +rotate it in the notebook.

+

You may need to install the ipympl package first.

+
+
+
+
#%matplotlib widget
+
+
+
+
+
+
+
t, X = ode_integrate([1.0, 1.0, 20.0], 0.02, 30)
+from mpl_toolkits.mplot3d import Axes3D
+
+fig = plt.figure()
+ax = plt.axes(projection='3d')
+ax.plot(X[0,:], X[1,:], X[2,:])
+fig.set_size_inches(8.0,6.0)
+
+
+
+
+a 3D line plot of the solution -- it is dominated by two lobe-like structures +
+
+
+

try it

+

Rerun the integration, but change the initial conditions by 1 part in \(10^6\) for one of the components. +The make a plot of \(x\) vs. \(t\) comparing the solutions. You’ll see that the 2 solutions track well +for some time but then greatly diverged. This is the sensitivity to initial conditions that is the +hallmark of chaos.

+
+
+
+
X.shape
+
+
+
+
+
(3, 1500)
+
+
+
+
+
+
+
t2, X2 = ode_integrate([1.0001, 1.0, 20.0], 0.02, 30)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(t, X[0, :])
+ax.plot(t2, X2[0, :])
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fc659c3a120>]
+
+
+../_images/322cfb210143811bf47e093b805dca424d6cd58597dbc66c9bf60ac3d2bffaa8.png +
+
+
+

Multi-variate root find#

+

We can find the steady points in this system by doing a multi-variate root find on the RHS vector

+
+
+
sol1 = optimize.root(f, [2., 2., 2.], jac=True)
+print(sol1.x)
+
+sol2 = optimize.root(f, [10., -10., 10.], jac=True)
+print(sol2.x)
+
+sol3 = optimize.root(f, [-10., -10., -10.], jac=True)
+print(sol3.x)
+
+
+
+
+
[0. 0. 0.]
+[0. 0. 0.]
+[-8.48528137 -8.48528137 27.        ]
+
+
+
+
+
+
+
fig = plt.figure()
+fig.set_size_inches(8, 8)
+ax = plt.axes(projection='3d')
+
+ax.plot(X[0,:], X[1,:], X[2,:])
+
+ax.scatter(sol1.x[0], sol1.x[1], sol1.x[2], marker="x", color="C1")
+ax.scatter(sol2.x[0], sol2.x[1], sol2.x[2], marker="x", color="C1")
+ax.scatter(sol3.x[0], sol3.x[1], sol3.x[2], marker="x", color="C1")
+
+ax.set_xlabel("x")
+ax.set_ylabel("y")
+ax.set_zlabel("z")
+
+
+
+
+
Text(0.5, 0, 'z')
+
+
+the 3D solution again represented as a line / trajectory, now with the stable-points marked +
+
+
+
+

Stiff system of ODEs#

+

A stiff system of ODEs is one where there are multiple disparate timescales for change and we need to respect all of them to get an accurate solution

+

Here is an example from Chemical Kinetics (see, ex. Byrne & Hindmarsh 1986, or the VODE source code)

+
+\[ +\frac{d}{dt} \left ( + \begin{array}{c} y_1 \newline y_2 \newline y_3 \end{array} + \right ) = +% +\left ( + \begin{array}{rrr} + -0.04 y_1 & + 10^4 y_2 y_3 & \newline + 0.04 y_1 & - 10^4 y_2 y_3 & -3\times 10^7 y_2^2 \newline + & & 3\times 10^7 y_2^2 +\end{array} +\right ) +\]
+
+\[ +{\bf J} = \left ( +\begin{array}{ccc} + -0.04 & 10^4 y_3 & 10^4 y_2 \newline + 0.04 & -10^4 y_3 - 6\times 10^7 y_2 & -10^4 y_2 \newline + 0 & 6\times 10^7 y_2 & 0 +\end{array} +\right ) +\]
+

start with \(y_1(0) = 1, y_2(0) = y_3(0) = 0\). Long term behavior is \(y_1, y_2 \rightarrow 0; y_3 \rightarrow 1\)

+
+
+
def rhs(t, Y):
+    """ RHS of the system -- using 0-based indexing """
+    y1 = Y[0]
+    y2 = Y[1]
+    y3 = Y[2]
+
+    dy1dt = -0.04*y1 + 1.e4*y2*y3
+    dy2dt =  0.04*y1 - 1.e4*y2*y3 - 3.e7*y2**2
+    dy3dt =                         3.e7*y2**2
+
+    return np.array([dy1dt, dy2dt, dy3dt])
+
+def jac(t, Y):
+    """ J_{i,j} = df_i/dy_j """
+
+    y1 = Y[0]
+    y2 = Y[1]
+    y3 = Y[2]
+
+    df1dy1 = -0.04
+    df1dy2 = 1.e4*y3
+    df1dy3 = 1.e4*y2
+
+    df2dy1 = 0.04
+    df2dy2 = -1.e4*y3 - 6.e7*y2
+    df2dy3 = -1.e4*y2
+
+    df3dy1 = 0.0
+    df3dy2 = 6.e7*y2
+    df3dy3 = 0.0
+
+    return np.array([ [ df1dy1, df1dy2, df1dy3 ],
+                      [ df2dy1, df2dy2, df2dy3 ],
+                      [ df3dy1, df3dy2, df3dy3 ] ])
+
+
+
+
+
+
+
def vode_integrate(Y0, tmax):
+    """ integrate using the NDF method """
+
+    r = integrate.solve_ivp(rhs, (0.0, tmax), Y0,
+                            method="BDF", jac=jac, rtol=1.e-7, atol=1.e-10)
+
+    # Note: this solver does not have a dens_output method, instead we 
+    # access the solution data where it was evaluated internally via
+    # the return object
+    print(r)
+    return r.t, r.y
+
+
+
+
+
+
+
Y0 = np.array([1.0, 0.0, 0.0])
+tmax = 4.e7
+
+ts, Ys = vode_integrate(Y0, tmax)
+
+fig, ax = plt.subplots()
+ax.loglog(ts, Ys[0,:], label=r"$y_1$")
+ax.loglog(ts, Ys[1,:], label=r"$y_2$")
+ax.loglog(ts, Ys[2,:], label=r"$y_3$")
+
+ax.legend(loc="best", frameon=False)
+ax.set_xlabel("time")
+
+
+
+
+
  message: The solver successfully reached the end of the integration interval.
+  success: True
+   status: 0
+        t: [ 0.000e+00  3.196e-07 ...  3.894e+07  4.000e+07]
+        y: [[ 1.000e+00  1.000e+00 ...  5.344e-05  5.203e-05]
+            [ 0.000e+00  1.278e-08 ...  2.138e-10  2.081e-10]
+            [ 0.000e+00  1.323e-15 ...  9.999e-01  9.999e-01]]
+      sol: None
+ t_events: None
+ y_events: None
+     nfev: 2029
+     njev: 12
+      nlu: 130
+
+
+
Text(0.5, 0, 'time')
+
+
+the time-evolution of the species on a log scale +
+
+
+
+
sol
+
+
+
+
+
---------------------------------------------------------------------------
+NameError                                 Traceback (most recent call last)
+Cell In[48], line 1
+----> 1 sol
+
+NameError: name 'sol' is not defined
+
+
+
+
+
+

try it

+

Redo this integration, but now use the RK45 solver instead of BDF. Does it work?

+

You may need to use the kernel menu in Jupyter to interrupt the kernel if you get impatient.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-basics.html.backup b/05-scipy/scipy-basics.html.backup new file mode 100644 index 00000000..75b48986 --- /dev/null +++ b/05-scipy/scipy-basics.html.backup @@ -0,0 +1,2259 @@ + + + + + + + + + + + SciPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

SciPy#

+

SciPy is a collection of numerical algorithms with python interfaces. In many cases, these interfaces are wrappers around standard numerical libraries that have been developed in the community and are used with other languages. Usually detailed references are available to explain the implementation.

+
+

Note

+

There are many subpackages generally, you load the subpackages separately, e.g.

+
from scipy import linalg, optimize
+
+
+

then you have access to the methods in those namespaces

+
+
+

Important

+

One thing to keep in mind—all numerical methods have strengths and weaknesses, and make assumptions. You should always do some research into the method to understand what it is doing.

+
+
+

Tip

+

It is also always a good idea to run a new method on some test where you know the answer, to make sure it is behaving as expected.

+
+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Integration#

+

we’ll do some integrals of the form

+
+\[I = \int_a^b f(x) dx\]
+

We can imagine two situations:

+
    +
  • our function \(f(x)\) is given by an analytic expression. This gives us the freedom to pick our integration points, and in general can allow us to optimize our result and get high accuracy

  • +
  • our function \(f(x)\) is defined on at a set of (possibly regular spaced) points.

  • +
+
+

Note

+

In numerical analysis, the term quadrature is used to describe any integration method that represents the integral as the weighted sum of a discrete number of points.

+
+
+
+
from scipy import integrate
+#help(integrate)
+
+
+
+
+

Let’s consider integrating

+
+\[I = \int_0^{2\pi} \sin^2(x) dx\]
+

quad() is the basic integrator for a general (not sampled) function. It uses a general-interface from the Fortran package QUADPACK (QAGS or QAGI). It will return the integral in an interval and an estimate of the error in the approximation

+
+
+
def f(x):
+    return np.sin(x)**2
+
+
+
+
+
+
+
help(integrate.quad)
+
+
+
+
+
Help on function quad in module scipy.integrate._quadpack_py:
+
+quad(
+    func,
+    a,
+    b,
+    args=(),
+    full_output=0,
+    epsabs=1.49e-08,
+    epsrel=1.49e-08,
+    limit=50,
+    points=None,
+    weight=None,
+    wvar=None,
+    wopts=None,
+    maxp1=50,
+    limlst=50,
+    complex_func=False
+)
+    Compute a definite integral.
+
+    Integrate func from `a` to `b` (possibly infinite interval) using a
+    technique from the Fortran library QUADPACK.
+
+    Parameters
+    ----------
+    func : {function, scipy.LowLevelCallable}
+        A Python function or method to integrate. If `func` takes many
+        arguments, it is integrated along the axis corresponding to the
+        first argument.
+
+        If the user desires improved integration performance, then `f` may
+        be a `scipy.LowLevelCallable` with one of the signatures::
+
+            double func(double x)
+            double func(double x, void *user_data)
+            double func(int n, double *xx)
+            double func(int n, double *xx, void *user_data)
+
+        The ``user_data`` is the data contained in the `scipy.LowLevelCallable`.
+        In the call forms with ``xx``,  ``n`` is the length of the ``xx``
+        array which contains ``xx[0] == x`` and the rest of the items are
+        numbers contained in the ``args`` argument of quad.
+
+        In addition, certain ctypes call signatures are supported for
+        backward compatibility, but those should not be used in new code.
+    a : float
+        Lower limit of integration (use -numpy.inf for -infinity).
+    b : float
+        Upper limit of integration (use numpy.inf for +infinity).
+    args : tuple, optional
+        Extra arguments to pass to `func`.
+    full_output : int, optional
+        Non-zero to return a dictionary of integration information.
+        If non-zero, warning messages are also suppressed and the
+        message is appended to the output tuple.
+    complex_func : bool, optional
+        Indicate if the function's (`func`) return type is real
+        (``complex_func=False``: default) or complex (``complex_func=True``).
+        In both cases, the function's argument is real.
+        If full_output is also non-zero, the `infodict`, `message`, and
+        `explain` for the real and complex components are returned in
+        a dictionary with keys "real output" and "imag output".
+
+    Returns
+    -------
+    y : float
+        The integral of func from `a` to `b`.
+    abserr : float
+        An estimate of the absolute error in the result.
+    infodict : dict
+        A dictionary containing additional information.
+    message
+        A convergence message.
+    explain
+        Appended only with 'cos' or 'sin' weighting and infinite
+        integration limits, it contains an explanation of the codes in
+        infodict['ierlst']
+
+    Other Parameters
+    ----------------
+    epsabs : float or int, optional
+        Absolute error tolerance. Default is 1.49e-8. `quad` tries to obtain
+        an accuracy of ``abs(i-result) <= max(epsabs, epsrel*abs(i))``
+        where ``i`` = integral of `func` from `a` to `b`, and ``result`` is the
+        numerical approximation. See `epsrel` below.
+    epsrel : float or int, optional
+        Relative error tolerance. Default is 1.49e-8.
+        If ``epsabs <= 0``, `epsrel` must be greater than both 5e-29
+        and ``50 * (machine epsilon)``. See `epsabs` above.
+    limit : float or int, optional
+        An upper bound on the number of subintervals used in the adaptive
+        algorithm.
+    points : (sequence of floats,ints), optional
+        A sequence of break points in the bounded integration interval
+        where local difficulties of the integrand may occur (e.g.,
+        singularities, discontinuities). The sequence does not have
+        to be sorted. Note that this option cannot be used in conjunction
+        with ``weight``.
+    weight : float or int, optional
+        String indicating weighting function. Full explanation for this
+        and the remaining arguments can be found below.
+    wvar : optional
+        Variables for use with weighting functions.
+    wopts : optional
+        Optional input for reusing Chebyshev moments.
+    maxp1 : float or int, optional
+        An upper bound on the number of Chebyshev moments.
+    limlst : int, optional
+        Upper bound on the number of cycles (>=3) for use with a sinusoidal
+        weighting and an infinite end-point.
+
+    See Also
+    --------
+
+    :func:`dblquad`
+        double integral
+    :func:`tplquad`
+        triple integral
+    :func:`nquad`
+        n-dimensional integrals (uses `quad` recursively)
+    :func:`fixed_quad`
+        fixed-order Gaussian quadrature
+    :func:`simpson`
+        integrator for sampled data
+    :func:`romb`
+        integrator for sampled data
+    :func:`scipy.special`
+        for coefficients and roots of orthogonal polynomials
+
+
+    Notes
+    -----
+    For valid results, the integral must converge; behavior for divergent
+    integrals is not guaranteed.
+
+    **Extra information for quad() inputs and outputs**
+
+    If full_output is non-zero, then the third output argument
+    (infodict) is a dictionary with entries as tabulated below. For
+    infinite limits, the range is transformed to (0,1) and the
+    optional outputs are given with respect to this transformed range.
+    Let M be the input argument limit and let K be infodict['last'].
+    The entries are:
+
+    'neval'
+        The number of function evaluations.
+    'last'
+        The number, K, of subintervals produced in the subdivision process.
+    'alist'
+        A rank-1 array of length M, the first K elements of which are the
+        left end points of the subintervals in the partition of the
+        integration range.
+    'blist'
+        A rank-1 array of length M, the first K elements of which are the
+        right end points of the subintervals.
+    'rlist'
+        A rank-1 array of length M, the first K elements of which are the
+        integral approximations on the subintervals.
+    'elist'
+        A rank-1 array of length M, the first K elements of which are the
+        moduli of the absolute error estimates on the subintervals.
+    'iord'
+        A rank-1 integer array of length M, the first L elements of
+        which are pointers to the error estimates over the subintervals
+        with ``L=K`` if ``K<=M/2+2`` or ``L=M+1-K`` otherwise. Let I be the
+        sequence ``infodict['iord']`` and let E be the sequence
+        ``infodict['elist']``.  Then ``E[I[1]], ..., E[I[L]]`` forms a
+        decreasing sequence.
+
+    If the input argument points is provided (i.e., it is not None),
+    the following additional outputs are placed in the output
+    dictionary. Assume the points sequence is of length P.
+
+    'pts'
+        A rank-1 array of length P+2 containing the integration limits
+        and the break points of the intervals in ascending order.
+        This is an array giving the subintervals over which integration
+        will occur.
+    'level'
+        A rank-1 integer array of length M (=limit), containing the
+        subdivision levels of the subintervals, i.e., if (aa,bb) is a
+        subinterval of ``(pts[1], pts[2])`` where ``pts[0]`` and ``pts[2]``
+        are adjacent elements of ``infodict['pts']``, then (aa,bb) has level l
+        if ``|bb-aa| = |pts[2]-pts[1]| * 2**(-l)``.
+    'ndin'
+        A rank-1 integer array of length P+2. After the first integration
+        over the intervals (pts[1], pts[2]), the error estimates over some
+        of the intervals may have been increased artificially in order to
+        put their subdivision forward. This array has ones in slots
+        corresponding to the subintervals for which this happens.
+
+    **Weighting the integrand**
+
+    The input variables, *weight* and *wvar*, are used to weight the
+    integrand by a select list of functions. Different integration
+    methods are used to compute the integral with these weighting
+    functions, and these do not support specifying break points. The
+    possible values of weight and the corresponding weighting functions are.
+
+    ==========  ===================================   =====================
+    ``weight``  Weight function used                  ``wvar``
+    ==========  ===================================   =====================
+    'cos'       cos(w*x)                              wvar = w
+    'sin'       sin(w*x)                              wvar = w
+    'alg'       g(x) = ((x-a)**alpha)*((b-x)**beta)   wvar = (alpha, beta)
+    'alg-loga'  g(x)*log(x-a)                         wvar = (alpha, beta)
+    'alg-logb'  g(x)*log(b-x)                         wvar = (alpha, beta)
+    'alg-log'   g(x)*log(x-a)*log(b-x)                wvar = (alpha, beta)
+    'cauchy'    1/(x-c)                               wvar = c
+    ==========  ===================================   =====================
+
+    wvar holds the parameter w, (alpha, beta), or c depending on the weight
+    selected. In these expressions, a and b are the integration limits.
+
+    For the 'cos' and 'sin' weighting, additional inputs and outputs are
+    available.
+
+    For weighted integrals with finite integration limits, the integration
+    is performed using a Clenshaw-Curtis method, which uses Chebyshev moments.
+    For repeated calculations, these moments are saved in the output dictionary:
+
+    'momcom'
+        The maximum level of Chebyshev moments that have been computed,
+        i.e., if ``M_c`` is ``infodict['momcom']`` then the moments have been
+        computed for intervals of length ``|b-a| * 2**(-l)``,
+        ``l=0,1,...,M_c``.
+    'nnlog'
+        A rank-1 integer array of length M(=limit), containing the
+        subdivision levels of the subintervals, i.e., an element of this
+        array is equal to l if the corresponding subinterval is
+        ``|b-a|* 2**(-l)``.
+    'chebmo'
+        A rank-2 array of shape (25, maxp1) containing the computed
+        Chebyshev moments. These can be passed on to an integration
+        over the same interval by passing this array as the second
+        element of the sequence wopts and passing infodict['momcom'] as
+        the first element.
+
+    If one of the integration limits is infinite, then a Fourier integral is
+    computed (assuming w neq 0). If full_output is 1 and a numerical error
+    is encountered, besides the error message attached to the output tuple,
+    a dictionary is also appended to the output tuple which translates the
+    error codes in the array ``info['ierlst']`` to English messages. The
+    output information dictionary contains the following entries instead of
+    'last', 'alist', 'blist', 'rlist', and 'elist':
+
+    'lst'
+        The number of subintervals needed for the integration (call it ``K_f``).
+    'rslst'
+        A rank-1 array of length M_f=limlst, whose first ``K_f`` elements
+        contain the integral contribution over the interval
+        ``(a+(k-1)c, a+kc)`` where ``c = (2*floor(|w|) + 1) * pi / |w|``
+        and ``k=1,2,...,K_f``.
+    'erlst'
+        A rank-1 array of length ``M_f`` containing the error estimate
+        corresponding to the interval in the same position in
+        ``infodict['rslist']``.
+    'ierlst'
+        A rank-1 integer array of length ``M_f`` containing an error flag
+        corresponding to the interval in the same position in
+        ``infodict['rslist']``.  See the explanation dictionary (last entry
+        in the output tuple) for the meaning of the codes.
+
+    **Details of QUADPACK level routines**
+
+    `quad` calls routines from the FORTRAN library QUADPACK. This section
+    provides details on the conditions for each routine to be called and a
+    short description of each routine. The routine called depends on
+    `weight`, `points` and the integration limits `a` and `b`.
+
+    ================  ==============  ==========  =====================
+    QUADPACK routine  `weight`        `points`    infinite bounds
+    ================  ==============  ==========  =====================
+    qagse             None            No          No
+    qagie             None            No          Yes
+    qagpe             None            Yes         No
+    qawoe             'sin', 'cos'    No          No
+    qawfe             'sin', 'cos'    No          either `a` or `b`
+    qawse             'alg*'          No          No
+    qawce             'cauchy'        No          No
+    ================  ==============  ==========  =====================
+
+    The following provides a short description from [1]_ for each
+    routine.
+
+    qagse
+        is an integrator based on globally adaptive interval
+        subdivision in connection with extrapolation, which will
+        eliminate the effects of integrand singularities of
+        several types. The integration is performed using a 21-point Gauss-Kronrod
+        quadrature within each subinterval.
+    qagie
+        handles integration over infinite intervals. The infinite range is
+        mapped onto a finite interval and subsequently the same strategy as
+        in ``QAGS`` is applied.
+    qagpe
+        serves the same purposes as QAGS, but also allows the
+        user to provide explicit information about the location
+        and type of trouble-spots i.e. the abscissae of internal
+        singularities, discontinuities and other difficulties of
+        the integrand function.
+    qawoe
+        is an integrator for the evaluation of
+        :math:`\int^b_a \cos(\omega x)f(x)dx` or
+        :math:`\int^b_a \sin(\omega x)f(x)dx`
+        over a finite interval [a,b], where :math:`\omega` and :math:`f`
+        are specified by the user. The rule evaluation component is based
+        on the modified Clenshaw-Curtis technique
+
+        An adaptive subdivision scheme is used in connection
+        with an extrapolation procedure, which is a modification
+        of that in ``QAGS`` and allows the algorithm to deal with
+        singularities in :math:`f(x)`.
+    qawfe
+        calculates the Fourier transform
+        :math:`\int^\infty_a \cos(\omega x)f(x)dx` or
+        :math:`\int^\infty_a \sin(\omega x)f(x)dx`
+        for user-provided :math:`\omega` and :math:`f`. The procedure of
+        ``QAWO`` is applied on successive finite intervals, and convergence
+        acceleration by means of the :math:`\varepsilon`-algorithm is applied
+        to the series of integral approximations.
+    qawse
+        approximate :math:`\int^b_a w(x)f(x)dx`, with :math:`a < b` where
+        :math:`w(x) = (x-a)^{\alpha}(b-x)^{\beta}v(x)` with
+        :math:`\alpha,\beta > -1`, where :math:`v(x)` may be one of the
+        following functions: :math:`1`, :math:`\log(x-a)`, :math:`\log(b-x)`,
+        :math:`\log(x-a)\log(b-x)`.
+
+        The user specifies :math:`\alpha`, :math:`\beta` and the type of the
+        function :math:`v`. A globally adaptive subdivision strategy is
+        applied, with modified Clenshaw-Curtis integration on those
+        subintervals which contain `a` or `b`.
+    qawce
+        compute :math:`\int^b_a f(x) / (x-c)dx` where the integral must be
+        interpreted as a Cauchy principal value integral, for user specified
+        :math:`c` and :math:`f`. The strategy is globally adaptive. Modified
+        Clenshaw-Curtis integration is used on those intervals containing the
+        point :math:`x = c`.
+
+    **Integration of Complex Function of a Real Variable**
+
+    A complex valued function, :math:`f`, of a real variable can be written as
+    :math:`f = g + ih`.  Similarly, the integral of :math:`f` can be
+    written as
+
+    .. math::
+        \int_a^b f(x) dx = \int_a^b g(x) dx + i\int_a^b h(x) dx
+
+    assuming that the integrals of :math:`g` and :math:`h` exist
+    over the interval :math:`[a,b]` [2]_. Therefore, ``quad`` integrates
+    complex-valued functions by integrating the real and imaginary components
+    separately.
+
+    **Array API Standard Support**
+
+    `quad` has experimental support for Python Array API Standard compatible
+    backends in addition to NumPy. Please consider testing these features
+    by setting an environment variable ``SCIPY_ARRAY_API=1`` and providing
+    CuPy, PyTorch, JAX, or Dask arrays as array arguments. The following
+    combinations of backend and device (or other capability) are supported.
+
+    ====================  ====================  ====================
+    Library               CPU                   GPU
+    ====================  ====================  ====================
+    NumPy                 ✅                     n/a
+    CuPy                  n/a                   ⛔
+    PyTorch               ⛔                     ⛔
+    JAX                   ⛔                     ⛔
+    Dask                  ⛔                     n/a
+    ====================  ====================  ====================
+
+        See :ref:`dev-arrayapi` for more information.
+
+    References
+    ----------
+    .. [1] Piessens, Robert; de Doncker-Kapenga, Elise;
+           Überhuber, Christoph W.; Kahaner, David (1983).
+           QUADPACK: A subroutine package for automatic integration.
+           Springer-Verlag.
+           ISBN 978-3-540-12553-2.
+
+    .. [2] McCullough, Thomas; Phillips, Keith (1973).
+           Foundations of Analysis in the Complex Plane.
+           Holt Rinehart Winston.
+           ISBN 0-03-086370-8
+
+    Examples
+    --------
+    Calculate :math:`\int^4_0 x^2 dx` and compare with an analytic result
+
+    >>> from scipy import integrate
+    >>> import numpy as np
+    >>> x2 = lambda x: x**2
+    >>> integrate.quad(x2, 0, 4)
+    (21.333333333333332, 2.3684757858670003e-13)
+    >>> print(4**3 / 3.)  # analytical result
+    21.3333333333
+
+    Calculate :math:`\int^\infty_0 e^{-x} dx`
+
+    >>> invexp = lambda x: np.exp(-x)
+    >>> integrate.quad(invexp, 0, np.inf)
+    (1.0, 5.842605999138044e-11)
+
+    Calculate :math:`\int^1_0 a x \,dx` for :math:`a = 1, 3`
+
+    >>> f = lambda x, a: a*x
+    >>> y, err = integrate.quad(f, 0, 1, args=(1,))
+    >>> y
+    0.5
+    >>> y, err = integrate.quad(f, 0, 1, args=(3,))
+    >>> y
+    1.5
+
+    Calculate :math:`\int^1_0 x^2 + y^2 dx` with ctypes, holding
+    y parameter as 1::
+
+        testlib.c =>
+            double func(int n, double args[n]){
+                return args[0]*args[0] + args[1]*args[1];}
+        compile to library testlib.*
+
+    ::
+
+       from scipy import integrate
+       import ctypes
+       lib = ctypes.CDLL('/home/.../testlib.*') #use absolute path
+       lib.func.restype = ctypes.c_double
+       lib.func.argtypes = (ctypes.c_int,ctypes.c_double)
+       integrate.quad(lib.func,0,1,(1))
+       #(1.3333333333333333, 1.4802973661668752e-14)
+       print((1.0**3/3.0 + 1.0) - (0.0**3/3.0 + 0.0)) #Analytic result
+       # 1.3333333333333333
+
+    Be aware that pulse shapes and other sharp features as compared to the
+    size of the integration interval may not be integrated correctly using
+    this method. A simplified example of this limitation is integrating a
+    y-axis reflected step function with many zero values within the integrals
+    bounds.
+
+    >>> y = lambda x: 1 if x<=0 else 0
+    >>> integrate.quad(y, -1, 1)
+    (1.0, 1.1102230246251565e-14)
+    >>> integrate.quad(y, -1, 100)
+    (1.0000000002199108, 1.0189464580163188e-08)
+    >>> integrate.quad(y, -1, 10000)
+    (0.0, 0.0)
+
+
+
+
+

quad will return the integral and an estimate of the error. We can seek more accuracy by setting epsabs and epsrel, +but remember that we can’t do better than roundoff error.

+
+
+
I, err = integrate.quad(f, 0.0, 2.0*np.pi, epsabs=1.e-16, epsrel=1.e-16)
+print(I)
+print(err)
+
+
+
+
+
3.141592653589793
+3.4878684980086318e-15
+
+
+
/tmp/ipykernel_3232/932417219.py:1: IntegrationWarning: The occurrence of roundoff error is detected, which prevents 
+  the requested tolerance from being achieved.  The error may be 
+  underestimated.
+  I, err = integrate.quad(f, 0.0, 2.0*np.pi, epsabs=1.e-16, epsrel=1.e-16)
+
+
+
+
+
+
+
#help(integrate.quad)
+
+
+
+
+
+

Additional arguments#

+

Sometimes our integrand function takes optional arguments. Let’s consider integrating

+
+\[g(x) = A e^{-(x/\sigma)^2}\]
+

now we want to be able to define the amplitude, \(A\), and width, \(\sigma\) as part of the function.

+
+
+
def g(x, A, sigma):
+    return A*np.exp(-x**2/sigma**2)
+
+
+
+
+
+
+
I, err = integrate.quad(g, -1.0, 1.0, args=(1.0, 2.0))
+print(I, err)
+
+
+
+
+
1.8451240256511698 2.0484991765669867e-14
+
+
+
+
+
+
+

Integrating to infinity#

+

numpy defines the inf quantity which can be used in the integration limits. We can integrate a Gaussian over \([-\infty, \infty]\) (we know the answer +is \(\sqrt{\pi}\)).

+
+

Note

+

Behind the scenes, what the integration function does is do a variable transform like: \(t = x/(c +x)\). This works when one limit is \(\infty\), giving, e.g.,

+
+\[\int_a^\infty f(x) dx = c \int_{a/(c + a)}^1 f\left (c\frac{t}{1-t}\right) (1 - t)^{-2} dt\]
+
+
+
+
I, err = integrate.quad(g, -np.inf, np.inf, args=(1.0, 1.0))
+print(I, err)
+
+
+
+
+
1.7724538509055159 1.4202636780944923e-08
+
+
+
+
+
+
+

Multidimensional integrals#

+

Multidimensional integration can be done with successive calls to quad(), but there are wrappers that help

+

Let’s compute

+
+\[I = \int_{y=0}^{1/2} \int_{x=0}^{1-2y} xy dxdy = \frac{1}{96}\]
+

(this example comes from the SciPy tutorial)

+

Notice that the limits of integration in \(x\) depend on \(y\). This means that we need to do the \(x\) +integration first, which gives:

+
+\[I = \int_{y=0}^{1/2} \int_{x=0}^{1-2y} xy \,dxdy = \frac{1}{2} \int_{y=0}^{1/2} y \left [ x^2 \right |_0^{1-2y} dy = \frac{1}{2} \int_0^{1/2} (1-2y)^2 y \, dy = \frac{1}{96}\]
+

Note the form of the function:

+
dblquad(f, a, b, xlo, xhi)
+
+
+

where f = f(y, x) – the y argument is first to indicate that the \(y\) integration is done first and +then the \(x\) and \([a, b]\) are the limits of the \(x\) integration. We want the opposite in this example, +so we’ll switch the meaning of \(x\) and \(y\) in our example below.

+

The integral will be from: \(y = [0, 1/2]\), and \(x\) = xlo(y), \(x\) = xhi(y)

+
+
+
def integrand(x, y):
+    return x*y
+
+def x_lower_lim(y):
+    return 0
+    
+def x_upper_lim(y):
+    return 1-2*y
+
+# we change the definitions of x and y in this call
+I, err = integrate.dblquad(integrand, 0.0, 0.5, x_lower_lim, x_upper_lim)
+print(I, 1.0/I)
+
+
+
+
+
0.010416666666666668 95.99999999999999
+
+
+
+
+

If you remember the python lambda functions (one expression functions), you can do this more compactly:

+
+
+
I, err = integrate.dblquad(lambda x, y: x*y, 0.0, 0.5, lambda y: 0, lambda y: 1-2*y)
+print(I)
+
+
+
+
+
0.010416666666666668
+
+
+
+
+
+
+

Integration of a sampled function#

+

Here we integrate a function that is defined only at a sequence of points. A popular method +is Simpson’s rule which fits a parabola to 3 consecutive points +and integrates under the parabola.

+

Let’s compute

+
+\[I = \int_0^{2\pi} f(x_i) dx\]
+

with \(x_i = 0, \ldots, 2\pi\) defined at \(N\) points

+
+
+
N = 17
+x = np.linspace(0.0, 2.0*np.pi, N, endpoint=True)
+y = np.sin(x)**2
+
+I = integrate.simpson(y, x=x)
+print(I)
+
+
+
+
+
3.141592653589793
+
+
+
+
+

Romberg integration is specific to equally-spaced samples, where \(N = 2^k + 1\) and can be more converge faster (it uses extrapolation of coarser integration results to achieve higher accuracy)

+
+
+
N = 17
+x = np.linspace(0.0, 2.0*np.pi, N, endpoint=True)
+y = np.sin(x)**2
+
+I = integrate.romb(y, dx=x[1]-x[0])
+print(I)
+
+
+
+
+
3.1430658353300385
+
+
+
+
+
+
+
+

Interpolation#

+

Interpolation fills in the gaps between a discrete number of points by making an assumption about the behavior of the functional form of the data.

+

Many different types of interpolation exist

+
    +
  • some ensure no new extrema are introduced

  • +
  • some conserve the quantity being interpolated

  • +
  • some match derivative at end points

  • +
+
+

Caution

+

Pathologies exist—it is not always best to use a high-order polynomial to pass through all of the points in your dataset.

+
+

The interp1d() function allows for a variety of 1-d interpolation methods. It returns an object that acts as a function, which can be evaluated at any point.

+
+
+
import scipy.interpolate as interpolate
+
+
+
+
+
+
+
#help(interpolate.interp1d)
+
+
+
+
+

Let’s sample

+
+\[f(x) = x \sin(x)\]
+

and try to interpolate it.

+
+
+
def f_exact(x):
+    return np.sin(x)*x
+
+
+
+
+
+
+
N = 10
+x = np.linspace(0, 20, N)
+
+y = f_exact(x)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+
+x_fine = np.linspace(0, 20, 10*N)
+
+ax.scatter(x, y)
+ax.plot(x_fine, f_exact(x_fine), ls=":", label="original function")
+# alt-text: a figure showing data points and an interpolant passing through them
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fc65d190ec0>]
+
+
+../_images/3ac4d61e01e4ad2f40fe01f62e57bd76a174429d7c754b847618ee8a04974bc3.png +
+
+

When we create an interpolant via interp1d, it creates a function object

+
+
+
help(interpolate.interp1d)
+
+
+
+
+
Help on class interp1d in module scipy.interpolate._interpolate:
+
+class interp1d(scipy.interpolate._polyint._Interpolator1D)
+ |  interp1d(
+ |      x,
+ |      y,
+ |      kind='linear',
+ |      axis=-1,
+ |      copy=True,
+ |      bounds_error=None,
+ |      fill_value=nan,
+ |      assume_sorted=False
+ |  )
+ |
+ |  Interpolate a 1-D function (legacy).
+ |
+ |  .. legacy:: class
+ |
+ |      For a guide to the intended replacements for `interp1d` see
+ |      :ref:`tutorial-interpolate_1Dsection`.
+ |
+ |  `x` and `y` are arrays of values used to approximate some function f:
+ |  ``y = f(x)``. This class returns a function whose call method uses
+ |  interpolation to find the value of new points.
+ |
+ |  Parameters
+ |  ----------
+ |  x : (npoints, ) array_like
+ |      A 1-D array of real values.
+ |  y : (..., npoints, ...) array_like
+ |      An N-D array of real values. The length of `y` along the interpolation
+ |      axis must be equal to the length of `x`. Use the ``axis`` parameter
+ |      to select correct axis. Unlike other interpolators, the default
+ |      interpolation axis is the last axis of `y`.
+ |  kind : str or int, optional
+ |      Specifies the kind of interpolation as a string or as an integer
+ |      specifying the order of the spline interpolator to use.
+ |      The string has to be one of 'linear', 'nearest', 'nearest-up', 'zero',
+ |      'slinear', 'quadratic', 'cubic', 'previous', or 'next'. 'zero',
+ |      'slinear', 'quadratic' and 'cubic' refer to a spline interpolation of
+ |      zeroth, first, second or third order; 'previous' and 'next' simply
+ |      return the previous or next value of the point; 'nearest-up' and
+ |      'nearest' differ when interpolating half-integers (e.g. 0.5, 1.5)
+ |      in that 'nearest-up' rounds up and 'nearest' rounds down. Default
+ |      is 'linear'.
+ |  axis : int, optional
+ |      Axis in the ``y`` array corresponding to the x-coordinate values. Unlike
+ |      other interpolators, defaults to ``axis=-1``.
+ |  copy : bool, optional
+ |      If ``True``, the class makes internal copies of x and y. If ``False``,
+ |      references to ``x`` and ``y`` are used if possible. The default is to copy.
+ |  bounds_error : bool, optional
+ |      If True, a ValueError is raised any time interpolation is attempted on
+ |      a value outside of the range of x (where extrapolation is
+ |      necessary). If False, out of bounds values are assigned `fill_value`.
+ |      By default, an error is raised unless ``fill_value="extrapolate"``.
+ |  fill_value : array-like or (array-like, array_like) or "extrapolate", optional
+ |      - if a ndarray (or float), this value will be used to fill in for
+ |        requested points outside of the data range. If not provided, then
+ |        the default is NaN. The array-like must broadcast properly to the
+ |        dimensions of the non-interpolation axes.
+ |      - If a two-element tuple, then the first element is used as a
+ |        fill value for ``x_new < x[0]`` and the second element is used for
+ |        ``x_new > x[-1]``. Anything that is not a 2-element tuple (e.g.,
+ |        list or ndarray, regardless of shape) is taken to be a single
+ |        array-like argument meant to be used for both bounds as
+ |        ``below, above = fill_value, fill_value``. Using a two-element tuple
+ |        or ndarray requires ``bounds_error=False``.
+ |
+ |        .. versionadded:: 0.17.0
+ |      - If "extrapolate", then points outside the data range will be
+ |        extrapolated.
+ |
+ |        .. versionadded:: 0.17.0
+ |  assume_sorted : bool, optional
+ |      If False, values of `x` can be in any order and they are sorted first.
+ |      If True, `x` has to be an array of monotonically increasing values.
+ |
+ |  Attributes
+ |  ----------
+ |  fill_value
+ |
+ |  Methods
+ |  -------
+ |  __call__
+ |
+ |  See Also
+ |  --------
+ |
+ |  :func:`splrep`, :func:`splev`
+ |      Spline interpolation/smoothing based on FITPACK.
+ |  :func:`UnivariateSpline`
+ |      An object-oriented wrapper of the FITPACK routines.
+ |  :func:`interp2d`
+ |      2-D interpolation
+ |
+ |
+ |  Notes
+ |  -----
+ |  Calling `interp1d` with NaNs present in input values results in
+ |  undefined behaviour.
+ |
+ |  Input values `x` and `y` must be convertible to `float` values like
+ |  `int` or `float`.
+ |
+ |  If the values in `x` are not unique, the resulting behavior is
+ |  undefined and specific to the choice of `kind`, i.e., changing
+ |  `kind` will change the behavior for duplicates.
+ |
+ |  **Array API Standard Support**
+ |
+ |  `interp1d` is not in-scope for support of Python Array API Standard compatible
+ |  backends other than NumPy.
+ |
+ |  See :ref:`dev-arrayapi` for more information.
+ |
+ |
+ |  Examples
+ |  --------
+ |  >>> import numpy as np
+ |  >>> import matplotlib.pyplot as plt
+ |  >>> from scipy import interpolate
+ |  >>> x = np.arange(0, 10)
+ |  >>> y = np.exp(-x/3.0)
+ |  >>> f = interpolate.interp1d(x, y)
+ |
+ |  >>> xnew = np.arange(0, 9, 0.1)
+ |  >>> ynew = f(xnew)   # use interpolation function returned by `interp1d`
+ |  >>> plt.plot(x, y, 'o', xnew, ynew, '-')
+ |  >>> plt.show()
+ |
+ |  Method resolution order:
+ |      interp1d
+ |      scipy.interpolate._polyint._Interpolator1D
+ |      builtins.object
+ |
+ |  Methods defined here:
+ |
+ |  __init__(
+ |      self,
+ |      x,
+ |      y,
+ |      kind='linear',
+ |      axis=-1,
+ |      copy=True,
+ |      bounds_error=None,
+ |      fill_value=nan,
+ |      assume_sorted=False
+ |  )
+ |      Initialize a 1-D linear interpolation class.
+ |
+ |  ----------------------------------------------------------------------
+ |  Data descriptors defined here:
+ |
+ |  __dict__
+ |      dictionary for instance variables
+ |
+ |  __weakref__
+ |      list of weak references to the object
+ |
+ |  fill_value
+ |      The fill value.
+ |
+ |  ----------------------------------------------------------------------
+ |  Methods inherited from scipy.interpolate._polyint._Interpolator1D:
+ |
+ |  __call__(self, x)
+ |      Evaluate the interpolant
+ |
+ |      Parameters
+ |      ----------
+ |      x : array_like
+ |          Point or points at which to evaluate the interpolant.
+ |
+ |      Returns
+ |      -------
+ |      y : array_like
+ |          Interpolated values. Shape is determined by replacing
+ |          the interpolation axis in the original array with the shape of `x`.
+ |
+ |      Notes
+ |      -----
+ |      Input values `x` must be convertible to `float` values like `int`
+ |      or `float`.
+ |
+ |  ----------------------------------------------------------------------
+ |  Class methods inherited from scipy.interpolate._polyint._Interpolator1D:
+ |
+ |  __class_getitem__ = GenericAlias(args, /)
+ |      Represent a PEP 585 generic type
+ |
+ |      E.g. for t = list[int], t.__origin__ is list and t.__args__ is (int,).
+ |
+ |  ----------------------------------------------------------------------
+ |  Data descriptors inherited from scipy.interpolate._polyint._Interpolator1D:
+ |
+ |  dtype
+
+
+
+
+
+
+
f_interp = interpolate.interp1d(x, y, kind="nearest")
+
+
+
+
+
+
+
ax.plot(x_fine, f_interp(x_fine), label="nearest")
+
+ax.legend(frameon=False, loc="best")
+fig
+# alt-text: a figure showing data points, an interpolant to them, and the original function we sampled
+
+
+
+
+../_images/305ad536173a0f5f3b3b06bbf6bc11bdd8de0d3f90936a177d5398fc960a9523.png +
+
+
+

Multi-d interpolation#

+

Here’s an example of mult-d interpolation from the official tutorial.

+

First we define the “answer”—this is the true function that we will sample at a number of points and then try to use interpolation to recover

+
+
+
def func(x, y):
+    return x*(1-x)*np.cos(4*np.pi*x) * np.sin(4*np.pi*y**2)**2
+
+
+
+
+

We’ll use np.meshgrid() to create the two-dimensional rectangular grid of points were we define our data.

+
+
+
nx = 100
+ny = 200
+
+x = np.linspace(0, 1, nx)
+y = np.linspace(0, 1, ny)
+
+x, y = np.meshgrid(x, y, indexing="ij")
+
+
+
+
+

here’s what the exact function looks like—note that our function is defined in x,y, but imshow is meant for plotting an array, so the first index is the row. We take the transpose when plotting

+
+
+
fig, ax = plt.subplots()
+data = func(x, y)
+im = ax.imshow(data.T, extent=(0, 1, 0, 1), origin="lower")
+fig.colorbar(im, ax=ax)
+# alt-text: a heat-map figure showing a function with small-amplitude ripples
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc65cfe9400>
+
+
+../_images/7d75ee826cda9aea1c634d659e512abdd2e69cf123085dfb9f88fb2c0cb225a3.png +
+
+

Now we’ll coarsen it by taking only every 4th point

+
+
+
coarse = data[::4, ::4]
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+im = ax.imshow(coarse.T, extent=(0, 1, 0, 1), origin="lower")
+fig.colorbar(im, ax=ax)
+# alt-text: a heat-map showing coarsened representation of our function
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc65ced4d70>
+
+
+../_images/ff442053d64f0baf70c89195cd68af1f60dd275bdb42787829fb1b8bce9c50ec.png +
+
+

Let’s now use interpolation to try to recover the look of the original data.

+
+

Note

+

This is considered structured grid interpolation, and SciPy has the RegularGridInterpolator() class for this type of data.

+

If the data were unstructured, then you should explore griddata() instead.

+
+
+
+
from scipy import interpolate
+
+
+
+
+
+
+
x_coarse = np.linspace(0, 1, nx//4)
+y_coarse = np.linspace(0, 1, ny//4)
+
+interp = interpolate.RegularGridInterpolator((x_coarse, y_coarse), coarse, method="cubic")
+
+
+
+
+

Now interp() is a function that we can use to sample the coarsened data.

+

Now interpolate it onto the original grid

+
+
+
new_data = interp((x, y))
+new_data.shape
+
+
+
+
+
(100, 200)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+im = ax.imshow(new_data.T, extent=(0, 1, 0, 1), origin="lower")
+fig.colorbar(im, ax=ax)
+# alt-text: a heat-map showing the reconstructed function via interpolation
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc65cf37cb0>
+
+
+../_images/a087c096f127028aed4565dfdf3b10e2cdbd8048d1b2e886a77d05438f3f1ccb.png +
+
+

and let’s plot the difference

+
+
+
diff = new_data - data
+fig, ax = plt.subplots()
+im = ax.imshow(diff.T, origin="lower", extent=(0, 1, 0, 1))
+fig.colorbar(im, ax=ax)
+# alt-text: a heat-map showing the error in our interpolation.  It is better than 10%
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7fc659e32a50>
+
+
+../_images/7ced87012e88958170d22c7d32d41f0aef30708641631267b24dbafcc0cea420.png +
+
+
+
+
+

Root Finding#

+

Often we need to find a value of a variable that zeros a function – this is root finding. Sometimes, this is a multidimensional problem.

+

The brentq() method offers a very robust method for find roots from a scalar function. You do need to provide an interval that bounds the root.

+
+

Tip

+

It’s a good idea to plot the function, if you can, so you can learn how the function behaves +in the vicinity of a root (and how many roots there might be)

+
+

Let’s consider:

+

\(f(x) = \frac{x e^x}{e^x - 1} - 5\)

+
+
+
import scipy.optimize as optimize
+
+
+
+
+
+
+
def f(x):
+    return (x*np.exp(x)/(np.exp(x) - 1.0) - 5.0)
+
+
+
+
+
+
+
root, r = optimize.brentq(f, 0.1, 10.0, full_output=True)
+
+print(root)
+print(r.converged)
+
+
+
+
+
4.965114231744287
+True
+
+
+
+
+
+
+
x = np.linspace(0.1, 10.0, 1000)
+fig, ax = plt.subplots()
+ax.plot(x, f(x))
+ax.scatter(np.array([root]), np.array([f(root)]))
+ax.grid()
+# alt-text: a plot of our function with the root represented as a point
+
+
+
+
+../_images/347a411bd510f339f1112f612899e17cdfa2108351c56d6d11a840fd782f14a3.png +
+
+
+
+

ODEs#

+

Many methods exist for integrating ordinary differential equations. Most will want you to write your ODEs as a system of first order equations.

+

The Lorenz system is a very simple +model of convection in our atmosphere, but demonstrates the idea of chaos well.

+

This system of ODEs for the Lorenz system is:

+
+\[\frac{dx}{dt} = \sigma (y - x)\]
+
+\[\frac{dy}{dt} = rx - y - xz\]
+
+\[\frac{dz}{dt} = xy - bz\]
+

the steady states of this system correspond to:

+
+\[\begin{split}{\bf f}({\bf x}) = +\left ( +\begin{array}{c} +\sigma (y -x) \\ +rx - y -xz \\ +xy - bz +\end{array} +\right ) += 0\end{split}\]
+
+
+
# system parameters
+sigma = 10.0
+b = 8./3.
+r = 28.0
+
+def rhs(t, x):
+    xdot = sigma*(x[1] - x[0])
+    ydot = r*x[0] - x[1] - x[0]*x[2]
+    zdot = x[0]*x[1] - b*x[2]
+
+    return np.array([xdot, ydot, zdot])
+
+def jac(t, x):
+
+    return np.array(
+        [ [-sigma, sigma, 0.0], 
+          [r - x[2], -1.0, -x[0]],
+          [x[1], x[0], -b] ])
+
+def f(x):
+    return rhs(0.,x), jac(0.,x)
+
+
+
+
+

SciPy has a uniform interface to the different ODE solvers, solve_ivp()—we use that here.

+

These integrators will do error estimation along the way and adapt the stepsize to ensure that the accuracy +you request is met.

+
+
+
def ode_integrate(X0, dt, tmax):
+    """ integrate using the VODE method, storing the solution each dt """
+
+    r = integrate.solve_ivp(rhs, (0.0, tmax), X0,
+                            method="RK45", dense_output=True)
+
+    # get the solution at intermediate times
+    ts = np.arange(0.0, tmax, dt)
+    
+    Xs = r.sol(ts)
+    return ts, Xs
+
+
+
+
+
+

Tip

+

Execute

+
%matplotlib widget
+
+
+

in a cell before making this 3D plot and you will be able to interactively +rotate it in the notebook.

+

You may need to install the ipympl package first.

+
+
+
+
#%matplotlib widget
+
+
+
+
+
+
+
t, X = ode_integrate([1.0, 1.0, 20.0], 0.02, 30)
+from mpl_toolkits.mplot3d import Axes3D
+
+fig = plt.figure()
+ax = plt.axes(projection='3d')
+ax.plot(X[0,:], X[1,:], X[2,:])
+fig.set_size_inches(8.0,6.0)
+# alt-text: a 3D line plot of the solution -- it is dominated by two lobe-like structures
+
+
+
+
+../_images/3bbab2cf334619d5446d14b9b094fffa02575a671e25e11f45e798017d459c92.png +
+
+
+

try it

+

Rerun the integration, but change the initial conditions by 1 part in \(10^6\) for one of the components. +The make a plot of \(x\) vs. \(t\) comparing the solutions. You’ll see that the 2 solutions track well +for some time but then greatly diverged. This is the sensitivity to initial conditions that is the +hallmark of chaos.

+
+
+
+
X.shape
+
+
+
+
+
(3, 1500)
+
+
+
+
+
+
+
t2, X2 = ode_integrate([1.0001, 1.0, 20.0], 0.02, 30)
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+ax.plot(t, X[0, :])
+ax.plot(t2, X2[0, :])
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fc659c3a120>]
+
+
+../_images/322cfb210143811bf47e093b805dca424d6cd58597dbc66c9bf60ac3d2bffaa8.png +
+
+
+

Multi-variate root find#

+

We can find the steady points in this system by doing a multi-variate root find on the RHS vector

+
+
+
sol1 = optimize.root(f, [2., 2., 2.], jac=True)
+print(sol1.x)
+
+sol2 = optimize.root(f, [10., -10., 10.], jac=True)
+print(sol2.x)
+
+sol3 = optimize.root(f, [-10., -10., -10.], jac=True)
+print(sol3.x)
+
+
+
+
+
[0. 0. 0.]
+[0. 0. 0.]
+[-8.48528137 -8.48528137 27.        ]
+
+
+
+
+
+
+
fig = plt.figure()
+fig.set_size_inches(8, 8)
+ax = plt.axes(projection='3d')
+
+ax.plot(X[0,:], X[1,:], X[2,:])
+
+ax.scatter(sol1.x[0], sol1.x[1], sol1.x[2], marker="x", color="C1")
+ax.scatter(sol2.x[0], sol2.x[1], sol2.x[2], marker="x", color="C1")
+ax.scatter(sol3.x[0], sol3.x[1], sol3.x[2], marker="x", color="C1")
+
+ax.set_xlabel("x")
+ax.set_ylabel("y")
+ax.set_zlabel("z")
+# alt-text: the 3D solution again represented as a line / trajectory, now with the stable-points marked
+
+
+
+
+
Text(0.5, 0, 'z')
+
+
+../_images/ec894b10ee74fd1a6ff2549194ffd8b3c35714accac628c04e867676d5b804c7.png +
+
+
+
+

Stiff system of ODEs#

+

A stiff system of ODEs is one where there are multiple disparate timescales for change and we need to respect all of them to get an accurate solution

+

Here is an example from Chemical Kinetics (see, ex. Byrne & Hindmarsh 1986, or the VODE source code)

+
+\[ +\frac{d}{dt} \left ( + \begin{array}{c} y_1 \newline y_2 \newline y_3 \end{array} + \right ) = +% +\left ( + \begin{array}{rrr} + -0.04 y_1 & + 10^4 y_2 y_3 & \newline + 0.04 y_1 & - 10^4 y_2 y_3 & -3\times 10^7 y_2^2 \newline + & & 3\times 10^7 y_2^2 +\end{array} +\right ) +\]
+
+\[ +{\bf J} = \left ( +\begin{array}{ccc} + -0.04 & 10^4 y_3 & 10^4 y_2 \newline + 0.04 & -10^4 y_3 - 6\times 10^7 y_2 & -10^4 y_2 \newline + 0 & 6\times 10^7 y_2 & 0 +\end{array} +\right ) +\]
+

start with \(y_1(0) = 1, y_2(0) = y_3(0) = 0\). Long term behavior is \(y_1, y_2 \rightarrow 0; y_3 \rightarrow 1\)

+
+
+
def rhs(t, Y):
+    """ RHS of the system -- using 0-based indexing """
+    y1 = Y[0]
+    y2 = Y[1]
+    y3 = Y[2]
+
+    dy1dt = -0.04*y1 + 1.e4*y2*y3
+    dy2dt =  0.04*y1 - 1.e4*y2*y3 - 3.e7*y2**2
+    dy3dt =                         3.e7*y2**2
+
+    return np.array([dy1dt, dy2dt, dy3dt])
+
+def jac(t, Y):
+    """ J_{i,j} = df_i/dy_j """
+
+    y1 = Y[0]
+    y2 = Y[1]
+    y3 = Y[2]
+
+    df1dy1 = -0.04
+    df1dy2 = 1.e4*y3
+    df1dy3 = 1.e4*y2
+
+    df2dy1 = 0.04
+    df2dy2 = -1.e4*y3 - 6.e7*y2
+    df2dy3 = -1.e4*y2
+
+    df3dy1 = 0.0
+    df3dy2 = 6.e7*y2
+    df3dy3 = 0.0
+
+    return np.array([ [ df1dy1, df1dy2, df1dy3 ],
+                      [ df2dy1, df2dy2, df2dy3 ],
+                      [ df3dy1, df3dy2, df3dy3 ] ])
+
+
+
+
+
+
+
def vode_integrate(Y0, tmax):
+    """ integrate using the NDF method """
+
+    r = integrate.solve_ivp(rhs, (0.0, tmax), Y0,
+                            method="BDF", jac=jac, rtol=1.e-7, atol=1.e-10)
+
+    # Note: this solver does not have a dens_output method, instead we 
+    # access the solution data where it was evaluated internally via
+    # the return object
+    print(r)
+    return r.t, r.y
+
+
+
+
+
+
+
Y0 = np.array([1.0, 0.0, 0.0])
+tmax = 4.e7
+
+ts, Ys = vode_integrate(Y0, tmax)
+
+fig, ax = plt.subplots()
+ax.loglog(ts, Ys[0,:], label=r"$y_1$")
+ax.loglog(ts, Ys[1,:], label=r"$y_2$")
+ax.loglog(ts, Ys[2,:], label=r"$y_3$")
+
+ax.legend(loc="best", frameon=False)
+ax.set_xlabel("time")
+# alt-text: the time-evolution of the species on a log scale
+
+
+
+
+
  message: The solver successfully reached the end of the integration interval.
+  success: True
+   status: 0
+        t: [ 0.000e+00  3.196e-07 ...  3.894e+07  4.000e+07]
+        y: [[ 1.000e+00  1.000e+00 ...  5.344e-05  5.203e-05]
+            [ 0.000e+00  1.278e-08 ...  2.138e-10  2.081e-10]
+            [ 0.000e+00  1.323e-15 ...  9.999e-01  9.999e-01]]
+      sol: None
+ t_events: None
+ y_events: None
+     nfev: 2029
+     njev: 12
+      nlu: 130
+
+
+
Text(0.5, 0, 'time')
+
+
+../_images/1a8b730832e97d8d0b31d24d2b778ff95ba6f3c3ccf0baa447e6022883f4a0e7.png +
+
+
+
+
sol
+
+
+
+
+
---------------------------------------------------------------------------
+NameError                                 Traceback (most recent call last)
+Cell In[48], line 1
+----> 1 sol
+
+NameError: name 'sol' is not defined
+
+
+
+
+
+

try it

+

Redo this integration, but now use the RK45 solver instead of BDF. Does it work?

+

You may need to use the kernel menu in Jupyter to interrupt the kernel if you get impatient.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-exercises-2.html b/05-scipy/scipy-exercises-2.html new file mode 100644 index 00000000..b45bb4b1 --- /dev/null +++ b/05-scipy/scipy-exercises-2.html @@ -0,0 +1,894 @@ + + + + + + + + + + + More SciPy Exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

More SciPy Exercises#

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Linear Algebra#

+
+
+

Q1: Condition number#

+

For a linear system, \({\bf A x} = {\bf b}\), we can only solve for \(x\) if the determinant of the matrix \({\bf A}\) is non-zero. If the determinant is zero, then we call the matrix singular. The condition number of a matrix is a measure of how close we are to being singular. The formal definition is:

+
+(1)#\[\begin{equation} +\mathrm{cond}({\bf A}) = \| {\bf A}\| \| {\bf A}^{-1} \| +\end{equation}\]
+

But we can think of it as a measure of how much \({\bf x}\) would change due to a small change in \({\bf b}\). A large condition number means that our solution for \({\bf x}\) could be inaccurate.

+

A Hilbert matrix has \(H_{ij} = (i + j + 1)^{-1}\), and is known to have a large condition number. Here’s a routine to generate a Hilbert matrix

+
+
+
def hilbert(n):
+    """ return a Hilbert matrix, H_ij = (i + j - 1)^{-1} """
+
+    H = np.zeros((n,n), dtype=np.float64)
+
+    for i in range(1, n+1):
+        for j in range(1, n+1):
+            H[i-1,j-1] = 1.0/(i + j - 1.0)
+    return H
+
+
+
+
+

Let’s solve \({\bf Hx} ={\bf b}\). Create a linear system by picking an \({\bf x}\) and generating a \({\bf b}\) by multiplying by the matrix \({\bf H}\). Then use the scipy.linalg.solve() function to recover \({\bf x}\). Compute the error in \({\bf x}\) as a function of the size of the matrix.

+

You won’t need a large matrix, \(n \sim 13\) or so, will start showing big errors.

+

You can compute the condition number with numpy.linalg.cond()

+

There are methods that can do a better job with nearly-singular matrices. Take a look at scipy.linalg.lstsq() for example.

+
+
+
+

FFTs#

+
+

Q2: Noisy signal#

+

A convolution is defined as:

+
+(2)#\[\begin{equation} + (f \star g)(t) \equiv \int_{-\infty}^{\infty} f(\tau) g(t - \tau) d\tau +\end{equation} \]
+

It is easy to compute this with FFTs, via the convolution theorem,

+
+(3)#\[\begin{equation} + \mathcal{F}\{f \star g\} = \mathcal{F}\{f\} \, \mathcal{F}\{g\} +\end{equation} \]
+

That is the Fourier transform of the convolution of \(f\) and \(g\) is simply +the product of the individual transforms of \(f\) and \(g\). This allows us +to compute the convolution via multiplication in Fourier space and then take +the inverse transform, \(\mathcal{F}^{-1}\{\}\), to recover the convolution in real space:

+
+(4)#\[\begin{equation} +f \star g = \mathcal{F}^{-1}\{ \mathcal{F}\{f\} \, \mathcal{F}\{g\}\} +\end{equation}\]
+

A common use of a convolution is to smooth noisy data, for example by convolving noisy data with a Gaussian. We’ll do that here.

+

Here’s some noisy data we’ll work with

+
+
+
def fdata(x, L):
+    A = L/10.0
+    return 2*np.sin(2*np.pi*x/L) + x*(L-x)**2/L**3 * np.cos(x) + \
+           5*x*(L-x)/L**2 + A/2 + 0.1*A*np.sin(13*np.pi*x/L)
+
+N = 2048
+L = 50.0
+x = np.linspace(0, L, N, endpoint=False)
+orig = fdata(x, L)
+
+rng = np.random.default_rng()
+noisy = orig + 0.5 * rng.standard_normal(N)
+
+
+
+
+
+
+
plt.plot(x, noisy)
+plt.plot(x, orig)
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fca2fbd7230>]
+
+
+a plot showing noisy sinusoidal and the original, un-noised data +
+
+

SciPy provides a convolution function scipy.signal.convolve() that can do the convolution for us directly. To smooth the data, we want to use a Gaussian, which can be produced by scipy.signal.gaussian().

+

Convolve the noisy data with a Gaussian and plot the result together with the original data orig. You’ll need to play with the width of the Gaussian to get a nice smoothing. You also will need to normalize the Gaussian so that it sums to 1, otherwise, your convolved data will be shifted verfically from the original function.

+
+
+

Q3: FFT of chaotic pendulum#

+

Last time we looked at ODEs and the chaotic pendulum, and were interested in writing a method to integrate the pendulum in time.

+

Here we want to examine its behavior in frequency space. The code below will integrate the chaotic pendulum, while requesting that the solution be stored at points spaced with a fixed dt, which makes it suitable for taking the FFT.

+
+
+
from functools import partial
+from scipy.integrate import solve_ivp
+
+def rhs(t, Y, q, omega_d, b):
+    """ damped driven pendulum system derivatives.  Here, Y = (theta, omega) are
+        the solution variables. """
+    f = np.zeros_like(Y)
+        
+    f[0] = Y[1]
+    f[1] = -q*Y[1] - np.sin(Y[0]) + b*np.cos(omega_d*t)
+
+    return f
+
+def restrict_theta(theta):
+    """ convert theta to be restricted to lie between -pi and pi"""
+    tnew = theta + np.pi
+    tnew += -2.0*np.pi*np.floor(tnew/(2.0*np.pi))
+    tnew -= np.pi
+    return tnew
+
+def int_pendulum(theta0, q, omega_d, b, tend, dt):
+    """ integrate the pendulum and return solution with dt"""
+
+    # points in time where we'll request the solution
+    tpoints = np.arange(0.0, tend, dt)
+    
+    r = solve_ivp(partial(rhs, q=q, omega_d=omega_d, b=b),
+                  [0.0, tend], [theta0, 0.0],
+                  method='RK45', t_eval=tpoints)
+
+    return r.t, r.y
+
+
+
+
+

The call below will give an undamped pendulum. For a small amplitude, since we have \(L = g\) in our pendulum, the period is simply \(T = 2\pi\), and the frequency is \(\nu_k = 1/(2\pi)\). We plot things in terms of angular frequency, \(\omega_k = 2\pi \nu_k\), so all the power will be at \(\omega_k = 1\).

+
+
+
t, y = int_pendulum(np.radians(10), 0.0, 0.6666, 0.0, 200.0, 0.1)
+
+
+
+
+

Your task is to complete the power spectrum routine below to calculate the FFT of theta and plot it. Experiment with the damping and driving parameters to see the complexity of the pendulum in frequency space when it becomes chaotic. For reference, here’s a plot of the solution theta

+
+
+
plt.plot(t, restrict_theta(y[0,:]))
+plt.xlabel("t")
+plt.ylabel(r"$\theta$")
+
+
+
+
+
Text(0, 0.5, '$\\theta$')
+
+
+a plot showing many periods of a sinusoidal function +
+
+
+
+
def power_spectrum(t, theta0):
+    """ return the power spectrum of theta.  For the frequency
+        component, return it in terms of omega """
+
+    theta = restrict_theta(theta0)
+    
+    # fill in the rest -- take the FFT of theta and return omega_k and 
+    # the transform of theta
+
+
+
+
+
+
+
+

Fitting#

+
+

Q4: Let’s find the errors on our fit#

+

We looked at fits, but not what the errors are on the fit. Look at scipy.optimize.curve_fit(). This is a simplified wrapper on the least squares fitting. It can return the convariance matrix, the diagonals of which can give the error of the fit for the parameters.

+

Make up some data that models a non-linear function (by introducing some random noise) and perform a fit and find the errors on the parameters.

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-exercises-2.html.backup b/05-scipy/scipy-exercises-2.html.backup new file mode 100644 index 00000000..8a5e3a37 --- /dev/null +++ b/05-scipy/scipy-exercises-2.html.backup @@ -0,0 +1,896 @@ + + + + + + + + + + + More SciPy Exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

More SciPy Exercises#

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Linear Algebra#

+
+
+

Q1: Condition number#

+

For a linear system, \({\bf A x} = {\bf b}\), we can only solve for \(x\) if the determinant of the matrix \({\bf A}\) is non-zero. If the determinant is zero, then we call the matrix singular. The condition number of a matrix is a measure of how close we are to being singular. The formal definition is:

+
+(1)#\[\begin{equation} +\mathrm{cond}({\bf A}) = \| {\bf A}\| \| {\bf A}^{-1} \| +\end{equation}\]
+

But we can think of it as a measure of how much \({\bf x}\) would change due to a small change in \({\bf b}\). A large condition number means that our solution for \({\bf x}\) could be inaccurate.

+

A Hilbert matrix has \(H_{ij} = (i + j + 1)^{-1}\), and is known to have a large condition number. Here’s a routine to generate a Hilbert matrix

+
+
+
def hilbert(n):
+    """ return a Hilbert matrix, H_ij = (i + j - 1)^{-1} """
+
+    H = np.zeros((n,n), dtype=np.float64)
+
+    for i in range(1, n+1):
+        for j in range(1, n+1):
+            H[i-1,j-1] = 1.0/(i + j - 1.0)
+    return H
+
+
+
+
+

Let’s solve \({\bf Hx} ={\bf b}\). Create a linear system by picking an \({\bf x}\) and generating a \({\bf b}\) by multiplying by the matrix \({\bf H}\). Then use the scipy.linalg.solve() function to recover \({\bf x}\). Compute the error in \({\bf x}\) as a function of the size of the matrix.

+

You won’t need a large matrix, \(n \sim 13\) or so, will start showing big errors.

+

You can compute the condition number with numpy.linalg.cond()

+

There are methods that can do a better job with nearly-singular matrices. Take a look at scipy.linalg.lstsq() for example.

+
+
+
+

FFTs#

+
+

Q2: Noisy signal#

+

A convolution is defined as:

+
+(2)#\[\begin{equation} + (f \star g)(t) \equiv \int_{-\infty}^{\infty} f(\tau) g(t - \tau) d\tau +\end{equation} \]
+

It is easy to compute this with FFTs, via the convolution theorem,

+
+(3)#\[\begin{equation} + \mathcal{F}\{f \star g\} = \mathcal{F}\{f\} \, \mathcal{F}\{g\} +\end{equation} \]
+

That is the Fourier transform of the convolution of \(f\) and \(g\) is simply +the product of the individual transforms of \(f\) and \(g\). This allows us +to compute the convolution via multiplication in Fourier space and then take +the inverse transform, \(\mathcal{F}^{-1}\{\}\), to recover the convolution in real space:

+
+(4)#\[\begin{equation} +f \star g = \mathcal{F}^{-1}\{ \mathcal{F}\{f\} \, \mathcal{F}\{g\}\} +\end{equation}\]
+

A common use of a convolution is to smooth noisy data, for example by convolving noisy data with a Gaussian. We’ll do that here.

+

Here’s some noisy data we’ll work with

+
+
+
def fdata(x, L):
+    A = L/10.0
+    return 2*np.sin(2*np.pi*x/L) + x*(L-x)**2/L**3 * np.cos(x) + \
+           5*x*(L-x)/L**2 + A/2 + 0.1*A*np.sin(13*np.pi*x/L)
+
+N = 2048
+L = 50.0
+x = np.linspace(0, L, N, endpoint=False)
+orig = fdata(x, L)
+
+rng = np.random.default_rng()
+noisy = orig + 0.5 * rng.standard_normal(N)
+
+
+
+
+
+
+
plt.plot(x, noisy)
+plt.plot(x, orig)
+# alt-text: a plot showing noisy sinusoidal and the original, un-noised data
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fca2fbd7230>]
+
+
+../_images/99a67cee0e0bf420274cba3ccae7c4f8007a099125cb6550003621a45abc4c75.png +
+
+

SciPy provides a convolution function scipy.signal.convolve() that can do the convolution for us directly. To smooth the data, we want to use a Gaussian, which can be produced by scipy.signal.gaussian().

+

Convolve the noisy data with a Gaussian and plot the result together with the original data orig. You’ll need to play with the width of the Gaussian to get a nice smoothing. You also will need to normalize the Gaussian so that it sums to 1, otherwise, your convolved data will be shifted verfically from the original function.

+
+
+

Q3: FFT of chaotic pendulum#

+

Last time we looked at ODEs and the chaotic pendulum, and were interested in writing a method to integrate the pendulum in time.

+

Here we want to examine its behavior in frequency space. The code below will integrate the chaotic pendulum, while requesting that the solution be stored at points spaced with a fixed dt, which makes it suitable for taking the FFT.

+
+
+
from functools import partial
+from scipy.integrate import solve_ivp
+
+def rhs(t, Y, q, omega_d, b):
+    """ damped driven pendulum system derivatives.  Here, Y = (theta, omega) are
+        the solution variables. """
+    f = np.zeros_like(Y)
+        
+    f[0] = Y[1]
+    f[1] = -q*Y[1] - np.sin(Y[0]) + b*np.cos(omega_d*t)
+
+    return f
+
+def restrict_theta(theta):
+    """ convert theta to be restricted to lie between -pi and pi"""
+    tnew = theta + np.pi
+    tnew += -2.0*np.pi*np.floor(tnew/(2.0*np.pi))
+    tnew -= np.pi
+    return tnew
+
+def int_pendulum(theta0, q, omega_d, b, tend, dt):
+    """ integrate the pendulum and return solution with dt"""
+
+    # points in time where we'll request the solution
+    tpoints = np.arange(0.0, tend, dt)
+    
+    r = solve_ivp(partial(rhs, q=q, omega_d=omega_d, b=b),
+                  [0.0, tend], [theta0, 0.0],
+                  method='RK45', t_eval=tpoints)
+
+    return r.t, r.y
+
+
+
+
+

The call below will give an undamped pendulum. For a small amplitude, since we have \(L = g\) in our pendulum, the period is simply \(T = 2\pi\), and the frequency is \(\nu_k = 1/(2\pi)\). We plot things in terms of angular frequency, \(\omega_k = 2\pi \nu_k\), so all the power will be at \(\omega_k = 1\).

+
+
+
t, y = int_pendulum(np.radians(10), 0.0, 0.6666, 0.0, 200.0, 0.1)
+
+
+
+
+

Your task is to complete the power spectrum routine below to calculate the FFT of theta and plot it. Experiment with the damping and driving parameters to see the complexity of the pendulum in frequency space when it becomes chaotic. For reference, here’s a plot of the solution theta

+
+
+
plt.plot(t, restrict_theta(y[0,:]))
+plt.xlabel("t")
+plt.ylabel(r"$\theta$")
+# alt-text: a plot showing many periods of a sinusoidal function
+
+
+
+
+
Text(0, 0.5, '$\\theta$')
+
+
+../_images/b897fc22d6a1d0326dabca816283e8742aee42c4fa9ceaefb55d6e13c81f6c45.png +
+
+
+
+
def power_spectrum(t, theta0):
+    """ return the power spectrum of theta.  For the frequency
+        component, return it in terms of omega """
+
+    theta = restrict_theta(theta0)
+    
+    # fill in the rest -- take the FFT of theta and return omega_k and 
+    # the transform of theta
+
+
+
+
+
+
+
+

Fitting#

+
+

Q4: Let’s find the errors on our fit#

+

We looked at fits, but not what the errors are on the fit. Look at scipy.optimize.curve_fit(). This is a simplified wrapper on the least squares fitting. It can return the convariance matrix, the diagonals of which can give the error of the fit for the parameters.

+

Make up some data that models a non-linear function (by introducing some random noise) and perform a fit and find the errors on the parameters.

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy-exercises.html b/05-scipy/scipy-exercises.html new file mode 100644 index 00000000..445b6ac3 --- /dev/null +++ b/05-scipy/scipy-exercises.html @@ -0,0 +1,907 @@ + + + + + + + + + + + SciPy exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

SciPy exercises#

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Integration#

+
+
+
from scipy import integrate
+
+
+
+
+
+

Q1: integrating an analytic function#

+

Numerical integration methods work differently depending on whether you have the analytic function available (in which case you can evaluate it freely at any point you please) or if it is sampled for you.

+

Consider the function \(f(x) = e^{-x^2}\). We want to integrate this from \([-5, 5]\). The +analytic integral is not easily obtained. Use integrate.quad to do the integration.

+
+
+

Q2: integrating a sampled function#

+

Consider now that you have data that represents a function sampled a N points, but you don’t know the analytic form of the function. Here, we create the sampling here for a Gaussian and we will do the same integral as in Q1.

+
+
+
N = 32
+x = np.linspace(-5, 5, N)
+f = np.exp(-x**2)
+f
+
+
+
+
+
array([1.38879439e-11, 3.15061953e-10, 5.80457065e-09, 8.68481106e-08,
+       1.05527775e-06, 1.04133225e-05, 8.34503173e-05, 5.43103745e-04,
+       2.87047478e-03, 1.23208538e-02, 4.29481052e-02, 1.21580337e-01,
+       2.79510942e-01, 5.21855680e-01, 7.91258065e-01, 9.74320895e-01,
+       9.74320895e-01, 7.91258065e-01, 5.21855680e-01, 2.79510942e-01,
+       1.21580337e-01, 4.29481052e-02, 1.23208538e-02, 2.87047478e-03,
+       5.43103745e-04, 8.34503173e-05, 1.04133225e-05, 1.05527775e-06,
+       8.68481106e-08, 5.80457065e-09, 3.15061953e-10, 1.38879439e-11])
+
+
+
+
+

Compute the integral of this sampled function using Simpson’s method (integrate.simps). Now, vary the number of sample points (try 64, 128, …) and see how the answer changes. Simpson’s method is 4-th order accurate, which means that the error should decrease by \(2^4\) when we double the number of sample points

+

Optional: Make a plot of the error (compared to the analytic integral from Q1) vs. N

+
+
+
+

Interpolation#

+
+
+
from scipy import interpolate
+
+
+
+
+
+

Q3: interpolation error#

+

There are a large number of different interpolation schemes available through scipy. Let’s test them out.

+

Create a python function, \(f(x)\), that is your true function. Now create \(N\) samples of it (either regularly spaced or irregularly spaced).

+

Try some of the different interolation routines. interpolate.interp1d takes a kind argument that let’s you choose the order of the interpolation. Measure the error in the method, by comparing the interpolated result with the actual function value. Also, try using cubic splines (look at CubicSpline)

+

Try plotting the resulting interpolant.

+
+
+
+

Root Finding#

+
+

Q4: scalar function roots#

+

Consider the function

+
+\[q(x) = x^3 - 2x^2 - 11x + 12\]
+

This has 3 roots, but is known to cause problems for some root-finding methods (it exhibits basis of attraction: https://en.wikipedia.org/wiki/Newton’s_method#Basins_of_attraction – very closely spaced initial guesses leave to very different roots)

+

Use the SciPy optimize.brentq method to find the roots. You might need to play around with the intervals to find all 3 roots (try plotting the function to help)

+
+
+
from scipy import optimize
+
+
+
+
+
+
+
+

ODEs#

+
+

Q5: orbits#

+

We want to consider planetary orbits. To do this, we need to solve Newton’s second law together with Newton’s law of gravity. If we restrict ourselves to the x-y plane, then there are 4 quantities we need to solve for: \(x\), \(y\), \(v_x\), and \(v_y\). These evolve according to:

+
+\[\begin{align*} +\frac{dx}{dt} &= v_x \\ +\frac{dy}{dt} &= v_y \\ +\frac{dv_x}{dt} &= a_x = -\frac{GM_\star x}{r^3} \\ +\frac{dv_y}{dt} &= a_y = -\frac{GM_\star y}{r^3} +\end{align*}\]
+

To integrate these forward in time, we need an initial condition for each quantity. We’ll setup our system such that the Sun is at the origin (that will be one focus), and the planet begins at perihelion and orbits counterclockwise.

+

geometry

+

The distance of perihelion from the focus is:

+
+\[r_p = a (1 - e)\]
+

where \(a\) is the semi-major axis and \(e\) is the eccentricity. The perihelion velocity is all in the \(y\) direction and is:

+
+\[v_y = v_p = \sqrt{\frac{GM_\star}{a} \frac{1+e}{1-e}}\]
+

We’ll work in units of AU, years, and solar masses, in which case, \(GM_\star = 4\pi^2\) (for the Sun).

+

Your initial conditions should be:

+
    +
  • \(x(t=0) = r_p\)

  • +
  • \(y(t=0) = 0\)

  • +
  • \(v_x(t=0) = 0\)

  • +
  • \(v_y(t=0) = v_p\)

  • +
+

Here’s a righthand side function for the ODEs:

+
+
+
def rhs(t, Y, GM=4*np.pi**2):
+    """RHS for orbits, Y is the solution vector, containing
+    x, y, v_x, and v_y"""
+
+    x, y, vx, vy = Y
+    f = np.zeros_like(Y)
+
+    # dx/dt = vx
+    f[0] = vx
+
+    # dy/dt = vy
+    f[1] = vy
+
+    # d(vx)/dt = -GMx/r**3
+    r = np.sqrt(x**2 + y**2)
+    f[2] = -GM*x/r**3
+
+    # d(vy)/dt = -GMy/r**3
+    f[3] = -GM*y/r**3
+
+    return f
+
+
+
+
+

Use the SciPy ODE integration methods to integrate an orbit and plot it

+
+
+

Q6: damped driven pendulum and chaos#

+

There are a large class of ODE integration methods available through the scipy.integrate.ode() function. Not all of them provide dense output – most will just give you the value at the end of the integration.

+

The explicit Runge-Kutta integrator will give you access to the solution at intermediate points and provides methods to interpolate to any value. You enable this via dense_output=True (see the example in our out-of-class notebook).

+

The damped driven pendulum obeys the following equations:

+
+\[\dot{\theta} = \omega\]
+
+\[\dot{\omega} = -q \omega - \sin \theta + b \cos \omega_d t\]
+

here, \(\theta\) is the angle of the pendulum from vertical and \(\omega\) is the angular velocity. \(q\) is a damping coefficient, \(b\) is a forcing amplitude, and \(\omega_d\) is a driving frequency.

+

Choose \(q = 0.5\) and \(\omega_d = 2/3\).

+

Integrate the system for different values of \(b\) (start with \(b = 0.9\) and increase by \(0.05\), and plot the results (\(\theta\) vs. \(t\)). Here’s a RHS function to get you started:

+
+
+
def rhs(t, Y, q, omega_d, b):
+        """ damped driven pendulum system derivatives.  Here, Y = (theta, omega) are
+        the solution variables. """
+        f = np.zeros_like(Y)
+        
+        f[0] = Y[1]
+        f[1] = -q*Y[1] - np.sin(Y[0]) + b*np.cos(omega_d*t)
+
+        return f
+
+
+
+
+

Note that the pendulum can flip over, giving values of \(\theta\) outside of \([-\pi, \pi]\). The following function can be used to restrict it back to \([-\pi, \pi]\) for plotting.

+
+
+
def restrict_theta(theta):
+    """ convert theta to be restricted to lie between -pi and pi"""
+    tnew = theta + np.pi
+    tnew += -2.0*np.pi*np.floor(tnew/(2.0*np.pi))
+    tnew -= np.pi
+    return tnew
+
+
+
+
+

Write a function that takes an initial angle, \(\theta_0\), and integrates the system and returns the solution.

+

Note, the righthand side function, rhs, takes additional arguments that you need to pass through the integrator. The preferred method to do this with the solve_ivp() interface appears to be to use functools.partial(), as:

+
from functools import partial
+
+r = solve_ivp(partial(rhs, q=q, omega_d=omega_d, b=b), ...)
+
+
+

Some values of \(b\) will show very non-periodic behavior. To see chaos, integrate two different pendula that are the same except for \(\theta_0\), with only a small difference between then (like 60 degrees and 60.0001 degrees. You’ll see the solutions track for a while, but then diverge.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/05-scipy/scipy.html b/05-scipy/scipy.html new file mode 100644 index 00000000..5af58957 --- /dev/null +++ b/05-scipy/scipy.html @@ -0,0 +1,605 @@ + + + + + + + + + + + SciPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

SciPy

+ +
+
+ +
+
+
+ + + + +
+ +
+

SciPy#

+

SciPy provides implementations of many common numerical methods.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/06-sympy/sympy-examples.html b/06-sympy/sympy-examples.html new file mode 100644 index 00000000..5913c642 --- /dev/null +++ b/06-sympy/sympy-examples.html @@ -0,0 +1,1807 @@ + + + + + + + + + + + SymPy examples — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

SymPy examples#

+

sources: +http://docs.sympy.org/latest/tutorial/ +http://nbviewer.ipython.org/github/ipython/ipython/blob/master/examples/notebooks/SymPy Examples.ipynb

+

SymPy provides support for symbolic math to python, similar to what you would do with Mathematica or Maple. The major difference is that it acts just like any other python module, so you can use the symbolic math together in your own python projects with the rest of python functionality.

+

The following import and function (init_session()) sets up a nice environment for us when working in Jupyter

+
+
+
from sympy import init_session
+init_session(use_latex="mathjax")
+
+
+
+
+
IPython console for SymPy 1.14.0 (Python 3.14.3-64-bit) (ground types: python)
+
+These commands were executed:
+>>> from sympy import *
+>>> x, y, z, t = symbols('x y z t')
+>>> k, m, n = symbols('k m n', integer=True)
+>>> f, g, h = symbols('f g h', cls=Function)
+>>> init_printing()
+
+Documentation can be found at https://docs.sympy.org/1.14.0/
+
+
+
+
+
+
+
import math
+
+
+
+
+
+

SymPy types and basic symbolic manipulation#

+

Sympy defines its own types, you can convert them to python types, but you don’t always want to (and will probably lose accuracy when you do).

+
+
+
print(math.sqrt(2))
+
+
+
+
+
1.4142135623730951
+
+
+
+
+
+
+
print(sqrt(2))
+
+
+
+
+
sqrt(2)
+
+
+
+
+
+
+
print(sqrt(8))
+
+
+
+
+
2*sqrt(2)
+
+
+
+
+
+
+
#help(sqrt(8))
+
+
+
+
+

We can do symbolic math not just on numbers, but we can tell SymPy what to treat as a symbol, using symbols()

+
+
+
from sympy import symbols
+x, y, z = symbols("x y z")
+
+
+
+
+
+
+
expr = x + 2*y
+expr
+
+
+
+
+
+\[\displaystyle x + 2 y\]
+
+
+
+
+
expr - 1
+
+
+
+
+
+\[\displaystyle x + 2 y - 1\]
+
+
+
+
+
expr - y
+
+
+
+
+
+\[\displaystyle x + y\]
+
+
+
+
+
f = x*expr
+f
+
+
+
+
+
+\[\displaystyle x \left(x + 2 y\right)\]
+
+
+
+
+
g = expand(f)
+g
+
+
+
+
+
+\[\displaystyle x^{2} + 2 x y\]
+
+
+
+
+
factor(g)
+
+
+
+
+
+\[\displaystyle x \left(x + 2 y\right)\]
+
+
+
+
+

substitution#

+

SymPy provides methods to substitute values for symbols in symbolic expressions. Note, the follow likely does not do what you expect:

+
+
+
expr = sin(z*2*pi)
+z = 0
+expr
+
+
+
+
+
+\[\displaystyle \sin{\left(2 \pi z \right)}\]
+
+
+

We’ve now redefined z to be a python type

+
+
+
type(z)
+
+
+
+
+
int
+
+
+
+
+

to do substitution, we use the subs() method

+
+
+
expr = sin(x*2*pi)
+expr
+
+
+
+
+
+\[\displaystyle \sin{\left(2 \pi x \right)}\]
+
+
+
+
+
a = expr.subs(x, 0.125)
+a
+
+
+
+
+
+\[\displaystyle \frac{\sqrt{2}}{2}\]
+
+
+

Note that this is not a floating point number – it is still a SymPy object. To make it floating point, we can use evalf()

+
+
+
b = a.evalf()
+print(b, type(b))
+
+
+
+
+
0.707106781186548 <class 'sympy.core.numbers.Float'>
+
+
+
+
+

This is still a SymPy object, because SymPy can do arbitrary precision

+
+
+
a.evalf(50)
+
+
+
+
+
+\[\displaystyle 0.70710678118654752440084436210484903928483593768847\]
+
+
+

want regular python types?

+
+
+
c = float(b)
+print(c, type(c))
+
+
+
+
+
0.7071067811865476 <class 'float'>
+
+
+
+
+
+
+

Python and SymPy#

+
+
+
x, y, z, t = symbols('x y z t')
+
+
+
+
+

SymPy symbols are just objects and when you do operations on two sympy objects the result is a sympy object.

+

When you combine a sympy and python object, the result is also a sympy object.

+

But we need to be careful when doing fractions. For instance doing x + 1/3 will first compute 1/3 in python (giving 0.333...) and then add it to the sympy x symbol. The Rational() function makes this all happen in sympy

+
+
+
f = expr + Rational(1,3)
+f
+
+
+
+
+
+\[\displaystyle \sin{\left(2 \pi x \right)} + \frac{1}{3}\]
+
+
+
+
+
expr + 1/3
+
+
+
+
+
+\[\displaystyle \sin{\left(2 \pi x \right)} + 0.333333333333333\]
+
+
+
+
+

equality#

+

= is still the assignment operator of python (it does not mean symbolic equality), and == is still the logical test (exact structural equality). There is a separate object, Eq() to specify symbolic equality.

+

And testing for algebraic equality is not always accomplished using ==, since that tests for structural equality.

+
+
+
x + 1 == 4
+
+
+
+
+
False
+
+
+
+
+
+
+
Eq(x + 1, 4)
+
+
+
+
+
+\[\displaystyle x + 1 = 4\]
+
+
+
+
+
a = (x + 1)**2
+b = x**2 + 2*x + 1    # these are algebraically equal
+
+
+
+
+
+
+
a == b
+
+
+
+
+
False
+
+
+
+
+

We can use simplify() to test for algebraic equality

+
+
+
simplify(a - b)
+
+
+
+
+
+\[\displaystyle 0\]
+
+
+
+
+
a = cos(x) + I*sin(x)
+a
+
+
+
+
+
+\[\displaystyle i \sin{\left(x \right)} + \cos{\left(x \right)}\]
+
+
+
+
+
simplify(a)
+
+
+
+
+
+\[\displaystyle e^{i x}\]
+
+
+
+
+

More substitution#

+

note that substitution returns a new expression: SymPy expressions are immutable

+
+
+
expr = cos(x)
+expr.subs(x, 0)
+
+
+
+
+
+\[\displaystyle 1\]
+
+
+
+
+
expr
+
+
+
+
+
+\[\displaystyle \cos{\left(x \right)}\]
+
+
+
+
+
x
+
+
+
+
+
+\[\displaystyle x\]
+
+
+

multiple substitutions, pass a list of tuples

+
+
+
expr = x**3 + 4*x*y - z
+expr
+
+
+
+
+
+\[\displaystyle x^{3} + 4 x y - z\]
+
+
+
+
+
expr.subs([(x, 2), (y, 4), (z, 0)])
+
+
+
+
+
+\[\displaystyle 40\]
+
+
+
+
+

simplifying#

+

There is not unique definition of what the simplest form of an expression is.

+

simplify() tries lots of methods for simplification

+
+
+
simplify(sin(x)**2 + cos(x)**2)
+
+
+
+
+
+\[\displaystyle 1\]
+
+
+
+
+
simplify( (x**3 + x**2 - x - 1)/(x**2 + 2*x + 1) )
+
+
+
+
+
+\[\displaystyle x - 1\]
+
+
+
+
+
simplify(gamma(x)/gamma(x - 2))
+
+
+
+
+
+\[\displaystyle \left(x - 2\right) \left(x - 1\right)\]
+
+
+

but sometimes it doesn’t have your idea of what the simplest form is

+
+
+
simplify(x**2 + 2*x + 1)
+
+
+
+
+
+\[\displaystyle x^{2} + 2 x + 1\]
+
+
+

instead factor may be what you want

+
+
+
factor(x**2 + 2*x + 1)
+
+
+
+
+
+\[\displaystyle \left(x + 1\right)^{2}\]
+
+
+
+

polynomial simplification#

+
+
+
expand((x + 1)**2)
+
+
+
+
+
+\[\displaystyle x^{2} + 2 x + 1\]
+
+
+
+
+
expand((x + 2)*(x - 3))
+
+
+
+
+
+\[\displaystyle x^{2} - x - 6\]
+
+
+
+
+
expand( (x + 1)*(x - 2) - (x - 1)*x)
+
+
+
+
+
+\[\displaystyle -2\]
+
+
+
+
+
factor(x**2*z + 4*x*y*z + 4*y**2*z)
+
+
+
+
+
+\[\displaystyle z \left(x + 2 y\right)^{2}\]
+
+
+
+
+
factor_list(x**2*z + 4*x*y*z + 4*y**2*z)
+
+
+
+
+
+\[\displaystyle \left( 1, \ \left[ \left( z, \ 1\right), \ \left( x + 2 y, \ 2\right)\right]\right)\]
+
+
+

collect collects common powers

+
+
+
expr = x*y + x - 3 + 2*x**2 - z*x**2 + x**3
+expr
+
+
+
+
+
+\[\displaystyle x^{3} - x^{2} z + 2 x^{2} + x y + x - 3\]
+
+
+
+
+
collected_expr = collect(expr, x)
+collected_expr
+
+
+
+
+
+\[\displaystyle x^{3} + x^{2} \left(2 - z\right) + x \left(y + 1\right) - 3\]
+
+
+

cancel cancels

+
+
+
a = (x**2 + 2*x + 1)/(x**2 + x)
+a
+
+
+
+
+
+\[\displaystyle \frac{x^{2} + 2 x + 1}{x^{2} + x}\]
+
+
+
+
+
cancel(a)
+
+
+
+
+
+\[\displaystyle \frac{x + 1}{x}\]
+
+
+

trigsimp simplifies trigonometric identities

+
+
+
trigsimp(sin(x)**4 - 2*cos(x)**2*sin(x)**2 + cos(x)**4)
+
+
+
+
+
+\[\displaystyle \frac{\cos{\left(4 x \right)}}{2} + \frac{1}{2}\]
+
+
+
+
+
trigsimp(sin(x)*tan(x)/sec(x))
+
+
+
+
+
+\[\displaystyle \sin^{2}{\left(x \right)}\]
+
+
+

the tutorial discusses some of the nuances of simplification of powers and special functions

+
+
+
+

Calculus#

+

Calculus operations are simple in SymPy

+
+

derivatives#

+
+
+
diff(cos(x), x)
+
+
+
+
+
+\[\displaystyle - \sin{\left(x \right)}\]
+
+
+
+
+
diff(exp(x**2), x)
+
+
+
+
+
+\[\displaystyle 2 x e^{x^{2}}\]
+
+
+

third derivative

+
+
+
diff(x**4, x, 3)
+
+
+
+
+
+\[\displaystyle 24 x\]
+
+
+

differentiate different variables

+
+
+
expr = exp(x*y*z)
+diff(expr, x, y, z)
+
+
+
+
+
+\[\displaystyle \left(x^{2} y^{2} z^{2} + 3 x y z + 1\right) e^{x y z}\]
+
+
+

unevaluated derivatives can be useful for building up ODEs and PDEs

+
+
+
deriv = Derivative(expr, x, y, z)
+deriv
+
+
+
+
+
+\[\displaystyle \frac{\partial^{3}}{\partial z\partial y\partial x} e^{x y z}\]
+
+
+
+
+
deriv.doit()
+
+
+
+
+
+\[\displaystyle \left(x^{2} y^{2} z^{2} + 3 x y z + 1\right) e^{x y z}\]
+
+
+
+
+

integrals#

+

definite and indefinite integrals are supported

+
+
+
integrate(cos(x), x)
+
+
+
+
+
+\[\displaystyle \sin{\left(x \right)}\]
+
+
+

definite integral – note the construction of the infinity

+
+
+
integrate(exp(-x), (x, 0, oo))
+
+
+
+
+
+\[\displaystyle 1\]
+
+
+

double integral

+
+
+
integrate(exp(-x**2 - y**2), (x, -oo, oo), (y, -oo, oo))
+
+
+
+
+
+\[\displaystyle \pi\]
+
+
+

if it is unable to do the integral, it returns an Integral object

+
+
+
expr = integrate(x**x, x)
+print(expr)
+expr
+
+
+
+
+
Integral(x**x, x)
+
+
+
+\[\displaystyle \int x^{x}\, dx\]
+
+
+
+
+
a = x / sqrt(x**4 + 10*x**2 - 96*x - 71)   # example from Wikipedia Risch algorithm page)
+a
+
+
+
+
+
+\[\displaystyle \frac{x}{\sqrt{x^{4} + 10 x^{2} - 96 x - 71}}\]
+
+
+
+
+
integrate(a, x)     # this has a known solution, but SymPy fails to find it
+
+
+
+
+
+\[\displaystyle \int \frac{x}{\sqrt{x^{4} + 10 x^{2} - 96 x - 71}}\, dx\]
+
+
+
+
+

limits#

+
+
+
limit(sin(x)/x, x, 0)
+
+
+
+
+
+\[\displaystyle 1\]
+
+
+
+
+

series expansions#

+
+
+
expr = exp(sin(x))
+a = expr.series(x, 0, 10)
+a
+
+
+
+
+
+\[\displaystyle 1 + x + \frac{x^{2}}{2} - \frac{x^{4}}{8} - \frac{x^{5}}{15} - \frac{x^{6}}{240} + \frac{x^{7}}{90} + \frac{31 x^{8}}{5760} + \frac{x^{9}}{5670} + O\left(x^{10}\right)\]
+
+
+
+
+
c = log(x).series(x, x0=1, n=6)
+c
+
+
+
+
+
+\[\displaystyle -1 - \frac{\left(x - 1\right)^{2}}{2} + \frac{\left(x - 1\right)^{3}}{3} - \frac{\left(x - 1\right)^{4}}{4} + \frac{\left(x - 1\right)^{5}}{5} + x + O\left(\left(x - 1\right)^{6}; x\rightarrow 1\right)\]
+
+
+
+
+
simplify(c.removeO())
+
+
+
+
+
+\[\displaystyle \frac{x^{5}}{5} - \frac{5 x^{4}}{4} + \frac{10 x^{3}}{3} - 5 x^{2} + 5 x - \frac{137}{60}\]
+
+
+
+
+
+

solvers#

+

solveset() is the main interface to solvers in SymPy. Note that it used to be solve(), but this has been replaced (see http://docs.sympy.org/latest/modules/solvers/solveset.html)

+

If no Eq() is done, then it is assumed to be equal to 0

+
+
+
solveset(x**2 - x, x)
+
+
+
+
+
+\[\displaystyle \left\{0, 1\right\}\]
+
+
+

you can restrict the domain of the solution (e.g. to reals). Recall that Z is the set of integers

+
+
+
solveset(sin(x) - 1, x, domain=S.Reals)
+
+
+
+
+
+\[\displaystyle \left\{2 n \pi + \frac{\pi}{2}\; \middle|\; n \in \mathbb{Z}\right\}\]
+
+
+
+

linear systems#

+

linsolve() is the interface to linear systems

+
+
+
linsolve([x - y + 2, x + y - 3], [x, y])
+
+
+
+
+
+\[\displaystyle \left\{\left( \frac{1}{2}, \ \frac{5}{2}\right)\right\}\]
+
+
+
+
+
linsolve([x + y + z - 1, x + y + 2*z - 3 ], (x, y, z))
+
+
+
+
+
+\[\displaystyle \left\{\left( - y - 1, \ y, \ 2\right)\right\}\]
+
+
+

roots will report if a solution is multiple by listing it multiple times

+
+
+
roots(x**3 - 6*x**2 + 9*x, x)
+
+
+
+
+
+\[\displaystyle \left\{ 0 : 1, \ 3 : 2\right\}\]
+
+
+

0 is 1 root, and 3 is 2 more roots

+
+
+

Differential equations#

+

you need an undefined function (f and g already are by our init_session() above, but we’ve probably reset these

+
+
+
f, g = symbols('f g', cls=Function)
+
+
+
+
+
+
+
f(x)
+
+
+
+
+
+\[\displaystyle f{\left(x \right)}\]
+
+
+
+
+
f(x).diff(x)
+
+
+
+
+
+\[\displaystyle \frac{d}{d x} f{\left(x \right)}\]
+
+
+
+
+
diffeq = Eq(f(x).diff(x, 2) - 2*f(x).diff(x) + f(x), sin(x))
+
+
+
+
+
+
+
diffeq
+
+
+
+
+
+\[\displaystyle f{\left(x \right)} - 2 \frac{d}{d x} f{\left(x \right)} + \frac{d^{2}}{d x^{2}} f{\left(x \right)} = \sin{\left(x \right)}\]
+
+
+
+
+
dsolve(diffeq, f(x))
+
+
+
+
+
+\[\displaystyle f{\left(x \right)} = \left(C_{1} + C_{2} x\right) e^{x} + \frac{\cos{\left(x \right)}}{2}\]
+
+
+
+
+

Matrices#

+

consider the Euler equations:

+
+\[q_t + A(q) q_x = 0\]
+

where

+
+\[\begin{split}q = \left ( \begin{array}{c} \rho \\ u \\ p \end{array} \right ) +\qquad +A(q) = \left ( \begin{array}{ccc} u & \rho & 0 \\ + 0 & u & 1/\rho \\ + 0 & c^2 \rho & u \end{array} \right ) \end{split}\]
+
+
+
from sympy.abc import rho
+rho, u, c = symbols('rho u c')
+A = Matrix([[u, rho, 0], [0, u, rho**-1], [0, c**2 * rho, u]])
+A
+
+
+
+
+
+\[\begin{split}\displaystyle \left[\begin{matrix}u & \rho & 0\\0 & u & \frac{1}{\rho}\\0 & c^{2} \rho & u\end{matrix}\right]\end{split}\]
+
+
+
+
+
A.row(0)
+
+
+
+
+
+\[\displaystyle \left[\begin{matrix}u & \rho & 0\end{matrix}\right]\]
+
+
+

The eigenvalues of the system are the speeds at which information propagates

+
+
+
A.eigenvals()
+
+
+
+
+
+\[\displaystyle \left\{ u : 1, \ - c + u : 1, \ c + u : 1\right\}\]
+
+
+

You can diagonalize it, such that +$\( A = PDP^{-1}\)$

+
+
+
P, D = A.diagonalize()
+
+
+
+
+

\(D\) will be a matrix of the eigenvalues

+
+
+
D
+
+
+
+
+
+\[\begin{split}\displaystyle \left[\begin{matrix}u & 0 & 0\\0 & - c + u & 0\\0 & 0 & c + u\end{matrix}\right]\end{split}\]
+
+
+

\(P\) will be the matrix of right eigenvectors

+
+
+
P
+
+
+
+
+
+\[\begin{split}\displaystyle \left[\begin{matrix}1 & \frac{1}{c^{2}} & \frac{1}{c^{2}}\\0 & - \frac{1}{c \rho} & \frac{1}{c \rho}\\0 & 1 & 1\end{matrix}\right]\end{split}\]
+
+
+

Inverse

+
+
+
A**-1
+
+
+
+
+
+\[\begin{split}\displaystyle \left[\begin{matrix}\frac{1}{u} & - \frac{\rho}{- c^{2} + u^{2}} & \frac{1}{- c^{2} u + u^{3}}\\0 & \frac{u}{- c^{2} + u^{2}} & - \frac{1}{- c^{2} \rho + \rho u^{2}}\\0 & - \frac{c^{2} \rho}{- c^{2} + u^{2}} & \frac{u}{- c^{2} + u^{2}}\end{matrix}\right]\end{split}\]
+
+
+
+
+
+

Units#

+

Sympy can attach units to numbers and propagate them through

+
+
+
from sympy.physics.units import newton, kilogram, meter, second, convert_to
+
+
+
+
+
+
+
F = 1 * kilogram * 9.81 * meter / second**2
+convert_to(F, newton)
+
+
+
+
+
+\[\displaystyle 9.81 \text{N}\]
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/06-sympy/sympy-exercises.html b/06-sympy/sympy-exercises.html new file mode 100644 index 00000000..d7f48f78 --- /dev/null +++ b/06-sympy/sympy-exercises.html @@ -0,0 +1,793 @@ + + + + + + + + + + + SymPy Exercises — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

SymPy Exercises#

+
+
+
import sympy as sym
+from sympy import init_session
+init_session()
+
+
+
+
+
IPython console for SymPy 1.14.0 (Python 3.14.3-64-bit) (ground types: python)
+
+These commands were executed:
+>>> from sympy import *
+>>> x, y, z, t = symbols('x y z t')
+>>> k, m, n = symbols('k m n', integer=True)
+>>> f, g, h = symbols('f g h', cls=Function)
+>>> init_printing()
+
+Documentation can be found at https://docs.sympy.org/1.14.0/
+
+
+
+
+
+

Q1: Creating an expression#

+

Create the expression:

+
+\[f = x e^{-x} + x (1-x)\]
+

Then evaluate it for

+
+\[x = 0, 0.1, 0.2, 0.4, 0.8\]
+
+
+

Q2: Factoring a polynomial, and finding its roots#

+

Factor

+
+\[x^{4} - 6 x^{3} + x^{2} + 24 x + 16\]
+

Then find its zeros.

+
+
+

Q3: Integratation and differentiation#

+

Integrate the function:

+
+\[f = \sin(x) e^{-x}\]
+

Then differentiate the result to see if you get back the original function

+
+
+

Q4: Parsing an expression#

+

Write a program that reads in a mathematical expression as a string (e.g., "sin(2*pi*x)"), converts it to a SymPy expression, and then evaluates it as needed.

+

Have your program either make a plot of the entered function, or use the input function as the function to fit a dataset to using curvefit.

+

The following will be helpful:

+

parse_expr() will convert a string into a SymPy expression

+
+
+
from sympy.parsing.sympy_parser import parse_expr
+
+
+
+
+
+
+
s = "sin(2*pi*x)"
+a = parse_expr(s)
+a
+
+
+
+
+../_images/bd2dc15da4e6fe950717320e2e27df939f63a85b567a3bd2dbf8a35f386abd83.png +
+
+

sympy.lambdify() will convert a SymPy expression into a function that is callable by python. You can make it a numpy-compatible function too (this means, e.g., that any sin() in your SymPy expression will be evaluate using np.sin())

+
+
+
f = sym.lambdify(x, a, "numpy")
+
+
+
+
+
+
+
f(1.0)
+
+
+
+
+../_images/433ba52e047896b8c7177f2df8930782d9cafe653b4234466b00034c22f8f4c7.png +
+
+
+
+
#help(lambdify)
+
+
+
+
+
+
+

Q5: Units#

+

SymPy can deal with physical units. See:

+

http://docs.sympy.org/latest/modules/physics/units/quantities.html

+

Let’s try this out. Newton’s 2nd law is

+
+\[F = ma\]
+

Create a mass of 1 kg and an acceleration of 10 m/s\(^2\), and compute the force, \(F\), and express the result in Newtons.

+

Note: the convert_to function was added in SymPy 1.1, so if you are using an earlier version, you will need to divide by the target unit to do the conversion.

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/06-sympy/sympy.html b/06-sympy/sympy.html new file mode 100644 index 00000000..17f9fc0b --- /dev/null +++ b/06-sympy/sympy.html @@ -0,0 +1,607 @@ + + + + + + + + + + + SymPy — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

SymPy

+ +
+
+ +
+
+
+ + + + +
+ +
+

SymPy#

+

SymPy is the symbolic math library for python. A key design feature +of it is that it can interoperate with all of the libraries we’ve +already seen.

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/09-packages/python-arguments.html b/09-packages/python-arguments.html new file mode 100644 index 00000000..6056209d --- /dev/null +++ b/09-packages/python-arguments.html @@ -0,0 +1,656 @@ + + + + + + + + + + + Command line arguments — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Command line arguments

+ +
+
+ +
+
+
+ + + + +
+ +
+

Command line arguments#

+

For standalone programs, we often want to have our program take +command line arguments that affect the runtime behavior of our +program. There are a variety of mechanisms to do this in python, but +the best option is the argparse +module.

+

Here’s an example of using argparse to take a variety of options:

+
#!/usr/bin/env python3
+
+# to get usage: use -h
+import argparse
+
+
+def setup_args():
+
+    # simple example of argparse
+
+    parser = argparse.ArgumentParser()
+    parser.add_argument("-a", help="the -a option", action="store_true")
+    parser.add_argument("-b", help="-b takes a number", type=int, default=0)
+    parser.add_argument("-c", help="-c takes a string", type=str, default=None)
+    parser.add_argument("--darg", help="the --darg option", action="store_true")
+    parser.add_argument("--earg", help="--earg takes a string", type=str, metavar="test",
+                        default="example string")
+
+    # extra arguments (positional)
+    parser.add_argument("extras", metavar="extra", type=str, nargs="*",
+                        help="optional positional arguments")
+
+    return parser.parse_args()
+
+
+if __name__ == "__main__":
+
+    args = setup_args()
+
+
+    if args.a:
+        print("-a set")
+    print(f"-b = {args.b}")
+    print(f"-c = {args.c}")
+    if args.darg:
+        print("--dargs set")
+    print(f"--earg value = {args.earg}")
+
+    print(" ")
+    print("extra positional arguments: ")
+    if len(args.extras) > 0:
+        for e in args.extras:
+            print(e)
+
+
+

A nice feature of argparse is that it automatically generates help for us. If +we place the above code in argparse_example.py then we can do:

+
python argparse_example.py --help
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/09-packages/python-modules.html b/09-packages/python-modules.html new file mode 100644 index 00000000..c1146234 --- /dev/null +++ b/09-packages/python-modules.html @@ -0,0 +1,707 @@ + + + + + + + + + + + Python Modules — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Python Modules

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Python Modules#

+

So far, we’ve been writing our code all in Jupyter. But when it comes +time to write code that we want to reuse, we want to put it into a +standalone *.py file.

+

Then we can load it on in python (or Jupyter) and use the capabilities +it provides or make it a standalone program that can be run from the +command line.

+
+

Tip

+

Jupyter is great for interactive explorations and sharing your workflow with others +in a self-contained way. But if there is an operation that you do over and over, +you should put it into a separate module that you import. That way you only need to +maintain and debug a single instance of the function, and all your workflows can reuse it.

+
+
+

Editors#

+

There are a number of popular editors for writing python source. Some +popular ones include:

+ +
+
+

Standalone module#

+

Here’s a very simply module (lets call it hello.py):

+
def hello():
+    print("hello")
+
+if __name__ == "__main__":
+    hello()
+
+
+

There are two ways we can use this.

+
    +
  • Inside of python (or IPython), we can do:

    +
    import hello
    +hello.hello()
    +
    +
    +
  • +
  • From the command line, we can do:

    +
    python hello.py
    +
    +
    +
  • +
+

Additionally, on a Unix system, we can add:

+
#!/usr/bin/env python3
+
+
+

to the top and then mark the file as executable, via:

+
chmod a+x hello.py
+
+
+

allowing us to execute it simply as:

+
./hello.py
+
+
+
+

Hint

+

Here we see how the __name__ variable is treated by python:

+
    +
  • If we import our module into python, then __name__ is set to the module name

  • +
  • If we run the module from the command line, then __name__ is set to __main__

  • +
+
+
+
+

Changing module contents#

+

If we make changes to our module file, then we need to re-import it. This can be done as:

+
import importlib
+example = importlib.reload(example)
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/09-packages/python-more-modules.html b/09-packages/python-more-modules.html new file mode 100644 index 00000000..f11aedc9 --- /dev/null +++ b/09-packages/python-more-modules.html @@ -0,0 +1,646 @@ + + + + + + + + + + + Module Paths — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Module Paths

+ +
+
+ +
+
+
+ + + + +
+ +
+

Module Paths#

+

How does python find modules? It has a search order:

+
    +
  • current directory

  • +
  • PYTHONPATH environment variable (this follows the same format as +the shell PATH environment variable)

  • +
  • System-wide python installation default path (usually has a +site-packages directory)

  • +
+

We can look at the path via sys.path. On my machine I get:

+
['/home/zingale/.local/bin',
+ '/home/zingale/classes/python-science/content/09-packages',
+ '/home/zingale/classes/numerical_exercises',
+ '/home/zingale/classes/astro_animations',
+ '/usr/lib64/python312.zip',
+ '/usr/lib64/python3.12',
+ '/usr/lib64/python3.12/lib-dynload',
+ '',
+ '/home/zingale/.local/lib/python3.12/site-packages',
+ '/usr/lib64/python3.12/site-packages',
+ '/usr/lib/python3.12/site-packages']
+
+
+
+
+

Note

+

You can explicitly add paths to the sys.path by setting the PYTHONPATH +environment variable.

+
+

Notice that the general places that it looks are in ~/.local and in +/usr. The first is the user-specific path—you can install things +here without admin privileges. The second is a system-wide path.

+

You can find your user-specific path via:

+
python3 -m site --user-site
+
+
+

on my machine, this gives:

+
/home/zingale/.local/lib/python3.12/site-packages
+
+
+
+

Tip

+

Using PYTHONPATH to quickly add a module to your search path is an easy hack, +but if you are developing a library that will be used by others, it is better +to make the modules installable to the system search paths. This is where +packaging comes into play.

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/09-packages/python-packages.html b/09-packages/python-packages.html new file mode 100644 index 00000000..2a14b8fc --- /dev/null +++ b/09-packages/python-packages.html @@ -0,0 +1,801 @@ + + + + + + + + + + + Packaging — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Packaging

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Packaging#

+

Let’s look at the structure of creating an installable python package.

+
+

Note

+

The python packaging system is constantly evolving, and the current recommendations +of tools is list here: https://packaging.python.org/en/latest/guides/tool-recommendations/

+
+

xkcd comic on python packaging chaos

+

(from https://xkcd.com)

+
+

Our example#

+

We’ll work on an example that builds on the Mandelbrot set exercise +from our matplotlib discussion. Our example is hosted here:

+

sbu-python-class/mymodule

+

On your local computer, if you have git installed, you can clone this via:

+
git clone https://github.com/sbu-python-class/mymodule.git
+
+
+

The directory structure appears as:

+
mymodule/
+├── mymodule
+│   ├── __init__.py
+│   └── mandel.py
+├── pyproject.toml
+└── README.md
+
+
+

This is a rather common way of structuring a project:

+
    +
  • The top-level mymodule directory is not part of the python +package, but instead is where the source control (e.g. git) begins, +and also hosts setup files that are used for installation

  • +
  • mymodule/mymodule is the actual python module that we will load.

    +
    +

    Important

    +

    To make python recognize this as a module, we need an __init__.py +file there—it can be completely empty.

    +
    +
  • +
  • The actual *.py files that make up our module are in mymodule/mymodule

  • +
+

Right now, this package does not appear in our python search path, so +the only way to load it is to work in the top-level mymodule/ +directory, and then we can do:

+
import mymodule.mandel
+
+
+

we could also do:

+
from mymodule.mandel import mandelbrot
+
+
+
+
+

setuptools#

+

A popular set of packages are:

+
    +
  • Installation:

    +
      +
    • pip to install packages from PyPI

    • +
    • conda for disctribution cross-platform software stacks

    • +
    +
  • +
  • Packaging tools:

    +
      +
    • setuptools to create source distributions

    • +
    • build for binary distributions

    • +
    • twine to upload to PyPI

    • +
    +
  • +
+

We’ll look at how to use setuptools to package our library.

+
+

Note

+

A lot of setuptools documentation is out-of-date and +inconsistent with the packaging guidelines.

+

Packages used to create a setup.py file that had all of the project information, +but this is deprecated. Instead we should create a +pyproject.toml file—this +is consistent with PEP 517.

+
+

Here’s a first pyproject.toml:

+
[build-system]
+requires = ["setuptools"]
+build-backend = "setuptools.build_meta"
+
+[project]
+name = "mymodule"
+description = "test module for PHY 546"
+readme = "README.md"
+license.text = "BSD"
+version="0.1.0"
+authors = [
+  {name="Michael Zingale"},
+  {email="michael.zingale@stonybrook.edu"},
+]
+
+dependencies = [
+  "numpy",
+  "matplotlib",
+]
+
+
+

Some notes:

+
    +
  • We have a [build-system] table that specifies the build tool. +Here we choose setuptools.

  • +
  • We have a lot of metadata for our project defined in the [project] +table.

  • +
  • We also list the dependencies of our project in the [project] table. +This will allow the installer to install any missing packages that are +required.

  • +
+

There are many additional options to specify how to find files that +are part of the project as well as data files, etc.

+
+

Tip

+

pyproject.toml also allows you to specify defaults for tools, like +pylint, flake8, and others with a [tool.X] subtable.

+
+
+

Note

+

Some projects also contain a setup.cfg +file when using setuptools. This is +usually not needed, since we can put everything +in the [project] table.

+
+
+
+

Installing#

+

We can now install simply as:

+
pip install .
+
+
+
+

Tip

+

Look in your .local/lib/python3.12/site-packages directory, and you’ll +see the module there.

+
+

If instead, we want to install in a way that still allows us to edit the source, +we can install as “editable” via:

+
pip install -e .
+
+
+

To uninstall, we can do:

+
pip uninstall mymodule
+
+
+

in a directory outside of our project (otherwise, pip may get confused).

+
+
+

Using our module#

+

Once the module is installed, we can use it from any directory. For example, if we do:

+
import mymodule
+print(mymodule.__file__)
+
+
+

it shows us where the module is installed on our system. In my case, it is:

+
/home/zingale/.local/lib/python3.12/site-packages/mymodule-0.1.0-py3.12.egg/mymodule/__init__.py
+
+
+

Let’s generate a plot:

+
from mymodule.mandel import mandelbrot
+fig = mandelbrot(128)
+fig.savefig("test.png")
+
+
+

This produces the plot shown below:

+

sample Mandelbrot set image using 128x128 points

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/09-packages/python-tools.html b/09-packages/python-tools.html new file mode 100644 index 00000000..e184db22 --- /dev/null +++ b/09-packages/python-tools.html @@ -0,0 +1,683 @@ + + + + + + + + + + + Tools to Make Your Life Easier — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Tools to Make Your Life Easier

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Tools to Make Your Life Easier#

+
+

Version control#

+

Generally, you should put your project into version control. The most widely used +package today is git. +git will track the changes you make to your code, allow you to revert changes, collaboratively +develop with others, work on several different features independently from one another while +keeping the main codebase clean and more.

+

git is often used together with github, which provides a web-based view +of your source code and provides additional mechanisms for collaboration.

+

A nice introduction to git/github is provided by the Software +Carpentry Version Control with Git +lesson.

+
+
+

Code checkers#

+

There are a number of tools that help check code for formatting and +syntax errors that are quite useful for developers. Many projects +automatically enforce these tools on changes submitted to github.

+
+

Tip

+

Many editors have plugins that can automatically run these tools +as your write your code.

+
+
    +
  • flake8

    +

    flake8 is a checker for PEP 8 +style conformance. You can turn off checks that you don’t like +via a .flake8 +file.

    +
  • +
  • pylint

    +

    pylint is a static code analyzer. It can find errors and also suggest improvements +to your code. You can generate a configuration file +to customize its behavior (or add a section to pyproject.toml).

    +
  • +
  • black

    +

    black is an uncompromising code formatted. It will automatically rewrite your code +based on PEP-8 style.

    +
  • +
  • pyupgrade

    +

    pyupgrade will upgrade source to a later python standard, making +use of new features where available. For instance, you can run as:

    +
    pyupgrade --py39-plus file.py
    +
    +
    +

    to update to python 3.9 support.

    +
  • +
  • isort

    +

    isort simply sorts the module imports at the top of your modules, +grouping the standard python ones together followed by +package-specific ones.

    +
  • +
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/10-testing/more-pytest.html b/10-testing/more-pytest.html new file mode 100644 index 00000000..eddce424 --- /dev/null +++ b/10-testing/more-pytest.html @@ -0,0 +1,777 @@ + + + + + + + + + + + More pytest — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

More pytest

+ +
+ +
+
+ + + + +
+ +
+

More pytest#

+

Unit tests sometimes require some setup to be done before the test is run. +Fixtures provide this capability, allowing tests to run with a consistent +environment and data.

+

Standard pytest fixtures are written as functions with the @pytest.fixture +decorator:

+
@pytest.fixture
+def message():
+    return "Hello world!"
+
+
+

A fixture may return an object, which will be passed to any function +that requests it, or it may just do some setup tasks (like creating a file or +connecting to a database).

+

Test functions can request a fixture by specifying a parameter with the same +name as the fixture:

+
def test_split(message):
+    assert len(message.split()) == 2
+
+
+

An alternate method for initializing test state is with explicit setup/teardown +functions, which we’ll look at a bit later. This is a style that’s available in +many other languages as well: see https://en.wikipedia.org/wiki/XUnit.

+
+

Fixtures examples#

+

Fixtures are reusable across different tests. This lets us avoid repeating the +same setup code in multiple places, especially as we add more tests or need +more complicated inputs.

+

Here are some tests for the Item class that use fixtures, adapted from the +shopping cart exercise. The full code is available +here +on the github repository for this site. You can download this file and run +the tests with pytest -v test_item.py.

+

All the fixtures that a test depends on will run once for each test. +This gives each test a fresh copy of the data, so any changes made to the +fixture results inside a test won’t impact other tests.

+

We can also test that a function raises specific exceptions with pytest.raises:

+
+

Fixtures can request other fixtures#

+

This is useful to split up complex initialization into smaller parts. +A fixture can also modify the results of the fixtures it requests, which will +be visible to anything that includes the fixture.

+

Here is a set of tests that show how this can be used (test_list.py):

+
import pytest
+
+@pytest.fixture
+def numbers():
+    return []
+
+@pytest.fixture
+def append_1(numbers):
+    numbers.append(1)
+
+@pytest.fixture
+def append_2(numbers, append_1):
+    numbers.append(2)
+
+
+

Note that append_1() and append_2() only modify numbers, and don’t return +anything. append_2() requires append_1, to make sure they are run in the +right order.

+

This test only requires numbers, so it will receive an empty list:

+
def test_initial(numbers):
+    assert numbers == []
+
+
+

This test requires append_1, but not append_2:

+
def test_append_1(numbers, append_1):
+    assert numbers == [1]
+
+
+

This test requires append_2, which itself pulls in append_1:

+
def test_append_2(numbers, append_2):
+    assert numbers == [1, 2]
+
+
+
+
+
+

Example class#

+

It is common to use a class to organize a set of related unit tests. This is +not a full-fledged class – it simply helps to organize tests and data. In particular, +there is no constructor, __init__(). See https://stackoverflow.com/questions/21430900/py-test-skips-test-class-if-constructor-is-defined

+

We’ll look at an example with a NumPy array

+ +

Here’s an example:

+
# a test class is useful to hold data that we might want set up
+# for every test.
+
+import numpy as np
+from numpy.testing import assert_array_equal
+
+class TestClassExample:
+    @classmethod
+    def setup_class(cls):
+        """ this is run once for each class, before any tests """
+        pass
+
+    @classmethod
+    def teardown_class(cls):
+        """ this is run once for each class, after all tests """
+        pass
+
+    def setup_method(self):
+        """ this is run before each of the test methods """
+        self.a = np.arange(24).reshape(6, 4)
+
+    def teardown_method(self):
+        """ this is run after each of the test methods """
+        pass
+
+    def test_max(self):
+        assert self.a.max() == 23
+
+    def test_flat(self):
+        assert_array_equal(self.a.flat, np.arange(24))
+
+
+
+

Note

+

Here we see the @classmethod decorator. +This means that the function receives the class itself as the first argument rather than an instance, +e.g., self.

+
+

Put this into a file called test_class.py and then we can run as:

+
pytest -v
+
+
+
+

Quick Exercise

+

Try adding a new test that modifies self.a, above test_max(). +Does this behave as you expect? What happens if you move the array creation +into setup_class() instead?

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/10-testing/pytest.html b/10-testing/pytest.html new file mode 100644 index 00000000..df338135 --- /dev/null +++ b/10-testing/pytest.html @@ -0,0 +1,736 @@ + + + + + + + + + + + pytest — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

pytest

+ +
+ +
+
+ + + + +
+ +
+

pytest#

+

pytest is a unit testing framework for python code.

+

Basic elements:

+
    +
  • Discoverability: it will find the tests

  • +
  • Automation

  • +
  • Fixtures (setup and teardown)

  • +
+
+

Installing#

+

You can install pytest for a single user as:

+
pip install pytest
+
+
+

This should put pytest in your search path, likely in ~/.local/bin.

+

If you want to generate coverage reports, you should also install pytest-cov:

+
pip install pytest-cov
+
+
+
+
+

Test discovery#

+

Adhering to these naming conventions will ensure that your tests are automatically found:

+
    +
  • File names should start or end with “test”:

    +
      +
    • test_example.py

    • +
    • example_test.py

    • +
    +
  • +
  • For tests in a class, the class name should begin with Test

    +
      +
    • e.g., TestExample

    • +
    • There should be no __init__()

    • +
    +
  • +
  • Test method / function names should start with test_

    +
      +
    • e.g., test_example()

    • +
    +
  • +
+
+
+

Assertions#

+

Tests use assertions (via python’s assert statement) to check behavior at runtime

+
    +
  • https://docs.python.org/3/reference/simple_stmts.html#assert

  • +
  • Basic usage: assert expression

    +
      +
    • Raises AssertionError if expression is not true

    • +
    • e.g., assert 1 == 0 will fail with an exception

    • +
    +
  • +
  • pytest does some magic under the hood to add more details about what +exactly went wrong, which we will see below

  • +
+
+
+

Simple pytest example#

+

Create a file named test_simple.py with the following content:

+
def multiply(a, b):
+    return a*b
+
+def test_multiply():
+    assert multiply(4, 6) == 24
+
+def test_multiply2():
+    assert multiply(5, 6) == 2
+
+
+

then we can run the tests as:

+
pytest -v
+
+
+

and we get the output:

+
============================= test session starts ==============================
+platform linux -- Python 3.11.3, pytest-7.2.2, pluggy-1.0.0 -- /usr/bin/python3
+cachedir: .pytest_cache
+rootdir: /home/zingale/temp/pytest
+plugins: anyio-3.6.2
+collected 2 items                                                              
+
+test_simple.py::test_multiply PASSED                                     [ 50%]
+test_simple.py::test_multiply2 FAILED                                    [100%]
+
+=================================== FAILURES ===================================
+________________________________ test_multiply2 ________________________________
+
+    def test_multiply2():
+>       assert multiply(5, 6) == 2
+E       assert 30 == 2
+E        +  where 30 = multiply(5, 6)
+
+test_simple.py:8: AssertionError
+=========================== short test summary info ============================
+FAILED test_simple.py::test_multiply2 - assert 30 == 2
+========================= 1 failed, 1 passed in 0.04s ==========================
+
+
+

this is telling us that one of our tests has failed.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/10-testing/real-world-example.html b/10-testing/real-world-example.html new file mode 100644 index 00000000..c012bf69 --- /dev/null +++ b/10-testing/real-world-example.html @@ -0,0 +1,712 @@ + + + + + + + + + + + Real World Example — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Real World Example

+ +
+ +
+
+ + + + +
+ +
+

Real World Example#

+

Let’s look at the testing in a larger python package. We’ll use our +group’s python hydrodynamics code, pyro, as a test:

+

python-hydro/pyro2

+
+

Installing#

+

We need to install the package first, via the setup.py:

+
python setup.py install --user
+
+
+

or alternately as

+
pip install .
+
+
+
+
+

Running the tests#

+

We can run the tests via:

+
pytest -v pyro
+
+
+
+
+

Using notebooks as tests#

+

Sometimes we want to use Jupyter notebooks as tests themselves—this +is enabled via the nbval plugin. In +this way, pytest will execute the cells in the notebook and compare +the result to the result stored in the notebook. If they agree, then +the test passes.

+

Sometimes there’s a particular cell that we don’t want to be part of the +testing—we can disable these on a cell-by-cell basis by adding +tags to a cell.

+

We can test notebooks as:

+
pytest -v --nbval pyro
+
+
+
+
+

Coverage report#

+

The pytest-cov plugin enables the generation +of a coverage report. This will tell you what fraction of each python file was tested. +We run this as:

+
pytest -v --cov=pyro --nbval pyro
+
+
+

We can also generate a more detailed interactive report with

+
coverage html
+
+
+
+
+

Other types of tests#

+

Unit tests are only one form of testing—they test a function in +isolation of others. Sometimes we need to test everything working together. +For scientific codes, regression testing is often used. The basic workflow +is:

+
    +
  • Start with the project working in a way you are happy with

  • +
  • Store the output of one (or more) runs as a benchmark.

  • +
  • Each time you make changes, run the code and compare the new output +to the stored benchmark.

    +
      +
    • If there are no differences, then your changes are likely good +(but there is always the case of some feature not being tested).

    • +
    • If there are differences, then either you introduced a bug, in which +case you should fix it, or you fixed a bug, in which case you should +update the benchmarks.

    • +
    +
  • +
+

For our example code, pyro, the regression test runs simulations using +all the different solvers and compares against the stored output, zone-by-zone +for any differences. The comparison itself is built into the main driver +of the code and can be invoked as:

+
./pyro/test.py
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/10-testing/testing.html b/10-testing/testing.html new file mode 100644 index 00000000..e32460e7 --- /dev/null +++ b/10-testing/testing.html @@ -0,0 +1,687 @@ + + + + + + + + + + + Testing — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Testing

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Testing#

+

Testing is an integral part of the software development process. We want to catch +mistakes early, before they go on to affect our results.

+
+

Types of testing#

+

There are a lot of different types of software testing that exist. +Most commonly, for scientific codes, we hear about:

+
    +
  • Unit testing : Tests that a single function does what it was designed to do

  • +
  • Integration testing : Tests whether the individual pieces work together as intended. +Sometimes done one piece at a time (iteratively)

  • +
  • Regression testing : Checks whether code changes have changed answers

  • +
  • Verification & Validation (from the science perspective)

    +
      +
    • Verification: are we solving the equations correctly?

    • +
    • Validation: are we solving the correct equations?

    • +
    +
  • +
+
+
+

Automating testing#

+

The best testing is automated. Github provides a continuous integration service that can +be run on pull requests. You write a short definition (a Github workflow) that tells Github +how to run your tests and then any time there is a change, the tests are run.

+
+
+

Unit testing#

+
    +
  • When to write tests?

    +
      +
    • Some people advocate writing a unit test for a specification +before you write the functions they will test

      + +
    • +
    • This helps you understand the interface, return values, +side-effects, etc. of what you intend to write

    • +
    +
  • +
  • Often we already have code, so we can start by writing tests to +cover some core functionality

    +
      +
    • Add new tests when you encounter a bug, precisely to ensure that +this bug doesn’t arise again

    • +
    +
  • +
  • Tests should be short and simple

    +
      +
    • You want to be able to run them frequently

    • +
    • The more granular your tests are, the easier it will be to track down bugs

    • +
    +
  • +
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/gradient-descent.html b/11-machine-learning/gradient-descent.html new file mode 100644 index 00000000..5025d733 --- /dev/null +++ b/11-machine-learning/gradient-descent.html @@ -0,0 +1,851 @@ + + + + + + + + + + + Gradient Descent — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Gradient Descent

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Gradient Descent#

+

Gradient descent is a simple algorithm for finding the minimum of a function of multiple variables. It works on the principle of looking at the local gradient of a function then then moving in the direction where it decreases the fastest.

+
+

Warning

+

There is no guarantee that you arrive at the global minimum instead of a local minimum.

+
+

Given a function \(f({\bf x})\), where \({\bf x} = (x_0, x_1, \ldots, x_{N-1})\), +the idea is to first compute the derivative:

+
+\[\partial f / \partial {\bf x} = (\partial f/\partial x_0, \partial f/\partial x_1, \ldots, \partial f/\partial x_{N-1})\]
+

and then move in the opposite direction by some fraction, \(\eta\):

+
+\[{\bf x} \leftarrow {\bf x} - \eta \frac{\partial f}{\partial {\bf x}}\]
+

There are different ways to define what \(\eta\) should be, but we’ll use a fixed value. We’ll call \(\eta\) the learning rate.

+

Let’s demonstrate this.

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Test function#

+

The Rosenbrock function +or the banana function is a very difficult problem for minimization. It +has the form:

+
+\[f(x, y) = (a - x)^2 + b (y - x^2)^2\]
+

and for \(a = 1\) and \(b = 100\), the minimimum is at a point \((a, a^2)\).

+
+
+
def rosenbrock(x0, x1, a, b):
+    return (a - x0)**2 + b*(x1 - x0**2)**2
+
+def drosdx(x, a, b):
+    x0 = x[0]
+    x1 = x[1]
+    return np.array([-2.0*(a - x0) - 4.0*b*(x1 - x0**2)*x0,
+                     2.0*b*(x1 - x0**2)])
+
+
+
+
+

Let’s plot the function

+
+
+
xmin = -2.0
+xmax = 2.0
+ymin = -1.0
+ymax = 3.0
+
+
+
+
+
+
+
a = 1.0
+b = 100.0
+
+
+
+
+
+
+
N = 256
+x = np.linspace(xmin, xmax, N)
+y = np.linspace(ymin, ymax, N)
+
+x2d, y2d = np.meshgrid(x, y, indexing="ij")
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+
+im = ax.imshow(np.log10(np.transpose(rosenbrock(x2d, y2d, a, b))),
+               origin="lower", extent=[xmin, xmax, ymin, ymax])
+
+fig.colorbar(im, ax=ax)
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7f39f95b3a10>
+
+
+a heat-map plot of the banana function +
+
+
+
+

Implementing gradient descent#

+

Let’s start with an initial guess. We’ll keep guessing until the change in the solution is small.

+

Note: our success is very sensitive to our choice of \(\eta\).

+
+
+
x0 = np.array([-1.0, 1.5])
+
+
+
+
+

We’ll set a tolerance and keep iterating until the change in the solution, dx is small

+
+
+
def do_descent(dfdx, x0, eps=1.e-5, eta=2.e-3, args=None, ax=None):
+
+    # dx will be the change in the solution -- we'll iterate until this
+    # is small
+    dx = 1.e30
+    xp_old = x0.copy()
+
+    if args:
+        grad = dfdx(xp_old, *args)
+    else:
+        grad = dfdx(xp_old)
+
+    while dx > eps:
+
+        xp = xp_old - eta * grad
+        
+        if ax:
+            ax.plot([xp_old[0], xp[0]], [xp_old[1], xp[1]], color="C1")
+            
+        dx = np.linalg.norm(xp - xp_old)
+        
+        if args:
+            grad_new = dfdx(xp, *args)
+        else:
+            grad_new = dfdx(xp)
+            
+        #eta_new = np.abs(np.transpose(xp) @ (grad_new - grad)) / np.linalg.norm(grad_new - grad)**2
+        #eta = min(10*eta, eta_new)
+        
+        grad = grad_new
+        
+        xp_old[:] = xp
+
+
+
+
+
+
+
do_descent(drosdx, x0, args=(a, b), ax=ax)
+
+
+
+
+
+
+
fig
+
+
+
+
+a heat-map of the banana function with the gradient descent trajectory plotted +
+
+
+
+

momentum#

+

A variation on gradient descent is to add “momentum” +to the update. This means that the correct depends +on the past gradients as well as the current one, +via some combination. This has the effect of reducing +the zig-zag effect that we see in our attempt above.

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/gradient-descent.html.backup b/11-machine-learning/gradient-descent.html.backup new file mode 100644 index 00000000..1f31415e --- /dev/null +++ b/11-machine-learning/gradient-descent.html.backup @@ -0,0 +1,853 @@ + + + + + + + + + + + Gradient Descent — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Gradient Descent

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Gradient Descent#

+

Gradient descent is a simple algorithm for finding the minimum of a function of multiple variables. It works on the principle of looking at the local gradient of a function then then moving in the direction where it decreases the fastest.

+
+

Warning

+

There is no guarantee that you arrive at the global minimum instead of a local minimum.

+
+

Given a function \(f({\bf x})\), where \({\bf x} = (x_0, x_1, \ldots, x_{N-1})\), +the idea is to first compute the derivative:

+
+\[\partial f / \partial {\bf x} = (\partial f/\partial x_0, \partial f/\partial x_1, \ldots, \partial f/\partial x_{N-1})\]
+

and then move in the opposite direction by some fraction, \(\eta\):

+
+\[{\bf x} \leftarrow {\bf x} - \eta \frac{\partial f}{\partial {\bf x}}\]
+

There are different ways to define what \(\eta\) should be, but we’ll use a fixed value. We’ll call \(\eta\) the learning rate.

+

Let’s demonstrate this.

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+

Test function#

+

The Rosenbrock function +or the banana function is a very difficult problem for minimization. It +has the form:

+
+\[f(x, y) = (a - x)^2 + b (y - x^2)^2\]
+

and for \(a = 1\) and \(b = 100\), the minimimum is at a point \((a, a^2)\).

+
+
+
def rosenbrock(x0, x1, a, b):
+    return (a - x0)**2 + b*(x1 - x0**2)**2
+
+def drosdx(x, a, b):
+    x0 = x[0]
+    x1 = x[1]
+    return np.array([-2.0*(a - x0) - 4.0*b*(x1 - x0**2)*x0,
+                     2.0*b*(x1 - x0**2)])
+
+
+
+
+

Let’s plot the function

+
+
+
xmin = -2.0
+xmax = 2.0
+ymin = -1.0
+ymax = 3.0
+
+
+
+
+
+
+
a = 1.0
+b = 100.0
+
+
+
+
+
+
+
N = 256
+x = np.linspace(xmin, xmax, N)
+y = np.linspace(ymin, ymax, N)
+
+x2d, y2d = np.meshgrid(x, y, indexing="ij")
+
+
+
+
+
+
+
fig, ax = plt.subplots()
+
+im = ax.imshow(np.log10(np.transpose(rosenbrock(x2d, y2d, a, b))),
+               origin="lower", extent=[xmin, xmax, ymin, ymax])
+
+fig.colorbar(im, ax=ax)
+# alt-text: a heat-map plot of the banana function
+
+
+
+
+
<matplotlib.colorbar.Colorbar at 0x7f39f95b3a10>
+
+
+../_images/b59abeb56bbd6be6c26cb8b33dbf9c2044a5bf2811adf7cb6f93af01d1c1da38.png +
+
+
+
+

Implementing gradient descent#

+

Let’s start with an initial guess. We’ll keep guessing until the change in the solution is small.

+

Note: our success is very sensitive to our choice of \(\eta\).

+
+
+
x0 = np.array([-1.0, 1.5])
+
+
+
+
+

We’ll set a tolerance and keep iterating until the change in the solution, dx is small

+
+
+
def do_descent(dfdx, x0, eps=1.e-5, eta=2.e-3, args=None, ax=None):
+
+    # dx will be the change in the solution -- we'll iterate until this
+    # is small
+    dx = 1.e30
+    xp_old = x0.copy()
+
+    if args:
+        grad = dfdx(xp_old, *args)
+    else:
+        grad = dfdx(xp_old)
+
+    while dx > eps:
+
+        xp = xp_old - eta * grad
+        
+        if ax:
+            ax.plot([xp_old[0], xp[0]], [xp_old[1], xp[1]], color="C1")
+            
+        dx = np.linalg.norm(xp - xp_old)
+        
+        if args:
+            grad_new = dfdx(xp, *args)
+        else:
+            grad_new = dfdx(xp)
+            
+        #eta_new = np.abs(np.transpose(xp) @ (grad_new - grad)) / np.linalg.norm(grad_new - grad)**2
+        #eta = min(10*eta, eta_new)
+        
+        grad = grad_new
+        
+        xp_old[:] = xp
+
+
+
+
+
+
+
do_descent(drosdx, x0, args=(a, b), ax=ax)
+
+
+
+
+
+
+
fig
+# alt-text: a heat-map of the banana function with the gradient descent trajectory plotted
+
+
+
+
+../_images/14a55c4b37454039b454f3503c5f615e6dccb3f245e259af494d20119331fbe7.png +
+
+
+
+

momentum#

+

A variation on gradient descent is to add “momentum” +to the update. This means that the correct depends +on the past gradients as well as the current one, +via some combination. This has the effect of reducing +the zig-zag effect that we see in our attempt above.

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/keras-clustering.html b/11-machine-learning/keras-clustering.html new file mode 100644 index 00000000..6f802018 --- /dev/null +++ b/11-machine-learning/keras-clustering.html @@ -0,0 +1,1509 @@ + + + + + + + + + + + Clustering — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Clustering

+ +
+
+ +
+
+
+ + + + +
+ +
+

Clustering#

+

Clustering seeks to group data into clusters based on their properties and then allow us to predict which cluster a new member belongs.

+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+

We’ll use a dataset generator that is part of scikit-learn called make_moons. This generates data that falls into 2 different sets with a shape that looks like half-moons.

+
+
+
from sklearn import datasets
+
+
+
+
+
+
+
def generate_data():
+    xvec, val = datasets.make_moons(200, noise=0.2)
+
+    # encode the output to be 2 elements
+    x = []
+    v = []
+    for xv, vv in zip(xvec, val):
+        x.append(np.array(xv))
+        v.append(vv)
+
+    return np.array(x), np.array(v)
+
+
+
+
+
+
+
x, v = generate_data()
+
+
+
+
+

Let’s look at a point and it’s value

+
+
+
print(f"x = {x[0]}, value = {v[0]}")
+
+
+
+
+
x = [0.29463213 0.16881306], value = 1
+
+
+
+
+

Now let’s plot the data

+
+
+
def plot_data(x, v):
+    xpt = [q[0] for q in x]
+    ypt = [q[1] for q in x]
+
+    fig, ax = plt.subplots()
+    ax.scatter(xpt, ypt, s=40, c=v, cmap="viridis")
+    ax.set_aspect("equal")
+    return fig
+
+
+
+
+
+
+
fig = plot_data(x, v)
+
+
+
+
+../_images/493bfaaba447acc8b31ece91f13bcf936db00f5924f8ae6fb3c6aae858f6a917.png +
+
+

We want to partition this domain into 2 regions, such that when we come in with a new point, we know which group it belongs to.

+

First we setup and train our network

+
+
+
from keras.models import Sequential
+from keras.layers import Dense, Dropout, Activation, Input
+from keras.optimizers import RMSprop
+
+
+
+
+
+
+
model = Sequential()
+model.add(Input(shape=(2,)))
+model.add(Dense(50, activation="relu"))
+model.add(Dense(20, activation="relu"))
+model.add(Dense(1, activation="sigmoid"))
+
+
+
+
+
+
+
rms = RMSprop()
+model.compile(loss='binary_crossentropy',
+              optimizer=rms, metrics=['accuracy'])
+
+
+
+
+
+
+
model.summary()
+
+
+
+
+
Model: "sequential"
+
+
┏━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━┳━━━━━━━━━━━━━━━━━━━━━━━━┳━━━━━━━━━━━━━━━┓
+┃ Layer (type)                     Output Shape                  Param # ┃
+┡━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━╇━━━━━━━━━━━━━━━━━━━━━━━━╇━━━━━━━━━━━━━━━┩
+│ dense (Dense)                   │ (None, 50)             │           150 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dense_1 (Dense)                 │ (None, 20)             │         1,020 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dense_2 (Dense)                 │ (None, 1)              │            21 │
+└─────────────────────────────────┴────────────────────────┴───────────────┘
+
+
 Total params: 1,191 (4.65 KB)
+
+
 Trainable params: 1,191 (4.65 KB)
+
+
 Non-trainable params: 0 (0.00 B)
+
+
+
+

We seem to need a lot of epochs here to get a good result

+
+
+
epochs = 100
+results = model.fit(x, v, batch_size=50, epochs=epochs, verbose=2)
+
+
+
+
+
Epoch 1/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.5350 - loss: 0.6916
+
+
+
Epoch 2/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.7300 - loss: 0.6570
+
+
+
Epoch 3/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.7850 - loss: 0.6319
+
+
+
Epoch 4/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8250 - loss: 0.6098
+
+
+
Epoch 5/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8300 - loss: 0.5884
+
+
+
Epoch 6/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8500 - loss: 0.5682
+
+
+
Epoch 7/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8450 - loss: 0.5498
+
+
+
Epoch 8/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8500 - loss: 0.5315
+
+
+
Epoch 9/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8550 - loss: 0.5147
+
+
+
Epoch 10/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8550 - loss: 0.4982
+
+
+
Epoch 11/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8550 - loss: 0.4827
+
+
+
Epoch 12/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8600 - loss: 0.4680
+
+
+
Epoch 13/100
+
+
+
4/4 - 0s - 25ms/step - accuracy: 0.8600 - loss: 0.4539
+
+
+
Epoch 14/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8600 - loss: 0.4407
+
+
+
Epoch 15/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8600 - loss: 0.4274
+
+
+
Epoch 16/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8600 - loss: 0.4153
+
+
+
Epoch 17/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8600 - loss: 0.4036
+
+
+
Epoch 18/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8600 - loss: 0.3930
+
+
+
Epoch 19/100
+
+
+
4/4 - 0s - 12ms/step - accuracy: 0.8600 - loss: 0.3825
+
+
+
Epoch 20/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8550 - loss: 0.3733
+
+
+
Epoch 21/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8550 - loss: 0.3645
+
+
+
Epoch 22/100
+
+
+
4/4 - 0s - 7ms/step - accuracy: 0.8550 - loss: 0.3571
+
+
+
Epoch 23/100
+
+
+
4/4 - 0s - 7ms/step - accuracy: 0.8550 - loss: 0.3501
+
+
+
Epoch 24/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8550 - loss: 0.3435
+
+
+
Epoch 25/100
+
+
+
4/4 - 0s - 22ms/step - accuracy: 0.8550 - loss: 0.3391
+
+
+
Epoch 26/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8600 - loss: 0.3333
+
+
+
Epoch 27/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8650 - loss: 0.3291
+
+
+
Epoch 28/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3261
+
+
+
Epoch 29/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3216
+
+
+
Epoch 30/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3186
+
+
+
Epoch 31/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3157
+
+
+
Epoch 32/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3148
+
+
+
Epoch 33/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8800 - loss: 0.3124
+
+
+
Epoch 34/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3085
+
+
+
Epoch 35/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8700 - loss: 0.3069
+
+
+
Epoch 36/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8750 - loss: 0.3061
+
+
+
Epoch 37/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8800 - loss: 0.3033
+
+
+
Epoch 38/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.3026
+
+
+
Epoch 39/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8800 - loss: 0.3003
+
+
+
Epoch 40/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.3003
+
+
+
Epoch 41/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2981
+
+
+
Epoch 42/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2980
+
+
+
Epoch 43/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2958
+
+
+
Epoch 44/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2953
+
+
+
Epoch 45/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2933
+
+
+
Epoch 46/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2941
+
+
+
Epoch 47/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8850 - loss: 0.2914
+
+
+
Epoch 48/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2906
+
+
+
Epoch 49/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2896
+
+
+
Epoch 50/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2889
+
+
+
Epoch 51/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2885
+
+
+
Epoch 52/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2880
+
+
+
Epoch 53/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2871
+
+
+
Epoch 54/100
+
+
+
4/4 - 0s - 42ms/step - accuracy: 0.8900 - loss: 0.2864
+
+
+
Epoch 55/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2844
+
+
+
Epoch 56/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2859
+
+
+
Epoch 57/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2829
+
+
+
Epoch 58/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2838
+
+
+
Epoch 59/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2810
+
+
+
Epoch 60/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2806
+
+
+
Epoch 61/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2816
+
+
+
Epoch 62/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2786
+
+
+
Epoch 63/100
+
+
+
4/4 - 0s - 17ms/step - accuracy: 0.8900 - loss: 0.2782
+
+
+
Epoch 64/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2780
+
+
+
Epoch 65/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2778
+
+
+
Epoch 66/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2780
+
+
+
Epoch 67/100
+
+
+
4/4 - 0s - 9ms/step - accuracy: 0.8900 - loss: 0.2767
+
+
+
Epoch 68/100
+
+
+
4/4 - 0s - 8ms/step - accuracy: 0.8900 - loss: 0.2750
+
+
+
Epoch 69/100
+
+
+
4/4 - 0s - 8ms/step - accuracy: 0.8900 - loss: 0.2739
+
+
+
Epoch 70/100
+
+
+
4/4 - 0s - 9ms/step - accuracy: 0.8900 - loss: 0.2772
+
+
+
Epoch 71/100
+
+
+
4/4 - 0s - 21ms/step - accuracy: 0.8900 - loss: 0.2730
+
+
+
Epoch 72/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2735
+
+
+
Epoch 73/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2733
+
+
+
Epoch 74/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2726
+
+
+
Epoch 75/100
+
+
+
4/4 - 0s - 7ms/step - accuracy: 0.8900 - loss: 0.2710
+
+
+
Epoch 76/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2702
+
+
+
Epoch 77/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2695
+
+
+
Epoch 78/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2700
+
+
+
Epoch 79/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2687
+
+
+
Epoch 80/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2691
+
+
+
Epoch 81/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2697
+
+
+
Epoch 82/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2694
+
+
+
Epoch 83/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2663
+
+
+
Epoch 84/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2666
+
+
+
Epoch 85/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2689
+
+
+
Epoch 86/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2649
+
+
+
Epoch 87/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2635
+
+
+
Epoch 88/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2653
+
+
+
Epoch 89/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2634
+
+
+
Epoch 90/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.9000 - loss: 0.2631
+
+
+
Epoch 91/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2629
+
+
+
Epoch 92/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2616
+
+
+
Epoch 93/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2617
+
+
+
Epoch 94/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8900 - loss: 0.2609
+
+
+
Epoch 95/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8950 - loss: 0.2622
+
+
+
Epoch 96/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.9000 - loss: 0.2603
+
+
+
Epoch 97/100
+
+
+
4/4 - 0s - 6ms/step - accuracy: 0.8900 - loss: 0.2594
+
+
+
Epoch 98/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.8950 - loss: 0.2608
+
+
+
Epoch 99/100
+
+
+
4/4 - 0s - 52ms/step - accuracy: 0.8900 - loss: 0.2581
+
+
+
Epoch 100/100
+
+
+
4/4 - 0s - 5ms/step - accuracy: 0.9000 - loss: 0.2580
+
+
+
+
+
+
+
score = model.evaluate(x, v, verbose=0)
+print(f"score = {score[0]}")
+print(f"accuracy = {score[1]}")
+
+
+
+
+
score = 0.25629422068595886
+accuracy = 0.8949999809265137
+
+
+
+
+

Let’s look at a prediction. We need to feed in a single point as an array of shape (N, 2), where N is the number of points

+
+
+
res = model.predict(np.array([[-2, 2]]))
+res
+
+
+
+
+
1/1 ━━━━━━━━━━━━━━━━━━━━ 0s 3ms/step
+
+
+

+1/1 ━━━━━━━━━━━━━━━━━━━━ 0s 4ms/step
+
+
+
array([[1.4644101e-05]], dtype=float32)
+
+
+
+
+

We see that we get a floating point number. We will need to convert this to 0 or 1 by rounding.

+

Let’s plot the partitioning

+
+
+
M = 128
+N = 128
+
+xmin = -1.75
+xmax = 2.5
+ymin = -1.25
+ymax = 1.75
+
+xpt = np.linspace(xmin, xmax, M)
+ypt = np.linspace(ymin, ymax, N)
+
+
+
+
+

To make the prediction go faster, we want to feed in a vector of these points, of the form:

+
[[xpt[0], ypt[0]],
+ [xpt[1], ypt[1]],
+ ...
+]
+
+
+

We can see that this packs them into the vector

+
+
+
pairs = np.array(np.meshgrid(xpt, ypt)).T.reshape(-1, 2)
+pairs[0]
+
+
+
+
+
array([-1.75, -1.25])
+
+
+
+
+

Now we do the prediction. We will get a vector out, which we reshape to match the original domain.

+
+
+
res = model.predict(pairs, verbose=0)
+res.shape = (M, N)
+
+
+
+
+

Finally, round to 0 or 1

+
+
+
domain = np.where(res > 0.5, 1, 0)
+
+
+
+
+

and we can plot the data

+
+
+
fig, ax = plt.subplots()
+ax.imshow(domain.T, origin="lower",
+          extent=[xmin, xmax, ymin, ymax], alpha=0.25)
+xpt = [q[0] for q in x]
+ypt = [q[1] for q in x]
+
+ax.scatter(xpt, ypt, s=40, c=v, cmap="viridis")
+
+
+
+
+
<matplotlib.collections.PathCollection at 0x7fbf993f8410>
+
+
+../_images/3e380a95587953689da981c6f23b481ca85e0e4f9c8066fc27542a791367e07e.png +
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/keras-mnist.html b/11-machine-learning/keras-mnist.html new file mode 100644 index 00000000..ef215f6c --- /dev/null +++ b/11-machine-learning/keras-mnist.html @@ -0,0 +1,1678 @@ + + + + + + + + + + + KERAS and MNIST — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

KERAS and MNIST#

+
+
+
import matplotlib.pyplot as plt
+import numpy as np
+
+
+
+
+

We’ll apply the ideas we just learned to a neural network that does character recognition using the MNIST database. This is a set of handwritten digits (0–9) represented as a 28×28 pixel grayscale image.

+

There are 2 datasets, the training set with 60,000 images and the test set with 10,000 images.

+
+
+
import keras
+
+
+
+
+
+

Important

+

Keras requires a backend, which can be tensorflow, pytorch, or jax.

+

By default, it will assume tensorflow.

+

This notebook has been tested with both pytorch and tensorflow.

+
+
+

Tip

+

To have keras use pytorch, set the environment variable KERAS_BACKEND as:

+
export KERAS_BACKEND="torch"
+
+
+
+

We follow the example for setting up the network: +Vict0rSch/deep_learning

+
+

Note

+

For visualization of the network, you need to have pydot installed.

+
+
+

The MNIST data#

+

The keras library can download the MNIST data directly and provides a function to give us both the training and test images and the corresponding digits. This is already in a format that Keras wants, so we don’t use the classes that we defined earlier.

+
+
+
from keras.datasets import mnist
+
+
+
+
+
+
+
(X_train, y_train), (X_test, y_test) = mnist.load_data()
+
+
+
+
+
Downloading data from https://storage.googleapis.com/tensorflow/tf-keras-datasets/mnist.npz
+
+
+
       0/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0s/step
+
+
+

+  327680/11490434 ━━━━━━━━━━━━━━━━━━━━ 1s 0us/step
+
+
+

+ 4513792/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0us/step
+
+
+

+10133504/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0us/step
+
+
+

+11490434/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0us/step
+
+
+
+
+

As before, the training set consists of 60000 digits represented as a 28x28 array (there are no color channels, so this is grayscale data). They are also integer data.

+
+
+
X_train.shape
+
+
+
+
+
(60000, 28, 28)
+
+
+
+
+
+
+
X_train.dtype
+
+
+
+
+
dtype('uint8')
+
+
+
+
+

Let’s look at the first digit and the “y” value (target) associated with it—that’s the correct answer.

+
+
+
plt.imshow(X_train[0], cmap="gray_r")
+print(y_train[0])
+
+
+
+
+
5
+
+
+the number 5 represented as a small grayscale image +
+
+
+
+

Preparing the Data#

+

The neural network takes a 1-d vector of input and will return a 1-d vector of output. We need to convert our data to this form.

+

We’ll scale the image data to fall in [0, 1) and the numerical output to be categorized as an array. Finally, we need the input data to be one-dimensional, so we fill flatten the 28x28 images into a single 784 vector.

+
+
+
X_train = X_train.astype('float32')/255
+X_test = X_test.astype('float32')/255
+
+X_train = np.reshape(X_train, (60000, 784))
+X_test = np.reshape(X_test, (10000, 784))
+
+
+
+
+
+
+
X_train[0]
+
+
+
+
+
array([0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.01176471, 0.07058824, 0.07058824,
+       0.07058824, 0.49411765, 0.53333336, 0.6862745 , 0.10196079,
+       0.6509804 , 1.        , 0.96862745, 0.49803922, 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.11764706, 0.14117648, 0.36862746, 0.6039216 ,
+       0.6666667 , 0.99215686, 0.99215686, 0.99215686, 0.99215686,
+       0.99215686, 0.88235295, 0.6745098 , 0.99215686, 0.9490196 ,
+       0.7647059 , 0.2509804 , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.19215687, 0.93333334,
+       0.99215686, 0.99215686, 0.99215686, 0.99215686, 0.99215686,
+       0.99215686, 0.99215686, 0.99215686, 0.9843137 , 0.3647059 ,
+       0.32156864, 0.32156864, 0.21960784, 0.15294118, 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.07058824, 0.85882354, 0.99215686, 0.99215686,
+       0.99215686, 0.99215686, 0.99215686, 0.7764706 , 0.7137255 ,
+       0.96862745, 0.94509804, 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.3137255 , 0.6117647 , 0.41960785, 0.99215686, 0.99215686,
+       0.8039216 , 0.04313726, 0.        , 0.16862746, 0.6039216 ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.05490196,
+       0.00392157, 0.6039216 , 0.99215686, 0.3529412 , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.54509807,
+       0.99215686, 0.74509805, 0.00784314, 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.04313726, 0.74509805, 0.99215686,
+       0.27450982, 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.13725491, 0.94509804, 0.88235295, 0.627451  ,
+       0.42352942, 0.00392157, 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.31764707, 0.9411765 , 0.99215686, 0.99215686, 0.46666667,
+       0.09803922, 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.1764706 ,
+       0.7294118 , 0.99215686, 0.99215686, 0.5882353 , 0.10588235,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.0627451 , 0.3647059 ,
+       0.9882353 , 0.99215686, 0.73333335, 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.9764706 , 0.99215686,
+       0.9764706 , 0.2509804 , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.18039216, 0.50980395,
+       0.7176471 , 0.99215686, 0.99215686, 0.8117647 , 0.00784314,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.15294118,
+       0.5803922 , 0.8980392 , 0.99215686, 0.99215686, 0.99215686,
+       0.98039216, 0.7137255 , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.09411765, 0.44705883, 0.8666667 , 0.99215686, 0.99215686,
+       0.99215686, 0.99215686, 0.7882353 , 0.30588236, 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.09019608, 0.25882354, 0.8352941 , 0.99215686,
+       0.99215686, 0.99215686, 0.99215686, 0.7764706 , 0.31764707,
+       0.00784314, 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.07058824, 0.67058825, 0.85882354,
+       0.99215686, 0.99215686, 0.99215686, 0.99215686, 0.7647059 ,
+       0.3137255 , 0.03529412, 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.21568628, 0.6745098 ,
+       0.8862745 , 0.99215686, 0.99215686, 0.99215686, 0.99215686,
+       0.95686275, 0.52156866, 0.04313726, 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.53333336, 0.99215686, 0.99215686, 0.99215686,
+       0.83137256, 0.5294118 , 0.5176471 , 0.0627451 , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        ], dtype=float32)
+
+
+
+
+

We will use categorical data. Keras includes routines to categorize data. In our case, since there are 10 possible digits, we want to put the output into 10 categories (represented by 10 neurons)

+
+
+
from keras.utils import to_categorical
+
+y_train = to_categorical(y_train, 10)
+y_test = to_categorical(y_test, 10)
+
+
+
+
+

Now let’s look at the target for the first training digit. We know from above that it was ‘5’. Here we see that there is a 1 in the index corresponding to 5 (remember we start counting at 0 in python).

+
+
+
y_train[0]
+
+
+
+
+
array([0., 0., 0., 0., 0., 1., 0., 0., 0., 0.])
+
+
+
+
+
+
+

Build the Neural Network#

+

Now we’ll build the neural network. We will have 2 hidden layers, and the number of neurons will look like:

+

784 → 500 → 300 → 10

+
+

Layers#

+

Let’s start by setting up the layers. For each layer, we tell keras the number of output neurons. It infers the number of inputs from the previous layer (with the exception of the input layer, where we need to tell it what to expect as input).

+

Properties on the layers:

+ +
+
+
from keras.models import Sequential
+from keras.layers import Dense, Dropout, Activation, Input
+
+model = Sequential()
+model.add(Input(shape=(784,)))
+model.add(Dense(500, activation="relu"))
+model.add(Dropout(0.4))
+model.add(Dense(300, activation="relu"))
+model.add(Dropout(0.4))
+model.add(Dense(10, activation="softmax"))
+
+
+
+
+
+
+

Loss function#

+

We need to specify what we want to optimize and how we are going to do it.

+

Recall: the loss (or cost) function measures how well our predictions match the expected target. +Previously we were using the sum of the squares of the error.

+

For categorical data, like we have, the “cross-entropy” metric is often used. See here for an explanation: https://jamesmccaffrey.wordpress.com/2013/11/05/why-you-should-use-cross-entropy-error-instead-of-classification-error-or-mean-squared-error-for-neural-network-classifier-training/

+
+
+

Optimizer#

+

We also need to specify an optimizer. This could be gradient descent, as we used before. Here’s a list of the optimizers supoprted by keras: https://keras.io/api/optimizers/ We’ll use RMPprop, which builds off of gradient descent and includes some momentum.

+

Finally, we need to specify a metric that is evaluated during training and testing. We’ll use "accuracy" here. This means that we’ll see the accuracy of our model reported as we are training and testing.

+

More details on these options is here: https://keras.io/api/models/model/

+
+
+
from keras.optimizers import RMSprop
+
+rms = RMSprop()
+model.compile(loss='categorical_crossentropy',
+              optimizer=rms, metrics=['accuracy'])
+
+
+
+
+
+
+

Network summary#

+

Let’s take a look at the network:

+
+
+
model.summary()
+
+
+
+
+
Model: "sequential"
+
+
┏━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━┳━━━━━━━━━━━━━━━━━━━━━━━━┳━━━━━━━━━━━━━━━┓
+┃ Layer (type)                     Output Shape                  Param # ┃
+┡━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━╇━━━━━━━━━━━━━━━━━━━━━━━━╇━━━━━━━━━━━━━━━┩
+│ dense (Dense)                   │ (None, 500)            │       392,500 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dropout (Dropout)               │ (None, 500)            │             0 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dense_1 (Dense)                 │ (None, 300)            │       150,300 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dropout_1 (Dropout)             │ (None, 300)            │             0 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dense_2 (Dense)                 │ (None, 10)             │         3,010 │
+└─────────────────────────────────┴────────────────────────┴───────────────┘
+
+
 Total params: 545,810 (2.08 MB)
+
+
 Trainable params: 545,810 (2.08 MB)
+
+
 Non-trainable params: 0 (0.00 B)
+
+
+
+

We see that there are > 500k parameters that we will be training

+
+
+
+
+

Train#

+

For training, we pass in the inputs and target and the number of epochs to run and it will optimize the network by adjusting the weights between the nodes in the layers.

+

The number of epochs is the number of times the entire data set is passed forward and backward through the network. The batch size is the number of training pairs you pass through the network at a given time. You update the parameter in your model (the weights) once for each batch. This makes things more efficient and less noisy.

+
+
+
epochs = 20
+batch_size = 256
+model.fit(X_train, y_train, epochs=epochs, batch_size=batch_size,
+          validation_data=(X_test, y_test), verbose=2)
+
+
+
+
+
Epoch 1/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.8846 - loss: 0.3777 - val_accuracy: 0.9544 - val_loss: 0.1499
+
+
+
Epoch 2/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9517 - loss: 0.1601 - val_accuracy: 0.9682 - val_loss: 0.1046
+
+
+
Epoch 3/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9645 - loss: 0.1176 - val_accuracy: 0.9749 - val_loss: 0.0836
+
+
+
Epoch 4/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9695 - loss: 0.0965 - val_accuracy: 0.9770 - val_loss: 0.0748
+
+
+
Epoch 5/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9751 - loss: 0.0825 - val_accuracy: 0.9769 - val_loss: 0.0706
+
+
+
Epoch 6/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9772 - loss: 0.0720 - val_accuracy: 0.9793 - val_loss: 0.0679
+
+
+
Epoch 7/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9802 - loss: 0.0646 - val_accuracy: 0.9808 - val_loss: 0.0656
+
+
+
Epoch 8/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9819 - loss: 0.0587 - val_accuracy: 0.9814 - val_loss: 0.0634
+
+
+
Epoch 9/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9834 - loss: 0.0522 - val_accuracy: 0.9826 - val_loss: 0.0584
+
+
+
Epoch 10/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9847 - loss: 0.0490 - val_accuracy: 0.9839 - val_loss: 0.0592
+
+
+
Epoch 11/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9856 - loss: 0.0458 - val_accuracy: 0.9830 - val_loss: 0.0628
+
+
+
Epoch 12/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9862 - loss: 0.0437 - val_accuracy: 0.9837 - val_loss: 0.0631
+
+
+
Epoch 13/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9880 - loss: 0.0386 - val_accuracy: 0.9845 - val_loss: 0.0604
+
+
+
Epoch 14/20
+
+
+
235/235 - 4s - 16ms/step - accuracy: 0.9880 - loss: 0.0373 - val_accuracy: 0.9844 - val_loss: 0.0618
+
+
+
Epoch 15/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9891 - loss: 0.0338 - val_accuracy: 0.9833 - val_loss: 0.0584
+
+
+
Epoch 16/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9889 - loss: 0.0345 - val_accuracy: 0.9838 - val_loss: 0.0612
+
+
+
Epoch 17/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9901 - loss: 0.0320 - val_accuracy: 0.9830 - val_loss: 0.0627
+
+
+
Epoch 18/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9902 - loss: 0.0300 - val_accuracy: 0.9834 - val_loss: 0.0626
+
+
+
Epoch 19/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9901 - loss: 0.0294 - val_accuracy: 0.9826 - val_loss: 0.0697
+
+
+
Epoch 20/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9909 - loss: 0.0287 - val_accuracy: 0.9843 - val_loss: 0.0639
+
+
+
<keras.src.callbacks.history.History at 0x7f31e19d7a10>
+
+
+
+
+
+

Test#

+

keras has a routine, evaluate() that can take the inputs and targets of a test data set and return the loss value and accuracy (or other defined metrics) on this data.

+

Here we see we are > 98% accurate on the test data—this is the data that the model has never seen before (and was not trained with).

+
+
+
loss_value, accuracy = model.evaluate(X_test, y_test, batch_size=16)
+print(accuracy)
+
+
+
+
+
  1/625 ━━━━━━━━━━━━━━━━━━━━ 4s 7ms/step - accuracy: 1.0000 - loss: 0.0022
+
+
+

+  5/625 ━━━━━━━━━━━━━━━━━━━━ 13s 22ms/step - accuracy: 1.0000 - loss: 0.0012
+
+
+

+ 16/625 ━━━━━━━━━━━━━━━━━━━━ 5s 9ms/step - accuracy: 0.9945 - loss: 0.0107  
+
+
+

+ 27/625 ━━━━━━━━━━━━━━━━━━━━ 4s 7ms/step - accuracy: 0.9920 - loss: 0.0299
+
+
+

+ 38/625 ━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9905 - loss: 0.0417
+
+
+

+ 49/625 ━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9889 - loss: 0.0482
+
+
+

+ 60/625 ━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9880 - loss: 0.0516
+
+
+

+ 71/625 ━━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9874 - loss: 0.0546
+
+
+

+ 82/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9867 - loss: 0.0589
+
+
+

+ 93/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9859 - loss: 0.0632
+
+
+

+104/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9852 - loss: 0.0672
+
+
+

+115/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9846 - loss: 0.0706
+
+
+

+116/625 ━━━━━━━━━━━━━━━━━━━━ 3s 7ms/step - accuracy: 0.9846 - loss: 0.0708
+
+
+

+127/625 ━━━━━━━━━━━━━━━━━━━━ 3s 7ms/step - accuracy: 0.9842 - loss: 0.0733
+
+
+

+139/625 ━━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9837 - loss: 0.0761
+
+
+

+150/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9832 - loss: 0.0782
+
+
+

+156/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9830 - loss: 0.0793
+
+
+

+166/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9826 - loss: 0.0808
+
+
+

+175/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9823 - loss: 0.0821
+
+
+

+181/625 ━━━━━━━━━━━━━━━━━━━━ 2s 7ms/step - accuracy: 0.9822 - loss: 0.0828
+
+
+

+191/625 ━━━━━━━━━━━━━━━━━━━━ 2s 7ms/step - accuracy: 0.9819 - loss: 0.0839
+
+
+

+201/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9817 - loss: 0.0849
+
+
+

+212/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9815 - loss: 0.0857
+
+
+

+223/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9813 - loss: 0.0864
+
+
+

+234/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9812 - loss: 0.0871
+
+
+

+246/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9810 - loss: 0.0879
+
+
+

+258/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9808 - loss: 0.0887
+
+
+

+270/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9806 - loss: 0.0892
+
+
+

+282/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9805 - loss: 0.0897
+
+
+

+293/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9803 - loss: 0.0901
+
+
+

+304/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9802 - loss: 0.0904
+
+
+

+315/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9800 - loss: 0.0906
+
+
+

+327/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9800 - loss: 0.0908
+
+
+

+333/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0908
+
+
+

+342/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0907
+
+
+

+352/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0907
+
+
+

+358/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0906
+
+
+

+370/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0904
+
+
+

+381/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0902
+
+
+

+392/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0900
+
+
+

+404/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0897
+
+
+

+415/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0895
+
+
+

+426/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0892
+
+
+

+437/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0890
+
+
+

+448/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0887
+
+
+

+459/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9799 - loss: 0.0883
+
+
+

+470/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9800 - loss: 0.0880
+
+
+

+481/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9800 - loss: 0.0876
+
+
+

+492/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9801 - loss: 0.0872
+
+
+

+503/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9801 - loss: 0.0868
+
+
+

+507/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9802 - loss: 0.0866
+
+
+

+518/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9802 - loss: 0.0862
+
+
+

+526/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9803 - loss: 0.0859
+
+
+

+534/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9803 - loss: 0.0856
+
+
+

+535/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9803 - loss: 0.0856
+
+
+

+546/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9804 - loss: 0.0852
+
+
+

+557/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9805 - loss: 0.0848
+
+
+

+568/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9805 - loss: 0.0844
+
+
+

+579/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9806 - loss: 0.0840
+
+
+

+590/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9807 - loss: 0.0836
+
+
+

+601/625 ━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9808 - loss: 0.0832
+
+
+

+612/625 ━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9808 - loss: 0.0828
+
+
+

+624/625 ━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9809 - loss: 0.0825
+
+
+

+625/625 ━━━━━━━━━━━━━━━━━━━━ 4s 6ms/step - accuracy: 0.9843 - loss: 0.0639
+
+
+
0.9843000173568726
+
+
+
+
+
+
+

Predicting#

+

Suppose we simply want to ask our neural network to predict the target for an input. We can use the predict() method to return the category array with the predictions. We can then use np.argmax() to select the most probable.

+
+
+
np.argmax(model.predict(np.array([X_test[0]])))
+
+
+
+
+
1/1 ━━━━━━━━━━━━━━━━━━━━ 0s 4ms/step
+
+
+

+1/1 ━━━━━━━━━━━━━━━━━━━━ 0s 5ms/step
+
+
+
np.int64(7)
+
+
+
+
+
+
+
y_test[0]
+
+
+
+
+
array([0., 0., 0., 0., 0., 0., 0., 1., 0., 0.])
+
+
+
+
+

Now let’s loop over the test set and print out what we predict vs. the true answer for those we get wrong. We can also plot the image of the digit.

+
+
+
wrong = 0
+max_wrong = 10
+
+for n, (x, y) in enumerate(zip(X_test, y_test)):
+    try:
+        res = model.predict(np.array([x]), verbose=0)
+        if np.argmax(res) != np.argmax(y):
+            print(f"test {n}: prediction = {np.argmax(res)}, truth is {np.argmax(y)}")
+            plt.imshow(x.reshape(28, 28), cmap="gray_r")
+            plt.show()
+            wrong += 1
+            if (wrong > max_wrong-1):
+                break
+    except KeyboardInterrupt:
+        print("stopping")
+        break
+
+
+
+
+
test 115: prediction = 9, truth is 4
+
+
+../_images/58d940405d5b2d97a8ac4387c0747f19aceabb1b381df374961dae4b6e883716.png +
test 149: prediction = 3, truth is 2
+
+
+../_images/e89ded31bb0805eaed85d00c64bd2ea93dcb6c61745dc293d035532da31af2ac.png +
test 247: prediction = 6, truth is 4
+
+
+../_images/95b9f0fd23894c2cbbb25bb94ff4162bea2142c17024708eb2e068cc777e852f.png +
test 321: prediction = 7, truth is 2
+
+
+../_images/ffee7b61de1ff038024f9ad240685159d4c292312da298aac782027770fecb9c.png +
test 340: prediction = 3, truth is 5
+
+
+../_images/c8c2834b4172a70240f93d1cb14ae0d552f4a26654861da536d16eea043dd641.png +
test 445: prediction = 0, truth is 6
+
+
+../_images/99aa1a1124655bc04ed0c253cede4ee4f50d860b4a8e1e8796107a753cbcfabf.png +
test 495: prediction = 0, truth is 8
+
+
+../_images/ae7d94ffa26d5baa2e15a13dae0847ac6a63895412a6d03f86c08f8e3f328f37.png +
test 582: prediction = 2, truth is 8
+
+
+../_images/33080619ca831dc4a962e00d235d22b7840db996fcbf78452a7c4a9c7b934226.png +
test 613: prediction = 8, truth is 2
+
+
+../_images/e8fcb33912198404e43a9829e9f7bd807269f3a99cda7610f7fac6df54f49af5.png +
test 646: prediction = 6, truth is 2
+
+
+../_images/636857cadff1acef2aa145c156a25e58a6d145860be88a309a2b0803c0ace6fa.png +
+
+
+
+

Experimenting#

+

There are a number of things we can play with to see how the network performance +changes:

+
    +
  • batch size

  • +
  • adding or removing hidden layers

  • +
  • changing the dropout

  • +
  • changing the activation function

  • +
+
+
+

Callbacks#

+

Keras allows for callbacks each epoch to store some information. These can allow you to, +for example, plot of the accuracy vs. epoch by adding a callback. Take a look here for some inspiration:

+

https://www.tensorflow.org/api_docs/python/tf/keras/callbacks/History

+
+
+

Going Further#

+

Convolutional neural networks are often used for image recognition, especially with larger images. They use filter to try to recognize patterns in portions of images (A tile). See this for a keras example:

+

https://www.tensorflow.org/tutorials/images/cnn

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/keras-mnist.html.backup b/11-machine-learning/keras-mnist.html.backup new file mode 100644 index 00000000..6408bdec --- /dev/null +++ b/11-machine-learning/keras-mnist.html.backup @@ -0,0 +1,1679 @@ + + + + + + + + + + + KERAS and MNIST — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

KERAS and MNIST#

+
+
+
import matplotlib.pyplot as plt
+import numpy as np
+
+
+
+
+

We’ll apply the ideas we just learned to a neural network that does character recognition using the MNIST database. This is a set of handwritten digits (0–9) represented as a 28×28 pixel grayscale image.

+

There are 2 datasets, the training set with 60,000 images and the test set with 10,000 images.

+
+
+
import keras
+
+
+
+
+
+

Important

+

Keras requires a backend, which can be tensorflow, pytorch, or jax.

+

By default, it will assume tensorflow.

+

This notebook has been tested with both pytorch and tensorflow.

+
+
+

Tip

+

To have keras use pytorch, set the environment variable KERAS_BACKEND as:

+
export KERAS_BACKEND="torch"
+
+
+
+

We follow the example for setting up the network: +Vict0rSch/deep_learning

+
+

Note

+

For visualization of the network, you need to have pydot installed.

+
+
+

The MNIST data#

+

The keras library can download the MNIST data directly and provides a function to give us both the training and test images and the corresponding digits. This is already in a format that Keras wants, so we don’t use the classes that we defined earlier.

+
+
+
from keras.datasets import mnist
+
+
+
+
+
+
+
(X_train, y_train), (X_test, y_test) = mnist.load_data()
+
+
+
+
+
Downloading data from https://storage.googleapis.com/tensorflow/tf-keras-datasets/mnist.npz
+
+
+
       0/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0s/step
+
+
+

+  327680/11490434 ━━━━━━━━━━━━━━━━━━━━ 1s 0us/step
+
+
+

+ 4513792/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0us/step
+
+
+

+10133504/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0us/step
+
+
+

+11490434/11490434 ━━━━━━━━━━━━━━━━━━━━ 0s 0us/step
+
+
+
+
+

As before, the training set consists of 60000 digits represented as a 28x28 array (there are no color channels, so this is grayscale data). They are also integer data.

+
+
+
X_train.shape
+
+
+
+
+
(60000, 28, 28)
+
+
+
+
+
+
+
X_train.dtype
+
+
+
+
+
dtype('uint8')
+
+
+
+
+

Let’s look at the first digit and the “y” value (target) associated with it—that’s the correct answer.

+
+
+
plt.imshow(X_train[0], cmap="gray_r")
+print(y_train[0])
+# alt-text: the number 5 represented as a small grayscale image
+
+
+
+
+
5
+
+
+../_images/4567d8f9bd61f12d86168899465c03b2a4ce67b2904092490c6a2b9dc7107b30.png +
+
+
+
+

Preparing the Data#

+

The neural network takes a 1-d vector of input and will return a 1-d vector of output. We need to convert our data to this form.

+

We’ll scale the image data to fall in [0, 1) and the numerical output to be categorized as an array. Finally, we need the input data to be one-dimensional, so we fill flatten the 28x28 images into a single 784 vector.

+
+
+
X_train = X_train.astype('float32')/255
+X_test = X_test.astype('float32')/255
+
+X_train = np.reshape(X_train, (60000, 784))
+X_test = np.reshape(X_test, (10000, 784))
+
+
+
+
+
+
+
X_train[0]
+
+
+
+
+
array([0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.01176471, 0.07058824, 0.07058824,
+       0.07058824, 0.49411765, 0.53333336, 0.6862745 , 0.10196079,
+       0.6509804 , 1.        , 0.96862745, 0.49803922, 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.11764706, 0.14117648, 0.36862746, 0.6039216 ,
+       0.6666667 , 0.99215686, 0.99215686, 0.99215686, 0.99215686,
+       0.99215686, 0.88235295, 0.6745098 , 0.99215686, 0.9490196 ,
+       0.7647059 , 0.2509804 , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.19215687, 0.93333334,
+       0.99215686, 0.99215686, 0.99215686, 0.99215686, 0.99215686,
+       0.99215686, 0.99215686, 0.99215686, 0.9843137 , 0.3647059 ,
+       0.32156864, 0.32156864, 0.21960784, 0.15294118, 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.07058824, 0.85882354, 0.99215686, 0.99215686,
+       0.99215686, 0.99215686, 0.99215686, 0.7764706 , 0.7137255 ,
+       0.96862745, 0.94509804, 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.3137255 , 0.6117647 , 0.41960785, 0.99215686, 0.99215686,
+       0.8039216 , 0.04313726, 0.        , 0.16862746, 0.6039216 ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.05490196,
+       0.00392157, 0.6039216 , 0.99215686, 0.3529412 , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.54509807,
+       0.99215686, 0.74509805, 0.00784314, 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.04313726, 0.74509805, 0.99215686,
+       0.27450982, 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.13725491, 0.94509804, 0.88235295, 0.627451  ,
+       0.42352942, 0.00392157, 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.31764707, 0.9411765 , 0.99215686, 0.99215686, 0.46666667,
+       0.09803922, 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.1764706 ,
+       0.7294118 , 0.99215686, 0.99215686, 0.5882353 , 0.10588235,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.0627451 , 0.3647059 ,
+       0.9882353 , 0.99215686, 0.73333335, 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.9764706 , 0.99215686,
+       0.9764706 , 0.2509804 , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.18039216, 0.50980395,
+       0.7176471 , 0.99215686, 0.99215686, 0.8117647 , 0.00784314,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.15294118,
+       0.5803922 , 0.8980392 , 0.99215686, 0.99215686, 0.99215686,
+       0.98039216, 0.7137255 , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.09411765, 0.44705883, 0.8666667 , 0.99215686, 0.99215686,
+       0.99215686, 0.99215686, 0.7882353 , 0.30588236, 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.09019608, 0.25882354, 0.8352941 , 0.99215686,
+       0.99215686, 0.99215686, 0.99215686, 0.7764706 , 0.31764707,
+       0.00784314, 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.07058824, 0.67058825, 0.85882354,
+       0.99215686, 0.99215686, 0.99215686, 0.99215686, 0.7647059 ,
+       0.3137255 , 0.03529412, 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.21568628, 0.6745098 ,
+       0.8862745 , 0.99215686, 0.99215686, 0.99215686, 0.99215686,
+       0.95686275, 0.52156866, 0.04313726, 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.53333336, 0.99215686, 0.99215686, 0.99215686,
+       0.83137256, 0.5294118 , 0.5176471 , 0.0627451 , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        , 0.        ,
+       0.        , 0.        , 0.        , 0.        ], dtype=float32)
+
+
+
+
+

We will use categorical data. Keras includes routines to categorize data. In our case, since there are 10 possible digits, we want to put the output into 10 categories (represented by 10 neurons)

+
+
+
from keras.utils import to_categorical
+
+y_train = to_categorical(y_train, 10)
+y_test = to_categorical(y_test, 10)
+
+
+
+
+

Now let’s look at the target for the first training digit. We know from above that it was ‘5’. Here we see that there is a 1 in the index corresponding to 5 (remember we start counting at 0 in python).

+
+
+
y_train[0]
+
+
+
+
+
array([0., 0., 0., 0., 0., 1., 0., 0., 0., 0.])
+
+
+
+
+
+
+

Build the Neural Network#

+

Now we’ll build the neural network. We will have 2 hidden layers, and the number of neurons will look like:

+

784 → 500 → 300 → 10

+
+

Layers#

+

Let’s start by setting up the layers. For each layer, we tell keras the number of output neurons. It infers the number of inputs from the previous layer (with the exception of the input layer, where we need to tell it what to expect as input).

+

Properties on the layers:

+ +
+
+
from keras.models import Sequential
+from keras.layers import Dense, Dropout, Activation, Input
+
+model = Sequential()
+model.add(Input(shape=(784,)))
+model.add(Dense(500, activation="relu"))
+model.add(Dropout(0.4))
+model.add(Dense(300, activation="relu"))
+model.add(Dropout(0.4))
+model.add(Dense(10, activation="softmax"))
+
+
+
+
+
+
+

Loss function#

+

We need to specify what we want to optimize and how we are going to do it.

+

Recall: the loss (or cost) function measures how well our predictions match the expected target. +Previously we were using the sum of the squares of the error.

+

For categorical data, like we have, the “cross-entropy” metric is often used. See here for an explanation: https://jamesmccaffrey.wordpress.com/2013/11/05/why-you-should-use-cross-entropy-error-instead-of-classification-error-or-mean-squared-error-for-neural-network-classifier-training/

+
+
+

Optimizer#

+

We also need to specify an optimizer. This could be gradient descent, as we used before. Here’s a list of the optimizers supoprted by keras: https://keras.io/api/optimizers/ We’ll use RMPprop, which builds off of gradient descent and includes some momentum.

+

Finally, we need to specify a metric that is evaluated during training and testing. We’ll use "accuracy" here. This means that we’ll see the accuracy of our model reported as we are training and testing.

+

More details on these options is here: https://keras.io/api/models/model/

+
+
+
from keras.optimizers import RMSprop
+
+rms = RMSprop()
+model.compile(loss='categorical_crossentropy',
+              optimizer=rms, metrics=['accuracy'])
+
+
+
+
+
+
+

Network summary#

+

Let’s take a look at the network:

+
+
+
model.summary()
+
+
+
+
+
Model: "sequential"
+
+
┏━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━┳━━━━━━━━━━━━━━━━━━━━━━━━┳━━━━━━━━━━━━━━━┓
+┃ Layer (type)                     Output Shape                  Param # ┃
+┡━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━━╇━━━━━━━━━━━━━━━━━━━━━━━━╇━━━━━━━━━━━━━━━┩
+│ dense (Dense)                   │ (None, 500)            │       392,500 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dropout (Dropout)               │ (None, 500)            │             0 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dense_1 (Dense)                 │ (None, 300)            │       150,300 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dropout_1 (Dropout)             │ (None, 300)            │             0 │
+├─────────────────────────────────┼────────────────────────┼───────────────┤
+│ dense_2 (Dense)                 │ (None, 10)             │         3,010 │
+└─────────────────────────────────┴────────────────────────┴───────────────┘
+
+
 Total params: 545,810 (2.08 MB)
+
+
 Trainable params: 545,810 (2.08 MB)
+
+
 Non-trainable params: 0 (0.00 B)
+
+
+
+

We see that there are > 500k parameters that we will be training

+
+
+
+
+

Train#

+

For training, we pass in the inputs and target and the number of epochs to run and it will optimize the network by adjusting the weights between the nodes in the layers.

+

The number of epochs is the number of times the entire data set is passed forward and backward through the network. The batch size is the number of training pairs you pass through the network at a given time. You update the parameter in your model (the weights) once for each batch. This makes things more efficient and less noisy.

+
+
+
epochs = 20
+batch_size = 256
+model.fit(X_train, y_train, epochs=epochs, batch_size=batch_size,
+          validation_data=(X_test, y_test), verbose=2)
+
+
+
+
+
Epoch 1/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.8846 - loss: 0.3777 - val_accuracy: 0.9544 - val_loss: 0.1499
+
+
+
Epoch 2/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9517 - loss: 0.1601 - val_accuracy: 0.9682 - val_loss: 0.1046
+
+
+
Epoch 3/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9645 - loss: 0.1176 - val_accuracy: 0.9749 - val_loss: 0.0836
+
+
+
Epoch 4/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9695 - loss: 0.0965 - val_accuracy: 0.9770 - val_loss: 0.0748
+
+
+
Epoch 5/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9751 - loss: 0.0825 - val_accuracy: 0.9769 - val_loss: 0.0706
+
+
+
Epoch 6/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9772 - loss: 0.0720 - val_accuracy: 0.9793 - val_loss: 0.0679
+
+
+
Epoch 7/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9802 - loss: 0.0646 - val_accuracy: 0.9808 - val_loss: 0.0656
+
+
+
Epoch 8/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9819 - loss: 0.0587 - val_accuracy: 0.9814 - val_loss: 0.0634
+
+
+
Epoch 9/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9834 - loss: 0.0522 - val_accuracy: 0.9826 - val_loss: 0.0584
+
+
+
Epoch 10/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9847 - loss: 0.0490 - val_accuracy: 0.9839 - val_loss: 0.0592
+
+
+
Epoch 11/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9856 - loss: 0.0458 - val_accuracy: 0.9830 - val_loss: 0.0628
+
+
+
Epoch 12/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9862 - loss: 0.0437 - val_accuracy: 0.9837 - val_loss: 0.0631
+
+
+
Epoch 13/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9880 - loss: 0.0386 - val_accuracy: 0.9845 - val_loss: 0.0604
+
+
+
Epoch 14/20
+
+
+
235/235 - 4s - 16ms/step - accuracy: 0.9880 - loss: 0.0373 - val_accuracy: 0.9844 - val_loss: 0.0618
+
+
+
Epoch 15/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9891 - loss: 0.0338 - val_accuracy: 0.9833 - val_loss: 0.0584
+
+
+
Epoch 16/20
+
+
+
235/235 - 4s - 18ms/step - accuracy: 0.9889 - loss: 0.0345 - val_accuracy: 0.9838 - val_loss: 0.0612
+
+
+
Epoch 17/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9901 - loss: 0.0320 - val_accuracy: 0.9830 - val_loss: 0.0627
+
+
+
Epoch 18/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9902 - loss: 0.0300 - val_accuracy: 0.9834 - val_loss: 0.0626
+
+
+
Epoch 19/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9901 - loss: 0.0294 - val_accuracy: 0.9826 - val_loss: 0.0697
+
+
+
Epoch 20/20
+
+
+
235/235 - 4s - 17ms/step - accuracy: 0.9909 - loss: 0.0287 - val_accuracy: 0.9843 - val_loss: 0.0639
+
+
+
<keras.src.callbacks.history.History at 0x7f31e19d7a10>
+
+
+
+
+
+

Test#

+

keras has a routine, evaluate() that can take the inputs and targets of a test data set and return the loss value and accuracy (or other defined metrics) on this data.

+

Here we see we are > 98% accurate on the test data—this is the data that the model has never seen before (and was not trained with).

+
+
+
loss_value, accuracy = model.evaluate(X_test, y_test, batch_size=16)
+print(accuracy)
+
+
+
+
+
  1/625 ━━━━━━━━━━━━━━━━━━━━ 4s 7ms/step - accuracy: 1.0000 - loss: 0.0022
+
+
+

+  5/625 ━━━━━━━━━━━━━━━━━━━━ 13s 22ms/step - accuracy: 1.0000 - loss: 0.0012
+
+
+

+ 16/625 ━━━━━━━━━━━━━━━━━━━━ 5s 9ms/step - accuracy: 0.9945 - loss: 0.0107  
+
+
+

+ 27/625 ━━━━━━━━━━━━━━━━━━━━ 4s 7ms/step - accuracy: 0.9920 - loss: 0.0299
+
+
+

+ 38/625 ━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9905 - loss: 0.0417
+
+
+

+ 49/625 ━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9889 - loss: 0.0482
+
+
+

+ 60/625 ━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9880 - loss: 0.0516
+
+
+

+ 71/625 ━━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9874 - loss: 0.0546
+
+
+

+ 82/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9867 - loss: 0.0589
+
+
+

+ 93/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9859 - loss: 0.0632
+
+
+

+104/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9852 - loss: 0.0672
+
+
+

+115/625 ━━━━━━━━━━━━━━━━━━━━ 2s 5ms/step - accuracy: 0.9846 - loss: 0.0706
+
+
+

+116/625 ━━━━━━━━━━━━━━━━━━━━ 3s 7ms/step - accuracy: 0.9846 - loss: 0.0708
+
+
+

+127/625 ━━━━━━━━━━━━━━━━━━━━ 3s 7ms/step - accuracy: 0.9842 - loss: 0.0733
+
+
+

+139/625 ━━━━━━━━━━━━━━━━━━━━ 3s 6ms/step - accuracy: 0.9837 - loss: 0.0761
+
+
+

+150/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9832 - loss: 0.0782
+
+
+

+156/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9830 - loss: 0.0793
+
+
+

+166/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9826 - loss: 0.0808
+
+
+

+175/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9823 - loss: 0.0821
+
+
+

+181/625 ━━━━━━━━━━━━━━━━━━━━ 2s 7ms/step - accuracy: 0.9822 - loss: 0.0828
+
+
+

+191/625 ━━━━━━━━━━━━━━━━━━━━ 2s 7ms/step - accuracy: 0.9819 - loss: 0.0839
+
+
+

+201/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9817 - loss: 0.0849
+
+
+

+212/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9815 - loss: 0.0857
+
+
+

+223/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9813 - loss: 0.0864
+
+
+

+234/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9812 - loss: 0.0871
+
+
+

+246/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9810 - loss: 0.0879
+
+
+

+258/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9808 - loss: 0.0887
+
+
+

+270/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9806 - loss: 0.0892
+
+
+

+282/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9805 - loss: 0.0897
+
+
+

+293/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9803 - loss: 0.0901
+
+
+

+304/625 ━━━━━━━━━━━━━━━━━━━━ 2s 6ms/step - accuracy: 0.9802 - loss: 0.0904
+
+
+

+315/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9800 - loss: 0.0906
+
+
+

+327/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9800 - loss: 0.0908
+
+
+

+333/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0908
+
+
+

+342/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0907
+
+
+

+352/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0907
+
+
+

+358/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0906
+
+
+

+370/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0904
+
+
+

+381/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0902
+
+
+

+392/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0900
+
+
+

+404/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0897
+
+
+

+415/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0895
+
+
+

+426/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0892
+
+
+

+437/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9798 - loss: 0.0890
+
+
+

+448/625 ━━━━━━━━━━━━━━━━━━━━ 1s 6ms/step - accuracy: 0.9799 - loss: 0.0887
+
+
+

+459/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9799 - loss: 0.0883
+
+
+

+470/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9800 - loss: 0.0880
+
+
+

+481/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9800 - loss: 0.0876
+
+
+

+492/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9801 - loss: 0.0872
+
+
+

+503/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9801 - loss: 0.0868
+
+
+

+507/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9802 - loss: 0.0866
+
+
+

+518/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9802 - loss: 0.0862
+
+
+

+526/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9803 - loss: 0.0859
+
+
+

+534/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9803 - loss: 0.0856
+
+
+

+535/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9803 - loss: 0.0856
+
+
+

+546/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9804 - loss: 0.0852
+
+
+

+557/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9805 - loss: 0.0848
+
+
+

+568/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9805 - loss: 0.0844
+
+
+

+579/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9806 - loss: 0.0840
+
+
+

+590/625 ━━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9807 - loss: 0.0836
+
+
+

+601/625 ━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9808 - loss: 0.0832
+
+
+

+612/625 ━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9808 - loss: 0.0828
+
+
+

+624/625 ━━━━━━━━━━━━━━━━━━━ 0s 6ms/step - accuracy: 0.9809 - loss: 0.0825
+
+
+

+625/625 ━━━━━━━━━━━━━━━━━━━━ 4s 6ms/step - accuracy: 0.9843 - loss: 0.0639
+
+
+
0.9843000173568726
+
+
+
+
+
+
+

Predicting#

+

Suppose we simply want to ask our neural network to predict the target for an input. We can use the predict() method to return the category array with the predictions. We can then use np.argmax() to select the most probable.

+
+
+
np.argmax(model.predict(np.array([X_test[0]])))
+
+
+
+
+
1/1 ━━━━━━━━━━━━━━━━━━━━ 0s 4ms/step
+
+
+

+1/1 ━━━━━━━━━━━━━━━━━━━━ 0s 5ms/step
+
+
+
np.int64(7)
+
+
+
+
+
+
+
y_test[0]
+
+
+
+
+
array([0., 0., 0., 0., 0., 0., 0., 1., 0., 0.])
+
+
+
+
+

Now let’s loop over the test set and print out what we predict vs. the true answer for those we get wrong. We can also plot the image of the digit.

+
+
+
wrong = 0
+max_wrong = 10
+
+for n, (x, y) in enumerate(zip(X_test, y_test)):
+    try:
+        res = model.predict(np.array([x]), verbose=0)
+        if np.argmax(res) != np.argmax(y):
+            print(f"test {n}: prediction = {np.argmax(res)}, truth is {np.argmax(y)}")
+            plt.imshow(x.reshape(28, 28), cmap="gray_r")
+            plt.show()
+            wrong += 1
+            if (wrong > max_wrong-1):
+                break
+    except KeyboardInterrupt:
+        print("stopping")
+        break
+
+
+
+
+
test 115: prediction = 9, truth is 4
+
+
+../_images/58d940405d5b2d97a8ac4387c0747f19aceabb1b381df374961dae4b6e883716.png +
test 149: prediction = 3, truth is 2
+
+
+../_images/e89ded31bb0805eaed85d00c64bd2ea93dcb6c61745dc293d035532da31af2ac.png +
test 247: prediction = 6, truth is 4
+
+
+../_images/95b9f0fd23894c2cbbb25bb94ff4162bea2142c17024708eb2e068cc777e852f.png +
test 321: prediction = 7, truth is 2
+
+
+../_images/ffee7b61de1ff038024f9ad240685159d4c292312da298aac782027770fecb9c.png +
test 340: prediction = 3, truth is 5
+
+
+../_images/c8c2834b4172a70240f93d1cb14ae0d552f4a26654861da536d16eea043dd641.png +
test 445: prediction = 0, truth is 6
+
+
+../_images/99aa1a1124655bc04ed0c253cede4ee4f50d860b4a8e1e8796107a753cbcfabf.png +
test 495: prediction = 0, truth is 8
+
+
+../_images/ae7d94ffa26d5baa2e15a13dae0847ac6a63895412a6d03f86c08f8e3f328f37.png +
test 582: prediction = 2, truth is 8
+
+
+../_images/33080619ca831dc4a962e00d235d22b7840db996fcbf78452a7c4a9c7b934226.png +
test 613: prediction = 8, truth is 2
+
+
+../_images/e8fcb33912198404e43a9829e9f7bd807269f3a99cda7610f7fac6df54f49af5.png +
test 646: prediction = 6, truth is 2
+
+
+../_images/636857cadff1acef2aa145c156a25e58a6d145860be88a309a2b0803c0ace6fa.png +
+
+
+
+

Experimenting#

+

There are a number of things we can play with to see how the network performance +changes:

+
    +
  • batch size

  • +
  • adding or removing hidden layers

  • +
  • changing the dropout

  • +
  • changing the activation function

  • +
+
+
+

Callbacks#

+

Keras allows for callbacks each epoch to store some information. These can allow you to, +for example, plot of the accuracy vs. epoch by adding a callback. Take a look here for some inspiration:

+

https://www.tensorflow.org/api_docs/python/tf/keras/callbacks/History

+
+
+

Going Further#

+

Convolutional neural networks are often used for image recognition, especially with larger images. They use filter to try to recognize patterns in portions of images (A tile). See this for a keras example:

+

https://www.tensorflow.org/tutorials/images/cnn

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/machine-learning-basics.html b/11-machine-learning/machine-learning-basics.html new file mode 100644 index 00000000..8c468a9a --- /dev/null +++ b/11-machine-learning/machine-learning-basics.html @@ -0,0 +1,806 @@ + + + + + + + + + + + Machine Learning Introduction — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Machine Learning Introduction

+ +
+ +
+
+ + + + +
+ +
+

Machine Learning Introduction#

+
+

Neural networks#

+

When we talk about machine learning, we usually mean an artifical neural network. +A neural network mimics the action of neurons in your brain.

+

Basic idea:

+
    +
  • Create a nonlinear fitting routine with free parameters

  • +
  • Train the network on data with known inputs and outputs to set the parameters

  • +
  • Use the trained network on new data to predict the outcome

  • +
+

We can think of a neural network as a map that takes a set of n parameters and returns a set of m parameters, \(\mathbb{R}^n \rightarrow \mathbb{R}^m\) and we can express this as:

+
+\[{\bf z} = {\bf A} {\bf x}\]
+

where \({\bf x} \in \mathbb{R}^n\) are the inputs, \({\bf z} \in \mathbb{R}^m\) are the outputs, and \({\bf A}\) is an \(m \times n\) matrix.

+

Our goal is to determine the matrix elements of \({\bf A}\).

+
+

Some nomeclature#

+

We can visualize a neural network as:

+

NN diagram

+
    +
  • Neural networks are divided into layers

    +
      +
    • There is always an input layer—it doesn’t do any processing

    • +
    • There is always an output layer

    • +
    +
  • +
  • Within a layer there are neurons or nodes.

    +
      +
    • For input, there will be one node for each input variable.

    • +
    +
  • +
  • Every node in the first layer connects to every node in the next layer

    +
      +
    • The weight associated with the connection can vary—these are the matrix elements.

    • +
    +
  • +
  • In this example, the processing is done in layer 2 (the output)

  • +
  • When you train the neural network, you are adjusting the weights connecting to the nodes

    +
      +
    • Some connections might have zero weight

    • +
    • This mimics nature—a single neuron can connect to several (or lots) of other neurons.

    • +
    +
  • +
+
+
+
+

Universal approximation theorem and non-linearity#

+

A neural network can be designed to approximate any function, \(f(x)\). For this to work, there must be a source of non-linearity in the network. This is applied on a layer. This is a result of the universal approximation theorem.

+

We call this an activation function and it has the form:

+
+\[\begin{split}g({\bf x}) = \left ( \begin{array}{c} g(x_0) \\ g(x_1) \\ \vdots \\ g(x_{n-1}) \end{array} \right )\end{split}\]
+

Then our neural network has the form: \({\bf z} = g({\bf A x})\)

+

We want to choose a \(g(x)\) that is differentiable. A common choice is the sigmoid function:

+
+\[g(p) = \frac{1}{1 + e^{-p}}\]
+
+
+
import numpy as np
+import matplotlib.pyplot as plt
+
+
+
+
+
+
+
def sigmoid(p):
+    return 1 / (1 + np.exp(-p))
+
+
+
+
+
+
+
p = np.linspace(-10, 10, 200)
+
+fig, ax = plt.subplots()
+
+ax.plot(p, sigmoid(p))
+
+
+
+
+
[<matplotlib.lines.Line2D at 0x7fd49c1927b0>]
+
+
+../_images/da56e7aa5a4fec26cc6454ce53c70390b3cfe2458b4c55e3a75f4a8462d6dd90.png +
+
+

Notice that the sigmoid scales all output to be in \(z_i \in (0, 1)\)

+

This means that we need to ensure that our training set set is likewise mapped to \((0, 1)\), and if not, we need to transform it.

+
+
+

Basic algorithm#

+
    +
  • Training

    +
      +
    • We have \(T\) pairs \((x^k, y^k)\) for \(k = 1, \ldots, T\)

    • +
    • We require that \(g({\bf A x}^k) = {\bf y}^k\) for all \(k\)

      +

      Recall that \(g(p)\) is a scalar function that works element-by-element:

      +
      +\[z_i = g([{\bf A x}]_i) = g \left ( \sum_j A_{ij} x_j \right )\]
      +
    • +
    • Find the elements of \({\bf A}\)

      +

      This is a minimization problem, where we are minimizing:

      +
      +\[f(A_{ij}) = \| g({\bf A x}^k) - {\bf y}^k \|^2\]
      +

      We call this function the cost function.

      +

      A common minimization technique is gradient descent.

      +

      Some caveats:

      +
        +
      • When you minimize with one set of training data, there is no guarantee that your are still minimimzed with respect to the others. We do multiple epochs or passes through the training data to fix this.

      • +
      • We often don’t apply the full correction from gradient descent, but instead scale it by some \(\eta < 1\) called the learning rate.

      • +
      +
    • +
    +
  • +
  • Using the network

    +

    With the trained \({\bf A}\), we can now use the network on data we haven’t seen before

    +
  • +
+
+
+

Hidden layers#

+

We can get better performance from a neural network by adding a hidden layer:

+

hidden layers

+

The side of the hidden layer is independent of the size of the input and output layers. Now we have an additional matrix \({\bf B}\) to train. This can all be done together using the same algorithm described above. Where we now minimize:

+
+\[f(A_{ls}, B_{ij}) = \sum_{l=1}^m (z_l - y_l)^2\]
+
+\[\tilde{z}_i = g \left ( \sum_{j=1}^n B_{ij} x_j \right )\]
+
+\[z_l = g \left ( \sum_{s=1}^k A_{ls} \tilde{z}_s \right )\]
+
+
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/machine-learning-libraries.html b/11-machine-learning/machine-learning-libraries.html new file mode 100644 index 00000000..b2756611 --- /dev/null +++ b/11-machine-learning/machine-learning-libraries.html @@ -0,0 +1,717 @@ + + + + + + + + + + + Diving Deeper into Machine Learning — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Diving Deeper into Machine Learning

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Diving Deeper into Machine Learning#

+

We’ve focused on neural networks, using labeled data that we +can use to learn the trends in our data. This is an example +of supervised learning.

+

Broadly speaking there are +3 main approaches to machine learning

+
    +
  • Supervised learning

    +

    This uses labeled pairs (input and output) to train the model +to learn how to predict the outputs from the inputs.

    +
  • +
  • Unsupervised learning

    +

    No labeled data is provided. Instead the machine learning +algorithm seeks to find the structure on its own. The goal +is to learn patterns and features to be able to produce +new data.

    +
  • +
  • Reinforcement learning

    +

    As with unsupervised learning, no labeled data is used, +but the model is “rewarded” when it does something right, +and the model tries to maximize rewards (think: self-driving +cars).

    +
  • +
+
+

Libraries#

+

There are a number of popular libraries that implement machine learning algorithms. +Their features and performance vary quite a bit. An comparison of their +features is provided by Wikipedia: Comparison of deep learning software.

+

Some additional comparisons are provided here: https://ritza.co/articles/scikit-learn-vs-tensorflow-vs-pytorch-vs-keras/

+
    +
  • TensorFlow

    +

    This is an open source machine learning library released by Google. It has support +for CPUs, GPUs, and TPUs, +and provides all the features you need to build deep learning workflows: +TensorFlow feactures.

    +

    You can install tensorflow via:

    +
    pip install tensorflow
    +
    +
    +
    +

    Note

    +

    At the moment, tensorflow only supports python <= 3.12. So I’ll be using +pytorch instead (since I am running python 3.13).

    +
    +
  • +
  • PyTorch

    +

    This is a machine learning library build off of the Torch library, originally +developed by Facebook.

    +

    You can install pytorch via:

    +
    pip install torch
    +
    +
    +
  • +
  • scikit-learn

    +

    This is a python library developed for machine learning. It has a lot of +sample datasets that provide a nice means to learn how different methods work. +It is designed to work with NumPy and SciPy.

    +

    General recommendations on the web seem to be to use Scikit-learn to get +started with machine learning and to explore ideas, but to switch to +one of the other packages for computationally-intensive work.

    +

    You can install scikit-learn via:

    +
    pip install scikit-learn
    +
    +
    +

    Scikit-learn provides some nice sample datasets:

    +

    https://scikit-learn.org/stable/datasets/toy_dataset.html

    +

    as well as generators for +datasets:

    +

    https://scikit-learn.org/stable/datasets/sample_generators.html

    +
  • +
+

There are also tools that provide higher-level interfaces to these

+
    +
  • Keras

    +

    Keras provides a common python interface to several different machine learning +libraries, including tensorflow and torch. This hides a lot of the implementation +details and makes it easy to get started using these libraries.

    +
  • +
+
+
+

Keras#

+

We’ll focus on Keras.

+

There are a large number of examples provided by Keras:

+

https://keras.io/examples/

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/machine-learning.html b/11-machine-learning/machine-learning.html new file mode 100644 index 00000000..ffb75821 --- /dev/null +++ b/11-machine-learning/machine-learning.html @@ -0,0 +1,583 @@ + + + + + + + + + + + Machine Learning — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Machine Learning

+ +
+
+ +
+
+
+ + + + +
+ +
+

Machine Learning#

+

We’ll look at a popular library for machine learning.

+
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/neural-net-basics.html b/11-machine-learning/neural-net-basics.html new file mode 100644 index 00000000..cabccb8a --- /dev/null +++ b/11-machine-learning/neural-net-basics.html @@ -0,0 +1,781 @@ + + + + + + + + + + + Artificial Neural Network Basics — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Artificial Neural Network Basics

+ +
+ +
+
+ + + + +
+ +
+

Artificial Neural Network Basics#

+
+

Neural networks#

+

An artifical +neural +network +mimics the action of neurons in your brain to form connections +between nodes (neurons) that link the input to the output.

+
+

Note

+

We’ll loosely +follow the notation from Computational Methods for Physics by +Franklin.

+
+

Basic idea:

+
    +
  • Create a nonlinear fitting routine with free parameters

  • +
  • Train the network on data with known inputs and outputs to set the parameters

  • +
  • Use the trained network on new data to predict the outcome

  • +
+

We can think of a neural network as a map that takes a set of +\(N_\mathrm{in}\) parameters and returns a set of \(N_\mathrm{out}\) +parameters, which we can express this as:

+
+\[{\bf z} = {\bf A} {\bf x}\]
+

where

+
+\[{\bf x} = (x_1, x_2, \ldots, x_{N_\mathrm{in}})\]
+

are the inputs,

+
+\[{\bf z} = (z_1, z_2, \ldots, z_{N_\mathrm{out}})\]
+

are the outputs, and +\({\bf A}\) is an \(N_\mathrm{out} \times N_\mathrm{in}\) matrix.

+

Our goal is to determine the matrix elements of \({\bf A}\).

+
+
+

Nomenclature#

+

We can visualize a neural network as:

+

neural network diagram showing nodes in layers linked

+
    +
  • Neural networks are divided into layers

    +
      +
    • There is always an input layer—it doesn’t do any processing.

    • +
    • There is always an output layer.

    • +
    +
  • +
  • Within a layer there are neurons or nodes.

    +
      +
    • For input, there will be one node for each input variable. In this figure, +there are 3 nodes on the input layer.

    • +
    • The output layer will have as many nodes are needed to convey the answer +we are seeking from the network. In this case, there are 2 nodes on the +output layer.

    • +
    +
  • +
  • Every node in the first layer connects to every node in the next layer

    +
      +
    • The weight associated with the connection can vary—these are the matrix elements.

      +
      +

      Note

      +

      This is called a dense layer. There are alternate types of layers +we can explore where the nodes are connected differently.

      +
      +
    • +
    +
  • +
  • In this example, the processing is done in layer 2 (the output)

  • +
  • When you train the neural network, you are adjusting the weights connecting to the nodes

    +
      +
    • Some connections might have zero weight

    • +
    • This mimics nature—a single neuron can connect to several (or lots) of other neurons.

    • +
    +
  • +
+
+
+

Universal approximation theorem#

+

A neural network can be designed to approximate any function, \(f(x)\). For this to work, there must be a source of non-linearity in the network—this is a result of the universal approximation theorem.

+

We use a nonlinear activation function that is applied in a layer. It has +the form:

+
+\[\begin{split}g({\bf v}) = \left ( \begin{array}{c} g(v_0) \\ g(v_1) \\ \vdots \\ g(v_{n-1}) \end{array} \right )\end{split}\]
+
+

Note

+

The activation function, \(g({\bf v})\) works element-by-element on the vector \({\bf v}\).

+
+

Then our neural network has the form: \({\bf z} = g({\bf A x})\)

+

We want to choose a function \(g(\xi)\) that is differentiable. A common choice is the sigmoid function:

+
+\[g(\xi) = \frac{1}{1 + e^{-\xi}}\]
+
+a plot of the sigmoid function +
+

Fig. 1 The sigmoid function#

+
+
+
+

Note

+

There are many choices for the activation function which have +different properties. Often the choice of activation function will be empirical, by experimenting with the +performance of the network.

+
+
+
+

Basic algorithm#

+

We’ll consider the case where we have training data—a set of inputs, \({\bf x}^k\), +together with the expected output (answer), \({\bf y}^k\). These training pairs +allow us to constrain the output of the network and train the weights.

+
    +
  • Training

    +
      +
    • Loop over the \(T\) pairs \(({\bf x}^k, {\bf y}^k)\) for \(k = 1, \ldots, T\)

      +
        +
      • Predict the output for \({\bf x}^k\) as:

        +
        +\[z_i = g([{\bf A x}^k]_i) = g \left ( \sum_{j=1}^{N_\mathrm{in}} A_{ij} x^k_j \right )\]
        +
      • +
      • Constrain that \({\bf z} = {\bf y}^k\).

        +

        This is a minimization problem, where we are minimizing:

        +
        +\[\begin{align*} +\mathcal{L}(A_{ij}) &= \| g({\bf A x}^k) - {\bf y}^k \|^2 \\ + &= \sum_{i=1}^{N_\mathrm{out}} \left [ g\left (\sum_{j=1}^{N_\mathrm{in}} A_{ij} x^k_j \right ) - y^k_i \right ]^2 +\end{align*}\]
        +

        We call this function, \(\mathcal{L}\), the cost function or loss function.

        +
        +

        Note

        +

        This is called the mean square error loss function, and is one possible choice for \(\mathcal{L}(A_{ij})\), but many others exist.

        +
        +
      • +
      • Update the matrix \({\bf A}\) based on the training pair \(({\bf x}^k, {\bf y^{k}})\).

      • +
      +
    • +
    +
  • +
  • Using the network

    +

    With the trained \({\bf A}\), we can now use the network on data we haven’t seen before, \(\boldsymbol \chi\):

    +
    +\[z_i = g([{\bf A {\boldsymbol \chi}}^k]_i) = g \left ( \sum_{j=1}^{N_\mathrm{in}} A_{ij} \chi^k_j \right )\]
    +
  • +
+

There are a lot of details that we still need to figure out involving the training and minimization. +We’ll start with minimization: a common minimization technique used with +neural networks is gradient descent.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/neural-net-derivation.html b/11-machine-learning/neural-net-derivation.html new file mode 100644 index 00000000..8ba63ed1 --- /dev/null +++ b/11-machine-learning/neural-net-derivation.html @@ -0,0 +1,716 @@ + + + + + + + + + + + Deriving the Learning Correction — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Deriving the Learning Correction

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Deriving the Learning Correction#

+

For gradient descent, we need to derive the update to the matrix +\({\bf A}\) based on training on a set of our data, \(({\bf x}^k, {\bf y}^k)\).

+
+

Important

+

The derivation we do here is specific to our choice of loss function, \(\mathcal{L}(A_{ij})\) +and activation function, \(g(\xi)\).

+
+

Let’s start with our cost function:

+
+\[\mathcal{L}(A_{ij}) = \sum_{i=1}^{N_\mathrm{out}} (z_i - y_i^k)^2 = \sum_{i=1}^{N_\mathrm{out}} + \Biggl [ g\biggl (\underbrace{\sum_{j=1}^{N_\mathrm{in}} A_{ij} x^k_j}_{\equiv \alpha_i} \biggr ) - y^k_i \Biggr ]^2\]
+

where we’ll refer to the product \(\boldsymbol{\alpha} \equiv {\bf +Ax}\) to help simplify notation. This means that \({\bf z} = g(\boldsymbol{\alpha})\).

+

We can compute the derivative with respect to a single matrix +element, \(A_{pq}\) by applying the chain rule:

+
+\[\frac{\partial \mathcal{L}}{\partial A_{pq}} = + 2 \sum_{i=1}^{N_\mathrm{out}} (z_i - y^k_i) \left . \frac{\partial g}{\partial \xi} \right |_{\xi=\alpha_i} \frac{\partial \alpha_i}{\partial A_{pq}}\]
+

with

+
+\[\frac{\partial \alpha_i}{\partial A_{pq}} = \sum_{j=1}^{N_\mathrm{in}} \frac{\partial A_{ij}}{\partial A_{pq}} x^k_j = \sum_{j=1}^{N_\mathrm{in}} \delta_{ip} \delta_{jq} x^k_j = \delta_{ip} x^k_q\]
+

and for \(g(\xi)\), we will assume the sigmoid function,so

+
+\[\frac{\partial g}{\partial \xi} + = \frac{\partial}{\partial \xi} \frac{1}{1 + e^{-\xi}} + =- (1 + e^{-\xi})^{-2} (- e^{-\xi}) + = g(\xi) \frac{e^{-\xi}}{1+ e^{-\xi}} = g(\xi) (1 - g(\xi))\]
+

which gives us:

+
+\[\begin{align*} +\frac{\partial \mathcal{L}}{\partial A_{pq}} &= 2 \sum_{i=1}^{N_\mathrm{out}} + (z_i - y^k_i) z_i (1 - z_i) \delta_{ip} x^k_q \\ + &= 2 (z_p - y^k_p) z_p (1- z_p) x^k_q +\end{align*}\]
+

where we used the fact that the \(\delta_{ip}\) means that only a single term contributes to the sum.

+
+

Note

+

Observe that:

+
    +
  • \(e_p^k \equiv (z_p - y_p^k)\) is the error on the output layer, +and the correction is proportional to the error (as we would +expect).

  • +
  • The \(k\) superscripts here remind us that this is the result of +only a single pair of data from the training set.

  • +
+
+

Now \({\bf z}\) and \({\bf y}^k\) are all vectors of size \(N_\mathrm{out} \times 1\) and \({\bf x}^k\) is a vector of size \(N_\mathrm{in} \times 1\), so we can write this expression for the matrix as a whole as:

+
+\[\frac{\partial \mathcal{L}}{\partial {\bf A}} = 2 ({\bf z} - {\bf y}^k) \circ {\bf z} \circ (1 - {\bf z}) \cdot ({\bf x}^k)^\intercal\]
+

where the operator \(\circ\) represents element-by-element multiplication (the Hadamard product).

+
+

Performing the update#

+

We could do the update like we just saw with our gradient descent +example: take a single data point, \(({\bf x}^k, {\bf y}^k)\) and +do the full minimization, continually estimating the correction, +\(\partial \mathcal{L}/\partial {\bf A}\) and updating \({\bf A}\) until we +reach a minimum. The problem with this is that \(({\bf x}^k, {\bf y}^k)\) is only one point in our training data, and there is no +guarantee that if we minimize completely with point \(k\) that we will +also be a minimum with point \(k+1\).

+

Instead we take multiple passes through the training data (called epochs) and apply only a single push in the direction that gradient +descent suggests, scaled by a learning rate \(\eta\).

+

The overall minimization appears as:

+
+
+
+Minimization
+
    +
  • Loop over epochs

    +
      +
    • Loop over the training data, \(\{ ({\bf x}^0, {\bf y}^0), ({\bf x}^1, {\bf y}^1), \ldots \}\). We’ll refer to the current training +pair as \(({\bf x}^k, {\bf y}^k)\)

      +
        +
      • Propagate \({\bf x}^k\) through the network, getting the output +\({\bf z} = g({\bf A x}^k)\)

      • +
      • Compute the error on the output layer, \({\bf e}^k = {\bf z} - {\bf y}^k\)

      • +
      • Update the matrix \({\bf A}\) according to:

        +
        +\[{\bf A} \leftarrow {\bf A} - 2 \,\eta\, {\bf e}^k \circ {\bf z} \circ (1 - {\bf z}) \cdot ({\bf x}^k)^\intercal\]
        +
      • +
      +
    • +
    +
  • +
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/neural-net-hidden.html b/11-machine-learning/neural-net-hidden.html new file mode 100644 index 00000000..c94ed16a --- /dev/null +++ b/11-machine-learning/neural-net-hidden.html @@ -0,0 +1,726 @@ + + + + + + + + + + + Hidden Layers — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Hidden Layers

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Hidden Layers#

+

We can get better performance from a neural network by adding a hidden layer:

+

neutron network diagram showing a single hidden layer

+

The size of the hidden layer is independent of the size of the input and output +layers. In this case, we have a hidden layer that is larger +than either the input or output layers.

+

Now we have an additional matrix \({\bf B}\) to train. The matrix sizes are:

+
    +
  • \({\bf A}\) : \(N_\mathrm{out} \times N_\mathrm{hidden}\)

  • +
  • \({\bf B}\) : \(N_\mathrm{hidden} \times N_\mathrm{in}\)

  • +
+
+

Note

+

Neglecting the activation functions, the action of the network +is to do \({\bf z} = {\bf A B x}\) which has size \(N_\mathrm{out}\).

+
+

The derivation of the corrections to matrices \({\bf A}\) and \({\bf B}\) can be done +via the chain rule.

+
+

Note

+

We’ll consider the case of a single hidden layer, but the derivation we +do here generalizes to multiple hidden layers.

+
+
+(5)#\[\begin{equation} +\mathcal{L}(A_{lm}, B_{ij}) = \sum_{l=1}^{N_\mathrm{out}} (z_l - y^k_l)^2 +\end{equation} \]
+
+\[\tilde{z}_i = g \biggl ( \underbrace{\sum_{j=1}^{N_\mathrm{in}} B_{ij} x^k_j}_{\equiv \beta_i} \biggr )\]
+
+\[z_l = g \biggl ( \underbrace{\sum_{m=1}^{N_\mathrm{hidden}} A_{lm} \tilde{z}_m}_{\equiv \alpha_l} \biggr )\]
+

Note that we are assuming here that the same activation function, \(g(\xi)\) +is used on each layer.

+
+

Updates to \({\bf A}\)#

+

Matrix \({\bf A}\) is trained based on the output layer, we know the error there +directly, \({\bf e}^k = {\bf z} - {\bf y}^k\). As a result, we can just use +the result that we got for a single layer, but now the input is \(\tilde{\bf z}\) +instead of \({\bf x}\):

+
+\[\frac{\partial \mathcal{L}}{\partial {\bf A}} = 2 {\bf e}^k \circ {\bf z} \circ (1 - {\bf z}) \cdot \tilde{\bf z}^\intercal\]
+
+
+

Updates to \({\bf B}\)#

+

To find the corrections to matrix \({\bf B}\), we essentially need to know what the +error is on the hidden layer. But we only know the error on the output layer, so +by applying the chainrule on our cost function, we will work out this correction, +and in the process see how the error on the output layer informs the error on the +hidden layer—a process called backpropagation.

+

Let’s start with our cost function:

+
+\[\begin{align*} +\mathcal{L}(A_{lm}, B_{ij}) &= \sum_{l=1}^{N_\mathrm{out}} (z_l - y^k_l)^2 \\ + &= \sum_{l=1}^{N_\mathrm{out}} \Biggl [ g \biggl ( \sum_{m=1}^{N_\mathrm{hidden}} A_{lm} \tilde{z}_m \biggr ) - y_l^k \Biggr ]^2 \\ + &= \sum_{l=1}^{N_\mathrm{out}} \Biggl [ g \biggl ( \sum_{m=1}^{N_\mathrm{hidden}} A_{lm} \,g \biggl ( \sum_{j=1}^{N_\mathrm{in}} B_{mj} x_j^k \biggr ) \biggr ) - y_l^k \Biggr ]^2 +\end{align*} \]
+

Differentiating with respect to an element in matrix \({\bf B}\), we apply the chain rule over and over, +giving:

+
+\[\frac{\partial \mathcal{L}}{\partial B_{pq}} = 2 \sum_{l=1}^{N_\mathrm{out}} (z_l - y_l^k) + \left .\frac{\partial g}{\partial \xi} \right |_{\xi = \alpha_l} + \sum_{m=1}^{N_\mathrm{hidden}} A_{lm}\, \left . \frac{\partial g}{\partial \xi} \right |_{\xi = \beta_m} + \sum_{j=1}^{N_\mathrm{in}} \frac{\partial B_{mj}}{\partial B_{pq}} x_j^k \]
+

Now we have 3 derivatives left, which are straightforward:

+
+\[\left .\frac{\partial g}{\partial \xi} \right |_{\xi = \alpha_l} = g(\alpha_l)\left [ 1 - g(\alpha_l)\right ] + = z_l (1 - z_l)\]
+
+\[\left .\frac{\partial g}{\partial \xi} \right |_{\xi = \beta_m} = g(\beta_m)\left [ 1 - g(\beta_m)\right ] + = \tilde{z}_m (1 - \tilde{z}_m)\]
+
+\[\frac{\partial B_{mj}}{\partial B_{pq}} = \delta_{mp} \delta_{jq}\]
+

Inserting these dervatives and using the \(\delta\)’s, we are left with:

+
+\[\frac{\partial \mathcal{L}}{\partial B_{pq}} = 2 \sum_{l=1}^{N_\mathrm{out}} + \underbrace{(z_l - y_l^k)}_{ = e_l^k} z_l (1 - z_l) A_{lp} \tilde{z}_p (1 - \tilde{z}_p) x^k_q\]
+

Now, that remaining sum is contracting on the first of the indices of +the matrix \({\bf A}\), indicating a matrix vector product involving +\({\bf A}^\intercal\). This allows us to define the error backpropagated to the hidden layer:

+
+\[\tilde{e}_p^k = \sum_{l=1}^{N_\mathrm{out}} e_l^k z_l (1 - z_l) A_{lp} + = \left [ {\bf A}^\intercal \cdot ({\bf e}^k \circ {\bf z} \circ (1 - {\bf z})) \right ]_p\]
+

and we can write

+
+\[\frac{\partial \mathcal{L}}{\partial {\bf B}} = 2 \tilde{\bf e}^k \circ \tilde{\bf z} \circ (1 - \tilde{\bf z}) \cdot ({\bf x}^k)^\intercal\]
+

Notice the symmetry in the update of each matrix:

+
+\[\begin{align*} +\frac{\partial \mathcal{L}}{\partial {\bf A}} &= 2 {\bf e}^k \circ {\bf z} \circ (1 - {\bf z}) \cdot \tilde{\bf z}^\intercal \\ +\frac{\partial \mathcal{L}}{\partial {\bf B}} &= 2 \tilde{\bf e}^k \circ \tilde{\bf z} \circ (1 - \tilde{\bf z}) \cdot ({\bf x}^k)^\intercal +\end{align*}\]
+

Adding additional hidden layers would continue the trend, with each hidden layer’s matrix update depending +on the error backpropagated to that layer.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/11-machine-learning/neural-net-improvements.html b/11-machine-learning/neural-net-improvements.html new file mode 100644 index 00000000..8093d8ad --- /dev/null +++ b/11-machine-learning/neural-net-improvements.html @@ -0,0 +1,741 @@ + + + + + + + + + + + Improvements — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

Improvements#

+

There are many ways we could improve the performance of our network, but these will add +a lot of complexity to the simple class that we wrote. Fortunately there are a lot of +machine learning libraries that provide these features, and work efficiently, so for +real applications we would want to use one of those libraries (we’ll explore these next).

+
+

Batching#

+

Right now, we did our training as:

+
    +
  • Loop over the \(T\) pairs \(({\bf x}^k, {\bf y}^k)\) for \(k = 1, \ldots, T\)

    +
      +
    • Propagate \(({\bf x}^k, {\bf y}^k)\) through the network

    • +
    • Compute the corrections \(\partial \mathcal{L}/\partial {\bf A}\), \(\partial \mathcal{L}/\partial {\bf B}\)

    • +
    • Update the matrices:

      +
      +\[{\bf A} \leftarrow {\bf A} - \eta \frac{\partial \mathcal{L}}{\partial {\bf A}}\]
      +
      +\[{\bf B} \leftarrow {\bf B} - \eta \frac{\partial \mathcal{L}}{\partial {\bf B}}\]
      +
    • +
    +
  • +
+

In this manner, each training pair sees slightly different +matrices \({\bf A}\) and \({\bf B}\), as each previous pair +updates it immediately.

+

We could instead divide our training set into \(N\) batches, +each with \(\tau = T/N\) training pairs and do our update as:

+
    +
  • Loop over \(N\) batches

    +
      +
    • Loop over the \(\tau\) pairs \(({\bf x}^k, {\bf y}^k)\) for \(k = 1, \ldots, \tau\) in the current batch

      +
        +
      • Propagate \(({\bf x}^k, {\bf y}^k)\) through the network

      • +
      • Compute the gradients \(\partial \mathcal{L}/\partial {\bf A}^k\), \(\partial \mathcal{L}/\partial {\bf B}^k\) from the current pair

      • +
      • Accumulate the gradients:

        +
        +\[\frac{\partial \mathcal{L}}{\partial {\bf A}} = \frac{\partial \mathcal{L}}{\partial {\bf A}} + \frac{\partial \mathcal{L}}{\partial {\bf A}^k}\]
        +
        +\[\frac{\partial \mathcal{L}}{\partial {\bf B}} = \frac{\partial \mathcal{L}}{\partial {\bf B}} + \frac{\partial \mathcal{L}}{\partial {\bf B}^k}\]
        +
      • +
      +
    • +
    • Apply a single update to the matrices for this batch:

      +
      +\[{\bf A} \leftarrow {\bf A} - \frac{\eta}{\tau} \frac{\partial \mathcal{L}}{\partial {\bf A}}\]
      +
      +\[{\bf B} \leftarrow {\bf B} - \frac{\eta}{\tau} \frac{\partial \mathcal{L}}{\partial {\bf B}}\]
      +
    • +
    +
  • +
+
+

Note

+

We normalize the accumulated gradients by the batch size, \(\tau\), which means that +we are applying the average gradient over the batch.

+
+

The advantage of this is that the \(\tau\) trainings in a batch +can all be done in parallel now, spread across many CPU cores +or GPU cores. This greatly accelerates the training time.

+
+
+

Different activation or cost functions#

+

We used a simple cost function: the sum of the square of the errors. This is analogous to the \(L_2\) norm we discussed previously. But there are a lot of other cost functions +we could explore. Changing the cost function will require +us to recompute our derivatives.

+

Likewise, there are a wide number of activation functions, +some of which are not differentiable. The choice of activation +function can depend on what type of data you are using. You +might also want to use a different activation function +on each layer. Again, this would require us to redo +our derivatives.

+
+
+

Use a different minimization technique#

+

We only explored gradient descent. But there are improvements +to this (like momentum that we mentioned previously) as well +as alternate minimization techniques we could use (some of +which don’t need the gradient at all).

+
+
+

Different types of layers / connections#

+

We only considered a dense network: every node on one +layer was connected to every node on the adjacent layer. +But there are alternatives.

+

For example, a convolutional neural network performs a convolution on a layer with some kernel. This +helps identifying features.

+
+
+

More hidden layers#

+

There is no restriction on the number of hidden layers we +can use. Each additional hidden layer means an additional +matrix is added to our network. For our code, we’d simply need to backpropagate +the error to each hidden layer and compute the update to +the new matrix.

+
+
+

Auto-differentiation libraries#

+

At some point, with all of these options, doing all of the +differentiation / chain-rule by hand becomes burdensome and +prone to errors. For this reason, libraries often use +automatic differentiation libraries, like JAX which can take +the derivatives of our python functions themselves.

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/12-extensions/extensions-example.html b/12-extensions/extensions-example.html new file mode 100644 index 00000000..7f694737 --- /dev/null +++ b/12-extensions/extensions-example.html @@ -0,0 +1,1364 @@ + + + + + + + + + + + Example Extension — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + + + + + + +
+ +
+

Example Extension#

+

Let’s rewrite our Mandelbrot generator using different languages +to see how the performance differs.

+

Recall the Mandelbrot set is defined as the set such that \(z_{k+1} = z_k^2 + c\) +remains bounded, defined as \(|z_{k+1}| \le 2\), where \(c\) is a complex number, +\(c = x + iy\), in the complex plane, and \(z_0 = 0\) is the starting condition.

+

We’ll do a fixed number of iterations, and store the iteration for which \(|z_{k+1}|\) +first becomes larger than 2.

+
+

NumPy array syntax#

+

Here’s an example of a python implementation using NumPy array operations:

+
import numpy as np
+
+def mandelbrot(N,
+               xmin=-2.0, xmax=2.0,
+               ymin=-2.0, ymax=2.0,
+               max_iter=10):
+
+    x = np.linspace(xmin, xmax, N)
+    y = np.linspace(ymin, ymax, N)
+
+    xv, yv = np.meshgrid(x, y, indexing="ij")
+
+    c = xv + 1j * yv
+
+    z = np.zeros((N, N), dtype=np.complex128)
+
+    m = np.zeros((N, N), dtype=np.int32)
+
+    for i in range(1, max_iter+1):
+        z[m == 0] = z[m == 0]**2 + c[m == 0]
+
+        m[np.logical_and(np.abs(z) > 2, m == 0)] = i
+
+    return m
+
+
+

We can test this as:

+
import matplotlib.pyplot as plt
+import numpy as np
+
+import mandel
+
+import time
+
+start = time.time()
+
+xmin = -2.5
+xmax = 1.5
+ymin = -2.0
+ymax = 2.0
+
+m = mandel.mandelbrot(1024, xmin, xmax, ymin, ymax, max_iter=50)
+
+print(f"execution time = {time.time() - start}\n")
+
+fig, ax = plt.subplots()
+ax.imshow(np.transpose(m % 16), origin="lower",
+          extent=[xmin, xmax, ymin, ymax], cmap="viridis")
+
+fig.tight_layout()
+fig.savefig("test.png")
+
+
+

Here’s the resulting image

+An image of the Mandelbrot set +
+
+

Python with explicit loops#

+

Here’s a version where the loops are explicitly written out in python:

+
import numpy as np
+
+def mandelbrot(N,
+               xmin=-2.0, xmax=2.0,
+               ymin=-2.0, ymax=2.0,
+               max_iter=10):
+
+    x = np.linspace(xmin, xmax, N)
+    y = np.linspace(ymin, ymax, N)
+
+    c = np.zeros((N, N), dtype=np.complex128)
+
+    for i in range(N):
+        for j in range(N):
+            c[i, j] = x[i] + 1j * y[j]
+
+    z = np.zeros((N, N), dtype=np.complex128)
+
+    # note: we need to use a numba type here
+    m = np.zeros((N, N), dtype=np.int32)
+
+    for n in range(1, max_iter+1):
+
+        for i in range(N):
+            for j in range(N):
+                if m[i, j] == 0:
+                    z[i, j] = z[i, j] * z[i, j] + c[i, j]
+
+                    if np.abs(z[i,j]) > 2:
+                        m[i, j] = n
+
+    return m
+
+
+

This can be run using the same driver as the numpy vectorized version.

+
+
+

Numba version#

+

We can install Numba simply by doing:

+
pip install numba
+
+
+

To get a Numba optimized version of the python with explicit loops we just add:

+
from numba import njit
+
+
+

and then right before the function definition:

+
@njit()
+
+
+

Here’s the full code:

+
import numpy as np
+
+from numba import njit
+
+
+@njit(nopython=True)
+def mandelbrot(N,
+               xmin=-2.0, xmax=2.0,
+               ymin=-2.0, ymax=2.0,
+               max_iter=10):
+
+    x = np.linspace(xmin, xmax, N)
+    y = np.linspace(ymin, ymax, N)
+
+    c = np.zeros((N, N), dtype=np.complex128)
+
+    for i in range(N):
+        for j in range(N):
+            c[i, j] = x[i] + 1j * y[j]
+
+    z = np.zeros((N, N), dtype=np.complex128)
+
+    # note: we need to use a numba type here
+    m = np.zeros((N, N), dtype=np.int32)
+
+    for n in range(1, max_iter+1):
+
+        for i in range(N):
+            for j in range(N):
+                if m[i, j] == 0:
+                    z[i, j] = z[i, j] * z[i, j] + c[i, j]
+
+                    if np.abs(z[i, j]) > 2:
+                        m[i, j] = n
+
+    return m
+
+
+

Again, this uses the same driver.

+
+

Note

+

We didn’t need to do anything special to compile the numba code. +This is done for us when we first encounter it.

+
+
+

Tip

+

We run it twice in our driver, since the first call will have the overhead +of the JIT compilation.

+
+
import matplotlib.pyplot as plt
+import numpy as np
+
+import mandel
+
+import time
+
+start = time.time()
+
+xmin = -2.5
+xmax = 1.5
+ymin = -2.0
+ymax = 2.0
+
+m = mandel.mandelbrot(1024, xmin, xmax, ymin, ymax, max_iter=50)
+
+print(f"execution time (including jit) = {time.time() - start}\n")
+
+start = time.time()
+
+m = mandel.mandelbrot(1024, xmin, xmax, ymin, ymax, max_iter=50)
+
+print(f"second run time = {time.time() - start}\n")
+
+fig, ax = plt.subplots()
+ax.imshow(np.transpose(m % 16), origin="lower",
+          extent=[xmin, xmax, ymin, ymax], cmap="viridis")
+
+fig.tight_layout()
+fig.savefig("test.png")
+
+
+
+

Tip

+

We can get even better performance if we let numba do things in parallel, with

+
@njit(parallel=True)
+
+
+
+
+
+

Cython version#

+

We can install Cython by doing

+
pip install Cython
+
+
+

For Cython, we mainly need to specify the datatypes of the different +variables. We use the extension .pyx for a cython file.

+

Here’s the full code:

+
import cython
+import numpy as np
+cimport numpy as np
+
+@cython.boundscheck(False)
+@cython.wraparound(False)
+@cython.returns(np.ndarray)
+def mandelbrot(int N,
+               double xmin=-2.0, double xmax=2.0,
+               double ymin=-2.0, double ymax=2.0,
+               int max_iter=10):
+
+    cdef np.ndarray[np.float64_t, ndim=1] x = np.linspace(xmin, xmax, N, dtype=np.float64)
+    cdef np.ndarray[np.float64_t, ndim=1] y = np.linspace(ymin, ymax, N, dtype=np.float64)
+
+    cdef np.ndarray[np.complex128_t, ndim=2] c = np.zeros((N, N), dtype=np.complex128)
+
+    cdef unsigned int i, j
+    for i in range(N):
+        for j in range(N):
+            c[i, j] = x[i] + 1j * y[j]
+
+    cdef np.ndarray[np.complex128_t, ndim=2] z = np.zeros((N, N), dtype=np.complex128)
+
+    cdef np.ndarray[np.int32_t, ndim=2] m = np.zeros((N, N), dtype=np.int32)
+
+    cdef unsigned int n
+    for n in range(1, max_iter+1):
+
+        for i in range(N):
+            for j in range(N):
+                if m[i, j] == 0:
+                    z[i, j] = z[i, j] * z[i, j] + c[i, j]
+
+                    if abs(z[i,j]) > 2:
+                        m[i, j] = n
+
+    return m
+
+
+

To build it, we can use a setup.py file:

+
from setuptools import setup
+from Cython.Build import cythonize
+
+setup(name="mandel",
+      ext_modules=cythonize("mandel.pyx"),
+      zip_safe=False)
+
+
+

and make the extension as:

+
python setup.py build_ext --inplace
+
+
+
+

Note

+

This build process will likely change in the near future, as +the community is transitioning away from setup.py, but the +docs don’t seem to be fully up to date on the new way to build.

+
+
+

Tip

+

To help understand where the slow parts of your Cython code are, you +can do

+
cythonize -a mandel.pyx
+
+
+

This will produce an HTML file with the parts of the code that interact +with python highlighted. (Make sure there are no .c files hanging around). +These highlighted lines are places you should try to optimize.

+

For our example, if we do

+
np.abs(z[i,j])
+
+
+

instead of

+
abs(z[i,j])
+
+
+

we get a dramatic slowdown!

+

Thanks to Eric Johnson for pointing this out.

+
+
+
+

Fortran implementation#

+

If we want to write the code in Fortran, we need to compile it into a shared +object library that python can import.
+This is where f2py comes in—it is part of the numpy project, so you probably +already have it installed.

+
+

Note

+

Support for this is in transition at the moment. The old official way to do this +was to use distutils, but this is removed in python 3.12.

+

Instead, we will use the meson build system.

+
+

We need to install meson and ninja:

+
pip install meson ninja
+
+
+

Here’s our Fortran implementation for the Mandelbrot generator:

+
subroutine mandelbrot(N, xmin, xmax, ymin, ymax, max_iter, m)
+
+  implicit none
+
+  integer, intent(in) :: N
+  double precision, intent(in) :: xmin, xmax, ymin, ymax
+  integer, intent(in) :: max_iter
+
+  integer, intent(out) :: m(N, N)
+
+  double complex, parameter :: i_unit = (0, 1)
+
+!f2py depend(N) :: m
+!f2py intent(out) :: m
+
+  integer :: i, j, niter
+  double precision :: x(N), y(N)
+  double precision :: dx, dy
+  double complex, allocatable :: c(:, :)
+  double complex, allocatable :: z(:, :)
+
+  ! compute coordinates
+  dx = (xmax - xmin) / (N - 1)
+  dy = (ymax - ymin) / (N - 1)
+
+  do i = 1, N
+     x(i) = xmin + (i-1) * dx
+     y(i) = ymin + (i-1) * dy
+  enddo
+
+  allocate(c(N, N))
+
+  do j = 1, N
+     do i = 1, N
+        c(i, j) = x(i) + i_unit * y(j)
+     enddo
+  enddo
+
+  m(:, :) = 0
+
+  allocate(z(N, N))
+  z(:, :) = 0.0
+
+  do niter = 1, max_iter
+
+     do j = 1, N
+        do i = 1, N
+
+           if (m(i, j) == 0) then
+              z(i, j) = z(i, j) * z(i, j) + c(i, j)
+
+              if (abs(z(i,j)) > 2) then
+                 m(i, j) = niter
+              endif
+           endif
+
+        enddo
+     enddo
+
+  enddo
+
+end subroutine mandelbrot
+
+
+

To build the extension, we can do:

+
f2py -c mandel.f90 -m mandel_f2py
+
+
+
+

Note

+

If the f2py command-line tool is not available, you can try running it as a module instead:

+
python -m numpy.f2py -c mandel.f90 -m mandel_f2py
+
+
+
+
+

Tip

+

The build doesn’t show you the compilation commands used to make the library. But if you look +at the output, it will say something like:

+
The Meson build system
+Version: 1.4.0
+Source dir: /tmp/tmp0sbl86zt
+Build dir: /tmp/tmp0sbl86zt/bbdir
+Build type: native build
+Project name: mandel_f2py
+
+
+

If you then look in the build directory, there will be a file compile_commands.json that +lists the commands that meson + f2py use to compile the extension. In our case, +it is using the optimization flag -O3.

+
+

This will create a library (on my machine, it is called mandel_f2py.cpython-312-x86_64-linux-gnu.so) +which we can import as import mandel_f2py.

+

Here’s a driver:

+
import matplotlib.pyplot as plt
+import numpy as np
+
+import mandel_f2py
+
+import time
+
+start = time.time()
+
+xmin = -2.5
+xmax = 1.5
+ymin = -2.0
+ymax = 2.0
+
+max_iter = 50
+
+m = mandel_f2py.mandelbrot(1024, xmin, xmax, ymin, ymax, max_iter)
+
+print(f"execution time = {time.time() - start}\n")
+
+fig, ax = plt.subplots()
+ax.imshow(np.transpose(m), origin="lower",
+          extent=[xmin, xmax, ymin, ymax])
+
+fig.tight_layout()
+fig.savefig("test.png")
+
+
+
+

Note

+

Even though our Fortran subroutine takes the array m as an +argument, since it is marked as intent(out), the python module +will use this as the return value.

+
+
+

Note

+

The numpy array returned to python will have Fortran ordering (column-major) instead +of the usual row-major ordering (take a look at the .flags attributes).

+
+
+
+

C++ / pybind11 implementation#

+

pybind11 allows you to construct a numpy-compatible array in C++ +and return it. There are different constructors for this—here +we use on that allows us to specify the shape and stride.

+

We can install pybind11 via pip:

+
pip install pybind11
+
+
+

Inside of the mandelbrot() function, we need temporary +two-dimensional arrays to store \(z\) and \(c\). With C++23 +we could use std::mdspan to give us nice multidimensional +indexing. For now, we need to do something different. +Our first attempt will use std::vector<std::vector<std::complex<double>>>.

+

Here’s the implementation of our Mandelbrot generator:

+
#include <iostream>
+#include <cmath>
+#include <complex>
+#include <vector>
+
+#include <pybind11/pybind11.h>
+#include <pybind11/numpy.h>
+
+
+namespace py = pybind11;
+
+using cmplx_arr = std::vector<std::vector<std::complex<double>>>;
+
+using namespace std::complex_literals;
+
+
+py::array_t<int> mandelbrot(int N,
+                            double xmin, double xmax,
+                            double ymin, double ymax, int max_iter) {
+
+    // construct the numpy array we will return
+    // we need to specify the strides manually
+
+    constexpr std::size_t elsize = sizeof(int);
+    std::size_t shape[2]{N, N};
+    std::size_t strides[2]{N * elsize, elsize};
+    auto m = py::array_t<int>(shape, strides);
+    auto m_view = m.mutable_unchecked<2>();
+
+    // for the other arrays used only here, we can
+    // do whatever we want.  Since we can't yet rely
+    // on C++23 mdspan, we'll just do a vector of vectors
+
+    std::vector<double> x(N, 0.0);
+    std::vector<double> y(N, 0.0);
+
+    double dx = (xmax - xmin) / static_cast<double>(N - 1);
+    double dy = (ymax - ymin) / static_cast<double>(N - 1);
+
+    for (int i = 0; i < N; ++i) {
+        x[i] = xmin + static_cast<double>(i) * dx;
+        y[i] = ymin + static_cast<double>(i) * dy;
+    }
+
+    cmplx_arr c(N, std::vector<std::complex<double>>(N, 0.0));
+    cmplx_arr z(N, std::vector<std::complex<double>>(N, 0.0));
+
+    // initialize c;
+
+    for (int i = 0; i < N; ++i) {
+        for (int j = 0; j < N; ++j) {
+            c[i][j] = x[i] + 1i * y[j];
+        }
+    }
+
+    // zero out the output array
+
+    for (int i = 0; i < m.shape(0); ++i) {
+        for (int j = 0; j < m.shape(1); ++j) {
+            m_view(i, j) = 0;
+        }
+    }
+
+    for (int niter = 1; niter <= max_iter; ++niter) {
+
+        for (int i = 0; i < m.shape(0); ++i) {
+            for (int j = 0; j < m.shape(1); ++j) {
+
+                if (m_view(i, j) == 0) {
+                    z[i][j] = z[i][j] * z[i][j] + c[i][j];
+
+                    if (std::abs(z[i][j]) > 2) {
+                        m_view(i, j) = niter;
+                    }
+                }
+            }
+        }
+    }
+
+    return m;
+}
+
+
+PYBIND11_MODULE(mandel, m) {
+    m.doc() = "C++ Mandelbrot example";
+    m.def("mandelbrot", &mandelbrot, "generate the Mandelbrot set of size N");
+}
+
+
+

We build the shared library as:

+
g++ -DNDEBUG -O3  -Wall -Wextra -shared -std=c++17 -fPIC $(python3 -m pybind11 --includes) mandel.cpp -o mandel$(python3-config --extension-suffix)
+
+
+

Our driver is essentially the same as the Fortran one.

+
import matplotlib.pyplot as plt
+import numpy as np
+
+import mandel
+
+import time
+
+start = time.time()
+
+xmin = -2.5
+xmax = 1.5
+ymin = -2.0
+ymax = 2.0
+
+max_iter = 50
+
+m = mandel.mandelbrot(1024, xmin, xmax, ymin, ymax, max_iter)
+
+print(f"execution time = {time.time() - start}\n")
+
+
+fig, ax = plt.subplots()
+ax.imshow(np.transpose(m), origin="lower",
+          extent=[xmin, xmax, ymin, ymax])
+
+fig.tight_layout()
+fig.savefig("test.png")
+
+
+

A slightly more complicated version that creates a contiguous Array class +that can be indexed with () runs faster. That code is here:

+
#include <cstddef>
+#include <cmath>
+#include <complex>
+
+#include <pybind11/pybind11.h>
+#include <pybind11/numpy.h>
+
+
+namespace py = pybind11;
+
+using namespace std::complex_literals;
+
+class Array {
+
+    int N;
+    std::vector<std::complex<double>> _data;
+
+public:
+
+    Array(int N_in)
+        : N(N_in), _data(N_in * N_in, 0.0) {}
+
+    inline std::complex<double>& operator() (int row, int col) {
+        return _data[row * N + col];
+    }
+};
+
+py::array_t<int> mandelbrot(int N,
+                            double xmin, double xmax,
+                            double ymin, double ymax, int max_iter) {
+
+    // construct the numpy array we will return
+    // we need to specify the strides manually
+
+    constexpr std::size_t elsize = sizeof(int);
+    std::size_t shape[2]{N, N};
+    std::size_t strides[2]{N * elsize, elsize};
+    auto m = py::array_t<int>(shape, strides);
+    auto m_view = m.mutable_unchecked<2>();
+
+    // we'll use a simple contiguous array here.  When
+    // C++23 mdspan is available, that will be preferred.
+
+    std::vector<double> x(N, 0.0);
+    std::vector<double> y(N, 0.0);
+
+    double dx = (xmax - xmin) / static_cast<double>(N - 1);
+    double dy = (ymax - ymin) / static_cast<double>(N - 1);
+
+    for (int i = 0; i < N; ++i) {
+        x[i] = xmin + static_cast<double>(i) * dx;
+        y[i] = ymin + static_cast<double>(i) * dy;
+    }
+
+    Array c(N);
+    Array z(N);
+
+    // initialize c;
+
+    for (int i = 0; i < N; ++i) {
+        for (int j = 0; j < N; ++j) {
+            c(i, j) = x[i] + 1i * y[j];
+        }
+    }
+
+    // zero out the output array
+
+    for (int i = 0; i < m.shape(0); ++i) {
+        for (int j = 0; j < m.shape(1); ++j) {
+            m_view(i, j) = 0;
+        }
+    }
+
+    for (int niter = 1; niter <= max_iter; ++niter) {
+
+        for (int i = 0; i < m.shape(0); ++i) {
+            for (int j = 0; j < m.shape(1); ++j) {
+
+                if (m_view(i, j) == 0) {
+                    z(i, j) = z(i, j) * z(i, j) + c(i, j);
+
+                    if (std::abs(z(i, j)) > 2) {
+                        m_view(i, j) = niter;
+                    }
+                }
+            }
+        }
+    }
+
+    return m;
+}
+
+
+PYBIND11_MODULE(mandel, m) {
+    m.doc() = "C++ Mandelbrot example";
+    m.def("mandelbrot", &mandelbrot, "generate the Mandelbrot set of size N");
+}
+
+
+

It uses the same driver.

+
+
+

Timings#

+

On my machine, (python 3.13, numpy 2.2.5, Cython 3.0.12, GCC 15, numba +0.61.2, pybind11 2.13.6) here are some timings (average of 3 runs):

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + +

technique

timings (s)

python / numpy

0.218

python w/ explicit loops

17.4

Numba(*)

0.0922

Cython

0.0866

Fortran + f2py

0.0860

C++ + pybind11 (vector of vector)

0.120

C++ + pybind11 (contiguous Array)

0.108

+
+

(*) timing for the second invocation, which excludes JIT overhead.

+

We see that Numba, Cython, and Fortran are all quite close in +performance, with C++ contiguous only slightly slower, and all of +these much faster than the other implementations. It may be possible +to further optimize the numpy version, but it is so much easier to +just use Numba in this situation.

+
+
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/12-extensions/extensions-overview.html b/12-extensions/extensions-overview.html new file mode 100644 index 00000000..8f1c04cd --- /dev/null +++ b/12-extensions/extensions-overview.html @@ -0,0 +1,703 @@ + + + + + + + + + + + Extensions — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Extensions

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Extensions#

+

Python code can be slow, so we sometimes turn to extension modules to +get performance in critical parts of our algorithms There are a number +of ways to write extension modules in python – these can be in +another language like C or Fortran or use a library that converts +python into compiled code (with some restrictions) like Cython or +Numba.

+

We’ll look at some examples of these and talk about their strengths +and weaknesses.

+
+

Methods#

+
    +
  • C++

    +
      +
    • pybind11 : this is a +header-only library that allows you to call C++ functions directly +from python.

      +

      A related library is nanobind, +which has similar syntax but may be more efficient.

      +
    • +
    +
  • +
  • C

    +
      +
    • C-API : the +standard python interpreter (cpython) is written in C, so it is +natural that we can write C code to interact with our python code. +This is the python C-API. Since NumPy is also written in C, we +can work with NumPy arrays in C code as well.

      +

      This will give us the performance of C compiled code, but the +downside is that we lose a lot of what makes python great. We +need to pass data into C as pointers and cast them into types that +represent the arrays we use. This means writing a lot of +boilerplate code just to deal with some simple operations.

      +

      This underlies many of the techniques that we’ll see here.

      +
      +

      Note

      +

      These days, there are better methods for most applications, +and you should probably not use the C-API directly.

      +
      +
    • +
    • ctypes : this +is a module that allows you to call functions in shared libraries. +This is part of standard python.

      +

      With ctypes, you don’t need to modify your C code – you just need to +define an interface to the C function in python. However, the calling +mechanism can be slow.

      +

      There is support for NumPy through numpy.ctypeslib.

      +
    • +
    +
  • +
  • Fortran

    +
      +
    • f2py : this is part of +NumPy. It allows for easy calling of Fortran from python.

      +

      You essentially just need to add some comments to your Fortran +code to allow f2py to build an interface. f2py understands the +different orderings of indices between C and Fortran arrays.

      +
    • +
    +
  • +
  • python

    +
      +
    • Cython : this is a superset of python that can convert python into +compiled C code.

      +

      The advantage here is that the code looks like python, with some +declarations of the variable types with cdef. Performance can be +really great when you need to explicitly write out loops over +NumPy array indices.

      +
    • +
    • Numba : this is a just-in-time +compiler. It just requires a simple decorator and then it will +compile a python function the first time it is encountered.

    • +
    +
  • +
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/CHANGES b/CHANGES deleted file mode 100644 index 0c9edf6f..00000000 --- a/CHANGES +++ /dev/null @@ -1,158 +0,0 @@ --- python tutor: http://www.pythontutor.com/ - --- show pybind11 - https://pybind11.readthedocs.io/en/stable/basics.html#compiling-the-test-cases - --- use RISE: - https://damianavila.github.io/RISE/customize.html - --- merge in the REU python stuff - --- matplotlib example: mandelbrot - --- matplotlib state vs OO interfaces - - http://pbpython.com/effective-matplotlib.html - --- git diff of jupyter notebooks: - - https://nbdime.readthedocs.io/en/latest/ - - --- interactive notebook online: - - http://mybinder.org/ - http://ivory.idyll.org/blog/2016-mybinder.html - --- pandas: - - https://github.com/jakevdp/PythonDataScienceHandbook - - Star Wars API examples :) - http://nbviewer.jupyter.org/github/rasbt/pattern_classification/blob/master/data_viz/swapi_viz.ipynb - --- snakify: - - https://snakify.org/ - - --- visualize python code execution line-by-line: - - https://github.com/lgpage/nbtutor - --- python 3 for scientists: - - http://python-3-for-scientists.readthedocs.io/en/latest/ - - --- restructure it all: - - after basic introduction class, have students run through ipython - notebooks before class, and then in class, have a workbook that we - will fill in together, interactively - - - - --- Machine learning: http://www.toptal.com/machine-learning/machine-learning-theory-an-introductory-primer - - --- post an "assignment" of tasks after each class to the discussion forum. - --- try git: - - https://try.github.io/levels/1/challenges/1 - --- python in HPC: - - https://github.com/pyhpc/pyhpc-tutorial - --- new-style classes: - - http://python-history.blogspot.com/2010/06/new-style-classes.html - - --- decorators: http://thecodeship.com/patterns/guide-to-python-function-decorators/ - --- use project Euler for in-class code projects - --- piazza or freeforums.org -- open discussion forum - --- tedEd -- exercises embedded in lectures - --- jiffylab -- set up a teaching environemtn - or ipython chrome app (colaboration ?) - --- do the codeacademy python track outside of class? - --- Stanford NIFTY: computer science projects for students - --- ipython widgets - --- wakari: host a notebook - --- plot.ly - --- coLaboratory Notebooks - - -- available in the Chrome store - --- pythran? - --- nbdiff - --- mpld3 -- interactive matplotlib in ipython notebook - --- "seven ways to think like the web" - --- have a lecture at the start on "mananging projects with git, github, pull - requests - - --- debugger: from Nathan on yt: - - "The easiest way to debug issues like this is to use a python - debugger. I prefer ipdb, which has nice integration with IPython, - including tab completions. Others like pudb. There's also pdb, - which is part of the python standard library. All of these - debuggers have a gdb-like command-line interface, allowing printing - out backtraces, inspecting variables, and stepping through - code. Both ipdb and pudb can be installed via pip." - - - - - -references: - - -- "Computational Thinking" J M Wing (Communications in the ACM) - - -- Computing 4 Physics: https://github.com/Computing4Physics/C4P - - - -grading: - - -- grading is based on discussion. Here's a loose metric: - - by posting, I don't mean a "me to" type post, but something - either demonstrating a problem you don't understand (giving code), - asking for some detail from the lecture to be explained, - sharing a neat trick you found - - A: 12 postings to the discussion board (essentially once a week) - - + - - a small example showing how you can apply what we've discussed - in class to your field. - - - A-: 8 postings to the discussion board - - B+: 5 postings to the discussion board - - B: 2 postings to the discussion board - - --- hadoop streaming API: http://www.michael-noll.com/tutorials/writing-an-hadoop-mapreduce-program-in-python/ diff --git a/Introduction.html b/Introduction.html new file mode 100644 index 00000000..d5ddc78a --- /dev/null +++ b/Introduction.html @@ -0,0 +1,687 @@ + + + + + + + + + + + PHY 546: Python for Scientific Computing — PHY 546: Python for Scientific Computing + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + +
+ +
+ + + + + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

PHY 546: Python for Scientific Computing

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

PHY 546: Python for Scientific Computing#

+

xkcd python cartoon

+

(from https://xkcd.com)

+
+

Why python?#

+
    +
  • Python is a very high-level language

    +
      +
    • it provides many complex data-structures (lists, dictionaries, …)

    • +
    • your code is shorter than a comparable algorithm in a compiled language

    • +
    +
  • +
  • Many powerful libraries to perform complex tasks

    +
      +
    • Parse structured inputs files

    • +
    • send e-mail

    • +
    • interact with the operating system

    • +
    • make plots

    • +
    • make GUIs

    • +
    • do scientific computations

    • +
    • +
    +
  • +
  • Python makes it easy to prototype new tools

  • +
  • Python is cross-platform and Free

  • +
+
+
+

Language Features#

+

Some of the language features are:

+
    +
  • Dynamical typing

  • +
  • Object-oriented foundation

  • +
  • Extensible (easy to call Fortran, C/C++, …)

  • +
  • Automatic memory management (garbage collection)

  • +
  • Ease of readability (whitespace matters)

  • +
+
+
+

Scientific python#

+

Perhaps most importantly, and why we are here:

+
+

Python has been widely adopted in the scientific community.

+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/README.md b/README.md deleted file mode 100644 index 143ae6cb..00000000 --- a/README.md +++ /dev/null @@ -1,12 +0,0 @@ -# Python in Scientific Computing -*lecture notes and IPython notebooks* - -These are the lecture notes and IPython notebooks used to teach the -*Python for Scientific Computing* class at Stony Brook University. - -Feel free to fork this repository and make any changes you wish. -Contributions are welcomed. - - - - diff --git a/_images/05b93724c7fe07ec65ef5c1c21c6785ef2c54d0a8ded3cc3d404a1d49e57ead3.png b/_images/05b93724c7fe07ec65ef5c1c21c6785ef2c54d0a8ded3cc3d404a1d49e57ead3.png new file mode 100644 index 00000000..5dbe2679 Binary files /dev/null and b/_images/05b93724c7fe07ec65ef5c1c21c6785ef2c54d0a8ded3cc3d404a1d49e57ead3.png differ diff --git a/_images/12158ea15c928d43a30e2afd5fbc1c6444e47d37058e3182be60f71a63af8fa5.png b/_images/12158ea15c928d43a30e2afd5fbc1c6444e47d37058e3182be60f71a63af8fa5.png new file mode 100644 index 00000000..d90ebeb5 Binary files /dev/null and b/_images/12158ea15c928d43a30e2afd5fbc1c6444e47d37058e3182be60f71a63af8fa5.png differ diff --git a/_images/14611db2c48172b619658b4c708e37334a568f90b7b23798503295f6e80077db.png b/_images/14611db2c48172b619658b4c708e37334a568f90b7b23798503295f6e80077db.png new file mode 100644 index 00000000..603d98ba Binary files /dev/null and b/_images/14611db2c48172b619658b4c708e37334a568f90b7b23798503295f6e80077db.png differ diff --git a/_images/14a55c4b37454039b454f3503c5f615e6dccb3f245e259af494d20119331fbe7.png b/_images/14a55c4b37454039b454f3503c5f615e6dccb3f245e259af494d20119331fbe7.png new file mode 100644 index 00000000..d944e1cd Binary files /dev/null and b/_images/14a55c4b37454039b454f3503c5f615e6dccb3f245e259af494d20119331fbe7.png differ diff --git a/_images/18bb87f4a28b0bb4588355d6203a23546722fd40585a27f99318e66e528bee84.png b/_images/18bb87f4a28b0bb4588355d6203a23546722fd40585a27f99318e66e528bee84.png new file mode 100644 index 00000000..5b13eb74 Binary files /dev/null and b/_images/18bb87f4a28b0bb4588355d6203a23546722fd40585a27f99318e66e528bee84.png differ diff --git a/_images/1a8b730832e97d8d0b31d24d2b778ff95ba6f3c3ccf0baa447e6022883f4a0e7.png b/_images/1a8b730832e97d8d0b31d24d2b778ff95ba6f3c3ccf0baa447e6022883f4a0e7.png new file mode 100644 index 00000000..6ca5bac7 Binary files /dev/null and b/_images/1a8b730832e97d8d0b31d24d2b778ff95ba6f3c3ccf0baa447e6022883f4a0e7.png differ diff --git a/_images/248d017378fc7c24dd754d652d9a91c009464062c1c98c72944cc2ad5b5dd486.png b/_images/248d017378fc7c24dd754d652d9a91c009464062c1c98c72944cc2ad5b5dd486.png new file mode 100644 index 00000000..d17bf6d2 Binary files /dev/null and b/_images/248d017378fc7c24dd754d652d9a91c009464062c1c98c72944cc2ad5b5dd486.png differ diff --git a/_images/29b1ce756a8461259f118d9cc3963ee84959a0af7c2bf3aed56d12b9d0dc4fa4.png b/_images/29b1ce756a8461259f118d9cc3963ee84959a0af7c2bf3aed56d12b9d0dc4fa4.png new file mode 100644 index 00000000..ced439b3 Binary files /dev/null and b/_images/29b1ce756a8461259f118d9cc3963ee84959a0af7c2bf3aed56d12b9d0dc4fa4.png differ diff --git a/_images/305ad536173a0f5f3b3b06bbf6bc11bdd8de0d3f90936a177d5398fc960a9523.png b/_images/305ad536173a0f5f3b3b06bbf6bc11bdd8de0d3f90936a177d5398fc960a9523.png new file mode 100644 index 00000000..fb233a69 Binary files /dev/null and b/_images/305ad536173a0f5f3b3b06bbf6bc11bdd8de0d3f90936a177d5398fc960a9523.png differ diff --git a/_images/322cfb210143811bf47e093b805dca424d6cd58597dbc66c9bf60ac3d2bffaa8.png b/_images/322cfb210143811bf47e093b805dca424d6cd58597dbc66c9bf60ac3d2bffaa8.png new file mode 100644 index 00000000..6fee8c3e Binary files /dev/null and b/_images/322cfb210143811bf47e093b805dca424d6cd58597dbc66c9bf60ac3d2bffaa8.png differ diff --git a/_images/33080619ca831dc4a962e00d235d22b7840db996fcbf78452a7c4a9c7b934226.png b/_images/33080619ca831dc4a962e00d235d22b7840db996fcbf78452a7c4a9c7b934226.png new file mode 100644 index 00000000..2b6425a7 Binary files /dev/null and b/_images/33080619ca831dc4a962e00d235d22b7840db996fcbf78452a7c4a9c7b934226.png differ diff --git a/_images/347a411bd510f339f1112f612899e17cdfa2108351c56d6d11a840fd782f14a3.png b/_images/347a411bd510f339f1112f612899e17cdfa2108351c56d6d11a840fd782f14a3.png new file mode 100644 index 00000000..40b4e9b2 Binary files /dev/null and b/_images/347a411bd510f339f1112f612899e17cdfa2108351c56d6d11a840fd782f14a3.png differ diff --git a/_images/34e1da86c9edd98931cacd10bfecba95f96f423142d61cbe2e13833a93adf48f.png b/_images/34e1da86c9edd98931cacd10bfecba95f96f423142d61cbe2e13833a93adf48f.png new file mode 100644 index 00000000..e6f8a311 Binary files /dev/null and b/_images/34e1da86c9edd98931cacd10bfecba95f96f423142d61cbe2e13833a93adf48f.png differ diff --git a/_images/3ac4d61e01e4ad2f40fe01f62e57bd76a174429d7c754b847618ee8a04974bc3.png b/_images/3ac4d61e01e4ad2f40fe01f62e57bd76a174429d7c754b847618ee8a04974bc3.png new file mode 100644 index 00000000..0bdd2e46 Binary files /dev/null and b/_images/3ac4d61e01e4ad2f40fe01f62e57bd76a174429d7c754b847618ee8a04974bc3.png differ diff --git a/_images/3bbab2cf334619d5446d14b9b094fffa02575a671e25e11f45e798017d459c92.png b/_images/3bbab2cf334619d5446d14b9b094fffa02575a671e25e11f45e798017d459c92.png new file mode 100644 index 00000000..c4cfc5bd Binary files /dev/null and b/_images/3bbab2cf334619d5446d14b9b094fffa02575a671e25e11f45e798017d459c92.png differ diff --git a/_images/3e380a95587953689da981c6f23b481ca85e0e4f9c8066fc27542a791367e07e.png b/_images/3e380a95587953689da981c6f23b481ca85e0e4f9c8066fc27542a791367e07e.png new file mode 100644 index 00000000..284331d9 Binary files /dev/null and b/_images/3e380a95587953689da981c6f23b481ca85e0e4f9c8066fc27542a791367e07e.png differ diff --git a/_images/3ec9e8820552c29bedb8733a09eef410e319daa5f2f917b9366051c4e9f6b13d.png b/_images/3ec9e8820552c29bedb8733a09eef410e319daa5f2f917b9366051c4e9f6b13d.png new file mode 100644 index 00000000..129395d2 Binary files /dev/null and b/_images/3ec9e8820552c29bedb8733a09eef410e319daa5f2f917b9366051c4e9f6b13d.png differ diff --git a/_images/433ba52e047896b8c7177f2df8930782d9cafe653b4234466b00034c22f8f4c7.png b/_images/433ba52e047896b8c7177f2df8930782d9cafe653b4234466b00034c22f8f4c7.png new file mode 100644 index 00000000..32e338fb Binary files /dev/null and b/_images/433ba52e047896b8c7177f2df8930782d9cafe653b4234466b00034c22f8f4c7.png differ diff --git a/_images/4567d8f9bd61f12d86168899465c03b2a4ce67b2904092490c6a2b9dc7107b30.png b/_images/4567d8f9bd61f12d86168899465c03b2a4ce67b2904092490c6a2b9dc7107b30.png new file mode 100644 index 00000000..fd38fe54 Binary files /dev/null and b/_images/4567d8f9bd61f12d86168899465c03b2a4ce67b2904092490c6a2b9dc7107b30.png differ diff --git a/_images/493bfaaba447acc8b31ece91f13bcf936db00f5924f8ae6fb3c6aae858f6a917.png b/_images/493bfaaba447acc8b31ece91f13bcf936db00f5924f8ae6fb3c6aae858f6a917.png new file mode 100644 index 00000000..0e9d960e Binary files /dev/null and b/_images/493bfaaba447acc8b31ece91f13bcf936db00f5924f8ae6fb3c6aae858f6a917.png differ diff --git a/_images/5617d55160afd4564a01ed069520d3f30915b23d9d997f8675ac844c00e19c29.png b/_images/5617d55160afd4564a01ed069520d3f30915b23d9d997f8675ac844c00e19c29.png new file mode 100644 index 00000000..c6ee8035 Binary files /dev/null and b/_images/5617d55160afd4564a01ed069520d3f30915b23d9d997f8675ac844c00e19c29.png differ diff --git a/_images/567340fd5c0f4220f685c50adc59432167e90edc971cdc98c37610d9cc7e7f4c.png b/_images/567340fd5c0f4220f685c50adc59432167e90edc971cdc98c37610d9cc7e7f4c.png new file mode 100644 index 00000000..839762fd Binary files /dev/null and b/_images/567340fd5c0f4220f685c50adc59432167e90edc971cdc98c37610d9cc7e7f4c.png differ diff --git a/_images/5707a02e8cca32ab41ddc3e507473f33e404efe75b61045d1b311ea520450202.png b/_images/5707a02e8cca32ab41ddc3e507473f33e404efe75b61045d1b311ea520450202.png new file mode 100644 index 00000000..9e91de73 Binary files /dev/null and b/_images/5707a02e8cca32ab41ddc3e507473f33e404efe75b61045d1b311ea520450202.png differ diff --git a/_images/58d940405d5b2d97a8ac4387c0747f19aceabb1b381df374961dae4b6e883716.png b/_images/58d940405d5b2d97a8ac4387c0747f19aceabb1b381df374961dae4b6e883716.png new file mode 100644 index 00000000..f71a8bb5 Binary files /dev/null and b/_images/58d940405d5b2d97a8ac4387c0747f19aceabb1b381df374961dae4b6e883716.png differ diff --git a/_images/636857cadff1acef2aa145c156a25e58a6d145860be88a309a2b0803c0ace6fa.png b/_images/636857cadff1acef2aa145c156a25e58a6d145860be88a309a2b0803c0ace6fa.png new file mode 100644 index 00000000..18bca1d6 Binary files /dev/null and b/_images/636857cadff1acef2aa145c156a25e58a6d145860be88a309a2b0803c0ace6fa.png differ diff --git a/_images/6bc78f3fe2a9e65e3d606852a276b997d3deff24f08686a8548303dc6c3d334c.png b/_images/6bc78f3fe2a9e65e3d606852a276b997d3deff24f08686a8548303dc6c3d334c.png new file mode 100644 index 00000000..29d40948 Binary files /dev/null and b/_images/6bc78f3fe2a9e65e3d606852a276b997d3deff24f08686a8548303dc6c3d334c.png differ diff --git a/_images/7ced87012e88958170d22c7d32d41f0aef30708641631267b24dbafcc0cea420.png b/_images/7ced87012e88958170d22c7d32d41f0aef30708641631267b24dbafcc0cea420.png new file mode 100644 index 00000000..1c346f21 Binary files /dev/null and b/_images/7ced87012e88958170d22c7d32d41f0aef30708641631267b24dbafcc0cea420.png differ diff --git a/_images/7d75ee826cda9aea1c634d659e512abdd2e69cf123085dfb9f88fb2c0cb225a3.png b/_images/7d75ee826cda9aea1c634d659e512abdd2e69cf123085dfb9f88fb2c0cb225a3.png new file mode 100644 index 00000000..7d2f36da Binary files /dev/null and b/_images/7d75ee826cda9aea1c634d659e512abdd2e69cf123085dfb9f88fb2c0cb225a3.png differ diff --git a/_images/830fb17c4921139b0db9b82b1fff526ef6074e98449be40a24780a60c5f1957d.png b/_images/830fb17c4921139b0db9b82b1fff526ef6074e98449be40a24780a60c5f1957d.png new file mode 100644 index 00000000..998687c6 Binary files /dev/null and b/_images/830fb17c4921139b0db9b82b1fff526ef6074e98449be40a24780a60c5f1957d.png differ diff --git a/_images/8f22444e032fd5b8480eb4e0752cbffe2ed935ab38ea9d30bcfe690d80c847f3.png b/_images/8f22444e032fd5b8480eb4e0752cbffe2ed935ab38ea9d30bcfe690d80c847f3.png new file mode 100644 index 00000000..378dd7d9 Binary files /dev/null and b/_images/8f22444e032fd5b8480eb4e0752cbffe2ed935ab38ea9d30bcfe690d80c847f3.png differ diff --git a/_images/9117b21318fe3c3165d87c5d4c46d5a1b3c429cc8cf31bebed9c203fda6b40d9.png b/_images/9117b21318fe3c3165d87c5d4c46d5a1b3c429cc8cf31bebed9c203fda6b40d9.png new file mode 100644 index 00000000..3569771e Binary files /dev/null and b/_images/9117b21318fe3c3165d87c5d4c46d5a1b3c429cc8cf31bebed9c203fda6b40d9.png differ diff --git a/_images/9231241e6bd766784356e576c64f4a902c6f34847590b61274f8a9b8380916b1.png b/_images/9231241e6bd766784356e576c64f4a902c6f34847590b61274f8a9b8380916b1.png new file mode 100644 index 00000000..4013ca7c Binary files /dev/null and b/_images/9231241e6bd766784356e576c64f4a902c6f34847590b61274f8a9b8380916b1.png differ diff --git a/_images/9464b0c0bcee714b070f959c01ff09c68008dbf76d6bcb101f395150b9d6b153.png b/_images/9464b0c0bcee714b070f959c01ff09c68008dbf76d6bcb101f395150b9d6b153.png new file mode 100644 index 00000000..b1e150fd Binary files /dev/null and b/_images/9464b0c0bcee714b070f959c01ff09c68008dbf76d6bcb101f395150b9d6b153.png differ diff --git a/_images/95b9f0fd23894c2cbbb25bb94ff4162bea2142c17024708eb2e068cc777e852f.png b/_images/95b9f0fd23894c2cbbb25bb94ff4162bea2142c17024708eb2e068cc777e852f.png new file mode 100644 index 00000000..ad9cbda9 Binary files /dev/null and b/_images/95b9f0fd23894c2cbbb25bb94ff4162bea2142c17024708eb2e068cc777e852f.png differ diff --git a/_images/98a22dc806bbeee37742184bb9a747cd2a055fa0b69409bda8bc9e42c6e3327a.png b/_images/98a22dc806bbeee37742184bb9a747cd2a055fa0b69409bda8bc9e42c6e3327a.png new file mode 100644 index 00000000..c24267f1 Binary files /dev/null and b/_images/98a22dc806bbeee37742184bb9a747cd2a055fa0b69409bda8bc9e42c6e3327a.png differ diff --git a/_images/99a67cee0e0bf420274cba3ccae7c4f8007a099125cb6550003621a45abc4c75.png b/_images/99a67cee0e0bf420274cba3ccae7c4f8007a099125cb6550003621a45abc4c75.png new file mode 100644 index 00000000..739bdba7 Binary files /dev/null and b/_images/99a67cee0e0bf420274cba3ccae7c4f8007a099125cb6550003621a45abc4c75.png differ diff --git a/_images/99aa1a1124655bc04ed0c253cede4ee4f50d860b4a8e1e8796107a753cbcfabf.png b/_images/99aa1a1124655bc04ed0c253cede4ee4f50d860b4a8e1e8796107a753cbcfabf.png new file mode 100644 index 00000000..7b1c5b9b Binary files /dev/null and b/_images/99aa1a1124655bc04ed0c253cede4ee4f50d860b4a8e1e8796107a753cbcfabf.png differ diff --git a/_images/9ad115d2a594e0d189e996c0204cda78b2df12f8e9d61a968cab4d3ecaecd970.png b/_images/9ad115d2a594e0d189e996c0204cda78b2df12f8e9d61a968cab4d3ecaecd970.png new file mode 100644 index 00000000..b864f65b Binary files /dev/null and b/_images/9ad115d2a594e0d189e996c0204cda78b2df12f8e9d61a968cab4d3ecaecd970.png differ diff --git a/_images/a087c096f127028aed4565dfdf3b10e2cdbd8048d1b2e886a77d05438f3f1ccb.png b/_images/a087c096f127028aed4565dfdf3b10e2cdbd8048d1b2e886a77d05438f3f1ccb.png new file mode 100644 index 00000000..638f1622 Binary files /dev/null and b/_images/a087c096f127028aed4565dfdf3b10e2cdbd8048d1b2e886a77d05438f3f1ccb.png differ diff --git a/_images/ac8d3ce8eecdd5cb24b438db7ea2a2d517d57d84887392d87efab1d8f9d5fd94.png b/_images/ac8d3ce8eecdd5cb24b438db7ea2a2d517d57d84887392d87efab1d8f9d5fd94.png new file mode 100644 index 00000000..baec6289 Binary files /dev/null and b/_images/ac8d3ce8eecdd5cb24b438db7ea2a2d517d57d84887392d87efab1d8f9d5fd94.png differ diff --git a/_images/ae7d94ffa26d5baa2e15a13dae0847ac6a63895412a6d03f86c08f8e3f328f37.png b/_images/ae7d94ffa26d5baa2e15a13dae0847ac6a63895412a6d03f86c08f8e3f328f37.png new file mode 100644 index 00000000..28d02ad6 Binary files /dev/null and b/_images/ae7d94ffa26d5baa2e15a13dae0847ac6a63895412a6d03f86c08f8e3f328f37.png differ diff --git a/content/04-matplotlib/anatomy1.png b/_images/anatomy1.png similarity index 100% rename from content/04-matplotlib/anatomy1.png rename to _images/anatomy1.png diff --git a/_images/b59abeb56bbd6be6c26cb8b33dbf9c2044a5bf2811adf7cb6f93af01d1c1da38.png b/_images/b59abeb56bbd6be6c26cb8b33dbf9c2044a5bf2811adf7cb6f93af01d1c1da38.png new file mode 100644 index 00000000..b693c6ec Binary files /dev/null and b/_images/b59abeb56bbd6be6c26cb8b33dbf9c2044a5bf2811adf7cb6f93af01d1c1da38.png differ diff --git a/_images/b897fc22d6a1d0326dabca816283e8742aee42c4fa9ceaefb55d6e13c81f6c45.png b/_images/b897fc22d6a1d0326dabca816283e8742aee42c4fa9ceaefb55d6e13c81f6c45.png new file mode 100644 index 00000000..08fb6cb2 Binary files /dev/null and b/_images/b897fc22d6a1d0326dabca816283e8742aee42c4fa9ceaefb55d6e13c81f6c45.png differ diff --git a/_images/bd2dc15da4e6fe950717320e2e27df939f63a85b567a3bd2dbf8a35f386abd83.png b/_images/bd2dc15da4e6fe950717320e2e27df939f63a85b567a3bd2dbf8a35f386abd83.png new file mode 100644 index 00000000..69c3ce99 Binary files /dev/null and b/_images/bd2dc15da4e6fe950717320e2e27df939f63a85b567a3bd2dbf8a35f386abd83.png differ diff --git a/_images/c5438daabd7e7caf26009be4c16d43bb4bc5a754ef48f6b7a6a16440848bdb20.png b/_images/c5438daabd7e7caf26009be4c16d43bb4bc5a754ef48f6b7a6a16440848bdb20.png new file mode 100644 index 00000000..443ebbd6 Binary files /dev/null and b/_images/c5438daabd7e7caf26009be4c16d43bb4bc5a754ef48f6b7a6a16440848bdb20.png differ diff --git a/_images/c62cb3987d333d4e135d6e54b6380771dd67af5d0377162c755c8a723636c989.png b/_images/c62cb3987d333d4e135d6e54b6380771dd67af5d0377162c755c8a723636c989.png new file mode 100644 index 00000000..1efa7441 Binary files /dev/null and b/_images/c62cb3987d333d4e135d6e54b6380771dd67af5d0377162c755c8a723636c989.png differ diff --git a/_images/c8c2834b4172a70240f93d1cb14ae0d552f4a26654861da536d16eea043dd641.png b/_images/c8c2834b4172a70240f93d1cb14ae0d552f4a26654861da536d16eea043dd641.png new file mode 100644 index 00000000..60168a80 Binary files /dev/null and b/_images/c8c2834b4172a70240f93d1cb14ae0d552f4a26654861da536d16eea043dd641.png differ diff --git a/_images/cff06e6db54c63aafc594447299f1f54fa904a8c1ffdcd6337a6f738f0d98336.png b/_images/cff06e6db54c63aafc594447299f1f54fa904a8c1ffdcd6337a6f738f0d98336.png new file mode 100644 index 00000000..36dd36e2 Binary files /dev/null and b/_images/cff06e6db54c63aafc594447299f1f54fa904a8c1ffdcd6337a6f738f0d98336.png differ diff --git a/_images/da56e7aa5a4fec26cc6454ce53c70390b3cfe2458b4c55e3a75f4a8462d6dd90.png b/_images/da56e7aa5a4fec26cc6454ce53c70390b3cfe2458b4c55e3a75f4a8462d6dd90.png new file mode 100644 index 00000000..52144dfe Binary files /dev/null and b/_images/da56e7aa5a4fec26cc6454ce53c70390b3cfe2458b4c55e3a75f4a8462d6dd90.png differ diff --git a/_images/dddbe10d121cc0b0be544e8b7ba4bf180995b70c69b599294cde933d0725396f.png b/_images/dddbe10d121cc0b0be544e8b7ba4bf180995b70c69b599294cde933d0725396f.png new file mode 100644 index 00000000..9068f5cd Binary files /dev/null and b/_images/dddbe10d121cc0b0be544e8b7ba4bf180995b70c69b599294cde933d0725396f.png differ diff --git a/content/git/distributed_version_control.png b/_images/distributed_version_control.png similarity index 100% rename from content/git/distributed_version_control.png rename to _images/distributed_version_control.png diff --git a/_images/e89ded31bb0805eaed85d00c64bd2ea93dcb6c61745dc293d035532da31af2ac.png b/_images/e89ded31bb0805eaed85d00c64bd2ea93dcb6c61745dc293d035532da31af2ac.png new file mode 100644 index 00000000..5d515ab2 Binary files /dev/null and b/_images/e89ded31bb0805eaed85d00c64bd2ea93dcb6c61745dc293d035532da31af2ac.png differ diff --git a/_images/e8fcb33912198404e43a9829e9f7bd807269f3a99cda7610f7fac6df54f49af5.png b/_images/e8fcb33912198404e43a9829e9f7bd807269f3a99cda7610f7fac6df54f49af5.png new file mode 100644 index 00000000..e6d7124b Binary files /dev/null and b/_images/e8fcb33912198404e43a9829e9f7bd807269f3a99cda7610f7fac6df54f49af5.png differ diff --git a/_images/ea36916fe87eb56d146e30bc3732345060fe752538e655250838ad92c5d3b836.png b/_images/ea36916fe87eb56d146e30bc3732345060fe752538e655250838ad92c5d3b836.png new file mode 100644 index 00000000..4b2ff209 Binary files /dev/null and b/_images/ea36916fe87eb56d146e30bc3732345060fe752538e655250838ad92c5d3b836.png differ diff --git a/_images/ec894b10ee74fd1a6ff2549194ffd8b3c35714accac628c04e867676d5b804c7.png b/_images/ec894b10ee74fd1a6ff2549194ffd8b3c35714accac628c04e867676d5b804c7.png new file mode 100644 index 00000000..d01fb303 Binary files /dev/null and b/_images/ec894b10ee74fd1a6ff2549194ffd8b3c35714accac628c04e867676d5b804c7.png differ diff --git a/_images/fb0a6c80516310178afbce3044be9cff9c3d04e75390440cb7f125480aa50ee5.png b/_images/fb0a6c80516310178afbce3044be9cff9c3d04e75390440cb7f125480aa50ee5.png new file mode 100644 index 00000000..bcc08d55 Binary files /dev/null and b/_images/fb0a6c80516310178afbce3044be9cff9c3d04e75390440cb7f125480aa50ee5.png differ diff --git a/_images/ff442053d64f0baf70c89195cd68af1f60dd275bdb42787829fb1b8bce9c50ec.png b/_images/ff442053d64f0baf70c89195cd68af1f60dd275bdb42787829fb1b8bce9c50ec.png new file mode 100644 index 00000000..aef661ac Binary files /dev/null and b/_images/ff442053d64f0baf70c89195cd68af1f60dd275bdb42787829fb1b8bce9c50ec.png differ diff --git a/_images/ffee7b61de1ff038024f9ad240685159d4c292312da298aac782027770fecb9c.png b/_images/ffee7b61de1ff038024f9ad240685159d4c292312da298aac782027770fecb9c.png new file mode 100644 index 00000000..8cb40d58 Binary files /dev/null and b/_images/ffee7b61de1ff038024f9ad240685159d4c292312da298aac782027770fecb9c.png differ diff --git a/content/git/github-clone.png b/_images/github-clone.png similarity index 100% rename from content/git/github-clone.png rename to _images/github-clone.png diff --git a/content/git/github-copy-ssh.png b/_images/github-copy-ssh.png similarity index 100% rename from content/git/github-copy-ssh.png rename to _images/github-copy-ssh.png diff --git a/content/git/github-create.png b/_images/github-create.png similarity index 100% rename from content/git/github-create.png rename to _images/github-create.png diff --git a/content/git/github-fork.png b/_images/github-fork.png similarity index 100% rename from content/git/github-fork.png rename to _images/github-fork.png diff --git a/content/git/github-new.png b/_images/github-new.png similarity index 100% rename from content/git/github-new.png rename to _images/github-new.png diff --git a/content/git/github-pr.png b/_images/github-pr.png similarity index 100% rename from content/git/github-pr.png rename to _images/github-pr.png diff --git a/content/git/github-pr2.png b/_images/github-pr2.png similarity index 100% rename from content/git/github-pr2.png rename to _images/github-pr2.png diff --git a/content/git/github-workflow.png b/_images/github-workflow.png similarity index 100% rename from content/git/github-workflow.png rename to _images/github-workflow.png diff --git a/content/11-machine-learning/nn_fig.png b/_images/nn_fig.png similarity index 100% rename from content/11-machine-learning/nn_fig.png rename to _images/nn_fig.png diff --git a/content/11-machine-learning/nn_fig2.png b/_images/nn_fig2.png similarity index 100% rename from content/11-machine-learning/nn_fig2.png rename to _images/nn_fig2.png diff --git a/content/11-machine-learning/nn_fig_hidden.png b/_images/nn_fig_hidden.png similarity index 100% rename from content/11-machine-learning/nn_fig_hidden.png rename to _images/nn_fig_hidden.png diff --git a/content/05-scipy/orbit_setup.png b/_images/orbit_setup.png similarity index 100% rename from content/05-scipy/orbit_setup.png rename to _images/orbit_setup.png diff --git a/content/01-python/python.png b/_images/python.png similarity index 100% rename from content/01-python/python.png rename to _images/python.png diff --git a/content/09-packages/python_environment.png b/_images/python_environment.png similarity index 100% rename from content/09-packages/python_environment.png rename to _images/python_environment.png diff --git a/content/02-numpy/row_column_major.png b/_images/row_column_major.png similarity index 100% rename from content/02-numpy/row_column_major.png rename to _images/row_column_major.png diff --git a/content/11-machine-learning/sigmoid.png b/_images/sigmoid.png similarity index 100% rename from content/11-machine-learning/sigmoid.png rename to _images/sigmoid.png diff --git a/content/09-packages/test.png b/_images/test.png similarity index 100% rename from content/09-packages/test.png rename to _images/test.png diff --git a/content/12-extensions/test.png b/_images/test1.png similarity index 100% rename from content/12-extensions/test.png rename to _images/test1.png diff --git a/content/01-python/basics.md b/_sources/01-python/basics.md similarity index 100% rename from content/01-python/basics.md rename to _sources/01-python/basics.md diff --git a/content/01-python/functions-classes.md b/_sources/01-python/functions-classes.md similarity index 100% rename from content/01-python/functions-classes.md rename to _sources/01-python/functions-classes.md diff --git a/content/01-python/installing.md b/_sources/01-python/installing.md similarity index 100% rename from content/01-python/installing.md rename to _sources/01-python/installing.md diff --git a/content/01-python/misc.md b/_sources/01-python/misc.md similarity index 100% rename from content/01-python/misc.md rename to _sources/01-python/misc.md diff --git a/content/01-python/python-io.ipynb b/_sources/01-python/python-io.ipynb similarity index 100% rename from content/01-python/python-io.ipynb rename to _sources/01-python/python-io.ipynb diff --git a/content/01-python/python.md b/_sources/01-python/python.md similarity index 100% rename from content/01-python/python.md rename to _sources/01-python/python.md diff --git a/content/01-python/using.md b/_sources/01-python/using.md similarity index 100% rename from content/01-python/using.md rename to _sources/01-python/using.md diff --git a/content/01-python/w1-jupyter.ipynb b/_sources/01-python/w1-jupyter.ipynb similarity index 100% rename from content/01-python/w1-jupyter.ipynb rename to _sources/01-python/w1-jupyter.ipynb diff --git a/content/01-python/w1-python-datatypes.ipynb b/_sources/01-python/w1-python-datatypes.ipynb similarity index 100% rename from content/01-python/w1-python-datatypes.ipynb rename to _sources/01-python/w1-python-datatypes.ipynb diff --git a/content/01-python/w2-python-advanced-datatypes.ipynb b/_sources/01-python/w2-python-advanced-datatypes.ipynb similarity index 100% rename from content/01-python/w2-python-advanced-datatypes.ipynb rename to _sources/01-python/w2-python-advanced-datatypes.ipynb diff --git a/content/01-python/w2-python-control-flow.ipynb b/_sources/01-python/w2-python-control-flow.ipynb similarity index 100% rename from content/01-python/w2-python-control-flow.ipynb rename to _sources/01-python/w2-python-control-flow.ipynb diff --git a/content/01-python/w2-python-exercises.ipynb b/_sources/01-python/w2-python-exercises.ipynb similarity index 100% rename from content/01-python/w2-python-exercises.ipynb rename to _sources/01-python/w2-python-exercises.ipynb diff --git a/content/01-python/w3-python-exceptions.ipynb b/_sources/01-python/w3-python-exceptions.ipynb similarity index 100% rename from content/01-python/w3-python-exceptions.ipynb rename to _sources/01-python/w3-python-exceptions.ipynb diff --git a/content/01-python/w3-python-exercises.ipynb b/_sources/01-python/w3-python-exercises.ipynb similarity index 100% rename from content/01-python/w3-python-exercises.ipynb rename to _sources/01-python/w3-python-exercises.ipynb diff --git a/content/01-python/w3-python-functions.ipynb b/_sources/01-python/w3-python-functions.ipynb similarity index 100% rename from content/01-python/w3-python-functions.ipynb rename to _sources/01-python/w3-python-functions.ipynb diff --git a/content/01-python/w4-python-classes.ipynb b/_sources/01-python/w4-python-classes.ipynb similarity index 100% rename from content/01-python/w4-python-classes.ipynb rename to _sources/01-python/w4-python-classes.ipynb diff --git a/content/01-python/w4-python-exercises.ipynb b/_sources/01-python/w4-python-exercises.ipynb similarity index 100% rename from content/01-python/w4-python-exercises.ipynb rename to _sources/01-python/w4-python-exercises.ipynb diff --git a/content/01-python/w4-python-modules.ipynb b/_sources/01-python/w4-python-modules.ipynb similarity index 100% rename from content/01-python/w4-python-modules.ipynb rename to _sources/01-python/w4-python-modules.ipynb diff --git a/content/01-python/w5-python-more-examples.ipynb b/_sources/01-python/w5-python-more-examples.ipynb similarity index 100% rename from content/01-python/w5-python-more-examples.ipynb rename to _sources/01-python/w5-python-more-examples.ipynb diff --git a/content/02-numpy/numpy-advanced.ipynb b/_sources/02-numpy/numpy-advanced.ipynb similarity index 100% rename from content/02-numpy/numpy-advanced.ipynb rename to _sources/02-numpy/numpy-advanced.ipynb diff --git a/content/02-numpy/numpy-basics.ipynb b/_sources/02-numpy/numpy-basics.ipynb similarity index 100% rename from content/02-numpy/numpy-basics.ipynb rename to _sources/02-numpy/numpy-basics.ipynb diff --git a/content/02-numpy/numpy-exercises.ipynb b/_sources/02-numpy/numpy-exercises.ipynb similarity index 100% rename from content/02-numpy/numpy-exercises.ipynb rename to _sources/02-numpy/numpy-exercises.ipynb diff --git a/content/02-numpy/numpy.md b/_sources/02-numpy/numpy.md similarity index 100% rename from content/02-numpy/numpy.md rename to _sources/02-numpy/numpy.md diff --git a/content/03-practices/git-single.md b/_sources/03-practices/git-single.md similarity index 100% rename from content/03-practices/git-single.md rename to _sources/03-practices/git-single.md diff --git a/content/03-practices/python-style.ipynb b/_sources/03-practices/python-style.ipynb similarity index 100% rename from content/03-practices/python-style.ipynb rename to _sources/03-practices/python-style.ipynb diff --git a/content/04-matplotlib/ipyvolume-example.ipynb b/_sources/04-matplotlib/ipyvolume-example.ipynb similarity index 100% rename from content/04-matplotlib/ipyvolume-example.ipynb rename to _sources/04-matplotlib/ipyvolume-example.ipynb diff --git a/content/04-matplotlib/matplotlib-basics.ipynb b/_sources/04-matplotlib/matplotlib-basics.ipynb similarity index 100% rename from content/04-matplotlib/matplotlib-basics.ipynb rename to _sources/04-matplotlib/matplotlib-basics.ipynb diff --git a/content/04-matplotlib/matplotlib-exercises.ipynb b/_sources/04-matplotlib/matplotlib-exercises.ipynb similarity index 100% rename from content/04-matplotlib/matplotlib-exercises.ipynb rename to _sources/04-matplotlib/matplotlib-exercises.ipynb diff --git a/content/04-matplotlib/matplotlib.md b/_sources/04-matplotlib/matplotlib.md similarity index 100% rename from content/04-matplotlib/matplotlib.md rename to _sources/04-matplotlib/matplotlib.md diff --git a/content/05-scipy/scipy-basics-2.ipynb b/_sources/05-scipy/scipy-basics-2.ipynb similarity index 100% rename from content/05-scipy/scipy-basics-2.ipynb rename to _sources/05-scipy/scipy-basics-2.ipynb diff --git a/content/05-scipy/scipy-basics.ipynb b/_sources/05-scipy/scipy-basics.ipynb similarity index 100% rename from content/05-scipy/scipy-basics.ipynb rename to _sources/05-scipy/scipy-basics.ipynb diff --git a/content/05-scipy/scipy-exercises-2.ipynb b/_sources/05-scipy/scipy-exercises-2.ipynb similarity index 100% rename from content/05-scipy/scipy-exercises-2.ipynb rename to _sources/05-scipy/scipy-exercises-2.ipynb diff --git a/content/05-scipy/scipy-exercises.ipynb b/_sources/05-scipy/scipy-exercises.ipynb similarity index 100% rename from content/05-scipy/scipy-exercises.ipynb rename to _sources/05-scipy/scipy-exercises.ipynb diff --git a/content/05-scipy/scipy.md b/_sources/05-scipy/scipy.md similarity index 100% rename from content/05-scipy/scipy.md rename to _sources/05-scipy/scipy.md diff --git a/content/06-sympy/sympy-examples.ipynb b/_sources/06-sympy/sympy-examples.ipynb similarity index 100% rename from content/06-sympy/sympy-examples.ipynb rename to _sources/06-sympy/sympy-examples.ipynb diff --git a/content/06-sympy/sympy-exercises.ipynb b/_sources/06-sympy/sympy-exercises.ipynb similarity index 100% rename from content/06-sympy/sympy-exercises.ipynb rename to _sources/06-sympy/sympy-exercises.ipynb diff --git a/content/06-sympy/sympy.md b/_sources/06-sympy/sympy.md similarity index 100% rename from content/06-sympy/sympy.md rename to _sources/06-sympy/sympy.md diff --git a/content/09-packages/python-arguments.md b/_sources/09-packages/python-arguments.md similarity index 100% rename from content/09-packages/python-arguments.md rename to _sources/09-packages/python-arguments.md diff --git a/content/09-packages/python-modules.md b/_sources/09-packages/python-modules.md similarity index 100% rename from content/09-packages/python-modules.md rename to _sources/09-packages/python-modules.md diff --git a/content/09-packages/python-more-modules.md b/_sources/09-packages/python-more-modules.md similarity index 100% rename from content/09-packages/python-more-modules.md rename to _sources/09-packages/python-more-modules.md diff --git a/content/09-packages/python-packages.md b/_sources/09-packages/python-packages.md similarity index 100% rename from content/09-packages/python-packages.md rename to _sources/09-packages/python-packages.md diff --git a/content/09-packages/python-tools.md b/_sources/09-packages/python-tools.md similarity index 100% rename from content/09-packages/python-tools.md rename to _sources/09-packages/python-tools.md diff --git a/content/10-testing/more-pytest.md b/_sources/10-testing/more-pytest.md similarity index 100% rename from content/10-testing/more-pytest.md rename to _sources/10-testing/more-pytest.md diff --git a/content/10-testing/pytest.md b/_sources/10-testing/pytest.md similarity index 100% rename from content/10-testing/pytest.md rename to _sources/10-testing/pytest.md diff --git a/content/10-testing/real-world-example.md b/_sources/10-testing/real-world-example.md similarity index 100% rename from content/10-testing/real-world-example.md rename to _sources/10-testing/real-world-example.md diff --git a/content/10-testing/testing.md b/_sources/10-testing/testing.md similarity index 100% rename from content/10-testing/testing.md rename to _sources/10-testing/testing.md diff --git a/content/11-machine-learning/gradient-descent.ipynb b/_sources/11-machine-learning/gradient-descent.ipynb similarity index 100% rename from content/11-machine-learning/gradient-descent.ipynb rename to _sources/11-machine-learning/gradient-descent.ipynb diff --git a/content/11-machine-learning/keras-clustering.ipynb b/_sources/11-machine-learning/keras-clustering.ipynb similarity index 100% rename from content/11-machine-learning/keras-clustering.ipynb rename to _sources/11-machine-learning/keras-clustering.ipynb diff --git a/content/11-machine-learning/keras-mnist.ipynb b/_sources/11-machine-learning/keras-mnist.ipynb similarity index 100% rename from content/11-machine-learning/keras-mnist.ipynb rename to _sources/11-machine-learning/keras-mnist.ipynb diff --git a/content/11-machine-learning/machine-learning-basics.ipynb b/_sources/11-machine-learning/machine-learning-basics.ipynb similarity index 100% rename from content/11-machine-learning/machine-learning-basics.ipynb rename to _sources/11-machine-learning/machine-learning-basics.ipynb diff --git a/content/11-machine-learning/machine-learning-libraries.md b/_sources/11-machine-learning/machine-learning-libraries.md similarity index 100% rename from content/11-machine-learning/machine-learning-libraries.md rename to _sources/11-machine-learning/machine-learning-libraries.md diff --git a/content/11-machine-learning/machine-learning.md b/_sources/11-machine-learning/machine-learning.md similarity index 100% rename from content/11-machine-learning/machine-learning.md rename to _sources/11-machine-learning/machine-learning.md diff --git a/content/11-machine-learning/neural-net-basics.md b/_sources/11-machine-learning/neural-net-basics.md similarity index 100% rename from content/11-machine-learning/neural-net-basics.md rename to _sources/11-machine-learning/neural-net-basics.md diff --git a/content/11-machine-learning/neural-net-derivation.md b/_sources/11-machine-learning/neural-net-derivation.md similarity index 100% rename from content/11-machine-learning/neural-net-derivation.md rename to _sources/11-machine-learning/neural-net-derivation.md diff --git a/content/11-machine-learning/neural-net-hidden.md b/_sources/11-machine-learning/neural-net-hidden.md similarity index 100% rename from content/11-machine-learning/neural-net-hidden.md rename to _sources/11-machine-learning/neural-net-hidden.md diff --git a/content/11-machine-learning/neural-net-improvements.md b/_sources/11-machine-learning/neural-net-improvements.md similarity index 100% rename from content/11-machine-learning/neural-net-improvements.md rename to _sources/11-machine-learning/neural-net-improvements.md diff --git a/content/12-extensions/extensions-example.md b/_sources/12-extensions/extensions-example.md similarity index 100% rename from content/12-extensions/extensions-example.md rename to _sources/12-extensions/extensions-example.md diff --git a/content/12-extensions/extensions-overview.md b/_sources/12-extensions/extensions-overview.md similarity index 100% rename from content/12-extensions/extensions-overview.md rename to _sources/12-extensions/extensions-overview.md diff --git a/content/Introduction.md b/_sources/Introduction.md similarity index 100% rename from content/Introduction.md rename to _sources/Introduction.md diff --git a/content/git/git-branches.md b/_sources/git/git-branches.md similarity index 100% rename from content/git/git-branches.md rename to _sources/git/git-branches.md diff --git a/content/git/git-remotes.md b/_sources/git/git-remotes.md similarity index 100% rename from content/git/git-remotes.md rename to _sources/git/git-remotes.md diff --git a/content/git/git.md b/_sources/git/git.md similarity index 100% rename from content/git/git.md rename to _sources/git/git.md diff --git a/content/git/github.md b/_sources/git/github.md similarity index 100% rename from content/git/github.md rename to _sources/git/github.md diff --git a/content/git/pull-requests.md b/_sources/git/pull-requests.md similarity index 100% rename from content/git/pull-requests.md rename to _sources/git/pull-requests.md diff --git a/content/git/version-control.md b/_sources/git/version-control.md similarity index 100% rename from content/git/version-control.md rename to _sources/git/version-control.md diff --git a/_sphinx_design_static/design-tabs.js b/_sphinx_design_static/design-tabs.js new file mode 100644 index 00000000..b25bd6a4 --- /dev/null +++ b/_sphinx_design_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_sphinx_design_static/sphinx-design.min.css b/_sphinx_design_static/sphinx-design.min.css new file mode 100644 index 00000000..860c36da --- /dev/null +++ b/_sphinx_design_static/sphinx-design.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative;font-size:var(--sd-fontsize-dropdown)}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary.sd-summary-title{padding:.5em .6em .5em 1em;font-size:var(--sd-fontsize-dropdown-title);font-weight:var(--sd-fontweight-dropdown-title);user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;list-style:none;display:inline-flex;justify-content:space-between}details.sd-dropdown summary.sd-summary-title::-webkit-details-marker{display:none}details.sd-dropdown summary.sd-summary-title:focus{outline:none}details.sd-dropdown summary.sd-summary-title .sd-summary-icon{margin-right:.6em;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary.sd-summary-title .sd-summary-text{flex-grow:1;line-height:1.5;padding-right:.5rem}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker{pointer-events:none;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker svg{opacity:.6}details.sd-dropdown summary.sd-summary-title:hover .sd-summary-state-marker svg{opacity:1;transform:scale(1.1)}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown .sd-summary-chevron-right{transition:.25s}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-right{transform:rotate(90deg)}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-down{transform:rotate(180deg)}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-bg: rgba(0, 113, 188, 0.2);--sd-color-secondary-bg: rgba(108, 117, 125, 0.2);--sd-color-success-bg: rgba(40, 167, 69, 0.2);--sd-color-info-bg: rgba(23, 162, 184, 0.2);--sd-color-warning-bg: rgba(240, 179, 126, 0.2);--sd-color-danger-bg: rgba(220, 53, 69, 0.2);--sd-color-light-bg: rgba(248, 249, 250, 0.2);--sd-color-muted-bg: rgba(108, 117, 125, 0.2);--sd-color-dark-bg: rgba(33, 37, 41, 0.2);--sd-color-black-bg: rgba(0, 0, 0, 0.2);--sd-color-white-bg: rgba(255, 255, 255, 0.2);--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem;--sd-fontsize-dropdown: inherit;--sd-fontsize-dropdown-title: 1rem;--sd-fontweight-dropdown-title: 700} diff --git a/_static/basic.css b/_static/basic.css new file mode 100644 index 00000000..f316efcb --- /dev/null +++ b/_static/basic.css @@ -0,0 +1,925 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 230px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a:visited { + color: #551A8B; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} + +nav.contents, +aside.topic, +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ + +nav.contents, +aside.topic, +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +nav.contents > :last-child, +aside.topic > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +nav.contents::after, +aside.topic::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +aside.footnote > span, +div.citation > span { + float: left; +} +aside.footnote > span:last-of-type, +div.citation > span:last-of-type { + padding-right: 0.5em; +} +aside.footnote > p { + margin-left: 2em; +} +div.citation > p { + margin-left: 4em; +} +aside.footnote > p:last-of-type, +div.citation > p:last-of-type { + margin-bottom: 0em; +} +aside.footnote > p:last-of-type:after, +div.citation > p:last-of-type:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +.sig dd { + margin-top: 0px; + margin-bottom: 0px; +} + +.sig dl { + margin-top: 0px; + margin-bottom: 0px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +.translated { + background-color: rgba(207, 255, 207, 0.2) +} + +.untranslated { + background-color: rgba(255, 207, 207, 0.2) +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/_static/check-solid.svg b/_static/check-solid.svg new file mode 100644 index 00000000..92fad4b5 --- /dev/null +++ b/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/_static/clipboard.min.js b/_static/clipboard.min.js new file mode 100644 index 00000000..54b3c463 --- /dev/null +++ b/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/_static/copybutton.css b/_static/copybutton.css new file mode 100644 index 00000000..f1916ec7 --- /dev/null +++ b/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/_static/copybutton.js b/_static/copybutton.js new file mode 100644 index 00000000..2ea7ff3e --- /dev/null +++ b/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/_static/copybutton_funcs.js b/_static/copybutton_funcs.js new file mode 100644 index 00000000..dbe1aaad --- /dev/null +++ b/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/_static/design-tabs.js b/_static/design-tabs.js new file mode 100644 index 00000000..b25bd6a4 --- /dev/null +++ b/_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/doctools.js b/_static/doctools.js new file mode 100644 index 00000000..4d67807d --- /dev/null +++ b/_static/doctools.js @@ -0,0 +1,156 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const BLACKLISTED_KEY_CONTROL_ELEMENTS = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", +]); + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + document.addEventListener("keydown", (event) => { + // bail for input elements + if (BLACKLISTED_KEY_CONTROL_ELEMENTS.has(document.activeElement.tagName)) return; + // bail with special keys + if (event.altKey || event.ctrlKey || event.metaKey) return; + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/_static/documentation_options.js b/_static/documentation_options.js new file mode 100644 index 00000000..dab586c0 --- /dev/null +++ b/_static/documentation_options.js @@ -0,0 +1,13 @@ +const DOCUMENTATION_OPTIONS = { + VERSION: '', + LANGUAGE: 'en', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: false, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: true, +}; \ No newline at end of file diff --git a/_static/download_patch.js b/_static/download_patch.js new file mode 100644 index 00000000..4141cf5d --- /dev/null +++ b/_static/download_patch.js @@ -0,0 +1,15 @@ +document.addEventListener('DOMContentLoaded', function() { + console.log('force download is enabled!'); + const dropdown = document.querySelector('.dropdown-download-buttons'); + if (dropdown) { + dropdown.querySelectorAll('a').forEach(a => { + const href = a.getAttribute('href'); + if (href && (href.endsWith('.md') || href.endsWith('.ipynb'))) { + console.log(`Adding download attribute to ${href}`); + if (!a.hasAttribute('download')) { + a.setAttribute('download', ''); + } + } + }); + } +}); diff --git a/_static/file.png b/_static/file.png new file mode 100644 index 00000000..a858a410 Binary files /dev/null and b/_static/file.png differ diff --git a/_static/fix_admonition_style.css b/_static/fix_admonition_style.css new file mode 100644 index 00000000..cbf0eee4 --- /dev/null +++ b/_static/fix_admonition_style.css @@ -0,0 +1,3 @@ +.admonition.toggle-hidden .admonition-title ~ * { + display: none; +} diff --git a/_static/fix_align_code.css b/_static/fix_align_code.css new file mode 100644 index 00000000..b9b324a4 --- /dev/null +++ b/_static/fix_align_code.css @@ -0,0 +1,6 @@ +/* this to enforce left alignment for docutils content (i.e. code cells) */ +/* assumption is that all code is left aligned, so we enforce that */ +/* if not desired, raise an issue with a use case */ +div.cell.docutils.container { + text-align: left !important; +} \ No newline at end of file diff --git a/_static/fix_align_text_captions.css b/_static/fix_align_text_captions.css new file mode 100644 index 00000000..f2db5bd9 --- /dev/null +++ b/_static/fix_align_text_captions.css @@ -0,0 +1,3 @@ +figure figcaption p { + text-align: center !important; /* Always enforce center alignment */ +} \ No newline at end of file diff --git a/_static/fix_code_header_style.css b/_static/fix_code_header_style.css new file mode 100644 index 00000000..9f61b4b9 --- /dev/null +++ b/_static/fix_code_header_style.css @@ -0,0 +1,8 @@ +h1 code, +h2 code, +h3 code, +h4 code, +h5 code, +h6 code { + font-size: inherit; +} \ No newline at end of file diff --git a/_static/fix_dropdown_style.css b/_static/fix_dropdown_style.css new file mode 100644 index 00000000..ee2644fe --- /dev/null +++ b/_static/fix_dropdown_style.css @@ -0,0 +1,3 @@ +html[data-theme="dark"] { + --mystnb-source-bg-color: #262f3c; + } \ No newline at end of file diff --git a/_static/fix_hash_jump.js b/_static/fix_hash_jump.js new file mode 100644 index 00000000..80748f79 --- /dev/null +++ b/_static/fix_hash_jump.js @@ -0,0 +1,9 @@ +window.addEventListener("load", function() { + if (window.location.hash) { + const id = window.location.hash.substring(1); + const el = document.getElementById(id); + if (el) { + el.scrollIntoView({ behavior: "instant", block: "start" }); + } + } +}); \ No newline at end of file diff --git a/_static/fix_margin.css b/_static/fix_margin.css new file mode 100644 index 00000000..63f1145d --- /dev/null +++ b/_static/fix_margin.css @@ -0,0 +1,26 @@ +/** + * This file is an adaptation of the jupyterbook theme's _margin.scss file + * See the license for the jupyterbook theme in the LICENSE file. + * It is used to fix the margin behaviour between 992 and 1200px + */ + +/* Override the border style for aside.sidebar.margin */ +@media (min-width: 992px) and (max-width: 1200px) { + aside.sidebar.margin { + border: 1px solid var(--pst-color-border) !important; + } +} + +/* Override the styles for margin-related elements */ +@media (min-width: 992px) and (max-width: 1200px), print { + .cell.tag_margin, + .cell.tag_popout, + .margin.docutils.container, + aside.margin, + div.margin, + figure.margin { + clear: right !important; + margin: 0 0 0.5em 1em !important; + width: 40% !important; + } +} diff --git a/_static/fix_sidebar_scroll.css b/_static/fix_sidebar_scroll.css new file mode 100644 index 00000000..5af60688 --- /dev/null +++ b/_static/fix_sidebar_scroll.css @@ -0,0 +1,3 @@ +.bd-sidebar-primary { + display: block !important; /* Always enforce block display */ +} \ No newline at end of file diff --git a/_static/images/logo_binder.svg b/_static/images/logo_binder.svg new file mode 100644 index 00000000..45fecf75 --- /dev/null +++ b/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/_static/images/logo_colab.png b/_static/images/logo_colab.png new file mode 100644 index 00000000..b7560ec2 Binary files /dev/null and b/_static/images/logo_colab.png differ diff --git a/_static/images/logo_deepnote.svg b/_static/images/logo_deepnote.svg new file mode 100644 index 00000000..fa77ebfc --- /dev/null +++ b/_static/images/logo_deepnote.svg @@ -0,0 +1 @@ + diff --git a/_static/images/logo_jupyterhub.svg b/_static/images/logo_jupyterhub.svg new file mode 100644 index 00000000..60cfe9f2 --- /dev/null +++ b/_static/images/logo_jupyterhub.svg @@ -0,0 +1 @@ +logo_jupyterhubHub diff --git a/_static/images/logo_jupyterlite.svg b/_static/images/logo_jupyterlite.svg new file mode 100644 index 00000000..09e821f6 --- /dev/null +++ b/_static/images/logo_jupyterlite.svg @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + + + diff --git a/_static/language_data.js b/_static/language_data.js new file mode 100644 index 00000000..367b8ed8 --- /dev/null +++ b/_static/language_data.js @@ -0,0 +1,199 @@ +/* + * language_data.js + * ~~~~~~~~~~~~~~~~ + * + * This script contains the language-specific data used by searchtools.js, + * namely the list of stopwords, stemmer, scorer and splitter. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +var stopwords = ["a", "and", "are", "as", "at", "be", "but", "by", "for", "if", "in", "into", "is", "it", "near", "no", "not", "of", "on", "or", "such", "that", "the", "their", "then", "there", "these", "they", "this", "to", "was", "will", "with"]; + + +/* Non-minified version is copied as a separate JS file, if available */ + +/** + * Porter Stemmer + */ +var Stemmer = function() { + + var step2list = { + ational: 'ate', + tional: 'tion', + enci: 'ence', + anci: 'ance', + izer: 'ize', + bli: 'ble', + alli: 'al', + entli: 'ent', + eli: 'e', + ousli: 'ous', + ization: 'ize', + ation: 'ate', + ator: 'ate', + alism: 'al', + iveness: 'ive', + fulness: 'ful', + ousness: 'ous', + aliti: 'al', + iviti: 'ive', + biliti: 'ble', + logi: 'log' + }; + + var step3list = { + icate: 'ic', + ative: '', + alize: 'al', + iciti: 'ic', + ical: 'ic', + ful: '', + ness: '' + }; + + var c = "[^aeiou]"; // consonant + var v = "[aeiouy]"; // vowel + var C = c + "[^aeiouy]*"; // consonant sequence + var V = v + "[aeiou]*"; // vowel sequence + + var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0 + var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1 + var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1 + var s_v = "^(" + C + ")?" + v; // vowel in stem + + this.stemWord = function (w) { + var stem; + var suffix; + var firstch; + var origword = w; + + if (w.length < 3) + return w; + + var re; + var re2; + var re3; + var re4; + + firstch = w.substr(0,1); + if (firstch == "y") + w = firstch.toUpperCase() + w.substr(1); + + // Step 1a + re = /^(.+?)(ss|i)es$/; + re2 = /^(.+?)([^s])s$/; + + if (re.test(w)) + w = w.replace(re,"$1$2"); + else if (re2.test(w)) + w = w.replace(re2,"$1$2"); + + // Step 1b + re = /^(.+?)eed$/; + re2 = /^(.+?)(ed|ing)$/; + if (re.test(w)) { + var fp = re.exec(w); + re = new RegExp(mgr0); + if (re.test(fp[1])) { + re = /.$/; + w = w.replace(re,""); + } + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1]; + re2 = new RegExp(s_v); + if (re2.test(stem)) { + w = stem; + re2 = /(at|bl|iz)$/; + re3 = new RegExp("([^aeiouylsz])\\1$"); + re4 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re2.test(w)) + w = w + "e"; + else if (re3.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + else if (re4.test(w)) + w = w + "e"; + } + } + + // Step 1c + re = /^(.+?)y$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(s_v); + if (re.test(stem)) + w = stem + "i"; + } + + // Step 2 + re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step2list[suffix]; + } + + // Step 3 + re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step3list[suffix]; + } + + // Step 4 + re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/; + re2 = /^(.+?)(s|t)(ion)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + if (re.test(stem)) + w = stem; + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1] + fp[2]; + re2 = new RegExp(mgr1); + if (re2.test(stem)) + w = stem; + } + + // Step 5 + re = /^(.+?)e$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + re2 = new RegExp(meq1); + re3 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) + w = stem; + } + re = /ll$/; + re2 = new RegExp(mgr1); + if (re.test(w) && re2.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + + // and turn initial Y back to y + if (firstch == "y") + w = firstch.toLowerCase() + w.substr(1); + return w; + } +} + diff --git a/_static/locales/ar/LC_MESSAGES/booktheme.po b/_static/locales/ar/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..066f20f9 --- /dev/null +++ b/_static/locales/ar/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ar\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "بواسطة" + +msgid "By" +msgstr "بواسطة" + +msgid "Contents" +msgstr "محتويات" + +msgid "Copyright" +msgstr "حقوق النشر" + +msgid "Download notebook file" +msgstr "تنزيل ملف دفتر الملاحظات" + +msgid "Download source file" +msgstr "تنزيل ملف المصدر" + +msgid "Download this page" +msgstr "قم بتنزيل هذه الصفحة" + +msgid "Edit this page" +msgstr "قم بتحرير هذه الصفحة" + +msgid "Fullscreen mode" +msgstr "وضع ملء الشاشة" + +msgid "Last updated on" +msgstr "آخر تحديث في" + +msgid "Launch" +msgstr "إطلاق" + +msgid "Open an issue" +msgstr "افتح قضية" + +msgid "Print to PDF" +msgstr "طباعة إلى PDF" + +msgid "Source repository" +msgstr "مستودع المصدر" + +msgid "Sphinx Book Theme" +msgstr "موضوع كتاب أبو الهول" + +msgid "Theme by the" +msgstr "موضوع بواسطة" + +msgid "Toggle navigation" +msgstr "تبديل التنقل" + +msgid "next page" +msgstr "الصفحة التالية" + +msgid "open issue" +msgstr "قضية مفتوحة" + +msgid "previous page" +msgstr "الصفحة السابقة" + +msgid "repository" +msgstr "مخزن" + +msgid "suggest edit" +msgstr "أقترح تحرير" diff --git a/_static/locales/bg/LC_MESSAGES/booktheme.po b/_static/locales/bg/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..0f22f49a --- /dev/null +++ b/_static/locales/bg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "По" + +msgid "By" +msgstr "От" + +msgid "Contents" +msgstr "Съдържание" + +msgid "Copyright" +msgstr "Авторско право" + +msgid "Download notebook file" +msgstr "Изтеглете файла на бележника" + +msgid "Download source file" +msgstr "Изтеглете изходния файл" + +msgid "Download this page" +msgstr "Изтеглете тази страница" + +msgid "Edit this page" +msgstr "Редактирайте тази страница" + +msgid "Fullscreen mode" +msgstr "Режим на цял екран" + +msgid "Last updated on" +msgstr "Последна актуализация на" + +msgid "Launch" +msgstr "Стартиране" + +msgid "Open an issue" +msgstr "Отворете проблем" + +msgid "Print to PDF" +msgstr "Печат в PDF" + +msgid "Source repository" +msgstr "Хранилище на източника" + +msgid "Sphinx Book Theme" +msgstr "Тема на книгата Sphinx" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Toggle navigation" +msgstr "Превключване на навигацията" + +msgid "next page" +msgstr "Следваща страница" + +msgid "open issue" +msgstr "отворен брой" + +msgid "previous page" +msgstr "предишна страница" + +msgid "repository" +msgstr "хранилище" + +msgid "suggest edit" +msgstr "предложи редактиране" diff --git a/_static/locales/bn/LC_MESSAGES/booktheme.po b/_static/locales/bn/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..7202a5f3 --- /dev/null +++ b/_static/locales/bn/LC_MESSAGES/booktheme.po @@ -0,0 +1,63 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bn\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "দ্বারা" + +msgid "By" +msgstr "দ্বারা" + +msgid "Copyright" +msgstr "কপিরাইট" + +msgid "Download notebook file" +msgstr "নোটবুক ফাইল ডাউনলোড করুন" + +msgid "Download source file" +msgstr "উত্স ফাইল ডাউনলোড করুন" + +msgid "Download this page" +msgstr "এই পৃষ্ঠাটি ডাউনলোড করুন" + +msgid "Edit this page" +msgstr "এই পৃষ্ঠাটি সম্পাদনা করুন" + +msgid "Last updated on" +msgstr "সর্বশেষ আপডেট" + +msgid "Launch" +msgstr "শুরু করা" + +msgid "Open an issue" +msgstr "একটি সমস্যা খুলুন" + +msgid "Print to PDF" +msgstr "পিডিএফ প্রিন্ট করুন" + +msgid "Source repository" +msgstr "উত্স সংগ্রহস্থল" + +msgid "Sphinx Book Theme" +msgstr "স্পিনিক্স বুক থিম" + +msgid "Theme by the" +msgstr "থিম দ্বারা" + +msgid "Toggle navigation" +msgstr "নেভিগেশন টগল করুন" + +msgid "next page" +msgstr "পরবর্তী পৃষ্ঠা" + +msgid "open issue" +msgstr "খোলা সমস্যা" + +msgid "previous page" +msgstr "আগের পৃষ্ঠা" diff --git a/_static/locales/ca/LC_MESSAGES/booktheme.po b/_static/locales/ca/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..a325041f --- /dev/null +++ b/_static/locales/ca/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ca\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Per la" + +msgid "By" +msgstr "Per" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "Descarregar fitxer de quadern" + +msgid "Download source file" +msgstr "Baixeu el fitxer font" + +msgid "Download this page" +msgstr "Descarregueu aquesta pàgina" + +msgid "Edit this page" +msgstr "Editeu aquesta pàgina" + +msgid "Last updated on" +msgstr "Darrera actualització el" + +msgid "Launch" +msgstr "Llançament" + +msgid "Open an issue" +msgstr "Obriu un número" + +msgid "Print to PDF" +msgstr "Imprimeix a PDF" + +msgid "Source repository" +msgstr "Dipòsit de fonts" + +msgid "Sphinx Book Theme" +msgstr "Tema del llibre Esfinx" + +msgid "Theme by the" +msgstr "Tema del" + +msgid "Toggle navigation" +msgstr "Commuta la navegació" + +msgid "next page" +msgstr "pàgina següent" + +msgid "open issue" +msgstr "número obert" + +msgid "previous page" +msgstr "Pàgina anterior" + +msgid "suggest edit" +msgstr "suggerir edició" diff --git a/_static/locales/cs/LC_MESSAGES/booktheme.po b/_static/locales/cs/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..97e52e8a --- /dev/null +++ b/_static/locales/cs/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: cs\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Podle" + +msgid "By" +msgstr "Podle" + +msgid "Contents" +msgstr "Obsah" + +msgid "Copyright" +msgstr "autorská práva" + +msgid "Download notebook file" +msgstr "Stáhnout soubor poznámkového bloku" + +msgid "Download source file" +msgstr "Stáhněte si zdrojový soubor" + +msgid "Download this page" +msgstr "Stáhněte si tuto stránku" + +msgid "Edit this page" +msgstr "Upravit tuto stránku" + +msgid "Fullscreen mode" +msgstr "Režim celé obrazovky" + +msgid "Last updated on" +msgstr "Naposledy aktualizováno" + +msgid "Launch" +msgstr "Zahájení" + +msgid "Open an issue" +msgstr "Otevřete problém" + +msgid "Print to PDF" +msgstr "Tisk do PDF" + +msgid "Source repository" +msgstr "Zdrojové úložiště" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Toggle navigation" +msgstr "Přepnout navigaci" + +msgid "next page" +msgstr "další strana" + +msgid "open issue" +msgstr "otevřené číslo" + +msgid "previous page" +msgstr "předchozí stránka" + +msgid "repository" +msgstr "úložiště" + +msgid "suggest edit" +msgstr "navrhnout úpravy" diff --git a/_static/locales/da/LC_MESSAGES/booktheme.po b/_static/locales/da/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..084b4e57 --- /dev/null +++ b/_static/locales/da/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: da\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Ved" + +msgid "By" +msgstr "Ved" + +msgid "Contents" +msgstr "Indhold" + +msgid "Copyright" +msgstr "ophavsret" + +msgid "Download notebook file" +msgstr "Download notesbog-fil" + +msgid "Download source file" +msgstr "Download kildefil" + +msgid "Download this page" +msgstr "Download denne side" + +msgid "Edit this page" +msgstr "Rediger denne side" + +msgid "Fullscreen mode" +msgstr "Fuldskærmstilstand" + +msgid "Last updated on" +msgstr "Sidst opdateret den" + +msgid "Launch" +msgstr "Start" + +msgid "Open an issue" +msgstr "Åbn et problem" + +msgid "Print to PDF" +msgstr "Udskriv til PDF" + +msgid "Source repository" +msgstr "Kildelager" + +msgid "Sphinx Book Theme" +msgstr "Sphinx bogtema" + +msgid "Theme by the" +msgstr "Tema af" + +msgid "Toggle navigation" +msgstr "Skift navigation" + +msgid "next page" +msgstr "Næste side" + +msgid "open issue" +msgstr "åbent nummer" + +msgid "previous page" +msgstr "forrige side" + +msgid "repository" +msgstr "lager" + +msgid "suggest edit" +msgstr "foreslå redigering" diff --git a/_static/locales/de/LC_MESSAGES/booktheme.po b/_static/locales/de/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..1ed1dc16 --- /dev/null +++ b/_static/locales/de/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: de\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Bis zum" + +msgid "By" +msgstr "Durch" + +msgid "Contents" +msgstr "Inhalt" + +msgid "Copyright" +msgstr "Urheberrechte ©" + +msgid "Download notebook file" +msgstr "Notebook-Datei herunterladen" + +msgid "Download source file" +msgstr "Quelldatei herunterladen" + +msgid "Download this page" +msgstr "Laden Sie diese Seite herunter" + +msgid "Edit this page" +msgstr "Bearbeite diese Seite" + +msgid "Fullscreen mode" +msgstr "Vollbildmodus" + +msgid "Last updated on" +msgstr "Zuletzt aktualisiert am" + +msgid "Launch" +msgstr "Starten" + +msgid "Open an issue" +msgstr "Öffnen Sie ein Problem" + +msgid "Print to PDF" +msgstr "In PDF drucken" + +msgid "Source repository" +msgstr "Quell-Repository" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-Buch-Thema" + +msgid "Theme by the" +msgstr "Thema von der" + +msgid "Toggle navigation" +msgstr "Navigation umschalten" + +msgid "next page" +msgstr "Nächste Seite" + +msgid "open issue" +msgstr "offenes Thema" + +msgid "previous page" +msgstr "vorherige Seite" + +msgid "repository" +msgstr "Repository" + +msgid "suggest edit" +msgstr "vorschlagen zu bearbeiten" diff --git a/_static/locales/el/LC_MESSAGES/booktheme.po b/_static/locales/el/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..27d1274a --- /dev/null +++ b/_static/locales/el/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: el\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Από το" + +msgid "By" +msgstr "Με" + +msgid "Contents" +msgstr "Περιεχόμενα" + +msgid "Copyright" +msgstr "Πνευματική ιδιοκτησία" + +msgid "Download notebook file" +msgstr "Λήψη αρχείου σημειωματάριου" + +msgid "Download source file" +msgstr "Λήψη αρχείου προέλευσης" + +msgid "Download this page" +msgstr "Λήψη αυτής της σελίδας" + +msgid "Edit this page" +msgstr "Επεξεργαστείτε αυτήν τη σελίδα" + +msgid "Fullscreen mode" +msgstr "ΛΕΙΤΟΥΡΓΙΑ ΠΛΗΡΟΥΣ ΟΘΟΝΗΣ" + +msgid "Last updated on" +msgstr "Τελευταία ενημέρωση στις" + +msgid "Launch" +msgstr "Εκτόξευση" + +msgid "Open an issue" +msgstr "Ανοίξτε ένα ζήτημα" + +msgid "Print to PDF" +msgstr "Εκτύπωση σε PDF" + +msgid "Source repository" +msgstr "Αποθήκη πηγής" + +msgid "Sphinx Book Theme" +msgstr "Θέμα βιβλίου Sphinx" + +msgid "Theme by the" +msgstr "Θέμα από το" + +msgid "Toggle navigation" +msgstr "Εναλλαγή πλοήγησης" + +msgid "next page" +msgstr "επόμενη σελίδα" + +msgid "open issue" +msgstr "ανοιχτό ζήτημα" + +msgid "previous page" +msgstr "προηγούμενη σελίδα" + +msgid "repository" +msgstr "αποθήκη" + +msgid "suggest edit" +msgstr "προτείνω επεξεργασία" diff --git a/_static/locales/eo/LC_MESSAGES/booktheme.po b/_static/locales/eo/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..1fda1bcd --- /dev/null +++ b/_static/locales/eo/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: eo\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Per la" + +msgid "By" +msgstr "De" + +msgid "Contents" +msgstr "Enhavo" + +msgid "Copyright" +msgstr "Kopirajto" + +msgid "Download notebook file" +msgstr "Elŝutu kajeran dosieron" + +msgid "Download source file" +msgstr "Elŝutu fontodosieron" + +msgid "Download this page" +msgstr "Elŝutu ĉi tiun paĝon" + +msgid "Edit this page" +msgstr "Redaktu ĉi tiun paĝon" + +msgid "Fullscreen mode" +msgstr "Plenekrana reĝimo" + +msgid "Last updated on" +msgstr "Laste ĝisdatigita la" + +msgid "Launch" +msgstr "Lanĉo" + +msgid "Open an issue" +msgstr "Malfermu numeron" + +msgid "Print to PDF" +msgstr "Presi al PDF" + +msgid "Source repository" +msgstr "Fonto-deponejo" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa Libro-Temo" + +msgid "Theme by the" +msgstr "Temo de la" + +msgid "Toggle navigation" +msgstr "Ŝalti navigadon" + +msgid "next page" +msgstr "sekva paĝo" + +msgid "open issue" +msgstr "malferma numero" + +msgid "previous page" +msgstr "antaŭa paĝo" + +msgid "repository" +msgstr "deponejo" + +msgid "suggest edit" +msgstr "sugesti redaktadon" diff --git a/_static/locales/es/LC_MESSAGES/booktheme.po b/_static/locales/es/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..c91b41b9 --- /dev/null +++ b/_static/locales/es/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: es\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Por el" + +msgid "By" +msgstr "Por" + +msgid "Contents" +msgstr "Contenido" + +msgid "Copyright" +msgstr "Derechos de autor" + +msgid "Download notebook file" +msgstr "Descargar archivo de cuaderno" + +msgid "Download source file" +msgstr "Descargar archivo fuente" + +msgid "Download this page" +msgstr "Descarga esta pagina" + +msgid "Edit this page" +msgstr "Edita esta página" + +msgid "Fullscreen mode" +msgstr "Modo de pantalla completa" + +msgid "Last updated on" +msgstr "Ultima actualización en" + +msgid "Launch" +msgstr "Lanzamiento" + +msgid "Open an issue" +msgstr "Abrir un problema" + +msgid "Print to PDF" +msgstr "Imprimir en PDF" + +msgid "Source repository" +msgstr "Repositorio de origen" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro de la esfinge" + +msgid "Theme by the" +msgstr "Tema por el" + +msgid "Toggle navigation" +msgstr "Navegación de palanca" + +msgid "next page" +msgstr "siguiente página" + +msgid "open issue" +msgstr "Tema abierto" + +msgid "previous page" +msgstr "pagina anterior" + +msgid "repository" +msgstr "repositorio" + +msgid "suggest edit" +msgstr "sugerir editar" diff --git a/_static/locales/et/LC_MESSAGES/booktheme.po b/_static/locales/et/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..2fd1ea20 --- /dev/null +++ b/_static/locales/et/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: et\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Autor" + +msgid "By" +msgstr "Kõrval" + +msgid "Contents" +msgstr "Sisu" + +msgid "Copyright" +msgstr "Autoriõigus" + +msgid "Download notebook file" +msgstr "Laadige sülearvuti fail alla" + +msgid "Download source file" +msgstr "Laadige alla lähtefail" + +msgid "Download this page" +msgstr "Laadige see leht alla" + +msgid "Edit this page" +msgstr "Muutke seda lehte" + +msgid "Fullscreen mode" +msgstr "Täisekraanirežiim" + +msgid "Last updated on" +msgstr "Viimati uuendatud" + +msgid "Launch" +msgstr "Käivitage" + +msgid "Open an issue" +msgstr "Avage probleem" + +msgid "Print to PDF" +msgstr "Prindi PDF-i" + +msgid "Source repository" +msgstr "Allikahoidla" + +msgid "Sphinx Book Theme" +msgstr "Sfinksiraamatu teema" + +msgid "Theme by the" +msgstr "Teema" + +msgid "Toggle navigation" +msgstr "Lülita navigeerimine sisse" + +msgid "next page" +msgstr "järgmine leht" + +msgid "open issue" +msgstr "avatud küsimus" + +msgid "previous page" +msgstr "eelmine leht" + +msgid "repository" +msgstr "hoidla" + +msgid "suggest edit" +msgstr "soovita muuta" diff --git a/_static/locales/fi/LC_MESSAGES/booktheme.po b/_static/locales/fi/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..2843f2c7 --- /dev/null +++ b/_static/locales/fi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Mukaan" + +msgid "By" +msgstr "Tekijä" + +msgid "Contents" +msgstr "Sisällys" + +msgid "Copyright" +msgstr "Tekijänoikeus" + +msgid "Download notebook file" +msgstr "Lataa muistikirjatiedosto" + +msgid "Download source file" +msgstr "Lataa lähdetiedosto" + +msgid "Download this page" +msgstr "Lataa tämä sivu" + +msgid "Edit this page" +msgstr "Muokkaa tätä sivua" + +msgid "Fullscreen mode" +msgstr "Koko näytön tila" + +msgid "Last updated on" +msgstr "Viimeksi päivitetty" + +msgid "Launch" +msgstr "Tuoda markkinoille" + +msgid "Open an issue" +msgstr "Avaa ongelma" + +msgid "Print to PDF" +msgstr "Tulosta PDF-tiedostoon" + +msgid "Source repository" +msgstr "Lähteen arkisto" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-kirjan teema" + +msgid "Theme by the" +msgstr "Teeman tekijä" + +msgid "Toggle navigation" +msgstr "Vaihda navigointia" + +msgid "next page" +msgstr "seuraava sivu" + +msgid "open issue" +msgstr "avoin ongelma" + +msgid "previous page" +msgstr "Edellinen sivu" + +msgid "repository" +msgstr "arkisto" + +msgid "suggest edit" +msgstr "ehdottaa muokkausta" diff --git a/_static/locales/fr/LC_MESSAGES/booktheme.po b/_static/locales/fr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..351cddd6 --- /dev/null +++ b/_static/locales/fr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Par le" + +msgid "By" +msgstr "Par" + +msgid "Contents" +msgstr "Contenu" + +msgid "Copyright" +msgstr "droits d'auteur" + +msgid "Download notebook file" +msgstr "Télécharger le fichier notebook" + +msgid "Download source file" +msgstr "Télécharger le fichier source" + +msgid "Download this page" +msgstr "Téléchargez cette page" + +msgid "Edit this page" +msgstr "Modifier cette page" + +msgid "Fullscreen mode" +msgstr "Mode plein écran" + +msgid "Last updated on" +msgstr "Dernière mise à jour le" + +msgid "Launch" +msgstr "lancement" + +msgid "Open an issue" +msgstr "Ouvrez un problème" + +msgid "Print to PDF" +msgstr "Imprimer au format PDF" + +msgid "Source repository" +msgstr "Dépôt source" + +msgid "Sphinx Book Theme" +msgstr "Thème du livre Sphinx" + +msgid "Theme by the" +msgstr "Thème par le" + +msgid "Toggle navigation" +msgstr "Basculer la navigation" + +msgid "next page" +msgstr "page suivante" + +msgid "open issue" +msgstr "signaler un problème" + +msgid "previous page" +msgstr "page précédente" + +msgid "repository" +msgstr "dépôt" + +msgid "suggest edit" +msgstr "suggestion de modification" diff --git a/_static/locales/hr/LC_MESSAGES/booktheme.po b/_static/locales/hr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..3c1cf079 --- /dev/null +++ b/_static/locales/hr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: hr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Od strane" + +msgid "By" +msgstr "Po" + +msgid "Contents" +msgstr "Sadržaj" + +msgid "Copyright" +msgstr "Autorska prava" + +msgid "Download notebook file" +msgstr "Preuzmi datoteku bilježnice" + +msgid "Download source file" +msgstr "Preuzmi izvornu datoteku" + +msgid "Download this page" +msgstr "Preuzmite ovu stranicu" + +msgid "Edit this page" +msgstr "Uredite ovu stranicu" + +msgid "Fullscreen mode" +msgstr "Način preko cijelog zaslona" + +msgid "Last updated on" +msgstr "Posljednje ažuriranje:" + +msgid "Launch" +msgstr "Pokrenite" + +msgid "Open an issue" +msgstr "Otvorite izdanje" + +msgid "Print to PDF" +msgstr "Ispis u PDF" + +msgid "Source repository" +msgstr "Izvorno spremište" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "Theme by the" +msgstr "Tema autora" + +msgid "Toggle navigation" +msgstr "Uključi / isključi navigaciju" + +msgid "next page" +msgstr "sljedeća stranica" + +msgid "open issue" +msgstr "otvoreno izdanje" + +msgid "previous page" +msgstr "Prethodna stranica" + +msgid "repository" +msgstr "spremište" + +msgid "suggest edit" +msgstr "predloži uređivanje" diff --git a/_static/locales/hu/LC_MESSAGES/booktheme.po b/_static/locales/hu/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..1f0b2b02 --- /dev/null +++ b/_static/locales/hu/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: hu\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Szerző:" + +msgid "By" +msgstr "Szerző:" + +msgid "Contents" +msgstr "Tartalom" + +msgid "Copyright" +msgstr "Szerzői jog" + +msgid "Download notebook file" +msgstr "Jegyzettömbfájl letöltése" + +msgid "Download source file" +msgstr "Forrásfájl letöltése" + +msgid "Download this page" +msgstr "Az oldal letöltése" + +msgid "Edit this page" +msgstr "Az oldal szerkesztése" + +msgid "Fullscreen mode" +msgstr "Teljes képernyős mód" + +msgid "Last updated on" +msgstr "Utoljára frissítve:" + +msgid "Launch" +msgstr "Indítás" + +msgid "Open an issue" +msgstr "Problémajegy nyitása" + +msgid "Print to PDF" +msgstr "Nyomtatás PDF-be" + +msgid "Source repository" +msgstr "Forráskódtároló" + +msgid "Sphinx Book Theme" +msgstr "Sphinx könyvsablon" + +msgid "Theme by the" +msgstr "Téma készítője:" + +msgid "Toggle navigation" +msgstr "Navigáció ki- és bekapcsolása" + +msgid "next page" +msgstr "következő oldal" + +msgid "open issue" +msgstr "problémajegy nyitása" + +msgid "previous page" +msgstr "előző oldal" + +msgid "repository" +msgstr "tároló" + +msgid "suggest edit" +msgstr "szerkesztési javaslat" diff --git a/_static/locales/id/LC_MESSAGES/booktheme.po b/_static/locales/id/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..809498c7 --- /dev/null +++ b/_static/locales/id/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: id\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Oleh" + +msgid "By" +msgstr "Oleh" + +msgid "Contents" +msgstr "Isi" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download notebook file" +msgstr "Unduh file notebook" + +msgid "Download source file" +msgstr "Unduh file sumber" + +msgid "Download this page" +msgstr "Unduh halaman ini" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "Fullscreen mode" +msgstr "Mode layar penuh" + +msgid "Last updated on" +msgstr "Terakhir diperbarui saat" + +msgid "Launch" +msgstr "Meluncurkan" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Toggle navigation" +msgstr "Alihkan navigasi" + +msgid "next page" +msgstr "halaman selanjutnya" + +msgid "open issue" +msgstr "masalah terbuka" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "repository" +msgstr "gudang" + +msgid "suggest edit" +msgstr "menyarankan edit" diff --git a/_static/locales/it/LC_MESSAGES/booktheme.po b/_static/locales/it/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..fbc8d03b --- /dev/null +++ b/_static/locales/it/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: it\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Dal" + +msgid "By" +msgstr "Di" + +msgid "Contents" +msgstr "Contenuti" + +msgid "Copyright" +msgstr "Diritto d'autore" + +msgid "Download notebook file" +msgstr "Scarica il file del taccuino" + +msgid "Download source file" +msgstr "Scarica il file sorgente" + +msgid "Download this page" +msgstr "Scarica questa pagina" + +msgid "Edit this page" +msgstr "Modifica questa pagina" + +msgid "Fullscreen mode" +msgstr "Modalità schermo intero" + +msgid "Last updated on" +msgstr "Ultimo aggiornamento il" + +msgid "Launch" +msgstr "Lanciare" + +msgid "Open an issue" +msgstr "Apri un problema" + +msgid "Print to PDF" +msgstr "Stampa in PDF" + +msgid "Source repository" +msgstr "Repository di origine" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro della Sfinge" + +msgid "Theme by the" +msgstr "Tema di" + +msgid "Toggle navigation" +msgstr "Attiva / disattiva la navigazione" + +msgid "next page" +msgstr "pagina successiva" + +msgid "open issue" +msgstr "questione aperta" + +msgid "previous page" +msgstr "pagina precedente" + +msgid "repository" +msgstr "repository" + +msgid "suggest edit" +msgstr "suggerisci modifica" diff --git a/_static/locales/iw/LC_MESSAGES/booktheme.po b/_static/locales/iw/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..a82f3512 --- /dev/null +++ b/_static/locales/iw/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: iw\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "דרך" + +msgid "By" +msgstr "על ידי" + +msgid "Contents" +msgstr "תוכן" + +msgid "Copyright" +msgstr "זכויות יוצרים" + +msgid "Download notebook file" +msgstr "הורד קובץ מחברת" + +msgid "Download source file" +msgstr "הורד את קובץ המקור" + +msgid "Download this page" +msgstr "הורד דף זה" + +msgid "Edit this page" +msgstr "ערוך דף זה" + +msgid "Fullscreen mode" +msgstr "מצב מסך מלא" + +msgid "Last updated on" +msgstr "עודכן לאחרונה ב" + +msgid "Launch" +msgstr "לְהַשִׁיק" + +msgid "Open an issue" +msgstr "פתח גיליון" + +msgid "Print to PDF" +msgstr "הדפס לקובץ PDF" + +msgid "Source repository" +msgstr "מאגר המקורות" + +msgid "Sphinx Book Theme" +msgstr "נושא ספר ספינקס" + +msgid "Theme by the" +msgstr "נושא מאת" + +msgid "Toggle navigation" +msgstr "החלף ניווט" + +msgid "next page" +msgstr "עמוד הבא" + +msgid "open issue" +msgstr "בעיה פתוחה" + +msgid "previous page" +msgstr "עמוד קודם" + +msgid "repository" +msgstr "מאגר" + +msgid "suggest edit" +msgstr "מציע לערוך" diff --git a/_static/locales/ja/LC_MESSAGES/booktheme.po b/_static/locales/ja/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..3caab09e --- /dev/null +++ b/_static/locales/ja/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ja\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "によって" + +msgid "By" +msgstr "著者" + +msgid "Contents" +msgstr "目次" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "ノートブックファイルをダウンロード" + +msgid "Download source file" +msgstr "ソースファイルをダウンロード" + +msgid "Download this page" +msgstr "このページをダウンロード" + +msgid "Edit this page" +msgstr "このページを編集" + +msgid "Fullscreen mode" +msgstr "全画面モード" + +msgid "Last updated on" +msgstr "最終更新日" + +msgid "Launch" +msgstr "起動" + +msgid "Open an issue" +msgstr "問題を報告" + +msgid "Print to PDF" +msgstr "PDFに印刷" + +msgid "Source repository" +msgstr "ソースリポジトリ" + +msgid "Sphinx Book Theme" +msgstr "スフィンクスの本のテーマ" + +msgid "Theme by the" +msgstr "のテーマ" + +msgid "Toggle navigation" +msgstr "ナビゲーションを切り替え" + +msgid "next page" +msgstr "次のページ" + +msgid "open issue" +msgstr "未解決の問題" + +msgid "previous page" +msgstr "前のページ" + +msgid "repository" +msgstr "リポジトリ" + +msgid "suggest edit" +msgstr "編集を提案する" diff --git a/_static/locales/ko/LC_MESSAGES/booktheme.po b/_static/locales/ko/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..2db12a1b --- /dev/null +++ b/_static/locales/ko/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ko\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "에 의해" + +msgid "By" +msgstr "으로" + +msgid "Contents" +msgstr "내용" + +msgid "Copyright" +msgstr "저작권" + +msgid "Download notebook file" +msgstr "노트북 파일 다운로드" + +msgid "Download source file" +msgstr "소스 파일 다운로드" + +msgid "Download this page" +msgstr "이 페이지 다운로드" + +msgid "Edit this page" +msgstr "이 페이지 편집" + +msgid "Fullscreen mode" +msgstr "전체 화면으로보기" + +msgid "Last updated on" +msgstr "마지막 업데이트" + +msgid "Launch" +msgstr "시작하다" + +msgid "Open an issue" +msgstr "이슈 열기" + +msgid "Print to PDF" +msgstr "PDF로 인쇄" + +msgid "Source repository" +msgstr "소스 저장소" + +msgid "Sphinx Book Theme" +msgstr "스핑크스 도서 테마" + +msgid "Theme by the" +msgstr "테마별" + +msgid "Toggle navigation" +msgstr "탐색 전환" + +msgid "next page" +msgstr "다음 페이지" + +msgid "open issue" +msgstr "열린 문제" + +msgid "previous page" +msgstr "이전 페이지" + +msgid "repository" +msgstr "저장소" + +msgid "suggest edit" +msgstr "편집 제안" diff --git a/_static/locales/lt/LC_MESSAGES/booktheme.po b/_static/locales/lt/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..07b64680 --- /dev/null +++ b/_static/locales/lt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Prie" + +msgid "By" +msgstr "Iki" + +msgid "Contents" +msgstr "Turinys" + +msgid "Copyright" +msgstr "Autorių teisės" + +msgid "Download notebook file" +msgstr "Atsisiųsti nešiojamojo kompiuterio failą" + +msgid "Download source file" +msgstr "Atsisiųsti šaltinio failą" + +msgid "Download this page" +msgstr "Atsisiųskite šį puslapį" + +msgid "Edit this page" +msgstr "Redaguoti šį puslapį" + +msgid "Fullscreen mode" +msgstr "Pilno ekrano režimas" + +msgid "Last updated on" +msgstr "Paskutinį kartą atnaujinta" + +msgid "Launch" +msgstr "Paleiskite" + +msgid "Open an issue" +msgstr "Atidarykite problemą" + +msgid "Print to PDF" +msgstr "Spausdinti į PDF" + +msgid "Source repository" +msgstr "Šaltinio saugykla" + +msgid "Sphinx Book Theme" +msgstr "Sfinkso knygos tema" + +msgid "Theme by the" +msgstr "Tema" + +msgid "Toggle navigation" +msgstr "Perjungti naršymą" + +msgid "next page" +msgstr "Kitas puslapis" + +msgid "open issue" +msgstr "atviras klausimas" + +msgid "previous page" +msgstr "Ankstesnis puslapis" + +msgid "repository" +msgstr "saugykla" + +msgid "suggest edit" +msgstr "pasiūlyti redaguoti" diff --git a/_static/locales/lv/LC_MESSAGES/booktheme.po b/_static/locales/lv/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..b741c289 --- /dev/null +++ b/_static/locales/lv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Ar" + +msgid "By" +msgstr "Autors" + +msgid "Contents" +msgstr "Saturs" + +msgid "Copyright" +msgstr "Autortiesības" + +msgid "Download notebook file" +msgstr "Lejupielādēt piezīmju grāmatiņu" + +msgid "Download source file" +msgstr "Lejupielādēt avota failu" + +msgid "Download this page" +msgstr "Lejupielādējiet šo lapu" + +msgid "Edit this page" +msgstr "Rediģēt šo lapu" + +msgid "Fullscreen mode" +msgstr "Pilnekrāna režīms" + +msgid "Last updated on" +msgstr "Pēdējoreiz atjaunināts" + +msgid "Launch" +msgstr "Uzsākt" + +msgid "Open an issue" +msgstr "Atveriet problēmu" + +msgid "Print to PDF" +msgstr "Drukāt PDF formātā" + +msgid "Source repository" +msgstr "Avota krātuve" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa grāmatas tēma" + +msgid "Theme by the" +msgstr "Autora tēma" + +msgid "Toggle navigation" +msgstr "Pārslēgt navigāciju" + +msgid "next page" +msgstr "nākamā lapaspuse" + +msgid "open issue" +msgstr "atklāts jautājums" + +msgid "previous page" +msgstr "iepriekšējā lapa" + +msgid "repository" +msgstr "krātuve" + +msgid "suggest edit" +msgstr "ieteikt rediģēt" diff --git a/_static/locales/ml/LC_MESSAGES/booktheme.po b/_static/locales/ml/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..bdad3de2 --- /dev/null +++ b/_static/locales/ml/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ml\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "എഴുതിയത്" + +msgid "By" +msgstr "എഴുതിയത്" + +msgid "Copyright" +msgstr "പകർപ്പവകാശം" + +msgid "Download notebook file" +msgstr "നോട്ട്ബുക്ക് ഫയൽ ഡൺലോഡ് ചെയ്യുക" + +msgid "Download source file" +msgstr "ഉറവിട ഫയൽ ഡൗൺലോഡുചെയ്യുക" + +msgid "Download this page" +msgstr "ഈ പേജ് ഡൗൺലോഡുചെയ്യുക" + +msgid "Edit this page" +msgstr "ഈ പേജ് എഡിറ്റുചെയ്യുക" + +msgid "Last updated on" +msgstr "അവസാനം അപ്‌ഡേറ്റുചെയ്‌തത്" + +msgid "Launch" +msgstr "സമാരംഭിക്കുക" + +msgid "Open an issue" +msgstr "ഒരു പ്രശ്നം തുറക്കുക" + +msgid "Print to PDF" +msgstr "PDF- ലേക്ക് പ്രിന്റുചെയ്യുക" + +msgid "Source repository" +msgstr "ഉറവിട ശേഖരം" + +msgid "Sphinx Book Theme" +msgstr "സ്ഫിങ്ക്സ് പുസ്തക തീം" + +msgid "Theme by the" +msgstr "പ്രമേയം" + +msgid "Toggle navigation" +msgstr "നാവിഗേഷൻ ടോഗിൾ ചെയ്യുക" + +msgid "next page" +msgstr "അടുത്ത പേജ്" + +msgid "open issue" +msgstr "തുറന്ന പ്രശ്നം" + +msgid "previous page" +msgstr "മുൻപത്തെ താൾ" + +msgid "suggest edit" +msgstr "എഡിറ്റുചെയ്യാൻ നിർദ്ദേശിക്കുക" diff --git a/_static/locales/mr/LC_MESSAGES/booktheme.po b/_static/locales/mr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..61bfad4d --- /dev/null +++ b/_static/locales/mr/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: mr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "द्वारा" + +msgid "By" +msgstr "द्वारा" + +msgid "Copyright" +msgstr "कॉपीराइट" + +msgid "Download notebook file" +msgstr "नोटबुक फाईल डाउनलोड करा" + +msgid "Download source file" +msgstr "स्त्रोत फाइल डाउनलोड करा" + +msgid "Download this page" +msgstr "हे पृष्ठ डाउनलोड करा" + +msgid "Edit this page" +msgstr "हे पृष्ठ संपादित करा" + +msgid "Last updated on" +msgstr "अखेरचे अद्यतनित" + +msgid "Launch" +msgstr "लाँच करा" + +msgid "Open an issue" +msgstr "एक मुद्दा उघडा" + +msgid "Print to PDF" +msgstr "पीडीएफवर मुद्रित करा" + +msgid "Source repository" +msgstr "स्त्रोत भांडार" + +msgid "Sphinx Book Theme" +msgstr "स्फिंक्स बुक थीम" + +msgid "Theme by the" +msgstr "द्वारा थीम" + +msgid "Toggle navigation" +msgstr "नेव्हिगेशन टॉगल करा" + +msgid "next page" +msgstr "पुढील पृष्ठ" + +msgid "open issue" +msgstr "खुला मुद्दा" + +msgid "previous page" +msgstr "मागील पान" + +msgid "suggest edit" +msgstr "संपादन सुचवा" diff --git a/_static/locales/ms/LC_MESSAGES/booktheme.po b/_static/locales/ms/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..ade6515a --- /dev/null +++ b/_static/locales/ms/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ms\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Oleh" + +msgid "By" +msgstr "Oleh" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download notebook file" +msgstr "Muat turun fail buku nota" + +msgid "Download source file" +msgstr "Muat turun fail sumber" + +msgid "Download this page" +msgstr "Muat turun halaman ini" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "Last updated on" +msgstr "Terakhir dikemas kini pada" + +msgid "Launch" +msgstr "Lancarkan" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Toggle navigation" +msgstr "Togol navigasi" + +msgid "next page" +msgstr "muka surat seterusnya" + +msgid "open issue" +msgstr "isu terbuka" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "suggest edit" +msgstr "cadangkan edit" diff --git a/_static/locales/nl/LC_MESSAGES/booktheme.po b/_static/locales/nl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..e114611d --- /dev/null +++ b/_static/locales/nl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: nl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Door de" + +msgid "By" +msgstr "Door" + +msgid "Contents" +msgstr "Inhoud" + +msgid "Copyright" +msgstr "auteursrechten" + +msgid "Download notebook file" +msgstr "Download notebookbestand" + +msgid "Download source file" +msgstr "Download het bronbestand" + +msgid "Download this page" +msgstr "Download deze pagina" + +msgid "Edit this page" +msgstr "bewerk deze pagina" + +msgid "Fullscreen mode" +msgstr "Volledig scherm" + +msgid "Last updated on" +msgstr "Laatst geupdate op" + +msgid "Launch" +msgstr "Lancering" + +msgid "Open an issue" +msgstr "Open een probleem" + +msgid "Print to PDF" +msgstr "Afdrukken naar pdf" + +msgid "Source repository" +msgstr "Bronopslagplaats" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-boekthema" + +msgid "Theme by the" +msgstr "Thema door de" + +msgid "Toggle navigation" +msgstr "Schakel navigatie" + +msgid "next page" +msgstr "volgende bladzijde" + +msgid "open issue" +msgstr "open probleem" + +msgid "previous page" +msgstr "vorige pagina" + +msgid "repository" +msgstr "repository" + +msgid "suggest edit" +msgstr "suggereren bewerken" diff --git a/_static/locales/no/LC_MESSAGES/booktheme.po b/_static/locales/no/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..53fa9fc3 --- /dev/null +++ b/_static/locales/no/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: no\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Ved" + +msgid "By" +msgstr "Av" + +msgid "Contents" +msgstr "Innhold" + +msgid "Copyright" +msgstr "opphavsrett" + +msgid "Download notebook file" +msgstr "Last ned notatbokfilen" + +msgid "Download source file" +msgstr "Last ned kildefilen" + +msgid "Download this page" +msgstr "Last ned denne siden" + +msgid "Edit this page" +msgstr "Rediger denne siden" + +msgid "Fullscreen mode" +msgstr "Fullskjerm-modus" + +msgid "Last updated on" +msgstr "Sist oppdatert den" + +msgid "Launch" +msgstr "Start" + +msgid "Open an issue" +msgstr "Åpne et problem" + +msgid "Print to PDF" +msgstr "Skriv ut til PDF" + +msgid "Source repository" +msgstr "Kildedepot" + +msgid "Sphinx Book Theme" +msgstr "Sphinx boktema" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Toggle navigation" +msgstr "Bytt navigasjon" + +msgid "next page" +msgstr "neste side" + +msgid "open issue" +msgstr "åpent nummer" + +msgid "previous page" +msgstr "forrige side" + +msgid "repository" +msgstr "oppbevaringssted" + +msgid "suggest edit" +msgstr "foreslå redigering" diff --git a/_static/locales/pl/LC_MESSAGES/booktheme.po b/_static/locales/pl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..a4822159 --- /dev/null +++ b/_static/locales/pl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Przez" + +msgid "By" +msgstr "Przez" + +msgid "Contents" +msgstr "Zawartość" + +msgid "Copyright" +msgstr "prawa autorskie" + +msgid "Download notebook file" +msgstr "Pobierz plik notatnika" + +msgid "Download source file" +msgstr "Pobierz plik źródłowy" + +msgid "Download this page" +msgstr "Pobierz tę stronę" + +msgid "Edit this page" +msgstr "Edytuj tę strone" + +msgid "Fullscreen mode" +msgstr "Pełny ekran" + +msgid "Last updated on" +msgstr "Ostatnia aktualizacja" + +msgid "Launch" +msgstr "Uruchomić" + +msgid "Open an issue" +msgstr "Otwórz problem" + +msgid "Print to PDF" +msgstr "Drukuj do PDF" + +msgid "Source repository" +msgstr "Repozytorium źródłowe" + +msgid "Sphinx Book Theme" +msgstr "Motyw książki Sphinx" + +msgid "Theme by the" +msgstr "Motyw autorstwa" + +msgid "Toggle navigation" +msgstr "Przełącz nawigację" + +msgid "next page" +msgstr "Następna strona" + +msgid "open issue" +msgstr "otwarty problem" + +msgid "previous page" +msgstr "Poprzednia strona" + +msgid "repository" +msgstr "magazyn" + +msgid "suggest edit" +msgstr "zaproponuj edycję" diff --git a/_static/locales/pt/LC_MESSAGES/booktheme.po b/_static/locales/pt/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..bbc872d0 --- /dev/null +++ b/_static/locales/pt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Pelo" + +msgid "By" +msgstr "De" + +msgid "Contents" +msgstr "Conteúdo" + +msgid "Copyright" +msgstr "direito autoral" + +msgid "Download notebook file" +msgstr "Baixar arquivo de notebook" + +msgid "Download source file" +msgstr "Baixar arquivo fonte" + +msgid "Download this page" +msgstr "Baixe esta página" + +msgid "Edit this page" +msgstr "Edite essa página" + +msgid "Fullscreen mode" +msgstr "Modo tela cheia" + +msgid "Last updated on" +msgstr "Última atualização em" + +msgid "Launch" +msgstr "Lançamento" + +msgid "Open an issue" +msgstr "Abra um problema" + +msgid "Print to PDF" +msgstr "Imprimir em PDF" + +msgid "Source repository" +msgstr "Repositório fonte" + +msgid "Sphinx Book Theme" +msgstr "Tema do livro Sphinx" + +msgid "Theme by the" +msgstr "Tema por" + +msgid "Toggle navigation" +msgstr "Alternar de navegação" + +msgid "next page" +msgstr "próxima página" + +msgid "open issue" +msgstr "questão aberta" + +msgid "previous page" +msgstr "página anterior" + +msgid "repository" +msgstr "repositório" + +msgid "suggest edit" +msgstr "sugerir edição" diff --git a/_static/locales/ro/LC_MESSAGES/booktheme.po b/_static/locales/ro/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..b9b8b4f3 --- /dev/null +++ b/_static/locales/ro/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ro\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Langa" + +msgid "By" +msgstr "De" + +msgid "Contents" +msgstr "Cuprins" + +msgid "Copyright" +msgstr "Drepturi de autor" + +msgid "Download notebook file" +msgstr "Descărcați fișierul notebook" + +msgid "Download source file" +msgstr "Descărcați fișierul sursă" + +msgid "Download this page" +msgstr "Descarcă această pagină" + +msgid "Edit this page" +msgstr "Editați această pagină" + +msgid "Fullscreen mode" +msgstr "Modul ecran întreg" + +msgid "Last updated on" +msgstr "Ultima actualizare la" + +msgid "Launch" +msgstr "Lansa" + +msgid "Open an issue" +msgstr "Deschideți o problemă" + +msgid "Print to PDF" +msgstr "Imprimați în PDF" + +msgid "Source repository" +msgstr "Depozit sursă" + +msgid "Sphinx Book Theme" +msgstr "Tema Sphinx Book" + +msgid "Theme by the" +msgstr "Tema de" + +msgid "Toggle navigation" +msgstr "Comutare navigare" + +msgid "next page" +msgstr "pagina următoare" + +msgid "open issue" +msgstr "problema deschisă" + +msgid "previous page" +msgstr "pagina anterioară" + +msgid "repository" +msgstr "repertoriu" + +msgid "suggest edit" +msgstr "sugerează editare" diff --git a/_static/locales/ru/LC_MESSAGES/booktheme.po b/_static/locales/ru/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..e0f35551 --- /dev/null +++ b/_static/locales/ru/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ru\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Посредством" + +msgid "By" +msgstr "Автор:" + +msgid "Contents" +msgstr "Содержание" + +msgid "Copyright" +msgstr "авторское право" + +msgid "Download notebook file" +msgstr "Скачать файл записной книжки" + +msgid "Download source file" +msgstr "Скачать исходный файл" + +msgid "Download this page" +msgstr "Загрузите эту страницу" + +msgid "Edit this page" +msgstr "Редактировать эту страницу" + +msgid "Fullscreen mode" +msgstr "Полноэкранный режим" + +msgid "Last updated on" +msgstr "Последнее обновление" + +msgid "Launch" +msgstr "Запуск" + +msgid "Open an issue" +msgstr "Открыть вопрос" + +msgid "Print to PDF" +msgstr "Распечатать в PDF" + +msgid "Source repository" +msgstr "Исходный репозиторий" + +msgid "Sphinx Book Theme" +msgstr "Тема книги Сфинкс" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Toggle navigation" +msgstr "Переключить навигацию" + +msgid "next page" +msgstr "Следующая страница" + +msgid "open issue" +msgstr "открытый вопрос" + +msgid "previous page" +msgstr "Предыдущая страница" + +msgid "repository" +msgstr "хранилище" + +msgid "suggest edit" +msgstr "предложить редактировать" diff --git a/_static/locales/sk/LC_MESSAGES/booktheme.po b/_static/locales/sk/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..4b5225a3 --- /dev/null +++ b/_static/locales/sk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Podľa" + +msgid "By" +msgstr "Autor:" + +msgid "Contents" +msgstr "Obsah" + +msgid "Copyright" +msgstr "Autorské práva" + +msgid "Download notebook file" +msgstr "Stiahnite si zošit" + +msgid "Download source file" +msgstr "Stiahnite si zdrojový súbor" + +msgid "Download this page" +msgstr "Stiahnite si túto stránku" + +msgid "Edit this page" +msgstr "Upraviť túto stránku" + +msgid "Fullscreen mode" +msgstr "Režim celej obrazovky" + +msgid "Last updated on" +msgstr "Posledná aktualizácia dňa" + +msgid "Launch" +msgstr "Spustiť" + +msgid "Open an issue" +msgstr "Otvorte problém" + +msgid "Print to PDF" +msgstr "Tlač do PDF" + +msgid "Source repository" +msgstr "Zdrojové úložisko" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Toggle navigation" +msgstr "Prepnúť navigáciu" + +msgid "next page" +msgstr "ďalšia strana" + +msgid "open issue" +msgstr "otvorené vydanie" + +msgid "previous page" +msgstr "predchádzajúca strana" + +msgid "repository" +msgstr "Úložisko" + +msgid "suggest edit" +msgstr "navrhnúť úpravu" diff --git a/_static/locales/sl/LC_MESSAGES/booktheme.po b/_static/locales/sl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..45592e71 --- /dev/null +++ b/_static/locales/sl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Avtor" + +msgid "By" +msgstr "Avtor" + +msgid "Contents" +msgstr "Vsebina" + +msgid "Copyright" +msgstr "avtorske pravice" + +msgid "Download notebook file" +msgstr "Prenesite datoteko zvezka" + +msgid "Download source file" +msgstr "Prenesite izvorno datoteko" + +msgid "Download this page" +msgstr "Prenesite to stran" + +msgid "Edit this page" +msgstr "Uredite to stran" + +msgid "Fullscreen mode" +msgstr "Celozaslonski način" + +msgid "Last updated on" +msgstr "Nazadnje posodobljeno dne" + +msgid "Launch" +msgstr "Kosilo" + +msgid "Open an issue" +msgstr "Odprite številko" + +msgid "Print to PDF" +msgstr "Natisni v PDF" + +msgid "Source repository" +msgstr "Izvorno skladišče" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "Theme by the" +msgstr "Tema avtorja" + +msgid "Toggle navigation" +msgstr "Preklopi navigacijo" + +msgid "next page" +msgstr "Naslednja stran" + +msgid "open issue" +msgstr "odprto vprašanje" + +msgid "previous page" +msgstr "Prejšnja stran" + +msgid "repository" +msgstr "odlagališče" + +msgid "suggest edit" +msgstr "predlagajte urejanje" diff --git a/_static/locales/sr/LC_MESSAGES/booktheme.po b/_static/locales/sr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..4ddf693d --- /dev/null +++ b/_static/locales/sr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Од" + +msgid "By" +msgstr "Од стране" + +msgid "Contents" +msgstr "Садржај" + +msgid "Copyright" +msgstr "Ауторско право" + +msgid "Download notebook file" +msgstr "Преузмите датотеку бележнице" + +msgid "Download source file" +msgstr "Преузми изворну датотеку" + +msgid "Download this page" +msgstr "Преузмите ову страницу" + +msgid "Edit this page" +msgstr "Уредите ову страницу" + +msgid "Fullscreen mode" +msgstr "Режим целог екрана" + +msgid "Last updated on" +msgstr "Последње ажурирање" + +msgid "Launch" +msgstr "Лансирање" + +msgid "Open an issue" +msgstr "Отворите издање" + +msgid "Print to PDF" +msgstr "Испис у ПДФ" + +msgid "Source repository" +msgstr "Изворно спремиште" + +msgid "Sphinx Book Theme" +msgstr "Тема књиге Спхинк" + +msgid "Theme by the" +msgstr "Тхеме би" + +msgid "Toggle navigation" +msgstr "Укључи / искључи навигацију" + +msgid "next page" +msgstr "Следећа страна" + +msgid "open issue" +msgstr "отворено издање" + +msgid "previous page" +msgstr "Претходна страница" + +msgid "repository" +msgstr "спремиште" + +msgid "suggest edit" +msgstr "предложи уређивање" diff --git a/_static/locales/sv/LC_MESSAGES/booktheme.po b/_static/locales/sv/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..a5587a56 --- /dev/null +++ b/_static/locales/sv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Av den" + +msgid "By" +msgstr "Av" + +msgid "Contents" +msgstr "Innehåll" + +msgid "Copyright" +msgstr "Upphovsrätt" + +msgid "Download notebook file" +msgstr "Ladda ner notebook-fil" + +msgid "Download source file" +msgstr "Ladda ner källfil" + +msgid "Download this page" +msgstr "Ladda ner den här sidan" + +msgid "Edit this page" +msgstr "Redigera den här sidan" + +msgid "Fullscreen mode" +msgstr "Fullskärmsläge" + +msgid "Last updated on" +msgstr "Senast uppdaterad den" + +msgid "Launch" +msgstr "Öppna" + +msgid "Open an issue" +msgstr "Öppna en problemrapport" + +msgid "Print to PDF" +msgstr "Skriv ut till PDF" + +msgid "Source repository" +msgstr "Källkodsrepositorium" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Boktema" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Toggle navigation" +msgstr "Växla navigering" + +msgid "next page" +msgstr "nästa sida" + +msgid "open issue" +msgstr "öppna problemrapport" + +msgid "previous page" +msgstr "föregående sida" + +msgid "repository" +msgstr "repositorium" + +msgid "suggest edit" +msgstr "föreslå ändring" diff --git a/_static/locales/ta/LC_MESSAGES/booktheme.po b/_static/locales/ta/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..fb871e23 --- /dev/null +++ b/_static/locales/ta/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ta\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "மூலம்" + +msgid "By" +msgstr "வழங்கியவர்" + +msgid "Copyright" +msgstr "பதிப்புரிமை" + +msgid "Download notebook file" +msgstr "நோட்புக் கோப்பைப் பதிவிறக்கவும்" + +msgid "Download source file" +msgstr "மூல கோப்பைப் பதிவிறக்குக" + +msgid "Download this page" +msgstr "இந்தப் பக்கத்தைப் பதிவிறக்கவும்" + +msgid "Edit this page" +msgstr "இந்தப் பக்கத்தைத் திருத்தவும்" + +msgid "Last updated on" +msgstr "கடைசியாக புதுப்பிக்கப்பட்டது" + +msgid "Launch" +msgstr "தொடங்க" + +msgid "Open an issue" +msgstr "சிக்கலைத் திறக்கவும்" + +msgid "Print to PDF" +msgstr "PDF இல் அச்சிடுக" + +msgid "Source repository" +msgstr "மூல களஞ்சியம்" + +msgid "Sphinx Book Theme" +msgstr "ஸ்பிங்க்ஸ் புத்தக தீம்" + +msgid "Theme by the" +msgstr "வழங்கிய தீம்" + +msgid "Toggle navigation" +msgstr "வழிசெலுத்தலை நிலைமாற்று" + +msgid "next page" +msgstr "அடுத்த பக்கம்" + +msgid "open issue" +msgstr "திறந்த பிரச்சினை" + +msgid "previous page" +msgstr "முந்தைய பக்கம்" + +msgid "suggest edit" +msgstr "திருத்த பரிந்துரைக்கவும்" diff --git a/_static/locales/te/LC_MESSAGES/booktheme.po b/_static/locales/te/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..22ab77c1 --- /dev/null +++ b/_static/locales/te/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: te\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "ద్వారా" + +msgid "By" +msgstr "ద్వారా" + +msgid "Copyright" +msgstr "కాపీరైట్" + +msgid "Download notebook file" +msgstr "నోట్బుక్ ఫైల్ను డౌన్లోడ్ చేయండి" + +msgid "Download source file" +msgstr "మూల ఫైల్‌ను డౌన్‌లోడ్ చేయండి" + +msgid "Download this page" +msgstr "ఈ పేజీని డౌన్‌లోడ్ చేయండి" + +msgid "Edit this page" +msgstr "ఈ పేజీని సవరించండి" + +msgid "Last updated on" +msgstr "చివరిగా నవీకరించబడింది" + +msgid "Launch" +msgstr "ప్రారంభించండి" + +msgid "Open an issue" +msgstr "సమస్యను తెరవండి" + +msgid "Print to PDF" +msgstr "PDF కి ముద్రించండి" + +msgid "Source repository" +msgstr "మూల రిపోజిటరీ" + +msgid "Sphinx Book Theme" +msgstr "సింహిక పుస్తక థీమ్" + +msgid "Theme by the" +msgstr "ద్వారా థీమ్" + +msgid "Toggle navigation" +msgstr "నావిగేషన్‌ను టోగుల్ చేయండి" + +msgid "next page" +msgstr "తరువాతి పేజీ" + +msgid "open issue" +msgstr "ఓపెన్ ఇష్యూ" + +msgid "previous page" +msgstr "ముందు పేజి" + +msgid "suggest edit" +msgstr "సవరించమని సూచించండి" diff --git a/_static/locales/tg/LC_MESSAGES/booktheme.po b/_static/locales/tg/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..e499352d --- /dev/null +++ b/_static/locales/tg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Бо" + +msgid "By" +msgstr "Бо" + +msgid "Contents" +msgstr "Мундариҷа" + +msgid "Copyright" +msgstr "Ҳуқуқи муаллиф" + +msgid "Download notebook file" +msgstr "Файли дафтарро зеркашӣ кунед" + +msgid "Download source file" +msgstr "Файли манбаъро зеркашӣ кунед" + +msgid "Download this page" +msgstr "Ин саҳифаро зеркашӣ кунед" + +msgid "Edit this page" +msgstr "Ин саҳифаро таҳрир кунед" + +msgid "Fullscreen mode" +msgstr "Ҳолати экрани пурра" + +msgid "Last updated on" +msgstr "Last навсозӣ дар" + +msgid "Launch" +msgstr "Оғоз" + +msgid "Open an issue" +msgstr "Масъаларо кушоед" + +msgid "Print to PDF" +msgstr "Чоп ба PDF" + +msgid "Source repository" +msgstr "Анбори манбаъ" + +msgid "Sphinx Book Theme" +msgstr "Сфинкс Мавзӯи китоб" + +msgid "Theme by the" +msgstr "Мавзӯъи аз" + +msgid "Toggle navigation" +msgstr "Гузаришро иваз кунед" + +msgid "next page" +msgstr "саҳифаи оянда" + +msgid "open issue" +msgstr "барориши кушод" + +msgid "previous page" +msgstr "саҳифаи қаблӣ" + +msgid "repository" +msgstr "анбор" + +msgid "suggest edit" +msgstr "пешниҳод вироиш" diff --git a/_static/locales/th/LC_MESSAGES/booktheme.po b/_static/locales/th/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..6f0103ea --- /dev/null +++ b/_static/locales/th/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: th\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "โดย" + +msgid "By" +msgstr "โดย" + +msgid "Contents" +msgstr "สารบัญ" + +msgid "Copyright" +msgstr "ลิขสิทธิ์" + +msgid "Download notebook file" +msgstr "ดาวน์โหลดไฟล์สมุดบันทึก" + +msgid "Download source file" +msgstr "ดาวน์โหลดไฟล์ต้นฉบับ" + +msgid "Download this page" +msgstr "ดาวน์โหลดหน้านี้" + +msgid "Edit this page" +msgstr "แก้ไขหน้านี้" + +msgid "Fullscreen mode" +msgstr "โหมดเต็มหน้าจอ" + +msgid "Last updated on" +msgstr "ปรับปรุงล่าสุดเมื่อ" + +msgid "Launch" +msgstr "เปิด" + +msgid "Open an issue" +msgstr "เปิดปัญหา" + +msgid "Print to PDF" +msgstr "พิมพ์เป็น PDF" + +msgid "Source repository" +msgstr "ที่เก็บซอร์ส" + +msgid "Sphinx Book Theme" +msgstr "ธีมหนังสือสฟิงซ์" + +msgid "Theme by the" +msgstr "ธีมโดย" + +msgid "Toggle navigation" +msgstr "ไม่ต้องสลับช่องทาง" + +msgid "next page" +msgstr "หน้าต่อไป" + +msgid "open issue" +msgstr "เปิดปัญหา" + +msgid "previous page" +msgstr "หน้าที่แล้ว" + +msgid "repository" +msgstr "ที่เก็บ" + +msgid "suggest edit" +msgstr "แนะนำแก้ไข" diff --git a/_static/locales/tl/LC_MESSAGES/booktheme.po b/_static/locales/tl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..dbeb2565 --- /dev/null +++ b/_static/locales/tl/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Sa pamamagitan ng" + +msgid "By" +msgstr "Ni" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "Mag-download ng file ng notebook" + +msgid "Download source file" +msgstr "Mag-download ng file ng pinagmulan" + +msgid "Download this page" +msgstr "I-download ang pahinang ito" + +msgid "Edit this page" +msgstr "I-edit ang pahinang ito" + +msgid "Last updated on" +msgstr "Huling na-update noong" + +msgid "Launch" +msgstr "Ilunsad" + +msgid "Open an issue" +msgstr "Magbukas ng isyu" + +msgid "Print to PDF" +msgstr "I-print sa PDF" + +msgid "Source repository" +msgstr "Pinagmulan ng imbakan" + +msgid "Sphinx Book Theme" +msgstr "Tema ng Sphinx Book" + +msgid "Theme by the" +msgstr "Tema ng" + +msgid "Toggle navigation" +msgstr "I-toggle ang pag-navigate" + +msgid "next page" +msgstr "Susunod na pahina" + +msgid "open issue" +msgstr "bukas na isyu" + +msgid "previous page" +msgstr "Nakaraang pahina" + +msgid "suggest edit" +msgstr "iminumungkahi i-edit" diff --git a/_static/locales/tr/LC_MESSAGES/booktheme.po b/_static/locales/tr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..610c1ab0 --- /dev/null +++ b/_static/locales/tr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Tarafından" + +msgid "By" +msgstr "Tarafından" + +msgid "Contents" +msgstr "İçindekiler" + +msgid "Copyright" +msgstr "Telif hakkı" + +msgid "Download notebook file" +msgstr "Defter dosyasını indirin" + +msgid "Download source file" +msgstr "Kaynak dosyayı indirin" + +msgid "Download this page" +msgstr "Bu sayfayı indirin" + +msgid "Edit this page" +msgstr "Bu sayfayı düzenle" + +msgid "Fullscreen mode" +msgstr "Tam ekran modu" + +msgid "Last updated on" +msgstr "Son güncelleme tarihi" + +msgid "Launch" +msgstr "Başlatmak" + +msgid "Open an issue" +msgstr "Bir sorunu açın" + +msgid "Print to PDF" +msgstr "PDF olarak yazdır" + +msgid "Source repository" +msgstr "Kaynak kod deposu" + +msgid "Sphinx Book Theme" +msgstr "Sfenks Kitap Teması" + +msgid "Theme by the" +msgstr "Tarafından tema" + +msgid "Toggle navigation" +msgstr "Gezinmeyi değiştir" + +msgid "next page" +msgstr "sonraki Sayfa" + +msgid "open issue" +msgstr "Açık konu" + +msgid "previous page" +msgstr "önceki sayfa" + +msgid "repository" +msgstr "depo" + +msgid "suggest edit" +msgstr "düzenleme öner" diff --git a/_static/locales/uk/LC_MESSAGES/booktheme.po b/_static/locales/uk/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..8ae61c48 --- /dev/null +++ b/_static/locales/uk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: uk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "По" + +msgid "By" +msgstr "Автор" + +msgid "Contents" +msgstr "Зміст" + +msgid "Copyright" +msgstr "Авторське право" + +msgid "Download notebook file" +msgstr "Завантажте файл блокнота" + +msgid "Download source file" +msgstr "Завантажити вихідний файл" + +msgid "Download this page" +msgstr "Завантажте цю сторінку" + +msgid "Edit this page" +msgstr "Редагувати цю сторінку" + +msgid "Fullscreen mode" +msgstr "Повноекранний режим" + +msgid "Last updated on" +msgstr "Останнє оновлення:" + +msgid "Launch" +msgstr "Запуск" + +msgid "Open an issue" +msgstr "Відкрийте випуск" + +msgid "Print to PDF" +msgstr "Друк у форматі PDF" + +msgid "Source repository" +msgstr "Джерело сховища" + +msgid "Sphinx Book Theme" +msgstr "Тема книги \"Сфінкс\"" + +msgid "Theme by the" +msgstr "Тема від" + +msgid "Toggle navigation" +msgstr "Переключити навігацію" + +msgid "next page" +msgstr "Наступна сторінка" + +msgid "open issue" +msgstr "відкритий випуск" + +msgid "previous page" +msgstr "Попередня сторінка" + +msgid "repository" +msgstr "сховище" + +msgid "suggest edit" +msgstr "запропонувати редагувати" diff --git a/_static/locales/ur/LC_MESSAGES/booktheme.po b/_static/locales/ur/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..63018eae --- /dev/null +++ b/_static/locales/ur/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ur\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "کی طرف" + +msgid "By" +msgstr "بذریعہ" + +msgid "Copyright" +msgstr "کاپی رائٹ" + +msgid "Download notebook file" +msgstr "نوٹ بک فائل ڈاؤن لوڈ کریں" + +msgid "Download source file" +msgstr "سورس فائل ڈاؤن لوڈ کریں" + +msgid "Download this page" +msgstr "اس صفحے کو ڈاؤن لوڈ کریں" + +msgid "Edit this page" +msgstr "اس صفحے میں ترمیم کریں" + +msgid "Last updated on" +msgstr "آخری بار تازہ کاری ہوئی" + +msgid "Launch" +msgstr "لانچ کریں" + +msgid "Open an issue" +msgstr "ایک مسئلہ کھولیں" + +msgid "Print to PDF" +msgstr "پی ڈی ایف پرنٹ کریں" + +msgid "Source repository" +msgstr "ماخذ ذخیرہ" + +msgid "Sphinx Book Theme" +msgstr "سپنکس بک تھیم" + +msgid "Theme by the" +msgstr "کے ذریعہ تھیم" + +msgid "Toggle navigation" +msgstr "نیویگیشن ٹوگل کریں" + +msgid "next page" +msgstr "اگلا صفحہ" + +msgid "open issue" +msgstr "کھلا مسئلہ" + +msgid "previous page" +msgstr "سابقہ ​​صفحہ" + +msgid "suggest edit" +msgstr "ترمیم کی تجویز کریں" diff --git a/_static/locales/vi/LC_MESSAGES/booktheme.po b/_static/locales/vi/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..ac91b0f1 --- /dev/null +++ b/_static/locales/vi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: vi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Bằng" + +msgid "By" +msgstr "Bởi" + +msgid "Contents" +msgstr "Nội dung" + +msgid "Copyright" +msgstr "Bản quyền" + +msgid "Download notebook file" +msgstr "Tải xuống tệp sổ tay" + +msgid "Download source file" +msgstr "Tải xuống tệp nguồn" + +msgid "Download this page" +msgstr "Tải xuống trang này" + +msgid "Edit this page" +msgstr "chỉnh sửa trang này" + +msgid "Fullscreen mode" +msgstr "Chế độ toàn màn hình" + +msgid "Last updated on" +msgstr "Cập nhật lần cuối vào" + +msgid "Launch" +msgstr "Phóng" + +msgid "Open an issue" +msgstr "Mở một vấn đề" + +msgid "Print to PDF" +msgstr "In sang PDF" + +msgid "Source repository" +msgstr "Kho nguồn" + +msgid "Sphinx Book Theme" +msgstr "Chủ đề sách nhân sư" + +msgid "Theme by the" +msgstr "Chủ đề của" + +msgid "Toggle navigation" +msgstr "Chuyển đổi điều hướng thành" + +msgid "next page" +msgstr "Trang tiếp theo" + +msgid "open issue" +msgstr "vấn đề mở" + +msgid "previous page" +msgstr "trang trước" + +msgid "repository" +msgstr "kho" + +msgid "suggest edit" +msgstr "đề nghị chỉnh sửa" diff --git a/_static/locales/zh_CN/LC_MESSAGES/booktheme.po b/_static/locales/zh_CN/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..ff1c9383 --- /dev/null +++ b/_static/locales/zh_CN/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_CN\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "作者:" + +msgid "By" +msgstr "作者:" + +msgid "Contents" +msgstr "目录" + +msgid "Copyright" +msgstr "版权" + +msgid "Download notebook file" +msgstr "下载笔记本文件" + +msgid "Download source file" +msgstr "下载源文件" + +msgid "Download this page" +msgstr "下载此页面" + +msgid "Edit this page" +msgstr "编辑此页面" + +msgid "Fullscreen mode" +msgstr "全屏模式" + +msgid "Last updated on" +msgstr "上次更新时间:" + +msgid "Launch" +msgstr "启动" + +msgid "Open an issue" +msgstr "创建议题" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Source repository" +msgstr "源码库" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 主题" + +msgid "Theme by the" +msgstr "主题作者:" + +msgid "Toggle navigation" +msgstr "显示或隐藏导航栏" + +msgid "next page" +msgstr "下一页" + +msgid "open issue" +msgstr "创建议题" + +msgid "previous page" +msgstr "上一页" + +msgid "repository" +msgstr "仓库" + +msgid "suggest edit" +msgstr "提出修改建议" diff --git a/_static/locales/zh_TW/LC_MESSAGES/booktheme.po b/_static/locales/zh_TW/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..f2b300fa --- /dev/null +++ b/_static/locales/zh_TW/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_TW\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "作者:" + +msgid "By" +msgstr "作者:" + +msgid "Contents" +msgstr "目錄" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "下載 Notebook 檔案" + +msgid "Download source file" +msgstr "下載原始檔" + +msgid "Download this page" +msgstr "下載此頁面" + +msgid "Edit this page" +msgstr "編輯此頁面" + +msgid "Fullscreen mode" +msgstr "全螢幕模式" + +msgid "Last updated on" +msgstr "最後更新時間:" + +msgid "Launch" +msgstr "啟動" + +msgid "Open an issue" +msgstr "開啟議題" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Source repository" +msgstr "來源儲存庫" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 佈景主題" + +msgid "Theme by the" +msgstr "佈景主題作者:" + +msgid "Toggle navigation" +msgstr "顯示或隱藏導覽列" + +msgid "next page" +msgstr "下一頁" + +msgid "open issue" +msgstr "公開的問題" + +msgid "previous page" +msgstr "上一頁" + +msgid "repository" +msgstr "儲存庫" + +msgid "suggest edit" +msgstr "提出修改建議" diff --git a/_static/margin_patch.css b/_static/margin_patch.css new file mode 100644 index 00000000..ab76352d --- /dev/null +++ b/_static/margin_patch.css @@ -0,0 +1,17 @@ +div.admonition:has(.margin.docutils.container), +div.admonition:has(aside.margin), +div.admonition:has(div.margin), +div.admonition:has(figure.margin), +div.admonition:has(figure.margin-caption) { + overflow: visible; /* allow margin elements to render outside the box */ +} + +@media (min-width: 992px), print { + div.admonition:has(.margin.docutils.container) .margin.docutils.container, + div.admonition:has(aside.margin) aside.margin, + div.admonition:has(div.margin) div.margin, + div.admonition:has(figure.margin) figure.margin, + div.admonition:has(figure.margin-caption) figure.margin-caption figcaption{ + margin-right: calc(-36% - 1em - 1.4rem) !important; + } +} \ No newline at end of file diff --git a/_static/mathjax_patch.css b/_static/mathjax_patch.css new file mode 100644 index 00000000..a7283bd8 --- /dev/null +++ b/_static/mathjax_patch.css @@ -0,0 +1,15 @@ +/* Fix vertical visibility of inline and display math */ +.bd-content mjx-container[jax="CHTML"] { + line-height: 1.2 !important; +} + +/* Fix horizontal visibility of inline math */ +.bd-content span.math { + max-width: none !important; + overflow: visible !important; +} + +/* Fix vertical visibility of display math */ +.bd-content div.math mjx-container { + padding-top: 0.2rem !important; +} \ No newline at end of file diff --git a/_static/mathjax_patch.js b/_static/mathjax_patch.js new file mode 100644 index 00000000..ea36695a --- /dev/null +++ b/_static/mathjax_patch.js @@ -0,0 +1,11 @@ +(function () { + var isFirefox = typeof InstallTrigger !== 'undefined'; + var output = isFirefox ? 'svg' : 'chtml'; + + // Laad MathJax vanaf CDN + var script = document.createElement('script'); + script.src = 'https://cdn.jsdelivr.net/npm/mathjax@3/es5/tex-mml-' + output + '.js'; + script.async = true; + document.head.appendChild(script); + })(); + \ No newline at end of file diff --git a/_static/minus.png b/_static/minus.png new file mode 100644 index 00000000..d96755fd Binary files /dev/null and b/_static/minus.png differ diff --git a/content/_static/myfile.css b/_static/myfile.css similarity index 100% rename from content/_static/myfile.css rename to _static/myfile.css diff --git a/_static/mystnb.11b39860a7a0cbfd473a3ad8a317855267ff0bd372690045ca344a6b62be495e.css b/_static/mystnb.11b39860a7a0cbfd473a3ad8a317855267ff0bd372690045ca344a6b62be495e.css new file mode 100644 index 00000000..9f3d7646 --- /dev/null +++ b/_static/mystnb.11b39860a7a0cbfd473a3ad8a317855267ff0bd372690045ca344a6b62be495e.css @@ -0,0 +1,2449 @@ +/* Dark mode support: + * if (e.g. Furo theme) or (e.g. PyData theme) has `data-theme` set, respect it. + * else default to the system color scheme + */ +@media (prefers-color-scheme: dark) { + :root { + --light: ; + --dark: initial; + } +} + +@media (prefers-color-scheme: light) { + :root { + --dark: ; + --light: initial; + } +} + +:is(html, body)[data-theme="dark"] { + --light: ; + --dark: initial; +} + +:is(html, body)[data-theme="light"] { + --dark: ; + --light: initial; +} + +/* Variables */ +:root { + /* + Following palettes are generated by using https://m2.material.io/design/color/the-color-system.html#tools-for-picking-colors + - neutral palette with #fcfcfc and danger palette with #ffdddd as base colors. + 50 means lightest, 900 means darkest; less used intermediate shades are omitted + but can be added when needed by accessing full palette from the above link. + */ + --mystnb-neutral-palette-50: #fcfcfc; + --mystnb-neutral-palette-100: #f7f7f7; + --mystnb-neutral-palette-400: #cccccc; + --mystnb-neutral-palette-500: #afafaf; + --mystnb-neutral-palette-800: #505050; + --mystnb-neutral-palette-900: #2d2d2d; + + --mystnb-danger-palette-50: #ffdddd; + --mystnb-danger-palette-100: #f5acad; + --mystnb-danger-palette-400: #c42029; + --mystnb-danger-palette-500: #b40008; + --mystnb-danger-palette-800: #850010; + --mystnb-danger-palette-900: #680010; + + /* MyST-NB specific variables; colors should be logically picked from palettes */ + --mystnb-source-bg-color: var(--light, var(--mystnb-neutral-palette-100)) var(--dark, var(--mystnb-neutral-palette-800)); + --mystnb-stdout-bg-color: var(--light, var(--mystnb-neutral-palette-50)) var(--dark, var(--mystnb-neutral-palette-900)); + --mystnb-stderr-bg-color: var(--light, var(--mystnb-danger-palette-50)) var(--dark, var(--mystnb-danger-palette-900)); + --mystnb-traceback-bg-color: var(--light, var(--mystnb-neutral-palette-50)) var(--dark, var(--mystnb-neutral-palette-900)); + --mystnb-source-border-color: var(--light, var(--mystnb-neutral-palette-400)) var(--dark, var(--mystnb-neutral-palette-500)); + --mystnb-source-margin-color: green; + --mystnb-stdout-border-color: var(--light, var(--mystnb-neutral-palette-100)) var(--dark, var(--mystnb-neutral-palette-800)); + --mystnb-stderr-border-color: var(--light, var(--mystnb-neutral-palette-100)) var(--dark, var(--mystnb-neutral-palette-800)); + --mystnb-traceback-border-color: var(--light, var(--mystnb-danger-palette-100)) var(--dark, var(--mystnb-danger-palette-800)); + --mystnb-hide-prompt-opacity: 70%; + --mystnb-source-border-radius: .4em; + --mystnb-source-border-width: 1px; + --mystnb-scrollbar-width: 0.3rem; + --mystnb-scrollbar-height: 0.3rem; + --mystnb-scrollbar-thumb-color: var(--light, var(--mystnb-neutral-palette-400)) var(--dark, var(--mystnb-neutral-palette-500)); + --mystnb-scrollbar-thumb-hover-color: var(--light, var(--mystnb-neutral-palette-500)) var(--dark, var(--mystnb-neutral-palette-400)); + --mystnb-scrollbar-thumb-border-radius: 0.25rem; +} + + +/* Whole cell */ +div.container.cell { + padding-left: 0; + margin-bottom: 1em; +} + +/* Removing all background formatting so we can control at the div level */ +.cell_input div.highlight, +.cell_output pre, +.cell_input pre, +.cell_output .output { + border: none; + box-shadow: none; +} + +.cell_output .output pre, +.cell_input pre { + margin: 0px; +} + +/* Input cells */ +div.cell > div.cell_input { + padding-left: 0em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + background-color: var(--mystnb-source-bg-color); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; + border-radius: var(--mystnb-source-border-radius); +} + +div.cell_input>div, +div.cell_output div.output>div.highlight { + margin: 0em !important; + border: none !important; +} + +/* All cell outputs */ +.cell_output { + padding-left: 1em; + padding-right: 0em; + margin-top: 1em; +} + +/* Text outputs from cells */ +.cell_output .output.text_plain, +.cell_output .output.traceback, +.cell_output .output.stream, +.cell_output .output.stderr { + margin-top: 1em; + margin-bottom: 0em; + box-shadow: none; +} + +.cell_output .output.text_plain:not(:has(.highlight)), +.cell_output .output.stream:not(:has(.highlight)) { + /* plain (or stream of) output, not containing a pygments-highlighted block */ + background: var(--mystnb-stdout-bg-color); + border: 1px solid var(--mystnb-stdout-border-color); +} + +.cell_output .output.stderr { + background: var(--mystnb-stderr-bg-color); + border: 1px solid var(--mystnb-stderr-border-color); +} + +.cell_output .output.traceback { + background: var(--mystnb-traceback-bg-color); + border: 1px solid var(--mystnb-traceback-border-color); +} + +/* --- Collapsible cell content --- */ + +/* +encourage summary container to blend in with its parent. +p.admonition-title should hold the title styles. +*/ +div.cell details.hide summary { + border-left: unset; + padding: inherit; + margin: inherit; + background-color: inherit; +} + +/* Neighboring input/output elements - spacing, borders */ +div.cell details.hide.above-input + details.below-input, +div.cell div.cell_input + details.below-input +{ + margin-top: 0; +} + +div.cell details.hide.above-input:has(+ details.below-input), +div.cell div.cell_input:has(+ details.below-input) +{ + margin-bottom: 0; +} + +div.cell:has(> *:nth-child(2)) div.cell_input:first-child, +div.cell:has(> *:nth-child(2)) details:first-child +{ + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +div.cell:has(> *:nth-child(2)) div.cell_input:last-child, +div.cell:has(> *:nth-child(2)) details:last-child +{ + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +/* intra-label styles for collapsibles */ +div.cell.container details.hide.above-input>summary, +div.cell.container details.hide.below-input>summary, +div.cell.container details.hide.above-output>summary +{ + display: block; + border-left: none; +} + +div.cell details.hide>summary>p.admonition-title { + display: list-item; + margin-bottom: 0; +} + +div.cell details.hide:not([open]) { + padding-bottom: 0; +} + +div.cell details.hide[open]>summary>p.collapsed { + display: none; +} + +div.cell details.hide:not([open])>summary>p.expanded { + display: none; +} + +@keyframes collapsed-fade-in { + 0% { + opacity: 0; + } + + 100% { + opacity: 1; + } +} +div.cell details.hide[open]>summary~* { + -moz-animation: collapsed-fade-in 0.3s ease-in-out; + -webkit-animation: collapsed-fade-in 0.3s ease-in-out; + animation: collapsed-fade-in 0.3s ease-in-out; +} + +/* Clear conflicting styles for details and admonitions set by some themes */ +div.cell details.admonition summary::before { + content: unset; +} + +/* Math align to the left */ +.cell_output .MathJax_Display { + text-align: left !important; +} + +/** source code line numbers **/ +span.linenos { + opacity: 0.5; +} + +/* Inline text from `paste` operation */ + +span.pasted-text { + font-weight: bold; +} + +span.pasted-inline img { + max-height: 2em; +} + +tbody span.pasted-inline img { + max-height: none; +} + + +/* Adding scroll bars if tags: output_scroll, scroll-output, and scroll-input + * On screens, we want to scroll, but on print show all + * + * It was before in https://github.com/executablebooks/sphinx-book-theme/blob/eb1b6baf098b27605e8f2b7b2979b17ebf1b9540/src/sphinx_book_theme/assets/styles/extensions/_myst-nb.scss +*/ +div.cell:is( + .tag_output_scroll, + .tag_scroll-output, + .config_scroll_outputs + ) + div.cell_output, +div.cell.tag_scroll-input div.cell_input { + max-height: 24em; + overflow-y: auto; + max-width: 100%; + overflow-x: auto; +} + +div.cell.config_scroll_outputs div.cell_output:has(img) { + /* If the output cell has image(s), allow it to take 90% of viewport height + but still bounded between 24em and 60em */ + max-height: clamp(24em, 90vh, 60em); +} + +/* Custom scrollbars */ +div.cell:is( + .tag_output_scroll, + .tag_scroll-output, + .config_scroll_outputs + ) + div.cell_output::-webkit-scrollbar, +div.cell.tag_scroll-input div.cell_input::-webkit-scrollbar { + width: var(--mystnb-scrollbar-width); + height: var(--mystnb-scrollbar-height); +} + +div.cell:is( + .tag_output_scroll, + .tag_scroll-output, + .config_scroll_outputs + ) + div.cell_output::-webkit-scrollbar-thumb, +div.cell.tag_scroll-input div.cell_input::-webkit-scrollbar-thumb { + background: var(--mystnb-scrollbar-thumb-color); + border-radius: var(--mystnb-scrollbar-thumb-border-radius); +} + +div.cell:is( + .tag_output_scroll, + .tag_scroll-output, + .config_scroll_outputs + ) + div.cell_output::-webkit-scrollbar-thumb:hover, +div.cell.tag_scroll-input div.cell_input::-webkit-scrollbar-thumb:hover { + background: var(--mystnb-scrollbar-thumb-hover-color); +} + +/* In print mode, unset scroll styles */ +@media print { + div.cell:is( + .tag_output_scroll, + .tag_scroll-output, + .config_scroll_outputs + ) + div.cell_output, + div.cell.tag_scroll-input div.cell_input { + max-height: unset; + overflow-y: visible; + max-width: unset; + overflow-x: visible; + } +} + +/* Font colors for translated ANSI escape sequences +Color values are copied from Jupyter Notebook +https://github.com/jupyter/notebook/blob/52581f8eda9b319eb0390ac77fe5903c38f81e3e/notebook/static/notebook/less/ansicolors.less#L14-L21 +Background colors from +https://nbsphinx.readthedocs.io/en/latest/code-cells.html#ANSI-Colors +*/ +div.highlight .-Color-Bold { + font-weight: bold; +} + +div.highlight .-Color[class*=-Black] { + color: #3E424D +} + +div.highlight .-Color[class*=-Red] { + color: #E75C58 +} + +div.highlight .-Color[class*=-Green] { + color: #00A250 +} + +div.highlight .-Color[class*=-Yellow] { + color: #DDB62B +} + +div.highlight .-Color[class*=-Blue] { + color: #208FFB +} + +div.highlight .-Color[class*=-Magenta] { + color: #D160C4 +} + +div.highlight .-Color[class*=-Cyan] { + color: #60C6C8 +} + +div.highlight .-Color[class*=-White] { + color: #C5C1B4 +} + +div.highlight .-Color[class*=-BGBlack] { + background-color: #3E424D +} + +div.highlight .-Color[class*=-BGRed] { + background-color: #E75C58 +} + +div.highlight .-Color[class*=-BGGreen] { + background-color: #00A250 +} + +div.highlight .-Color[class*=-BGYellow] { + background-color: #DDB62B +} + +div.highlight .-Color[class*=-BGBlue] { + background-color: #208FFB +} + +div.highlight .-Color[class*=-BGMagenta] { + background-color: #D160C4 +} + +div.highlight .-Color[class*=-BGCyan] { + background-color: #60C6C8 +} + +div.highlight .-Color[class*=-BGWhite] { + background-color: #C5C1B4 +} + +/* Font colors for 8-bit ANSI */ + +div.highlight .-Color[class*=-C0] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC0] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C1] { + color: #800000 +} + +div.highlight .-Color[class*=-BGC1] { + background-color: #800000 +} + +div.highlight .-Color[class*=-C2] { + color: #008000 +} + +div.highlight .-Color[class*=-BGC2] { + background-color: #008000 +} + +div.highlight .-Color[class*=-C3] { + color: #808000 +} + +div.highlight .-Color[class*=-BGC3] { + background-color: #808000 +} + +div.highlight .-Color[class*=-C4] { + color: #000080 +} + +div.highlight .-Color[class*=-BGC4] { + background-color: #000080 +} + +div.highlight .-Color[class*=-C5] { + color: #800080 +} + +div.highlight .-Color[class*=-BGC5] { + background-color: #800080 +} + +div.highlight .-Color[class*=-C6] { + color: #008080 +} + +div.highlight .-Color[class*=-BGC6] { + background-color: #008080 +} + +div.highlight .-Color[class*=-C7] { + color: #C0C0C0 +} + +div.highlight .-Color[class*=-BGC7] { + background-color: #C0C0C0 +} + +div.highlight .-Color[class*=-C8] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC8] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C9] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC9] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C10] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC10] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C11] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC11] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C12] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC12] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C13] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC13] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C14] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC14] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C15] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC15] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C16] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC16] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C17] { + color: #00005F +} + +div.highlight .-Color[class*=-BGC17] { + background-color: #00005F +} + +div.highlight .-Color[class*=-C18] { + color: #000087 +} + +div.highlight .-Color[class*=-BGC18] { + background-color: #000087 +} + +div.highlight .-Color[class*=-C19] { + color: #0000AF +} + +div.highlight .-Color[class*=-BGC19] { + background-color: #0000AF +} + +div.highlight .-Color[class*=-C20] { + color: #0000D7 +} + +div.highlight .-Color[class*=-BGC20] { + background-color: #0000D7 +} + +div.highlight .-Color[class*=-C21] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC21] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C22] { + color: #005F00 +} + +div.highlight .-Color[class*=-BGC22] { + background-color: #005F00 +} + +div.highlight .-Color[class*=-C23] { + color: #005F5F +} + +div.highlight .-Color[class*=-BGC23] { + background-color: #005F5F +} + +div.highlight .-Color[class*=-C24] { + color: #005F87 +} + +div.highlight .-Color[class*=-BGC24] { + background-color: #005F87 +} + +div.highlight .-Color[class*=-C25] { + color: #005FAF +} + +div.highlight .-Color[class*=-BGC25] { + background-color: #005FAF +} + +div.highlight .-Color[class*=-C26] { + color: #005FD7 +} + +div.highlight .-Color[class*=-BGC26] { + background-color: #005FD7 +} + +div.highlight .-Color[class*=-C27] { + color: #005FFF +} + +div.highlight .-Color[class*=-BGC27] { + background-color: #005FFF +} + +div.highlight .-Color[class*=-C28] { + color: #008700 +} + +div.highlight .-Color[class*=-BGC28] { + background-color: #008700 +} + +div.highlight .-Color[class*=-C29] { + color: #00875F +} + +div.highlight .-Color[class*=-BGC29] { + background-color: #00875F +} + +div.highlight .-Color[class*=-C30] { + color: #008787 +} + +div.highlight .-Color[class*=-BGC30] { + background-color: #008787 +} + +div.highlight .-Color[class*=-C31] { + color: #0087AF +} + +div.highlight .-Color[class*=-BGC31] { + background-color: #0087AF +} + +div.highlight .-Color[class*=-C32] { + color: #0087D7 +} + +div.highlight .-Color[class*=-BGC32] { + background-color: #0087D7 +} + +div.highlight .-Color[class*=-C33] { + color: #0087FF +} + +div.highlight .-Color[class*=-BGC33] { + background-color: #0087FF +} + +div.highlight .-Color[class*=-C34] { + color: #00AF00 +} + +div.highlight .-Color[class*=-BGC34] { + background-color: #00AF00 +} + +div.highlight .-Color[class*=-C35] { + color: #00AF5F +} + +div.highlight .-Color[class*=-BGC35] { + background-color: #00AF5F +} + +div.highlight .-Color[class*=-C36] { + color: #00AF87 +} + +div.highlight .-Color[class*=-BGC36] { + background-color: #00AF87 +} + +div.highlight .-Color[class*=-C37] { + color: #00AFAF +} + +div.highlight .-Color[class*=-BGC37] { + background-color: #00AFAF +} + +div.highlight .-Color[class*=-C38] { + color: #00AFD7 +} + +div.highlight .-Color[class*=-BGC38] { + background-color: #00AFD7 +} + +div.highlight .-Color[class*=-C39] { + color: #00AFFF +} + +div.highlight .-Color[class*=-BGC39] { + background-color: #00AFFF +} + +div.highlight .-Color[class*=-C40] { + color: #00D700 +} + +div.highlight .-Color[class*=-BGC40] { + background-color: #00D700 +} + +div.highlight .-Color[class*=-C41] { + color: #00D75F +} + +div.highlight .-Color[class*=-BGC41] { + background-color: #00D75F +} + +div.highlight .-Color[class*=-C42] { + color: #00D787 +} + +div.highlight .-Color[class*=-BGC42] { + background-color: #00D787 +} + +div.highlight .-Color[class*=-C43] { + color: #00D7AF +} + +div.highlight .-Color[class*=-BGC43] { + background-color: #00D7AF +} + +div.highlight .-Color[class*=-C44] { + color: #00D7D7 +} + +div.highlight .-Color[class*=-BGC44] { + background-color: #00D7D7 +} + +div.highlight .-Color[class*=-C45] { + color: #00D7FF +} + +div.highlight .-Color[class*=-BGC45] { + background-color: #00D7FF +} + +div.highlight .-Color[class*=-C46] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC46] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C47] { + color: #00FF5F +} + +div.highlight .-Color[class*=-BGC47] { + background-color: #00FF5F +} + +div.highlight .-Color[class*=-C48] { + color: #00FF87 +} + +div.highlight .-Color[class*=-BGC48] { + background-color: #00FF87 +} + +div.highlight .-Color[class*=-C49] { + color: #00FFAF +} + +div.highlight .-Color[class*=-BGC49] { + background-color: #00FFAF +} + +div.highlight .-Color[class*=-C50] { + color: #00FFD7 +} + +div.highlight .-Color[class*=-BGC50] { + background-color: #00FFD7 +} + +div.highlight .-Color[class*=-C51] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC51] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C52] { + color: #5F0000 +} + +div.highlight .-Color[class*=-BGC52] { + background-color: #5F0000 +} + +div.highlight .-Color[class*=-C53] { + color: #5F005F +} + +div.highlight .-Color[class*=-BGC53] { + background-color: #5F005F +} + +div.highlight .-Color[class*=-C54] { + color: #5F0087 +} + +div.highlight .-Color[class*=-BGC54] { + background-color: #5F0087 +} + +div.highlight .-Color[class*=-C55] { + color: #5F00AF +} + +div.highlight .-Color[class*=-BGC55] { + background-color: #5F00AF +} + +div.highlight .-Color[class*=-C56] { + color: #5F00D7 +} + +div.highlight .-Color[class*=-BGC56] { + background-color: #5F00D7 +} + +div.highlight .-Color[class*=-C57] { + color: #5F00FF +} + +div.highlight .-Color[class*=-BGC57] { + background-color: #5F00FF +} + +div.highlight .-Color[class*=-C58] { + color: #5F5F00 +} + +div.highlight .-Color[class*=-BGC58] { + background-color: #5F5F00 +} + +div.highlight .-Color[class*=-C59] { + color: #5F5F5F +} + +div.highlight .-Color[class*=-BGC59] { + background-color: #5F5F5F +} + +div.highlight .-Color[class*=-C60] { + color: #5F5F87 +} + +div.highlight .-Color[class*=-BGC60] { + background-color: #5F5F87 +} + +div.highlight .-Color[class*=-C61] { + color: #5F5FAF +} + +div.highlight .-Color[class*=-BGC61] { + background-color: #5F5FAF +} + +div.highlight .-Color[class*=-C62] { + color: #5F5FD7 +} + +div.highlight .-Color[class*=-BGC62] { + background-color: #5F5FD7 +} + +div.highlight .-Color[class*=-C63] { + color: #5F5FFF +} + +div.highlight .-Color[class*=-BGC63] { + background-color: #5F5FFF +} + +div.highlight .-Color[class*=-C64] { + color: #5F8700 +} + +div.highlight .-Color[class*=-BGC64] { + background-color: #5F8700 +} + +div.highlight .-Color[class*=-C65] { + color: #5F875F +} + +div.highlight .-Color[class*=-BGC65] { + background-color: #5F875F +} + +div.highlight .-Color[class*=-C66] { + color: #5F8787 +} + +div.highlight .-Color[class*=-BGC66] { + background-color: #5F8787 +} + +div.highlight .-Color[class*=-C67] { + color: #5F87AF +} + +div.highlight .-Color[class*=-BGC67] { + background-color: #5F87AF +} + +div.highlight .-Color[class*=-C68] { + color: #5F87D7 +} + +div.highlight .-Color[class*=-BGC68] { + background-color: #5F87D7 +} + +div.highlight .-Color[class*=-C69] { + color: #5F87FF +} + +div.highlight .-Color[class*=-BGC69] { + background-color: #5F87FF +} + +div.highlight .-Color[class*=-C70] { + color: #5FAF00 +} + +div.highlight .-Color[class*=-BGC70] { + background-color: #5FAF00 +} + +div.highlight .-Color[class*=-C71] { + color: #5FAF5F +} + +div.highlight .-Color[class*=-BGC71] { + background-color: #5FAF5F +} + +div.highlight .-Color[class*=-C72] { + color: #5FAF87 +} + +div.highlight .-Color[class*=-BGC72] { + background-color: #5FAF87 +} + +div.highlight .-Color[class*=-C73] { + color: #5FAFAF +} + +div.highlight .-Color[class*=-BGC73] { + background-color: #5FAFAF +} + +div.highlight .-Color[class*=-C74] { + color: #5FAFD7 +} + +div.highlight .-Color[class*=-BGC74] { + background-color: #5FAFD7 +} + +div.highlight .-Color[class*=-C75] { + color: #5FAFFF +} + +div.highlight .-Color[class*=-BGC75] { + background-color: #5FAFFF +} + +div.highlight .-Color[class*=-C76] { + color: #5FD700 +} + +div.highlight .-Color[class*=-BGC76] { + background-color: #5FD700 +} + +div.highlight .-Color[class*=-C77] { + color: #5FD75F +} + +div.highlight .-Color[class*=-BGC77] { + background-color: #5FD75F +} + +div.highlight .-Color[class*=-C78] { + color: #5FD787 +} + +div.highlight .-Color[class*=-BGC78] { + background-color: #5FD787 +} + +div.highlight .-Color[class*=-C79] { + color: #5FD7AF +} + +div.highlight .-Color[class*=-BGC79] { + background-color: #5FD7AF +} + +div.highlight .-Color[class*=-C80] { + color: #5FD7D7 +} + +div.highlight .-Color[class*=-BGC80] { + background-color: #5FD7D7 +} + +div.highlight .-Color[class*=-C81] { + color: #5FD7FF +} + +div.highlight .-Color[class*=-BGC81] { + background-color: #5FD7FF +} + +div.highlight .-Color[class*=-C82] { + color: #5FFF00 +} + +div.highlight .-Color[class*=-BGC82] { + background-color: #5FFF00 +} + +div.highlight .-Color[class*=-C83] { + color: #5FFF5F +} + +div.highlight .-Color[class*=-BGC83] { + background-color: #5FFF5F +} + +div.highlight .-Color[class*=-C84] { + color: #5FFF87 +} + +div.highlight .-Color[class*=-BGC84] { + background-color: #5FFF87 +} + +div.highlight .-Color[class*=-C85] { + color: #5FFFAF +} + +div.highlight .-Color[class*=-BGC85] { + background-color: #5FFFAF +} + +div.highlight .-Color[class*=-C86] { + color: #5FFFD7 +} + +div.highlight .-Color[class*=-BGC86] { + background-color: #5FFFD7 +} + +div.highlight .-Color[class*=-C87] { + color: #5FFFFF +} + +div.highlight .-Color[class*=-BGC87] { + background-color: #5FFFFF +} + +div.highlight .-Color[class*=-C88] { + color: #870000 +} + +div.highlight .-Color[class*=-BGC88] { + background-color: #870000 +} + +div.highlight .-Color[class*=-C89] { + color: #87005F +} + +div.highlight .-Color[class*=-BGC89] { + background-color: #87005F +} + +div.highlight .-Color[class*=-C90] { + color: #870087 +} + +div.highlight .-Color[class*=-BGC90] { + background-color: #870087 +} + +div.highlight .-Color[class*=-C91] { + color: #8700AF +} + +div.highlight .-Color[class*=-BGC91] { + background-color: #8700AF +} + +div.highlight .-Color[class*=-C92] { + color: #8700D7 +} + +div.highlight .-Color[class*=-BGC92] { + background-color: #8700D7 +} + +div.highlight .-Color[class*=-C93] { + color: #8700FF +} + +div.highlight .-Color[class*=-BGC93] { + background-color: #8700FF +} + +div.highlight .-Color[class*=-C94] { + color: #875F00 +} + +div.highlight .-Color[class*=-BGC94] { + background-color: #875F00 +} + +div.highlight .-Color[class*=-C95] { + color: #875F5F +} + +div.highlight .-Color[class*=-BGC95] { + background-color: #875F5F +} + +div.highlight .-Color[class*=-C96] { + color: #875F87 +} + +div.highlight .-Color[class*=-BGC96] { + background-color: #875F87 +} + +div.highlight .-Color[class*=-C97] { + color: #875FAF +} + +div.highlight .-Color[class*=-BGC97] { + background-color: #875FAF +} + +div.highlight .-Color[class*=-C98] { + color: #875FD7 +} + +div.highlight .-Color[class*=-BGC98] { + background-color: #875FD7 +} + +div.highlight .-Color[class*=-C99] { + color: #875FFF +} + +div.highlight .-Color[class*=-BGC99] { + background-color: #875FFF +} + +div.highlight .-Color[class*=-C100] { + color: #878700 +} + +div.highlight .-Color[class*=-BGC100] { + background-color: #878700 +} + +div.highlight .-Color[class*=-C101] { + color: #87875F +} + +div.highlight .-Color[class*=-BGC101] { + background-color: #87875F +} + +div.highlight .-Color[class*=-C102] { + color: #878787 +} + +div.highlight .-Color[class*=-BGC102] { + background-color: #878787 +} + +div.highlight .-Color[class*=-C103] { + color: #8787AF +} + +div.highlight .-Color[class*=-BGC103] { + background-color: #8787AF +} + +div.highlight .-Color[class*=-C104] { + color: #8787D7 +} + +div.highlight .-Color[class*=-BGC104] { + background-color: #8787D7 +} + +div.highlight .-Color[class*=-C105] { + color: #8787FF +} + +div.highlight .-Color[class*=-BGC105] { + background-color: #8787FF +} + +div.highlight .-Color[class*=-C106] { + color: #87AF00 +} + +div.highlight .-Color[class*=-BGC106] { + background-color: #87AF00 +} + +div.highlight .-Color[class*=-C107] { + color: #87AF5F +} + +div.highlight .-Color[class*=-BGC107] { + background-color: #87AF5F +} + +div.highlight .-Color[class*=-C108] { + color: #87AF87 +} + +div.highlight .-Color[class*=-BGC108] { + background-color: #87AF87 +} + +div.highlight .-Color[class*=-C109] { + color: #87AFAF +} + +div.highlight .-Color[class*=-BGC109] { + background-color: #87AFAF +} + +div.highlight .-Color[class*=-C110] { + color: #87AFD7 +} + +div.highlight .-Color[class*=-BGC110] { + background-color: #87AFD7 +} + +div.highlight .-Color[class*=-C111] { + color: #87AFFF +} + +div.highlight .-Color[class*=-BGC111] { + background-color: #87AFFF +} + +div.highlight .-Color[class*=-C112] { + color: #87D700 +} + +div.highlight .-Color[class*=-BGC112] { + background-color: #87D700 +} + +div.highlight .-Color[class*=-C113] { + color: #87D75F +} + +div.highlight .-Color[class*=-BGC113] { + background-color: #87D75F +} + +div.highlight .-Color[class*=-C114] { + color: #87D787 +} + +div.highlight .-Color[class*=-BGC114] { + background-color: #87D787 +} + +div.highlight .-Color[class*=-C115] { + color: #87D7AF +} + +div.highlight .-Color[class*=-BGC115] { + background-color: #87D7AF +} + +div.highlight .-Color[class*=-C116] { + color: #87D7D7 +} + +div.highlight .-Color[class*=-BGC116] { + background-color: #87D7D7 +} + +div.highlight .-Color[class*=-C117] { + color: #87D7FF +} + +div.highlight .-Color[class*=-BGC117] { + background-color: #87D7FF +} + +div.highlight .-Color[class*=-C118] { + color: #87FF00 +} + +div.highlight .-Color[class*=-BGC118] { + background-color: #87FF00 +} + +div.highlight .-Color[class*=-C119] { + color: #87FF5F +} + +div.highlight .-Color[class*=-BGC119] { + background-color: #87FF5F +} + +div.highlight .-Color[class*=-C120] { + color: #87FF87 +} + +div.highlight .-Color[class*=-BGC120] { + background-color: #87FF87 +} + +div.highlight .-Color[class*=-C121] { + color: #87FFAF +} + +div.highlight .-Color[class*=-BGC121] { + background-color: #87FFAF +} + +div.highlight .-Color[class*=-C122] { + color: #87FFD7 +} + +div.highlight .-Color[class*=-BGC122] { + background-color: #87FFD7 +} + +div.highlight .-Color[class*=-C123] { + color: #87FFFF +} + +div.highlight .-Color[class*=-BGC123] { + background-color: #87FFFF +} + +div.highlight .-Color[class*=-C124] { + color: #AF0000 +} + +div.highlight .-Color[class*=-BGC124] { + background-color: #AF0000 +} + +div.highlight .-Color[class*=-C125] { + color: #AF005F +} + +div.highlight .-Color[class*=-BGC125] { + background-color: #AF005F +} + +div.highlight .-Color[class*=-C126] { + color: #AF0087 +} + +div.highlight .-Color[class*=-BGC126] { + background-color: #AF0087 +} + +div.highlight .-Color[class*=-C127] { + color: #AF00AF +} + +div.highlight .-Color[class*=-BGC127] { + background-color: #AF00AF +} + +div.highlight .-Color[class*=-C128] { + color: #AF00D7 +} + +div.highlight .-Color[class*=-BGC128] { + background-color: #AF00D7 +} + +div.highlight .-Color[class*=-C129] { + color: #AF00FF +} + +div.highlight .-Color[class*=-BGC129] { + background-color: #AF00FF +} + +div.highlight .-Color[class*=-C130] { + color: #AF5F00 +} + +div.highlight .-Color[class*=-BGC130] { + background-color: #AF5F00 +} + +div.highlight .-Color[class*=-C131] { + color: #AF5F5F +} + +div.highlight .-Color[class*=-BGC131] { + background-color: #AF5F5F +} + +div.highlight .-Color[class*=-C132] { + color: #AF5F87 +} + +div.highlight .-Color[class*=-BGC132] { + background-color: #AF5F87 +} + +div.highlight .-Color[class*=-C133] { + color: #AF5FAF +} + +div.highlight .-Color[class*=-BGC133] { + background-color: #AF5FAF +} + +div.highlight .-Color[class*=-C134] { + color: #AF5FD7 +} + +div.highlight .-Color[class*=-BGC134] { + background-color: #AF5FD7 +} + +div.highlight .-Color[class*=-C135] { + color: #AF5FFF +} + +div.highlight .-Color[class*=-BGC135] { + background-color: #AF5FFF +} + +div.highlight .-Color[class*=-C136] { + color: #AF8700 +} + +div.highlight .-Color[class*=-BGC136] { + background-color: #AF8700 +} + +div.highlight .-Color[class*=-C137] { + color: #AF875F +} + +div.highlight .-Color[class*=-BGC137] { + background-color: #AF875F +} + +div.highlight .-Color[class*=-C138] { + color: #AF8787 +} + +div.highlight .-Color[class*=-BGC138] { + background-color: #AF8787 +} + +div.highlight .-Color[class*=-C139] { + color: #AF87AF +} + +div.highlight .-Color[class*=-BGC139] { + background-color: #AF87AF +} + +div.highlight .-Color[class*=-C140] { + color: #AF87D7 +} + +div.highlight .-Color[class*=-BGC140] { + background-color: #AF87D7 +} + +div.highlight .-Color[class*=-C141] { + color: #AF87FF +} + +div.highlight .-Color[class*=-BGC141] { + background-color: #AF87FF +} + +div.highlight .-Color[class*=-C142] { + color: #AFAF00 +} + +div.highlight .-Color[class*=-BGC142] { + background-color: #AFAF00 +} + +div.highlight .-Color[class*=-C143] { + color: #AFAF5F +} + +div.highlight .-Color[class*=-BGC143] { + background-color: #AFAF5F +} + +div.highlight .-Color[class*=-C144] { + color: #AFAF87 +} + +div.highlight .-Color[class*=-BGC144] { + background-color: #AFAF87 +} + +div.highlight .-Color[class*=-C145] { + color: #AFAFAF +} + +div.highlight .-Color[class*=-BGC145] { + background-color: #AFAFAF +} + +div.highlight .-Color[class*=-C146] { + color: #AFAFD7 +} + +div.highlight .-Color[class*=-BGC146] { + background-color: #AFAFD7 +} + +div.highlight .-Color[class*=-C147] { + color: #AFAFFF +} + +div.highlight .-Color[class*=-BGC147] { + background-color: #AFAFFF +} + +div.highlight .-Color[class*=-C148] { + color: #AFD700 +} + +div.highlight .-Color[class*=-BGC148] { + background-color: #AFD700 +} + +div.highlight .-Color[class*=-C149] { + color: #AFD75F +} + +div.highlight .-Color[class*=-BGC149] { + background-color: #AFD75F +} + +div.highlight .-Color[class*=-C150] { + color: #AFD787 +} + +div.highlight .-Color[class*=-BGC150] { + background-color: #AFD787 +} + +div.highlight .-Color[class*=-C151] { + color: #AFD7AF +} + +div.highlight .-Color[class*=-BGC151] { + background-color: #AFD7AF +} + +div.highlight .-Color[class*=-C152] { + color: #AFD7D7 +} + +div.highlight .-Color[class*=-BGC152] { + background-color: #AFD7D7 +} + +div.highlight .-Color[class*=-C153] { + color: #AFD7FF +} + +div.highlight .-Color[class*=-BGC153] { + background-color: #AFD7FF +} + +div.highlight .-Color[class*=-C154] { + color: #AFFF00 +} + +div.highlight .-Color[class*=-BGC154] { + background-color: #AFFF00 +} + +div.highlight .-Color[class*=-C155] { + color: #AFFF5F +} + +div.highlight .-Color[class*=-BGC155] { + background-color: #AFFF5F +} + +div.highlight .-Color[class*=-C156] { + color: #AFFF87 +} + +div.highlight .-Color[class*=-BGC156] { + background-color: #AFFF87 +} + +div.highlight .-Color[class*=-C157] { + color: #AFFFAF +} + +div.highlight .-Color[class*=-BGC157] { + background-color: #AFFFAF +} + +div.highlight .-Color[class*=-C158] { + color: #AFFFD7 +} + +div.highlight .-Color[class*=-BGC158] { + background-color: #AFFFD7 +} + +div.highlight .-Color[class*=-C159] { + color: #AFFFFF +} + +div.highlight .-Color[class*=-BGC159] { + background-color: #AFFFFF +} + +div.highlight .-Color[class*=-C160] { + color: #D70000 +} + +div.highlight .-Color[class*=-BGC160] { + background-color: #D70000 +} + +div.highlight .-Color[class*=-C161] { + color: #D7005F +} + +div.highlight .-Color[class*=-BGC161] { + background-color: #D7005F +} + +div.highlight .-Color[class*=-C162] { + color: #D70087 +} + +div.highlight .-Color[class*=-BGC162] { + background-color: #D70087 +} + +div.highlight .-Color[class*=-C163] { + color: #D700AF +} + +div.highlight .-Color[class*=-BGC163] { + background-color: #D700AF +} + +div.highlight .-Color[class*=-C164] { + color: #D700D7 +} + +div.highlight .-Color[class*=-BGC164] { + background-color: #D700D7 +} + +div.highlight .-Color[class*=-C165] { + color: #D700FF +} + +div.highlight .-Color[class*=-BGC165] { + background-color: #D700FF +} + +div.highlight .-Color[class*=-C166] { + color: #D75F00 +} + +div.highlight .-Color[class*=-BGC166] { + background-color: #D75F00 +} + +div.highlight .-Color[class*=-C167] { + color: #D75F5F +} + +div.highlight .-Color[class*=-BGC167] { + background-color: #D75F5F +} + +div.highlight .-Color[class*=-C168] { + color: #D75F87 +} + +div.highlight .-Color[class*=-BGC168] { + background-color: #D75F87 +} + +div.highlight .-Color[class*=-C169] { + color: #D75FAF +} + +div.highlight .-Color[class*=-BGC169] { + background-color: #D75FAF +} + +div.highlight .-Color[class*=-C170] { + color: #D75FD7 +} + +div.highlight .-Color[class*=-BGC170] { + background-color: #D75FD7 +} + +div.highlight .-Color[class*=-C171] { + color: #D75FFF +} + +div.highlight .-Color[class*=-BGC171] { + background-color: #D75FFF +} + +div.highlight .-Color[class*=-C172] { + color: #D78700 +} + +div.highlight .-Color[class*=-BGC172] { + background-color: #D78700 +} + +div.highlight .-Color[class*=-C173] { + color: #D7875F +} + +div.highlight .-Color[class*=-BGC173] { + background-color: #D7875F +} + +div.highlight .-Color[class*=-C174] { + color: #D78787 +} + +div.highlight .-Color[class*=-BGC174] { + background-color: #D78787 +} + +div.highlight .-Color[class*=-C175] { + color: #D787AF +} + +div.highlight .-Color[class*=-BGC175] { + background-color: #D787AF +} + +div.highlight .-Color[class*=-C176] { + color: #D787D7 +} + +div.highlight .-Color[class*=-BGC176] { + background-color: #D787D7 +} + +div.highlight .-Color[class*=-C177] { + color: #D787FF +} + +div.highlight .-Color[class*=-BGC177] { + background-color: #D787FF +} + +div.highlight .-Color[class*=-C178] { + color: #D7AF00 +} + +div.highlight .-Color[class*=-BGC178] { + background-color: #D7AF00 +} + +div.highlight .-Color[class*=-C179] { + color: #D7AF5F +} + +div.highlight .-Color[class*=-BGC179] { + background-color: #D7AF5F +} + +div.highlight .-Color[class*=-C180] { + color: #D7AF87 +} + +div.highlight .-Color[class*=-BGC180] { + background-color: #D7AF87 +} + +div.highlight .-Color[class*=-C181] { + color: #D7AFAF +} + +div.highlight .-Color[class*=-BGC181] { + background-color: #D7AFAF +} + +div.highlight .-Color[class*=-C182] { + color: #D7AFD7 +} + +div.highlight .-Color[class*=-BGC182] { + background-color: #D7AFD7 +} + +div.highlight .-Color[class*=-C183] { + color: #D7AFFF +} + +div.highlight .-Color[class*=-BGC183] { + background-color: #D7AFFF +} + +div.highlight .-Color[class*=-C184] { + color: #D7D700 +} + +div.highlight .-Color[class*=-BGC184] { + background-color: #D7D700 +} + +div.highlight .-Color[class*=-C185] { + color: #D7D75F +} + +div.highlight .-Color[class*=-BGC185] { + background-color: #D7D75F +} + +div.highlight .-Color[class*=-C186] { + color: #D7D787 +} + +div.highlight .-Color[class*=-BGC186] { + background-color: #D7D787 +} + +div.highlight .-Color[class*=-C187] { + color: #D7D7AF +} + +div.highlight .-Color[class*=-BGC187] { + background-color: #D7D7AF +} + +div.highlight .-Color[class*=-C188] { + color: #D7D7D7 +} + +div.highlight .-Color[class*=-BGC188] { + background-color: #D7D7D7 +} + +div.highlight .-Color[class*=-C189] { + color: #D7D7FF +} + +div.highlight .-Color[class*=-BGC189] { + background-color: #D7D7FF +} + +div.highlight .-Color[class*=-C190] { + color: #D7FF00 +} + +div.highlight .-Color[class*=-BGC190] { + background-color: #D7FF00 +} + +div.highlight .-Color[class*=-C191] { + color: #D7FF5F +} + +div.highlight .-Color[class*=-BGC191] { + background-color: #D7FF5F +} + +div.highlight .-Color[class*=-C192] { + color: #D7FF87 +} + +div.highlight .-Color[class*=-BGC192] { + background-color: #D7FF87 +} + +div.highlight .-Color[class*=-C193] { + color: #D7FFAF +} + +div.highlight .-Color[class*=-BGC193] { + background-color: #D7FFAF +} + +div.highlight .-Color[class*=-C194] { + color: #D7FFD7 +} + +div.highlight .-Color[class*=-BGC194] { + background-color: #D7FFD7 +} + +div.highlight .-Color[class*=-C195] { + color: #D7FFFF +} + +div.highlight .-Color[class*=-BGC195] { + background-color: #D7FFFF +} + +div.highlight .-Color[class*=-C196] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC196] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C197] { + color: #FF005F +} + +div.highlight .-Color[class*=-BGC197] { + background-color: #FF005F +} + +div.highlight .-Color[class*=-C198] { + color: #FF0087 +} + +div.highlight .-Color[class*=-BGC198] { + background-color: #FF0087 +} + +div.highlight .-Color[class*=-C199] { + color: #FF00AF +} + +div.highlight .-Color[class*=-BGC199] { + background-color: #FF00AF +} + +div.highlight .-Color[class*=-C200] { + color: #FF00D7 +} + +div.highlight .-Color[class*=-BGC200] { + background-color: #FF00D7 +} + +div.highlight .-Color[class*=-C201] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC201] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C202] { + color: #FF5F00 +} + +div.highlight .-Color[class*=-BGC202] { + background-color: #FF5F00 +} + +div.highlight .-Color[class*=-C203] { + color: #FF5F5F +} + +div.highlight .-Color[class*=-BGC203] { + background-color: #FF5F5F +} + +div.highlight .-Color[class*=-C204] { + color: #FF5F87 +} + +div.highlight .-Color[class*=-BGC204] { + background-color: #FF5F87 +} + +div.highlight .-Color[class*=-C205] { + color: #FF5FAF +} + +div.highlight .-Color[class*=-BGC205] { + background-color: #FF5FAF +} + +div.highlight .-Color[class*=-C206] { + color: #FF5FD7 +} + +div.highlight .-Color[class*=-BGC206] { + background-color: #FF5FD7 +} + +div.highlight .-Color[class*=-C207] { + color: #FF5FFF +} + +div.highlight .-Color[class*=-BGC207] { + background-color: #FF5FFF +} + +div.highlight .-Color[class*=-C208] { + color: #FF8700 +} + +div.highlight .-Color[class*=-BGC208] { + background-color: #FF8700 +} + +div.highlight .-Color[class*=-C209] { + color: #FF875F +} + +div.highlight .-Color[class*=-BGC209] { + background-color: #FF875F +} + +div.highlight .-Color[class*=-C210] { + color: #FF8787 +} + +div.highlight .-Color[class*=-BGC210] { + background-color: #FF8787 +} + +div.highlight .-Color[class*=-C211] { + color: #FF87AF +} + +div.highlight .-Color[class*=-BGC211] { + background-color: #FF87AF +} + +div.highlight .-Color[class*=-C212] { + color: #FF87D7 +} + +div.highlight .-Color[class*=-BGC212] { + background-color: #FF87D7 +} + +div.highlight .-Color[class*=-C213] { + color: #FF87FF +} + +div.highlight .-Color[class*=-BGC213] { + background-color: #FF87FF +} + +div.highlight .-Color[class*=-C214] { + color: #FFAF00 +} + +div.highlight .-Color[class*=-BGC214] { + background-color: #FFAF00 +} + +div.highlight .-Color[class*=-C215] { + color: #FFAF5F +} + +div.highlight .-Color[class*=-BGC215] { + background-color: #FFAF5F +} + +div.highlight .-Color[class*=-C216] { + color: #FFAF87 +} + +div.highlight .-Color[class*=-BGC216] { + background-color: #FFAF87 +} + +div.highlight .-Color[class*=-C217] { + color: #FFAFAF +} + +div.highlight .-Color[class*=-BGC217] { + background-color: #FFAFAF +} + +div.highlight .-Color[class*=-C218] { + color: #FFAFD7 +} + +div.highlight .-Color[class*=-BGC218] { + background-color: #FFAFD7 +} + +div.highlight .-Color[class*=-C219] { + color: #FFAFFF +} + +div.highlight .-Color[class*=-BGC219] { + background-color: #FFAFFF +} + +div.highlight .-Color[class*=-C220] { + color: #FFD700 +} + +div.highlight .-Color[class*=-BGC220] { + background-color: #FFD700 +} + +div.highlight .-Color[class*=-C221] { + color: #FFD75F +} + +div.highlight .-Color[class*=-BGC221] { + background-color: #FFD75F +} + +div.highlight .-Color[class*=-C222] { + color: #FFD787 +} + +div.highlight .-Color[class*=-BGC222] { + background-color: #FFD787 +} + +div.highlight .-Color[class*=-C223] { + color: #FFD7AF +} + +div.highlight .-Color[class*=-BGC223] { + background-color: #FFD7AF +} + +div.highlight .-Color[class*=-C224] { + color: #FFD7D7 +} + +div.highlight .-Color[class*=-BGC224] { + background-color: #FFD7D7 +} + +div.highlight .-Color[class*=-C225] { + color: #FFD7FF +} + +div.highlight .-Color[class*=-BGC225] { + background-color: #FFD7FF +} + +div.highlight .-Color[class*=-C226] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC226] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C227] { + color: #FFFF5F +} + +div.highlight .-Color[class*=-BGC227] { + background-color: #FFFF5F +} + +div.highlight .-Color[class*=-C228] { + color: #FFFF87 +} + +div.highlight .-Color[class*=-BGC228] { + background-color: #FFFF87 +} + +div.highlight .-Color[class*=-C229] { + color: #FFFFAF +} + +div.highlight .-Color[class*=-BGC229] { + background-color: #FFFFAF +} + +div.highlight .-Color[class*=-C230] { + color: #FFFFD7 +} + +div.highlight .-Color[class*=-BGC230] { + background-color: #FFFFD7 +} + +div.highlight .-Color[class*=-C231] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC231] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C232] { + color: #080808 +} + +div.highlight .-Color[class*=-BGC232] { + background-color: #080808 +} + +div.highlight .-Color[class*=-C233] { + color: #121212 +} + +div.highlight .-Color[class*=-BGC233] { + background-color: #121212 +} + +div.highlight .-Color[class*=-C234] { + color: #1C1C1C +} + +div.highlight .-Color[class*=-BGC234] { + background-color: #1C1C1C +} + +div.highlight .-Color[class*=-C235] { + color: #262626 +} + +div.highlight .-Color[class*=-BGC235] { + background-color: #262626 +} + +div.highlight .-Color[class*=-C236] { + color: #303030 +} + +div.highlight .-Color[class*=-BGC236] { + background-color: #303030 +} + +div.highlight .-Color[class*=-C237] { + color: #3A3A3A +} + +div.highlight .-Color[class*=-BGC237] { + background-color: #3A3A3A +} + +div.highlight .-Color[class*=-C238] { + color: #444444 +} + +div.highlight .-Color[class*=-BGC238] { + background-color: #444444 +} + +div.highlight .-Color[class*=-C239] { + color: #4E4E4E +} + +div.highlight .-Color[class*=-BGC239] { + background-color: #4E4E4E +} + +div.highlight .-Color[class*=-C240] { + color: #585858 +} + +div.highlight .-Color[class*=-BGC240] { + background-color: #585858 +} + +div.highlight .-Color[class*=-C241] { + color: #626262 +} + +div.highlight .-Color[class*=-BGC241] { + background-color: #626262 +} + +div.highlight .-Color[class*=-C242] { + color: #6C6C6C +} + +div.highlight .-Color[class*=-BGC242] { + background-color: #6C6C6C +} + +div.highlight .-Color[class*=-C243] { + color: #767676 +} + +div.highlight .-Color[class*=-BGC243] { + background-color: #767676 +} + +div.highlight .-Color[class*=-C244] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC244] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C245] { + color: #8A8A8A +} + +div.highlight .-Color[class*=-BGC245] { + background-color: #8A8A8A +} + +div.highlight .-Color[class*=-C246] { + color: #949494 +} + +div.highlight .-Color[class*=-BGC246] { + background-color: #949494 +} + +div.highlight .-Color[class*=-C247] { + color: #9E9E9E +} + +div.highlight .-Color[class*=-BGC247] { + background-color: #9E9E9E +} + +div.highlight .-Color[class*=-C248] { + color: #A8A8A8 +} + +div.highlight .-Color[class*=-BGC248] { + background-color: #A8A8A8 +} + +div.highlight .-Color[class*=-C249] { + color: #B2B2B2 +} + +div.highlight .-Color[class*=-BGC249] { + background-color: #B2B2B2 +} + +div.highlight .-Color[class*=-C250] { + color: #BCBCBC +} + +div.highlight .-Color[class*=-BGC250] { + background-color: #BCBCBC +} + +div.highlight .-Color[class*=-C251] { + color: #C6C6C6 +} + +div.highlight .-Color[class*=-BGC251] { + background-color: #C6C6C6 +} + +div.highlight .-Color[class*=-C252] { + color: #D0D0D0 +} + +div.highlight .-Color[class*=-BGC252] { + background-color: #D0D0D0 +} + +div.highlight .-Color[class*=-C253] { + color: #DADADA +} + +div.highlight .-Color[class*=-BGC253] { + background-color: #DADADA +} + +div.highlight .-Color[class*=-C254] { + color: #E4E4E4 +} + +div.highlight .-Color[class*=-BGC254] { + background-color: #E4E4E4 +} + +div.highlight .-Color[class*=-C255] { + color: #EEEEEE +} + +div.highlight .-Color[class*=-BGC255] { + background-color: #EEEEEE +} diff --git a/content/_static/no-search.css b/_static/no-search.css similarity index 100% rename from content/_static/no-search.css rename to _static/no-search.css diff --git a/_static/play-solid.svg b/_static/play-solid.svg new file mode 100644 index 00000000..bcd81f7a --- /dev/null +++ b/_static/play-solid.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/_static/plus.png b/_static/plus.png new file mode 100644 index 00000000..7107cec9 Binary files /dev/null and b/_static/plus.png differ diff --git a/_static/preserve_dropdown_state.js b/_static/preserve_dropdown_state.js new file mode 100644 index 00000000..daba2c37 --- /dev/null +++ b/_static/preserve_dropdown_state.js @@ -0,0 +1,81 @@ +// Save dropdown states before navigation +function saveDropdownStates() { + const states = {}; + let index = 0; + + // Save states for details-based dropdowns (Sphinx Design, toggle-details, etc.) + document.querySelectorAll('details.dropdown, details.sd-dropdown, details.toggle-details').forEach((detail) => { + const id = detail.id || `details-dropdown-${index++}`; + states[id] = detail.open; + }); + + // Save states for div-based dropdowns (admonitions with toggle buttons) + index = 0; + document.querySelectorAll('div.dropdown').forEach((div) => { + const id = div.id || `div-dropdown-${index++}`; + const isOpen = !div.classList.contains('toggle-hidden'); + states[id] = isOpen; + }); + + sessionStorage.setItem('dropdownStates', JSON.stringify(states)); +} + +// Restore dropdown states after page load +function restoreDropdownStates() { + const savedStates = sessionStorage.getItem('dropdownStates'); + if (!savedStates) return; + + try { + const states = JSON.parse(savedStates); + let index = 0; + + // Restore states for details-based dropdowns + document.querySelectorAll('details.dropdown, details.sd-dropdown, details.toggle-details').forEach((detail) => { + const id = detail.id || `details-dropdown-${index++}`; + const shouldBeOpen = states[id]; + + if (shouldBeOpen !== undefined && detail.open !== shouldBeOpen) { + detail.open = shouldBeOpen; + } + }); + + // Restore states for div-based dropdowns + index = 0; + document.querySelectorAll('div.dropdown').forEach((div) => { + const id = div.id || `div-dropdown-${index++}`; + const shouldBeOpen = states[id]; + + if (shouldBeOpen !== undefined) { + const isCurrentlyOpen = !div.classList.contains('toggle-hidden'); + + // Toggle if the state doesn't match + if (shouldBeOpen !== isCurrentlyOpen) { + const title = div.querySelector('.admonition-title'); + if (title) { + title.click(); + } + } + } + }); + } catch (e) { + console.error('Error restoring dropdown states:', e); + } +} + +// Save states when clicking on internal links +document.addEventListener('click', function(e) { + const link = e.target.closest('a'); + if (link && link.origin === window.location.origin) { + saveDropdownStates(); + } +}); + +// Save states before navigating away +window.addEventListener('beforeunload', function() { + saveDropdownStates(); +}); + +// Restore dropdown states on page load +window.addEventListener("load", function() { + restoreDropdownStates(); +}); diff --git a/_static/pygments.css b/_static/pygments.css new file mode 100644 index 00000000..d7dd5778 --- /dev/null +++ b/_static/pygments.css @@ -0,0 +1,152 @@ +html[data-theme="light"] .highlight pre { line-height: 125%; } +html[data-theme="light"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight .hll { background-color: #fae4c2 } +html[data-theme="light"] .highlight { background: #fefefe; color: #080808 } +html[data-theme="light"] .highlight .c { color: #515151 } /* Comment */ +html[data-theme="light"] .highlight .err { color: #A12236 } /* Error */ +html[data-theme="light"] .highlight .k { color: #6730C5 } /* Keyword */ +html[data-theme="light"] .highlight .l { color: #7F4707 } /* Literal */ +html[data-theme="light"] .highlight .n { color: #080808 } /* Name */ +html[data-theme="light"] .highlight .o { color: #00622F } /* Operator */ +html[data-theme="light"] .highlight .p { color: #080808 } /* Punctuation */ +html[data-theme="light"] .highlight .ch { color: #515151 } /* Comment.Hashbang */ +html[data-theme="light"] .highlight .cm { color: #515151 } /* Comment.Multiline */ +html[data-theme="light"] .highlight .cp { color: #515151 } /* Comment.Preproc */ +html[data-theme="light"] .highlight .cpf { color: #515151 } /* Comment.PreprocFile */ +html[data-theme="light"] .highlight .c1 { color: #515151 } /* Comment.Single */ +html[data-theme="light"] .highlight .cs { color: #515151 } /* Comment.Special */ +html[data-theme="light"] .highlight .gd { color: #005B82 } /* Generic.Deleted */ +html[data-theme="light"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="light"] .highlight .gh { color: #005B82 } /* Generic.Heading */ +html[data-theme="light"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="light"] .highlight .gu { color: #005B82 } /* Generic.Subheading */ +html[data-theme="light"] .highlight .kc { color: #6730C5 } /* Keyword.Constant */ +html[data-theme="light"] .highlight .kd { color: #6730C5 } /* Keyword.Declaration */ +html[data-theme="light"] .highlight .kn { color: #6730C5 } /* Keyword.Namespace */ +html[data-theme="light"] .highlight .kp { color: #6730C5 } /* Keyword.Pseudo */ +html[data-theme="light"] .highlight .kr { color: #6730C5 } /* Keyword.Reserved */ +html[data-theme="light"] .highlight .kt { color: #7F4707 } /* Keyword.Type */ +html[data-theme="light"] .highlight .ld { color: #7F4707 } /* Literal.Date */ +html[data-theme="light"] .highlight .m { color: #7F4707 } /* Literal.Number */ +html[data-theme="light"] .highlight .s { color: #00622F } /* Literal.String */ +html[data-theme="light"] .highlight .na { color: #912583 } /* Name.Attribute */ +html[data-theme="light"] .highlight .nb { color: #7F4707 } /* Name.Builtin */ +html[data-theme="light"] .highlight .nc { color: #005B82 } /* Name.Class */ +html[data-theme="light"] .highlight .no { color: #005B82 } /* Name.Constant */ +html[data-theme="light"] .highlight .nd { color: #7F4707 } /* Name.Decorator */ +html[data-theme="light"] .highlight .ni { color: #00622F } /* Name.Entity */ +html[data-theme="light"] .highlight .ne { color: #6730C5 } /* Name.Exception */ +html[data-theme="light"] .highlight .nf { color: #005B82 } /* Name.Function */ +html[data-theme="light"] .highlight .nl { color: #7F4707 } /* Name.Label */ +html[data-theme="light"] .highlight .nn { color: #080808 } /* Name.Namespace */ +html[data-theme="light"] .highlight .nx { color: #080808 } /* Name.Other */ +html[data-theme="light"] .highlight .py { color: #005B82 } /* Name.Property */ +html[data-theme="light"] .highlight .nt { color: #005B82 } /* Name.Tag */ +html[data-theme="light"] .highlight .nv { color: #A12236 } /* Name.Variable */ +html[data-theme="light"] .highlight .ow { color: #6730C5 } /* Operator.Word */ +html[data-theme="light"] .highlight .pm { color: #080808 } /* Punctuation.Marker */ +html[data-theme="light"] .highlight .w { color: #080808 } /* Text.Whitespace */ +html[data-theme="light"] .highlight .mb { color: #7F4707 } /* Literal.Number.Bin */ +html[data-theme="light"] .highlight .mf { color: #7F4707 } /* Literal.Number.Float */ +html[data-theme="light"] .highlight .mh { color: #7F4707 } /* Literal.Number.Hex */ +html[data-theme="light"] .highlight .mi { color: #7F4707 } /* Literal.Number.Integer */ +html[data-theme="light"] .highlight .mo { color: #7F4707 } /* Literal.Number.Oct */ +html[data-theme="light"] .highlight .sa { color: #00622F } /* Literal.String.Affix */ +html[data-theme="light"] .highlight .sb { color: #00622F } /* Literal.String.Backtick */ +html[data-theme="light"] .highlight .sc { color: #00622F } /* Literal.String.Char */ +html[data-theme="light"] .highlight .dl { color: #00622F } /* Literal.String.Delimiter */ +html[data-theme="light"] .highlight .sd { color: #00622F } /* Literal.String.Doc */ +html[data-theme="light"] .highlight .s2 { color: #00622F } /* Literal.String.Double */ +html[data-theme="light"] .highlight .se { color: #00622F } /* Literal.String.Escape */ +html[data-theme="light"] .highlight .sh { color: #00622F } /* Literal.String.Heredoc */ +html[data-theme="light"] .highlight .si { color: #00622F } /* Literal.String.Interpol */ +html[data-theme="light"] .highlight .sx { color: #00622F } /* Literal.String.Other */ +html[data-theme="light"] .highlight .sr { color: #A12236 } /* Literal.String.Regex */ +html[data-theme="light"] .highlight .s1 { color: #00622F } /* Literal.String.Single */ +html[data-theme="light"] .highlight .ss { color: #005B82 } /* Literal.String.Symbol */ +html[data-theme="light"] .highlight .bp { color: #7F4707 } /* Name.Builtin.Pseudo */ +html[data-theme="light"] .highlight .fm { color: #005B82 } /* Name.Function.Magic */ +html[data-theme="light"] .highlight .vc { color: #A12236 } /* Name.Variable.Class */ +html[data-theme="light"] .highlight .vg { color: #A12236 } /* Name.Variable.Global */ +html[data-theme="light"] .highlight .vi { color: #A12236 } /* Name.Variable.Instance */ +html[data-theme="light"] .highlight .vm { color: #7F4707 } /* Name.Variable.Magic */ +html[data-theme="light"] .highlight .il { color: #7F4707 } /* Literal.Number.Integer.Long */ +html[data-theme="dark"] .highlight pre { line-height: 125%; } +html[data-theme="dark"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight .hll { background-color: #ffd9002e } +html[data-theme="dark"] .highlight { background: #2b2b2b; color: #F8F8F2 } +html[data-theme="dark"] .highlight .c { color: #FFD900 } /* Comment */ +html[data-theme="dark"] .highlight .err { color: #FFA07A } /* Error */ +html[data-theme="dark"] .highlight .k { color: #DCC6E0 } /* Keyword */ +html[data-theme="dark"] .highlight .l { color: #FFD900 } /* Literal */ +html[data-theme="dark"] .highlight .n { color: #F8F8F2 } /* Name */ +html[data-theme="dark"] .highlight .o { color: #ABE338 } /* Operator */ +html[data-theme="dark"] .highlight .p { color: #F8F8F2 } /* Punctuation */ +html[data-theme="dark"] .highlight .ch { color: #FFD900 } /* Comment.Hashbang */ +html[data-theme="dark"] .highlight .cm { color: #FFD900 } /* Comment.Multiline */ +html[data-theme="dark"] .highlight .cp { color: #FFD900 } /* Comment.Preproc */ +html[data-theme="dark"] .highlight .cpf { color: #FFD900 } /* Comment.PreprocFile */ +html[data-theme="dark"] .highlight .c1 { color: #FFD900 } /* Comment.Single */ +html[data-theme="dark"] .highlight .cs { color: #FFD900 } /* Comment.Special */ +html[data-theme="dark"] .highlight .gd { color: #00E0E0 } /* Generic.Deleted */ +html[data-theme="dark"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="dark"] .highlight .gh { color: #00E0E0 } /* Generic.Heading */ +html[data-theme="dark"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="dark"] .highlight .gu { color: #00E0E0 } /* Generic.Subheading */ +html[data-theme="dark"] .highlight .kc { color: #DCC6E0 } /* Keyword.Constant */ +html[data-theme="dark"] .highlight .kd { color: #DCC6E0 } /* Keyword.Declaration */ +html[data-theme="dark"] .highlight .kn { color: #DCC6E0 } /* Keyword.Namespace */ +html[data-theme="dark"] .highlight .kp { color: #DCC6E0 } /* Keyword.Pseudo */ +html[data-theme="dark"] .highlight .kr { color: #DCC6E0 } /* Keyword.Reserved */ +html[data-theme="dark"] .highlight .kt { color: #FFD900 } /* Keyword.Type */ +html[data-theme="dark"] .highlight .ld { color: #FFD900 } /* Literal.Date */ +html[data-theme="dark"] .highlight .m { color: #FFD900 } /* Literal.Number */ +html[data-theme="dark"] .highlight .s { color: #ABE338 } /* Literal.String */ +html[data-theme="dark"] .highlight .na { color: #FFD900 } /* Name.Attribute */ +html[data-theme="dark"] .highlight .nb { color: #FFD900 } /* Name.Builtin */ +html[data-theme="dark"] .highlight .nc { color: #00E0E0 } /* Name.Class */ +html[data-theme="dark"] .highlight .no { color: #00E0E0 } /* Name.Constant */ +html[data-theme="dark"] .highlight .nd { color: #FFD900 } /* Name.Decorator */ +html[data-theme="dark"] .highlight .ni { color: #ABE338 } /* Name.Entity */ +html[data-theme="dark"] .highlight .ne { color: #DCC6E0 } /* Name.Exception */ +html[data-theme="dark"] .highlight .nf { color: #00E0E0 } /* Name.Function */ +html[data-theme="dark"] .highlight .nl { color: #FFD900 } /* Name.Label */ +html[data-theme="dark"] .highlight .nn { color: #F8F8F2 } /* Name.Namespace */ +html[data-theme="dark"] .highlight .nx { color: #F8F8F2 } /* Name.Other */ +html[data-theme="dark"] .highlight .py { color: #00E0E0 } /* Name.Property */ +html[data-theme="dark"] .highlight .nt { color: #00E0E0 } /* Name.Tag */ +html[data-theme="dark"] .highlight .nv { color: #FFA07A } /* Name.Variable */ +html[data-theme="dark"] .highlight .ow { color: #DCC6E0 } /* Operator.Word */ +html[data-theme="dark"] .highlight .pm { color: #F8F8F2 } /* Punctuation.Marker */ +html[data-theme="dark"] .highlight .w { color: #F8F8F2 } /* Text.Whitespace */ +html[data-theme="dark"] .highlight .mb { color: #FFD900 } /* Literal.Number.Bin */ +html[data-theme="dark"] .highlight .mf { color: #FFD900 } /* Literal.Number.Float */ +html[data-theme="dark"] .highlight .mh { color: #FFD900 } /* Literal.Number.Hex */ +html[data-theme="dark"] .highlight .mi { color: #FFD900 } /* Literal.Number.Integer */ +html[data-theme="dark"] .highlight .mo { color: #FFD900 } /* Literal.Number.Oct */ +html[data-theme="dark"] .highlight .sa { color: #ABE338 } /* Literal.String.Affix */ +html[data-theme="dark"] .highlight .sb { color: #ABE338 } /* Literal.String.Backtick */ +html[data-theme="dark"] .highlight .sc { color: #ABE338 } /* Literal.String.Char */ +html[data-theme="dark"] .highlight .dl { color: #ABE338 } /* Literal.String.Delimiter */ +html[data-theme="dark"] .highlight .sd { color: #ABE338 } /* Literal.String.Doc */ +html[data-theme="dark"] .highlight .s2 { color: #ABE338 } /* Literal.String.Double */ +html[data-theme="dark"] .highlight .se { color: #ABE338 } /* Literal.String.Escape */ +html[data-theme="dark"] .highlight .sh { color: #ABE338 } /* Literal.String.Heredoc */ +html[data-theme="dark"] .highlight .si { color: #ABE338 } /* Literal.String.Interpol */ +html[data-theme="dark"] .highlight .sx { color: #ABE338 } /* Literal.String.Other */ +html[data-theme="dark"] .highlight .sr { color: #FFA07A } /* Literal.String.Regex */ +html[data-theme="dark"] .highlight .s1 { color: #ABE338 } /* Literal.String.Single */ +html[data-theme="dark"] .highlight .ss { color: #00E0E0 } /* Literal.String.Symbol */ +html[data-theme="dark"] .highlight .bp { color: #FFD900 } /* Name.Builtin.Pseudo */ +html[data-theme="dark"] .highlight .fm { color: #00E0E0 } /* Name.Function.Magic */ +html[data-theme="dark"] .highlight .vc { color: #FFA07A } /* Name.Variable.Class */ +html[data-theme="dark"] .highlight .vg { color: #FFA07A } /* Name.Variable.Global */ +html[data-theme="dark"] .highlight .vi { color: #FFA07A } /* Name.Variable.Instance */ +html[data-theme="dark"] .highlight .vm { color: #FFD900 } /* Name.Variable.Magic */ +html[data-theme="dark"] .highlight .il { color: #FFD900 } /* Literal.Number.Integer.Long */ \ No newline at end of file diff --git a/_static/sbt-webpack-macros.html b/_static/sbt-webpack-macros.html new file mode 100644 index 00000000..6cbf559f --- /dev/null +++ b/_static/sbt-webpack-macros.html @@ -0,0 +1,11 @@ + +{% macro head_pre_bootstrap() %} + +{% endmacro %} + +{% macro body_post() %} + +{% endmacro %} diff --git a/_static/scripts/bootstrap.js b/_static/scripts/bootstrap.js new file mode 100644 index 00000000..c8178deb --- /dev/null +++ b/_static/scripts/bootstrap.js @@ -0,0 +1,3 @@ +/*! For license information please see bootstrap.js.LICENSE.txt */ +(()=>{"use strict";var t={d:(e,i)=>{for(var n in i)t.o(i,n)&&!t.o(e,n)&&Object.defineProperty(e,n,{enumerable:!0,get:i[n]})},o:(t,e)=>Object.prototype.hasOwnProperty.call(t,e),r:t=>{"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})}},e={};t.r(e),t.d(e,{afterMain:()=>E,afterRead:()=>v,afterWrite:()=>C,applyStyles:()=>$,arrow:()=>J,auto:()=>a,basePlacements:()=>l,beforeMain:()=>y,beforeRead:()=>_,beforeWrite:()=>A,bottom:()=>s,clippingParents:()=>d,computeStyles:()=>it,createPopper:()=>Dt,createPopperBase:()=>St,createPopperLite:()=>$t,detectOverflow:()=>_t,end:()=>h,eventListeners:()=>st,flip:()=>bt,hide:()=>wt,left:()=>r,main:()=>w,modifierPhases:()=>O,offset:()=>Et,placements:()=>g,popper:()=>f,popperGenerator:()=>Lt,popperOffsets:()=>At,preventOverflow:()=>Tt,read:()=>b,reference:()=>p,right:()=>o,start:()=>c,top:()=>n,variationPlacements:()=>m,viewport:()=>u,write:()=>T});var i={};t.r(i),t.d(i,{Alert:()=>Oe,Button:()=>ke,Carousel:()=>li,Collapse:()=>Ei,Dropdown:()=>Ki,Modal:()=>Ln,Offcanvas:()=>Kn,Popover:()=>bs,ScrollSpy:()=>Ls,Tab:()=>Js,Toast:()=>po,Tooltip:()=>fs});var n="top",s="bottom",o="right",r="left",a="auto",l=[n,s,o,r],c="start",h="end",d="clippingParents",u="viewport",f="popper",p="reference",m=l.reduce((function(t,e){return t.concat([e+"-"+c,e+"-"+h])}),[]),g=[].concat(l,[a]).reduce((function(t,e){return t.concat([e,e+"-"+c,e+"-"+h])}),[]),_="beforeRead",b="read",v="afterRead",y="beforeMain",w="main",E="afterMain",A="beforeWrite",T="write",C="afterWrite",O=[_,b,v,y,w,E,A,T,C];function x(t){return t?(t.nodeName||"").toLowerCase():null}function k(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function L(t){return t instanceof k(t).Element||t instanceof Element}function S(t){return t instanceof k(t).HTMLElement||t instanceof HTMLElement}function D(t){return"undefined"!=typeof ShadowRoot&&(t instanceof k(t).ShadowRoot||t instanceof ShadowRoot)}const $={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];S(s)&&x(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});S(n)&&x(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function I(t){return t.split("-")[0]}var N=Math.max,P=Math.min,M=Math.round;function j(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function F(){return!/^((?!chrome|android).)*safari/i.test(j())}function H(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&S(t)&&(s=t.offsetWidth>0&&M(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&M(n.height)/t.offsetHeight||1);var r=(L(t)?k(t):window).visualViewport,a=!F()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function B(t){var e=H(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function W(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&D(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function z(t){return k(t).getComputedStyle(t)}function R(t){return["table","td","th"].indexOf(x(t))>=0}function q(t){return((L(t)?t.ownerDocument:t.document)||window.document).documentElement}function V(t){return"html"===x(t)?t:t.assignedSlot||t.parentNode||(D(t)?t.host:null)||q(t)}function Y(t){return S(t)&&"fixed"!==z(t).position?t.offsetParent:null}function K(t){for(var e=k(t),i=Y(t);i&&R(i)&&"static"===z(i).position;)i=Y(i);return i&&("html"===x(i)||"body"===x(i)&&"static"===z(i).position)?e:i||function(t){var e=/firefox/i.test(j());if(/Trident/i.test(j())&&S(t)&&"fixed"===z(t).position)return null;var i=V(t);for(D(i)&&(i=i.host);S(i)&&["html","body"].indexOf(x(i))<0;){var n=z(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Q(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function X(t,e,i){return N(t,P(e,i))}function U(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function G(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const J={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,a=t.name,c=t.options,h=i.elements.arrow,d=i.modifiersData.popperOffsets,u=I(i.placement),f=Q(u),p=[r,o].indexOf(u)>=0?"height":"width";if(h&&d){var m=function(t,e){return U("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:G(t,l))}(c.padding,i),g=B(h),_="y"===f?n:r,b="y"===f?s:o,v=i.rects.reference[p]+i.rects.reference[f]-d[f]-i.rects.popper[p],y=d[f]-i.rects.reference[f],w=K(h),E=w?"y"===f?w.clientHeight||0:w.clientWidth||0:0,A=v/2-y/2,T=m[_],C=E-g[p]-m[b],O=E/2-g[p]/2+A,x=X(T,O,C),k=f;i.modifiersData[a]=((e={})[k]=x,e.centerOffset=x-O,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&W(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Z(t){return t.split("-")[1]}var tt={top:"auto",right:"auto",bottom:"auto",left:"auto"};function et(t){var e,i=t.popper,a=t.popperRect,l=t.placement,c=t.variation,d=t.offsets,u=t.position,f=t.gpuAcceleration,p=t.adaptive,m=t.roundOffsets,g=t.isFixed,_=d.x,b=void 0===_?0:_,v=d.y,y=void 0===v?0:v,w="function"==typeof m?m({x:b,y}):{x:b,y};b=w.x,y=w.y;var E=d.hasOwnProperty("x"),A=d.hasOwnProperty("y"),T=r,C=n,O=window;if(p){var x=K(i),L="clientHeight",S="clientWidth";x===k(i)&&"static"!==z(x=q(i)).position&&"absolute"===u&&(L="scrollHeight",S="scrollWidth"),(l===n||(l===r||l===o)&&c===h)&&(C=s,y-=(g&&x===O&&O.visualViewport?O.visualViewport.height:x[L])-a.height,y*=f?1:-1),l!==r&&(l!==n&&l!==s||c!==h)||(T=o,b-=(g&&x===O&&O.visualViewport?O.visualViewport.width:x[S])-a.width,b*=f?1:-1)}var D,$=Object.assign({position:u},p&&tt),I=!0===m?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:M(i*s)/s||0,y:M(n*s)/s||0}}({x:b,y},k(i)):{x:b,y};return b=I.x,y=I.y,f?Object.assign({},$,((D={})[C]=A?"0":"",D[T]=E?"0":"",D.transform=(O.devicePixelRatio||1)<=1?"translate("+b+"px, "+y+"px)":"translate3d("+b+"px, "+y+"px, 0)",D)):Object.assign({},$,((e={})[C]=A?y+"px":"",e[T]=E?b+"px":"",e.transform="",e))}const it={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:I(e.placement),variation:Z(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,et(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,et(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var nt={passive:!0};const st={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=k(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,nt)})),a&&l.addEventListener("resize",i.update,nt),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,nt)})),a&&l.removeEventListener("resize",i.update,nt)}},data:{}};var ot={left:"right",right:"left",bottom:"top",top:"bottom"};function rt(t){return t.replace(/left|right|bottom|top/g,(function(t){return ot[t]}))}var at={start:"end",end:"start"};function lt(t){return t.replace(/start|end/g,(function(t){return at[t]}))}function ct(t){var e=k(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function ht(t){return H(q(t)).left+ct(t).scrollLeft}function dt(t){var e=z(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function ut(t){return["html","body","#document"].indexOf(x(t))>=0?t.ownerDocument.body:S(t)&&dt(t)?t:ut(V(t))}function ft(t,e){var i;void 0===e&&(e=[]);var n=ut(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=k(n),r=s?[o].concat(o.visualViewport||[],dt(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(ft(V(r)))}function pt(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function mt(t,e,i){return e===u?pt(function(t,e){var i=k(t),n=q(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=F();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+ht(t),y:l}}(t,i)):L(e)?function(t,e){var i=H(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):pt(function(t){var e,i=q(t),n=ct(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=N(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=N(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+ht(t),l=-n.scrollTop;return"rtl"===z(s||i).direction&&(a+=N(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(q(t)))}function gt(t){var e,i=t.reference,a=t.element,l=t.placement,d=l?I(l):null,u=l?Z(l):null,f=i.x+i.width/2-a.width/2,p=i.y+i.height/2-a.height/2;switch(d){case n:e={x:f,y:i.y-a.height};break;case s:e={x:f,y:i.y+i.height};break;case o:e={x:i.x+i.width,y:p};break;case r:e={x:i.x-a.width,y:p};break;default:e={x:i.x,y:i.y}}var m=d?Q(d):null;if(null!=m){var g="y"===m?"height":"width";switch(u){case c:e[m]=e[m]-(i[g]/2-a[g]/2);break;case h:e[m]=e[m]+(i[g]/2-a[g]/2)}}return e}function _t(t,e){void 0===e&&(e={});var i=e,r=i.placement,a=void 0===r?t.placement:r,c=i.strategy,h=void 0===c?t.strategy:c,m=i.boundary,g=void 0===m?d:m,_=i.rootBoundary,b=void 0===_?u:_,v=i.elementContext,y=void 0===v?f:v,w=i.altBoundary,E=void 0!==w&&w,A=i.padding,T=void 0===A?0:A,C=U("number"!=typeof T?T:G(T,l)),O=y===f?p:f,k=t.rects.popper,D=t.elements[E?O:y],$=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=ft(V(t)),i=["absolute","fixed"].indexOf(z(t).position)>=0&&S(t)?K(t):t;return L(i)?e.filter((function(t){return L(t)&&W(t,i)&&"body"!==x(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=mt(t,i,n);return e.top=N(s.top,e.top),e.right=P(s.right,e.right),e.bottom=P(s.bottom,e.bottom),e.left=N(s.left,e.left),e}),mt(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(L(D)?D:D.contextElement||q(t.elements.popper),g,b,h),I=H(t.elements.reference),M=gt({reference:I,element:k,strategy:"absolute",placement:a}),j=pt(Object.assign({},k,M)),F=y===f?j:I,B={top:$.top-F.top+C.top,bottom:F.bottom-$.bottom+C.bottom,left:$.left-F.left+C.left,right:F.right-$.right+C.right},R=t.modifiersData.offset;if(y===f&&R){var Y=R[a];Object.keys(B).forEach((function(t){var e=[o,s].indexOf(t)>=0?1:-1,i=[n,s].indexOf(t)>=0?"y":"x";B[t]+=Y[i]*e}))}return B}const bt={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,h=t.name;if(!e.modifiersData[h]._skip){for(var d=i.mainAxis,u=void 0===d||d,f=i.altAxis,p=void 0===f||f,_=i.fallbackPlacements,b=i.padding,v=i.boundary,y=i.rootBoundary,w=i.altBoundary,E=i.flipVariations,A=void 0===E||E,T=i.allowedAutoPlacements,C=e.options.placement,O=I(C),x=_||(O!==C&&A?function(t){if(I(t)===a)return[];var e=rt(t);return[lt(t),e,lt(e)]}(C):[rt(C)]),k=[C].concat(x).reduce((function(t,i){return t.concat(I(i)===a?function(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,c=i.allowedAutoPlacements,h=void 0===c?g:c,d=Z(n),u=d?a?m:m.filter((function(t){return Z(t)===d})):l,f=u.filter((function(t){return h.indexOf(t)>=0}));0===f.length&&(f=u);var p=f.reduce((function(e,i){return e[i]=_t(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[I(i)],e}),{});return Object.keys(p).sort((function(t,e){return p[t]-p[e]}))}(e,{placement:i,boundary:v,rootBoundary:y,padding:b,flipVariations:A,allowedAutoPlacements:T}):i)}),[]),L=e.rects.reference,S=e.rects.popper,D=new Map,$=!0,N=k[0],P=0;P=0,B=H?"width":"height",W=_t(e,{placement:M,boundary:v,rootBoundary:y,altBoundary:w,padding:b}),z=H?F?o:r:F?s:n;L[B]>S[B]&&(z=rt(z));var R=rt(z),q=[];if(u&&q.push(W[j]<=0),p&&q.push(W[z]<=0,W[R]<=0),q.every((function(t){return t}))){N=M,$=!1;break}D.set(M,q)}if($)for(var V=function(t){var e=k.find((function(e){var i=D.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return N=e,"break"},Y=A?3:1;Y>0&&"break"!==V(Y);Y--);e.placement!==N&&(e.modifiersData[h]._skip=!0,e.placement=N,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function vt(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function yt(t){return[n,o,s,r].some((function(e){return t[e]>=0}))}const wt={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=_t(e,{elementContext:"reference"}),a=_t(e,{altBoundary:!0}),l=vt(r,n),c=vt(a,s,o),h=yt(l),d=yt(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},Et={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,s=t.name,a=i.offset,l=void 0===a?[0,0]:a,c=g.reduce((function(t,i){return t[i]=function(t,e,i){var s=I(t),a=[r,n].indexOf(s)>=0?-1:1,l="function"==typeof i?i(Object.assign({},e,{placement:t})):i,c=l[0],h=l[1];return c=c||0,h=(h||0)*a,[r,o].indexOf(s)>=0?{x:h,y:c}:{x:c,y:h}}(i,e.rects,l),t}),{}),h=c[e.placement],d=h.x,u=h.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=d,e.modifiersData.popperOffsets.y+=u),e.modifiersData[s]=c}},At={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=gt({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},Tt={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,a=t.name,l=i.mainAxis,h=void 0===l||l,d=i.altAxis,u=void 0!==d&&d,f=i.boundary,p=i.rootBoundary,m=i.altBoundary,g=i.padding,_=i.tether,b=void 0===_||_,v=i.tetherOffset,y=void 0===v?0:v,w=_t(e,{boundary:f,rootBoundary:p,padding:g,altBoundary:m}),E=I(e.placement),A=Z(e.placement),T=!A,C=Q(E),O="x"===C?"y":"x",x=e.modifiersData.popperOffsets,k=e.rects.reference,L=e.rects.popper,S="function"==typeof y?y(Object.assign({},e.rects,{placement:e.placement})):y,D="number"==typeof S?{mainAxis:S,altAxis:S}:Object.assign({mainAxis:0,altAxis:0},S),$=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,M={x:0,y:0};if(x){if(h){var j,F="y"===C?n:r,H="y"===C?s:o,W="y"===C?"height":"width",z=x[C],R=z+w[F],q=z-w[H],V=b?-L[W]/2:0,Y=A===c?k[W]:L[W],U=A===c?-L[W]:-k[W],G=e.elements.arrow,J=b&&G?B(G):{width:0,height:0},tt=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},et=tt[F],it=tt[H],nt=X(0,k[W],J[W]),st=T?k[W]/2-V-nt-et-D.mainAxis:Y-nt-et-D.mainAxis,ot=T?-k[W]/2+V+nt+it+D.mainAxis:U+nt+it+D.mainAxis,rt=e.elements.arrow&&K(e.elements.arrow),at=rt?"y"===C?rt.clientTop||0:rt.clientLeft||0:0,lt=null!=(j=null==$?void 0:$[C])?j:0,ct=z+ot-lt,ht=X(b?P(R,z+st-lt-at):R,z,b?N(q,ct):q);x[C]=ht,M[C]=ht-z}if(u){var dt,ut="x"===C?n:r,ft="x"===C?s:o,pt=x[O],mt="y"===O?"height":"width",gt=pt+w[ut],bt=pt-w[ft],vt=-1!==[n,r].indexOf(E),yt=null!=(dt=null==$?void 0:$[O])?dt:0,wt=vt?gt:pt-k[mt]-L[mt]-yt+D.altAxis,Et=vt?pt+k[mt]+L[mt]-yt-D.altAxis:bt,At=b&&vt?function(t,e,i){var n=X(t,e,i);return n>i?i:n}(wt,pt,Et):X(b?wt:gt,pt,b?Et:bt);x[O]=At,M[O]=At-pt}e.modifiersData[a]=M}},requiresIfExists:["offset"]};function Ct(t,e,i){void 0===i&&(i=!1);var n,s,o=S(e),r=S(e)&&function(t){var e=t.getBoundingClientRect(),i=M(e.width)/t.offsetWidth||1,n=M(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=q(e),l=H(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==x(e)||dt(a))&&(c=(n=e)!==k(n)&&S(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:ct(n)),S(e)?((h=H(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=ht(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function Ot(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var xt={placement:"bottom",modifiers:[],strategy:"absolute"};function kt(){for(var t=arguments.length,e=new Array(t),i=0;iIt.has(t)&&It.get(t).get(e)||null,remove(t,e){if(!It.has(t))return;const i=It.get(t);i.delete(e),0===i.size&&It.delete(t)}},Pt="transitionend",Mt=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),jt=t=>{t.dispatchEvent(new Event(Pt))},Ft=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),Ht=t=>Ft(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(Mt(t)):null,Bt=t=>{if(!Ft(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},Wt=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),zt=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?zt(t.parentNode):null},Rt=()=>{},qt=t=>{t.offsetHeight},Vt=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,Yt=[],Kt=()=>"rtl"===document.documentElement.dir,Qt=t=>{var e;e=()=>{const e=Vt();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(Yt.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of Yt)t()})),Yt.push(e)):e()},Xt=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,Ut=(t,e,i=!0)=>{if(!i)return void Xt(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let s=!1;const o=({target:i})=>{i===e&&(s=!0,e.removeEventListener(Pt,o),Xt(t))};e.addEventListener(Pt,o),setTimeout((()=>{s||jt(e)}),n)},Gt=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},Jt=/[^.]*(?=\..*)\.|.*/,Zt=/\..*/,te=/::\d+$/,ee={};let ie=1;const ne={mouseenter:"mouseover",mouseleave:"mouseout"},se=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function oe(t,e){return e&&`${e}::${ie++}`||t.uidEvent||ie++}function re(t){const e=oe(t);return t.uidEvent=e,ee[e]=ee[e]||{},ee[e]}function ae(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function le(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=ue(t);return se.has(o)||(o=t),[n,s,o]}function ce(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=le(e,i,n);if(e in ne){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=re(t),c=l[a]||(l[a]={}),h=ae(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=oe(r,e.replace(Jt,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return pe(s,{delegateTarget:r}),n.oneOff&&fe.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return pe(n,{delegateTarget:t}),i.oneOff&&fe.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function he(t,e,i,n,s){const o=ae(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function de(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&he(t,e,i,r.callable,r.delegationSelector)}function ue(t){return t=t.replace(Zt,""),ne[t]||t}const fe={on(t,e,i,n){ce(t,e,i,n,!1)},one(t,e,i,n){ce(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=le(e,i,n),a=r!==e,l=re(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))de(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(te,"");a&&!e.includes(s)||he(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;he(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=Vt();let s=null,o=!0,r=!0,a=!1;e!==ue(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=pe(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function pe(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function me(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function ge(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const _e={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${ge(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${ge(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=me(t.dataset[n])}return e},getDataAttribute:(t,e)=>me(t.getAttribute(`data-bs-${ge(e)}`))};class be{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=Ft(e)?_e.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...Ft(e)?_e.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],o=Ft(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(o))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${o}" but expected type "${s}".`)}var i}}class ve extends be{constructor(t,e){super(),(t=Ht(t))&&(this._element=t,this._config=this._getConfig(e),Nt.set(this._element,this.constructor.DATA_KEY,this))}dispose(){Nt.remove(this._element,this.constructor.DATA_KEY),fe.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){Ut(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return Nt.get(Ht(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const ye=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>Mt(t))).join(","):null},we={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!Wt(t)&&Bt(t)))},getSelectorFromElement(t){const e=ye(t);return e&&we.findOne(e)?e:null},getElementFromSelector(t){const e=ye(t);return e?we.findOne(e):null},getMultipleElementsFromSelector(t){const e=ye(t);return e?we.find(e):[]}},Ee=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;fe.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),Wt(this))return;const s=we.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},Ae=".bs.alert",Te=`close${Ae}`,Ce=`closed${Ae}`;class Oe extends ve{static get NAME(){return"alert"}close(){if(fe.trigger(this._element,Te).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),fe.trigger(this._element,Ce),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Oe.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}Ee(Oe,"close"),Qt(Oe);const xe='[data-bs-toggle="button"]';class ke extends ve{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=ke.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}fe.on(document,"click.bs.button.data-api",xe,(t=>{t.preventDefault();const e=t.target.closest(xe);ke.getOrCreateInstance(e).toggle()})),Qt(ke);const Le=".bs.swipe",Se=`touchstart${Le}`,De=`touchmove${Le}`,$e=`touchend${Le}`,Ie=`pointerdown${Le}`,Ne=`pointerup${Le}`,Pe={endCallback:null,leftCallback:null,rightCallback:null},Me={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class je extends be{constructor(t,e){super(),this._element=t,t&&je.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return Pe}static get DefaultType(){return Me}static get NAME(){return"swipe"}dispose(){fe.off(this._element,Le)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),Xt(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&Xt(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(fe.on(this._element,Ie,(t=>this._start(t))),fe.on(this._element,Ne,(t=>this._end(t))),this._element.classList.add("pointer-event")):(fe.on(this._element,Se,(t=>this._start(t))),fe.on(this._element,De,(t=>this._move(t))),fe.on(this._element,$e,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const Fe=".bs.carousel",He=".data-api",Be="ArrowLeft",We="ArrowRight",ze="next",Re="prev",qe="left",Ve="right",Ye=`slide${Fe}`,Ke=`slid${Fe}`,Qe=`keydown${Fe}`,Xe=`mouseenter${Fe}`,Ue=`mouseleave${Fe}`,Ge=`dragstart${Fe}`,Je=`load${Fe}${He}`,Ze=`click${Fe}${He}`,ti="carousel",ei="active",ii=".active",ni=".carousel-item",si=ii+ni,oi={[Be]:Ve,[We]:qe},ri={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},ai={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class li extends ve{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=we.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===ti&&this.cycle()}static get Default(){return ri}static get DefaultType(){return ai}static get NAME(){return"carousel"}next(){this._slide(ze)}nextWhenVisible(){!document.hidden&&Bt(this._element)&&this.next()}prev(){this._slide(Re)}pause(){this._isSliding&&jt(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?fe.one(this._element,Ke,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void fe.one(this._element,Ke,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?ze:Re;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&fe.on(this._element,Qe,(t=>this._keydown(t))),"hover"===this._config.pause&&(fe.on(this._element,Xe,(()=>this.pause())),fe.on(this._element,Ue,(()=>this._maybeEnableCycle()))),this._config.touch&&je.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of we.find(".carousel-item img",this._element))fe.on(t,Ge,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(qe)),rightCallback:()=>this._slide(this._directionToOrder(Ve)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new je(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=oi[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=we.findOne(ii,this._indicatorsElement);e.classList.remove(ei),e.removeAttribute("aria-current");const i=we.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(ei),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===ze,s=e||Gt(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>fe.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(Ye).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),qt(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(ei),i.classList.remove(ei,c,l),this._isSliding=!1,r(Ke)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return we.findOne(si,this._element)}_getItems(){return we.find(ni,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return Kt()?t===qe?Re:ze:t===qe?ze:Re}_orderToDirection(t){return Kt()?t===Re?qe:Ve:t===Re?Ve:qe}static jQueryInterface(t){return this.each((function(){const e=li.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}fe.on(document,Ze,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=we.getElementFromSelector(this);if(!e||!e.classList.contains(ti))return;t.preventDefault();const i=li.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===_e.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),fe.on(window,Je,(()=>{const t=we.find('[data-bs-ride="carousel"]');for(const e of t)li.getOrCreateInstance(e)})),Qt(li);const ci=".bs.collapse",hi=`show${ci}`,di=`shown${ci}`,ui=`hide${ci}`,fi=`hidden${ci}`,pi=`click${ci}.data-api`,mi="show",gi="collapse",_i="collapsing",bi=`:scope .${gi} .${gi}`,vi='[data-bs-toggle="collapse"]',yi={parent:null,toggle:!0},wi={parent:"(null|element)",toggle:"boolean"};class Ei extends ve{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=we.find(vi);for(const t of i){const e=we.getSelectorFromElement(t),i=we.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return yi}static get DefaultType(){return wi}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Ei.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(fe.trigger(this._element,hi).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(gi),this._element.classList.add(_i),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi,mi),this._element.style[e]="",fe.trigger(this._element,di)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(fe.trigger(this._element,ui).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,qt(this._element),this._element.classList.add(_i),this._element.classList.remove(gi,mi);for(const t of this._triggerArray){const e=we.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi),fe.trigger(this._element,fi)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(mi)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=Ht(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(vi);for(const e of t){const t=we.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=we.find(bi,this._config.parent);return we.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Ei.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}fe.on(document,pi,vi,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of we.getMultipleElementsFromSelector(this))Ei.getOrCreateInstance(t,{toggle:!1}).toggle()})),Qt(Ei);const Ai="dropdown",Ti=".bs.dropdown",Ci=".data-api",Oi="ArrowUp",xi="ArrowDown",ki=`hide${Ti}`,Li=`hidden${Ti}`,Si=`show${Ti}`,Di=`shown${Ti}`,$i=`click${Ti}${Ci}`,Ii=`keydown${Ti}${Ci}`,Ni=`keyup${Ti}${Ci}`,Pi="show",Mi='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',ji=`${Mi}.${Pi}`,Fi=".dropdown-menu",Hi=Kt()?"top-end":"top-start",Bi=Kt()?"top-start":"top-end",Wi=Kt()?"bottom-end":"bottom-start",zi=Kt()?"bottom-start":"bottom-end",Ri=Kt()?"left-start":"right-start",qi=Kt()?"right-start":"left-start",Vi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Yi={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Ki extends ve{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=we.next(this._element,Fi)[0]||we.prev(this._element,Fi)[0]||we.findOne(Fi,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return Vi}static get DefaultType(){return Yi}static get NAME(){return Ai}toggle(){return this._isShown()?this.hide():this.show()}show(){if(Wt(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!fe.trigger(this._element,Si,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Pi),this._element.classList.add(Pi),fe.trigger(this._element,Di,t)}}hide(){if(Wt(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!fe.trigger(this._element,ki,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._popper&&this._popper.destroy(),this._menu.classList.remove(Pi),this._element.classList.remove(Pi),this._element.setAttribute("aria-expanded","false"),_e.removeDataAttribute(this._menu,"popper"),fe.trigger(this._element,Li,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!Ft(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${Ai.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===e)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:Ft(this._config.reference)?t=Ht(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const i=this._getPopperConfig();this._popper=Dt(t,this._menu,i)}_isShown(){return this._menu.classList.contains(Pi)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Ri;if(t.classList.contains("dropstart"))return qi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Bi:Hi:e?zi:Wi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(_e.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...Xt(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=we.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>Bt(t)));i.length&&Gt(i,e,t===xi,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Ki.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=we.find(ji);for(const i of e){const e=Ki.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Oi,xi].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Mi)?this:we.prev(this,Mi)[0]||we.next(this,Mi)[0]||we.findOne(Mi,t.delegateTarget.parentNode),o=Ki.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}fe.on(document,Ii,Mi,Ki.dataApiKeydownHandler),fe.on(document,Ii,Fi,Ki.dataApiKeydownHandler),fe.on(document,$i,Ki.clearMenus),fe.on(document,Ni,Ki.clearMenus),fe.on(document,$i,Mi,(function(t){t.preventDefault(),Ki.getOrCreateInstance(this).toggle()})),Qt(Ki);const Qi="backdrop",Xi="show",Ui=`mousedown.bs.${Qi}`,Gi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Ji={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Zi extends be{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Gi}static get DefaultType(){return Ji}static get NAME(){return Qi}show(t){if(!this._config.isVisible)return void Xt(t);this._append();const e=this._getElement();this._config.isAnimated&&qt(e),e.classList.add(Xi),this._emulateAnimation((()=>{Xt(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Xi),this._emulateAnimation((()=>{this.dispose(),Xt(t)}))):Xt(t)}dispose(){this._isAppended&&(fe.off(this._element,Ui),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=Ht(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),fe.on(t,Ui,(()=>{Xt(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){Ut(t,this._getElement(),this._config.isAnimated)}}const tn=".bs.focustrap",en=`focusin${tn}`,nn=`keydown.tab${tn}`,sn="backward",on={autofocus:!0,trapElement:null},rn={autofocus:"boolean",trapElement:"element"};class an extends be{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return on}static get DefaultType(){return rn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),fe.off(document,tn),fe.on(document,en,(t=>this._handleFocusin(t))),fe.on(document,nn,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,fe.off(document,tn))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=we.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===sn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?sn:"forward")}}const ln=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",cn=".sticky-top",hn="padding-right",dn="margin-right";class un{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,hn,(e=>e+t)),this._setElementAttributes(ln,hn,(e=>e+t)),this._setElementAttributes(cn,dn,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,hn),this._resetElementAttributes(ln,hn),this._resetElementAttributes(cn,dn)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&_e.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=_e.getDataAttribute(t,e);null!==i?(_e.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(Ft(t))e(t);else for(const i of we.find(t,this._element))e(i)}}const fn=".bs.modal",pn=`hide${fn}`,mn=`hidePrevented${fn}`,gn=`hidden${fn}`,_n=`show${fn}`,bn=`shown${fn}`,vn=`resize${fn}`,yn=`click.dismiss${fn}`,wn=`mousedown.dismiss${fn}`,En=`keydown.dismiss${fn}`,An=`click${fn}.data-api`,Tn="modal-open",Cn="show",On="modal-static",xn={backdrop:!0,focus:!0,keyboard:!0},kn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class Ln extends ve{constructor(t,e){super(t,e),this._dialog=we.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new un,this._addEventListeners()}static get Default(){return xn}static get DefaultType(){return kn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||fe.trigger(this._element,_n,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(Tn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(fe.trigger(this._element,pn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(Cn),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){fe.off(window,fn),fe.off(this._dialog,fn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Zi({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new an({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=we.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),qt(this._element),this._element.classList.add(Cn),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,fe.trigger(this._element,bn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){fe.on(this._element,En,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),fe.on(window,vn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),fe.on(this._element,wn,(t=>{fe.one(this._element,yn,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(Tn),this._resetAdjustments(),this._scrollBar.reset(),fe.trigger(this._element,gn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(fe.trigger(this._element,mn).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(On)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(On),this._queueCallback((()=>{this._element.classList.remove(On),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=Kt()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=Kt()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=Ln.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}fe.on(document,An,'[data-bs-toggle="modal"]',(function(t){const e=we.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),fe.one(e,_n,(t=>{t.defaultPrevented||fe.one(e,gn,(()=>{Bt(this)&&this.focus()}))}));const i=we.findOne(".modal.show");i&&Ln.getInstance(i).hide(),Ln.getOrCreateInstance(e).toggle(this)})),Ee(Ln),Qt(Ln);const Sn=".bs.offcanvas",Dn=".data-api",$n=`load${Sn}${Dn}`,In="show",Nn="showing",Pn="hiding",Mn=".offcanvas.show",jn=`show${Sn}`,Fn=`shown${Sn}`,Hn=`hide${Sn}`,Bn=`hidePrevented${Sn}`,Wn=`hidden${Sn}`,zn=`resize${Sn}`,Rn=`click${Sn}${Dn}`,qn=`keydown.dismiss${Sn}`,Vn={backdrop:!0,keyboard:!0,scroll:!1},Yn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class Kn extends ve{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return Vn}static get DefaultType(){return Yn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||fe.trigger(this._element,jn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new un).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Nn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(In),this._element.classList.remove(Nn),fe.trigger(this._element,Fn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(fe.trigger(this._element,Hn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(Pn),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(In,Pn),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new un).reset(),fe.trigger(this._element,Wn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Zi({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():fe.trigger(this._element,Bn)}:null})}_initializeFocusTrap(){return new an({trapElement:this._element})}_addEventListeners(){fe.on(this._element,qn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():fe.trigger(this._element,Bn))}))}static jQueryInterface(t){return this.each((function(){const e=Kn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}fe.on(document,Rn,'[data-bs-toggle="offcanvas"]',(function(t){const e=we.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this))return;fe.one(e,Wn,(()=>{Bt(this)&&this.focus()}));const i=we.findOne(Mn);i&&i!==e&&Kn.getInstance(i).hide(),Kn.getOrCreateInstance(e).toggle(this)})),fe.on(window,$n,(()=>{for(const t of we.find(Mn))Kn.getOrCreateInstance(t).show()})),fe.on(window,zn,(()=>{for(const t of we.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&Kn.getOrCreateInstance(t).hide()})),Ee(Kn),Qt(Kn);const Qn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Xn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Un=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Gn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Xn.has(i)||Boolean(Un.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Jn={allowList:Qn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Zn={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},ts={entry:"(string|element|function|null)",selector:"(string|element)"};class es extends be{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Jn}static get DefaultType(){return Zn}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},ts)}_setContent(t,e,i){const n=we.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?Ft(e)?this._putElementInTemplate(Ht(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Gn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return Xt(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const is=new Set(["sanitize","allowList","sanitizeFn"]),ns="fade",ss="show",os=".tooltip-inner",rs=".modal",as="hide.bs.modal",ls="hover",cs="focus",hs={AUTO:"auto",TOP:"top",RIGHT:Kt()?"left":"right",BOTTOM:"bottom",LEFT:Kt()?"right":"left"},ds={allowList:Qn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},us={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class fs extends ve{constructor(t,i){if(void 0===e)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,i),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return ds}static get DefaultType(){return us}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),fe.off(this._element.closest(rs),as,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=fe.trigger(this._element,this.constructor.eventName("show")),e=(zt(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),fe.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._queueCallback((()=>{fe.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!fe.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._activeTrigger.click=!1,this._activeTrigger[cs]=!1,this._activeTrigger[ls]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),fe.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ns,ss),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ns),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new es({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{[os]:this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ns)}_isShown(){return this.tip&&this.tip.classList.contains(ss)}_createPopper(t){const e=Xt(this._config.placement,[this,t,this._element]),i=hs[e.toUpperCase()];return Dt(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return Xt(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...Xt(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)fe.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ls?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ls?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");fe.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?cs:ls]=!0,e._enter()})),fe.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?cs:ls]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},fe.on(this._element.closest(rs),as,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=_e.getDataAttributes(this._element);for(const t of Object.keys(e))is.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:Ht(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=fs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(fs);const ps=".popover-header",ms=".popover-body",gs={...fs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},_s={...fs.DefaultType,content:"(null|string|element|function)"};class bs extends fs{static get Default(){return gs}static get DefaultType(){return _s}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{[ps]:this._getTitle(),[ms]:this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=bs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(bs);const vs=".bs.scrollspy",ys=`activate${vs}`,ws=`click${vs}`,Es=`load${vs}.data-api`,As="active",Ts="[href]",Cs=".nav-link",Os=`${Cs}, .nav-item > ${Cs}, .list-group-item`,xs={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},ks={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Ls extends ve{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return xs}static get DefaultType(){return ks}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=Ht(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(fe.off(this._config.target,ws),fe.on(this._config.target,ws,Ts,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=we.find(Ts,this._config.target);for(const e of t){if(!e.hash||Wt(e))continue;const t=we.findOne(decodeURI(e.hash),this._element);Bt(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(As),this._activateParents(t),fe.trigger(this._element,ys,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))we.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(As);else for(const e of we.parents(t,".nav, .list-group"))for(const t of we.prev(e,Os))t.classList.add(As)}_clearActiveClass(t){t.classList.remove(As);const e=we.find(`${Ts}.${As}`,t);for(const t of e)t.classList.remove(As)}static jQueryInterface(t){return this.each((function(){const e=Ls.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(window,Es,(()=>{for(const t of we.find('[data-bs-spy="scroll"]'))Ls.getOrCreateInstance(t)})),Qt(Ls);const Ss=".bs.tab",Ds=`hide${Ss}`,$s=`hidden${Ss}`,Is=`show${Ss}`,Ns=`shown${Ss}`,Ps=`click${Ss}`,Ms=`keydown${Ss}`,js=`load${Ss}`,Fs="ArrowLeft",Hs="ArrowRight",Bs="ArrowUp",Ws="ArrowDown",zs="Home",Rs="End",qs="active",Vs="fade",Ys="show",Ks=".dropdown-toggle",Qs=`:not(${Ks})`,Xs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Us=`.nav-link${Qs}, .list-group-item${Qs}, [role="tab"]${Qs}, ${Xs}`,Gs=`.${qs}[data-bs-toggle="tab"], .${qs}[data-bs-toggle="pill"], .${qs}[data-bs-toggle="list"]`;class Js extends ve{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),fe.on(this._element,Ms,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?fe.trigger(e,Ds,{relatedTarget:t}):null;fe.trigger(t,Is,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(qs),this._activate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),fe.trigger(t,Ns,{relatedTarget:e})):t.classList.add(Ys)}),t,t.classList.contains(Vs)))}_deactivate(t,e){t&&(t.classList.remove(qs),t.blur(),this._deactivate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),fe.trigger(t,$s,{relatedTarget:e})):t.classList.remove(Ys)}),t,t.classList.contains(Vs)))}_keydown(t){if(![Fs,Hs,Bs,Ws,zs,Rs].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!Wt(t)));let i;if([zs,Rs].includes(t.key))i=e[t.key===zs?0:e.length-1];else{const n=[Hs,Ws].includes(t.key);i=Gt(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Js.getOrCreateInstance(i).show())}_getChildren(){return we.find(Us,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=we.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=we.findOne(t,i);s&&s.classList.toggle(n,e)};n(Ks,qs),n(".dropdown-menu",Ys),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(qs)}_getInnerElement(t){return t.matches(Us)?t:we.findOne(Us,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Js.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(document,Ps,Xs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this)||Js.getOrCreateInstance(this).show()})),fe.on(window,js,(()=>{for(const t of we.find(Gs))Js.getOrCreateInstance(t)})),Qt(Js);const Zs=".bs.toast",to=`mouseover${Zs}`,eo=`mouseout${Zs}`,io=`focusin${Zs}`,no=`focusout${Zs}`,so=`hide${Zs}`,oo=`hidden${Zs}`,ro=`show${Zs}`,ao=`shown${Zs}`,lo="hide",co="show",ho="showing",uo={animation:"boolean",autohide:"boolean",delay:"number"},fo={animation:!0,autohide:!0,delay:5e3};class po extends ve{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return fo}static get DefaultType(){return uo}static get NAME(){return"toast"}show(){fe.trigger(this._element,ro).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(lo),qt(this._element),this._element.classList.add(co,ho),this._queueCallback((()=>{this._element.classList.remove(ho),fe.trigger(this._element,ao),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(fe.trigger(this._element,so).defaultPrevented||(this._element.classList.add(ho),this._queueCallback((()=>{this._element.classList.add(lo),this._element.classList.remove(ho,co),fe.trigger(this._element,oo)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(co),super.dispose()}isShown(){return this._element.classList.contains(co)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){fe.on(this._element,to,(t=>this._onInteraction(t,!0))),fe.on(this._element,eo,(t=>this._onInteraction(t,!1))),fe.on(this._element,io,(t=>this._onInteraction(t,!0))),fe.on(this._element,no,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=po.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}function mo(t){"loading"!=document.readyState?t():document.addEventListener("DOMContentLoaded",t)}Ee(po),Qt(po),mo((function(){[].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map((function(t){return new fs(t,{delay:{show:500,hide:100}})}))})),mo((function(){document.getElementById("pst-back-to-top").addEventListener("click",(function(){document.body.scrollTop=0,document.documentElement.scrollTop=0}))})),mo((function(){var t=document.getElementById("pst-back-to-top"),e=document.getElementsByClassName("bd-header")[0].getBoundingClientRect();window.addEventListener("scroll",(function(){this.oldScroll>this.scrollY&&this.scrollY>e.bottom?t.style.display="block":t.style.display="none",this.oldScroll=this.scrollY}))})),window.bootstrap=i})(); +//# sourceMappingURL=bootstrap.js.map \ No newline at end of file diff --git a/_static/scripts/bootstrap.js.LICENSE.txt b/_static/scripts/bootstrap.js.LICENSE.txt new file mode 100644 index 00000000..28755c2c --- /dev/null +++ b/_static/scripts/bootstrap.js.LICENSE.txt @@ -0,0 +1,5 @@ +/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ diff --git a/_static/scripts/bootstrap.js.map b/_static/scripts/bootstrap.js.map new file mode 100644 index 00000000..4a3502ae --- /dev/null +++ b/_static/scripts/bootstrap.js.map @@ -0,0 +1 @@ +{"version":3,"file":"scripts/bootstrap.js","mappings":";mBACA,IAAIA,EAAsB,CCA1BA,EAAwB,CAACC,EAASC,KACjC,IAAI,IAAIC,KAAOD,EACXF,EAAoBI,EAAEF,EAAYC,KAASH,EAAoBI,EAAEH,EAASE,IAC5EE,OAAOC,eAAeL,EAASE,EAAK,CAAEI,YAAY,EAAMC,IAAKN,EAAWC,IAE1E,ECNDH,EAAwB,CAACS,EAAKC,IAAUL,OAAOM,UAAUC,eAAeC,KAAKJ,EAAKC,GCClFV,EAAyBC,IACH,oBAAXa,QAA0BA,OAAOC,aAC1CV,OAAOC,eAAeL,EAASa,OAAOC,YAAa,CAAEC,MAAO,WAE7DX,OAAOC,eAAeL,EAAS,aAAc,CAAEe,OAAO,GAAO,01BCLvD,IAAI,EAAM,MACNC,EAAS,SACTC,EAAQ,QACRC,EAAO,OACPC,EAAO,OACPC,EAAiB,CAAC,EAAKJ,EAAQC,EAAOC,GACtCG,EAAQ,QACRC,EAAM,MACNC,EAAkB,kBAClBC,EAAW,WACXC,EAAS,SACTC,EAAY,YACZC,EAAmCP,EAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAIE,OAAO,CAACD,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAChE,GAAG,IACQ,EAA0B,GAAGS,OAAOX,EAAgB,CAACD,IAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAIE,OAAO,CAACD,EAAWA,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAC3E,GAAG,IAEQU,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAc,cACdC,EAAQ,QACRC,EAAa,aACbC,EAAiB,CAACT,EAAYC,EAAMC,EAAWC,EAAYC,EAAMC,EAAWC,EAAaC,EAAOC,GC9B5F,SAASE,EAAYC,GAClC,OAAOA,GAAWA,EAAQC,UAAY,IAAIC,cAAgB,IAC5D,CCFe,SAASC,EAAUC,GAChC,GAAY,MAARA,EACF,OAAOC,OAGT,GAAwB,oBAApBD,EAAKE,WAAkC,CACzC,IAAIC,EAAgBH,EAAKG,cACzB,OAAOA,GAAgBA,EAAcC,aAAwBH,MAC/D,CAEA,OAAOD,CACT,CCTA,SAASK,EAAUL,GAEjB,OAAOA,aADUD,EAAUC,GAAMM,SACIN,aAAgBM,OACvD,CAEA,SAASC,EAAcP,GAErB,OAAOA,aADUD,EAAUC,GAAMQ,aACIR,aAAgBQ,WACvD,CAEA,SAASC,EAAaT,GAEpB,MAA0B,oBAAfU,aAKJV,aADUD,EAAUC,GAAMU,YACIV,aAAgBU,WACvD,CCwDA,SACEC,KAAM,cACNC,SAAS,EACTC,MAAO,QACPC,GA5EF,SAAqBC,GACnB,IAAIC,EAAQD,EAAKC,MACjB3D,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIS,EAAQJ,EAAMK,OAAOV,IAAS,CAAC,EAC/BW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EACxCf,EAAUoB,EAAME,SAASP,GAExBJ,EAAcX,IAAaD,EAAYC,KAO5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUR,GACxC,IAAI3C,EAAQsD,EAAWX,IAET,IAAV3C,EACF4B,EAAQ4B,gBAAgBb,GAExBf,EAAQ6B,aAAad,GAAgB,IAAV3C,EAAiB,GAAKA,EAErD,IACF,GACF,EAoDE0D,OAlDF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MACdY,EAAgB,CAClBlD,OAAQ,CACNmD,SAAUb,EAAMc,QAAQC,SACxB5D,KAAM,IACN6D,IAAK,IACLC,OAAQ,KAEVC,MAAO,CACLL,SAAU,YAEZlD,UAAW,CAAC,GASd,OAPAtB,OAAOkE,OAAOP,EAAME,SAASxC,OAAO0C,MAAOQ,EAAclD,QACzDsC,EAAMK,OAASO,EAEXZ,EAAME,SAASgB,OACjB7E,OAAOkE,OAAOP,EAAME,SAASgB,MAAMd,MAAOQ,EAAcM,OAGnD,WACL7E,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIf,EAAUoB,EAAME,SAASP,GACzBW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EAGxCS,EAFkB/D,OAAO4D,KAAKD,EAAMK,OAAOzD,eAAe+C,GAAQK,EAAMK,OAAOV,GAAQiB,EAAcjB,IAE7E9B,QAAO,SAAUuC,EAAOe,GAElD,OADAf,EAAMe,GAAY,GACXf,CACT,GAAG,CAAC,GAECb,EAAcX,IAAaD,EAAYC,KAI5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUiB,GACxCxC,EAAQ4B,gBAAgBY,EAC1B,IACF,GACF,CACF,EASEC,SAAU,CAAC,kBCjFE,SAASC,EAAiBvD,GACvC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCHO,IAAI,EAAMC,KAAKC,IACX,EAAMD,KAAKE,IACXC,EAAQH,KAAKG,MCFT,SAASC,IACtB,IAAIC,EAASC,UAAUC,cAEvB,OAAc,MAAVF,GAAkBA,EAAOG,QAAUC,MAAMC,QAAQL,EAAOG,QACnDH,EAAOG,OAAOG,KAAI,SAAUC,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACjC,IAAGC,KAAK,KAGHT,UAAUU,SACnB,CCTe,SAASC,IACtB,OAAQ,iCAAiCC,KAAKd,IAChD,CCCe,SAASe,EAAsB/D,EAASgE,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAalE,EAAQ+D,wBACrBI,EAAS,EACTC,EAAS,EAETJ,GAAgBrD,EAAcX,KAChCmE,EAASnE,EAAQqE,YAAc,GAAItB,EAAMmB,EAAWI,OAAStE,EAAQqE,aAAmB,EACxFD,EAASpE,EAAQuE,aAAe,GAAIxB,EAAMmB,EAAWM,QAAUxE,EAAQuE,cAAoB,GAG7F,IACIE,GADOhE,EAAUT,GAAWG,EAAUH,GAAWK,QAC3BoE,eAEtBC,GAAoBb,KAAsBI,EAC1CU,GAAKT,EAAW3F,MAAQmG,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMT,EAC/FU,GAAKX,EAAW9B,KAAOsC,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMV,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BK,EAASN,EAAWM,OAASJ,EACjC,MAAO,CACLE,MAAOA,EACPE,OAAQA,EACRpC,IAAKyC,EACLvG,MAAOqG,EAAIL,EACXjG,OAAQwG,EAAIL,EACZjG,KAAMoG,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,EAAc/E,GACpC,IAAIkE,EAAaH,EAAsB/D,GAGnCsE,EAAQtE,EAAQqE,YAChBG,EAASxE,EAAQuE,aAUrB,OARI3B,KAAKoC,IAAId,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjB1B,KAAKoC,IAAId,EAAWM,OAASA,IAAW,IAC1CA,EAASN,EAAWM,QAGf,CACLG,EAAG3E,EAAQ4E,WACXC,EAAG7E,EAAQ8E,UACXR,MAAOA,EACPE,OAAQA,EAEZ,CCvBe,SAASS,EAASC,EAAQC,GACvC,IAAIC,EAAWD,EAAME,aAAeF,EAAME,cAE1C,GAAIH,EAAOD,SAASE,GAClB,OAAO,EAEJ,GAAIC,GAAYvE,EAAauE,GAAW,CACzC,IAAIE,EAAOH,EAEX,EAAG,CACD,GAAIG,GAAQJ,EAAOK,WAAWD,GAC5B,OAAO,EAITA,EAAOA,EAAKE,YAAcF,EAAKG,IACjC,OAASH,EACX,CAGF,OAAO,CACT,CCrBe,SAAS,EAAiBtF,GACvC,OAAOG,EAAUH,GAAS0F,iBAAiB1F,EAC7C,CCFe,SAAS2F,EAAe3F,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4F,QAAQ7F,EAAYC,KAAa,CAChE,CCFe,SAAS6F,EAAmB7F,GAEzC,QAASS,EAAUT,GAAWA,EAAQO,cACtCP,EAAQ8F,WAAazF,OAAOyF,UAAUC,eACxC,CCFe,SAASC,EAAchG,GACpC,MAA6B,SAAzBD,EAAYC,GACPA,EAMPA,EAAQiG,cACRjG,EAAQwF,aACR3E,EAAab,GAAWA,EAAQyF,KAAO,OAEvCI,EAAmB7F,EAGvB,CCVA,SAASkG,EAAoBlG,GAC3B,OAAKW,EAAcX,IACoB,UAAvC,EAAiBA,GAASiC,SAInBjC,EAAQmG,aAHN,IAIX,CAwCe,SAASC,EAAgBpG,GAItC,IAHA,IAAIK,EAASF,EAAUH,GACnBmG,EAAeD,EAAoBlG,GAEhCmG,GAAgBR,EAAeQ,IAA6D,WAA5C,EAAiBA,GAAclE,UACpFkE,EAAeD,EAAoBC,GAGrC,OAAIA,IAA+C,SAA9BpG,EAAYoG,IAA0D,SAA9BpG,EAAYoG,IAAwE,WAA5C,EAAiBA,GAAclE,UAC3H5B,EAGF8F,GAhDT,SAA4BnG,GAC1B,IAAIqG,EAAY,WAAWvC,KAAKd,KAGhC,GAFW,WAAWc,KAAKd,MAEfrC,EAAcX,IAII,UAFX,EAAiBA,GAEnBiC,SACb,OAAO,KAIX,IAAIqE,EAAcN,EAAchG,GAMhC,IAJIa,EAAayF,KACfA,EAAcA,EAAYb,MAGrB9E,EAAc2F,IAAgB,CAAC,OAAQ,QAAQV,QAAQ7F,EAAYuG,IAAgB,GAAG,CAC3F,IAAIC,EAAM,EAAiBD,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAed,QAAQW,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAIK,QAAyB,SAAfL,EAAIK,OACjO,OAAON,EAEPA,EAAcA,EAAYd,UAE9B,CAEA,OAAO,IACT,CAgByBqB,CAAmB7G,IAAYK,CACxD,CCpEe,SAASyG,EAAyB3H,GAC/C,MAAO,CAAC,MAAO,UAAUyG,QAAQzG,IAAc,EAAI,IAAM,GAC3D,CCDO,SAAS4H,EAAOjE,EAAK1E,EAAOyE,GACjC,OAAO,EAAQC,EAAK,EAAQ1E,EAAOyE,GACrC,CCFe,SAASmE,EAAmBC,GACzC,OAAOxJ,OAAOkE,OAAO,CAAC,ECDf,CACLS,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuC0I,EACjD,CEHe,SAASC,EAAgB9I,EAAOiD,GAC7C,OAAOA,EAAKpC,QAAO,SAAUkI,EAAS5J,GAEpC,OADA4J,EAAQ5J,GAAOa,EACR+I,CACT,GAAG,CAAC,EACN,CC4EA,SACEpG,KAAM,QACNC,SAAS,EACTC,MAAO,OACPC,GApEF,SAAeC,GACb,IAAIiG,EAEAhG,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZmB,EAAUf,EAAKe,QACfmF,EAAejG,EAAME,SAASgB,MAC9BgF,EAAgBlG,EAAMmG,cAAcD,cACpCE,EAAgB9E,EAAiBtB,EAAMjC,WACvCsI,EAAOX,EAAyBU,GAEhCE,EADa,CAACnJ,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIL,EAxBgB,SAAyBU,EAASvG,GAItD,OAAO4F,EAAsC,iBAH7CW,EAA6B,mBAAZA,EAAyBA,EAAQlK,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CAC/EzI,UAAWiC,EAAMjC,aACbwI,GACkDA,EAAUT,EAAgBS,EAASlJ,GAC7F,CAmBsBoJ,CAAgB3F,EAAQyF,QAASvG,GACjD0G,EAAY/C,EAAcsC,GAC1BU,EAAmB,MAATN,EAAe,EAAMlJ,EAC/ByJ,EAAmB,MAATP,EAAepJ,EAASC,EAClC2J,EAAU7G,EAAMwG,MAAM7I,UAAU2I,GAAOtG,EAAMwG,MAAM7I,UAAU0I,GAAQH,EAAcG,GAAQrG,EAAMwG,MAAM9I,OAAO4I,GAC9GQ,EAAYZ,EAAcG,GAAQrG,EAAMwG,MAAM7I,UAAU0I,GACxDU,EAAoB/B,EAAgBiB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9CpF,EAAMmE,EAAcc,GACpBlF,EAAMuF,EAAaN,EAAUJ,GAAOT,EAAce,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS1B,EAAOjE,EAAK0F,EAAQ3F,GAE7B6F,EAAWjB,EACfrG,EAAMmG,cAAcxG,KAASqG,EAAwB,CAAC,GAAyBsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnBzJ,CAoBF,EAkCEtF,OAhCF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MAEdwH,EADU7G,EAAMG,QACWlC,QAC3BqH,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAejG,EAAME,SAASxC,OAAO+J,cAAcxB,MAOhDpC,EAAS7D,EAAME,SAASxC,OAAQuI,KAIrCjG,EAAME,SAASgB,MAAQ+E,EACzB,EASE5E,SAAU,CAAC,iBACXqG,iBAAkB,CAAC,oBCxFN,SAASC,EAAa5J,GACnC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCOA,IAAIqG,GAAa,CACf5G,IAAK,OACL9D,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAAS0K,GAAYlH,GAC1B,IAAImH,EAEApK,EAASiD,EAAMjD,OACfqK,EAAapH,EAAMoH,WACnBhK,EAAY4C,EAAM5C,UAClBiK,EAAYrH,EAAMqH,UAClBC,EAAUtH,EAAMsH,QAChBpH,EAAWF,EAAME,SACjBqH,EAAkBvH,EAAMuH,gBACxBC,EAAWxH,EAAMwH,SACjBC,EAAezH,EAAMyH,aACrBC,EAAU1H,EAAM0H,QAChBC,EAAaL,EAAQ1E,EACrBA,OAAmB,IAAf+E,EAAwB,EAAIA,EAChCC,EAAaN,EAAQxE,EACrBA,OAAmB,IAAf8E,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5D7E,EAAGA,EACHE,IACG,CACHF,EAAGA,EACHE,GAGFF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EACV,IAAIgF,EAAOR,EAAQrL,eAAe,KAC9B8L,EAAOT,EAAQrL,eAAe,KAC9B+L,EAAQxL,EACRyL,EAAQ,EACRC,EAAM5J,OAEV,GAAIkJ,EAAU,CACZ,IAAIpD,EAAeC,EAAgBtH,GAC/BoL,EAAa,eACbC,EAAY,cAEZhE,IAAiBhG,EAAUrB,IAGmB,WAA5C,EAFJqH,EAAeN,EAAmB/G,IAECmD,UAAsC,aAAbA,IAC1DiI,EAAa,eACbC,EAAY,gBAOZhL,IAAc,IAAQA,IAAcZ,GAAQY,IAAcb,IAAU8K,IAAczK,KACpFqL,EAAQ3L,EAGRwG,IAFc4E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeD,OACzF2B,EAAa+D,IACEf,EAAW3E,OAC1BK,GAAKyE,EAAkB,GAAK,GAG1BnK,IAAcZ,IAASY,IAAc,GAAOA,IAAcd,GAAW+K,IAAczK,KACrFoL,EAAQzL,EAGRqG,IAFc8E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeH,MACzF6B,EAAagE,IACEhB,EAAW7E,MAC1BK,GAAK2E,EAAkB,GAAK,EAEhC,CAEA,IAgBMc,EAhBFC,EAAe5M,OAAOkE,OAAO,CAC/BM,SAAUA,GACTsH,GAAYP,IAEXsB,GAAyB,IAAjBd,EAlFd,SAA2BrI,EAAM8I,GAC/B,IAAItF,EAAIxD,EAAKwD,EACTE,EAAI1D,EAAK0D,EACT0F,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACL7F,EAAG5B,EAAM4B,EAAI4F,GAAOA,GAAO,EAC3B1F,EAAG9B,EAAM8B,EAAI0F,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpD9F,EAAGA,EACHE,GACC1E,EAAUrB,IAAW,CACtB6F,EAAGA,EACHE,GAMF,OAHAF,EAAI2F,EAAM3F,EACVE,EAAIyF,EAAMzF,EAENyE,EAGK7L,OAAOkE,OAAO,CAAC,EAAG0I,IAAeD,EAAiB,CAAC,GAAkBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe5D,WAAayD,EAAIO,kBAAoB,IAAM,EAAI,aAAe7F,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAUuF,IAG5R3M,OAAOkE,OAAO,CAAC,EAAG0I,IAAenB,EAAkB,CAAC,GAAmBc,GAASF,EAAOjF,EAAI,KAAO,GAAIqE,EAAgBa,GAASF,EAAOlF,EAAI,KAAO,GAAIuE,EAAgB1C,UAAY,GAAI0C,GAC9L,CA4CA,UACEnI,KAAM,gBACNC,SAAS,EACTC,MAAO,cACPC,GA9CF,SAAuBwJ,GACrB,IAAItJ,EAAQsJ,EAAMtJ,MACdc,EAAUwI,EAAMxI,QAChByI,EAAwBzI,EAAQoH,gBAChCA,OAA4C,IAA1BqB,GAA0CA,EAC5DC,EAAoB1I,EAAQqH,SAC5BA,OAAiC,IAAtBqB,GAAsCA,EACjDC,EAAwB3I,EAAQsH,aAChCA,OAAyC,IAA1BqB,GAA0CA,EACzDR,EAAe,CACjBlL,UAAWuD,EAAiBtB,EAAMjC,WAClCiK,UAAWL,EAAa3H,EAAMjC,WAC9BL,OAAQsC,EAAME,SAASxC,OACvBqK,WAAY/H,EAAMwG,MAAM9I,OACxBwK,gBAAiBA,EACjBG,QAAoC,UAA3BrI,EAAMc,QAAQC,UAGgB,MAArCf,EAAMmG,cAAcD,gBACtBlG,EAAMK,OAAO3C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAO3C,OAAQmK,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACvGhB,QAASjI,EAAMmG,cAAcD,cAC7BrF,SAAUb,EAAMc,QAAQC,SACxBoH,SAAUA,EACVC,aAAcA,OAIe,MAA7BpI,EAAMmG,cAAcjF,QACtBlB,EAAMK,OAAOa,MAAQ7E,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAOa,MAAO2G,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACrGhB,QAASjI,EAAMmG,cAAcjF,MAC7BL,SAAU,WACVsH,UAAU,EACVC,aAAcA,OAIlBpI,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,wBAAyBsC,EAAMjC,WAEnC,EAQE2L,KAAM,CAAC,GCrKT,IAAIC,GAAU,CACZA,SAAS,GAsCX,UACEhK,KAAM,iBACNC,SAAS,EACTC,MAAO,QACPC,GAAI,WAAe,EACnBY,OAxCF,SAAgBX,GACd,IAAIC,EAAQD,EAAKC,MACb4J,EAAW7J,EAAK6J,SAChB9I,EAAUf,EAAKe,QACf+I,EAAkB/I,EAAQgJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkBjJ,EAAQkJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7C9K,EAASF,EAAUiB,EAAME,SAASxC,QAClCuM,EAAgB,GAAGjM,OAAOgC,EAAMiK,cAActM,UAAWqC,EAAMiK,cAAcvM,QAYjF,OAVIoM,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaC,iBAAiB,SAAUP,EAASQ,OAAQT,GAC3D,IAGEK,GACF/K,EAAOkL,iBAAiB,SAAUP,EAASQ,OAAQT,IAG9C,WACDG,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaG,oBAAoB,SAAUT,EAASQ,OAAQT,GAC9D,IAGEK,GACF/K,EAAOoL,oBAAoB,SAAUT,EAASQ,OAAQT,GAE1D,CACF,EASED,KAAM,CAAC,GC/CT,IAAIY,GAAO,CACTnN,KAAM,QACND,MAAO,OACPD,OAAQ,MACR+D,IAAK,UAEQ,SAASuJ,GAAqBxM,GAC3C,OAAOA,EAAUyM,QAAQ,0BAA0B,SAAUC,GAC3D,OAAOH,GAAKG,EACd,GACF,CCVA,IAAI,GAAO,CACTnN,MAAO,MACPC,IAAK,SAEQ,SAASmN,GAA8B3M,GACpD,OAAOA,EAAUyM,QAAQ,cAAc,SAAUC,GAC/C,OAAO,GAAKA,EACd,GACF,CCPe,SAASE,GAAgB3L,GACtC,IAAI6J,EAAM9J,EAAUC,GAGpB,MAAO,CACL4L,WAHe/B,EAAIgC,YAInBC,UAHcjC,EAAIkC,YAKtB,CCNe,SAASC,GAAoBpM,GAQ1C,OAAO+D,EAAsB8B,EAAmB7F,IAAUzB,KAAOwN,GAAgB/L,GAASgM,UAC5F,CCXe,SAASK,GAAerM,GAErC,IAAIsM,EAAoB,EAAiBtM,GACrCuM,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6B3I,KAAKyI,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBtM,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAawF,QAAQ7F,EAAYK,KAAU,EAEvDA,EAAKG,cAAcoM,KAGxBhM,EAAcP,IAASiM,GAAejM,GACjCA,EAGFsM,GAAgB1G,EAAc5F,GACvC,CCJe,SAASwM,GAAkB5M,EAAS6M,GACjD,IAAIC,OAES,IAATD,IACFA,EAAO,IAGT,IAAIvB,EAAeoB,GAAgB1M,GAC/B+M,EAASzB,KAAqE,OAAlDwB,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,MACpH1C,EAAM9J,EAAUmL,GAChB0B,EAASD,EAAS,CAAC9C,GAAK7K,OAAO6K,EAAIxF,gBAAkB,GAAI4H,GAAef,GAAgBA,EAAe,IAAMA,EAC7G2B,EAAcJ,EAAKzN,OAAO4N,GAC9B,OAAOD,EAASE,EAChBA,EAAY7N,OAAOwN,GAAkB5G,EAAcgH,IACrD,CCzBe,SAASE,GAAiBC,GACvC,OAAO1P,OAAOkE,OAAO,CAAC,EAAGwL,EAAM,CAC7B5O,KAAM4O,EAAKxI,EACXvC,IAAK+K,EAAKtI,EACVvG,MAAO6O,EAAKxI,EAAIwI,EAAK7I,MACrBjG,OAAQ8O,EAAKtI,EAAIsI,EAAK3I,QAE1B,CCqBA,SAAS4I,GAA2BpN,EAASqN,EAAgBlL,GAC3D,OAAOkL,IAAmBxO,EAAWqO,GCzBxB,SAAyBlN,EAASmC,GAC/C,IAAI8H,EAAM9J,EAAUH,GAChBsN,EAAOzH,EAAmB7F,GAC1ByE,EAAiBwF,EAAIxF,eACrBH,EAAQgJ,EAAKhF,YACb9D,EAAS8I,EAAKjF,aACd1D,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBH,EAAQG,EAAeH,MACvBE,EAASC,EAAeD,OACxB,IAAI+I,EAAiB1J,KAEjB0J,IAAmBA,GAA+B,UAAbpL,KACvCwC,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEvB,CAEA,MAAO,CACLR,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EAAIyH,GAAoBpM,GAC3B6E,EAAGA,EAEP,CDDwD2I,CAAgBxN,EAASmC,IAAa1B,EAAU4M,GAdxG,SAAoCrN,EAASmC,GAC3C,IAAIgL,EAAOpJ,EAAsB/D,GAAS,EAAoB,UAAbmC,GASjD,OARAgL,EAAK/K,IAAM+K,EAAK/K,IAAMpC,EAAQyN,UAC9BN,EAAK5O,KAAO4O,EAAK5O,KAAOyB,EAAQ0N,WAChCP,EAAK9O,OAAS8O,EAAK/K,IAAMpC,EAAQqI,aACjC8E,EAAK7O,MAAQ6O,EAAK5O,KAAOyB,EAAQsI,YACjC6E,EAAK7I,MAAQtE,EAAQsI,YACrB6E,EAAK3I,OAASxE,EAAQqI,aACtB8E,EAAKxI,EAAIwI,EAAK5O,KACd4O,EAAKtI,EAAIsI,EAAK/K,IACP+K,CACT,CAG0HQ,CAA2BN,EAAgBlL,GAAY+K,GEtBlK,SAAyBlN,GACtC,IAAI8M,EAEAQ,EAAOzH,EAAmB7F,GAC1B4N,EAAY7B,GAAgB/L,GAC5B2M,EAA0D,OAAlDG,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,KAChGrI,EAAQ,EAAIgJ,EAAKO,YAAaP,EAAKhF,YAAaqE,EAAOA,EAAKkB,YAAc,EAAGlB,EAAOA,EAAKrE,YAAc,GACvG9D,EAAS,EAAI8I,EAAKQ,aAAcR,EAAKjF,aAAcsE,EAAOA,EAAKmB,aAAe,EAAGnB,EAAOA,EAAKtE,aAAe,GAC5G1D,GAAKiJ,EAAU5B,WAAaI,GAAoBpM,GAChD6E,GAAK+I,EAAU1B,UAMnB,MAJiD,QAA7C,EAAiBS,GAAQW,GAAMS,YACjCpJ,GAAK,EAAI2I,EAAKhF,YAAaqE,EAAOA,EAAKrE,YAAc,GAAKhE,GAGrD,CACLA,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMmJ,CAAgBnI,EAAmB7F,IACrO,CG1Be,SAASiO,GAAe9M,GACrC,IAOIkI,EAPAtK,EAAYoC,EAAKpC,UACjBiB,EAAUmB,EAAKnB,QACfb,EAAYgC,EAAKhC,UACjBqI,EAAgBrI,EAAYuD,EAAiBvD,GAAa,KAC1DiK,EAAYjK,EAAY4J,EAAa5J,GAAa,KAClD+O,EAAUnP,EAAU4F,EAAI5F,EAAUuF,MAAQ,EAAItE,EAAQsE,MAAQ,EAC9D6J,EAAUpP,EAAU8F,EAAI9F,EAAUyF,OAAS,EAAIxE,EAAQwE,OAAS,EAGpE,OAAQgD,GACN,KAAK,EACH6B,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI7E,EAAQwE,QAE3B,MAEF,KAAKnG,EACHgL,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI9F,EAAUyF,QAE7B,MAEF,KAAKlG,EACH+K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI5F,EAAUuF,MAC3BO,EAAGsJ,GAEL,MAEF,KAAK5P,EACH8K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI3E,EAAQsE,MACzBO,EAAGsJ,GAEL,MAEF,QACE9E,EAAU,CACR1E,EAAG5F,EAAU4F,EACbE,EAAG9F,EAAU8F,GAInB,IAAIuJ,EAAW5G,EAAgBV,EAAyBU,GAAiB,KAEzE,GAAgB,MAAZ4G,EAAkB,CACpB,IAAI1G,EAAmB,MAAb0G,EAAmB,SAAW,QAExC,OAAQhF,GACN,KAAK1K,EACH2K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAC7E,MAEF,KAAK/I,EACH0K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAKnF,CAEA,OAAO2B,CACT,CC3De,SAASgF,GAAejN,EAAOc,QAC5B,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACXqM,EAAqBD,EAASnP,UAC9BA,OAAmC,IAAvBoP,EAAgCnN,EAAMjC,UAAYoP,EAC9DC,EAAoBF,EAASnM,SAC7BA,OAAiC,IAAtBqM,EAA+BpN,EAAMe,SAAWqM,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+B7P,EAAkB6P,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmC9P,EAAW8P,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmC/P,EAAS+P,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAAS3G,QAC5BA,OAA+B,IAArBsH,EAA8B,EAAIA,EAC5ChI,EAAgBD,EAAsC,iBAAZW,EAAuBA,EAAUT,EAAgBS,EAASlJ,IACpGyQ,EAAaJ,IAAmBhQ,EAASC,EAAYD,EACrDqK,EAAa/H,EAAMwG,MAAM9I,OACzBkB,EAAUoB,EAAME,SAAS0N,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBnP,EAAS0O,EAAUE,EAAczM,GACvE,IAAIiN,EAAmC,oBAAbV,EAlB5B,SAA4B1O,GAC1B,IAAIpB,EAAkBgO,GAAkB5G,EAAchG,IAElDqP,EADoB,CAAC,WAAY,SAASzJ,QAAQ,EAAiB5F,GAASiC,WAAa,GACnDtB,EAAcX,GAAWoG,EAAgBpG,GAAWA,EAE9F,OAAKS,EAAU4O,GAKRzQ,EAAgBgI,QAAO,SAAUyG,GACtC,OAAO5M,EAAU4M,IAAmBpI,EAASoI,EAAgBgC,IAAmD,SAAhCtP,EAAYsN,EAC9F,IANS,EAOX,CAK6DiC,CAAmBtP,GAAW,GAAGZ,OAAOsP,GAC/F9P,EAAkB,GAAGQ,OAAOgQ,EAAqB,CAACR,IAClDW,EAAsB3Q,EAAgB,GACtC4Q,EAAe5Q,EAAgBK,QAAO,SAAUwQ,EAASpC,GAC3D,IAAIF,EAAOC,GAA2BpN,EAASqN,EAAgBlL,GAK/D,OAJAsN,EAAQrN,IAAM,EAAI+K,EAAK/K,IAAKqN,EAAQrN,KACpCqN,EAAQnR,MAAQ,EAAI6O,EAAK7O,MAAOmR,EAAQnR,OACxCmR,EAAQpR,OAAS,EAAI8O,EAAK9O,OAAQoR,EAAQpR,QAC1CoR,EAAQlR,KAAO,EAAI4O,EAAK5O,KAAMkR,EAAQlR,MAC/BkR,CACT,GAAGrC,GAA2BpN,EAASuP,EAAqBpN,IAK5D,OAJAqN,EAAalL,MAAQkL,EAAalR,MAAQkR,EAAajR,KACvDiR,EAAahL,OAASgL,EAAanR,OAASmR,EAAapN,IACzDoN,EAAa7K,EAAI6K,EAAajR,KAC9BiR,EAAa3K,EAAI2K,EAAapN,IACvBoN,CACT,CInC2BE,CAAgBjP,EAAUT,GAAWA,EAAUA,EAAQ2P,gBAAkB9J,EAAmBzE,EAAME,SAASxC,QAAS4P,EAAUE,EAAczM,GACjKyN,EAAsB7L,EAAsB3C,EAAME,SAASvC,WAC3DuI,EAAgB2G,GAAe,CACjClP,UAAW6Q,EACX5P,QAASmJ,EACThH,SAAU,WACVhD,UAAWA,IAET0Q,EAAmB3C,GAAiBzP,OAAOkE,OAAO,CAAC,EAAGwH,EAAY7B,IAClEwI,EAAoBhB,IAAmBhQ,EAAS+Q,EAAmBD,EAGnEG,EAAkB,CACpB3N,IAAK+M,EAAmB/M,IAAM0N,EAAkB1N,IAAM6E,EAAc7E,IACpE/D,OAAQyR,EAAkBzR,OAAS8Q,EAAmB9Q,OAAS4I,EAAc5I,OAC7EE,KAAM4Q,EAAmB5Q,KAAOuR,EAAkBvR,KAAO0I,EAAc1I,KACvED,MAAOwR,EAAkBxR,MAAQ6Q,EAAmB7Q,MAAQ2I,EAAc3I,OAExE0R,EAAa5O,EAAMmG,cAAckB,OAErC,GAAIqG,IAAmBhQ,GAAUkR,EAAY,CAC3C,IAAIvH,EAASuH,EAAW7Q,GACxB1B,OAAO4D,KAAK0O,GAAiBxO,SAAQ,SAAUhE,GAC7C,IAAI0S,EAAW,CAAC3R,EAAOD,GAAQuH,QAAQrI,IAAQ,EAAI,GAAK,EACpDkK,EAAO,CAAC,EAAKpJ,GAAQuH,QAAQrI,IAAQ,EAAI,IAAM,IACnDwS,EAAgBxS,IAAQkL,EAAOhB,GAAQwI,CACzC,GACF,CAEA,OAAOF,CACT,CCyEA,UACEhP,KAAM,OACNC,SAAS,EACTC,MAAO,OACPC,GA5HF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KAEhB,IAAIK,EAAMmG,cAAcxG,GAAMmP,MAA9B,CAoCA,IAhCA,IAAIC,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BtO,EAAQuO,mBACtC9I,EAAUzF,EAAQyF,QAClB+G,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtB0B,EAAwBxO,EAAQyO,eAChCA,OAA2C,IAA1BD,GAA0CA,EAC3DE,EAAwB1O,EAAQ0O,sBAChCC,EAAqBzP,EAAMc,QAAQ/C,UACnCqI,EAAgB9E,EAAiBmO,GAEjCJ,EAAqBD,IADHhJ,IAAkBqJ,GACqCF,EAjC/E,SAAuCxR,GACrC,GAAIuD,EAAiBvD,KAAeX,EAClC,MAAO,GAGT,IAAIsS,EAAoBnF,GAAqBxM,GAC7C,MAAO,CAAC2M,GAA8B3M,GAAY2R,EAAmBhF,GAA8BgF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAAClF,GAAqBkF,KAChHG,EAAa,CAACH,GAAoBzR,OAAOqR,GAAoBxR,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAIE,OAAOsD,EAAiBvD,KAAeX,ECvCvC,SAA8B4C,EAAOc,QAClC,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACX/C,EAAYmP,EAASnP,UACrBuP,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBjH,EAAU2G,EAAS3G,QACnBgJ,EAAiBrC,EAASqC,eAC1BM,EAAwB3C,EAASsC,sBACjCA,OAAkD,IAA1BK,EAAmC,EAAgBA,EAC3E7H,EAAYL,EAAa5J,GACzB6R,EAAa5H,EAAYuH,EAAiB3R,EAAsBA,EAAoB4H,QAAO,SAAUzH,GACvG,OAAO4J,EAAa5J,KAAeiK,CACrC,IAAK3K,EACDyS,EAAoBF,EAAWpK,QAAO,SAAUzH,GAClD,OAAOyR,EAAsBhL,QAAQzG,IAAc,CACrD,IAEiC,IAA7B+R,EAAkBC,SACpBD,EAAoBF,GAItB,IAAII,EAAYF,EAAkBjS,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAakP,GAAejN,EAAO,CACrCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,IACRjF,EAAiBvD,IACbD,CACT,GAAG,CAAC,GACJ,OAAOzB,OAAO4D,KAAK+P,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EAClC,GACF,CDC6DC,CAAqBpQ,EAAO,CACnFjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTgJ,eAAgBA,EAChBC,sBAAuBA,IACpBzR,EACP,GAAG,IACCsS,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzB4S,EAAY,IAAIC,IAChBC,GAAqB,EACrBC,EAAwBb,EAAW,GAE9Bc,EAAI,EAAGA,EAAId,EAAWG,OAAQW,IAAK,CAC1C,IAAI3S,EAAY6R,EAAWc,GAEvBC,EAAiBrP,EAAiBvD,GAElC6S,EAAmBjJ,EAAa5J,KAAeT,EAC/CuT,EAAa,CAAC,EAAK5T,GAAQuH,QAAQmM,IAAmB,EACtDrK,EAAMuK,EAAa,QAAU,SAC7B1F,EAAW8B,GAAejN,EAAO,CACnCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACbrH,QAASA,IAEPuK,EAAoBD,EAAaD,EAAmB1T,EAAQC,EAAOyT,EAAmB3T,EAAS,EAE/FoT,EAAc/J,GAAOyB,EAAWzB,KAClCwK,EAAoBvG,GAAqBuG,IAG3C,IAAIC,EAAmBxG,GAAqBuG,GACxCE,EAAS,GAUb,GARIhC,GACFgC,EAAOC,KAAK9F,EAASwF,IAAmB,GAGtCxB,GACF6B,EAAOC,KAAK9F,EAAS2F,IAAsB,EAAG3F,EAAS4F,IAAqB,GAG1EC,EAAOE,OAAM,SAAUC,GACzB,OAAOA,CACT,IAAI,CACFV,EAAwB1S,EACxByS,GAAqB,EACrB,KACF,CAEAF,EAAUc,IAAIrT,EAAWiT,EAC3B,CAEA,GAAIR,EAqBF,IAnBA,IAEIa,EAAQ,SAAeC,GACzB,IAAIC,EAAmB3B,EAAW4B,MAAK,SAAUzT,GAC/C,IAAIiT,EAASV,EAAU9T,IAAIuB,GAE3B,GAAIiT,EACF,OAAOA,EAAOS,MAAM,EAAGH,GAAIJ,OAAM,SAAUC,GACzC,OAAOA,CACT,GAEJ,IAEA,GAAII,EAEF,OADAd,EAAwBc,EACjB,OAEX,EAESD,EAnBY/B,EAAiB,EAAI,EAmBZ+B,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCtR,EAAMjC,YAAc0S,IACtBzQ,EAAMmG,cAAcxG,GAAMmP,OAAQ,EAClC9O,EAAMjC,UAAY0S,EAClBzQ,EAAM0R,OAAQ,EA5GhB,CA8GF,EAQEhK,iBAAkB,CAAC,UACnBgC,KAAM,CACJoF,OAAO,IE7IX,SAAS6C,GAAexG,EAAUY,EAAM6F,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjBrO,EAAG,EACHE,EAAG,IAIA,CACLzC,IAAKmK,EAASnK,IAAM+K,EAAK3I,OAASwO,EAAiBnO,EACnDvG,MAAOiO,EAASjO,MAAQ6O,EAAK7I,MAAQ0O,EAAiBrO,EACtDtG,OAAQkO,EAASlO,OAAS8O,EAAK3I,OAASwO,EAAiBnO,EACzDtG,KAAMgO,EAAShO,KAAO4O,EAAK7I,MAAQ0O,EAAiBrO,EAExD,CAEA,SAASsO,GAAsB1G,GAC7B,MAAO,CAAC,EAAKjO,EAAOD,EAAQE,GAAM2U,MAAK,SAAUC,GAC/C,OAAO5G,EAAS4G,IAAS,CAC3B,GACF,CA+BA,UACEpS,KAAM,OACNC,SAAS,EACTC,MAAO,OACP6H,iBAAkB,CAAC,mBACnB5H,GAlCF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZ0Q,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBkU,EAAmB5R,EAAMmG,cAAc6L,gBACvCC,EAAoBhF,GAAejN,EAAO,CAC5C0N,eAAgB,cAEdwE,EAAoBjF,GAAejN,EAAO,CAC5C4N,aAAa,IAEXuE,EAA2BR,GAAeM,EAAmB5B,GAC7D+B,EAAsBT,GAAeO,EAAmBnK,EAAY6J,GACpES,EAAoBR,GAAsBM,GAC1CG,EAAmBT,GAAsBO,GAC7CpS,EAAMmG,cAAcxG,GAAQ,CAC1BwS,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBtS,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,+BAAgC2U,EAChC,sBAAuBC,GAE3B,GCJA,IACE3S,KAAM,SACNC,SAAS,EACTC,MAAO,OACPwB,SAAU,CAAC,iBACXvB,GA5BF,SAAgBa,GACd,IAAIX,EAAQW,EAAMX,MACdc,EAAUH,EAAMG,QAChBnB,EAAOgB,EAAMhB,KACb4S,EAAkBzR,EAAQuG,OAC1BA,OAA6B,IAApBkL,EAA6B,CAAC,EAAG,GAAKA,EAC/C7I,EAAO,EAAW7L,QAAO,SAAUC,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWyI,EAAOa,GACxD,IAAIjB,EAAgB9E,EAAiBvD,GACjCyU,EAAiB,CAACrV,EAAM,GAAKqH,QAAQ4B,IAAkB,GAAK,EAAI,EAEhErG,EAAyB,mBAAXsH,EAAwBA,EAAOhL,OAAOkE,OAAO,CAAC,EAAGiG,EAAO,CACxEzI,UAAWA,KACPsJ,EACFoL,EAAW1S,EAAK,GAChB2S,EAAW3S,EAAK,GAIpB,OAFA0S,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACrV,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAAI,CACjD7C,EAAGmP,EACHjP,EAAGgP,GACD,CACFlP,EAAGkP,EACHhP,EAAGiP,EAEP,CASqBC,CAAwB5U,EAAWiC,EAAMwG,MAAOa,GAC1DvJ,CACT,GAAG,CAAC,GACA8U,EAAwBlJ,EAAK1J,EAAMjC,WACnCwF,EAAIqP,EAAsBrP,EAC1BE,EAAImP,EAAsBnP,EAEW,MAArCzD,EAAMmG,cAAcD,gBACtBlG,EAAMmG,cAAcD,cAAc3C,GAAKA,EACvCvD,EAAMmG,cAAcD,cAAczC,GAAKA,GAGzCzD,EAAMmG,cAAcxG,GAAQ+J,CAC9B,GC1BA,IACE/J,KAAM,gBACNC,SAAS,EACTC,MAAO,OACPC,GApBF,SAAuBC,GACrB,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KAKhBK,EAAMmG,cAAcxG,GAAQkN,GAAe,CACzClP,UAAWqC,EAAMwG,MAAM7I,UACvBiB,QAASoB,EAAMwG,MAAM9I,OACrBqD,SAAU,WACVhD,UAAWiC,EAAMjC,WAErB,EAQE2L,KAAM,CAAC,GCgHT,IACE/J,KAAM,kBACNC,SAAS,EACTC,MAAO,OACPC,GA/HF,SAAyBC,GACvB,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KACZoP,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrD3B,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtBrH,EAAUzF,EAAQyF,QAClBsM,EAAkB/R,EAAQgS,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBjS,EAAQkS,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtD5H,EAAW8B,GAAejN,EAAO,CACnCsN,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTqH,YAAaA,IAEXxH,EAAgB9E,EAAiBtB,EAAMjC,WACvCiK,EAAYL,EAAa3H,EAAMjC,WAC/BkV,GAAmBjL,EACnBgF,EAAWtH,EAAyBU,GACpC8I,ECrCY,MDqCSlC,ECrCH,IAAM,IDsCxB9G,EAAgBlG,EAAMmG,cAAcD,cACpCmK,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBwV,EAA4C,mBAAjBF,EAA8BA,EAAa3W,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CACvGzI,UAAWiC,EAAMjC,aACbiV,EACFG,EAA2D,iBAAtBD,EAAiC,CACxElG,SAAUkG,EACVhE,QAASgE,GACP7W,OAAOkE,OAAO,CAChByM,SAAU,EACVkC,QAAS,GACRgE,GACCE,EAAsBpT,EAAMmG,cAAckB,OAASrH,EAAMmG,cAAckB,OAAOrH,EAAMjC,WAAa,KACjG2L,EAAO,CACTnG,EAAG,EACHE,EAAG,GAGL,GAAKyC,EAAL,CAIA,GAAI8I,EAAe,CACjB,IAAIqE,EAEAC,EAAwB,MAAbtG,EAAmB,EAAM7P,EACpCoW,EAAuB,MAAbvG,EAAmB/P,EAASC,EACtCoJ,EAAmB,MAAb0G,EAAmB,SAAW,QACpC3F,EAASnB,EAAc8G,GACvBtL,EAAM2F,EAAS8D,EAASmI,GACxB7R,EAAM4F,EAAS8D,EAASoI,GACxBC,EAAWV,GAAU/K,EAAWzB,GAAO,EAAI,EAC3CmN,EAASzL,IAAc1K,EAAQ+S,EAAc/J,GAAOyB,EAAWzB,GAC/DoN,EAAS1L,IAAc1K,GAASyK,EAAWzB,IAAQ+J,EAAc/J,GAGjEL,EAAejG,EAAME,SAASgB,MAC9BwF,EAAYoM,GAAU7M,EAAetC,EAAcsC,GAAgB,CACrE/C,MAAO,EACPE,OAAQ,GAENuQ,GAAqB3T,EAAMmG,cAAc,oBAAsBnG,EAAMmG,cAAc,oBAAoBI,QxBhFtG,CACLvF,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EFyW,GAAkBD,GAAmBL,GACrCO,GAAkBF,GAAmBJ,GAMrCO,GAAWnO,EAAO,EAAG0K,EAAc/J,GAAMI,EAAUJ,IACnDyN,GAAYd,EAAkB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWF,GAAkBT,EAA4BnG,SAAWyG,EAASK,GAAWF,GAAkBT,EAA4BnG,SACxMgH,GAAYf,GAAmB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWD,GAAkBV,EAA4BnG,SAAW0G,EAASI,GAAWD,GAAkBV,EAA4BnG,SACzMjG,GAAoB/G,EAAME,SAASgB,OAAS8D,EAAgBhF,EAAME,SAASgB,OAC3E+S,GAAelN,GAAiC,MAAbiG,EAAmBjG,GAAkBsF,WAAa,EAAItF,GAAkBuF,YAAc,EAAI,EAC7H4H,GAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBpG,IAAqBqG,EAAwB,EAEvJc,GAAY9M,EAAS2M,GAAYE,GACjCE,GAAkBzO,EAAOmN,EAAS,EAAQpR,EAF9B2F,EAAS0M,GAAYG,GAAsBD,IAEKvS,EAAK2F,EAAQyL,EAAS,EAAQrR,EAAK0S,IAAa1S,GAChHyE,EAAc8G,GAAYoH,GAC1B1K,EAAKsD,GAAYoH,GAAkB/M,CACrC,CAEA,GAAI8H,EAAc,CAChB,IAAIkF,GAEAC,GAAyB,MAAbtH,EAAmB,EAAM7P,EAErCoX,GAAwB,MAAbvH,EAAmB/P,EAASC,EAEvCsX,GAAUtO,EAAcgJ,GAExBuF,GAAmB,MAAZvF,EAAkB,SAAW,QAEpCwF,GAAOF,GAAUrJ,EAASmJ,IAE1BK,GAAOH,GAAUrJ,EAASoJ,IAE1BK,IAAuD,IAAxC,CAAC,EAAKzX,GAAMqH,QAAQ4B,GAEnCyO,GAAyH,OAAjGR,GAAgD,MAAvBjB,OAA8B,EAASA,EAAoBlE,IAAoBmF,GAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAEzI6F,GAAaH,GAAeJ,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAAUyF,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwBlT,EAAK1E,EAAOyE,GACzC,IAAIwT,EAAItP,EAAOjE,EAAK1E,EAAOyE,GAC3B,OAAOwT,EAAIxT,EAAMA,EAAMwT,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAcpP,EAAOmN,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKzO,EAAcgJ,GAAW8F,GACzBtL,EAAKwF,GAAW8F,GAAmBR,EACrC,CAEAxU,EAAMmG,cAAcxG,GAAQ+J,CAvE5B,CAwEF,EAQEhC,iBAAkB,CAAC,WE1HN,SAASyN,GAAiBC,EAAyBrQ,EAAcsD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCrJ,ECJOJ,EFuBvCyW,EAA0B9V,EAAcwF,GACxCuQ,EAAuB/V,EAAcwF,IAf3C,SAAyBnG,GACvB,IAAImN,EAAOnN,EAAQ+D,wBACfI,EAASpB,EAAMoK,EAAK7I,OAAStE,EAAQqE,aAAe,EACpDD,EAASrB,EAAMoK,EAAK3I,QAAUxE,EAAQuE,cAAgB,EAC1D,OAAkB,IAAXJ,GAA2B,IAAXC,CACzB,CAU4DuS,CAAgBxQ,GACtEJ,EAAkBF,EAAmBM,GACrCgH,EAAOpJ,EAAsByS,EAAyBE,EAAsBjN,GAC5EyB,EAAS,CACXc,WAAY,EACZE,UAAW,GAET7C,EAAU,CACZ1E,EAAG,EACHE,EAAG,GAkBL,OAfI4R,IAA4BA,IAA4BhN,MACxB,SAA9B1J,EAAYoG,IAChBkG,GAAetG,MACbmF,GCnCgC9K,EDmCT+F,KClCdhG,EAAUC,IAAUO,EAAcP,GCJxC,CACL4L,YAFyChM,EDQbI,GCNR4L,WACpBE,UAAWlM,EAAQkM,WDGZH,GAAgB3L,IDoCnBO,EAAcwF,KAChBkD,EAAUtF,EAAsBoC,GAAc,IACtCxB,GAAKwB,EAAauH,WAC1BrE,EAAQxE,GAAKsB,EAAasH,WACjB1H,IACTsD,EAAQ1E,EAAIyH,GAAoBrG,KAI7B,CACLpB,EAAGwI,EAAK5O,KAAO2M,EAAOc,WAAa3C,EAAQ1E,EAC3CE,EAAGsI,EAAK/K,IAAM8I,EAAOgB,UAAY7C,EAAQxE,EACzCP,MAAO6I,EAAK7I,MACZE,OAAQ2I,EAAK3I,OAEjB,CGvDA,SAASoS,GAAMC,GACb,IAAItT,EAAM,IAAIoO,IACVmF,EAAU,IAAIC,IACdC,EAAS,GAKb,SAAS3F,EAAK4F,GACZH,EAAQI,IAAID,EAASlW,MACN,GAAG3B,OAAO6X,EAASxU,UAAY,GAAIwU,EAASnO,kBAAoB,IACtEvH,SAAQ,SAAU4V,GACzB,IAAKL,EAAQM,IAAID,GAAM,CACrB,IAAIE,EAAc9T,EAAI3F,IAAIuZ,GAEtBE,GACFhG,EAAKgG,EAET,CACF,IACAL,EAAO3E,KAAK4E,EACd,CAQA,OAzBAJ,EAAUtV,SAAQ,SAAU0V,GAC1B1T,EAAIiP,IAAIyE,EAASlW,KAAMkW,EACzB,IAiBAJ,EAAUtV,SAAQ,SAAU0V,GACrBH,EAAQM,IAAIH,EAASlW,OAExBsQ,EAAK4F,EAET,IACOD,CACT,CCvBA,IAAIM,GAAkB,CACpBnY,UAAW,SACX0X,UAAW,GACX1U,SAAU,YAGZ,SAASoV,KACP,IAAK,IAAI1B,EAAO2B,UAAUrG,OAAQsG,EAAO,IAAIpU,MAAMwS,GAAO6B,EAAO,EAAGA,EAAO7B,EAAM6B,IAC/ED,EAAKC,GAAQF,UAAUE,GAGzB,OAAQD,EAAKvE,MAAK,SAAUlT,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQ+D,sBACrC,GACF,CAEO,SAAS4T,GAAgBC,QACL,IAArBA,IACFA,EAAmB,CAAC,GAGtB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCV,GAAkBU,EAC3E,OAAO,SAAsBjZ,EAAWD,EAAQoD,QAC9B,IAAZA,IACFA,EAAU+V,GAGZ,ICxC6B/W,EAC3BgX,EDuCE9W,EAAQ,CACVjC,UAAW,SACXgZ,iBAAkB,GAClBjW,QAASzE,OAAOkE,OAAO,CAAC,EAAG2V,GAAiBW,GAC5C1Q,cAAe,CAAC,EAChBjG,SAAU,CACRvC,UAAWA,EACXD,OAAQA,GAEV4C,WAAY,CAAC,EACbD,OAAQ,CAAC,GAEP2W,EAAmB,GACnBC,GAAc,EACdrN,EAAW,CACb5J,MAAOA,EACPkX,WAAY,SAAoBC,GAC9B,IAAIrW,EAAsC,mBAArBqW,EAAkCA,EAAiBnX,EAAMc,SAAWqW,EACzFC,IACApX,EAAMc,QAAUzE,OAAOkE,OAAO,CAAC,EAAGsW,EAAgB7W,EAAMc,QAASA,GACjEd,EAAMiK,cAAgB,CACpBtM,UAAW0B,EAAU1B,GAAa6N,GAAkB7N,GAAaA,EAAU4Q,eAAiB/C,GAAkB7N,EAAU4Q,gBAAkB,GAC1I7Q,OAAQ8N,GAAkB9N,IAI5B,IElE4B+X,EAC9B4B,EFiEMN,EDhCG,SAAwBtB,GAErC,IAAIsB,EAAmBvB,GAAMC,GAE7B,OAAO/W,EAAeb,QAAO,SAAUC,EAAK+B,GAC1C,OAAO/B,EAAIE,OAAO+Y,EAAiBvR,QAAO,SAAUqQ,GAClD,OAAOA,EAAShW,QAAUA,CAC5B,IACF,GAAG,GACL,CCuB+ByX,EElEK7B,EFkEsB,GAAGzX,OAAO2Y,EAAkB3W,EAAMc,QAAQ2U,WEjE9F4B,EAAS5B,EAAU5X,QAAO,SAAUwZ,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5X,MAK9B,OAJA0X,EAAOE,EAAQ5X,MAAQ6X,EAAWnb,OAAOkE,OAAO,CAAC,EAAGiX,EAAUD,EAAS,CACrEzW,QAASzE,OAAOkE,OAAO,CAAC,EAAGiX,EAAS1W,QAASyW,EAAQzW,SACrD4I,KAAMrN,OAAOkE,OAAO,CAAC,EAAGiX,EAAS9N,KAAM6N,EAAQ7N,QAC5C6N,EACEF,CACT,GAAG,CAAC,GAEGhb,OAAO4D,KAAKoX,GAAQlV,KAAI,SAAUhG,GACvC,OAAOkb,EAAOlb,EAChB,MF4DM,OAJA6D,EAAM+W,iBAAmBA,EAAiBvR,QAAO,SAAUiS,GACzD,OAAOA,EAAE7X,OACX,IA+FFI,EAAM+W,iBAAiB5W,SAAQ,SAAUJ,GACvC,IAAIJ,EAAOI,EAAKJ,KACZ+X,EAAe3X,EAAKe,QACpBA,OAA2B,IAAjB4W,EAA0B,CAAC,EAAIA,EACzChX,EAASX,EAAKW,OAElB,GAAsB,mBAAXA,EAAuB,CAChC,IAAIiX,EAAYjX,EAAO,CACrBV,MAAOA,EACPL,KAAMA,EACNiK,SAAUA,EACV9I,QAASA,IAKXkW,EAAiB/F,KAAK0G,GAFT,WAAmB,EAGlC,CACF,IA/GS/N,EAASQ,QAClB,EAMAwN,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkB7X,EAAME,SACxBvC,EAAYka,EAAgBla,UAC5BD,EAASma,EAAgBna,OAG7B,GAAKyY,GAAiBxY,EAAWD,GAAjC,CAKAsC,EAAMwG,MAAQ,CACZ7I,UAAWwX,GAAiBxX,EAAWqH,EAAgBtH,GAAoC,UAA3BsC,EAAMc,QAAQC,UAC9ErD,OAAQiG,EAAcjG,IAOxBsC,EAAM0R,OAAQ,EACd1R,EAAMjC,UAAYiC,EAAMc,QAAQ/C,UAKhCiC,EAAM+W,iBAAiB5W,SAAQ,SAAU0V,GACvC,OAAO7V,EAAMmG,cAAc0P,EAASlW,MAAQtD,OAAOkE,OAAO,CAAC,EAAGsV,EAASnM,KACzE,IAEA,IAAK,IAAIoO,EAAQ,EAAGA,EAAQ9X,EAAM+W,iBAAiBhH,OAAQ+H,IACzD,IAAoB,IAAhB9X,EAAM0R,MAAV,CAMA,IAAIqG,EAAwB/X,EAAM+W,iBAAiBe,GAC/ChY,EAAKiY,EAAsBjY,GAC3BkY,EAAyBD,EAAsBjX,QAC/CoM,OAAsC,IAA3B8K,EAAoC,CAAC,EAAIA,EACpDrY,EAAOoY,EAAsBpY,KAEf,mBAAPG,IACTE,EAAQF,EAAG,CACTE,MAAOA,EACPc,QAASoM,EACTvN,KAAMA,EACNiK,SAAUA,KACN5J,EAdR,MAHEA,EAAM0R,OAAQ,EACdoG,GAAS,CAzBb,CATA,CAqDF,EAGA1N,QC1I2BtK,ED0IV,WACf,OAAO,IAAImY,SAAQ,SAAUC,GAC3BtO,EAASgO,cACTM,EAAQlY,EACV,GACF,EC7IG,WAUL,OATK8W,IACHA,EAAU,IAAImB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBrB,OAAUsB,EACVF,EAAQpY,IACV,GACF,KAGKgX,CACT,GDmIIuB,QAAS,WACPjB,IACAH,GAAc,CAChB,GAGF,IAAKd,GAAiBxY,EAAWD,GAC/B,OAAOkM,EAmCT,SAASwN,IACPJ,EAAiB7W,SAAQ,SAAUL,GACjC,OAAOA,GACT,IACAkX,EAAmB,EACrB,CAEA,OAvCApN,EAASsN,WAAWpW,GAASqX,MAAK,SAAUnY,IACrCiX,GAAenW,EAAQwX,eAC1BxX,EAAQwX,cAActY,EAE1B,IAmCO4J,CACT,CACF,CACO,IAAI2O,GAA4BhC,KGzLnC,GAA4BA,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,EAAa,GAAQ,GAAM,GAAiB,EAAO,MCJrH,GAA4BjC,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,KCatE,MAAMC,GAAa,IAAIlI,IACjBmI,GAAO,CACX,GAAAtH,CAAIxS,EAASzC,EAAKyN,GACX6O,GAAWzC,IAAIpX,IAClB6Z,GAAWrH,IAAIxS,EAAS,IAAI2R,KAE9B,MAAMoI,EAAcF,GAAWjc,IAAIoC,GAI9B+Z,EAAY3C,IAAI7Z,IAA6B,IAArBwc,EAAYC,KAKzCD,EAAYvH,IAAIjV,EAAKyN,GAHnBiP,QAAQC,MAAM,+EAA+E7W,MAAM8W,KAAKJ,EAAY1Y,QAAQ,MAIhI,EACAzD,IAAG,CAACoC,EAASzC,IACPsc,GAAWzC,IAAIpX,IACV6Z,GAAWjc,IAAIoC,GAASpC,IAAIL,IAE9B,KAET,MAAA6c,CAAOpa,EAASzC,GACd,IAAKsc,GAAWzC,IAAIpX,GAClB,OAEF,MAAM+Z,EAAcF,GAAWjc,IAAIoC,GACnC+Z,EAAYM,OAAO9c,GAGM,IAArBwc,EAAYC,MACdH,GAAWQ,OAAOra,EAEtB,GAYIsa,GAAiB,gBAOjBC,GAAgBC,IAChBA,GAAYna,OAAOoa,KAAOpa,OAAOoa,IAAIC,SAEvCF,EAAWA,EAAS5O,QAAQ,iBAAiB,CAAC+O,EAAOC,IAAO,IAAIH,IAAIC,OAAOE,QAEtEJ,GA4CHK,GAAuB7a,IAC3BA,EAAQ8a,cAAc,IAAIC,MAAMT,IAAgB,EAE5C,GAAYU,MACXA,GAA4B,iBAAXA,UAGO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAEgB,IAApBA,EAAOE,UAEjBC,GAAaH,GAEb,GAAUA,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAEf,iBAAXA,GAAuBA,EAAO7J,OAAS,EACzCrL,SAAS+C,cAAc0R,GAAcS,IAEvC,KAEHI,GAAYpb,IAChB,IAAK,GAAUA,IAAgD,IAApCA,EAAQqb,iBAAiBlK,OAClD,OAAO,EAET,MAAMmK,EAAgF,YAA7D5V,iBAAiB1F,GAASub,iBAAiB,cAE9DC,EAAgBxb,EAAQyb,QAAQ,uBACtC,IAAKD,EACH,OAAOF,EAET,GAAIE,IAAkBxb,EAAS,CAC7B,MAAM0b,EAAU1b,EAAQyb,QAAQ,WAChC,GAAIC,GAAWA,EAAQlW,aAAegW,EACpC,OAAO,EAET,GAAgB,OAAZE,EACF,OAAO,CAEX,CACA,OAAOJ,CAAgB,EAEnBK,GAAa3b,IACZA,GAAWA,EAAQkb,WAAaU,KAAKC,gBAGtC7b,EAAQ8b,UAAU7W,SAAS,mBAGC,IAArBjF,EAAQ+b,SACV/b,EAAQ+b,SAEV/b,EAAQgc,aAAa,aAAoD,UAArChc,EAAQic,aAAa,aAE5DC,GAAiBlc,IACrB,IAAK8F,SAASC,gBAAgBoW,aAC5B,OAAO,KAIT,GAAmC,mBAAxBnc,EAAQqF,YAA4B,CAC7C,MAAM+W,EAAOpc,EAAQqF,cACrB,OAAO+W,aAAgBtb,WAAasb,EAAO,IAC7C,CACA,OAAIpc,aAAmBc,WACdd,EAIJA,EAAQwF,WAGN0W,GAAelc,EAAQwF,YAFrB,IAEgC,EAErC6W,GAAO,OAUPC,GAAStc,IACbA,EAAQuE,YAAY,EAEhBgY,GAAY,IACZlc,OAAOmc,SAAW1W,SAAS6G,KAAKqP,aAAa,qBACxC3b,OAAOmc,OAET,KAEHC,GAA4B,GAgB5BC,GAAQ,IAAuC,QAAjC5W,SAASC,gBAAgB4W,IACvCC,GAAqBC,IAhBAC,QAiBN,KACjB,MAAMC,EAAIR,KAEV,GAAIQ,EAAG,CACL,MAAMhc,EAAO8b,EAAOG,KACdC,EAAqBF,EAAE7b,GAAGH,GAChCgc,EAAE7b,GAAGH,GAAQ8b,EAAOK,gBACpBH,EAAE7b,GAAGH,GAAMoc,YAAcN,EACzBE,EAAE7b,GAAGH,GAAMqc,WAAa,KACtBL,EAAE7b,GAAGH,GAAQkc,EACNJ,EAAOK,gBAElB,GA5B0B,YAAxBpX,SAASuX,YAENZ,GAA0BtL,QAC7BrL,SAASyF,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMuR,KAAYL,GACrBK,GACF,IAGJL,GAA0BpK,KAAKyK,IAE/BA,GAkBA,EAEEQ,GAAU,CAACC,EAAkB9F,EAAO,GAAI+F,EAAeD,IACxB,mBAArBA,EAAkCA,KAAoB9F,GAAQ+F,EAExEC,GAAyB,CAACX,EAAUY,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAL,GAAQR,GAGV,MACMc,EA/JiC5d,KACvC,IAAKA,EACH,OAAO,EAIT,IAAI,mBACF6d,EAAkB,gBAClBC,GACEzd,OAAOqF,iBAAiB1F,GAC5B,MAAM+d,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAG/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBlb,MAAM,KAAK,GACnDmb,EAAkBA,EAAgBnb,MAAM,KAAK,GAtDf,KAuDtBqb,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KANzD,CAMoG,EA0IpFK,CAAiCT,GADlC,EAExB,IAAIU,GAAS,EACb,MAAMC,EAAU,EACdrR,aAEIA,IAAW0Q,IAGfU,GAAS,EACTV,EAAkBjS,oBAAoB6O,GAAgB+D,GACtDf,GAAQR,GAAS,EAEnBY,EAAkBnS,iBAAiB+O,GAAgB+D,GACnDC,YAAW,KACJF,GACHvD,GAAqB6C,EACvB,GACCE,EAAiB,EAYhBW,GAAuB,CAAC1R,EAAM2R,EAAeC,EAAeC,KAChE,MAAMC,EAAa9R,EAAKsE,OACxB,IAAI+H,EAAQrM,EAAKjH,QAAQ4Y,GAIzB,OAAe,IAAXtF,GACMuF,GAAiBC,EAAiB7R,EAAK8R,EAAa,GAAK9R,EAAK,IAExEqM,GAASuF,EAAgB,GAAK,EAC1BC,IACFxF,GAASA,EAAQyF,GAAcA,GAE1B9R,EAAKjK,KAAKC,IAAI,EAAGD,KAAKE,IAAIoW,EAAOyF,EAAa,KAAI,EAerDC,GAAiB,qBACjBC,GAAiB,OACjBC,GAAgB,SAChBC,GAAgB,CAAC,EACvB,IAAIC,GAAW,EACf,MAAMC,GAAe,CACnBC,WAAY,YACZC,WAAY,YAERC,GAAe,IAAIrI,IAAI,CAAC,QAAS,WAAY,UAAW,YAAa,cAAe,aAAc,iBAAkB,YAAa,WAAY,YAAa,cAAe,YAAa,UAAW,WAAY,QAAS,oBAAqB,aAAc,YAAa,WAAY,cAAe,cAAe,cAAe,YAAa,eAAgB,gBAAiB,eAAgB,gBAAiB,aAAc,QAAS,OAAQ,SAAU,QAAS,SAAU,SAAU,UAAW,WAAY,OAAQ,SAAU,eAAgB,SAAU,OAAQ,mBAAoB,mBAAoB,QAAS,QAAS,WAM/lB,SAASsI,GAAarf,EAASsf,GAC7B,OAAOA,GAAO,GAAGA,MAAQN,QAAgBhf,EAAQgf,UAAYA,IAC/D,CACA,SAASO,GAAiBvf,GACxB,MAAMsf,EAAMD,GAAarf,GAGzB,OAFAA,EAAQgf,SAAWM,EACnBP,GAAcO,GAAOP,GAAcO,IAAQ,CAAC,EACrCP,GAAcO,EACvB,CAiCA,SAASE,GAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOliB,OAAOmiB,OAAOH,GAAQ7M,MAAKiN,GAASA,EAAMH,WAAaA,GAAYG,EAAMF,qBAAuBA,GACzG,CACA,SAASG,GAAoBC,EAAmB1B,EAAS2B,GACvD,MAAMC,EAAiC,iBAAZ5B,EAErBqB,EAAWO,EAAcD,EAAqB3B,GAAW2B,EAC/D,IAAIE,EAAYC,GAAaJ,GAI7B,OAHKX,GAAahI,IAAI8I,KACpBA,EAAYH,GAEP,CAACE,EAAaP,EAAUQ,EACjC,CACA,SAASE,GAAWpgB,EAAS+f,EAAmB1B,EAAS2B,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmC/f,EAC5C,OAEF,IAAKigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GAIzF,GAAID,KAAqBd,GAAc,CACrC,MAAMqB,EAAepf,GACZ,SAAU2e,GACf,IAAKA,EAAMU,eAAiBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAevb,SAAS4a,EAAMU,eAC/G,OAAOrf,EAAGjD,KAAKwiB,KAAMZ,EAEzB,EAEFH,EAAWY,EAAaZ,EAC1B,CACA,MAAMD,EAASF,GAAiBvf,GAC1B0gB,EAAWjB,EAAOS,KAAeT,EAAOS,GAAa,CAAC,GACtDS,EAAmBnB,GAAYkB,EAAUhB,EAAUO,EAAc5B,EAAU,MACjF,GAAIsC,EAEF,YADAA,EAAiBN,OAASM,EAAiBN,QAAUA,GAGvD,MAAMf,EAAMD,GAAaK,EAAUK,EAAkBnU,QAAQgT,GAAgB,KACvE1d,EAAK+e,EA5Db,SAAoCjgB,EAASwa,EAAUtZ,GACrD,OAAO,SAASmd,EAAQwB,GACtB,MAAMe,EAAc5gB,EAAQ6gB,iBAAiBrG,GAC7C,IAAK,IAAI,OACPxN,GACE6S,EAAO7S,GAAUA,IAAWyT,KAAMzT,EAASA,EAAOxH,WACpD,IAAK,MAAMsb,KAAcF,EACvB,GAAIE,IAAe9T,EASnB,OANA+T,GAAWlB,EAAO,CAChBW,eAAgBxT,IAEdqR,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAM1G,EAAUtZ,GAE3CA,EAAGigB,MAAMnU,EAAQ,CAAC6S,GAG/B,CACF,CAwC2BuB,CAA2BphB,EAASqe,EAASqB,GAvExE,SAA0B1f,EAASkB,GACjC,OAAO,SAASmd,EAAQwB,GAOtB,OANAkB,GAAWlB,EAAO,CAChBW,eAAgBxgB,IAEdqe,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAMhgB,GAEjCA,EAAGigB,MAAMnhB,EAAS,CAAC6f,GAC5B,CACF,CA6DoFwB,CAAiBrhB,EAAS0f,GAC5Gxe,EAAGye,mBAAqBM,EAAc5B,EAAU,KAChDnd,EAAGwe,SAAWA,EACdxe,EAAGmf,OAASA,EACZnf,EAAG8d,SAAWM,EACdoB,EAASpB,GAAOpe,EAChBlB,EAAQuL,iBAAiB2U,EAAWhf,EAAI+e,EAC1C,CACA,SAASqB,GAActhB,EAASyf,EAAQS,EAAW7B,EAASsB,GAC1D,MAAMze,EAAKse,GAAYC,EAAOS,GAAY7B,EAASsB,GAC9Cze,IAGLlB,EAAQyL,oBAAoByU,EAAWhf,EAAIqgB,QAAQ5B,WAC5CF,EAAOS,GAAWhf,EAAG8d,UAC9B,CACA,SAASwC,GAAyBxhB,EAASyf,EAAQS,EAAWuB,GAC5D,MAAMC,EAAoBjC,EAAOS,IAAc,CAAC,EAChD,IAAK,MAAOyB,EAAY9B,KAAUpiB,OAAOmkB,QAAQF,GAC3CC,EAAWE,SAASJ,IACtBH,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAGtE,CACA,SAASQ,GAAaN,GAGpB,OADAA,EAAQA,EAAMjU,QAAQiT,GAAgB,IAC/BI,GAAaY,IAAUA,CAChC,CACA,MAAMmB,GAAe,CACnB,EAAAc,CAAG9hB,EAAS6f,EAAOxB,EAAS2B,GAC1BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAA+B,CAAI/hB,EAAS6f,EAAOxB,EAAS2B,GAC3BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAAiB,CAAIjhB,EAAS+f,EAAmB1B,EAAS2B,GACvC,GAAiC,iBAAtBD,IAAmC/f,EAC5C,OAEF,MAAOigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GACrFgC,EAAc9B,IAAcH,EAC5BN,EAASF,GAAiBvf,GAC1B0hB,EAAoBjC,EAAOS,IAAc,CAAC,EAC1C+B,EAAclC,EAAkBmC,WAAW,KACjD,QAAwB,IAAbxC,EAAX,CAQA,GAAIuC,EACF,IAAK,MAAME,KAAgB1kB,OAAO4D,KAAKoe,GACrC+B,GAAyBxhB,EAASyf,EAAQ0C,EAAcpC,EAAkBlN,MAAM,IAGpF,IAAK,MAAOuP,EAAavC,KAAUpiB,OAAOmkB,QAAQF,GAAoB,CACpE,MAAMC,EAAaS,EAAYxW,QAAQkT,GAAe,IACjDkD,IAAejC,EAAkB8B,SAASF,IAC7CL,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAEpE,CAXA,KAPA,CAEE,IAAKliB,OAAO4D,KAAKqgB,GAAmBvQ,OAClC,OAEFmQ,GAActhB,EAASyf,EAAQS,EAAWR,EAAUO,EAAc5B,EAAU,KAE9E,CAYF,EACA,OAAAgE,CAAQriB,EAAS6f,EAAOpI,GACtB,GAAqB,iBAAVoI,IAAuB7f,EAChC,OAAO,KAET,MAAM+c,EAAIR,KAGV,IAAI+F,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EAJH5C,IADFM,GAAaN,IAMZ9C,IACjBuF,EAAcvF,EAAEhC,MAAM8E,EAAOpI,GAC7BsF,EAAE/c,GAASqiB,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAEjC,MAAMC,EAAM9B,GAAW,IAAIhG,MAAM8E,EAAO,CACtC0C,UACAO,YAAY,IACVrL,GAUJ,OATIgL,GACFI,EAAIE,iBAEFP,GACFxiB,EAAQ8a,cAAc+H,GAEpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAEPF,CACT,GAEF,SAAS9B,GAAWljB,EAAKmlB,EAAO,CAAC,GAC/B,IAAK,MAAOzlB,EAAKa,KAAUX,OAAOmkB,QAAQoB,GACxC,IACEnlB,EAAIN,GAAOa,CACb,CAAE,MAAO6kB,GACPxlB,OAAOC,eAAeG,EAAKN,EAAK,CAC9B2lB,cAAc,EACdtlB,IAAG,IACMQ,GAGb,CAEF,OAAOP,CACT,CASA,SAASslB,GAAc/kB,GACrB,GAAc,SAAVA,EACF,OAAO,EAET,GAAc,UAAVA,EACF,OAAO,EAET,GAAIA,IAAU4f,OAAO5f,GAAOkC,WAC1B,OAAO0d,OAAO5f,GAEhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAET,GAAqB,iBAAVA,EACT,OAAOA,EAET,IACE,OAAOglB,KAAKC,MAAMC,mBAAmBllB,GACvC,CAAE,MAAO6kB,GACP,OAAO7kB,CACT,CACF,CACA,SAASmlB,GAAiBhmB,GACxB,OAAOA,EAAIqO,QAAQ,UAAU4X,GAAO,IAAIA,EAAItjB,iBAC9C,CACA,MAAMujB,GAAc,CAClB,gBAAAC,CAAiB1jB,EAASzC,EAAKa,GAC7B4B,EAAQ6B,aAAa,WAAW0hB,GAAiBhmB,KAAQa,EAC3D,EACA,mBAAAulB,CAAoB3jB,EAASzC,GAC3ByC,EAAQ4B,gBAAgB,WAAW2hB,GAAiBhmB,KACtD,EACA,iBAAAqmB,CAAkB5jB,GAChB,IAAKA,EACH,MAAO,CAAC,EAEV,MAAM0B,EAAa,CAAC,EACdmiB,EAASpmB,OAAO4D,KAAKrB,EAAQ8jB,SAASld,QAAOrJ,GAAOA,EAAI2kB,WAAW,QAAU3kB,EAAI2kB,WAAW,cAClG,IAAK,MAAM3kB,KAAOsmB,EAAQ,CACxB,IAAIE,EAAUxmB,EAAIqO,QAAQ,MAAO,IACjCmY,EAAUA,EAAQC,OAAO,GAAG9jB,cAAgB6jB,EAAQlR,MAAM,EAAGkR,EAAQ5S,QACrEzP,EAAWqiB,GAAWZ,GAAcnjB,EAAQ8jB,QAAQvmB,GACtD,CACA,OAAOmE,CACT,EACAuiB,iBAAgB,CAACjkB,EAASzC,IACjB4lB,GAAcnjB,EAAQic,aAAa,WAAWsH,GAAiBhmB,QAgB1E,MAAM2mB,GAEJ,kBAAWC,GACT,MAAO,CAAC,CACV,CACA,sBAAWC,GACT,MAAO,CAAC,CACV,CACA,eAAWpH,GACT,MAAM,IAAIqH,MAAM,sEAClB,CACA,UAAAC,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAChB,OAAOA,CACT,CACA,eAAAC,CAAgBD,EAAQvkB,GACtB,MAAM2kB,EAAa,GAAU3kB,GAAWyjB,GAAYQ,iBAAiBjkB,EAAS,UAAY,CAAC,EAE3F,MAAO,IACFygB,KAAKmE,YAAYT,WACM,iBAAfQ,EAA0BA,EAAa,CAAC,KAC/C,GAAU3kB,GAAWyjB,GAAYG,kBAAkB5jB,GAAW,CAAC,KAC7C,iBAAXukB,EAAsBA,EAAS,CAAC,EAE/C,CACA,gBAAAG,CAAiBH,EAAQM,EAAcpE,KAAKmE,YAAYR,aACtD,IAAK,MAAO7hB,EAAUuiB,KAAkBrnB,OAAOmkB,QAAQiD,GAAc,CACnE,MAAMzmB,EAAQmmB,EAAOhiB,GACfwiB,EAAY,GAAU3mB,GAAS,UAhiBrC4c,OADSA,EAiiB+C5c,GA/hBnD,GAAG4c,IAELvd,OAAOM,UAAUuC,SAASrC,KAAK+c,GAAQL,MAAM,eAAe,GAAGza,cA8hBlE,IAAK,IAAI8kB,OAAOF,GAAehhB,KAAKihB,GAClC,MAAM,IAAIE,UAAU,GAAGxE,KAAKmE,YAAY5H,KAAKkI,0BAA0B3iB,qBAA4BwiB,yBAAiCD,MAExI,CAriBW9J,KAsiBb,EAqBF,MAAMmK,WAAsBjB,GAC1B,WAAAU,CAAY5kB,EAASukB,GACnBa,SACAplB,EAAUmb,GAAWnb,MAIrBygB,KAAK4E,SAAWrlB,EAChBygB,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/BzK,GAAKtH,IAAIiO,KAAK4E,SAAU5E,KAAKmE,YAAYW,SAAU9E,MACrD,CAGA,OAAA+E,GACE1L,GAAKM,OAAOqG,KAAK4E,SAAU5E,KAAKmE,YAAYW,UAC5CvE,GAAaC,IAAIR,KAAK4E,SAAU5E,KAAKmE,YAAYa,WACjD,IAAK,MAAMC,KAAgBjoB,OAAOkoB,oBAAoBlF,MACpDA,KAAKiF,GAAgB,IAEzB,CACA,cAAAE,CAAe9I,EAAU9c,EAAS6lB,GAAa,GAC7CpI,GAAuBX,EAAU9c,EAAS6lB,EAC5C,CACA,UAAAvB,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,EAAQ9D,KAAK4E,UAC3Cd,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CAGA,kBAAOuB,CAAY9lB,GACjB,OAAO8Z,GAAKlc,IAAIud,GAAWnb,GAAUygB,KAAK8E,SAC5C,CACA,0BAAOQ,CAAoB/lB,EAASukB,EAAS,CAAC,GAC5C,OAAO9D,KAAKqF,YAAY9lB,IAAY,IAAIygB,KAAKzgB,EAA2B,iBAAXukB,EAAsBA,EAAS,KAC9F,CACA,kBAAWyB,GACT,MA5CY,OA6Cd,CACA,mBAAWT,GACT,MAAO,MAAM9E,KAAKzD,MACpB,CACA,oBAAWyI,GACT,MAAO,IAAIhF,KAAK8E,UAClB,CACA,gBAAOU,CAAUllB,GACf,MAAO,GAAGA,IAAO0f,KAAKgF,WACxB,EAUF,MAAMS,GAAclmB,IAClB,IAAIwa,EAAWxa,EAAQic,aAAa,kBACpC,IAAKzB,GAAyB,MAAbA,EAAkB,CACjC,IAAI2L,EAAgBnmB,EAAQic,aAAa,QAMzC,IAAKkK,IAAkBA,EAActE,SAAS,OAASsE,EAAcjE,WAAW,KAC9E,OAAO,KAILiE,EAActE,SAAS,OAASsE,EAAcjE,WAAW,OAC3DiE,EAAgB,IAAIA,EAAcxjB,MAAM,KAAK,MAE/C6X,EAAW2L,GAAmC,MAAlBA,EAAwBA,EAAcC,OAAS,IAC7E,CACA,OAAO5L,EAAWA,EAAS7X,MAAM,KAAKY,KAAI8iB,GAAO9L,GAAc8L,KAAM1iB,KAAK,KAAO,IAAI,EAEjF2iB,GAAiB,CACrB1T,KAAI,CAAC4H,EAAUxa,EAAU8F,SAASC,kBACzB,GAAG3G,UAAUsB,QAAQ3C,UAAU8iB,iBAAiB5iB,KAAK+B,EAASwa,IAEvE+L,QAAO,CAAC/L,EAAUxa,EAAU8F,SAASC,kBAC5BrF,QAAQ3C,UAAU8K,cAAc5K,KAAK+B,EAASwa,GAEvDgM,SAAQ,CAACxmB,EAASwa,IACT,GAAGpb,UAAUY,EAAQwmB,UAAU5f,QAAOzB,GAASA,EAAMshB,QAAQjM,KAEtE,OAAAkM,CAAQ1mB,EAASwa,GACf,MAAMkM,EAAU,GAChB,IAAIC,EAAW3mB,EAAQwF,WAAWiW,QAAQjB,GAC1C,KAAOmM,GACLD,EAAQrU,KAAKsU,GACbA,EAAWA,EAASnhB,WAAWiW,QAAQjB,GAEzC,OAAOkM,CACT,EACA,IAAAE,CAAK5mB,EAASwa,GACZ,IAAIqM,EAAW7mB,EAAQ8mB,uBACvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQjM,GACnB,MAAO,CAACqM,GAEVA,EAAWA,EAASC,sBACtB,CACA,MAAO,EACT,EAEA,IAAAxhB,CAAKtF,EAASwa,GACZ,IAAIlV,EAAOtF,EAAQ+mB,mBACnB,KAAOzhB,GAAM,CACX,GAAIA,EAAKmhB,QAAQjM,GACf,MAAO,CAAClV,GAEVA,EAAOA,EAAKyhB,kBACd,CACA,MAAO,EACT,EACA,iBAAAC,CAAkBhnB,GAChB,MAAMinB,EAAa,CAAC,IAAK,SAAU,QAAS,WAAY,SAAU,UAAW,aAAc,4BAA4B1jB,KAAIiX,GAAY,GAAGA,2BAAiC7W,KAAK,KAChL,OAAO8c,KAAK7N,KAAKqU,EAAYjnB,GAAS4G,QAAOsgB,IAAOvL,GAAWuL,IAAO9L,GAAU8L,IAClF,EACA,sBAAAC,CAAuBnnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAIwa,GACK8L,GAAeC,QAAQ/L,GAAYA,EAErC,IACT,EACA,sBAAA4M,CAAuBpnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAeC,QAAQ/L,GAAY,IACvD,EACA,+BAAA6M,CAAgCrnB,GAC9B,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAe1T,KAAK4H,GAAY,EACpD,GAUI8M,GAAuB,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAa,gBAAgBF,EAAU9B,YACvC1kB,EAAOwmB,EAAUvK,KACvBgE,GAAac,GAAGhc,SAAU2hB,EAAY,qBAAqB1mB,OAAU,SAAU8e,GAI7E,GAHI,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEF,MAAMzT,EAASsZ,GAAec,uBAAuB3G,OAASA,KAAKhF,QAAQ,IAAI1a,KAC9DwmB,EAAUxB,oBAAoB/Y,GAGtCwa,IACX,GAAE,EAiBEG,GAAc,YACdC,GAAc,QAAQD,KACtBE,GAAe,SAASF,KAQ9B,MAAMG,WAAc3C,GAElB,eAAWnI,GACT,MAfW,OAgBb,CAGA,KAAA+K,GAEE,GADmB/G,GAAaqB,QAAQ5B,KAAK4E,SAAUuC,IACxCnF,iBACb,OAEFhC,KAAK4E,SAASvJ,UAAU1B,OAlBF,QAmBtB,MAAMyL,EAAapF,KAAK4E,SAASvJ,UAAU7W,SApBrB,QAqBtBwb,KAAKmF,gBAAe,IAAMnF,KAAKuH,mBAAmBvH,KAAK4E,SAAUQ,EACnE,CAGA,eAAAmC,GACEvH,KAAK4E,SAASjL,SACd4G,GAAaqB,QAAQ5B,KAAK4E,SAAUwC,IACpCpH,KAAK+E,SACP,CAGA,sBAAOtI,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOgd,GAAM/B,oBAAoBtF,MACvC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOF6G,GAAqBQ,GAAO,SAM5BlL,GAAmBkL,IAcnB,MAKMI,GAAyB,4BAO/B,MAAMC,WAAehD,GAEnB,eAAWnI,GACT,MAfW,QAgBb,CAGA,MAAAoL,GAEE3H,KAAK4E,SAASxjB,aAAa,eAAgB4e,KAAK4E,SAASvJ,UAAUsM,OAjB3C,UAkB1B,CAGA,sBAAOlL,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOqd,GAAOpC,oBAAoBtF,MACzB,WAAX8D,GACFzZ,EAAKyZ,IAET,GACF,EAOFvD,GAAac,GAAGhc,SAjCe,2BAiCmBoiB,IAAwBrI,IACxEA,EAAMkD,iBACN,MAAMsF,EAASxI,EAAM7S,OAAOyO,QAAQyM,IACvBC,GAAOpC,oBAAoBsC,GACnCD,QAAQ,IAOfxL,GAAmBuL,IAcnB,MACMG,GAAc,YACdC,GAAmB,aAAaD,KAChCE,GAAkB,YAAYF,KAC9BG,GAAiB,WAAWH,KAC5BI,GAAoB,cAAcJ,KAClCK,GAAkB,YAAYL,KAK9BM,GAAY,CAChBC,YAAa,KACbC,aAAc,KACdC,cAAe,MAEXC,GAAgB,CACpBH,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAOjB,MAAME,WAAc/E,GAClB,WAAAU,CAAY5kB,EAASukB,GACnBa,QACA3E,KAAK4E,SAAWrlB,EACXA,GAAYipB,GAAMC,gBAGvBzI,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAK0I,QAAU,EACf1I,KAAK2I,sBAAwB7H,QAAQlhB,OAAOgpB,cAC5C5I,KAAK6I,cACP,CAGA,kBAAWnF,GACT,OAAOyE,EACT,CACA,sBAAWxE,GACT,OAAO4E,EACT,CACA,eAAWhM,GACT,MA/CW,OAgDb,CAGA,OAAAwI,GACExE,GAAaC,IAAIR,KAAK4E,SAAUiD,GAClC,CAGA,MAAAiB,CAAO1J,GACAY,KAAK2I,sBAIN3I,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,SAJrBhJ,KAAK0I,QAAUtJ,EAAM6J,QAAQ,GAAGD,OAMpC,CACA,IAAAE,CAAK9J,GACCY,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,QAAUhJ,KAAK0I,SAEtC1I,KAAKmJ,eACLtM,GAAQmD,KAAK6E,QAAQuD,YACvB,CACA,KAAAgB,CAAMhK,GACJY,KAAK0I,QAAUtJ,EAAM6J,SAAW7J,EAAM6J,QAAQvY,OAAS,EAAI,EAAI0O,EAAM6J,QAAQ,GAAGD,QAAUhJ,KAAK0I,OACjG,CACA,YAAAS,GACE,MAAME,EAAYlnB,KAAKoC,IAAIyb,KAAK0I,SAChC,GAAIW,GAnEgB,GAoElB,OAEF,MAAM/b,EAAY+b,EAAYrJ,KAAK0I,QACnC1I,KAAK0I,QAAU,EACVpb,GAGLuP,GAAQvP,EAAY,EAAI0S,KAAK6E,QAAQyD,cAAgBtI,KAAK6E,QAAQwD,aACpE,CACA,WAAAQ,GACM7I,KAAK2I,uBACPpI,GAAac,GAAGrB,KAAK4E,SAAUqD,IAAmB7I,GAASY,KAAK8I,OAAO1J,KACvEmB,GAAac,GAAGrB,KAAK4E,SAAUsD,IAAiB9I,GAASY,KAAKkJ,KAAK9J,KACnEY,KAAK4E,SAASvJ,UAAU5E,IAlFG,mBAoF3B8J,GAAac,GAAGrB,KAAK4E,SAAUkD,IAAkB1I,GAASY,KAAK8I,OAAO1J,KACtEmB,GAAac,GAAGrB,KAAK4E,SAAUmD,IAAiB3I,GAASY,KAAKoJ,MAAMhK,KACpEmB,GAAac,GAAGrB,KAAK4E,SAAUoD,IAAgB5I,GAASY,KAAKkJ,KAAK9J,KAEtE,CACA,uBAAA2J,CAAwB3J,GACtB,OAAOY,KAAK2I,wBA3FS,QA2FiBvJ,EAAMkK,aA5FrB,UA4FyDlK,EAAMkK,YACxF,CAGA,kBAAOb,GACL,MAAO,iBAAkBpjB,SAASC,iBAAmB7C,UAAU8mB,eAAiB,CAClF,EAeF,MAEMC,GAAc,eACdC,GAAiB,YACjBC,GAAmB,YACnBC,GAAoB,aAGpBC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAClBC,GAAc,QAAQR,KACtBS,GAAa,OAAOT,KACpBU,GAAkB,UAAUV,KAC5BW,GAAqB,aAAaX,KAClCY,GAAqB,aAAaZ,KAClCa,GAAmB,YAAYb,KAC/Bc,GAAwB,OAAOd,KAAcC,KAC7Cc,GAAyB,QAAQf,KAAcC,KAC/Ce,GAAsB,WACtBC,GAAsB,SAMtBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAKzCE,GAAmB,CACvB,CAACnB,IAAmBK,GACpB,CAACJ,IAAoBG,IAEjBgB,GAAY,CAChBC,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAEFC,GAAgB,CACpBN,SAAU,mBAEVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAOR,MAAME,WAAiB5G,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKuL,UAAY,KACjBvL,KAAKwL,eAAiB,KACtBxL,KAAKyL,YAAa,EAClBzL,KAAK0L,aAAe,KACpB1L,KAAK2L,aAAe,KACpB3L,KAAK4L,mBAAqB/F,GAAeC,QArCjB,uBAqC8C9F,KAAK4E,UAC3E5E,KAAK6L,qBACD7L,KAAK6E,QAAQqG,OAASV,IACxBxK,KAAK8L,OAET,CAGA,kBAAWpI,GACT,OAAOoH,EACT,CACA,sBAAWnH,GACT,OAAO0H,EACT,CACA,eAAW9O,GACT,MAnFW,UAoFb,CAGA,IAAA1X,GACEmb,KAAK+L,OAAOnC,GACd,CACA,eAAAoC,IAIO3mB,SAAS4mB,QAAUtR,GAAUqF,KAAK4E,WACrC5E,KAAKnb,MAET,CACA,IAAAshB,GACEnG,KAAK+L,OAAOlC,GACd,CACA,KAAAoB,GACMjL,KAAKyL,YACPrR,GAAqB4F,KAAK4E,UAE5B5E,KAAKkM,gBACP,CACA,KAAAJ,GACE9L,KAAKkM,iBACLlM,KAAKmM,kBACLnM,KAAKuL,UAAYa,aAAY,IAAMpM,KAAKgM,mBAAmBhM,KAAK6E,QAAQkG,SAC1E,CACA,iBAAAsB,GACOrM,KAAK6E,QAAQqG,OAGdlL,KAAKyL,WACPlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAK8L,UAGzD9L,KAAK8L,QACP,CACA,EAAAQ,CAAG7T,GACD,MAAM8T,EAAQvM,KAAKwM,YACnB,GAAI/T,EAAQ8T,EAAM7b,OAAS,GAAK+H,EAAQ,EACtC,OAEF,GAAIuH,KAAKyL,WAEP,YADAlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAKsM,GAAG7T,KAG5D,MAAMgU,EAAczM,KAAK0M,cAAc1M,KAAK2M,cAC5C,GAAIF,IAAgBhU,EAClB,OAEF,MAAMtC,EAAQsC,EAAQgU,EAAc7C,GAAaC,GACjD7J,KAAK+L,OAAO5V,EAAOoW,EAAM9T,GAC3B,CACA,OAAAsM,GACM/E,KAAK2L,cACP3L,KAAK2L,aAAa5G,UAEpBJ,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAEhB,OADAA,EAAO8I,gBAAkB9I,EAAOiH,SACzBjH,CACT,CACA,kBAAA+H,GACM7L,KAAK6E,QAAQmG,UACfzK,GAAac,GAAGrB,KAAK4E,SAAUsF,IAAiB9K,GAASY,KAAK6M,SAASzN,KAE9C,UAAvBY,KAAK6E,QAAQoG,QACf1K,GAAac,GAAGrB,KAAK4E,SAAUuF,IAAoB,IAAMnK,KAAKiL,UAC9D1K,GAAac,GAAGrB,KAAK4E,SAAUwF,IAAoB,IAAMpK,KAAKqM,uBAE5DrM,KAAK6E,QAAQsG,OAAS3C,GAAMC,eAC9BzI,KAAK8M,yBAET,CACA,uBAAAA,GACE,IAAK,MAAMC,KAAOlH,GAAe1T,KArIX,qBAqImC6N,KAAK4E,UAC5DrE,GAAac,GAAG0L,EAAK1C,IAAkBjL,GAASA,EAAMkD,mBAExD,MAmBM0K,EAAc,CAClB3E,aAAc,IAAMrI,KAAK+L,OAAO/L,KAAKiN,kBAAkBnD,KACvDxB,cAAe,IAAMtI,KAAK+L,OAAO/L,KAAKiN,kBAAkBlD,KACxD3B,YAtBkB,KACS,UAAvBpI,KAAK6E,QAAQoG,QAYjBjL,KAAKiL,QACDjL,KAAK0L,cACPwB,aAAalN,KAAK0L,cAEpB1L,KAAK0L,aAAe7N,YAAW,IAAMmC,KAAKqM,qBAjLjB,IAiL+DrM,KAAK6E,QAAQkG,UAAS,GAOhH/K,KAAK2L,aAAe,IAAInD,GAAMxI,KAAK4E,SAAUoI,EAC/C,CACA,QAAAH,CAASzN,GACP,GAAI,kBAAkB/b,KAAK+b,EAAM7S,OAAO0a,SACtC,OAEF,MAAM3Z,EAAYud,GAAiBzL,EAAMtiB,KACrCwQ,IACF8R,EAAMkD,iBACNtC,KAAK+L,OAAO/L,KAAKiN,kBAAkB3f,IAEvC,CACA,aAAAof,CAAcntB,GACZ,OAAOygB,KAAKwM,YAAYrnB,QAAQ5F,EAClC,CACA,0BAAA4tB,CAA2B1U,GACzB,IAAKuH,KAAK4L,mBACR,OAEF,MAAMwB,EAAkBvH,GAAeC,QAAQ4E,GAAiB1K,KAAK4L,oBACrEwB,EAAgB/R,UAAU1B,OAAO8Q,IACjC2C,EAAgBjsB,gBAAgB,gBAChC,MAAMksB,EAAqBxH,GAAeC,QAAQ,sBAAsBrN,MAAWuH,KAAK4L,oBACpFyB,IACFA,EAAmBhS,UAAU5E,IAAIgU,IACjC4C,EAAmBjsB,aAAa,eAAgB,QAEpD,CACA,eAAA+qB,GACE,MAAM5sB,EAAUygB,KAAKwL,gBAAkBxL,KAAK2M,aAC5C,IAAKptB,EACH,OAEF,MAAM+tB,EAAkB/P,OAAOgQ,SAAShuB,EAAQic,aAAa,oBAAqB,IAClFwE,KAAK6E,QAAQkG,SAAWuC,GAAmBtN,KAAK6E,QAAQ+H,eAC1D,CACA,MAAAb,CAAO5V,EAAO5W,EAAU,MACtB,GAAIygB,KAAKyL,WACP,OAEF,MAAM1N,EAAgBiC,KAAK2M,aACrBa,EAASrX,IAAUyT,GACnB6D,EAAcluB,GAAWue,GAAqBkC,KAAKwM,YAAazO,EAAeyP,EAAQxN,KAAK6E,QAAQuG,MAC1G,GAAIqC,IAAgB1P,EAClB,OAEF,MAAM2P,EAAmB1N,KAAK0M,cAAce,GACtCE,EAAenI,GACZjF,GAAaqB,QAAQ5B,KAAK4E,SAAUY,EAAW,CACpD1F,cAAe2N,EACfngB,UAAW0S,KAAK4N,kBAAkBzX,GAClCuD,KAAMsG,KAAK0M,cAAc3O,GACzBuO,GAAIoB,IAIR,GADmBC,EAAa3D,IACjBhI,iBACb,OAEF,IAAKjE,IAAkB0P,EAGrB,OAEF,MAAMI,EAAY/M,QAAQd,KAAKuL,WAC/BvL,KAAKiL,QACLjL,KAAKyL,YAAa,EAClBzL,KAAKmN,2BAA2BO,GAChC1N,KAAKwL,eAAiBiC,EACtB,MAAMK,EAAuBN,EA3OR,sBADF,oBA6ObO,EAAiBP,EA3OH,qBACA,qBA2OpBC,EAAYpS,UAAU5E,IAAIsX,GAC1BlS,GAAO4R,GACP1P,EAAc1C,UAAU5E,IAAIqX,GAC5BL,EAAYpS,UAAU5E,IAAIqX,GAQ1B9N,KAAKmF,gBAPoB,KACvBsI,EAAYpS,UAAU1B,OAAOmU,EAAsBC,GACnDN,EAAYpS,UAAU5E,IAAIgU,IAC1B1M,EAAc1C,UAAU1B,OAAO8Q,GAAqBsD,EAAgBD,GACpE9N,KAAKyL,YAAa,EAClBkC,EAAa1D,GAAW,GAEYlM,EAAeiC,KAAKgO,eACtDH,GACF7N,KAAK8L,OAET,CACA,WAAAkC,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAhQV,QAiQvB,CACA,UAAAmoB,GACE,OAAO9G,GAAeC,QAAQ8E,GAAsB5K,KAAK4E,SAC3D,CACA,SAAA4H,GACE,OAAO3G,GAAe1T,KAAKwY,GAAe3K,KAAK4E,SACjD,CACA,cAAAsH,GACMlM,KAAKuL,YACP0C,cAAcjO,KAAKuL,WACnBvL,KAAKuL,UAAY,KAErB,CACA,iBAAA0B,CAAkB3f,GAChB,OAAI2O,KACK3O,IAAcwc,GAAiBD,GAAaD,GAE9Ctc,IAAcwc,GAAiBF,GAAaC,EACrD,CACA,iBAAA+D,CAAkBzX,GAChB,OAAI8F,KACK9F,IAAU0T,GAAaC,GAAiBC,GAE1C5T,IAAU0T,GAAaE,GAAkBD,EAClD,CAGA,sBAAOrN,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOihB,GAAShG,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,GAIX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,OAREzZ,EAAKiiB,GAAGxI,EASZ,GACF,EAOFvD,GAAac,GAAGhc,SAAUklB,GAvSE,uCAuS2C,SAAUnL,GAC/E,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACrD,IAAKzT,IAAWA,EAAO8O,UAAU7W,SAASgmB,IACxC,OAEFpL,EAAMkD,iBACN,MAAM4L,EAAW5C,GAAShG,oBAAoB/Y,GACxC4hB,EAAanO,KAAKxE,aAAa,oBACrC,OAAI2S,GACFD,EAAS5B,GAAG6B,QACZD,EAAS7B,qBAGyC,SAAhDrJ,GAAYQ,iBAAiBxD,KAAM,UACrCkO,EAASrpB,YACTqpB,EAAS7B,sBAGX6B,EAAS/H,YACT+H,EAAS7B,oBACX,IACA9L,GAAac,GAAGzhB,OAAQ0qB,IAAuB,KAC7C,MAAM8D,EAAYvI,GAAe1T,KA5TR,6BA6TzB,IAAK,MAAM+b,KAAYE,EACrB9C,GAAShG,oBAAoB4I,EAC/B,IAOF/R,GAAmBmP,IAcnB,MAEM+C,GAAc,eAEdC,GAAe,OAAOD,KACtBE,GAAgB,QAAQF,KACxBG,GAAe,OAAOH,KACtBI,GAAiB,SAASJ,KAC1BK,GAAyB,QAAQL,cACjCM,GAAoB,OACpBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA6B,WAAWF,OAAwBA,KAKhEG,GAAyB,8BACzBC,GAAY,CAChBvqB,OAAQ,KACRkjB,QAAQ,GAEJsH,GAAgB,CACpBxqB,OAAQ,iBACRkjB,OAAQ,WAOV,MAAMuH,WAAiBxK,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmP,kBAAmB,EACxBnP,KAAKoP,cAAgB,GACrB,MAAMC,EAAaxJ,GAAe1T,KAAK4c,IACvC,IAAK,MAAMO,KAAQD,EAAY,CAC7B,MAAMtV,EAAW8L,GAAea,uBAAuB4I,GACjDC,EAAgB1J,GAAe1T,KAAK4H,GAAU5T,QAAOqpB,GAAgBA,IAAiBxP,KAAK4E,WAChF,OAAb7K,GAAqBwV,EAAc7e,QACrCsP,KAAKoP,cAAcxd,KAAK0d,EAE5B,CACAtP,KAAKyP,sBACAzP,KAAK6E,QAAQpgB,QAChBub,KAAK0P,0BAA0B1P,KAAKoP,cAAepP,KAAK2P,YAEtD3P,KAAK6E,QAAQ8C,QACf3H,KAAK2H,QAET,CAGA,kBAAWjE,GACT,OAAOsL,EACT,CACA,sBAAWrL,GACT,OAAOsL,EACT,CACA,eAAW1S,GACT,MA9DW,UA+Db,CAGA,MAAAoL,GACM3H,KAAK2P,WACP3P,KAAK4P,OAEL5P,KAAK6P,MAET,CACA,IAAAA,GACE,GAAI7P,KAAKmP,kBAAoBnP,KAAK2P,WAChC,OAEF,IAAIG,EAAiB,GAQrB,GALI9P,KAAK6E,QAAQpgB,SACfqrB,EAAiB9P,KAAK+P,uBAhEH,wCAgE4C5pB,QAAO5G,GAAWA,IAAYygB,KAAK4E,WAAU9hB,KAAIvD,GAAW2vB,GAAS5J,oBAAoB/lB,EAAS,CAC/JooB,QAAQ,OAGRmI,EAAepf,QAAUof,EAAe,GAAGX,iBAC7C,OAGF,GADmB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU0J,IACxCtM,iBACb,OAEF,IAAK,MAAMgO,KAAkBF,EAC3BE,EAAeJ,OAEjB,MAAMK,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAASvJ,UAAU1B,OAAOiV,IAC/B5O,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,EACjCjQ,KAAK0P,0BAA0B1P,KAAKoP,eAAe,GACnDpP,KAAKmP,kBAAmB,EACxB,MAQMgB,EAAa,SADUF,EAAU,GAAGxL,cAAgBwL,EAAU7d,MAAM,KAE1E4N,KAAKmF,gBATY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,GAAqBD,IACjD3O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjC1P,GAAaqB,QAAQ5B,KAAK4E,SAAU2J,GAAc,GAItBvO,KAAK4E,UAAU,GAC7C5E,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASuL,MACpD,CACA,IAAAP,GACE,GAAI5P,KAAKmP,mBAAqBnP,KAAK2P,WACjC,OAGF,GADmBpP,GAAaqB,QAAQ5B,KAAK4E,SAAU4J,IACxCxM,iBACb,OAEF,MAAMiO,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASthB,wBAAwB2sB,OAC1EpU,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAASvJ,UAAU1B,OAAOiV,GAAqBD,IACpD,IAAK,MAAM/M,KAAW5B,KAAKoP,cAAe,CACxC,MAAM7vB,EAAUsmB,GAAec,uBAAuB/E,GAClDriB,IAAYygB,KAAK2P,SAASpwB,IAC5BygB,KAAK0P,0BAA0B,CAAC9N,IAAU,EAE9C,CACA5B,KAAKmP,kBAAmB,EAOxBnP,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjCjQ,KAAKmF,gBAPY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,IAC5BrO,GAAaqB,QAAQ5B,KAAK4E,SAAU6J,GAAe,GAGvBzO,KAAK4E,UAAU,EAC/C,CACA,QAAA+K,CAASpwB,EAAUygB,KAAK4E,UACtB,OAAOrlB,EAAQ8b,UAAU7W,SAASmqB,GACpC,CAGA,iBAAA3K,CAAkBF,GAGhB,OAFAA,EAAO6D,OAAS7G,QAAQgD,EAAO6D,QAC/B7D,EAAOrf,OAASiW,GAAWoJ,EAAOrf,QAC3Bqf,CACT,CACA,aAAAoM,GACE,OAAOlQ,KAAK4E,SAASvJ,UAAU7W,SA3IL,uBAChB,QACC,QA0Ib,CACA,mBAAAirB,GACE,IAAKzP,KAAK6E,QAAQpgB,OAChB,OAEF,MAAMshB,EAAW/F,KAAK+P,uBAAuBhB,IAC7C,IAAK,MAAMxvB,KAAWwmB,EAAU,CAC9B,MAAMqK,EAAWvK,GAAec,uBAAuBpnB,GACnD6wB,GACFpQ,KAAK0P,0BAA0B,CAACnwB,GAAUygB,KAAK2P,SAASS,GAE5D,CACF,CACA,sBAAAL,CAAuBhW,GACrB,MAAMgM,EAAWF,GAAe1T,KAAK2c,GAA4B9O,KAAK6E,QAAQpgB,QAE9E,OAAOohB,GAAe1T,KAAK4H,EAAUiG,KAAK6E,QAAQpgB,QAAQ0B,QAAO5G,IAAYwmB,EAAS3E,SAAS7hB,IACjG,CACA,yBAAAmwB,CAA0BW,EAAcC,GACtC,GAAKD,EAAa3f,OAGlB,IAAK,MAAMnR,KAAW8wB,EACpB9wB,EAAQ8b,UAAUsM,OArKK,aAqKyB2I,GAChD/wB,EAAQ6B,aAAa,gBAAiBkvB,EAE1C,CAGA,sBAAO7T,CAAgBqH,GACrB,MAAMe,EAAU,CAAC,EAIjB,MAHsB,iBAAXf,GAAuB,YAAYzgB,KAAKygB,KACjDe,EAAQ8C,QAAS,GAEZ3H,KAAKwH,MAAK,WACf,MAAMnd,EAAO6kB,GAAS5J,oBAAoBtF,KAAM6E,GAChD,GAAsB,iBAAXf,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,CACF,GACF,EAOFvD,GAAac,GAAGhc,SAAUqpB,GAAwBK,IAAwB,SAAU3P,IAErD,MAAzBA,EAAM7S,OAAO0a,SAAmB7H,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAekH,UAC/E7H,EAAMkD,iBAER,IAAK,MAAM/iB,KAAWsmB,GAAee,gCAAgC5G,MACnEkP,GAAS5J,oBAAoB/lB,EAAS,CACpCooB,QAAQ,IACPA,QAEP,IAMAxL,GAAmB+S,IAcnB,MAAMqB,GAAS,WAETC,GAAc,eACdC,GAAiB,YAGjBC,GAAiB,UACjBC,GAAmB,YAGnBC,GAAe,OAAOJ,KACtBK,GAAiB,SAASL,KAC1BM,GAAe,OAAON,KACtBO,GAAgB,QAAQP,KACxBQ,GAAyB,QAAQR,KAAcC,KAC/CQ,GAAyB,UAAUT,KAAcC,KACjDS,GAAuB,QAAQV,KAAcC,KAC7CU,GAAoB,OAMpBC,GAAyB,4DACzBC,GAA6B,GAAGD,MAA0BD,KAC1DG,GAAgB,iBAIhBC,GAAgBtV,KAAU,UAAY,YACtCuV,GAAmBvV,KAAU,YAAc,UAC3CwV,GAAmBxV,KAAU,aAAe,eAC5CyV,GAAsBzV,KAAU,eAAiB,aACjD0V,GAAkB1V,KAAU,aAAe,cAC3C2V,GAAiB3V,KAAU,cAAgB,aAG3C4V,GAAY,CAChBC,WAAW,EACX7jB,SAAU,kBACV8jB,QAAS,UACT/pB,OAAQ,CAAC,EAAG,GACZgqB,aAAc,KACd1zB,UAAW,UAEP2zB,GAAgB,CACpBH,UAAW,mBACX7jB,SAAU,mBACV8jB,QAAS,SACT/pB,OAAQ,0BACRgqB,aAAc,yBACd1zB,UAAW,2BAOb,MAAM4zB,WAAiBxN,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmS,QAAU,KACfnS,KAAKoS,QAAUpS,KAAK4E,SAAS7f,WAE7Bib,KAAKqS,MAAQxM,GAAehhB,KAAKmb,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeM,KAAKnG,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeC,QAAQwL,GAAetR,KAAKoS,SACxKpS,KAAKsS,UAAYtS,KAAKuS,eACxB,CAGA,kBAAW7O,GACT,OAAOmO,EACT,CACA,sBAAWlO,GACT,OAAOsO,EACT,CACA,eAAW1V,GACT,OAAOgU,EACT,CAGA,MAAA5I,GACE,OAAO3H,KAAK2P,WAAa3P,KAAK4P,OAAS5P,KAAK6P,MAC9C,CACA,IAAAA,GACE,GAAI3U,GAAW8E,KAAK4E,WAAa5E,KAAK2P,WACpC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAGtB,IADkBrE,GAAaqB,QAAQ5B,KAAK4E,SAAUkM,GAAchR,GACtDkC,iBAAd,CASA,GANAhC,KAAKwS,gBAMD,iBAAkBntB,SAASC,kBAAoB0a,KAAKoS,QAAQpX,QAzExC,eA0EtB,IAAK,MAAMzb,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAG1CoE,KAAK4E,SAAS6N,QACdzS,KAAK4E,SAASxjB,aAAa,iBAAiB,GAC5C4e,KAAKqS,MAAMhX,UAAU5E,IAAI0a,IACzBnR,KAAK4E,SAASvJ,UAAU5E,IAAI0a,IAC5B5Q,GAAaqB,QAAQ5B,KAAK4E,SAAUmM,GAAejR,EAhBnD,CAiBF,CACA,IAAA8P,GACE,GAAI1U,GAAW8E,KAAK4E,YAAc5E,KAAK2P,WACrC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAEtB5E,KAAK0S,cAAc5S,EACrB,CACA,OAAAiF,GACM/E,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEf2L,MAAMI,SACR,CACA,MAAAha,GACEiV,KAAKsS,UAAYtS,KAAKuS,gBAClBvS,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,aAAA2nB,CAAc5S,GAEZ,IADkBS,GAAaqB,QAAQ5B,KAAK4E,SAAUgM,GAAc9Q,GACtDkC,iBAAd,CAMA,GAAI,iBAAkB3c,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAGvCoE,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEfgH,KAAKqS,MAAMhX,UAAU1B,OAAOwX,IAC5BnR,KAAK4E,SAASvJ,UAAU1B,OAAOwX,IAC/BnR,KAAK4E,SAASxjB,aAAa,gBAAiB,SAC5C4hB,GAAYE,oBAAoBlD,KAAKqS,MAAO,UAC5C9R,GAAaqB,QAAQ5B,KAAK4E,SAAUiM,GAAgB/Q,EAhBpD,CAiBF,CACA,UAAA+D,CAAWC,GAET,GAAgC,iBADhCA,EAASa,MAAMd,WAAWC,IACRxlB,YAA2B,GAAUwlB,EAAOxlB,YAAgE,mBAA3CwlB,EAAOxlB,UAAUgF,sBAElG,MAAM,IAAIkhB,UAAU,GAAG+L,GAAO9L,+GAEhC,OAAOX,CACT,CACA,aAAA0O,GACE,QAAsB,IAAX,EACT,MAAM,IAAIhO,UAAU,gEAEtB,IAAImO,EAAmB3S,KAAK4E,SACG,WAA3B5E,KAAK6E,QAAQvmB,UACfq0B,EAAmB3S,KAAKoS,QACf,GAAUpS,KAAK6E,QAAQvmB,WAChCq0B,EAAmBjY,GAAWsF,KAAK6E,QAAQvmB,WACA,iBAA3B0hB,KAAK6E,QAAQvmB,YAC7Bq0B,EAAmB3S,KAAK6E,QAAQvmB,WAElC,MAAM0zB,EAAehS,KAAK4S,mBAC1B5S,KAAKmS,QAAU,GAAoBQ,EAAkB3S,KAAKqS,MAAOL,EACnE,CACA,QAAArC,GACE,OAAO3P,KAAKqS,MAAMhX,UAAU7W,SAAS2sB,GACvC,CACA,aAAA0B,GACE,MAAMC,EAAiB9S,KAAKoS,QAC5B,GAAIU,EAAezX,UAAU7W,SArKN,WAsKrB,OAAOmtB,GAET,GAAImB,EAAezX,UAAU7W,SAvKJ,aAwKvB,OAAOotB,GAET,GAAIkB,EAAezX,UAAU7W,SAzKA,iBA0K3B,MA5JsB,MA8JxB,GAAIsuB,EAAezX,UAAU7W,SA3KE,mBA4K7B,MA9JyB,SAkK3B,MAAMuuB,EAAkF,QAA1E9tB,iBAAiB+a,KAAKqS,OAAOvX,iBAAiB,iBAAiB6K,OAC7E,OAAImN,EAAezX,UAAU7W,SArLP,UAsLbuuB,EAAQvB,GAAmBD,GAE7BwB,EAAQrB,GAAsBD,EACvC,CACA,aAAAc,GACE,OAAkD,OAA3CvS,KAAK4E,SAAS5J,QAnLD,UAoLtB,CACA,UAAAgY,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,gBAAA4qB,GACE,MAAMM,EAAwB,CAC5Bx0B,UAAWshB,KAAK6S,gBAChBzc,UAAW,CAAC,CACV9V,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,iBAanB,OAPIhT,KAAKsS,WAAsC,WAAzBtS,KAAK6E,QAAQkN,WACjC/O,GAAYC,iBAAiBjD,KAAKqS,MAAO,SAAU,UACnDa,EAAsB9c,UAAY,CAAC,CACjC9V,KAAM,cACNC,SAAS,KAGN,IACF2yB,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,eAAAC,EAAgB,IACdr2B,EAAG,OACHyP,IAEA,MAAMggB,EAAQ1G,GAAe1T,KAhOF,8DAgO+B6N,KAAKqS,OAAOlsB,QAAO5G,GAAWob,GAAUpb,KAC7FgtB,EAAM7b,QAMXoN,GAAqByO,EAAOhgB,EAAQzP,IAAQ6zB,IAAmBpE,EAAMnL,SAAS7U,IAASkmB,OACzF,CAGA,sBAAOhW,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6nB,GAAS5M,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,CACA,iBAAOsP,CAAWhU,GAChB,GA5QuB,IA4QnBA,EAAMwI,QAAgD,UAAfxI,EAAMqB,MA/QnC,QA+QuDrB,EAAMtiB,IACzE,OAEF,MAAMu2B,EAAcxN,GAAe1T,KAAKkf,IACxC,IAAK,MAAM1J,KAAU0L,EAAa,CAChC,MAAMC,EAAUpB,GAAS7M,YAAYsC,GACrC,IAAK2L,IAAyC,IAA9BA,EAAQzO,QAAQiN,UAC9B,SAEF,MAAMyB,EAAenU,EAAMmU,eACrBC,EAAeD,EAAanS,SAASkS,EAAQjB,OACnD,GAAIkB,EAAanS,SAASkS,EAAQ1O,WAA2C,WAA9B0O,EAAQzO,QAAQiN,YAA2B0B,GAA8C,YAA9BF,EAAQzO,QAAQiN,WAA2B0B,EACnJ,SAIF,GAAIF,EAAQjB,MAAM7tB,SAAS4a,EAAM7S,UAA2B,UAAf6S,EAAMqB,MA/RvC,QA+R2DrB,EAAMtiB,KAAqB,qCAAqCuG,KAAK+b,EAAM7S,OAAO0a,UACvJ,SAEF,MAAMnH,EAAgB,CACpBA,cAAewT,EAAQ1O,UAEN,UAAfxF,EAAMqB,OACRX,EAAckH,WAAa5H,GAE7BkU,EAAQZ,cAAc5S,EACxB,CACF,CACA,4BAAO2T,CAAsBrU,GAI3B,MAAMsU,EAAU,kBAAkBrwB,KAAK+b,EAAM7S,OAAO0a,SAC9C0M,EAjTW,WAiTKvU,EAAMtiB,IACtB82B,EAAkB,CAAClD,GAAgBC,IAAkBvP,SAAShC,EAAMtiB,KAC1E,IAAK82B,IAAoBD,EACvB,OAEF,GAAID,IAAYC,EACd,OAEFvU,EAAMkD,iBAGN,MAAMuR,EAAkB7T,KAAKgG,QAAQoL,IAA0BpR,KAAO6F,GAAeM,KAAKnG,KAAMoR,IAAwB,IAAMvL,GAAehhB,KAAKmb,KAAMoR,IAAwB,IAAMvL,GAAeC,QAAQsL,GAAwBhS,EAAMW,eAAehb,YACpPwF,EAAW2nB,GAAS5M,oBAAoBuO,GAC9C,GAAID,EAIF,OAHAxU,EAAM0U,kBACNvpB,EAASslB,YACTtlB,EAAS4oB,gBAAgB/T,GAGvB7U,EAASolB,aAEXvQ,EAAM0U,kBACNvpB,EAASqlB,OACTiE,EAAgBpB,QAEpB,EAOFlS,GAAac,GAAGhc,SAAU4rB,GAAwBG,GAAwBc,GAASuB,uBACnFlT,GAAac,GAAGhc,SAAU4rB,GAAwBK,GAAeY,GAASuB,uBAC1ElT,GAAac,GAAGhc,SAAU2rB,GAAwBkB,GAASkB,YAC3D7S,GAAac,GAAGhc,SAAU6rB,GAAsBgB,GAASkB,YACzD7S,GAAac,GAAGhc,SAAU2rB,GAAwBI,IAAwB,SAAUhS,GAClFA,EAAMkD,iBACN4P,GAAS5M,oBAAoBtF,MAAM2H,QACrC,IAMAxL,GAAmB+V,IAcnB,MAAM6B,GAAS,WAETC,GAAoB,OACpBC,GAAkB,gBAAgBF,KAClCG,GAAY,CAChBC,UAAW,iBACXC,cAAe,KACfhP,YAAY,EACZzK,WAAW,EAEX0Z,YAAa,QAETC,GAAgB,CACpBH,UAAW,SACXC,cAAe,kBACfhP,WAAY,UACZzK,UAAW,UACX0Z,YAAa,oBAOf,MAAME,WAAiB9Q,GACrB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwU,aAAc,EACnBxU,KAAK4E,SAAW,IAClB,CAGA,kBAAWlB,GACT,OAAOwQ,EACT,CACA,sBAAWvQ,GACT,OAAO2Q,EACT,CACA,eAAW/X,GACT,OAAOwX,EACT,CAGA,IAAAlE,CAAKxT,GACH,IAAK2D,KAAK6E,QAAQlK,UAEhB,YADAkC,GAAQR,GAGV2D,KAAKyU,UACL,MAAMl1B,EAAUygB,KAAK0U,cACjB1U,KAAK6E,QAAQO,YACfvJ,GAAOtc,GAETA,EAAQ8b,UAAU5E,IAAIud,IACtBhU,KAAK2U,mBAAkB,KACrB9X,GAAQR,EAAS,GAErB,CACA,IAAAuT,CAAKvT,GACE2D,KAAK6E,QAAQlK,WAIlBqF,KAAK0U,cAAcrZ,UAAU1B,OAAOqa,IACpChU,KAAK2U,mBAAkB,KACrB3U,KAAK+E,UACLlI,GAAQR,EAAS,KANjBQ,GAAQR,EAQZ,CACA,OAAA0I,GACO/E,KAAKwU,cAGVjU,GAAaC,IAAIR,KAAK4E,SAAUqP,IAChCjU,KAAK4E,SAASjL,SACdqG,KAAKwU,aAAc,EACrB,CAGA,WAAAE,GACE,IAAK1U,KAAK4E,SAAU,CAClB,MAAMgQ,EAAWvvB,SAASwvB,cAAc,OACxCD,EAAST,UAAYnU,KAAK6E,QAAQsP,UAC9BnU,KAAK6E,QAAQO,YACfwP,EAASvZ,UAAU5E,IApFD,QAsFpBuJ,KAAK4E,SAAWgQ,CAClB,CACA,OAAO5U,KAAK4E,QACd,CACA,iBAAAZ,CAAkBF,GAGhB,OADAA,EAAOuQ,YAAc3Z,GAAWoJ,EAAOuQ,aAChCvQ,CACT,CACA,OAAA2Q,GACE,GAAIzU,KAAKwU,YACP,OAEF,MAAMj1B,EAAUygB,KAAK0U,cACrB1U,KAAK6E,QAAQwP,YAAYS,OAAOv1B,GAChCghB,GAAac,GAAG9hB,EAAS00B,IAAiB,KACxCpX,GAAQmD,KAAK6E,QAAQuP,cAAc,IAErCpU,KAAKwU,aAAc,CACrB,CACA,iBAAAG,CAAkBtY,GAChBW,GAAuBX,EAAU2D,KAAK0U,cAAe1U,KAAK6E,QAAQO,WACpE,EAeF,MAEM2P,GAAc,gBACdC,GAAkB,UAAUD,KAC5BE,GAAoB,cAAcF,KAGlCG,GAAmB,WACnBC,GAAY,CAChBC,WAAW,EACXC,YAAa,MAETC,GAAgB,CACpBF,UAAW,UACXC,YAAa,WAOf,MAAME,WAAkB9R,GACtB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwV,WAAY,EACjBxV,KAAKyV,qBAAuB,IAC9B,CAGA,kBAAW/R,GACT,OAAOyR,EACT,CACA,sBAAWxR,GACT,OAAO2R,EACT,CACA,eAAW/Y,GACT,MArCW,WAsCb,CAGA,QAAAmZ,GACM1V,KAAKwV,YAGLxV,KAAK6E,QAAQuQ,WACfpV,KAAK6E,QAAQwQ,YAAY5C,QAE3BlS,GAAaC,IAAInb,SAAU0vB,IAC3BxU,GAAac,GAAGhc,SAAU2vB,IAAiB5V,GAASY,KAAK2V,eAAevW,KACxEmB,GAAac,GAAGhc,SAAU4vB,IAAmB7V,GAASY,KAAK4V,eAAexW,KAC1EY,KAAKwV,WAAY,EACnB,CACA,UAAAK,GACO7V,KAAKwV,YAGVxV,KAAKwV,WAAY,EACjBjV,GAAaC,IAAInb,SAAU0vB,IAC7B,CAGA,cAAAY,CAAevW,GACb,MAAM,YACJiW,GACErV,KAAK6E,QACT,GAAIzF,EAAM7S,SAAWlH,UAAY+Z,EAAM7S,SAAW8oB,GAAeA,EAAY7wB,SAAS4a,EAAM7S,QAC1F,OAEF,MAAM1L,EAAWglB,GAAeU,kBAAkB8O,GAC1B,IAApBx0B,EAAS6P,OACX2kB,EAAY5C,QACHzS,KAAKyV,uBAAyBP,GACvCr0B,EAASA,EAAS6P,OAAS,GAAG+hB,QAE9B5xB,EAAS,GAAG4xB,OAEhB,CACA,cAAAmD,CAAexW,GAzED,QA0ERA,EAAMtiB,MAGVkjB,KAAKyV,qBAAuBrW,EAAM0W,SAAWZ,GA5EzB,UA6EtB,EAeF,MAAMa,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAMxB,MAAMC,GACJ,WAAAhS,GACEnE,KAAK4E,SAAWvf,SAAS6G,IAC3B,CAGA,QAAAkqB,GAEE,MAAMC,EAAgBhxB,SAASC,gBAAgBuC,YAC/C,OAAO1F,KAAKoC,IAAI3E,OAAO02B,WAAaD,EACtC,CACA,IAAAzG,GACE,MAAM/rB,EAAQmc,KAAKoW,WACnBpW,KAAKuW,mBAELvW,KAAKwW,sBAAsBxW,KAAK4E,SAAUqR,IAAkBQ,GAAmBA,EAAkB5yB,IAEjGmc,KAAKwW,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkB5yB,IAC1Gmc,KAAKwW,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkB5yB,GAC5G,CACA,KAAAwO,GACE2N,KAAK0W,wBAAwB1W,KAAK4E,SAAU,YAC5C5E,KAAK0W,wBAAwB1W,KAAK4E,SAAUqR,IAC5CjW,KAAK0W,wBAAwBX,GAAwBE,IACrDjW,KAAK0W,wBAAwBV,GAAyBE,GACxD,CACA,aAAAS,GACE,OAAO3W,KAAKoW,WAAa,CAC3B,CAGA,gBAAAG,GACEvW,KAAK4W,sBAAsB5W,KAAK4E,SAAU,YAC1C5E,KAAK4E,SAAS7jB,MAAM+K,SAAW,QACjC,CACA,qBAAA0qB,CAAsBzc,EAAU8c,EAAexa,GAC7C,MAAMya,EAAiB9W,KAAKoW,WAS5BpW,KAAK+W,2BAA2Bhd,GARHxa,IAC3B,GAAIA,IAAYygB,KAAK4E,UAAYhlB,OAAO02B,WAAa/2B,EAAQsI,YAAcivB,EACzE,OAEF9W,KAAK4W,sBAAsBr3B,EAASs3B,GACpC,MAAMJ,EAAkB72B,OAAOqF,iBAAiB1F,GAASub,iBAAiB+b,GAC1Et3B,EAAQwB,MAAMi2B,YAAYH,EAAe,GAAGxa,EAASkB,OAAOC,WAAWiZ,QAAsB,GAGjG,CACA,qBAAAG,CAAsBr3B,EAASs3B,GAC7B,MAAMI,EAAc13B,EAAQwB,MAAM+Z,iBAAiB+b,GAC/CI,GACFjU,GAAYC,iBAAiB1jB,EAASs3B,EAAeI,EAEzD,CACA,uBAAAP,CAAwB3c,EAAU8c,GAWhC7W,KAAK+W,2BAA2Bhd,GAVHxa,IAC3B,MAAM5B,EAAQqlB,GAAYQ,iBAAiBjkB,EAASs3B,GAEtC,OAAVl5B,GAIJqlB,GAAYE,oBAAoB3jB,EAASs3B,GACzCt3B,EAAQwB,MAAMi2B,YAAYH,EAAel5B,IAJvC4B,EAAQwB,MAAMm2B,eAAeL,EAIgB,GAGnD,CACA,0BAAAE,CAA2Bhd,EAAUod,GACnC,GAAI,GAAUpd,GACZod,EAASpd,QAGX,IAAK,MAAM6L,KAAOC,GAAe1T,KAAK4H,EAAUiG,KAAK4E,UACnDuS,EAASvR,EAEb,EAeF,MAEMwR,GAAc,YAGdC,GAAe,OAAOD,KACtBE,GAAyB,gBAAgBF,KACzCG,GAAiB,SAASH,KAC1BI,GAAe,OAAOJ,KACtBK,GAAgB,QAAQL,KACxBM,GAAiB,SAASN,KAC1BO,GAAsB,gBAAgBP,KACtCQ,GAA0B,oBAAoBR,KAC9CS,GAA0B,kBAAkBT,KAC5CU,GAAyB,QAAQV,cACjCW,GAAkB,aAElBC,GAAoB,OACpBC,GAAoB,eAKpBC,GAAY,CAChBtD,UAAU,EACVnC,OAAO,EACPzH,UAAU,GAENmN,GAAgB,CACpBvD,SAAU,mBACVnC,MAAO,UACPzH,SAAU,WAOZ,MAAMoN,WAAc1T,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKqY,QAAUxS,GAAeC,QArBV,gBAqBmC9F,KAAK4E,UAC5D5E,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAa,IAAIvC,GACtBnW,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAOwU,EACT,CACA,sBAAWvU,GACT,OAAOwU,EACT,CACA,eAAW5b,GACT,MA1DW,OA2Db,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAAY3P,KAAKmP,kBAGR5O,GAAaqB,QAAQ5B,KAAK4E,SAAU4S,GAAc,CAClE1X,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAW9I,OAChBvqB,SAAS6G,KAAKmP,UAAU5E,IAAIshB,IAC5B/X,KAAK2Y,gBACL3Y,KAAKsY,UAAUzI,MAAK,IAAM7P,KAAK4Y,aAAa9Y,KAC9C,CACA,IAAA8P,GACO5P,KAAK2P,WAAY3P,KAAKmP,mBAGT5O,GAAaqB,QAAQ5B,KAAK4E,SAAUyS,IACxCrV,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASvJ,UAAU1B,OAAOqe,IAC/BhY,KAAKmF,gBAAe,IAAMnF,KAAK6Y,cAAc7Y,KAAK4E,SAAU5E,KAAKgO,gBACnE,CACA,OAAAjJ,GACExE,GAAaC,IAAI5gB,OAAQw3B,IACzB7W,GAAaC,IAAIR,KAAKqY,QAASjB,IAC/BpX,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CACA,YAAA+T,GACE9Y,KAAK2Y,eACP,CAGA,mBAAAJ,GACE,OAAO,IAAIhE,GAAS,CAClB5Z,UAAWmG,QAAQd,KAAK6E,QAAQ+P,UAEhCxP,WAAYpF,KAAKgO,eAErB,CACA,oBAAAyK,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,YAAAgU,CAAa9Y,GAENza,SAAS6G,KAAK1H,SAASwb,KAAK4E,WAC/Bvf,SAAS6G,KAAK4oB,OAAO9U,KAAK4E,UAE5B5E,KAAK4E,SAAS7jB,MAAMgxB,QAAU,QAC9B/R,KAAK4E,SAASzjB,gBAAgB,eAC9B6e,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASnZ,UAAY,EAC1B,MAAMstB,EAAYlT,GAAeC,QA7GT,cA6GsC9F,KAAKqY,SAC/DU,IACFA,EAAUttB,UAAY,GAExBoQ,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIuhB,IAU5BhY,KAAKmF,gBATsB,KACrBnF,KAAK6E,QAAQ4N,OACfzS,KAAKwY,WAAW9C,WAElB1V,KAAKmP,kBAAmB,EACxB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU6S,GAAe,CACjD3X,iBACA,GAEoCE,KAAKqY,QAASrY,KAAKgO,cAC7D,CACA,kBAAAnC,GACEtL,GAAac,GAAGrB,KAAK4E,SAAUiT,IAAyBzY,IAhJvC,WAiJXA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGP5P,KAAKgZ,6BAA4B,IAEnCzY,GAAac,GAAGzhB,OAAQ83B,IAAgB,KAClC1X,KAAK2P,WAAa3P,KAAKmP,kBACzBnP,KAAK2Y,eACP,IAEFpY,GAAac,GAAGrB,KAAK4E,SAAUgT,IAAyBxY,IAEtDmB,GAAae,IAAItB,KAAK4E,SAAU+S,IAAqBsB,IAC/CjZ,KAAK4E,WAAaxF,EAAM7S,QAAUyT,KAAK4E,WAAaqU,EAAO1sB,SAGjC,WAA1ByT,KAAK6E,QAAQ+P,SAIb5U,KAAK6E,QAAQ+P,UACf5U,KAAK4P,OAJL5P,KAAKgZ,6BAKP,GACA,GAEN,CACA,UAAAH,GACE7Y,KAAK4E,SAAS7jB,MAAMgxB,QAAU,OAC9B/R,KAAK4E,SAASxjB,aAAa,eAAe,GAC1C4e,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QAC9B6e,KAAKmP,kBAAmB,EACxBnP,KAAKsY,UAAU1I,MAAK,KAClBvqB,SAAS6G,KAAKmP,UAAU1B,OAAOoe,IAC/B/X,KAAKkZ,oBACLlZ,KAAK0Y,WAAWrmB,QAChBkO,GAAaqB,QAAQ5B,KAAK4E,SAAU2S,GAAe,GAEvD,CACA,WAAAvJ,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAjLT,OAkLxB,CACA,0BAAAw0B,GAEE,GADkBzY,GAAaqB,QAAQ5B,KAAK4E,SAAU0S,IACxCtV,iBACZ,OAEF,MAAMmX,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EwxB,EAAmBpZ,KAAK4E,SAAS7jB,MAAMiL,UAEpB,WAArBotB,GAAiCpZ,KAAK4E,SAASvJ,UAAU7W,SAASyzB,MAGjEkB,IACHnZ,KAAK4E,SAAS7jB,MAAMiL,UAAY,UAElCgU,KAAK4E,SAASvJ,UAAU5E,IAAIwhB,IAC5BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAASvJ,UAAU1B,OAAOse,IAC/BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAAS7jB,MAAMiL,UAAYotB,CAAgB,GAC/CpZ,KAAKqY,QAAQ,GACfrY,KAAKqY,SACRrY,KAAK4E,SAAS6N,QAChB,CAMA,aAAAkG,GACE,MAAMQ,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EkvB,EAAiB9W,KAAK0Y,WAAWtC,WACjCiD,EAAoBvC,EAAiB,EAC3C,GAAIuC,IAAsBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,cAAgB,eAC3C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACA,IAAKuC,GAAqBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,eAAiB,cAC5C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACF,CACA,iBAAAoC,GACElZ,KAAK4E,SAAS7jB,MAAMu4B,YAAc,GAClCtZ,KAAK4E,SAAS7jB,MAAMw4B,aAAe,EACrC,CAGA,sBAAO9c,CAAgBqH,EAAQhE,GAC7B,OAAOE,KAAKwH,MAAK,WACf,MAAMnd,EAAO+tB,GAAM9S,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQhE,EAJb,CAKF,GACF,EAOFS,GAAac,GAAGhc,SAAUyyB,GA9OK,4BA8O2C,SAAU1Y,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACjD,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAER/B,GAAae,IAAI/U,EAAQirB,IAAcgC,IACjCA,EAAUxX,kBAIdzB,GAAae,IAAI/U,EAAQgrB,IAAgB,KACnC5c,GAAUqF,OACZA,KAAKyS,OACP,GACA,IAIJ,MAAMgH,EAAc5T,GAAeC,QAnQb,eAoQlB2T,GACFrB,GAAM/S,YAAYoU,GAAa7J,OAEpBwI,GAAM9S,oBAAoB/Y,GAClCob,OAAO3H,KACd,IACA6G,GAAqBuR,IAMrBjc,GAAmBic,IAcnB,MAEMsB,GAAc,gBACdC,GAAiB,YACjBC,GAAwB,OAAOF,KAAcC,KAE7CE,GAAoB,OACpBC,GAAuB,UACvBC,GAAoB,SAEpBC,GAAgB,kBAChBC,GAAe,OAAOP,KACtBQ,GAAgB,QAAQR,KACxBS,GAAe,OAAOT,KACtBU,GAAuB,gBAAgBV,KACvCW,GAAiB,SAASX,KAC1BY,GAAe,SAASZ,KACxBa,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAwB,kBAAkBd,KAE1Ce,GAAY,CAChB7F,UAAU,EACV5J,UAAU,EACVvgB,QAAQ,GAEJiwB,GAAgB,CACpB9F,SAAU,mBACV5J,SAAU,UACVvgB,OAAQ,WAOV,MAAMkwB,WAAkBjW,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAO+W,EACT,CACA,sBAAW9W,GACT,OAAO+W,EACT,CACA,eAAWne,GACT,MApDW,WAqDb,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAGSpP,GAAaqB,QAAQ5B,KAAK4E,SAAUqV,GAAc,CAClEna,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAUzI,OACV7P,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkBvG,OAExB5P,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASvJ,UAAU5E,IAAIqjB,IAW5B9Z,KAAKmF,gBAVoB,KAClBnF,KAAK6E,QAAQpa,SAAUuV,KAAK6E,QAAQ+P,UACvC5U,KAAKwY,WAAW9C,WAElB1V,KAAK4E,SAASvJ,UAAU5E,IAAIojB,IAC5B7Z,KAAK4E,SAASvJ,UAAU1B,OAAOmgB,IAC/BvZ,GAAaqB,QAAQ5B,KAAK4E,SAAUsV,GAAe,CACjDpa,iBACA,GAEkCE,KAAK4E,UAAU,GACvD,CACA,IAAAgL,GACO5P,KAAK2P,WAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAUuV,IACxCnY,mBAGdhC,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASgW,OACd5a,KAAK2P,UAAW,EAChB3P,KAAK4E,SAASvJ,UAAU5E,IAAIsjB,IAC5B/Z,KAAKsY,UAAU1I,OAUf5P,KAAKmF,gBAToB,KACvBnF,KAAK4E,SAASvJ,UAAU1B,OAAOkgB,GAAmBE,IAClD/Z,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QACzB6e,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkB9jB,QAExBkO,GAAaqB,QAAQ5B,KAAK4E,SAAUyV,GAAe,GAEfra,KAAK4E,UAAU,IACvD,CACA,OAAAG,GACE/E,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CAGA,mBAAAwT,GACE,MASM5d,EAAYmG,QAAQd,KAAK6E,QAAQ+P,UACvC,OAAO,IAAIL,GAAS,CAClBJ,UA3HsB,qBA4HtBxZ,YACAyK,YAAY,EACZiP,YAAarU,KAAK4E,SAAS7f,WAC3BqvB,cAAezZ,EAfK,KACU,WAA1BqF,KAAK6E,QAAQ+P,SAIjB5U,KAAK4P,OAHHrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,GAG3B,EAUgC,MAE/C,CACA,oBAAA3B,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,kBAAAiH,GACEtL,GAAac,GAAGrB,KAAK4E,SAAU4V,IAAuBpb,IA5IvC,WA6ITA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGPrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,IAAqB,GAE7D,CAGA,sBAAO3d,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOswB,GAAUrV,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOFO,GAAac,GAAGhc,SAAUk1B,GA7JK,gCA6J2C,SAAUnb,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MAIrD,GAHI,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEFO,GAAae,IAAI/U,EAAQ8tB,IAAgB,KAEnC1f,GAAUqF,OACZA,KAAKyS,OACP,IAIF,MAAMgH,EAAc5T,GAAeC,QAAQkU,IACvCP,GAAeA,IAAgBltB,GACjCouB,GAAUtV,YAAYoU,GAAa7J,OAExB+K,GAAUrV,oBAAoB/Y,GACtCob,OAAO3H,KACd,IACAO,GAAac,GAAGzhB,OAAQg6B,IAAuB,KAC7C,IAAK,MAAM7f,KAAY8L,GAAe1T,KAAK6nB,IACzCW,GAAUrV,oBAAoBvL,GAAU8V,MAC1C,IAEFtP,GAAac,GAAGzhB,OAAQ06B,IAAc,KACpC,IAAK,MAAM/6B,KAAWsmB,GAAe1T,KAAK,gDACG,UAAvClN,iBAAiB1F,GAASiC,UAC5Bm5B,GAAUrV,oBAAoB/lB,GAASqwB,MAE3C,IAEF/I,GAAqB8T,IAMrBxe,GAAmBwe,IAUnB,MACME,GAAmB,CAEvB,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAHP,kBAI7BhqB,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/BiqB,KAAM,GACNhqB,EAAG,GACHiqB,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,GAAI,GACJC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJxqB,EAAG,GACH0b,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChD+O,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IAIAC,GAAgB,IAAIpmB,IAAI,CAAC,aAAc,OAAQ,OAAQ,WAAY,WAAY,SAAU,MAAO,eAShGqmB,GAAmB,0DACnBC,GAAmB,CAAC76B,EAAW86B,KACnC,MAAMC,EAAgB/6B,EAAUvC,SAASC,cACzC,OAAIo9B,EAAqBzb,SAAS0b,IAC5BJ,GAAc/lB,IAAImmB,IACbhc,QAAQ6b,GAAiBt5B,KAAKtB,EAAUg7B,YAM5CF,EAAqB12B,QAAO62B,GAAkBA,aAA0BzY,SAAQ9R,MAAKwqB,GAASA,EAAM55B,KAAKy5B,IAAe,EA0C3HI,GAAY,CAChBC,UAAWtC,GACXuC,QAAS,CAAC,EAEVC,WAAY,GACZxwB,MAAM,EACNywB,UAAU,EACVC,WAAY,KACZC,SAAU,eAENC,GAAgB,CACpBN,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZxwB,KAAM,UACNywB,SAAU,UACVC,WAAY,kBACZC,SAAU,UAENE,GAAqB,CACzBC,MAAO,iCACP5jB,SAAU,oBAOZ,MAAM6jB,WAAwBna,GAC5B,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,EACjC,CAGA,kBAAWJ,GACT,OAAOwZ,EACT,CACA,sBAAWvZ,GACT,OAAO8Z,EACT,CACA,eAAWlhB,GACT,MA3CW,iBA4Cb,CAGA,UAAAshB,GACE,OAAO7gC,OAAOmiB,OAAOa,KAAK6E,QAAQuY,SAASt6B,KAAIghB,GAAU9D,KAAK8d,yBAAyBha,KAAS3d,OAAO2a,QACzG,CACA,UAAAid,GACE,OAAO/d,KAAK6d,aAAantB,OAAS,CACpC,CACA,aAAAstB,CAAcZ,GAMZ,OALApd,KAAKie,cAAcb,GACnBpd,KAAK6E,QAAQuY,QAAU,IAClBpd,KAAK6E,QAAQuY,WACbA,GAEEpd,IACT,CACA,MAAAke,GACE,MAAMC,EAAkB94B,SAASwvB,cAAc,OAC/CsJ,EAAgBC,UAAYpe,KAAKqe,eAAere,KAAK6E,QAAQ2Y,UAC7D,IAAK,MAAOzjB,EAAUukB,KAASthC,OAAOmkB,QAAQnB,KAAK6E,QAAQuY,SACzDpd,KAAKue,YAAYJ,EAAiBG,EAAMvkB,GAE1C,MAAMyjB,EAAWW,EAAgBpY,SAAS,GACpCsX,EAAard,KAAK8d,yBAAyB9d,KAAK6E,QAAQwY,YAI9D,OAHIA,GACFG,EAASniB,UAAU5E,OAAO4mB,EAAWn7B,MAAM,MAEtCs7B,CACT,CAGA,gBAAAvZ,CAAiBH,GACfa,MAAMV,iBAAiBH,GACvB9D,KAAKie,cAAcna,EAAOsZ,QAC5B,CACA,aAAAa,CAAcO,GACZ,IAAK,MAAOzkB,EAAUqjB,KAAYpgC,OAAOmkB,QAAQqd,GAC/C7Z,MAAMV,iBAAiB,CACrBlK,WACA4jB,MAAOP,GACNM,GAEP,CACA,WAAAa,CAAYf,EAAUJ,EAASrjB,GAC7B,MAAM0kB,EAAkB5Y,GAAeC,QAAQ/L,EAAUyjB,GACpDiB,KAGLrB,EAAUpd,KAAK8d,yBAAyBV,IAKpC,GAAUA,GACZpd,KAAK0e,sBAAsBhkB,GAAW0iB,GAAUqB,GAG9Cze,KAAK6E,QAAQhY,KACf4xB,EAAgBL,UAAYpe,KAAKqe,eAAejB,GAGlDqB,EAAgBE,YAAcvB,EAX5BqB,EAAgB9kB,SAYpB,CACA,cAAA0kB,CAAeG,GACb,OAAOxe,KAAK6E,QAAQyY,SApJxB,SAAsBsB,EAAYzB,EAAW0B,GAC3C,IAAKD,EAAWluB,OACd,OAAOkuB,EAET,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAE1B,MACME,GADY,IAAIl/B,OAAOm/B,WACKC,gBAAgBJ,EAAY,aACxD/9B,EAAW,GAAGlC,UAAUmgC,EAAgB5yB,KAAKkU,iBAAiB,MACpE,IAAK,MAAM7gB,KAAWsB,EAAU,CAC9B,MAAMo+B,EAAc1/B,EAAQC,SAASC,cACrC,IAAKzC,OAAO4D,KAAKu8B,GAAW/b,SAAS6d,GAAc,CACjD1/B,EAAQoa,SACR,QACF,CACA,MAAMulB,EAAgB,GAAGvgC,UAAUY,EAAQ0B,YACrCk+B,EAAoB,GAAGxgC,OAAOw+B,EAAU,MAAQ,GAAIA,EAAU8B,IAAgB,IACpF,IAAK,MAAMl9B,KAAam9B,EACjBtC,GAAiB76B,EAAWo9B,IAC/B5/B,EAAQ4B,gBAAgBY,EAAUvC,SAGxC,CACA,OAAOs/B,EAAgB5yB,KAAKkyB,SAC9B,CA2HmCgB,CAAaZ,EAAKxe,KAAK6E,QAAQsY,UAAWnd,KAAK6E,QAAQ0Y,YAAciB,CACtG,CACA,wBAAAV,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,MACvB,CACA,qBAAA0e,CAAsBn/B,EAASk/B,GAC7B,GAAIze,KAAK6E,QAAQhY,KAGf,OAFA4xB,EAAgBL,UAAY,QAC5BK,EAAgB3J,OAAOv1B,GAGzBk/B,EAAgBE,YAAcp/B,EAAQo/B,WACxC,EAeF,MACMU,GAAwB,IAAI/oB,IAAI,CAAC,WAAY,YAAa,eAC1DgpB,GAAoB,OAEpBC,GAAoB,OACpBC,GAAyB,iBACzBC,GAAiB,SACjBC,GAAmB,gBACnBC,GAAgB,QAChBC,GAAgB,QAahBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAO/jB,KAAU,OAAS,QAC1BgkB,OAAQ,SACRC,KAAMjkB,KAAU,QAAU,QAEtBkkB,GAAY,CAChBhD,UAAWtC,GACXuF,WAAW,EACXnyB,SAAU,kBACVoyB,WAAW,EACXC,YAAa,GACbC,MAAO,EACPvwB,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/CnD,MAAM,EACN7E,OAAQ,CAAC,EAAG,GACZtJ,UAAW,MACXszB,aAAc,KACdsL,UAAU,EACVC,WAAY,KACZxjB,UAAU,EACVyjB,SAAU,+GACVgD,MAAO,GACP5e,QAAS,eAEL6e,GAAgB,CACpBtD,UAAW,SACXiD,UAAW,UACXnyB,SAAU,mBACVoyB,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACPvwB,mBAAoB,QACpBnD,KAAM,UACN7E,OAAQ,0BACRtJ,UAAW,oBACXszB,aAAc,yBACdsL,SAAU,UACVC,WAAY,kBACZxjB,SAAU,mBACVyjB,SAAU,SACVgD,MAAO,4BACP5e,QAAS,UAOX,MAAM8e,WAAgBhc,GACpB,WAAAP,CAAY5kB,EAASukB,GACnB,QAAsB,IAAX,EACT,MAAM,IAAIU,UAAU,+DAEtBG,MAAMplB,EAASukB,GAGf9D,KAAK2gB,YAAa,EAClB3gB,KAAK4gB,SAAW,EAChB5gB,KAAK6gB,WAAa,KAClB7gB,KAAK8gB,eAAiB,CAAC,EACvB9gB,KAAKmS,QAAU,KACfnS,KAAK+gB,iBAAmB,KACxB/gB,KAAKghB,YAAc,KAGnBhhB,KAAKihB,IAAM,KACXjhB,KAAKkhB,gBACAlhB,KAAK6E,QAAQ9K,UAChBiG,KAAKmhB,WAET,CAGA,kBAAWzd,GACT,OAAOyc,EACT,CACA,sBAAWxc,GACT,OAAO8c,EACT,CACA,eAAWlkB,GACT,MAxGW,SAyGb,CAGA,MAAA6kB,GACEphB,KAAK2gB,YAAa,CACpB,CACA,OAAAU,GACErhB,KAAK2gB,YAAa,CACpB,CACA,aAAAW,GACEthB,KAAK2gB,YAAc3gB,KAAK2gB,UAC1B,CACA,MAAAhZ,GACO3H,KAAK2gB,aAGV3gB,KAAK8gB,eAAeS,OAASvhB,KAAK8gB,eAAeS,MAC7CvhB,KAAK2P,WACP3P,KAAKwhB,SAGPxhB,KAAKyhB,SACP,CACA,OAAA1c,GACEmI,aAAalN,KAAK4gB,UAClBrgB,GAAaC,IAAIR,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,mBAC3E1hB,KAAK4E,SAASpJ,aAAa,2BAC7BwE,KAAK4E,SAASxjB,aAAa,QAAS4e,KAAK4E,SAASpJ,aAAa,2BAEjEwE,KAAK2hB,iBACLhd,MAAMI,SACR,CACA,IAAA8K,GACE,GAAoC,SAAhC7P,KAAK4E,SAAS7jB,MAAMgxB,QACtB,MAAM,IAAInO,MAAM,uCAElB,IAAM5D,KAAK4hB,mBAAoB5hB,KAAK2gB,WAClC,OAEF,MAAMnH,EAAYjZ,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAlItD,SAoIXqc,GADapmB,GAAeuE,KAAK4E,WACL5E,KAAK4E,SAAS9kB,cAAcwF,iBAAiBd,SAASwb,KAAK4E,UAC7F,GAAI4U,EAAUxX,mBAAqB6f,EACjC,OAIF7hB,KAAK2hB,iBACL,MAAMV,EAAMjhB,KAAK8hB,iBACjB9hB,KAAK4E,SAASxjB,aAAa,mBAAoB6/B,EAAIzlB,aAAa,OAChE,MAAM,UACJ6kB,GACErgB,KAAK6E,QAYT,GAXK7E,KAAK4E,SAAS9kB,cAAcwF,gBAAgBd,SAASwb,KAAKihB,OAC7DZ,EAAUvL,OAAOmM,GACjB1gB,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhJpC,cAkJnBxF,KAAKmS,QAAUnS,KAAKwS,cAAcyO,GAClCA,EAAI5lB,UAAU5E,IAAI8oB,IAMd,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAU1CoE,KAAKmF,gBAPY,KACf5E,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhKrC,WAiKQ,IAApBxF,KAAK6gB,YACP7gB,KAAKwhB,SAEPxhB,KAAK6gB,YAAa,CAAK,GAEK7gB,KAAKihB,IAAKjhB,KAAKgO,cAC/C,CACA,IAAA4B,GACE,GAAK5P,KAAK2P,aAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UA/KtD,SAgLHxD,iBAAd,CAQA,GALYhC,KAAK8hB,iBACbzmB,UAAU1B,OAAO4lB,IAIjB,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAG3CoE,KAAK8gB,eAA4B,OAAI,EACrC9gB,KAAK8gB,eAAelB,KAAiB,EACrC5f,KAAK8gB,eAAenB,KAAiB,EACrC3f,KAAK6gB,WAAa,KAYlB7gB,KAAKmF,gBAVY,KACXnF,KAAK+hB,yBAGJ/hB,KAAK6gB,YACR7gB,KAAK2hB,iBAEP3hB,KAAK4E,SAASzjB,gBAAgB,oBAC9Bof,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAzMpC,WAyM8D,GAEnDxF,KAAKihB,IAAKjhB,KAAKgO,cA1B7C,CA2BF,CACA,MAAAjjB,GACMiV,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,cAAA62B,GACE,OAAO9gB,QAAQd,KAAKgiB,YACtB,CACA,cAAAF,GAIE,OAHK9hB,KAAKihB,MACRjhB,KAAKihB,IAAMjhB,KAAKiiB,kBAAkBjiB,KAAKghB,aAAehhB,KAAKkiB,2BAEtDliB,KAAKihB,GACd,CACA,iBAAAgB,CAAkB7E,GAChB,MAAM6D,EAAMjhB,KAAKmiB,oBAAoB/E,GAASc,SAG9C,IAAK+C,EACH,OAAO,KAETA,EAAI5lB,UAAU1B,OAAO2lB,GAAmBC,IAExC0B,EAAI5lB,UAAU5E,IAAI,MAAMuJ,KAAKmE,YAAY5H,aACzC,MAAM6lB,EAvuGKC,KACb,GACEA,GAAUlgC,KAAKmgC,MA/BH,IA+BSngC,KAAKogC,gBACnBl9B,SAASm9B,eAAeH,IACjC,OAAOA,CAAM,EAmuGGI,CAAOziB,KAAKmE,YAAY5H,MAAM1c,WAK5C,OAJAohC,EAAI7/B,aAAa,KAAMghC,GACnBpiB,KAAKgO,eACPiT,EAAI5lB,UAAU5E,IAAI6oB,IAEb2B,CACT,CACA,UAAAyB,CAAWtF,GACTpd,KAAKghB,YAAc5D,EACfpd,KAAK2P,aACP3P,KAAK2hB,iBACL3hB,KAAK6P,OAET,CACA,mBAAAsS,CAAoB/E,GAYlB,OAXIpd,KAAK+gB,iBACP/gB,KAAK+gB,iBAAiB/C,cAAcZ,GAEpCpd,KAAK+gB,iBAAmB,IAAInD,GAAgB,IACvC5d,KAAK6E,QAGRuY,UACAC,WAAYrd,KAAK8d,yBAAyB9d,KAAK6E,QAAQyb,eAGpDtgB,KAAK+gB,gBACd,CACA,sBAAAmB,GACE,MAAO,CACL,CAAC1C,IAAyBxf,KAAKgiB,YAEnC,CACA,SAAAA,GACE,OAAOhiB,KAAK8d,yBAAyB9d,KAAK6E,QAAQ2b,QAAUxgB,KAAK4E,SAASpJ,aAAa,yBACzF,CAGA,4BAAAmnB,CAA6BvjB,GAC3B,OAAOY,KAAKmE,YAAYmB,oBAAoBlG,EAAMW,eAAgBC,KAAK4iB,qBACzE,CACA,WAAA5U,GACE,OAAOhO,KAAK6E,QAAQub,WAAapgB,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS86B,GAC3E,CACA,QAAA3P,GACE,OAAO3P,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS+6B,GACjD,CACA,aAAA/M,CAAcyO,GACZ,MAAMviC,EAAYme,GAAQmD,KAAK6E,QAAQnmB,UAAW,CAACshB,KAAMihB,EAAKjhB,KAAK4E,WAC7Die,EAAahD,GAAcnhC,EAAU+lB,eAC3C,OAAO,GAAoBzE,KAAK4E,SAAUqc,EAAKjhB,KAAK4S,iBAAiBiQ,GACvE,CACA,UAAA7P,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,wBAAA81B,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,KAAK4E,UAC5B,CACA,gBAAAgO,CAAiBiQ,GACf,MAAM3P,EAAwB,CAC5Bx0B,UAAWmkC,EACXzsB,UAAW,CAAC,CACV9V,KAAM,OACNmB,QAAS,CACPuO,mBAAoBgQ,KAAK6E,QAAQ7U,qBAElC,CACD1P,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,eAEd,CACD1yB,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,QACNmB,QAAS,CACPlC,QAAS,IAAIygB,KAAKmE,YAAY5H,eAE/B,CACDjc,KAAM,kBACNC,SAAS,EACTC,MAAO,aACPC,GAAI4J,IAGF2V,KAAK8hB,iBAAiB1gC,aAAa,wBAAyBiJ,EAAK1J,MAAMjC,UAAU,KAIvF,MAAO,IACFw0B,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,aAAAgO,GACE,MAAM4B,EAAW9iB,KAAK6E,QAAQjD,QAAQ1f,MAAM,KAC5C,IAAK,MAAM0f,KAAWkhB,EACpB,GAAgB,UAAZlhB,EACFrB,GAAac,GAAGrB,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAjVlC,SAiV4DxF,KAAK6E,QAAQ9K,UAAUqF,IAC/EY,KAAK2iB,6BAA6BvjB,GAC1CuI,QAAQ,SAEb,GA3VU,WA2VN/F,EAA4B,CACrC,MAAMmhB,EAAUnhB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV5C,cAmV0ExF,KAAKmE,YAAYqB,UArV5F,WAsVVwd,EAAWphB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV7C,cAmV2ExF,KAAKmE,YAAYqB,UArV5F,YAsVjBjF,GAAac,GAAGrB,KAAK4E,SAAUme,EAAS/iB,KAAK6E,QAAQ9K,UAAUqF,IAC7D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,YAAf1hB,EAAMqB,KAAqBmf,GAAgBD,KAAiB,EACnFrM,EAAQmO,QAAQ,IAElBlhB,GAAac,GAAGrB,KAAK4E,SAAUoe,EAAUhjB,KAAK6E,QAAQ9K,UAAUqF,IAC9D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,aAAf1hB,EAAMqB,KAAsBmf,GAAgBD,IAAiBrM,EAAQ1O,SAASpgB,SAAS4a,EAAMU,eACpHwT,EAAQkO,QAAQ,GAEpB,CAEFxhB,KAAK0hB,kBAAoB,KACnB1hB,KAAK4E,UACP5E,KAAK4P,MACP,EAEFrP,GAAac,GAAGrB,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,kBAChF,CACA,SAAAP,GACE,MAAMX,EAAQxgB,KAAK4E,SAASpJ,aAAa,SACpCglB,IAGAxgB,KAAK4E,SAASpJ,aAAa,eAAkBwE,KAAK4E,SAAS+Z,YAAYhZ,QAC1E3F,KAAK4E,SAASxjB,aAAa,aAAco/B,GAE3CxgB,KAAK4E,SAASxjB,aAAa,yBAA0Bo/B,GACrDxgB,KAAK4E,SAASzjB,gBAAgB,SAChC,CACA,MAAAsgC,GACMzhB,KAAK2P,YAAc3P,KAAK6gB,WAC1B7gB,KAAK6gB,YAAa,GAGpB7gB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACXjjB,KAAK6gB,YACP7gB,KAAK6P,MACP,GACC7P,KAAK6E,QAAQ0b,MAAM1Q,MACxB,CACA,MAAA2R,GACMxhB,KAAK+hB,yBAGT/hB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACVjjB,KAAK6gB,YACR7gB,KAAK4P,MACP,GACC5P,KAAK6E,QAAQ0b,MAAM3Q,MACxB,CACA,WAAAqT,CAAYrlB,EAASslB,GACnBhW,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW/iB,WAAWD,EAASslB,EACtC,CACA,oBAAAnB,GACE,OAAO/kC,OAAOmiB,OAAOa,KAAK8gB,gBAAgB1f,UAAS,EACrD,CACA,UAAAyC,CAAWC,GACT,MAAMqf,EAAiBngB,GAAYG,kBAAkBnD,KAAK4E,UAC1D,IAAK,MAAMwe,KAAiBpmC,OAAO4D,KAAKuiC,GAClC9D,GAAsB1oB,IAAIysB,WACrBD,EAAeC,GAU1B,OAPAtf,EAAS,IACJqf,KACmB,iBAAXrf,GAAuBA,EAASA,EAAS,CAAC,GAEvDA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAchB,OAbAA,EAAOuc,WAAiC,IAArBvc,EAAOuc,UAAsBh7B,SAAS6G,KAAOwO,GAAWoJ,EAAOuc,WACtD,iBAAjBvc,EAAOyc,QAChBzc,EAAOyc,MAAQ,CACb1Q,KAAM/L,EAAOyc,MACb3Q,KAAM9L,EAAOyc,QAGW,iBAAjBzc,EAAO0c,QAChB1c,EAAO0c,MAAQ1c,EAAO0c,MAAM3gC,YAEA,iBAAnBikB,EAAOsZ,UAChBtZ,EAAOsZ,QAAUtZ,EAAOsZ,QAAQv9B,YAE3BikB,CACT,CACA,kBAAA8e,GACE,MAAM9e,EAAS,CAAC,EAChB,IAAK,MAAOhnB,EAAKa,KAAUX,OAAOmkB,QAAQnB,KAAK6E,SACzC7E,KAAKmE,YAAYT,QAAQ5mB,KAASa,IACpCmmB,EAAOhnB,GAAOa,GASlB,OANAmmB,EAAO/J,UAAW,EAClB+J,EAAOlC,QAAU,SAKVkC,CACT,CACA,cAAA6d,GACM3hB,KAAKmS,UACPnS,KAAKmS,QAAQnZ,UACbgH,KAAKmS,QAAU,MAEbnS,KAAKihB,MACPjhB,KAAKihB,IAAItnB,SACTqG,KAAKihB,IAAM,KAEf,CAGA,sBAAOxkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOq2B,GAAQpb,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBukB,IAcnB,MACM2C,GAAiB,kBACjBC,GAAmB,gBACnBC,GAAY,IACb7C,GAAQhd,QACX0Z,QAAS,GACTp1B,OAAQ,CAAC,EAAG,GACZtJ,UAAW,QACX8+B,SAAU,8IACV5b,QAAS,SAEL4hB,GAAgB,IACjB9C,GAAQ/c,YACXyZ,QAAS,kCAOX,MAAMqG,WAAgB/C,GAEpB,kBAAWhd,GACT,OAAO6f,EACT,CACA,sBAAW5f,GACT,OAAO6f,EACT,CACA,eAAWjnB,GACT,MA7BW,SA8Bb,CAGA,cAAAqlB,GACE,OAAO5hB,KAAKgiB,aAAehiB,KAAK0jB,aAClC,CAGA,sBAAAxB,GACE,MAAO,CACL,CAACmB,IAAiBrjB,KAAKgiB,YACvB,CAACsB,IAAmBtjB,KAAK0jB,cAE7B,CACA,WAAAA,GACE,OAAO1jB,KAAK8d,yBAAyB9d,KAAK6E,QAAQuY,QACpD,CAGA,sBAAO3gB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOo5B,GAAQne,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBsnB,IAcnB,MAEME,GAAc,gBAEdC,GAAiB,WAAWD,KAC5BE,GAAc,QAAQF,KACtBG,GAAwB,OAAOH,cAE/BI,GAAsB,SAEtBC,GAAwB,SAExBC,GAAqB,YAGrBC,GAAsB,GAAGD,mBAA+CA,uBAGxEE,GAAY,CAChBn8B,OAAQ,KAERo8B,WAAY,eACZC,cAAc,EACd93B,OAAQ,KACR+3B,UAAW,CAAC,GAAK,GAAK,IAElBC,GAAgB,CACpBv8B,OAAQ,gBAERo8B,WAAY,SACZC,aAAc,UACd93B,OAAQ,UACR+3B,UAAW,SAOb,MAAME,WAAkB9f,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GAGf9D,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B8O,KAAK2kB,aAA6D,YAA9C1/B,iBAAiB+a,KAAK4E,UAAU5Y,UAA0B,KAAOgU,KAAK4E,SAC1F5E,KAAK4kB,cAAgB,KACrB5kB,KAAK6kB,UAAY,KACjB7kB,KAAK8kB,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnBhlB,KAAKilB,SACP,CAGA,kBAAWvhB,GACT,OAAOygB,EACT,CACA,sBAAWxgB,GACT,OAAO4gB,EACT,CACA,eAAWhoB,GACT,MAhEW,WAiEb,CAGA,OAAA0oB,GACEjlB,KAAKklB,mCACLllB,KAAKmlB,2BACDnlB,KAAK6kB,UACP7kB,KAAK6kB,UAAUO,aAEfplB,KAAK6kB,UAAY7kB,KAAKqlB,kBAExB,IAAK,MAAMC,KAAWtlB,KAAK0kB,oBAAoBvlB,SAC7Ca,KAAK6kB,UAAUU,QAAQD,EAE3B,CACA,OAAAvgB,GACE/E,KAAK6kB,UAAUO,aACfzgB,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAShB,OAPAA,EAAOvX,OAASmO,GAAWoJ,EAAOvX,SAAWlH,SAAS6G,KAGtD4X,EAAOsgB,WAAatgB,EAAO9b,OAAS,GAAG8b,EAAO9b,oBAAsB8b,EAAOsgB,WAC3C,iBAArBtgB,EAAOwgB,YAChBxgB,EAAOwgB,UAAYxgB,EAAOwgB,UAAUpiC,MAAM,KAAKY,KAAInF,GAAS4f,OAAOC,WAAW7f,MAEzEmmB,CACT,CACA,wBAAAqhB,GACOnlB,KAAK6E,QAAQwf,eAKlB9jB,GAAaC,IAAIR,KAAK6E,QAAQtY,OAAQs3B,IACtCtjB,GAAac,GAAGrB,KAAK6E,QAAQtY,OAAQs3B,GAAaG,IAAuB5kB,IACvE,MAAMomB,EAAoBxlB,KAAK0kB,oBAAoBvnC,IAAIiiB,EAAM7S,OAAOtB,MACpE,GAAIu6B,EAAmB,CACrBpmB,EAAMkD,iBACN,MAAM3G,EAAOqE,KAAK2kB,cAAgB/kC,OAC5BmE,EAASyhC,EAAkBnhC,UAAY2b,KAAK4E,SAASvgB,UAC3D,GAAIsX,EAAK8pB,SAKP,YAJA9pB,EAAK8pB,SAAS,CACZ9jC,IAAKoC,EACL2hC,SAAU,WAMd/pB,EAAKlQ,UAAY1H,CACnB,KAEJ,CACA,eAAAshC,GACE,MAAM5jC,EAAU,CACdka,KAAMqE,KAAK2kB,aACXL,UAAWtkB,KAAK6E,QAAQyf,UACxBF,WAAYpkB,KAAK6E,QAAQuf,YAE3B,OAAO,IAAIuB,sBAAqBxkB,GAAWnB,KAAK4lB,kBAAkBzkB,IAAU1f,EAC9E,CAGA,iBAAAmkC,CAAkBzkB,GAChB,MAAM0kB,EAAgBlI,GAAS3d,KAAKykB,aAAatnC,IAAI,IAAIwgC,EAAMpxB,OAAO4N,MAChEub,EAAWiI,IACf3d,KAAK8kB,oBAAoBC,gBAAkBpH,EAAMpxB,OAAOlI,UACxD2b,KAAK8lB,SAASD,EAAclI,GAAO,EAE/BqH,GAAmBhlB,KAAK2kB,cAAgBt/B,SAASC,iBAAiBmG,UAClEs6B,EAAkBf,GAAmBhlB,KAAK8kB,oBAAoBE,gBACpEhlB,KAAK8kB,oBAAoBE,gBAAkBA,EAC3C,IAAK,MAAMrH,KAASxc,EAAS,CAC3B,IAAKwc,EAAMqI,eAAgB,CACzBhmB,KAAK4kB,cAAgB,KACrB5kB,KAAKimB,kBAAkBJ,EAAclI,IACrC,QACF,CACA,MAAMuI,EAA2BvI,EAAMpxB,OAAOlI,WAAa2b,KAAK8kB,oBAAoBC,gBAEpF,GAAIgB,GAAmBG,GAGrB,GAFAxQ,EAASiI,IAEJqH,EACH,YAMCe,GAAoBG,GACvBxQ,EAASiI,EAEb,CACF,CACA,gCAAAuH,GACEllB,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B,MAAMi1B,EAActgB,GAAe1T,KAAK6xB,GAAuBhkB,KAAK6E,QAAQtY,QAC5E,IAAK,MAAM65B,KAAUD,EAAa,CAEhC,IAAKC,EAAOn7B,MAAQiQ,GAAWkrB,GAC7B,SAEF,MAAMZ,EAAoB3f,GAAeC,QAAQugB,UAAUD,EAAOn7B,MAAO+U,KAAK4E,UAG1EjK,GAAU6qB,KACZxlB,KAAKykB,aAAa1yB,IAAIs0B,UAAUD,EAAOn7B,MAAOm7B,GAC9CpmB,KAAK0kB,oBAAoB3yB,IAAIq0B,EAAOn7B,KAAMu6B,GAE9C,CACF,CACA,QAAAM,CAASv5B,GACHyT,KAAK4kB,gBAAkBr4B,IAG3ByT,KAAKimB,kBAAkBjmB,KAAK6E,QAAQtY,QACpCyT,KAAK4kB,cAAgBr4B,EACrBA,EAAO8O,UAAU5E,IAAIstB,IACrB/jB,KAAKsmB,iBAAiB/5B,GACtBgU,GAAaqB,QAAQ5B,KAAK4E,SAAUgf,GAAgB,CAClD9jB,cAAevT,IAEnB,CACA,gBAAA+5B,CAAiB/5B,GAEf,GAAIA,EAAO8O,UAAU7W,SA9LQ,iBA+L3BqhB,GAAeC,QArLc,mBAqLsBvZ,EAAOyO,QAtLtC,cAsLkEK,UAAU5E,IAAIstB,SAGtG,IAAK,MAAMwC,KAAa1gB,GAAeI,QAAQ1Z,EA9LnB,qBAiM1B,IAAK,MAAMxJ,KAAQ8iB,GAAeM,KAAKogB,EAAWrC,IAChDnhC,EAAKsY,UAAU5E,IAAIstB,GAGzB,CACA,iBAAAkC,CAAkBxhC,GAChBA,EAAO4W,UAAU1B,OAAOoqB,IACxB,MAAMyC,EAAc3gB,GAAe1T,KAAK,GAAG6xB,MAAyBD,KAAuBt/B,GAC3F,IAAK,MAAM9E,KAAQ6mC,EACjB7mC,EAAK0b,UAAU1B,OAAOoqB,GAE1B,CAGA,sBAAOtnB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOm6B,GAAUlf,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGzhB,OAAQkkC,IAAuB,KAC7C,IAAK,MAAM2C,KAAO5gB,GAAe1T,KApOT,0BAqOtBqyB,GAAUlf,oBAAoBmhB,EAChC,IAOFtqB,GAAmBqoB,IAcnB,MAEMkC,GAAc,UACdC,GAAe,OAAOD,KACtBE,GAAiB,SAASF,KAC1BG,GAAe,OAAOH,KACtBI,GAAgB,QAAQJ,KACxBK,GAAuB,QAAQL,KAC/BM,GAAgB,UAAUN,KAC1BO,GAAsB,OAAOP,KAC7BQ,GAAiB,YACjBC,GAAkB,aAClBC,GAAe,UACfC,GAAiB,YACjBC,GAAW,OACXC,GAAU,MACVC,GAAoB,SACpBC,GAAoB,OACpBC,GAAoB,OAEpBC,GAA2B,mBAE3BC,GAA+B,QAAQD,MAIvCE,GAAuB,2EACvBC,GAAsB,YAFOF,uBAAiDA,mBAA6CA,OAE/EC,KAC5CE,GAA8B,IAAIP,8BAA6CA,+BAA8CA,4BAMnI,MAAMQ,WAAYtjB,GAChB,WAAAP,CAAY5kB,GACVolB,MAAMplB,GACNygB,KAAKoS,QAAUpS,KAAK4E,SAAS5J,QAdN,uCAelBgF,KAAKoS,UAOVpS,KAAKioB,sBAAsBjoB,KAAKoS,QAASpS,KAAKkoB,gBAC9C3nB,GAAac,GAAGrB,KAAK4E,SAAUoiB,IAAe5nB,GAASY,KAAK6M,SAASzN,KACvE,CAGA,eAAW7C,GACT,MAnDW,KAoDb,CAGA,IAAAsT,GAEE,MAAMsY,EAAYnoB,KAAK4E,SACvB,GAAI5E,KAAKooB,cAAcD,GACrB,OAIF,MAAME,EAASroB,KAAKsoB,iBACdC,EAAYF,EAAS9nB,GAAaqB,QAAQymB,EAAQ1B,GAAc,CACpE7mB,cAAeqoB,IACZ,KACa5nB,GAAaqB,QAAQumB,EAAWtB,GAAc,CAC9D/mB,cAAeuoB,IAEHrmB,kBAAoBumB,GAAaA,EAAUvmB,mBAGzDhC,KAAKwoB,YAAYH,EAAQF,GACzBnoB,KAAKyoB,UAAUN,EAAWE,GAC5B,CAGA,SAAAI,CAAUlpC,EAASmpC,GACZnpC,IAGLA,EAAQ8b,UAAU5E,IAAI+wB,IACtBxnB,KAAKyoB,UAAU5iB,GAAec,uBAAuBpnB,IAcrDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ4B,gBAAgB,YACxB5B,EAAQ6B,aAAa,iBAAiB,GACtC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASunC,GAAe,CAC3ChnB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU5E,IAAIixB,GAQtB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,WAAAe,CAAYjpC,EAASmpC,GACdnpC,IAGLA,EAAQ8b,UAAU1B,OAAO6tB,IACzBjoC,EAAQq7B,OACR5a,KAAKwoB,YAAY3iB,GAAec,uBAAuBpnB,IAcvDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ6B,aAAa,iBAAiB,GACtC7B,EAAQ6B,aAAa,WAAY,MACjC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASqnC,GAAgB,CAC5C9mB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU1B,OAAO+tB,GAQzB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,QAAA5a,CAASzN,GACP,IAAK,CAAC8nB,GAAgBC,GAAiBC,GAAcC,GAAgBC,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrG,OAEFsiB,EAAM0U,kBACN1U,EAAMkD,iBACN,MAAMyD,EAAW/F,KAAKkoB,eAAe/hC,QAAO5G,IAAY2b,GAAW3b,KACnE,IAAIqpC,EACJ,GAAI,CAACtB,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrC8rC,EAAoB7iB,EAAS3G,EAAMtiB,MAAQwqC,GAAW,EAAIvhB,EAASrV,OAAS,OACvE,CACL,MAAM8c,EAAS,CAAC2Z,GAAiBE,IAAgBjmB,SAAShC,EAAMtiB,KAChE8rC,EAAoB9qB,GAAqBiI,EAAU3G,EAAM7S,OAAQihB,GAAQ,EAC3E,CACIob,IACFA,EAAkBnW,MAAM,CACtBoW,eAAe,IAEjBb,GAAI1iB,oBAAoBsjB,GAAmB/Y,OAE/C,CACA,YAAAqY,GAEE,OAAOriB,GAAe1T,KAAK21B,GAAqB9nB,KAAKoS,QACvD,CACA,cAAAkW,GACE,OAAOtoB,KAAKkoB,eAAe/1B,MAAKzN,GAASsb,KAAKooB,cAAc1jC,MAAW,IACzE,CACA,qBAAAujC,CAAsBxjC,EAAQshB,GAC5B/F,KAAK8oB,yBAAyBrkC,EAAQ,OAAQ,WAC9C,IAAK,MAAMC,KAASqhB,EAClB/F,KAAK+oB,6BAA6BrkC,EAEtC,CACA,4BAAAqkC,CAA6BrkC,GAC3BA,EAAQsb,KAAKgpB,iBAAiBtkC,GAC9B,MAAMukC,EAAWjpB,KAAKooB,cAAc1jC,GAC9BwkC,EAAYlpB,KAAKmpB,iBAAiBzkC,GACxCA,EAAMtD,aAAa,gBAAiB6nC,GAChCC,IAAcxkC,GAChBsb,KAAK8oB,yBAAyBI,EAAW,OAAQ,gBAE9CD,GACHvkC,EAAMtD,aAAa,WAAY,MAEjC4e,KAAK8oB,yBAAyBpkC,EAAO,OAAQ,OAG7Csb,KAAKopB,mCAAmC1kC,EAC1C,CACA,kCAAA0kC,CAAmC1kC,GACjC,MAAM6H,EAASsZ,GAAec,uBAAuBjiB,GAChD6H,IAGLyT,KAAK8oB,yBAAyBv8B,EAAQ,OAAQ,YAC1C7H,EAAMyV,IACR6F,KAAK8oB,yBAAyBv8B,EAAQ,kBAAmB,GAAG7H,EAAMyV,MAEtE,CACA,eAAAwuB,CAAgBppC,EAAS8pC,GACvB,MAAMH,EAAYlpB,KAAKmpB,iBAAiB5pC,GACxC,IAAK2pC,EAAU7tB,UAAU7W,SApKN,YAqKjB,OAEF,MAAMmjB,EAAS,CAAC5N,EAAUoa,KACxB,MAAM50B,EAAUsmB,GAAeC,QAAQ/L,EAAUmvB,GAC7C3pC,GACFA,EAAQ8b,UAAUsM,OAAOwM,EAAWkV,EACtC,EAEF1hB,EAAOggB,GAA0BH,IACjC7f,EA5K2B,iBA4KI+f,IAC/BwB,EAAU9nC,aAAa,gBAAiBioC,EAC1C,CACA,wBAAAP,CAAyBvpC,EAASwC,EAAWpE,GACtC4B,EAAQgc,aAAaxZ,IACxBxC,EAAQ6B,aAAaW,EAAWpE,EAEpC,CACA,aAAAyqC,CAAc9Y,GACZ,OAAOA,EAAKjU,UAAU7W,SAASgjC,GACjC,CAGA,gBAAAwB,CAAiB1Z,GACf,OAAOA,EAAKtJ,QAAQ8hB,IAAuBxY,EAAOzJ,GAAeC,QAAQgiB,GAAqBxY,EAChG,CAGA,gBAAA6Z,CAAiB7Z,GACf,OAAOA,EAAKtU,QA5LO,gCA4LoBsU,CACzC,CAGA,sBAAO7S,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO29B,GAAI1iB,oBAAoBtF,MACrC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGhc,SAAU0hC,GAAsBc,IAAsB,SAAUzoB,GAC1E,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,OAGfgoB,GAAI1iB,oBAAoBtF,MAAM6P,MAChC,IAKAtP,GAAac,GAAGzhB,OAAQqnC,IAAqB,KAC3C,IAAK,MAAM1nC,KAAWsmB,GAAe1T,KAAK41B,IACxCC,GAAI1iB,oBAAoB/lB,EAC1B,IAMF4c,GAAmB6rB,IAcnB,MAEMhjB,GAAY,YACZskB,GAAkB,YAAYtkB,KAC9BukB,GAAiB,WAAWvkB,KAC5BwkB,GAAgB,UAAUxkB,KAC1BykB,GAAiB,WAAWzkB,KAC5B0kB,GAAa,OAAO1kB,KACpB2kB,GAAe,SAAS3kB,KACxB4kB,GAAa,OAAO5kB,KACpB6kB,GAAc,QAAQ7kB,KAEtB8kB,GAAkB,OAClBC,GAAkB,OAClBC,GAAqB,UACrBrmB,GAAc,CAClByc,UAAW,UACX6J,SAAU,UACV1J,MAAO,UAEH7c,GAAU,CACd0c,WAAW,EACX6J,UAAU,EACV1J,MAAO,KAOT,MAAM2J,WAAcxlB,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK4gB,SAAW,KAChB5gB,KAAKmqB,sBAAuB,EAC5BnqB,KAAKoqB,yBAA0B,EAC/BpqB,KAAKkhB,eACP,CAGA,kBAAWxd,GACT,OAAOA,EACT,CACA,sBAAWC,GACT,OAAOA,EACT,CACA,eAAWpH,GACT,MA/CS,OAgDX,CAGA,IAAAsT,GACoBtP,GAAaqB,QAAQ5B,KAAK4E,SAAUglB,IACxC5nB,mBAGdhC,KAAKqqB,gBACDrqB,KAAK6E,QAAQub,WACfpgB,KAAK4E,SAASvJ,UAAU5E,IA/CN,QAsDpBuJ,KAAK4E,SAASvJ,UAAU1B,OAAOmwB,IAC/BjuB,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIszB,GAAiBC,IAC7ChqB,KAAKmF,gBARY,KACfnF,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,IAC/BzpB,GAAaqB,QAAQ5B,KAAK4E,SAAUilB,IACpC7pB,KAAKsqB,oBAAoB,GAKGtqB,KAAK4E,SAAU5E,KAAK6E,QAAQub,WAC5D,CACA,IAAAxQ,GACO5P,KAAKuqB,YAGQhqB,GAAaqB,QAAQ5B,KAAK4E,SAAU8kB,IACxC1nB,mBAQdhC,KAAK4E,SAASvJ,UAAU5E,IAAIuzB,IAC5BhqB,KAAKmF,gBANY,KACfnF,KAAK4E,SAASvJ,UAAU5E,IAAIqzB,IAC5B9pB,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,GAAoBD,IACnDxpB,GAAaqB,QAAQ5B,KAAK4E,SAAU+kB,GAAa,GAGrB3pB,KAAK4E,SAAU5E,KAAK6E,QAAQub,YAC5D,CACA,OAAArb,GACE/E,KAAKqqB,gBACDrqB,KAAKuqB,WACPvqB,KAAK4E,SAASvJ,UAAU1B,OAAOowB,IAEjCplB,MAAMI,SACR,CACA,OAAAwlB,GACE,OAAOvqB,KAAK4E,SAASvJ,UAAU7W,SAASulC,GAC1C,CAIA,kBAAAO,GACOtqB,KAAK6E,QAAQolB,WAGdjqB,KAAKmqB,sBAAwBnqB,KAAKoqB,0BAGtCpqB,KAAK4gB,SAAW/iB,YAAW,KACzBmC,KAAK4P,MAAM,GACV5P,KAAK6E,QAAQ0b,QAClB,CACA,cAAAiK,CAAeprB,EAAOqrB,GACpB,OAAQrrB,EAAMqB,MACZ,IAAK,YACL,IAAK,WAEDT,KAAKmqB,qBAAuBM,EAC5B,MAEJ,IAAK,UACL,IAAK,WAEDzqB,KAAKoqB,wBAA0BK,EAIrC,GAAIA,EAEF,YADAzqB,KAAKqqB,gBAGP,MAAM5c,EAAcrO,EAAMU,cACtBE,KAAK4E,WAAa6I,GAAezN,KAAK4E,SAASpgB,SAASipB,IAG5DzN,KAAKsqB,oBACP,CACA,aAAApJ,GACE3gB,GAAac,GAAGrB,KAAK4E,SAAU0kB,IAAiBlqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACpFmB,GAAac,GAAGrB,KAAK4E,SAAU2kB,IAAgBnqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACnFmB,GAAac,GAAGrB,KAAK4E,SAAU4kB,IAAepqB,GAASY,KAAKwqB,eAAeprB,GAAO,KAClFmB,GAAac,GAAGrB,KAAK4E,SAAU6kB,IAAgBrqB,GAASY,KAAKwqB,eAAeprB,GAAO,IACrF,CACA,aAAAirB,GACEnd,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW,IAClB,CAGA,sBAAOnkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6/B,GAAM5kB,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KACf,CACF,GACF,ECr0IK,SAAS0qB,GAAcruB,GACD,WAAvBhX,SAASuX,WAAyBP,IACjChX,SAASyF,iBAAiB,mBAAoBuR,EACrD,CDy0IAwK,GAAqBqjB,IAMrB/tB,GAAmB+tB,IEpyInBQ,IAzCA,WAC2B,GAAGt4B,MAAM5U,KAChC6H,SAAS+a,iBAAiB,+BAETtd,KAAI,SAAU6nC,GAC/B,OAAO,IAAI,GAAkBA,EAAkB,CAC7CpK,MAAO,CAAE1Q,KAAM,IAAKD,KAAM,MAE9B,GACF,IAiCA8a,IA5BA,WACYrlC,SAASm9B,eAAe,mBAC9B13B,iBAAiB,SAAS,WAC5BzF,SAAS6G,KAAKT,UAAY,EAC1BpG,SAASC,gBAAgBmG,UAAY,CACvC,GACF,IAuBAi/B,IArBA,WACE,IAAIE,EAAMvlC,SAASm9B,eAAe,mBAC9BqI,EAASxlC,SACVylC,uBAAuB,aAAa,GACpCxnC,wBACH1D,OAAOkL,iBAAiB,UAAU,WAC5BkV,KAAK+qB,UAAY/qB,KAAKgrB,SAAWhrB,KAAKgrB,QAAUH,EAAOjtC,OACzDgtC,EAAI7pC,MAAMgxB,QAAU,QAEpB6Y,EAAI7pC,MAAMgxB,QAAU,OAEtB/R,KAAK+qB,UAAY/qB,KAAKgrB,OACxB,GACF,IAUAprC,OAAOqrC,UAAY","sources":["webpack://pydata_sphinx_theme/webpack/bootstrap","webpack://pydata_sphinx_theme/webpack/runtime/define property getters","webpack://pydata_sphinx_theme/webpack/runtime/hasOwnProperty shorthand","webpack://pydata_sphinx_theme/webpack/runtime/make namespace object","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/enums.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/applyStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getBasePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/math.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/userAgent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/contains.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/within.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/expandToHashMap.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/arrow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getVariation.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/computeStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/eventListeners.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/rectToClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/detectOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/flip.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/hide.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/offset.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getAltAxis.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/orderModifiers.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/createPopper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/debounce.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergeByName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper-lite.js","webpack://pydata_sphinx_theme/./node_modules/bootstrap/dist/js/bootstrap.esm.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/mixin.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/bootstrap.js"],"sourcesContent":["// The require scope\nvar __webpack_require__ = {};\n\n","// define getter functions for harmony exports\n__webpack_require__.d = (exports, definition) => {\n\tfor(var key in definition) {\n\t\tif(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {\n\t\t\tObject.defineProperty(exports, key, { enumerable: true, get: definition[key] });\n\t\t}\n\t}\n};","__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))","// define __esModule on exports\n__webpack_require__.r = (exports) => {\n\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n\t}\n\tObject.defineProperty(exports, '__esModule', { value: true });\n};","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n });\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref) {\n var name = _ref.name,\n _ref$options = _ref.options,\n options = _ref$options === void 0 ? {} : _ref$options,\n effect = _ref.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","/*!\n * Bootstrap v5.3.3 (https://getbootstrap.com/)\n * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n */\nimport * as Popper from '@popperjs/core';\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\n\nconst elementMap = new Map();\nconst Data = {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map());\n }\n const instanceMap = elementMap.get(element);\n\n // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);\n return;\n }\n instanceMap.set(key, instance);\n },\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null;\n }\n return null;\n },\n remove(element, key) {\n if (!elementMap.has(element)) {\n return;\n }\n const instanceMap = elementMap.get(element);\n instanceMap.delete(key);\n\n // free up element references if there are no instances left for an element\n if (instanceMap.size === 0) {\n elementMap.delete(element);\n }\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst MAX_UID = 1000000;\nconst MILLISECONDS_MULTIPLIER = 1000;\nconst TRANSITION_END = 'transitionend';\n\n/**\n * Properly escape IDs selectors to handle weird IDs\n * @param {string} selector\n * @returns {string}\n */\nconst parseSelector = selector => {\n if (selector && window.CSS && window.CSS.escape) {\n // document.querySelector needs escaping to handle IDs (html5+) containing for instance /\n selector = selector.replace(/#([^\\s\"#']+)/g, (match, id) => `#${CSS.escape(id)}`);\n }\n return selector;\n};\n\n// Shout-out Angus Croll (https://goo.gl/pxwQGp)\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`;\n }\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase();\n};\n\n/**\n * Public Util API\n */\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID);\n } while (document.getElementById(prefix));\n return prefix;\n};\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0;\n }\n\n // Get transition-duration of the element\n let {\n transitionDuration,\n transitionDelay\n } = window.getComputedStyle(element);\n const floatTransitionDuration = Number.parseFloat(transitionDuration);\n const floatTransitionDelay = Number.parseFloat(transitionDelay);\n\n // Return 0 if element or transition duration is not found\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0;\n }\n\n // If multiple durations are defined, take the first\n transitionDuration = transitionDuration.split(',')[0];\n transitionDelay = transitionDelay.split(',')[0];\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;\n};\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END));\n};\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false;\n }\n if (typeof object.jquery !== 'undefined') {\n object = object[0];\n }\n return typeof object.nodeType !== 'undefined';\n};\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object;\n }\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(parseSelector(object));\n }\n return null;\n};\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false;\n }\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible';\n // Handle `details` element as its content may falsie appear visible when it is closed\n const closedDetails = element.closest('details:not([open])');\n if (!closedDetails) {\n return elementIsVisible;\n }\n if (closedDetails !== element) {\n const summary = element.closest('summary');\n if (summary && summary.parentNode !== closedDetails) {\n return false;\n }\n if (summary === null) {\n return false;\n }\n }\n return elementIsVisible;\n};\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true;\n }\n if (element.classList.contains('disabled')) {\n return true;\n }\n if (typeof element.disabled !== 'undefined') {\n return element.disabled;\n }\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';\n};\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null;\n }\n\n // Can find the shadow root otherwise it'll return the document\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode();\n return root instanceof ShadowRoot ? root : null;\n }\n if (element instanceof ShadowRoot) {\n return element;\n }\n\n // when we don't find a shadow root\n if (!element.parentNode) {\n return null;\n }\n return findShadowRoot(element.parentNode);\n};\nconst noop = () => {};\n\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\nconst reflow = element => {\n element.offsetHeight; // eslint-disable-line no-unused-expressions\n};\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery;\n }\n return null;\n};\nconst DOMContentLoadedCallbacks = [];\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback();\n }\n });\n }\n DOMContentLoadedCallbacks.push(callback);\n } else {\n callback();\n }\n};\nconst isRTL = () => document.documentElement.dir === 'rtl';\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery();\n /* istanbul ignore if */\n if ($) {\n const name = plugin.NAME;\n const JQUERY_NO_CONFLICT = $.fn[name];\n $.fn[name] = plugin.jQueryInterface;\n $.fn[name].Constructor = plugin;\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT;\n return plugin.jQueryInterface;\n };\n }\n });\n};\nconst execute = (possibleCallback, args = [], defaultValue = possibleCallback) => {\n return typeof possibleCallback === 'function' ? possibleCallback(...args) : defaultValue;\n};\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback);\n return;\n }\n const durationPadding = 5;\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;\n let called = false;\n const handler = ({\n target\n }) => {\n if (target !== transitionElement) {\n return;\n }\n called = true;\n transitionElement.removeEventListener(TRANSITION_END, handler);\n execute(callback);\n };\n transitionElement.addEventListener(TRANSITION_END, handler);\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement);\n }\n }, emulatedDuration);\n};\n\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length;\n let index = list.indexOf(activeElement);\n\n // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];\n }\n index += shouldGetNext ? 1 : -1;\n if (isCycleAllowed) {\n index = (index + listLength) % listLength;\n }\n return list[Math.max(0, Math.min(index, listLength - 1))];\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/;\nconst stripNameRegex = /\\..*/;\nconst stripUidRegex = /::\\d+$/;\nconst eventRegistry = {}; // Events storage\nlet uidEvent = 1;\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n};\nconst nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);\n\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;\n}\nfunction getElementEvents(element) {\n const uid = makeEventUid(element);\n element.uidEvent = uid;\n eventRegistry[uid] = eventRegistry[uid] || {};\n return eventRegistry[uid];\n}\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, {\n delegateTarget: element\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn);\n }\n return fn.apply(element, [event]);\n };\n}\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector);\n for (let {\n target\n } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue;\n }\n hydrateObj(event, {\n delegateTarget: target\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn);\n }\n return fn.apply(target, [event]);\n }\n }\n };\n}\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);\n}\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string';\n // TODO: tooltip passes `false` instead of selector, so we need to check\n const callable = isDelegated ? delegationFunction : handler || delegationFunction;\n let typeEvent = getTypeEvent(originalTypeEvent);\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent;\n }\n return [isDelegated, callable, typeEvent];\n}\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n\n // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {\n return fn.call(this, event);\n }\n };\n };\n callable = wrapFunction(callable);\n }\n const events = getElementEvents(element);\n const handlers = events[typeEvent] || (events[typeEvent] = {});\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff;\n return;\n }\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));\n const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);\n fn.delegationSelector = isDelegated ? handler : null;\n fn.callable = callable;\n fn.oneOff = oneOff;\n fn.uidEvent = uid;\n handlers[uid] = fn;\n element.addEventListener(typeEvent, fn, isDelegated);\n}\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector);\n if (!fn) {\n return;\n }\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));\n delete events[typeEvent][fn.uidEvent];\n}\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {};\n for (const [handlerKey, event] of Object.entries(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n}\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '');\n return customEvents[event] || event;\n}\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false);\n },\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true);\n },\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n const inNamespace = typeEvent !== originalTypeEvent;\n const events = getElementEvents(element);\n const storeElementEvent = events[typeEvent] || {};\n const isNamespace = originalTypeEvent.startsWith('.');\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return;\n }\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);\n return;\n }\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));\n }\n }\n for (const [keyHandlers, event] of Object.entries(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '');\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n },\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null;\n }\n const $ = getjQuery();\n const typeEvent = getTypeEvent(event);\n const inNamespace = event !== typeEvent;\n let jQueryEvent = null;\n let bubbles = true;\n let nativeDispatch = true;\n let defaultPrevented = false;\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args);\n $(element).trigger(jQueryEvent);\n bubbles = !jQueryEvent.isPropagationStopped();\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();\n defaultPrevented = jQueryEvent.isDefaultPrevented();\n }\n const evt = hydrateObj(new Event(event, {\n bubbles,\n cancelable: true\n }), args);\n if (defaultPrevented) {\n evt.preventDefault();\n }\n if (nativeDispatch) {\n element.dispatchEvent(evt);\n }\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault();\n }\n return evt;\n }\n};\nfunction hydrateObj(obj, meta = {}) {\n for (const [key, value] of Object.entries(meta)) {\n try {\n obj[key] = value;\n } catch (_unused) {\n Object.defineProperty(obj, key, {\n configurable: true,\n get() {\n return value;\n }\n });\n }\n }\n return obj;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nfunction normalizeData(value) {\n if (value === 'true') {\n return true;\n }\n if (value === 'false') {\n return false;\n }\n if (value === Number(value).toString()) {\n return Number(value);\n }\n if (value === '' || value === 'null') {\n return null;\n }\n if (typeof value !== 'string') {\n return value;\n }\n try {\n return JSON.parse(decodeURIComponent(value));\n } catch (_unused) {\n return value;\n }\n}\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);\n}\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);\n },\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);\n },\n getDataAttributes(element) {\n if (!element) {\n return {};\n }\n const attributes = {};\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '');\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);\n attributes[pureKey] = normalizeData(element.dataset[key]);\n }\n return attributes;\n },\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {};\n }\n static get DefaultType() {\n return {};\n }\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!');\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n return config;\n }\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse\n\n return {\n ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n };\n }\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const [property, expectedTypes] of Object.entries(configTypes)) {\n const value = config[property];\n const valueType = isElement(value) ? 'element' : toType(value);\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`);\n }\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst VERSION = '5.3.3';\n\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super();\n element = getElement(element);\n if (!element) {\n return;\n }\n this._element = element;\n this._config = this._getConfig(config);\n Data.set(this._element, this.constructor.DATA_KEY, this);\n }\n\n // Public\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY);\n EventHandler.off(this._element, this.constructor.EVENT_KEY);\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null;\n }\n }\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated);\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n\n // Static\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY);\n }\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);\n }\n static get VERSION() {\n return VERSION;\n }\n static get DATA_KEY() {\n return `bs.${this.NAME}`;\n }\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`;\n }\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target');\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href');\n\n // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {\n return null;\n }\n\n // Just in case some CMS puts out a full URL with the anchor appended\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`;\n }\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null;\n }\n return selector ? selector.split(',').map(sel => parseSelector(sel)).join(',') : null;\n};\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector));\n },\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector);\n },\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector));\n },\n parents(element, selector) {\n const parents = [];\n let ancestor = element.parentNode.closest(selector);\n while (ancestor) {\n parents.push(ancestor);\n ancestor = ancestor.parentNode.closest(selector);\n }\n return parents;\n },\n prev(element, selector) {\n let previous = element.previousElementSibling;\n while (previous) {\n if (previous.matches(selector)) {\n return [previous];\n }\n previous = previous.previousElementSibling;\n }\n return [];\n },\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling;\n while (next) {\n if (next.matches(selector)) {\n return [next];\n }\n next = next.nextElementSibling;\n }\n return [];\n },\n focusableChildren(element) {\n const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable=\"true\"]'].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',');\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));\n },\n getSelectorFromElement(element) {\n const selector = getSelector(element);\n if (selector) {\n return SelectorEngine.findOne(selector) ? selector : null;\n }\n return null;\n },\n getElementFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.findOne(selector) : null;\n },\n getMultipleElementsFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.find(selector) : [];\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`;\n const name = component.NAME;\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n const target = SelectorEngine.getElementFromSelector(this) || this.closest(`.${name}`);\n const instance = component.getOrCreateInstance(target);\n\n // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n instance[method]();\n });\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$f = 'alert';\nconst DATA_KEY$a = 'bs.alert';\nconst EVENT_KEY$b = `.${DATA_KEY$a}`;\nconst EVENT_CLOSE = `close${EVENT_KEY$b}`;\nconst EVENT_CLOSED = `closed${EVENT_KEY$b}`;\nconst CLASS_NAME_FADE$5 = 'fade';\nconst CLASS_NAME_SHOW$8 = 'show';\n\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$f;\n }\n\n // Public\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);\n if (closeEvent.defaultPrevented) {\n return;\n }\n this._element.classList.remove(CLASS_NAME_SHOW$8);\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated);\n }\n\n // Private\n _destroyElement() {\n this._element.remove();\n EventHandler.trigger(this._element, EVENT_CLOSED);\n this.dispose();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nenableDismissTrigger(Alert, 'close');\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$e = 'button';\nconst DATA_KEY$9 = 'bs.button';\nconst EVENT_KEY$a = `.${DATA_KEY$9}`;\nconst DATA_API_KEY$6 = '.data-api';\nconst CLASS_NAME_ACTIVE$3 = 'active';\nconst SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle=\"button\"]';\nconst EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;\n\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$e;\n }\n\n // Public\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this);\n if (config === 'toggle') {\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {\n event.preventDefault();\n const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);\n const data = Button.getOrCreateInstance(button);\n data.toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$d = 'swipe';\nconst EVENT_KEY$9 = '.bs.swipe';\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;\nconst POINTER_TYPE_TOUCH = 'touch';\nconst POINTER_TYPE_PEN = 'pen';\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event';\nconst SWIPE_THRESHOLD = 40;\nconst Default$c = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n};\nconst DefaultType$c = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n};\n\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super();\n this._element = element;\n if (!element || !Swipe.isSupported()) {\n return;\n }\n this._config = this._getConfig(config);\n this._deltaX = 0;\n this._supportPointerEvents = Boolean(window.PointerEvent);\n this._initEvents();\n }\n\n // Getters\n static get Default() {\n return Default$c;\n }\n static get DefaultType() {\n return DefaultType$c;\n }\n static get NAME() {\n return NAME$d;\n }\n\n // Public\n dispose() {\n EventHandler.off(this._element, EVENT_KEY$9);\n }\n\n // Private\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX;\n return;\n }\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX;\n }\n }\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX;\n }\n this._handleSwipe();\n execute(this._config.endCallback);\n }\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;\n }\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX);\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return;\n }\n const direction = absDeltaX / this._deltaX;\n this._deltaX = 0;\n if (!direction) {\n return;\n }\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);\n }\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));\n this._element.classList.add(CLASS_NAME_POINTER_EVENT);\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));\n }\n }\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);\n }\n\n // Static\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$c = 'carousel';\nconst DATA_KEY$8 = 'bs.carousel';\nconst EVENT_KEY$8 = `.${DATA_KEY$8}`;\nconst DATA_API_KEY$5 = '.data-api';\nconst ARROW_LEFT_KEY$1 = 'ArrowLeft';\nconst ARROW_RIGHT_KEY$1 = 'ArrowRight';\nconst TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next';\nconst ORDER_PREV = 'prev';\nconst DIRECTION_LEFT = 'left';\nconst DIRECTION_RIGHT = 'right';\nconst EVENT_SLIDE = `slide${EVENT_KEY$8}`;\nconst EVENT_SLID = `slid${EVENT_KEY$8}`;\nconst EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;\nconst EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;\nconst EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;\nconst EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst CLASS_NAME_CAROUSEL = 'carousel';\nconst CLASS_NAME_ACTIVE$2 = 'active';\nconst CLASS_NAME_SLIDE = 'slide';\nconst CLASS_NAME_END = 'carousel-item-end';\nconst CLASS_NAME_START = 'carousel-item-start';\nconst CLASS_NAME_NEXT = 'carousel-item-next';\nconst CLASS_NAME_PREV = 'carousel-item-prev';\nconst SELECTOR_ACTIVE = '.active';\nconst SELECTOR_ITEM = '.carousel-item';\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;\nconst SELECTOR_ITEM_IMG = '.carousel-item img';\nconst SELECTOR_INDICATORS = '.carousel-indicators';\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]';\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT\n};\nconst Default$b = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n};\nconst DefaultType$b = {\n interval: '(number|boolean)',\n // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._interval = null;\n this._activeElement = null;\n this._isSliding = false;\n this.touchTimeout = null;\n this._swipeHelper = null;\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);\n this._addEventListeners();\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$b;\n }\n static get DefaultType() {\n return DefaultType$b;\n }\n static get NAME() {\n return NAME$c;\n }\n\n // Public\n next() {\n this._slide(ORDER_NEXT);\n }\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next();\n }\n }\n prev() {\n this._slide(ORDER_PREV);\n }\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element);\n }\n this._clearInterval();\n }\n cycle() {\n this._clearInterval();\n this._updateInterval();\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);\n }\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle());\n return;\n }\n this.cycle();\n }\n to(index) {\n const items = this._getItems();\n if (index > items.length - 1 || index < 0) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index));\n return;\n }\n const activeIndex = this._getItemIndex(this._getActive());\n if (activeIndex === index) {\n return;\n }\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;\n this._slide(order, items[index]);\n }\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose();\n }\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n config.defaultInterval = config.interval;\n return config;\n }\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));\n }\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());\n EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());\n }\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners();\n }\n }\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());\n }\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return;\n }\n\n // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n this.pause();\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout);\n }\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);\n };\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n };\n this._swipeHelper = new Swipe(this._element, swipeConfig);\n }\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return;\n }\n const direction = KEY_TO_DIRECTION[event.key];\n if (direction) {\n event.preventDefault();\n this._slide(this._directionToOrder(direction));\n }\n }\n _getItemIndex(element) {\n return this._getItems().indexOf(element);\n }\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return;\n }\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);\n activeIndicator.removeAttribute('aria-current');\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement);\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);\n newActiveIndicator.setAttribute('aria-current', 'true');\n }\n }\n _updateInterval() {\n const element = this._activeElement || this._getActive();\n if (!element) {\n return;\n }\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);\n this._config.interval = elementInterval || this._config.defaultInterval;\n }\n _slide(order, element = null) {\n if (this._isSliding) {\n return;\n }\n const activeElement = this._getActive();\n const isNext = order === ORDER_NEXT;\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);\n if (nextElement === activeElement) {\n return;\n }\n const nextElementIndex = this._getItemIndex(nextElement);\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n });\n };\n const slideEvent = triggerEvent(EVENT_SLIDE);\n if (slideEvent.defaultPrevented) {\n return;\n }\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // TODO: change tests that use empty divs to avoid this check\n return;\n }\n const isCycling = Boolean(this._interval);\n this.pause();\n this._isSliding = true;\n this._setActiveIndicatorElement(nextElementIndex);\n this._activeElement = nextElement;\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;\n nextElement.classList.add(orderClassName);\n reflow(nextElement);\n activeElement.classList.add(directionalClassName);\n nextElement.classList.add(directionalClassName);\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName);\n nextElement.classList.add(CLASS_NAME_ACTIVE$2);\n activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);\n this._isSliding = false;\n triggerEvent(EVENT_SLID);\n };\n this._queueCallback(completeCallBack, activeElement, this._isAnimated());\n if (isCycling) {\n this.cycle();\n }\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE);\n }\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);\n }\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element);\n }\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval);\n this._interval = null;\n }\n }\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;\n }\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;\n }\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;\n }\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config);\n if (typeof config === 'number') {\n data.to(config);\n return;\n }\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return;\n }\n event.preventDefault();\n const carousel = Carousel.getOrCreateInstance(target);\n const slideIndex = this.getAttribute('data-bs-slide-to');\n if (slideIndex) {\n carousel.to(slideIndex);\n carousel._maybeEnableCycle();\n return;\n }\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next();\n carousel._maybeEnableCycle();\n return;\n }\n carousel.prev();\n carousel._maybeEnableCycle();\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel);\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$b = 'collapse';\nconst DATA_KEY$7 = 'bs.collapse';\nconst EVENT_KEY$7 = `.${DATA_KEY$7}`;\nconst DATA_API_KEY$4 = '.data-api';\nconst EVENT_SHOW$6 = `show${EVENT_KEY$7}`;\nconst EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;\nconst EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;\nconst EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;\nconst EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;\nconst CLASS_NAME_SHOW$7 = 'show';\nconst CLASS_NAME_COLLAPSE = 'collapse';\nconst CLASS_NAME_COLLAPSING = 'collapsing';\nconst CLASS_NAME_COLLAPSED = 'collapsed';\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal';\nconst WIDTH = 'width';\nconst HEIGHT = 'height';\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';\nconst SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle=\"collapse\"]';\nconst Default$a = {\n parent: null,\n toggle: true\n};\nconst DefaultType$a = {\n parent: '(null|element)',\n toggle: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isTransitioning = false;\n this._triggerArray = [];\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);\n for (const elem of toggleList) {\n const selector = SelectorEngine.getSelectorFromElement(elem);\n const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem);\n }\n }\n this._initializeChildren();\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());\n }\n if (this._config.toggle) {\n this.toggle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$a;\n }\n static get DefaultType() {\n return DefaultType$a;\n }\n static get NAME() {\n return NAME$b;\n }\n\n // Public\n toggle() {\n if (this._isShown()) {\n this.hide();\n } else {\n this.show();\n }\n }\n show() {\n if (this._isTransitioning || this._isShown()) {\n return;\n }\n let activeChildren = [];\n\n // find active children\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {\n toggle: false\n }));\n }\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n for (const activeInstance of activeChildren) {\n activeInstance.hide();\n }\n const dimension = this._getDimension();\n this._element.classList.remove(CLASS_NAME_COLLAPSE);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.style[dimension] = 0;\n this._addAriaAndCollapsedClass(this._triggerArray, true);\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n this._element.style[dimension] = '';\n EventHandler.trigger(this._element, EVENT_SHOWN$6);\n };\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);\n const scrollSize = `scroll${capitalizedDimension}`;\n this._queueCallback(complete, this._element, true);\n this._element.style[dimension] = `${this._element[scrollSize]}px`;\n }\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n const dimension = this._getDimension();\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n for (const trigger of this._triggerArray) {\n const element = SelectorEngine.getElementFromSelector(trigger);\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false);\n }\n }\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE);\n EventHandler.trigger(this._element, EVENT_HIDDEN$6);\n };\n this._element.style[dimension] = '';\n this._queueCallback(complete, this._element, true);\n }\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW$7);\n }\n\n // Private\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle); // Coerce string values\n config.parent = getElement(config.parent);\n return config;\n }\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;\n }\n _initializeChildren() {\n if (!this._config.parent) {\n return;\n }\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);\n for (const element of children) {\n const selected = SelectorEngine.getElementFromSelector(element);\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected));\n }\n }\n }\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent);\n // remove children if greater depth\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));\n }\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return;\n }\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);\n element.setAttribute('aria-expanded', isOpen);\n }\n }\n\n // Static\n static jQueryInterface(config) {\n const _config = {};\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false;\n }\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config);\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {\n event.preventDefault();\n }\n for (const element of SelectorEngine.getMultipleElementsFromSelector(this)) {\n Collapse.getOrCreateInstance(element, {\n toggle: false\n }).toggle();\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$a = 'dropdown';\nconst DATA_KEY$6 = 'bs.dropdown';\nconst EVENT_KEY$6 = `.${DATA_KEY$6}`;\nconst DATA_API_KEY$3 = '.data-api';\nconst ESCAPE_KEY$2 = 'Escape';\nconst TAB_KEY$1 = 'Tab';\nconst ARROW_UP_KEY$1 = 'ArrowUp';\nconst ARROW_DOWN_KEY$1 = 'ArrowDown';\nconst RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;\nconst EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;\nconst EVENT_SHOW$5 = `show${EVENT_KEY$6}`;\nconst EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;\nconst EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst CLASS_NAME_SHOW$6 = 'show';\nconst CLASS_NAME_DROPUP = 'dropup';\nconst CLASS_NAME_DROPEND = 'dropend';\nconst CLASS_NAME_DROPSTART = 'dropstart';\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center';\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';\nconst SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)';\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;\nconst SELECTOR_MENU = '.dropdown-menu';\nconst SELECTOR_NAVBAR = '.navbar';\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav';\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';\nconst PLACEMENT_TOPCENTER = 'top';\nconst PLACEMENT_BOTTOMCENTER = 'bottom';\nconst Default$9 = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n};\nconst DefaultType$9 = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n};\n\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._popper = null;\n this._parent = this._element.parentNode; // dropdown wrapper\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);\n this._inNavbar = this._detectNavbar();\n }\n\n // Getters\n static get Default() {\n return Default$9;\n }\n static get DefaultType() {\n return DefaultType$9;\n }\n static get NAME() {\n return NAME$a;\n }\n\n // Public\n toggle() {\n return this._isShown() ? this.hide() : this.show();\n }\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);\n if (showEvent.defaultPrevented) {\n return;\n }\n this._createPopper();\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n this._element.focus();\n this._element.setAttribute('aria-expanded', true);\n this._menu.classList.add(CLASS_NAME_SHOW$6);\n this._element.classList.add(CLASS_NAME_SHOW$6);\n EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);\n }\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n this._completeHide(relatedTarget);\n }\n dispose() {\n if (this._popper) {\n this._popper.destroy();\n }\n super.dispose();\n }\n update() {\n this._inNavbar = this._detectNavbar();\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Private\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n if (this._popper) {\n this._popper.destroy();\n }\n this._menu.classList.remove(CLASS_NAME_SHOW$6);\n this._element.classList.remove(CLASS_NAME_SHOW$6);\n this._element.setAttribute('aria-expanded', 'false');\n Manipulator.removeDataAttribute(this._menu, 'popper');\n EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);\n }\n _getConfig(config) {\n config = super._getConfig(config);\n if (typeof config.reference === 'object' && !isElement(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME$a.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`);\n }\n return config;\n }\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)');\n }\n let referenceElement = this._element;\n if (this._config.reference === 'parent') {\n referenceElement = this._parent;\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference);\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference;\n }\n const popperConfig = this._getPopperConfig();\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig);\n }\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW$6);\n }\n _getPlacement() {\n const parentDropdown = this._parent;\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER;\n }\n\n // We need to trim the value because custom properties can also include spaces\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;\n }\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;\n }\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null;\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n };\n\n // Disable Popper if we have a static display or Dropdown is in Navbar\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // TODO: v6 remove\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }];\n }\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _selectMenuItem({\n key,\n target\n }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));\n if (!items.length) {\n return;\n }\n\n // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {\n return;\n }\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle);\n if (!context || context._config.autoClose === false) {\n continue;\n }\n const composedPath = event.composedPath();\n const isMenuTarget = composedPath.includes(context._menu);\n if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {\n continue;\n }\n\n // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue;\n }\n const relatedTarget = {\n relatedTarget: context._element\n };\n if (event.type === 'click') {\n relatedTarget.clickEvent = event;\n }\n context._completeHide(relatedTarget);\n }\n }\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n\n const isInput = /input|textarea/i.test(event.target.tagName);\n const isEscapeEvent = event.key === ESCAPE_KEY$2;\n const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return;\n }\n if (isInput && !isEscapeEvent) {\n return;\n }\n event.preventDefault();\n\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);\n const instance = Dropdown.getOrCreateInstance(getToggleButton);\n if (isUpOrDownEvent) {\n event.stopPropagation();\n instance.show();\n instance._selectMenuItem(event);\n return;\n }\n if (instance._isShown()) {\n // else is escape and we check if it is shown\n event.stopPropagation();\n instance.hide();\n getToggleButton.focus();\n }\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {\n event.preventDefault();\n Dropdown.getOrCreateInstance(this).toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$9 = 'backdrop';\nconst CLASS_NAME_FADE$4 = 'fade';\nconst CLASS_NAME_SHOW$5 = 'show';\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;\nconst Default$8 = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true,\n // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n};\nconst DefaultType$8 = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n};\n\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isAppended = false;\n this._element = null;\n }\n\n // Getters\n static get Default() {\n return Default$8;\n }\n static get DefaultType() {\n return DefaultType$8;\n }\n static get NAME() {\n return NAME$9;\n }\n\n // Public\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._append();\n const element = this._getElement();\n if (this._config.isAnimated) {\n reflow(element);\n }\n element.classList.add(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n execute(callback);\n });\n }\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._getElement().classList.remove(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n this.dispose();\n execute(callback);\n });\n }\n dispose() {\n if (!this._isAppended) {\n return;\n }\n EventHandler.off(this._element, EVENT_MOUSEDOWN);\n this._element.remove();\n this._isAppended = false;\n }\n\n // Private\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div');\n backdrop.className = this._config.className;\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE$4);\n }\n this._element = backdrop;\n }\n return this._element;\n }\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement);\n return config;\n }\n _append() {\n if (this._isAppended) {\n return;\n }\n const element = this._getElement();\n this._config.rootElement.append(element);\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback);\n });\n this._isAppended = true;\n }\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated);\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$8 = 'focustrap';\nconst DATA_KEY$5 = 'bs.focustrap';\nconst EVENT_KEY$5 = `.${DATA_KEY$5}`;\nconst EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;\nconst TAB_KEY = 'Tab';\nconst TAB_NAV_FORWARD = 'forward';\nconst TAB_NAV_BACKWARD = 'backward';\nconst Default$7 = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n};\nconst DefaultType$7 = {\n autofocus: 'boolean',\n trapElement: 'element'\n};\n\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isActive = false;\n this._lastTabNavDirection = null;\n }\n\n // Getters\n static get Default() {\n return Default$7;\n }\n static get DefaultType() {\n return DefaultType$7;\n }\n static get NAME() {\n return NAME$8;\n }\n\n // Public\n activate() {\n if (this._isActive) {\n return;\n }\n if (this._config.autofocus) {\n this._config.trapElement.focus();\n }\n EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop\n EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));\n this._isActive = true;\n }\n deactivate() {\n if (!this._isActive) {\n return;\n }\n this._isActive = false;\n EventHandler.off(document, EVENT_KEY$5);\n }\n\n // Private\n _handleFocusin(event) {\n const {\n trapElement\n } = this._config;\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return;\n }\n const elements = SelectorEngine.focusableChildren(trapElement);\n if (elements.length === 0) {\n trapElement.focus();\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus();\n } else {\n elements[0].focus();\n }\n }\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return;\n }\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';\nconst SELECTOR_STICKY_CONTENT = '.sticky-top';\nconst PROPERTY_PADDING = 'padding-right';\nconst PROPERTY_MARGIN = 'margin-right';\n\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body;\n }\n\n // Public\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth;\n return Math.abs(window.innerWidth - documentWidth);\n }\n hide() {\n const width = this.getWidth();\n this._disableOverFlow();\n // give padding to element to balance the hidden scrollbar width\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);\n }\n reset() {\n this._resetElementAttributes(this._element, 'overflow');\n this._resetElementAttributes(this._element, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);\n }\n isOverflowing() {\n return this.getWidth() > 0;\n }\n\n // Private\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow');\n this._element.style.overflow = 'hidden';\n }\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth();\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return;\n }\n this._saveInitialAttribute(element, styleProperty);\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty);\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue);\n }\n }\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty);\n // We only want to remove the property if the value is `null`; the value can also be zero\n if (value === null) {\n element.style.removeProperty(styleProperty);\n return;\n }\n Manipulator.removeDataAttribute(element, styleProperty);\n element.style.setProperty(styleProperty, value);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector);\n return;\n }\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel);\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$7 = 'modal';\nconst DATA_KEY$4 = 'bs.modal';\nconst EVENT_KEY$4 = `.${DATA_KEY$4}`;\nconst DATA_API_KEY$2 = '.data-api';\nconst ESCAPE_KEY$1 = 'Escape';\nconst EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;\nconst EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;\nconst EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;\nconst EVENT_SHOW$4 = `show${EVENT_KEY$4}`;\nconst EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;\nconst EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;\nconst EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;\nconst EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;\nconst CLASS_NAME_OPEN = 'modal-open';\nconst CLASS_NAME_FADE$3 = 'fade';\nconst CLASS_NAME_SHOW$4 = 'show';\nconst CLASS_NAME_STATIC = 'modal-static';\nconst OPEN_SELECTOR$1 = '.modal.show';\nconst SELECTOR_DIALOG = '.modal-dialog';\nconst SELECTOR_MODAL_BODY = '.modal-body';\nconst SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle=\"modal\"]';\nconst Default$6 = {\n backdrop: true,\n focus: true,\n keyboard: true\n};\nconst DefaultType$6 = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._isShown = false;\n this._isTransitioning = false;\n this._scrollBar = new ScrollBarHelper();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$6;\n }\n static get DefaultType() {\n return DefaultType$6;\n }\n static get NAME() {\n return NAME$7;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._isTransitioning = true;\n this._scrollBar.hide();\n document.body.classList.add(CLASS_NAME_OPEN);\n this._adjustDialog();\n this._backdrop.show(() => this._showElement(relatedTarget));\n }\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._isShown = false;\n this._isTransitioning = true;\n this._focustrap.deactivate();\n this._element.classList.remove(CLASS_NAME_SHOW$4);\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());\n }\n dispose() {\n EventHandler.off(window, EVENT_KEY$4);\n EventHandler.off(this._dialog, EVENT_KEY$4);\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n handleUpdate() {\n this._adjustDialog();\n }\n\n // Private\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop),\n // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element);\n }\n this._element.style.display = 'block';\n this._element.removeAttribute('aria-hidden');\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.scrollTop = 0;\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);\n if (modalBody) {\n modalBody.scrollTop = 0;\n }\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_SHOW$4);\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate();\n }\n this._isTransitioning = false;\n EventHandler.trigger(this._element, EVENT_SHOWN$4, {\n relatedTarget\n });\n };\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated());\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {\n if (event.key !== ESCAPE_KEY$1) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n this._triggerBackdropTransition();\n });\n EventHandler.on(window, EVENT_RESIZE$1, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog();\n }\n });\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return;\n }\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition();\n return;\n }\n if (this._config.backdrop) {\n this.hide();\n }\n });\n });\n }\n _hideModal() {\n this._element.style.display = 'none';\n this._element.setAttribute('aria-hidden', true);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n this._isTransitioning = false;\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN);\n this._resetAdjustments();\n this._scrollBar.reset();\n EventHandler.trigger(this._element, EVENT_HIDDEN$4);\n });\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE$3);\n }\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);\n if (hideEvent.defaultPrevented) {\n return;\n }\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const initialOverflowY = this._element.style.overflowY;\n // return if the following background transition hasn't yet completed\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return;\n }\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden';\n }\n this._element.classList.add(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY;\n }, this._dialog);\n }, this._dialog);\n this._element.focus();\n }\n\n /**\n * The following methods are used to handle overflowing modals\n */\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const scrollbarWidth = this._scrollBar.getWidth();\n const isBodyOverflowing = scrollbarWidth > 0;\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n }\n _resetAdjustments() {\n this._element.style.paddingLeft = '';\n this._element.style.paddingRight = '';\n }\n\n // Static\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](relatedTarget);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n EventHandler.one(target, EVENT_SHOW$4, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$4, () => {\n if (isVisible(this)) {\n this.focus();\n }\n });\n });\n\n // avoid conflict when clicking modal toggler while another one is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide();\n }\n const data = Modal.getOrCreateInstance(target);\n data.toggle(this);\n});\nenableDismissTrigger(Modal);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$6 = 'offcanvas';\nconst DATA_KEY$3 = 'bs.offcanvas';\nconst EVENT_KEY$3 = `.${DATA_KEY$3}`;\nconst DATA_API_KEY$1 = '.data-api';\nconst EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst ESCAPE_KEY = 'Escape';\nconst CLASS_NAME_SHOW$3 = 'show';\nconst CLASS_NAME_SHOWING$1 = 'showing';\nconst CLASS_NAME_HIDING = 'hiding';\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop';\nconst OPEN_SELECTOR = '.offcanvas.show';\nconst EVENT_SHOW$3 = `show${EVENT_KEY$3}`;\nconst EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;\nconst EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;\nconst EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;\nconst EVENT_RESIZE = `resize${EVENT_KEY$3}`;\nconst EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;\nconst SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle=\"offcanvas\"]';\nconst Default$5 = {\n backdrop: true,\n keyboard: true,\n scroll: false\n};\nconst DefaultType$5 = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isShown = false;\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$5;\n }\n static get DefaultType() {\n return DefaultType$5;\n }\n static get NAME() {\n return NAME$6;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._backdrop.show();\n if (!this._config.scroll) {\n new ScrollBarHelper().hide();\n }\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.classList.add(CLASS_NAME_SHOWING$1);\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate();\n }\n this._element.classList.add(CLASS_NAME_SHOW$3);\n this._element.classList.remove(CLASS_NAME_SHOWING$1);\n EventHandler.trigger(this._element, EVENT_SHOWN$3, {\n relatedTarget\n });\n };\n this._queueCallback(completeCallBack, this._element, true);\n }\n hide() {\n if (!this._isShown) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._focustrap.deactivate();\n this._element.blur();\n this._isShown = false;\n this._element.classList.add(CLASS_NAME_HIDING);\n this._backdrop.hide();\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n if (!this._config.scroll) {\n new ScrollBarHelper().reset();\n }\n EventHandler.trigger(this._element, EVENT_HIDDEN$3);\n };\n this._queueCallback(completeCallback, this._element, true);\n }\n dispose() {\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n\n // Private\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n this.hide();\n };\n\n // 'static' option will be translated to true, and booleans will keep their value\n const isVisible = Boolean(this._config.backdrop);\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n });\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$3, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus();\n }\n });\n\n // avoid conflict when clicking a toggler of an offcanvas, while another is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide();\n }\n const data = Offcanvas.getOrCreateInstance(target);\n data.toggle(this);\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show();\n }\n});\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide();\n }\n }\n});\nenableDismissTrigger(Offcanvas);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n// js-docs-start allow-list\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i;\nconst DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n dd: [],\n div: [],\n dl: [],\n dt: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n};\n// js-docs-end allow-list\n\nconst uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);\n\n/**\n * A pattern that recognizes URLs that are safe wrt. XSS in URL navigation\n * contexts.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/15.2.8/packages/core/src/sanitization/url_sanitizer.ts#L38\n */\n// eslint-disable-next-line unicorn/better-regex\nconst SAFE_URL_PATTERN = /^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i;\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase();\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue));\n }\n return true;\n }\n\n // Check if a regular expression validates the attribute.\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));\n};\nfunction sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml;\n }\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml);\n }\n const domParser = new window.DOMParser();\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'));\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase();\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove();\n continue;\n }\n const attributeList = [].concat(...element.attributes);\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName);\n }\n }\n }\n return createdDocument.body.innerHTML;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$5 = 'TemplateFactory';\nconst Default$4 = {\n allowList: DefaultAllowlist,\n content: {},\n // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n};\nconst DefaultType$4 = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n};\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n};\n\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n }\n\n // Getters\n static get Default() {\n return Default$4;\n }\n static get DefaultType() {\n return DefaultType$4;\n }\n static get NAME() {\n return NAME$5;\n }\n\n // Public\n getContent() {\n return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);\n }\n hasContent() {\n return this.getContent().length > 0;\n }\n changeContent(content) {\n this._checkContent(content);\n this._config.content = {\n ...this._config.content,\n ...content\n };\n return this;\n }\n toHtml() {\n const templateWrapper = document.createElement('div');\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template);\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector);\n }\n const template = templateWrapper.children[0];\n const extraClass = this._resolvePossibleFunction(this._config.extraClass);\n if (extraClass) {\n template.classList.add(...extraClass.split(' '));\n }\n return template;\n }\n\n // Private\n _typeCheckConfig(config) {\n super._typeCheckConfig(config);\n this._checkContent(config.content);\n }\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({\n selector,\n entry: content\n }, DefaultContentType);\n }\n }\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template);\n if (!templateElement) {\n return;\n }\n content = this._resolvePossibleFunction(content);\n if (!content) {\n templateElement.remove();\n return;\n }\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement);\n return;\n }\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content);\n return;\n }\n templateElement.textContent = content;\n }\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this]);\n }\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = '';\n templateElement.append(element);\n return;\n }\n templateElement.textContent = element.textContent;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$4 = 'tooltip';\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);\nconst CLASS_NAME_FADE$2 = 'fade';\nconst CLASS_NAME_MODAL = 'modal';\nconst CLASS_NAME_SHOW$2 = 'show';\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner';\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;\nconst EVENT_MODAL_HIDE = 'hide.bs.modal';\nconst TRIGGER_HOVER = 'hover';\nconst TRIGGER_FOCUS = 'focus';\nconst TRIGGER_CLICK = 'click';\nconst TRIGGER_MANUAL = 'manual';\nconst EVENT_HIDE$2 = 'hide';\nconst EVENT_HIDDEN$2 = 'hidden';\nconst EVENT_SHOW$2 = 'show';\nconst EVENT_SHOWN$2 = 'shown';\nconst EVENT_INSERTED = 'inserted';\nconst EVENT_CLICK$1 = 'click';\nconst EVENT_FOCUSIN$1 = 'focusin';\nconst EVENT_FOCUSOUT$1 = 'focusout';\nconst EVENT_MOUSEENTER = 'mouseenter';\nconst EVENT_MOUSELEAVE = 'mouseleave';\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n};\nconst Default$3 = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 6],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '
' + '
' + '
' + '
',\n title: '',\n trigger: 'hover focus'\n};\nconst DefaultType$3 = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n};\n\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)');\n }\n super(element, config);\n\n // Private\n this._isEnabled = true;\n this._timeout = 0;\n this._isHovered = null;\n this._activeTrigger = {};\n this._popper = null;\n this._templateFactory = null;\n this._newContent = null;\n\n // Protected\n this.tip = null;\n this._setListeners();\n if (!this._config.selector) {\n this._fixTitle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$3;\n }\n static get DefaultType() {\n return DefaultType$3;\n }\n static get NAME() {\n return NAME$4;\n }\n\n // Public\n enable() {\n this._isEnabled = true;\n }\n disable() {\n this._isEnabled = false;\n }\n toggleEnabled() {\n this._isEnabled = !this._isEnabled;\n }\n toggle() {\n if (!this._isEnabled) {\n return;\n }\n this._activeTrigger.click = !this._activeTrigger.click;\n if (this._isShown()) {\n this._leave();\n return;\n }\n this._enter();\n }\n dispose() {\n clearTimeout(this._timeout);\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));\n }\n this._disposePopper();\n super.dispose();\n }\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements');\n }\n if (!(this._isWithContent() && this._isEnabled)) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));\n const shadowRoot = findShadowRoot(this._element);\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);\n if (showEvent.defaultPrevented || !isInTheDom) {\n return;\n }\n\n // TODO: v6 remove this or make it optional\n this._disposePopper();\n const tip = this._getTipElement();\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'));\n const {\n container\n } = this._config;\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip);\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));\n }\n this._popper = this._createPopper(tip);\n tip.classList.add(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));\n if (this._isHovered === false) {\n this._leave();\n }\n this._isHovered = false;\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n hide() {\n if (!this._isShown()) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));\n if (hideEvent.defaultPrevented) {\n return;\n }\n const tip = this._getTipElement();\n tip.classList.remove(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n this._activeTrigger[TRIGGER_CLICK] = false;\n this._activeTrigger[TRIGGER_FOCUS] = false;\n this._activeTrigger[TRIGGER_HOVER] = false;\n this._isHovered = null; // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return;\n }\n if (!this._isHovered) {\n this._disposePopper();\n }\n this._element.removeAttribute('aria-describedby');\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n update() {\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Protected\n _isWithContent() {\n return Boolean(this._getTitle());\n }\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());\n }\n return this.tip;\n }\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml();\n\n // TODO: remove this check in v6\n if (!tip) {\n return null;\n }\n tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2);\n // TODO: v6 the following can be achieved with CSS only\n tip.classList.add(`bs-${this.constructor.NAME}-auto`);\n const tipId = getUID(this.constructor.NAME).toString();\n tip.setAttribute('id', tipId);\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE$2);\n }\n return tip;\n }\n setContent(content) {\n this._newContent = content;\n if (this._isShown()) {\n this._disposePopper();\n this.show();\n }\n }\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content);\n } else {\n this._templateFactory = new TemplateFactory({\n ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n });\n }\n return this._templateFactory;\n }\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n };\n }\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');\n }\n\n // Private\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());\n }\n _isAnimated() {\n return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);\n }\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);\n }\n _createPopper(tip) {\n const placement = execute(this._config.placement, [this, tip, this._element]);\n const attachment = AttachmentMap[placement.toUpperCase()];\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment));\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this._element]);\n }\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [{\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }, {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n }, {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement);\n }\n }]\n };\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _setListeners() {\n const triggers = this._config.trigger.split(' ');\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context.toggle();\n });\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);\n const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;\n context._enter();\n });\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);\n context._leave();\n });\n }\n }\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide();\n }\n };\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n }\n _fixTitle() {\n const title = this._element.getAttribute('title');\n if (!title) {\n return;\n }\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title);\n }\n this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility\n this._element.removeAttribute('title');\n }\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true;\n return;\n }\n this._isHovered = true;\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show();\n }\n }, this._config.delay.show);\n }\n _leave() {\n if (this._isWithActiveTrigger()) {\n return;\n }\n this._isHovered = false;\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide();\n }\n }, this._config.delay.hide);\n }\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout);\n this._timeout = setTimeout(handler, timeout);\n }\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true);\n }\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element);\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute];\n }\n }\n config = {\n ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n };\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container);\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n }\n if (typeof config.title === 'number') {\n config.title = config.title.toString();\n }\n if (typeof config.content === 'number') {\n config.content = config.content.toString();\n }\n return config;\n }\n _getDelegateConfig() {\n const config = {};\n for (const [key, value] of Object.entries(this._config)) {\n if (this.constructor.Default[key] !== value) {\n config[key] = value;\n }\n }\n config.selector = false;\n config.trigger = 'manual';\n\n // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n return config;\n }\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy();\n this._popper = null;\n }\n if (this.tip) {\n this.tip.remove();\n this.tip = null;\n }\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Tooltip);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$3 = 'popover';\nconst SELECTOR_TITLE = '.popover-header';\nconst SELECTOR_CONTENT = '.popover-body';\nconst Default$2 = {\n ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '
' + '
' + '

' + '
' + '
',\n trigger: 'click'\n};\nconst DefaultType$2 = {\n ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n};\n\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default$2;\n }\n static get DefaultType() {\n return DefaultType$2;\n }\n static get NAME() {\n return NAME$3;\n }\n\n // Overrides\n _isWithContent() {\n return this._getTitle() || this._getContent();\n }\n\n // Private\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n };\n }\n _getContent() {\n return this._resolvePossibleFunction(this._config.content);\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Popover);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$2 = 'scrollspy';\nconst DATA_KEY$2 = 'bs.scrollspy';\nconst EVENT_KEY$2 = `.${DATA_KEY$2}`;\nconst DATA_API_KEY = '.data-api';\nconst EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;\nconst EVENT_CLICK = `click${EVENT_KEY$2}`;\nconst EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';\nconst CLASS_NAME_ACTIVE$1 = 'active';\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]';\nconst SELECTOR_TARGET_LINKS = '[href]';\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';\nconst SELECTOR_NAV_LINKS = '.nav-link';\nconst SELECTOR_NAV_ITEMS = '.nav-item';\nconst SELECTOR_LIST_ITEMS = '.list-group-item';\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;\nconst SELECTOR_DROPDOWN = '.dropdown';\nconst SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';\nconst Default$1 = {\n offset: null,\n // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n};\nconst DefaultType$1 = {\n offset: '(number|null)',\n // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n};\n\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n\n // this._element is the observablesContainer and config.target the menu links wrapper\n this._targetLinks = new Map();\n this._observableSections = new Map();\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;\n this._activeTarget = null;\n this._observer = null;\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n };\n this.refresh(); // initialize\n }\n\n // Getters\n static get Default() {\n return Default$1;\n }\n static get DefaultType() {\n return DefaultType$1;\n }\n static get NAME() {\n return NAME$2;\n }\n\n // Public\n refresh() {\n this._initializeTargetsAndObservables();\n this._maybeEnableSmoothScroll();\n if (this._observer) {\n this._observer.disconnect();\n } else {\n this._observer = this._getNewObserver();\n }\n for (const section of this._observableSections.values()) {\n this._observer.observe(section);\n }\n }\n dispose() {\n this._observer.disconnect();\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body;\n\n // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));\n }\n return config;\n }\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return;\n }\n\n // unregister any previous listeners\n EventHandler.off(this._config.target, EVENT_CLICK);\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash);\n if (observableSection) {\n event.preventDefault();\n const root = this._rootElement || window;\n const height = observableSection.offsetTop - this._element.offsetTop;\n if (root.scrollTo) {\n root.scrollTo({\n top: height,\n behavior: 'smooth'\n });\n return;\n }\n\n // Chrome 60 doesn't support `scrollTo`\n root.scrollTop = height;\n }\n });\n }\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n };\n return new IntersectionObserver(entries => this._observerCallback(entries), options);\n }\n\n // The logic of selection\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop;\n this._process(targetElement(entry));\n };\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;\n this._previousScrollData.parentScrollTop = parentScrollTop;\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null;\n this._clearActiveClass(targetElement(entry));\n continue;\n }\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop;\n // if we are scrolling down, pick the bigger offsetTop\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry);\n // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n if (!parentScrollTop) {\n return;\n }\n continue;\n }\n\n // if we are scrolling up, pick the smallest offsetTop\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry);\n }\n }\n }\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map();\n this._observableSections = new Map();\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue;\n }\n const observableSection = SelectorEngine.findOne(decodeURI(anchor.hash), this._element);\n\n // ensure that the observableSection exists & is visible\n if (isVisible(observableSection)) {\n this._targetLinks.set(decodeURI(anchor.hash), anchor);\n this._observableSections.set(anchor.hash, observableSection);\n }\n }\n }\n _process(target) {\n if (this._activeTarget === target) {\n return;\n }\n this._clearActiveClass(this._config.target);\n this._activeTarget = target;\n target.classList.add(CLASS_NAME_ACTIVE$1);\n this._activateParents(target);\n EventHandler.trigger(this._element, EVENT_ACTIVATE, {\n relatedTarget: target\n });\n }\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);\n return;\n }\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both