diff --git a/.devcontainer/Dockerfile b/.devcontainer/Dockerfile new file mode 100644 index 0000000..ff261ba --- /dev/null +++ b/.devcontainer/Dockerfile @@ -0,0 +1,9 @@ +ARG VARIANT="3.9" +FROM mcr.microsoft.com/vscode/devcontainers/python:0-${VARIANT} + +USER vscode + +RUN curl -sSf https://rye.astral.sh/get | RYE_VERSION="0.44.0" RYE_INSTALL_OPTION="--yes" bash +ENV PATH=/home/vscode/.rye/shims:$PATH + +RUN echo "[[ -d .venv ]] && source .venv/bin/activate || export PATH=\$PATH" >> /home/vscode/.bashrc diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json new file mode 100644 index 0000000..c17fdc1 --- /dev/null +++ b/.devcontainer/devcontainer.json @@ -0,0 +1,43 @@ +// For format details, see https://aka.ms/devcontainer.json. For config options, see the +// README at: https://github.com/devcontainers/templates/tree/main/src/debian +{ + "name": "Debian", + "build": { + "dockerfile": "Dockerfile", + "context": ".." + }, + + "postStartCommand": "rye sync --all-features", + + "customizations": { + "vscode": { + "extensions": [ + "ms-python.python" + ], + "settings": { + "terminal.integrated.shell.linux": "/bin/bash", + "python.pythonPath": ".venv/bin/python", + "python.defaultInterpreterPath": ".venv/bin/python", + "python.typeChecking": "basic", + "terminal.integrated.env.linux": { + "PATH": "/home/vscode/.rye/shims:${env:PATH}" + } + } + } + }, + "features": { + "ghcr.io/devcontainers/features/node:1": {} + } + + // Features to add to the dev container. More info: https://containers.dev/features. + // "features": {}, + + // Use 'forwardPorts' to make a list of ports inside the container available locally. + // "forwardPorts": [], + + // Configure tool-specific properties. + // "customizations": {}, + + // Uncomment to connect as root instead. More info: https://aka.ms/dev-containers-non-root. + // "remoteUser": "root" +} diff --git a/.github/workflows/ci.yml b/.github/workflows/ci.yml new file mode 100644 index 0000000..99ec9fb --- /dev/null +++ b/.github/workflows/ci.yml @@ -0,0 +1,104 @@ +name: CI +on: + push: + branches: + - '**' + - '!integrated/**' + - '!stl-preview-head/**' + - '!stl-preview-base/**' + - '!generated' + - '!codegen/**' + - 'codegen/stl/**' + pull_request: + branches-ignore: + - 'stl-preview-head/**' + - 'stl-preview-base/**' + +jobs: + lint: + timeout-minutes: 10 + name: lint + runs-on: ${{ github.repository == 'stainless-sdks/parallel-sdk-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: (github.event_name == 'push' || github.event.pull_request.head.repo.fork) && (github.event_name != 'push' || github.event.head_commit.message != 'codegen metadata') + steps: + - uses: actions/checkout@v6 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Install dependencies + run: rye sync --all-features + + - name: Run lints + run: ./scripts/lint + + build: + if: (github.event_name == 'push' || github.event.pull_request.head.repo.fork) && (github.event_name != 'push' || github.event.head_commit.message != 'codegen metadata') + timeout-minutes: 10 + name: build + permissions: + contents: read + id-token: write + runs-on: ${{ github.repository == 'stainless-sdks/parallel-sdk-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + steps: + - uses: actions/checkout@v6 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Install dependencies + run: rye sync --all-features + + - name: Run build + run: rye build + + - name: Get GitHub OIDC Token + if: |- + github.repository == 'stainless-sdks/parallel-sdk-python' && + !startsWith(github.ref, 'refs/heads/stl/') + id: github-oidc + uses: actions/github-script@v8 + with: + script: core.setOutput('github_token', await core.getIDToken()); + + - name: Upload tarball + if: |- + github.repository == 'stainless-sdks/parallel-sdk-python' && + !startsWith(github.ref, 'refs/heads/stl/') + env: + URL: https://pkg.stainless.com/s + AUTH: ${{ steps.github-oidc.outputs.github_token }} + SHA: ${{ github.sha }} + run: ./scripts/utils/upload-artifact.sh + + test: + timeout-minutes: 10 + name: test + runs-on: ${{ github.repository == 'stainless-sdks/parallel-sdk-python' && 'depot-ubuntu-24.04' || 'ubuntu-latest' }} + if: github.event_name == 'push' || github.event.pull_request.head.repo.fork + steps: + - uses: actions/checkout@v6 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Bootstrap + run: ./scripts/bootstrap + + - name: Run tests + run: ./scripts/test diff --git a/.github/workflows/detect-breaking-changes.yml b/.github/workflows/detect-breaking-changes.yml new file mode 100644 index 0000000..516cd71 --- /dev/null +++ b/.github/workflows/detect-breaking-changes.yml @@ -0,0 +1,42 @@ +name: CI +on: + pull_request: + branches: + - main + - next + +jobs: + detect_breaking_changes: + runs-on: 'ubuntu-latest' + name: detect-breaking-changes + if: github.repository == 'parallel-web/parallel-sdk-python' + steps: + - name: Calculate fetch-depth + run: | + echo "FETCH_DEPTH=$(expr ${{ github.event.pull_request.commits }} + 1)" >> $GITHUB_ENV + + - uses: actions/checkout@v6 + with: + # Ensure we can check out the pull request base in the script below. + fetch-depth: ${{ env.FETCH_DEPTH }} + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + - name: Install dependencies + run: | + rye sync --all-features + - name: Detect removed symbols + run: | + rye run python scripts/detect-breaking-changes.py "${{ github.event.pull_request.base.sha }}" + + - name: Detect breaking changes + run: | + # Try to check out previous versions of the breaking change detection script. This ensures that + # we still detect breaking changes when entire files and their tests are removed. + git checkout "${{ github.event.pull_request.base.sha }}" -- ./scripts/detect-breaking-changes 2>/dev/null || true + ./scripts/detect-breaking-changes ${{ github.event.pull_request.base.sha }} \ No newline at end of file diff --git a/.github/workflows/publish-pypi.yml b/.github/workflows/publish-pypi.yml new file mode 100644 index 0000000..c2a2199 --- /dev/null +++ b/.github/workflows/publish-pypi.yml @@ -0,0 +1,31 @@ +# This workflow is triggered when a GitHub release is created. +# It can also be run manually to re-publish to PyPI in case it failed for some reason. +# You can run this workflow by navigating to https://www.github.com/parallel-web/parallel-sdk-python/actions/workflows/publish-pypi.yml +name: Publish PyPI +on: + workflow_dispatch: + + release: + types: [published] + +jobs: + publish: + name: publish + runs-on: ubuntu-latest + + steps: + - uses: actions/checkout@v6 + + - name: Install Rye + run: | + curl -sSf https://rye.astral.sh/get | bash + echo "$HOME/.rye/shims" >> $GITHUB_PATH + env: + RYE_VERSION: '0.44.0' + RYE_INSTALL_OPTION: '--yes' + + - name: Publish to PyPI + run: | + bash ./bin/publish-pypi + env: + PYPI_TOKEN: ${{ secrets.PARALLEL_PYPI_TOKEN || secrets.PYPI_TOKEN }} diff --git a/.github/workflows/release-doctor.yml b/.github/workflows/release-doctor.yml new file mode 100644 index 0000000..821b37d --- /dev/null +++ b/.github/workflows/release-doctor.yml @@ -0,0 +1,21 @@ +name: Release Doctor +on: + pull_request: + branches: + - main + workflow_dispatch: + +jobs: + release_doctor: + name: release doctor + runs-on: ubuntu-latest + if: github.repository == 'parallel-web/parallel-sdk-python' && (github.event_name == 'push' || github.event_name == 'workflow_dispatch' || startsWith(github.head_ref, 'release-please') || github.head_ref == 'next') + + steps: + - uses: actions/checkout@v6 + + - name: Check release environment + run: | + bash ./bin/check-release-environment + env: + PYPI_TOKEN: ${{ secrets.PARALLEL_PYPI_TOKEN || secrets.PYPI_TOKEN }} diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..3824f4c --- /dev/null +++ b/.gitignore @@ -0,0 +1,16 @@ +.prism.log +.stdy.log +_dev + +__pycache__ +.mypy_cache + +dist + +.venv +.idea + +.env +.envrc +codegen.log +Brewfile.lock.json diff --git a/.python-version b/.python-version new file mode 100644 index 0000000..43077b2 --- /dev/null +++ b/.python-version @@ -0,0 +1 @@ +3.9.18 diff --git a/.release-please-manifest.json b/.release-please-manifest.json new file mode 100644 index 0000000..980ea05 --- /dev/null +++ b/.release-please-manifest.json @@ -0,0 +1,3 @@ +{ + ".": "0.4.2" +} \ No newline at end of file diff --git a/.stats.yml b/.stats.yml new file mode 100644 index 0000000..14cb97f --- /dev/null +++ b/.stats.yml @@ -0,0 +1,4 @@ +configured_endpoints: 21 +openapi_spec_url: https://storage.googleapis.com/stainless-sdk-openapi-specs/parallel-web%2Fparallel-sdk-728ba63c23bc2eb4fe37b429fb084ed7600ae50c8c652aeb0c787216c3ece07a.yml +openapi_spec_hash: 3568175d488fc927f1710b3ebca87cfc +config_hash: 84377e96caa95526984350fcc3c5b4c7 diff --git a/.vscode/settings.json b/.vscode/settings.json new file mode 100644 index 0000000..5b01030 --- /dev/null +++ b/.vscode/settings.json @@ -0,0 +1,3 @@ +{ + "python.analysis.importFormat": "relative", +} diff --git a/Brewfile b/Brewfile new file mode 100644 index 0000000..492ca37 --- /dev/null +++ b/Brewfile @@ -0,0 +1,2 @@ +brew "rye" + diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md new file mode 100644 index 0000000..1ecb266 --- /dev/null +++ b/CONTRIBUTING.md @@ -0,0 +1,127 @@ +## Setting up the environment + +### With Rye + +We use [Rye](https://rye.astral.sh/) to manage dependencies because it will automatically provision a Python environment with the expected Python version. To set it up, run: + +```sh +$ ./scripts/bootstrap +``` + +Or [install Rye manually](https://rye.astral.sh/guide/installation/) and run: + +```sh +$ rye sync --all-features +``` + +You can then run scripts using `rye run python script.py` or by activating the virtual environment: + +```sh +# Activate the virtual environment - https://docs.python.org/3/library/venv.html#how-venvs-work +$ source .venv/bin/activate + +# now you can omit the `rye run` prefix +$ python script.py +``` + +### Without Rye + +Alternatively if you don't want to install `Rye`, you can stick with the standard `pip` setup by ensuring you have the Python version specified in `.python-version`, create a virtual environment however you desire and then install dependencies using this command: + +```sh +$ pip install -r requirements-dev.lock +``` + +## Modifying/Adding code + +Most of the SDK is generated code. Modifications to code will be persisted between generations, but may +result in merge conflicts between manual patches and changes from the generator. The generator will never +modify the contents of the `src/parallel/lib/` and `examples/` directories. + +## Adding and running examples + +All files in the `examples/` directory are not modified by the generator and can be freely edited or added to. + +```py +# add an example to examples/.py + +#!/usr/bin/env -S rye run python +… +``` + +```sh +$ chmod +x examples/.py +# run the example against your api +$ ./examples/.py +``` + +## Using the repository from source + +If you’d like to use the repository from source, you can either install from git or link to a cloned repository: + +To install via git: + +```sh +$ pip install git+ssh://git@github.com/parallel-web/parallel-sdk-python.git +``` + +Alternatively, you can build from source and install the wheel file: + +Building this package will create two files in the `dist/` directory, a `.tar.gz` containing the source files and a `.whl` that can be used to install the package efficiently. + +To create a distributable version of the library, all you have to do is run this command: + +```sh +$ rye build +# or +$ python -m build +``` + +Then to install: + +```sh +$ pip install ./path-to-wheel-file.whl +``` + +## Running tests + +Most tests require you to [set up a mock server](https://github.com/dgellow/steady) against the OpenAPI spec to run the tests. + +```sh +$ ./scripts/mock +``` + +```sh +$ ./scripts/test +``` + +## Linting and formatting + +This repository uses [ruff](https://github.com/astral-sh/ruff) and +[black](https://github.com/psf/black) to format the code in the repository. + +To lint: + +```sh +$ ./scripts/lint +``` + +To format and fix all ruff issues automatically: + +```sh +$ ./scripts/format +``` + +## Publishing and releases + +Changes made to this repository via the automated release PR pipeline should publish to PyPI automatically. If +the changes aren't made through the automated pipeline, you may want to make releases manually. + +### Publish with a GitHub workflow + +You can release to package managers by using [the `Publish PyPI` GitHub action](https://www.github.com/parallel-web/parallel-sdk-python/actions/workflows/publish-pypi.yml). This requires a setup organization or repository secret to be set up. + +### Publish manually + +If you need to manually release a package, you can run the `bin/publish-pypi` script with a `PYPI_TOKEN` set on +the environment. diff --git a/LICENSE b/LICENSE new file mode 100644 index 0000000..5083166 --- /dev/null +++ b/LICENSE @@ -0,0 +1,7 @@ +Copyright 2026 Parallel + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/README.md b/README.md index b2e5078..618a03f 100644 --- a/README.md +++ b/README.md @@ -1 +1,405 @@ -# parallel-sdk-python \ No newline at end of file +# Parallel Python API library + + +[![PyPI version](https://img.shields.io/pypi/v/parallel-web.svg?label=pypi%20(stable))](https://pypi.org/project/parallel-web/) + +The Parallel Python library provides convenient access to the Parallel REST API from any Python 3.9+ +application. The library includes type definitions for all request params and response fields, +and offers both synchronous and asynchronous clients powered by [httpx](https://github.com/encode/httpx). + +It is generated with [Stainless](https://www.stainless.com/). + +## Documentation + +The REST API documentation can be found on [docs.parallel.ai](https://docs.parallel.ai). The full API of this library can be found in [api.md](api.md). + +## Installation + +```sh +# install from PyPI +pip install parallel-web +``` + +## Usage + +The full API of this library can be found in [api.md](api.md). + +```python +import os +from parallel import Parallel + +client = Parallel( + api_key=os.environ.get("PARALLEL_API_KEY"), # This is the default and can be omitted +) + +task_run = client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", +) +print(task_run.interaction_id) +``` + +While you can provide an `api_key` keyword argument, +we recommend using [python-dotenv](https://pypi.org/project/python-dotenv/) +to add `PARALLEL_API_KEY="My API Key"` to your `.env` file +so that your API Key is not stored in source control. + +## Async usage + +Simply import `AsyncParallel` instead of `Parallel` and use `await` with each API call: + +```python +import os +import asyncio +from parallel import AsyncParallel + +client = AsyncParallel( + api_key=os.environ.get("PARALLEL_API_KEY"), # This is the default and can be omitted +) + + +async def main() -> None: + task_run = await client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + print(task_run.interaction_id) + + +asyncio.run(main()) +``` + +Functionality between the synchronous and asynchronous clients is otherwise identical. + +### With aiohttp + +By default, the async client uses `httpx` for HTTP requests. However, for improved concurrency performance you may also use `aiohttp` as the HTTP backend. + +You can enable this by installing `aiohttp`: + +```sh +# install from PyPI +pip install parallel-web[aiohttp] +``` + +Then you can enable it by instantiating the client with `http_client=DefaultAioHttpClient()`: + +```python +import os +import asyncio +from parallel import DefaultAioHttpClient +from parallel import AsyncParallel + + +async def main() -> None: + async with AsyncParallel( + api_key=os.environ.get("PARALLEL_API_KEY"), # This is the default and can be omitted + http_client=DefaultAioHttpClient(), + ) as client: + task_run = await client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + print(task_run.interaction_id) + + +asyncio.run(main()) +``` + +## Using types + +Nested request parameters are [TypedDicts](https://docs.python.org/3/library/typing.html#typing.TypedDict). Responses are [Pydantic models](https://docs.pydantic.dev) which also provide helper methods for things like: + +- Serializing back into JSON, `model.to_json()` +- Converting to a dictionary, `model.to_dict()` + +Typed requests and responses provide autocomplete and documentation within your editor. If you would like to see type errors in VS Code to help catch bugs earlier, set `python.analysis.typeCheckingMode` to `basic`. + +## Nested params + +Nested parameters are dictionaries, typed using `TypedDict`, for example: + +```python +from parallel import Parallel + +client = Parallel() + +task_run = client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + source_policy={}, +) +print(task_run.source_policy) +``` + +## Handling errors + +When the library is unable to connect to the API (for example, due to network connection problems or a timeout), a subclass of `parallel.APIConnectionError` is raised. + +When the API returns a non-success status code (that is, 4xx or 5xx +response), a subclass of `parallel.APIStatusError` is raised, containing `status_code` and `response` properties. + +All errors inherit from `parallel.APIError`. + +```python +import parallel +from parallel import Parallel + +client = Parallel() + +try: + client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) +except parallel.APIConnectionError as e: + print("The server could not be reached") + print(e.__cause__) # an underlying Exception, likely raised within httpx. +except parallel.RateLimitError as e: + print("A 429 status code was received; we should back off a bit.") +except parallel.APIStatusError as e: + print("Another non-200-range status code was received") + print(e.status_code) + print(e.response) +``` + +Error codes are as follows: + +| Status Code | Error Type | +| ----------- | -------------------------- | +| 400 | `BadRequestError` | +| 401 | `AuthenticationError` | +| 403 | `PermissionDeniedError` | +| 404 | `NotFoundError` | +| 422 | `UnprocessableEntityError` | +| 429 | `RateLimitError` | +| >=500 | `InternalServerError` | +| N/A | `APIConnectionError` | + +### Retries + +Certain errors are automatically retried 2 times by default, with a short exponential backoff. +Connection errors (for example, due to a network connectivity problem), 408 Request Timeout, 409 Conflict, +429 Rate Limit, and >=500 Internal errors are all retried by default. + +You can use the `max_retries` option to configure or disable retry settings: + +```python +from parallel import Parallel + +# Configure the default for all requests: +client = Parallel( + # default is 2 + max_retries=0, +) + +# Or, configure per-request: +client.with_options(max_retries=5).task_run.create( + input="What was the GDP of France in 2023?", + processor="base", +) +``` + +### Timeouts + +By default requests time out after 1 minute. You can configure this with a `timeout` option, +which accepts a float or an [`httpx.Timeout`](https://www.python-httpx.org/advanced/timeouts/#fine-tuning-the-configuration) object: + +```python +from parallel import Parallel + +# Configure the default for all requests: +client = Parallel( + # 20 seconds (default is 1 minute) + timeout=20.0, +) + +# More granular control: +client = Parallel( + timeout=httpx.Timeout(60.0, read=5.0, write=10.0, connect=2.0), +) + +# Override per-request: +client.with_options(timeout=5.0).task_run.create( + input="What was the GDP of France in 2023?", + processor="base", +) +``` + +On timeout, an `APITimeoutError` is thrown. + +Note that requests that time out are [retried twice by default](#retries). + +## Advanced + +### Logging + +We use the standard library [`logging`](https://docs.python.org/3/library/logging.html) module. + +You can enable logging by setting the environment variable `PARALLEL_LOG` to `info`. + +```shell +$ export PARALLEL_LOG=info +``` + +Or to `debug` for more verbose logging. + +### How to tell whether `None` means `null` or missing + +In an API response, a field may be explicitly `null`, or missing entirely; in either case, its value is `None` in this library. You can differentiate the two cases with `.model_fields_set`: + +```py +if response.my_field is None: + if 'my_field' not in response.model_fields_set: + print('Got json like {}, without a "my_field" key present at all.') + else: + print('Got json like {"my_field": null}.') +``` + +### Accessing raw response data (e.g. headers) + +The "raw" Response object can be accessed by prefixing `.with_raw_response.` to any HTTP method call, e.g., + +```py +from parallel import Parallel + +client = Parallel() +response = client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", +) +print(response.headers.get('X-My-Header')) + +task_run = response.parse() # get the object that `task_run.create()` would have returned +print(task_run.interaction_id) +``` + +These methods return an [`APIResponse`](https://github.com/parallel-web/parallel-sdk-python/tree/main/src/parallel/_response.py) object. + +The async client returns an [`AsyncAPIResponse`](https://github.com/parallel-web/parallel-sdk-python/tree/main/src/parallel/_response.py) with the same structure, the only difference being `await`able methods for reading the response content. + +#### `.with_streaming_response` + +The above interface eagerly reads the full response body when you make the request, which may not always be what you want. + +To stream the response body, use `.with_streaming_response` instead, which requires a context manager and only reads the response body once you call `.read()`, `.text()`, `.json()`, `.iter_bytes()`, `.iter_text()`, `.iter_lines()` or `.parse()`. In the async client, these are async methods. + +```python +with client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", + processor="base", +) as response: + print(response.headers.get("X-My-Header")) + + for line in response.iter_lines(): + print(line) +``` + +The context manager is required so that the response will reliably be closed. + +### Making custom/undocumented requests + +This library is typed for convenient access to the documented API. + +If you need to access undocumented endpoints, params, or response properties, the library can still be used. + +#### Undocumented endpoints + +To make requests to undocumented endpoints, you can make requests using `client.get`, `client.post`, and other +http verbs. Options on the client will be respected (such as retries) when making this request. + +```py +import httpx + +response = client.post( + "/foo", + cast_to=httpx.Response, + body={"my_param": True}, +) + +print(response.headers.get("x-foo")) +``` + +#### Undocumented request params + +If you want to explicitly send an extra param, you can do so with the `extra_query`, `extra_body`, and `extra_headers` request +options. + +#### Undocumented response properties + +To access undocumented response properties, you can access the extra fields like `response.unknown_prop`. You +can also get all the extra fields on the Pydantic model as a dict with +[`response.model_extra`](https://docs.pydantic.dev/latest/api/base_model/#pydantic.BaseModel.model_extra). + +### Configuring the HTTP client + +You can directly override the [httpx client](https://www.python-httpx.org/api/#client) to customize it for your use case, including: + +- Support for [proxies](https://www.python-httpx.org/advanced/proxies/) +- Custom [transports](https://www.python-httpx.org/advanced/transports/) +- Additional [advanced](https://www.python-httpx.org/advanced/clients/) functionality + +```python +import httpx +from parallel import Parallel, DefaultHttpxClient + +client = Parallel( + # Or use the `PARALLEL_BASE_URL` env var + base_url="http://my.test.server.example.com:8083", + http_client=DefaultHttpxClient( + proxy="http://my.test.proxy.example.com", + transport=httpx.HTTPTransport(local_address="0.0.0.0"), + ), +) +``` + +You can also customize the client on a per-request basis by using `with_options()`: + +```python +client.with_options(http_client=DefaultHttpxClient(...)) +``` + +### Managing HTTP resources + +By default the library closes underlying HTTP connections whenever the client is [garbage collected](https://docs.python.org/3/reference/datamodel.html#object.__del__). You can manually close the client using the `.close()` method if desired, or with a context manager that closes when exiting. + +```py +from parallel import Parallel + +with Parallel() as client: + # make requests here + ... + +# HTTP client is now closed +``` + +## Versioning + +This package generally follows [SemVer](https://semver.org/spec/v2.0.0.html) conventions, though certain backwards-incompatible changes may be released as minor versions: + +1. Changes that only affect static types, without breaking runtime behavior. +2. Changes to library internals which are technically public but not intended or documented for external use. _(Please open a GitHub issue to let us know if you are relying on such internals.)_ +3. Changes that we do not expect to impact the vast majority of users in practice. + +We take backwards-compatibility seriously and work hard to ensure you can rely on a smooth upgrade experience. + +We are keen for your feedback; please open an [issue](https://www.github.com/parallel-web/parallel-sdk-python/issues) with questions, bugs, or suggestions. + +### Determining the installed version + +If you've upgraded to the latest version but aren't seeing any new features you were expecting then your python environment is likely still using an older version. + +You can determine the version that is being used at runtime with: + +```py +import parallel +print(parallel.__version__) +``` + +## Requirements + +Python 3.9 or higher. + +## Contributing + +See [the contributing documentation](./CONTRIBUTING.md). diff --git a/SECURITY.md b/SECURITY.md new file mode 100644 index 0000000..e37f76a --- /dev/null +++ b/SECURITY.md @@ -0,0 +1,27 @@ +# Security Policy + +## Reporting Security Issues + +This SDK is generated by [Stainless Software Inc](http://stainless.com). Stainless takes security seriously, and encourages you to report any security vulnerability promptly so that appropriate action can be taken. + +To report a security issue, please contact the Stainless team at security@stainless.com. + +## Responsible Disclosure + +We appreciate the efforts of security researchers and individuals who help us maintain the security of +SDKs we generate. If you believe you have found a security vulnerability, please adhere to responsible +disclosure practices by allowing us a reasonable amount of time to investigate and address the issue +before making any information public. + +## Reporting Non-SDK Related Security Issues + +If you encounter security issues that are not directly related to SDKs but pertain to the services +or products provided by Parallel, please follow the respective company's security reporting guidelines. + +### Parallel Terms and Policies + +Please contact support@parallel.ai for any questions or concerns regarding the security of our services. + +--- + +Thank you for helping us keep the SDKs and systems they interact with secure. diff --git a/api.md b/api.md new file mode 100644 index 0000000..9678a92 --- /dev/null +++ b/api.md @@ -0,0 +1,40 @@ +# Shared Types + +```python +from parallel.types import ErrorObject, ErrorResponse, SourcePolicy, Warning +``` + +# TaskRun + +Types: + +```python +from parallel.types import ( + AutoSchema, + Citation, + ErrorEvent, + FieldBasis, + JsonSchema, + McpServer, + McpToolCall, + RunInput, + TaskRun, + TaskRunEvent, + TaskRunJsonOutput, + TaskRunResult, + TaskRunTextOutput, + TaskSpec, + TextSchema, + Webhook, + TaskRunEventsResponse, +) +``` + +Methods: + +- client.task_run.create(\*\*params) -> TaskRun +- client.task_run.retrieve(run_id) -> TaskRun +- client.task_run.events(run_id) -> TaskRunEventsResponse +- client.task_run.result(run_id, \*\*params) -> TaskRunResult + +# [Beta](src/parallel/resources/beta/api.md) diff --git a/bin/check-release-environment b/bin/check-release-environment new file mode 100644 index 0000000..b845b0f --- /dev/null +++ b/bin/check-release-environment @@ -0,0 +1,21 @@ +#!/usr/bin/env bash + +errors=() + +if [ -z "${PYPI_TOKEN}" ]; then + errors+=("The PYPI_TOKEN secret has not been set. Please set it in either this repository's secrets or your organization secrets.") +fi + +lenErrors=${#errors[@]} + +if [[ lenErrors -gt 0 ]]; then + echo -e "Found the following errors in the release environment:\n" + + for error in "${errors[@]}"; do + echo -e "- $error\n" + done + + exit 1 +fi + +echo "The environment is ready to push releases!" diff --git a/bin/publish-pypi b/bin/publish-pypi new file mode 100644 index 0000000..826054e --- /dev/null +++ b/bin/publish-pypi @@ -0,0 +1,6 @@ +#!/usr/bin/env bash + +set -eux +mkdir -p dist +rye build --clean +rye publish --yes --token=$PYPI_TOKEN diff --git a/examples/.keep b/examples/.keep new file mode 100644 index 0000000..d8c73e9 --- /dev/null +++ b/examples/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store example files demonstrating usage of this SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/noxfile.py b/noxfile.py new file mode 100644 index 0000000..53bca7f --- /dev/null +++ b/noxfile.py @@ -0,0 +1,9 @@ +import nox + + +@nox.session(reuse_venv=True, name="test-pydantic-v1") +def test_pydantic_v1(session: nox.Session) -> None: + session.install("-r", "requirements-dev.lock") + session.install("pydantic<2") + + session.run("pytest", "--showlocals", "--ignore=tests/functional", *session.posargs) diff --git a/pyproject.toml b/pyproject.toml new file mode 100644 index 0000000..b50e064 --- /dev/null +++ b/pyproject.toml @@ -0,0 +1,270 @@ +[project] +name = "parallel-web" +version = "0.4.2" +description = "The official Python library for the Parallel API" +dynamic = ["readme"] +license = "MIT" +authors = [ +{ name = "Parallel", email = "support@parallel.ai" }, +] + +dependencies = [ + "httpx>=0.23.0, <1", + "pydantic>=1.9.0, <3", + "typing-extensions>=4.14, <5", + "anyio>=3.5.0, <5", + "distro>=1.7.0, <2", + "sniffio", +] + +requires-python = ">= 3.9" +classifiers = [ + "Typing :: Typed", + "Intended Audience :: Developers", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Programming Language :: Python :: 3.12", + "Programming Language :: Python :: 3.13", + "Programming Language :: Python :: 3.14", + "Operating System :: OS Independent", + "Operating System :: POSIX", + "Operating System :: MacOS", + "Operating System :: POSIX :: Linux", + "Operating System :: Microsoft :: Windows", + "Topic :: Software Development :: Libraries :: Python Modules", + "License :: OSI Approved :: MIT License" +] + +[project.urls] +Homepage = "https://github.com/parallel-web/parallel-sdk-python" +Repository = "https://github.com/parallel-web/parallel-sdk-python" + +[project.optional-dependencies] +aiohttp = ["aiohttp", "httpx_aiohttp>=0.1.9"] + +[tool.rye] +managed = true +# version pins are in requirements-dev.lock +dev-dependencies = [ + "pyright==1.1.399", + "mypy==1.17", + "respx", + "pytest", + "pytest-asyncio", + "ruff", + "time-machine", + "nox", + "dirty-equals>=0.6.0", + "importlib-metadata>=6.7.0", + "rich>=13.7.1", + "pytest-xdist>=3.6.1", + "griffe>=1", +] + +[tool.rye.scripts] +format = { chain = [ + "format:ruff", + "format:docs", + "fix:ruff", + # run formatting again to fix any inconsistencies when imports are stripped + "format:ruff", +]} +"format:docs" = "bash -c 'python scripts/utils/ruffen-docs.py README.md $(find . -type f -name api.md)'" +"format:ruff" = "ruff format" + +"lint" = { chain = [ + "check:ruff", + "typecheck", + "check:importable", +]} +"check:ruff" = "ruff check ." +"fix:ruff" = "ruff check --fix ." + +"check:importable" = "python -c 'import parallel'" + +typecheck = { chain = [ + "typecheck:pyright", + "typecheck:mypy" +]} +"typecheck:pyright" = "pyright" +"typecheck:verify-types" = "pyright --verifytypes parallel --ignoreexternal" +"typecheck:mypy" = "mypy ." + +[build-system] +requires = ["hatchling==1.26.3", "hatch-fancy-pypi-readme"] +build-backend = "hatchling.build" + +[tool.hatch.build] +include = [ + "src/*" +] + +[tool.hatch.build.targets.wheel] +packages = ["src/parallel"] + +[tool.hatch.build.targets.sdist] +# Basically everything except hidden files/directories (such as .github, .devcontainers, .python-version, etc) +include = [ + "/*.toml", + "/*.json", + "/*.lock", + "/*.md", + "/mypy.ini", + "/noxfile.py", + "bin/*", + "examples/*", + "src/*", + "tests/*", +] + +[tool.hatch.metadata.hooks.fancy-pypi-readme] +content-type = "text/markdown" + +[[tool.hatch.metadata.hooks.fancy-pypi-readme.fragments]] +path = "README.md" + +[[tool.hatch.metadata.hooks.fancy-pypi-readme.substitutions]] +# replace relative links with absolute links +pattern = '\[(.+?)\]\(((?!https?://)\S+?)\)' +replacement = '[\1](https://github.com/parallel-web/parallel-sdk-python/tree/main/\g<2>)' + +[tool.pytest.ini_options] +testpaths = ["tests"] +addopts = "--tb=short -n auto" +xfail_strict = true +asyncio_mode = "auto" +asyncio_default_fixture_loop_scope = "session" +filterwarnings = [ + "error" +] + +[tool.pyright] +# this enables practically every flag given by pyright. +# there are a couple of flags that are still disabled by +# default in strict mode as they are experimental and niche. +typeCheckingMode = "strict" +pythonVersion = "3.9" + +exclude = [ + "_dev", + ".venv", + ".nox", + ".git", +] + +reportImplicitOverride = true +reportOverlappingOverload = false + +reportImportCycles = false +reportPrivateUsage = false + +[tool.mypy] +pretty = true +show_error_codes = true + +# Exclude _files.py because mypy isn't smart enough to apply +# the correct type narrowing and as this is an internal module +# it's fine to just use Pyright. +# +# We also exclude our `tests` as mypy doesn't always infer +# types correctly and Pyright will still catch any type errors. +exclude = ['src/parallel/_files.py', '_dev/.*.py', 'tests/.*'] + +strict_equality = true +implicit_reexport = true +check_untyped_defs = true +no_implicit_optional = true + +warn_return_any = true +warn_unreachable = true +warn_unused_configs = true + +# Turn these options off as it could cause conflicts +# with the Pyright options. +warn_unused_ignores = false +warn_redundant_casts = false + +disallow_any_generics = true +disallow_untyped_defs = true +disallow_untyped_calls = true +disallow_subclassing_any = true +disallow_incomplete_defs = true +disallow_untyped_decorators = true +cache_fine_grained = true + +# By default, mypy reports an error if you assign a value to the result +# of a function call that doesn't return anything. We do this in our test +# cases: +# ``` +# result = ... +# assert result is None +# ``` +# Changing this codegen to make mypy happy would increase complexity +# and would not be worth it. +disable_error_code = "func-returns-value,overload-cannot-match" + +# https://github.com/python/mypy/issues/12162 +[[tool.mypy.overrides]] +module = "black.files.*" +ignore_errors = true +ignore_missing_imports = true + + +[tool.ruff] +line-length = 120 +output-format = "grouped" +target-version = "py38" + +[tool.ruff.format] +docstring-code-format = true + +[tool.ruff.lint] +select = [ + # isort + "I", + # bugbear rules + "B", + # remove unused imports + "F401", + # check for missing future annotations + "FA102", + # bare except statements + "E722", + # unused arguments + "ARG", + # print statements + "T201", + "T203", + # misuse of typing.TYPE_CHECKING + "TC004", + # import rules + "TID251", +] +ignore = [ + # mutable defaults + "B006", +] +unfixable = [ + # disable auto fix for print statements + "T201", + "T203", +] + +extend-safe-fixes = ["FA102"] + +[tool.ruff.lint.flake8-tidy-imports.banned-api] +"functools.lru_cache".msg = "This function does not retain type information for the wrapped function's arguments; The `lru_cache` function from `_utils` should be used instead" + +[tool.ruff.lint.isort] +length-sort = true +length-sort-straight = true +combine-as-imports = true +extra-standard-library = ["typing_extensions"] +known-first-party = ["parallel", "tests"] + +[tool.ruff.lint.per-file-ignores] +"bin/**.py" = ["T201", "T203"] +"scripts/**.py" = ["T201", "T203"] +"tests/**.py" = ["T201", "T203"] +"examples/**.py" = ["T201", "T203"] diff --git a/release-please-config.json b/release-please-config.json new file mode 100644 index 0000000..a7edfb4 --- /dev/null +++ b/release-please-config.json @@ -0,0 +1,66 @@ +{ + "packages": { + ".": {} + }, + "$schema": "https://raw.githubusercontent.com/stainless-api/release-please/main/schemas/config.json", + "include-v-in-tag": true, + "include-component-in-tag": false, + "versioning": "prerelease", + "prerelease": true, + "bump-minor-pre-major": true, + "bump-patch-for-minor-pre-major": false, + "pull-request-header": "Automated Release PR", + "pull-request-title-pattern": "release: ${version}", + "changelog-sections": [ + { + "type": "feat", + "section": "Features" + }, + { + "type": "fix", + "section": "Bug Fixes" + }, + { + "type": "perf", + "section": "Performance Improvements" + }, + { + "type": "revert", + "section": "Reverts" + }, + { + "type": "chore", + "section": "Chores" + }, + { + "type": "docs", + "section": "Documentation" + }, + { + "type": "style", + "section": "Styles" + }, + { + "type": "refactor", + "section": "Refactors" + }, + { + "type": "test", + "section": "Tests", + "hidden": true + }, + { + "type": "build", + "section": "Build System" + }, + { + "type": "ci", + "section": "Continuous Integration", + "hidden": true + } + ], + "release-type": "python", + "extra-files": [ + "src/parallel/_version.py" + ] +} \ No newline at end of file diff --git a/requirements-dev.lock b/requirements-dev.lock new file mode 100644 index 0000000..c32a9d9 --- /dev/null +++ b/requirements-dev.lock @@ -0,0 +1,152 @@ +# generated by rye +# use `rye lock` or `rye sync` to update this lockfile +# +# last locked with the following flags: +# pre: false +# features: [] +# all-features: true +# with-sources: false +# generate-hashes: false +# universal: false + +-e file:. +aiohappyeyeballs==2.6.1 + # via aiohttp +aiohttp==3.13.3 + # via httpx-aiohttp + # via parallel-web +aiosignal==1.4.0 + # via aiohttp +annotated-types==0.7.0 + # via pydantic +anyio==4.12.1 + # via httpx + # via parallel-web +argcomplete==3.6.3 + # via nox +async-timeout==5.0.1 + # via aiohttp +attrs==25.4.0 + # via aiohttp + # via nox +backports-asyncio-runner==1.2.0 + # via pytest-asyncio +certifi==2026.1.4 + # via httpcore + # via httpx +colorama==0.4.6 + # via griffe +colorlog==6.10.1 + # via nox +dependency-groups==1.3.1 + # via nox +dirty-equals==0.11 +distlib==0.4.0 + # via virtualenv +distro==1.9.0 + # via parallel-web +exceptiongroup==1.3.1 + # via anyio + # via pytest +execnet==2.1.2 + # via pytest-xdist +filelock==3.19.1 + # via virtualenv +frozenlist==1.8.0 + # via aiohttp + # via aiosignal +griffe==1.14.0 +h11==0.16.0 + # via httpcore +httpcore==1.0.9 + # via httpx +httpx==0.28.1 + # via httpx-aiohttp + # via parallel-web + # via respx +httpx-aiohttp==0.1.12 + # via parallel-web +humanize==4.13.0 + # via nox +idna==3.11 + # via anyio + # via httpx + # via yarl +importlib-metadata==8.7.1 +iniconfig==2.1.0 + # via pytest +markdown-it-py==3.0.0 + # via rich +mdurl==0.1.2 + # via markdown-it-py +multidict==6.7.0 + # via aiohttp + # via yarl +mypy==1.17.0 +mypy-extensions==1.1.0 + # via mypy +nodeenv==1.10.0 + # via pyright +nox==2025.11.12 +packaging==25.0 + # via dependency-groups + # via nox + # via pytest +pathspec==1.0.3 + # via mypy +platformdirs==4.4.0 + # via virtualenv +pluggy==1.6.0 + # via pytest +propcache==0.4.1 + # via aiohttp + # via yarl +pydantic==2.12.5 + # via parallel-web +pydantic-core==2.41.5 + # via pydantic +pygments==2.19.2 + # via pytest + # via rich +pyright==1.1.399 +pytest==8.4.2 + # via pytest-asyncio + # via pytest-xdist +pytest-asyncio==1.2.0 +pytest-xdist==3.8.0 +python-dateutil==2.9.0.post0 + # via time-machine +respx==0.22.0 +rich==14.2.0 +ruff==0.14.13 +six==1.17.0 + # via python-dateutil +sniffio==1.3.1 + # via parallel-web +time-machine==2.19.0 +tomli==2.4.0 + # via dependency-groups + # via mypy + # via nox + # via pytest +typing-extensions==4.15.0 + # via aiosignal + # via anyio + # via exceptiongroup + # via multidict + # via mypy + # via parallel-web + # via pydantic + # via pydantic-core + # via pyright + # via pytest-asyncio + # via typing-inspection + # via virtualenv +typing-inspection==0.4.2 + # via pydantic +virtualenv==20.36.1 + # via nox +yarl==1.22.0 + # via aiohttp +zipp==3.23.0 + # via importlib-metadata diff --git a/requirements.lock b/requirements.lock new file mode 100644 index 0000000..ff321d5 --- /dev/null +++ b/requirements.lock @@ -0,0 +1,76 @@ +# generated by rye +# use `rye lock` or `rye sync` to update this lockfile +# +# last locked with the following flags: +# pre: false +# features: [] +# all-features: true +# with-sources: false +# generate-hashes: false +# universal: false + +-e file:. +aiohappyeyeballs==2.6.1 + # via aiohttp +aiohttp==3.13.3 + # via httpx-aiohttp + # via parallel-web +aiosignal==1.4.0 + # via aiohttp +annotated-types==0.7.0 + # via pydantic +anyio==4.12.1 + # via httpx + # via parallel-web +async-timeout==5.0.1 + # via aiohttp +attrs==25.4.0 + # via aiohttp +certifi==2026.1.4 + # via httpcore + # via httpx +distro==1.9.0 + # via parallel-web +exceptiongroup==1.3.1 + # via anyio +frozenlist==1.8.0 + # via aiohttp + # via aiosignal +h11==0.16.0 + # via httpcore +httpcore==1.0.9 + # via httpx +httpx==0.28.1 + # via httpx-aiohttp + # via parallel-web +httpx-aiohttp==0.1.12 + # via parallel-web +idna==3.11 + # via anyio + # via httpx + # via yarl +multidict==6.7.0 + # via aiohttp + # via yarl +propcache==0.4.1 + # via aiohttp + # via yarl +pydantic==2.12.5 + # via parallel-web +pydantic-core==2.41.5 + # via pydantic +sniffio==1.3.1 + # via parallel-web +typing-extensions==4.15.0 + # via aiosignal + # via anyio + # via exceptiongroup + # via multidict + # via parallel-web + # via pydantic + # via pydantic-core + # via typing-inspection +typing-inspection==0.4.2 + # via pydantic +yarl==1.22.0 + # via aiohttp diff --git a/scripts/bootstrap b/scripts/bootstrap new file mode 100755 index 0000000..b430fee --- /dev/null +++ b/scripts/bootstrap @@ -0,0 +1,27 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [ -f "Brewfile" ] && [ "$(uname -s)" = "Darwin" ] && [ "$SKIP_BREW" != "1" ] && [ -t 0 ]; then + brew bundle check >/dev/null 2>&1 || { + echo -n "==> Install Homebrew dependencies? (y/N): " + read -r response + case "$response" in + [yY][eE][sS]|[yY]) + brew bundle + ;; + *) + ;; + esac + echo + } +fi + +echo "==> Installing Python dependencies…" + +# experimental uv support makes installations significantly faster +rye config --set-bool behavior.use-uv=true + +rye sync --all-features diff --git a/scripts/detect-breaking-changes b/scripts/detect-breaking-changes new file mode 100755 index 0000000..fb28f3a --- /dev/null +++ b/scripts/detect-breaking-changes @@ -0,0 +1,19 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Detecting breaking changes" + +TEST_PATHS=( tests/api_resources tests/test_client.py tests/test_response.py ) + +for PATHSPEC in "${TEST_PATHS[@]}"; do + # Try to check out previous versions of the test files + # with the current SDK. + git checkout "$1" -- "${PATHSPEC}" 2>/dev/null || true +done + +# Instead of running the tests, use the linter to check if an +# older test is no longer compatible with the latest SDK. +./scripts/lint diff --git a/scripts/detect-breaking-changes.py b/scripts/detect-breaking-changes.py new file mode 100644 index 0000000..4fc5250 --- /dev/null +++ b/scripts/detect-breaking-changes.py @@ -0,0 +1,79 @@ +from __future__ import annotations + +import sys +from typing import Iterator +from pathlib import Path + +import rich +import griffe +from rich.text import Text +from rich.style import Style + + +def public_members(obj: griffe.Object | griffe.Alias) -> dict[str, griffe.Object | griffe.Alias]: + if isinstance(obj, griffe.Alias): + # ignore imports for now, they're technically part of the public API + # but we don't have good preventative measures in place to prevent + # changing them + return {} + + return {name: value for name, value in obj.all_members.items() if not name.startswith("_")} + + +def find_breaking_changes( + new_obj: griffe.Object | griffe.Alias, + old_obj: griffe.Object | griffe.Alias, + *, + path: list[str], +) -> Iterator[Text | str]: + new_members = public_members(new_obj) + old_members = public_members(old_obj) + + for name, old_member in old_members.items(): + if isinstance(old_member, griffe.Alias) and len(path) > 2: + # ignore imports in `/types/` for now, they're technically part of the public API + # but we don't have good preventative measures in place to prevent changing them + continue + + new_member = new_members.get(name) + if new_member is None: + cls_name = old_member.__class__.__name__ + yield Text(f"({cls_name})", style=Style(color="rgb(119, 119, 119)")) + yield from [" " for _ in range(10 - len(cls_name))] + yield f" {'.'.join(path)}.{name}" + yield "\n" + continue + + yield from find_breaking_changes(new_member, old_member, path=[*path, name]) + + +def main() -> None: + try: + against_ref = sys.argv[1] + except IndexError as err: + raise RuntimeError("You must specify a base ref to run breaking change detection against") from err + + package = griffe.load( + "parallel", + search_paths=[Path(__file__).parent.parent.joinpath("src")], + ) + old_package = griffe.load_git( + "parallel", + ref=against_ref, + search_paths=["src"], + ) + assert isinstance(package, griffe.Module) + assert isinstance(old_package, griffe.Module) + + output = list(find_breaking_changes(package, old_package, path=["parallel"])) + if output: + rich.print(Text("Breaking changes detected!", style=Style(color="rgb(165, 79, 87)"))) + rich.print() + + for text in output: + rich.print(text, end="") + + sys.exit(1) + + +main() diff --git a/scripts/format b/scripts/format new file mode 100755 index 0000000..667ec2d --- /dev/null +++ b/scripts/format @@ -0,0 +1,8 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +echo "==> Running formatters" +rye run format diff --git a/scripts/lint b/scripts/lint new file mode 100755 index 0000000..5deb42d --- /dev/null +++ b/scripts/lint @@ -0,0 +1,16 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [ "$1" = "--fix" ]; then + echo "==> Running lints with --fix" + rye run fix:ruff +else + echo "==> Running lints" + rye run lint +fi + +echo "==> Making sure it imports" +rye run python -c 'import parallel' diff --git a/scripts/mock b/scripts/mock new file mode 100755 index 0000000..5cd7c15 --- /dev/null +++ b/scripts/mock @@ -0,0 +1,52 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +if [[ -n "$1" && "$1" != '--'* ]]; then + URL="$1" + shift +else + URL="$(grep 'openapi_spec_url' .stats.yml | cut -d' ' -f2)" +fi + +# Check if the URL is empty +if [ -z "$URL" ]; then + echo "Error: No OpenAPI spec path/url provided or found in .stats.yml" + exit 1 +fi + +echo "==> Starting mock server with URL ${URL}" + +# Run steady mock on the given spec +if [ "$1" == "--daemon" ]; then + # Pre-install the package so the download doesn't eat into the startup timeout + npm exec --package=@stdy/cli@0.20.2 -- steady --version + + npm exec --package=@stdy/cli@0.20.2 -- steady --host 127.0.0.1 -p 4010 --validator-query-array-format=comma --validator-form-array-format=comma --validator-query-object-format=brackets --validator-form-object-format=brackets "$URL" &> .stdy.log & + + # Wait for server to come online via health endpoint (max 30s) + echo -n "Waiting for server" + attempts=0 + while ! curl --silent --fail "http://127.0.0.1:4010/_x-steady/health" >/dev/null 2>&1; do + if ! kill -0 $! 2>/dev/null; then + echo + cat .stdy.log + exit 1 + fi + attempts=$((attempts + 1)) + if [ "$attempts" -ge 300 ]; then + echo + echo "Timed out waiting for Steady server to start" + cat .stdy.log + exit 1 + fi + echo -n "." + sleep 0.1 + done + + echo +else + npm exec --package=@stdy/cli@0.20.2 -- steady --host 127.0.0.1 -p 4010 --validator-query-array-format=comma --validator-form-array-format=comma --validator-query-object-format=brackets --validator-form-object-format=brackets "$URL" +fi diff --git a/scripts/test b/scripts/test new file mode 100755 index 0000000..b8143aa --- /dev/null +++ b/scripts/test @@ -0,0 +1,61 @@ +#!/usr/bin/env bash + +set -e + +cd "$(dirname "$0")/.." + +RED='\033[0;31m' +GREEN='\033[0;32m' +YELLOW='\033[0;33m' +NC='\033[0m' # No Color + +function steady_is_running() { + curl --silent "http://127.0.0.1:4010/_x-steady/health" >/dev/null 2>&1 +} + +kill_server_on_port() { + pids=$(lsof -t -i tcp:"$1" || echo "") + if [ "$pids" != "" ]; then + kill "$pids" + echo "Stopped $pids." + fi +} + +function is_overriding_api_base_url() { + [ -n "$TEST_API_BASE_URL" ] +} + +if ! is_overriding_api_base_url && ! steady_is_running ; then + # When we exit this script, make sure to kill the background mock server process + trap 'kill_server_on_port 4010' EXIT + + # Start the dev server + ./scripts/mock --daemon +fi + +if is_overriding_api_base_url ; then + echo -e "${GREEN}✔ Running tests against ${TEST_API_BASE_URL}${NC}" + echo +elif ! steady_is_running ; then + echo -e "${RED}ERROR:${NC} The test suite will not run without a mock Steady server" + echo -e "running against your OpenAPI spec." + echo + echo -e "To run the server, pass in the path or url of your OpenAPI" + echo -e "spec to the steady command:" + echo + echo -e " \$ ${YELLOW}npm exec --package=@stdy/cli@0.20.2 -- steady path/to/your.openapi.yml --host 127.0.0.1 -p 4010 --validator-query-array-format=comma --validator-form-array-format=comma --validator-query-object-format=brackets --validator-form-object-format=brackets${NC}" + echo + + exit 1 +else + echo -e "${GREEN}✔ Mock steady server is running with your OpenAPI spec${NC}" + echo +fi + +export DEFER_PYDANTIC_BUILD=false + +echo "==> Running tests" +rye run pytest "$@" + +echo "==> Running Pydantic v1 tests" +rye run nox -s test-pydantic-v1 -- "$@" diff --git a/scripts/utils/ruffen-docs.py b/scripts/utils/ruffen-docs.py new file mode 100644 index 0000000..0cf2bd2 --- /dev/null +++ b/scripts/utils/ruffen-docs.py @@ -0,0 +1,167 @@ +# fork of https://github.com/asottile/blacken-docs adapted for ruff +from __future__ import annotations + +import re +import sys +import argparse +import textwrap +import contextlib +import subprocess +from typing import Match, Optional, Sequence, Generator, NamedTuple, cast + +MD_RE = re.compile( + r"(?P^(?P *)```\s*python\n)" r"(?P.*?)" r"(?P^(?P=indent)```\s*$)", + re.DOTALL | re.MULTILINE, +) +MD_PYCON_RE = re.compile( + r"(?P^(?P *)```\s*pycon\n)" r"(?P.*?)" r"(?P^(?P=indent)```.*$)", + re.DOTALL | re.MULTILINE, +) +PYCON_PREFIX = ">>> " +PYCON_CONTINUATION_PREFIX = "..." +PYCON_CONTINUATION_RE = re.compile( + rf"^{re.escape(PYCON_CONTINUATION_PREFIX)}( |$)", +) +DEFAULT_LINE_LENGTH = 100 + + +class CodeBlockError(NamedTuple): + offset: int + exc: Exception + + +def format_str( + src: str, +) -> tuple[str, Sequence[CodeBlockError]]: + errors: list[CodeBlockError] = [] + + @contextlib.contextmanager + def _collect_error(match: Match[str]) -> Generator[None, None, None]: + try: + yield + except Exception as e: + errors.append(CodeBlockError(match.start(), e)) + + def _md_match(match: Match[str]) -> str: + code = textwrap.dedent(match["code"]) + with _collect_error(match): + code = format_code_block(code) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + def _pycon_match(match: Match[str]) -> str: + code = "" + fragment = cast(Optional[str], None) + + def finish_fragment() -> None: + nonlocal code + nonlocal fragment + + if fragment is not None: + with _collect_error(match): + fragment = format_code_block(fragment) + fragment_lines = fragment.splitlines() + code += f"{PYCON_PREFIX}{fragment_lines[0]}\n" + for line in fragment_lines[1:]: + # Skip blank lines to handle Black adding a blank above + # functions within blocks. A blank line would end the REPL + # continuation prompt. + # + # >>> if True: + # ... def f(): + # ... pass + # ... + if line: + code += f"{PYCON_CONTINUATION_PREFIX} {line}\n" + if fragment_lines[-1].startswith(" "): + code += f"{PYCON_CONTINUATION_PREFIX}\n" + fragment = None + + indentation = None + for line in match["code"].splitlines(): + orig_line, line = line, line.lstrip() + if indentation is None and line: + indentation = len(orig_line) - len(line) + continuation_match = PYCON_CONTINUATION_RE.match(line) + if continuation_match and fragment is not None: + fragment += line[continuation_match.end() :] + "\n" + else: + finish_fragment() + if line.startswith(PYCON_PREFIX): + fragment = line[len(PYCON_PREFIX) :] + "\n" + else: + code += orig_line[indentation:] + "\n" + finish_fragment() + return code + + def _md_pycon_match(match: Match[str]) -> str: + code = _pycon_match(match) + code = textwrap.indent(code, match["indent"]) + return f"{match['before']}{code}{match['after']}" + + src = MD_RE.sub(_md_match, src) + src = MD_PYCON_RE.sub(_md_pycon_match, src) + return src, errors + + +def format_code_block(code: str) -> str: + return subprocess.check_output( + [ + sys.executable, + "-m", + "ruff", + "format", + "--stdin-filename=script.py", + f"--line-length={DEFAULT_LINE_LENGTH}", + ], + encoding="utf-8", + input=code, + ) + + +def format_file( + filename: str, + skip_errors: bool, +) -> int: + with open(filename, encoding="UTF-8") as f: + contents = f.read() + new_contents, errors = format_str(contents) + for error in errors: + lineno = contents[: error.offset].count("\n") + 1 + print(f"{filename}:{lineno}: code block parse error {error.exc}") + if errors and not skip_errors: + return 1 + if contents != new_contents: + print(f"{filename}: Rewriting...") + with open(filename, "w", encoding="UTF-8") as f: + f.write(new_contents) + return 0 + else: + return 0 + + +def main(argv: Sequence[str] | None = None) -> int: + parser = argparse.ArgumentParser() + parser.add_argument( + "-l", + "--line-length", + type=int, + default=DEFAULT_LINE_LENGTH, + ) + parser.add_argument( + "-S", + "--skip-string-normalization", + action="store_true", + ) + parser.add_argument("-E", "--skip-errors", action="store_true") + parser.add_argument("filenames", nargs="*") + args = parser.parse_args(argv) + + retv = 0 + for filename in args.filenames: + retv |= format_file(filename, skip_errors=args.skip_errors) + return retv + + +if __name__ == "__main__": + raise SystemExit(main()) diff --git a/scripts/utils/upload-artifact.sh b/scripts/utils/upload-artifact.sh new file mode 100755 index 0000000..f3f256b --- /dev/null +++ b/scripts/utils/upload-artifact.sh @@ -0,0 +1,27 @@ +#!/usr/bin/env bash +set -exuo pipefail + +FILENAME=$(basename dist/*.whl) + +RESPONSE=$(curl -X POST "$URL?filename=$FILENAME" \ + -H "Authorization: Bearer $AUTH" \ + -H "Content-Type: application/json") + +SIGNED_URL=$(echo "$RESPONSE" | jq -r '.url') + +if [[ "$SIGNED_URL" == "null" ]]; then + echo -e "\033[31mFailed to get signed URL.\033[0m" + exit 1 +fi + +UPLOAD_RESPONSE=$(curl -v -X PUT \ + -H "Content-Type: binary/octet-stream" \ + --data-binary "@dist/$FILENAME" "$SIGNED_URL" 2>&1) + +if echo "$UPLOAD_RESPONSE" | grep -q "HTTP/[0-9.]* 200"; then + echo -e "\033[32mUploaded build to Stainless storage.\033[0m" + echo -e "\033[32mInstallation: pip install 'https://pkg.stainless.com/s/parallel-sdk-python/$SHA/$FILENAME'\033[0m" +else + echo -e "\033[31mFailed to upload artifact.\033[0m" + exit 1 +fi diff --git a/src/parallel/__init__.py b/src/parallel/__init__.py new file mode 100644 index 0000000..6c3a982 --- /dev/null +++ b/src/parallel/__init__.py @@ -0,0 +1,102 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import typing as _t + +from . import types +from ._types import NOT_GIVEN, Omit, NoneType, NotGiven, Transport, ProxiesTypes, omit, not_given +from ._utils import file_from_path +from ._client import ( + Client, + Stream, + Timeout, + Parallel, + Transport, + AsyncClient, + AsyncStream, + AsyncParallel, + RequestOptions, +) +from ._models import BaseModel +from ._version import __title__, __version__ +from ._response import APIResponse as APIResponse, AsyncAPIResponse as AsyncAPIResponse +from ._constants import DEFAULT_TIMEOUT, DEFAULT_MAX_RETRIES, DEFAULT_CONNECTION_LIMITS +from ._exceptions import ( + APIError, + ConflictError, + NotFoundError, + ParallelError, + APIStatusError, + RateLimitError, + APITimeoutError, + BadRequestError, + APIConnectionError, + AuthenticationError, + InternalServerError, + PermissionDeniedError, + UnprocessableEntityError, + APIResponseValidationError, +) +from ._base_client import DefaultHttpxClient, DefaultAioHttpClient, DefaultAsyncHttpxClient +from ._utils._logs import setup_logging as _setup_logging + +__all__ = [ + "types", + "__version__", + "__title__", + "NoneType", + "Transport", + "ProxiesTypes", + "NotGiven", + "NOT_GIVEN", + "not_given", + "Omit", + "omit", + "ParallelError", + "APIError", + "APIStatusError", + "APITimeoutError", + "APIConnectionError", + "APIResponseValidationError", + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", + "Timeout", + "RequestOptions", + "Client", + "AsyncClient", + "Stream", + "AsyncStream", + "Parallel", + "AsyncParallel", + "file_from_path", + "BaseModel", + "DEFAULT_TIMEOUT", + "DEFAULT_MAX_RETRIES", + "DEFAULT_CONNECTION_LIMITS", + "DefaultHttpxClient", + "DefaultAsyncHttpxClient", + "DefaultAioHttpClient", +] + +if not _t.TYPE_CHECKING: + from ._utils._resources_proxy import resources as resources + +_setup_logging() + +# Update the __module__ attribute for exported symbols so that +# error messages point to this module instead of the module +# it was originally defined in, e.g. +# parallel._exceptions.NotFoundError -> parallel.NotFoundError +__locals = locals() +for __name in __all__: + if not __name.startswith("__"): + try: + __locals[__name].__module__ = "parallel" + except (TypeError, AttributeError): + # Some of our exported symbols are builtins which we can't set attributes for. + pass diff --git a/src/parallel/_base_client.py b/src/parallel/_base_client.py new file mode 100644 index 0000000..b283b92 --- /dev/null +++ b/src/parallel/_base_client.py @@ -0,0 +1,2131 @@ +from __future__ import annotations + +import sys +import json +import time +import uuid +import email +import asyncio +import inspect +import logging +import platform +import warnings +import email.utils +from types import TracebackType +from random import random +from typing import ( + TYPE_CHECKING, + Any, + Dict, + Type, + Union, + Generic, + Mapping, + TypeVar, + Iterable, + Iterator, + Optional, + Generator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Literal, override, get_origin + +import anyio +import httpx +import distro +import pydantic +from httpx import URL +from pydantic import PrivateAttr + +from . import _exceptions +from ._qs import Querystring +from ._files import to_httpx_files, async_to_httpx_files +from ._types import ( + Body, + Omit, + Query, + Headers, + Timeout, + NotGiven, + ResponseT, + AnyMapping, + PostParser, + BinaryTypes, + RequestFiles, + HttpxSendArgs, + RequestOptions, + AsyncBinaryTypes, + HttpxRequestFiles, + ModelBuilderProtocol, + not_given, +) +from ._utils import is_dict, is_list, asyncify, is_given, lru_cache, is_mapping +from ._compat import PYDANTIC_V1, model_copy, model_dump +from ._models import GenericModel, FinalRequestOptions, validate_type, construct_type +from ._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + extract_response_type, +) +from ._constants import ( + DEFAULT_TIMEOUT, + MAX_RETRY_DELAY, + DEFAULT_MAX_RETRIES, + INITIAL_RETRY_DELAY, + RAW_RESPONSE_HEADER, + OVERRIDE_CAST_TO_HEADER, + DEFAULT_CONNECTION_LIMITS, +) +from ._streaming import Stream, SSEDecoder, AsyncStream, SSEBytesDecoder +from ._exceptions import ( + APIStatusError, + APITimeoutError, + APIConnectionError, + APIResponseValidationError, +) +from ._utils._json import openapi_dumps + +log: logging.Logger = logging.getLogger(__name__) + +# TODO: make base page type vars covariant +SyncPageT = TypeVar("SyncPageT", bound="BaseSyncPage[Any]") +AsyncPageT = TypeVar("AsyncPageT", bound="BaseAsyncPage[Any]") + + +_T = TypeVar("_T") +_T_co = TypeVar("_T_co", covariant=True) + +_StreamT = TypeVar("_StreamT", bound=Stream[Any]) +_AsyncStreamT = TypeVar("_AsyncStreamT", bound=AsyncStream[Any]) + +if TYPE_CHECKING: + from httpx._config import ( + DEFAULT_TIMEOUT_CONFIG, # pyright: ignore[reportPrivateImportUsage] + ) + + HTTPX_DEFAULT_TIMEOUT = DEFAULT_TIMEOUT_CONFIG +else: + try: + from httpx._config import DEFAULT_TIMEOUT_CONFIG as HTTPX_DEFAULT_TIMEOUT + except ImportError: + # taken from https://github.com/encode/httpx/blob/3ba5fe0d7ac70222590e759c31442b1cab263791/httpx/_config.py#L366 + HTTPX_DEFAULT_TIMEOUT = Timeout(5.0) + + +class PageInfo: + """Stores the necessary information to build the request to retrieve the next page. + + Either `url` or `params` must be set. + """ + + url: URL | NotGiven + params: Query | NotGiven + json: Body | NotGiven + + @overload + def __init__( + self, + *, + url: URL, + ) -> None: ... + + @overload + def __init__( + self, + *, + params: Query, + ) -> None: ... + + @overload + def __init__( + self, + *, + json: Body, + ) -> None: ... + + def __init__( + self, + *, + url: URL | NotGiven = not_given, + json: Body | NotGiven = not_given, + params: Query | NotGiven = not_given, + ) -> None: + self.url = url + self.json = json + self.params = params + + @override + def __repr__(self) -> str: + if self.url: + return f"{self.__class__.__name__}(url={self.url})" + if self.json: + return f"{self.__class__.__name__}(json={self.json})" + return f"{self.__class__.__name__}(params={self.params})" + + +class BasePage(GenericModel, Generic[_T]): + """ + Defines the core interface for pagination. + + Type Args: + ModelT: The pydantic model that represents an item in the response. + + Methods: + has_next_page(): Check if there is another page available + next_page_info(): Get the necessary information to make a request for the next page + """ + + _options: FinalRequestOptions = PrivateAttr() + _model: Type[_T] = PrivateAttr() + + def has_next_page(self) -> bool: + items = self._get_page_items() + if not items: + return False + return self.next_page_info() is not None + + def next_page_info(self) -> Optional[PageInfo]: ... + + def _get_page_items(self) -> Iterable[_T]: # type: ignore[empty-body] + ... + + def _params_from_url(self, url: URL) -> httpx.QueryParams: + # TODO: do we have to preprocess params here? + return httpx.QueryParams(cast(Any, self._options.params)).merge(url.params) + + def _info_to_options(self, info: PageInfo) -> FinalRequestOptions: + options = model_copy(self._options) + options._strip_raw_response_header() + + if not isinstance(info.params, NotGiven): + options.params = {**options.params, **info.params} + return options + + if not isinstance(info.url, NotGiven): + params = self._params_from_url(info.url) + url = info.url.copy_with(params=params) + options.params = dict(url.params) + options.url = str(url) + return options + + if not isinstance(info.json, NotGiven): + if not is_mapping(info.json): + raise TypeError("Pagination is only supported with mappings") + + if not options.json_data: + options.json_data = {**info.json} + else: + if not is_mapping(options.json_data): + raise TypeError("Pagination is only supported with mappings") + + options.json_data = {**options.json_data, **info.json} + return options + + raise ValueError("Unexpected PageInfo state") + + +class BaseSyncPage(BasePage[_T], Generic[_T]): + _client: SyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + client: SyncAPIClient, + model: Type[_T], + options: FinalRequestOptions, + ) -> None: + if (not PYDANTIC_V1) and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + # Pydantic uses a custom `__iter__` method to support casting BaseModels + # to dictionaries. e.g. dict(model). + # As we want to support `for item in page`, this is inherently incompatible + # with the default pydantic behaviour. It is not possible to support both + # use cases at once. Fortunately, this is not a big deal as all other pydantic + # methods should continue to work as expected as there is an alternative method + # to cast a model to a dictionary, model.dict(), which is used internally + # by pydantic. + def __iter__(self) -> Iterator[_T]: # type: ignore + for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + def iter_pages(self: SyncPageT) -> Iterator[SyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = page.get_next_page() + else: + return + + def get_next_page(self: SyncPageT) -> SyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return self._client._request_api_list(self._model, page=self.__class__, options=options) + + +class AsyncPaginator(Generic[_T, AsyncPageT]): + def __init__( + self, + client: AsyncAPIClient, + options: FinalRequestOptions, + page_cls: Type[AsyncPageT], + model: Type[_T], + ) -> None: + self._model = model + self._client = client + self._options = options + self._page_cls = page_cls + + def __await__(self) -> Generator[Any, None, AsyncPageT]: + return self._get_page().__await__() + + async def _get_page(self) -> AsyncPageT: + def _parser(resp: AsyncPageT) -> AsyncPageT: + resp._set_private_attributes( + model=self._model, + options=self._options, + client=self._client, + ) + return resp + + self._options.post_parser = _parser + + return await self._client.request(self._page_cls, self._options) + + async def __aiter__(self) -> AsyncIterator[_T]: + # https://github.com/microsoft/pyright/issues/3464 + page = cast( + AsyncPageT, + await self, # type: ignore + ) + async for item in page: + yield item + + +class BaseAsyncPage(BasePage[_T], Generic[_T]): + _client: AsyncAPIClient = pydantic.PrivateAttr() + + def _set_private_attributes( + self, + model: Type[_T], + client: AsyncAPIClient, + options: FinalRequestOptions, + ) -> None: + if (not PYDANTIC_V1) and getattr(self, "__pydantic_private__", None) is None: + self.__pydantic_private__ = {} + + self._model = model + self._client = client + self._options = options + + async def __aiter__(self) -> AsyncIterator[_T]: + async for page in self.iter_pages(): + for item in page._get_page_items(): + yield item + + async def iter_pages(self: AsyncPageT) -> AsyncIterator[AsyncPageT]: + page = self + while True: + yield page + if page.has_next_page(): + page = await page.get_next_page() + else: + return + + async def get_next_page(self: AsyncPageT) -> AsyncPageT: + info = self.next_page_info() + if not info: + raise RuntimeError( + "No next page expected; please check `.has_next_page()` before calling `.get_next_page()`." + ) + + options = self._info_to_options(info) + return await self._client._request_api_list(self._model, page=self.__class__, options=options) + + +_HttpxClientT = TypeVar("_HttpxClientT", bound=Union[httpx.Client, httpx.AsyncClient]) +_DefaultStreamT = TypeVar("_DefaultStreamT", bound=Union[Stream[Any], AsyncStream[Any]]) + + +class BaseClient(Generic[_HttpxClientT, _DefaultStreamT]): + _client: _HttpxClientT + _version: str + _base_url: URL + max_retries: int + timeout: Union[float, Timeout, None] + _strict_response_validation: bool + _idempotency_header: str | None + _default_stream_cls: type[_DefaultStreamT] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None = DEFAULT_TIMEOUT, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + self._version = version + self._base_url = self._enforce_trailing_slash(URL(base_url)) + self.max_retries = max_retries + self.timeout = timeout + self._custom_headers = custom_headers or {} + self._custom_query = custom_query or {} + self._strict_response_validation = _strict_response_validation + self._idempotency_header = None + self._platform: Platform | None = None + + if max_retries is None: # pyright: ignore[reportUnnecessaryComparison] + raise TypeError( + "max_retries cannot be None. If you want to disable retries, pass `0`; if you want unlimited retries, pass `math.inf` or a very high number; if you want the default behavior, pass `parallel.DEFAULT_MAX_RETRIES`" + ) + + def _enforce_trailing_slash(self, url: URL) -> URL: + if url.raw_path.endswith(b"/"): + return url + return url.copy_with(raw_path=url.raw_path + b"/") + + def _make_status_error_from_response( + self, + response: httpx.Response, + ) -> APIStatusError: + if response.is_closed and not response.is_stream_consumed: + # We can't read the response body as it has been closed + # before it was read. This can happen if an event hook + # raises a status error. + body = None + err_msg = f"Error code: {response.status_code}" + else: + err_text = response.text.strip() + body = err_text + + try: + body = json.loads(err_text) + err_msg = f"Error code: {response.status_code} - {body}" + except Exception: + err_msg = err_text or f"Error code: {response.status_code}" + + return self._make_status_error(err_msg, body=body, response=response) + + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> _exceptions.APIStatusError: + raise NotImplementedError() + + def _build_headers(self, options: FinalRequestOptions, *, retries_taken: int = 0) -> httpx.Headers: + custom_headers = options.headers or {} + headers_dict = _merge_mappings(self.default_headers, custom_headers) + self._validate_headers(headers_dict, custom_headers) + + # headers are case-insensitive while dictionaries are not. + headers = httpx.Headers(headers_dict) + + idempotency_header = self._idempotency_header + if idempotency_header and options.idempotency_key and idempotency_header not in headers: + headers[idempotency_header] = options.idempotency_key + + # Don't set these headers if they were already set or removed by the caller. We check + # `custom_headers`, which can contain `Omit()`, instead of `headers` to account for the removal case. + lower_custom_headers = [header.lower() for header in custom_headers] + if "x-stainless-retry-count" not in lower_custom_headers: + headers["x-stainless-retry-count"] = str(retries_taken) + if "x-stainless-read-timeout" not in lower_custom_headers: + timeout = self.timeout if isinstance(options.timeout, NotGiven) else options.timeout + if isinstance(timeout, Timeout): + timeout = timeout.read + if timeout is not None: + headers["x-stainless-read-timeout"] = str(timeout) + + return headers + + def _prepare_url(self, url: str) -> URL: + """ + Merge a URL argument together with any 'base_url' on the client, + to create the URL used for the outgoing request. + """ + # Copied from httpx's `_merge_url` method. + merge_url = URL(url) + if merge_url.is_relative_url: + merge_raw_path = self.base_url.raw_path + merge_url.raw_path.lstrip(b"/") + return self.base_url.copy_with(raw_path=merge_raw_path) + + return merge_url + + def _make_sse_decoder(self) -> SSEDecoder | SSEBytesDecoder: + return SSEDecoder() + + def _build_request( + self, + options: FinalRequestOptions, + *, + retries_taken: int = 0, + ) -> httpx.Request: + if log.isEnabledFor(logging.DEBUG): + log.debug( + "Request options: %s", + model_dump( + options, + exclude_unset=True, + # Pydantic v1 can't dump every type we support in content, so we exclude it for now. + exclude={ + "content", + } + if PYDANTIC_V1 + else {}, + ), + ) + kwargs: dict[str, Any] = {} + + json_data = options.json_data + if options.extra_json is not None: + if json_data is None: + json_data = cast(Body, options.extra_json) + elif is_mapping(json_data): + json_data = _merge_mappings(json_data, options.extra_json) + else: + raise RuntimeError(f"Unexpected JSON data type, {type(json_data)}, cannot merge with `extra_body`") + + headers = self._build_headers(options, retries_taken=retries_taken) + params = _merge_mappings(self.default_query, options.params) + content_type = headers.get("Content-Type") + files = options.files + + # If the given Content-Type header is multipart/form-data then it + # has to be removed so that httpx can generate the header with + # additional information for us as it has to be in this form + # for the server to be able to correctly parse the request: + # multipart/form-data; boundary=---abc-- + if content_type is not None and content_type.startswith("multipart/form-data"): + if "boundary" not in content_type: + # only remove the header if the boundary hasn't been explicitly set + # as the caller doesn't want httpx to come up with their own boundary + headers.pop("Content-Type") + + # As we are now sending multipart/form-data instead of application/json + # we need to tell httpx to use it, https://www.python-httpx.org/advanced/clients/#multipart-file-encoding + if json_data: + if not is_dict(json_data): + raise TypeError( + f"Expected query input to be a dictionary for multipart requests but got {type(json_data)} instead." + ) + kwargs["data"] = self._serialize_multipartform(json_data) + + # httpx determines whether or not to send a "multipart/form-data" + # request based on the truthiness of the "files" argument. + # This gets around that issue by generating a dict value that + # evaluates to true. + # + # https://github.com/encode/httpx/discussions/2399#discussioncomment-3814186 + if not files: + files = cast(HttpxRequestFiles, ForceMultipartDict()) + + prepared_url = self._prepare_url(options.url) + # preserve hard-coded query params from the url + if params and prepared_url.query: + params = {**dict(prepared_url.params.items()), **params} + prepared_url = prepared_url.copy_with(raw_path=prepared_url.raw_path.split(b"?", 1)[0]) + if "_" in prepared_url.host: + # work around https://github.com/encode/httpx/discussions/2880 + kwargs["extensions"] = {"sni_hostname": prepared_url.host.replace("_", "-")} + + is_body_allowed = options.method.lower() != "get" + + if is_body_allowed: + if options.content is not None and json_data is not None: + raise TypeError("Passing both `content` and `json_data` is not supported") + if options.content is not None and files is not None: + raise TypeError("Passing both `content` and `files` is not supported") + if options.content is not None: + kwargs["content"] = options.content + elif isinstance(json_data, bytes): + kwargs["content"] = json_data + elif not files: + # Don't set content when JSON is sent as multipart/form-data, + # since httpx's content param overrides other body arguments + kwargs["content"] = openapi_dumps(json_data) if is_given(json_data) and json_data is not None else None + kwargs["files"] = files + else: + headers.pop("Content-Type", None) + kwargs.pop("data", None) + + # TODO: report this error to httpx + return self._client.build_request( # pyright: ignore[reportUnknownMemberType] + headers=headers, + timeout=self.timeout if isinstance(options.timeout, NotGiven) else options.timeout, + method=options.method, + url=prepared_url, + # the `Query` type that we use is incompatible with qs' + # `Params` type as it needs to be typed as `Mapping[str, object]` + # so that passing a `TypedDict` doesn't cause an error. + # https://github.com/microsoft/pyright/issues/3526#event-6715453066 + params=self.qs.stringify(cast(Mapping[str, Any], params)) if params else None, + **kwargs, + ) + + def _serialize_multipartform(self, data: Mapping[object, object]) -> dict[str, object]: + items = self.qs.stringify_items( + # TODO: type ignore is required as stringify_items is well typed but we can't be + # well typed without heavy validation. + data, # type: ignore + array_format="brackets", + ) + serialized: dict[str, object] = {} + for key, value in items: + existing = serialized.get(key) + + if not existing: + serialized[key] = value + continue + + # If a value has already been set for this key then that + # means we're sending data like `array[]=[1, 2, 3]` and we + # need to tell httpx that we want to send multiple values with + # the same key which is done by using a list or a tuple. + # + # Note: 2d arrays should never result in the same key at both + # levels so it's safe to assume that if the value is a list, + # it was because we changed it to be a list. + if is_list(existing): + existing.append(value) + else: + serialized[key] = [existing, value] + + return serialized + + def _maybe_override_cast_to(self, cast_to: type[ResponseT], options: FinalRequestOptions) -> type[ResponseT]: + if not is_given(options.headers): + return cast_to + + # make a copy of the headers so we don't mutate user-input + headers = dict(options.headers) + + # we internally support defining a temporary header to override the + # default `cast_to` type for use with `.with_raw_response` and `.with_streaming_response` + # see _response.py for implementation details + override_cast_to = headers.pop(OVERRIDE_CAST_TO_HEADER, not_given) + if is_given(override_cast_to): + options.headers = headers + return cast(Type[ResponseT], override_cast_to) + + return cast_to + + def _should_stream_response_body(self, request: httpx.Request) -> bool: + return request.headers.get(RAW_RESPONSE_HEADER) == "stream" # type: ignore[no-any-return] + + def _process_response_data( + self, + *, + data: object, + cast_to: type[ResponseT], + response: httpx.Response, + ) -> ResponseT: + if data is None: + return cast(ResponseT, None) + + if cast_to is object: + return cast(ResponseT, data) + + try: + if inspect.isclass(cast_to) and issubclass(cast_to, ModelBuilderProtocol): + return cast(ResponseT, cast_to.build(response=response, data=data)) + + if self._strict_response_validation: + return cast(ResponseT, validate_type(type_=cast_to, value=data)) + + return cast(ResponseT, construct_type(type_=cast_to, value=data)) + except pydantic.ValidationError as err: + raise APIResponseValidationError(response=response, body=data) from err + + @property + def qs(self) -> Querystring: + return Querystring() + + @property + def custom_auth(self) -> httpx.Auth | None: + return None + + @property + def auth_headers(self) -> dict[str, str]: + return {} + + @property + def default_headers(self) -> dict[str, str | Omit]: + return { + "Accept": "application/json", + "Content-Type": "application/json", + "User-Agent": self.user_agent, + **self.platform_headers(), + **self.auth_headers, + **self._custom_headers, + } + + @property + def default_query(self) -> dict[str, object]: + return { + **self._custom_query, + } + + def _validate_headers( + self, + headers: Headers, # noqa: ARG002 + custom_headers: Headers, # noqa: ARG002 + ) -> None: + """Validate the given default headers and custom headers. + + Does nothing by default. + """ + return + + @property + def user_agent(self) -> str: + return f"{self.__class__.__name__}/Python {self._version}" + + @property + def base_url(self) -> URL: + return self._base_url + + @base_url.setter + def base_url(self, url: URL | str) -> None: + self._base_url = self._enforce_trailing_slash(url if isinstance(url, URL) else URL(url)) + + def platform_headers(self) -> Dict[str, str]: + # the actual implementation is in a separate `lru_cache` decorated + # function because adding `lru_cache` to methods will leak memory + # https://github.com/python/cpython/issues/88476 + return platform_headers(self._version, platform=self._platform) + + def _parse_retry_after_header(self, response_headers: Optional[httpx.Headers] = None) -> float | None: + """Returns a float of the number of seconds (not milliseconds) to wait after retrying, or None if unspecified. + + About the Retry-After header: https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After + See also https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Retry-After#syntax + """ + if response_headers is None: + return None + + # First, try the non-standard `retry-after-ms` header for milliseconds, + # which is more precise than integer-seconds `retry-after` + try: + retry_ms_header = response_headers.get("retry-after-ms", None) + return float(retry_ms_header) / 1000 + except (TypeError, ValueError): + pass + + # Next, try parsing `retry-after` header as seconds (allowing nonstandard floats). + retry_header = response_headers.get("retry-after") + try: + # note: the spec indicates that this should only ever be an integer + # but if someone sends a float there's no reason for us to not respect it + return float(retry_header) + except (TypeError, ValueError): + pass + + # Last, try parsing `retry-after` as a date. + retry_date_tuple = email.utils.parsedate_tz(retry_header) + if retry_date_tuple is None: + return None + + retry_date = email.utils.mktime_tz(retry_date_tuple) + return float(retry_date - time.time()) + + def _calculate_retry_timeout( + self, + remaining_retries: int, + options: FinalRequestOptions, + response_headers: Optional[httpx.Headers] = None, + ) -> float: + max_retries = options.get_max_retries(self.max_retries) + + # If the API asks us to wait a certain amount of time (and it's a reasonable amount), just do what it says. + retry_after = self._parse_retry_after_header(response_headers) + if retry_after is not None and 0 < retry_after <= 60: + return retry_after + + # Also cap retry count to 1000 to avoid any potential overflows with `pow` + nb_retries = min(max_retries - remaining_retries, 1000) + + # Apply exponential backoff, but not more than the max. + sleep_seconds = min(INITIAL_RETRY_DELAY * pow(2.0, nb_retries), MAX_RETRY_DELAY) + + # Apply some jitter, plus-or-minus half a second. + jitter = 1 - 0.25 * random() + timeout = sleep_seconds * jitter + return timeout if timeout >= 0 else 0 + + def _should_retry(self, response: httpx.Response) -> bool: + # Note: this is not a standard header + should_retry_header = response.headers.get("x-should-retry") + + # If the server explicitly says whether or not to retry, obey. + if should_retry_header == "true": + log.debug("Retrying as header `x-should-retry` is set to `true`") + return True + if should_retry_header == "false": + log.debug("Not retrying as header `x-should-retry` is set to `false`") + return False + + # Retry on request timeouts. + if response.status_code == 408: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on lock timeouts. + if response.status_code == 409: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry on rate limits. + if response.status_code == 429: + log.debug("Retrying due to status code %i", response.status_code) + return True + + # Retry internal errors. + if response.status_code >= 500: + log.debug("Retrying due to status code %i", response.status_code) + return True + + log.debug("Not retrying") + return False + + def _idempotency_key(self) -> str: + return f"stainless-python-retry-{uuid.uuid4()}" + + +class _DefaultHttpxClient(httpx.Client): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultHttpxClient = httpx.Client + """An alias to `httpx.Client` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.Client` will result in httpx's defaults being used, not ours. + """ +else: + DefaultHttpxClient = _DefaultHttpxClient + + +class SyncHttpxClientWrapper(DefaultHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + self.close() + except Exception: + pass + + +class SyncAPIClient(BaseClient[httpx.Client, Stream[Any]]): + _client: httpx.Client + _default_stream_cls: type[Stream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.Client | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + _strict_response_validation: bool, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.Client): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.Client` but got {type(http_client)}" + ) + + super().__init__( + version=version, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + base_url=base_url, + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or SyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + # If an error is thrown while constructing a client, self._client + # may not be present + if hasattr(self, "_client"): + self._client.close() + + def __enter__(self: _T) -> _T: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: Type[_StreamT], + ) -> _StreamT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: Type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + err.response.close() + self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + err.response.read() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + time.sleep(timeout) + + def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, APIResponse): + raise TypeError(f"API Response types must subclass {APIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + ResponseT, + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = APIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return api_response.parse() + + def _request_api_list( + self, + model: Type[object], + page: Type[SyncPageT], + options: FinalRequestOptions, + ) -> SyncPageT: + def _parser(resp: SyncPageT) -> SyncPageT: + resp._set_private_attributes( + client=self, + model=model, + options=options, + ) + return resp + + options.post_parser = _parser + + return self.request(page, options, stream=False) + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + # cast is required because mypy complains about returning Any even though + # it understands the type variables + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: Literal[True], + stream_cls: type[_StreamT], + ) -> _StreamT: ... + + @overload + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: ... + + def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + files: RequestFiles | None = None, + stream: bool = False, + stream_cls: type[_StreamT] | None = None, + ) -> ResponseT | _StreamT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, content=content, files=to_httpx_files(files), **options + ) + return cast(ResponseT, self.request(cast_to, opts, stream=stream, stream_cls=stream_cls)) + + def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="patch", url=path, json_data=body, content=content, files=to_httpx_files(files), **options + ) + return self.request(cast_to, opts) + + def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, content=content, files=to_httpx_files(files), **options + ) + return self.request(cast_to, opts) + + def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: BinaryTypes | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, content=content, **options) + return self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[object], + page: Type[SyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> SyncPageT: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +class _DefaultAsyncHttpxClient(httpx.AsyncClient): + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + super().__init__(**kwargs) + + +try: + import httpx_aiohttp +except ImportError: + + class _DefaultAioHttpClient(httpx.AsyncClient): + def __init__(self, **_kwargs: Any) -> None: + raise RuntimeError("To use the aiohttp client you must have installed the package with the `aiohttp` extra") +else: + + class _DefaultAioHttpClient(httpx_aiohttp.HttpxAiohttpClient): # type: ignore + def __init__(self, **kwargs: Any) -> None: + kwargs.setdefault("timeout", DEFAULT_TIMEOUT) + kwargs.setdefault("limits", DEFAULT_CONNECTION_LIMITS) + kwargs.setdefault("follow_redirects", True) + + super().__init__(**kwargs) + + +if TYPE_CHECKING: + DefaultAsyncHttpxClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that provides the same defaults that this SDK + uses internally. + + This is useful because overriding the `http_client` with your own instance of + `httpx.AsyncClient` will result in httpx's defaults being used, not ours. + """ + + DefaultAioHttpClient = httpx.AsyncClient + """An alias to `httpx.AsyncClient` that changes the default HTTP transport to `aiohttp`.""" +else: + DefaultAsyncHttpxClient = _DefaultAsyncHttpxClient + DefaultAioHttpClient = _DefaultAioHttpClient + + +class AsyncHttpxClientWrapper(DefaultAsyncHttpxClient): + def __del__(self) -> None: + if self.is_closed: + return + + try: + # TODO(someday): support non asyncio runtimes here + asyncio.get_running_loop().create_task(self.aclose()) + except Exception: + pass + + +class AsyncAPIClient(BaseClient[httpx.AsyncClient, AsyncStream[Any]]): + _client: httpx.AsyncClient + _default_stream_cls: type[AsyncStream[Any]] | None = None + + def __init__( + self, + *, + version: str, + base_url: str | URL, + _strict_response_validation: bool, + max_retries: int = DEFAULT_MAX_RETRIES, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.AsyncClient | None = None, + custom_headers: Mapping[str, str] | None = None, + custom_query: Mapping[str, object] | None = None, + ) -> None: + if not is_given(timeout): + # if the user passed in a custom http client with a non-default + # timeout set then we use that timeout. + # + # note: there is an edge case here where the user passes in a client + # where they've explicitly set the timeout to match the default timeout + # as this check is structural, meaning that we'll think they didn't + # pass in a timeout and will ignore it + if http_client and http_client.timeout != HTTPX_DEFAULT_TIMEOUT: + timeout = http_client.timeout + else: + timeout = DEFAULT_TIMEOUT + + if http_client is not None and not isinstance(http_client, httpx.AsyncClient): # pyright: ignore[reportUnnecessaryIsInstance] + raise TypeError( + f"Invalid `http_client` argument; Expected an instance of `httpx.AsyncClient` but got {type(http_client)}" + ) + + super().__init__( + version=version, + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + max_retries=max_retries, + custom_query=custom_query, + custom_headers=custom_headers, + _strict_response_validation=_strict_response_validation, + ) + self._client = http_client or AsyncHttpxClientWrapper( + base_url=base_url, + # cast to a valid type because mypy doesn't understand our type narrowing + timeout=cast(Timeout, timeout), + ) + + def is_closed(self) -> bool: + return self._client.is_closed + + async def close(self) -> None: + """Close the underlying HTTPX client. + + The client will *not* be usable after this. + """ + await self._client.aclose() + + async def __aenter__(self: _T) -> _T: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def _prepare_options( + self, + options: FinalRequestOptions, # noqa: ARG002 + ) -> FinalRequestOptions: + """Hook for mutating the given options""" + return options + + async def _prepare_request( + self, + request: httpx.Request, # noqa: ARG002 + ) -> None: + """This method is used as a callback for mutating the `Request` object + after it has been constructed. + This is useful for cases where you want to add certain headers based off of + the request properties, e.g. `url`, `method` etc. + """ + return None + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def request( + self, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + *, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + if self._platform is None: + # `get_platform` can make blocking IO calls so we + # execute it earlier while we are in an async context + self._platform = await asyncify(get_platform)() + + cast_to = self._maybe_override_cast_to(cast_to, options) + + # create a copy of the options we were given so that if the + # options are mutated later & we then retry, the retries are + # given the original options + input_options = model_copy(options) + if input_options.idempotency_key is None and input_options.method.lower() != "get": + # ensure the idempotency key is reused between requests + input_options.idempotency_key = self._idempotency_key() + + response: httpx.Response | None = None + max_retries = input_options.get_max_retries(self.max_retries) + + retries_taken = 0 + for retries_taken in range(max_retries + 1): + options = model_copy(input_options) + options = await self._prepare_options(options) + + remaining_retries = max_retries - retries_taken + request = self._build_request(options, retries_taken=retries_taken) + await self._prepare_request(request) + + kwargs: HttpxSendArgs = {} + if self.custom_auth is not None: + kwargs["auth"] = self.custom_auth + + if options.follow_redirects is not None: + kwargs["follow_redirects"] = options.follow_redirects + + log.debug("Sending HTTP Request: %s %s", request.method, request.url) + + response = None + try: + response = await self._client.send( + request, + stream=stream or self._should_stream_response_body(request=request), + **kwargs, + ) + except httpx.TimeoutException as err: + log.debug("Encountered httpx.TimeoutException", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising timeout error") + raise APITimeoutError(request=request) from err + except Exception as err: + log.debug("Encountered Exception", exc_info=True) + + if remaining_retries > 0: + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=None, + ) + continue + + log.debug("Raising connection error") + raise APIConnectionError(request=request) from err + + log.debug( + 'HTTP Response: %s %s "%i %s" %s', + request.method, + request.url, + response.status_code, + response.reason_phrase, + response.headers, + ) + + try: + response.raise_for_status() + except httpx.HTTPStatusError as err: # thrown on 4xx and 5xx status code + log.debug("Encountered httpx.HTTPStatusError", exc_info=True) + + if remaining_retries > 0 and self._should_retry(err.response): + await err.response.aclose() + await self._sleep_for_retry( + retries_taken=retries_taken, + max_retries=max_retries, + options=input_options, + response=response, + ) + continue + + # If the response is streamed then we need to explicitly read the response + # to completion before attempting to access the response text. + if not err.response.is_closed: + await err.response.aread() + + log.debug("Re-raising status error") + raise self._make_status_error_from_response(err.response) from None + + break + + assert response is not None, "could not resolve response (should never happen)" + return await self._process_response( + cast_to=cast_to, + options=options, + response=response, + stream=stream, + stream_cls=stream_cls, + retries_taken=retries_taken, + ) + + async def _sleep_for_retry( + self, *, retries_taken: int, max_retries: int, options: FinalRequestOptions, response: httpx.Response | None + ) -> None: + remaining_retries = max_retries - retries_taken + if remaining_retries == 1: + log.debug("1 retry left") + else: + log.debug("%i retries left", remaining_retries) + + timeout = self._calculate_retry_timeout(remaining_retries, options, response.headers if response else None) + log.info("Retrying request to %s in %f seconds", options.url, timeout) + + await anyio.sleep(timeout) + + async def _process_response( + self, + *, + cast_to: Type[ResponseT], + options: FinalRequestOptions, + response: httpx.Response, + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + retries_taken: int = 0, + ) -> ResponseT: + origin = get_origin(cast_to) or cast_to + + if ( + inspect.isclass(origin) + and issubclass(origin, BaseAPIResponse) + # we only want to actually return the custom BaseAPIResponse class if we're + # returning the raw response, or if we're not streaming SSE, as if we're streaming + # SSE then `cast_to` doesn't actively reflect the type we need to parse into + and (not stream or bool(response.request.headers.get(RAW_RESPONSE_HEADER))) + ): + if not issubclass(origin, AsyncAPIResponse): + raise TypeError(f"API Response types must subclass {AsyncAPIResponse}; Received {origin}") + + response_cls = cast("type[BaseAPIResponse[Any]]", cast_to) + return cast( + "ResponseT", + response_cls( + raw=response, + client=self, + cast_to=extract_response_type(response_cls), + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ), + ) + + if cast_to == httpx.Response: + return cast(ResponseT, response) + + api_response = AsyncAPIResponse( + raw=response, + client=self, + cast_to=cast("type[ResponseT]", cast_to), # pyright: ignore[reportUnnecessaryCast] + stream=stream, + stream_cls=stream_cls, + options=options, + retries_taken=retries_taken, + ) + if bool(response.request.headers.get(RAW_RESPONSE_HEADER)): + return cast(ResponseT, api_response) + + return await api_response.parse() + + def _request_api_list( + self, + model: Type[_T], + page: Type[AsyncPageT], + options: FinalRequestOptions, + ) -> AsyncPaginator[_T, AsyncPageT]: + return AsyncPaginator(client=self, options=options, page_cls=page, model=model) + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def get( + self, + path: str, + *, + cast_to: Type[ResponseT], + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + opts = FinalRequestOptions.construct(method="get", url=path, **options) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[False] = False, + ) -> ResponseT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: Literal[True], + stream_cls: type[_AsyncStreamT], + ) -> _AsyncStreamT: ... + + @overload + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: ... + + async def post( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + stream: bool = False, + stream_cls: type[_AsyncStreamT] | None = None, + ) -> ResponseT | _AsyncStreamT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="post", url=path, json_data=body, content=content, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts, stream=stream, stream_cls=stream_cls) + + async def patch( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="patch", + url=path, + json_data=body, + content=content, + files=await async_to_httpx_files(files), + **options, + ) + return await self.request(cast_to, opts) + + async def put( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + files: RequestFiles | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if files is not None and content is not None: + raise TypeError("Passing both `files` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct( + method="put", url=path, json_data=body, content=content, files=await async_to_httpx_files(files), **options + ) + return await self.request(cast_to, opts) + + async def delete( + self, + path: str, + *, + cast_to: Type[ResponseT], + body: Body | None = None, + content: AsyncBinaryTypes | None = None, + options: RequestOptions = {}, + ) -> ResponseT: + if body is not None and content is not None: + raise TypeError("Passing both `body` and `content` is not supported") + if isinstance(body, bytes): + warnings.warn( + "Passing raw bytes as `body` is deprecated and will be removed in a future version. " + "Please pass raw bytes via the `content` parameter instead.", + DeprecationWarning, + stacklevel=2, + ) + opts = FinalRequestOptions.construct(method="delete", url=path, json_data=body, content=content, **options) + return await self.request(cast_to, opts) + + def get_api_list( + self, + path: str, + *, + model: Type[_T], + page: Type[AsyncPageT], + body: Body | None = None, + options: RequestOptions = {}, + method: str = "get", + ) -> AsyncPaginator[_T, AsyncPageT]: + opts = FinalRequestOptions.construct(method=method, url=path, json_data=body, **options) + return self._request_api_list(model, page, opts) + + +def make_request_options( + *, + query: Query | None = None, + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + idempotency_key: str | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + post_parser: PostParser | NotGiven = not_given, +) -> RequestOptions: + """Create a dict of type RequestOptions without keys of NotGiven values.""" + options: RequestOptions = {} + if extra_headers is not None: + options["headers"] = extra_headers + + if extra_body is not None: + options["extra_json"] = cast(AnyMapping, extra_body) + + if query is not None: + options["params"] = query + + if extra_query is not None: + options["params"] = {**options.get("params", {}), **extra_query} + + if not isinstance(timeout, NotGiven): + options["timeout"] = timeout + + if idempotency_key is not None: + options["idempotency_key"] = idempotency_key + + if is_given(post_parser): + # internal + options["post_parser"] = post_parser # type: ignore + + return options + + +class ForceMultipartDict(Dict[str, None]): + def __bool__(self) -> bool: + return True + + +class OtherPlatform: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"Other:{self.name}" + + +Platform = Union[ + OtherPlatform, + Literal[ + "MacOS", + "Linux", + "Windows", + "FreeBSD", + "OpenBSD", + "iOS", + "Android", + "Unknown", + ], +] + + +def get_platform() -> Platform: + try: + system = platform.system().lower() + platform_name = platform.platform().lower() + except Exception: + return "Unknown" + + if "iphone" in platform_name or "ipad" in platform_name: + # Tested using Python3IDE on an iPhone 11 and Pythonista on an iPad 7 + # system is Darwin and platform_name is a string like: + # - Darwin-21.6.0-iPhone12,1-64bit + # - Darwin-21.6.0-iPad7,11-64bit + return "iOS" + + if system == "darwin": + return "MacOS" + + if system == "windows": + return "Windows" + + if "android" in platform_name: + # Tested using Pydroid 3 + # system is Linux and platform_name is a string like 'Linux-5.10.81-android12-9-00001-geba40aecb3b7-ab8534902-aarch64-with-libc' + return "Android" + + if system == "linux": + # https://distro.readthedocs.io/en/latest/#distro.id + distro_id = distro.id() + if distro_id == "freebsd": + return "FreeBSD" + + if distro_id == "openbsd": + return "OpenBSD" + + return "Linux" + + if platform_name: + return OtherPlatform(platform_name) + + return "Unknown" + + +@lru_cache(maxsize=None) +def platform_headers(version: str, *, platform: Platform | None) -> Dict[str, str]: + return { + "X-Stainless-Lang": "python", + "X-Stainless-Package-Version": version, + "X-Stainless-OS": str(platform or get_platform()), + "X-Stainless-Arch": str(get_architecture()), + "X-Stainless-Runtime": get_python_runtime(), + "X-Stainless-Runtime-Version": get_python_version(), + } + + +class OtherArch: + def __init__(self, name: str) -> None: + self.name = name + + @override + def __str__(self) -> str: + return f"other:{self.name}" + + +Arch = Union[OtherArch, Literal["x32", "x64", "arm", "arm64", "unknown"]] + + +def get_python_runtime() -> str: + try: + return platform.python_implementation() + except Exception: + return "unknown" + + +def get_python_version() -> str: + try: + return platform.python_version() + except Exception: + return "unknown" + + +def get_architecture() -> Arch: + try: + machine = platform.machine().lower() + except Exception: + return "unknown" + + if machine in ("arm64", "aarch64"): + return "arm64" + + # TODO: untested + if machine == "arm": + return "arm" + + if machine == "x86_64": + return "x64" + + # TODO: untested + if sys.maxsize <= 2**32: + return "x32" + + if machine: + return OtherArch(machine) + + return "unknown" + + +def _merge_mappings( + obj1: Mapping[_T_co, Union[_T, Omit]], + obj2: Mapping[_T_co, Union[_T, Omit]], +) -> Dict[_T_co, _T]: + """Merge two mappings of the same type, removing any values that are instances of `Omit`. + + In cases with duplicate keys the second mapping takes precedence. + """ + merged = {**obj1, **obj2} + return {key: value for key, value in merged.items() if not isinstance(value, Omit)} diff --git a/src/parallel/_client.py b/src/parallel/_client.py new file mode 100644 index 0000000..cf3f898 --- /dev/null +++ b/src/parallel/_client.py @@ -0,0 +1,518 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import TYPE_CHECKING, Any, Mapping +from typing_extensions import Self, override + +import httpx + +from . import _exceptions +from ._qs import Querystring +from ._types import ( + Omit, + Timeout, + NotGiven, + Transport, + ProxiesTypes, + RequestOptions, + not_given, +) +from ._utils import is_given, get_async_library +from ._compat import cached_property +from ._version import __version__ +from ._streaming import Stream as Stream, AsyncStream as AsyncStream +from ._exceptions import ParallelError, APIStatusError +from ._base_client import ( + DEFAULT_MAX_RETRIES, + SyncAPIClient, + AsyncAPIClient, +) + +if TYPE_CHECKING: + from .resources import beta, task_run + from .resources.task_run import TaskRunResource, AsyncTaskRunResource + from .resources.beta.beta import BetaResource, AsyncBetaResource + +__all__ = [ + "Timeout", + "Transport", + "ProxiesTypes", + "RequestOptions", + "Parallel", + "AsyncParallel", + "Client", + "AsyncClient", +] + + +class Parallel(SyncAPIClient): + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#client) for more details. + http_client: httpx.Client | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new synchronous Parallel client instance. + + This automatically infers the `api_key` argument from the `PARALLEL_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("PARALLEL_API_KEY") + if api_key is None: + raise ParallelError( + "The api_key client option must be set either by passing api_key to the client or by setting the PARALLEL_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("PARALLEL_BASE_URL") + if base_url is None: + base_url = f"https://api.parallel.ai" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + @cached_property + def task_run(self) -> TaskRunResource: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + from .resources.task_run import TaskRunResource + + return TaskRunResource(self) + + @cached_property + def beta(self) -> BetaResource: + from .resources.beta import BetaResource + + return BetaResource(self) + + @cached_property + def with_raw_response(self) -> ParallelWithRawResponse: + return ParallelWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> ParallelWithStreamedResponse: + return ParallelWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="comma") + + @property + @override + def auth_headers(self) -> dict[str, str]: + api_key = self.api_key + return {"x-api-key": api_key} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": "false", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.Client | None = None, + max_retries: int | NotGiven = not_given, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class AsyncParallel(AsyncAPIClient): + # client options + api_key: str + + def __init__( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + max_retries: int = DEFAULT_MAX_RETRIES, + default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + # Configure a custom httpx client. + # We provide a `DefaultAsyncHttpxClient` class that you can pass to retain the default values we use for `limits`, `timeout` & `follow_redirects`. + # See the [httpx documentation](https://www.python-httpx.org/api/#asyncclient) for more details. + http_client: httpx.AsyncClient | None = None, + # Enable or disable schema validation for data returned by the API. + # When enabled an error APIResponseValidationError is raised + # if the API responds with invalid data for the expected schema. + # + # This parameter may be removed or changed in the future. + # If you rely on this feature, please open a GitHub issue + # outlining your use-case to help us decide if it should be + # part of our public interface in the future. + _strict_response_validation: bool = False, + ) -> None: + """Construct a new async AsyncParallel client instance. + + This automatically infers the `api_key` argument from the `PARALLEL_API_KEY` environment variable if it is not provided. + """ + if api_key is None: + api_key = os.environ.get("PARALLEL_API_KEY") + if api_key is None: + raise ParallelError( + "The api_key client option must be set either by passing api_key to the client or by setting the PARALLEL_API_KEY environment variable" + ) + self.api_key = api_key + + if base_url is None: + base_url = os.environ.get("PARALLEL_BASE_URL") + if base_url is None: + base_url = f"https://api.parallel.ai" + + super().__init__( + version=__version__, + base_url=base_url, + max_retries=max_retries, + timeout=timeout, + http_client=http_client, + custom_headers=default_headers, + custom_query=default_query, + _strict_response_validation=_strict_response_validation, + ) + + @cached_property + def task_run(self) -> AsyncTaskRunResource: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + from .resources.task_run import AsyncTaskRunResource + + return AsyncTaskRunResource(self) + + @cached_property + def beta(self) -> AsyncBetaResource: + from .resources.beta import AsyncBetaResource + + return AsyncBetaResource(self) + + @cached_property + def with_raw_response(self) -> AsyncParallelWithRawResponse: + return AsyncParallelWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncParallelWithStreamedResponse: + return AsyncParallelWithStreamedResponse(self) + + @property + @override + def qs(self) -> Querystring: + return Querystring(array_format="comma") + + @property + @override + def auth_headers(self) -> dict[str, str]: + api_key = self.api_key + return {"x-api-key": api_key} + + @property + @override + def default_headers(self) -> dict[str, str | Omit]: + return { + **super().default_headers, + "X-Stainless-Async": f"async:{get_async_library()}", + **self._custom_headers, + } + + def copy( + self, + *, + api_key: str | None = None, + base_url: str | httpx.URL | None = None, + timeout: float | Timeout | None | NotGiven = not_given, + http_client: httpx.AsyncClient | None = None, + max_retries: int | NotGiven = not_given, + default_headers: Mapping[str, str] | None = None, + set_default_headers: Mapping[str, str] | None = None, + default_query: Mapping[str, object] | None = None, + set_default_query: Mapping[str, object] | None = None, + _extra_kwargs: Mapping[str, Any] = {}, + ) -> Self: + """ + Create a new client instance re-using the same options given to the current client with optional overriding. + """ + if default_headers is not None and set_default_headers is not None: + raise ValueError("The `default_headers` and `set_default_headers` arguments are mutually exclusive") + + if default_query is not None and set_default_query is not None: + raise ValueError("The `default_query` and `set_default_query` arguments are mutually exclusive") + + headers = self._custom_headers + if default_headers is not None: + headers = {**headers, **default_headers} + elif set_default_headers is not None: + headers = set_default_headers + + params = self._custom_query + if default_query is not None: + params = {**params, **default_query} + elif set_default_query is not None: + params = set_default_query + + http_client = http_client or self._client + return self.__class__( + api_key=api_key or self.api_key, + base_url=base_url or self.base_url, + timeout=self.timeout if isinstance(timeout, NotGiven) else timeout, + http_client=http_client, + max_retries=max_retries if is_given(max_retries) else self.max_retries, + default_headers=headers, + default_query=params, + **_extra_kwargs, + ) + + # Alias for `copy` for nicer inline usage, e.g. + # client.with_options(timeout=10).foo.create(...) + with_options = copy + + @override + def _make_status_error( + self, + err_msg: str, + *, + body: object, + response: httpx.Response, + ) -> APIStatusError: + if response.status_code == 400: + return _exceptions.BadRequestError(err_msg, response=response, body=body) + + if response.status_code == 401: + return _exceptions.AuthenticationError(err_msg, response=response, body=body) + + if response.status_code == 403: + return _exceptions.PermissionDeniedError(err_msg, response=response, body=body) + + if response.status_code == 404: + return _exceptions.NotFoundError(err_msg, response=response, body=body) + + if response.status_code == 409: + return _exceptions.ConflictError(err_msg, response=response, body=body) + + if response.status_code == 422: + return _exceptions.UnprocessableEntityError(err_msg, response=response, body=body) + + if response.status_code == 429: + return _exceptions.RateLimitError(err_msg, response=response, body=body) + + if response.status_code >= 500: + return _exceptions.InternalServerError(err_msg, response=response, body=body) + return APIStatusError(err_msg, response=response, body=body) + + +class ParallelWithRawResponse: + _client: Parallel + + def __init__(self, client: Parallel) -> None: + self._client = client + + @cached_property + def task_run(self) -> task_run.TaskRunResourceWithRawResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + from .resources.task_run import TaskRunResourceWithRawResponse + + return TaskRunResourceWithRawResponse(self._client.task_run) + + @cached_property + def beta(self) -> beta.BetaResourceWithRawResponse: + from .resources.beta import BetaResourceWithRawResponse + + return BetaResourceWithRawResponse(self._client.beta) + + +class AsyncParallelWithRawResponse: + _client: AsyncParallel + + def __init__(self, client: AsyncParallel) -> None: + self._client = client + + @cached_property + def task_run(self) -> task_run.AsyncTaskRunResourceWithRawResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + from .resources.task_run import AsyncTaskRunResourceWithRawResponse + + return AsyncTaskRunResourceWithRawResponse(self._client.task_run) + + @cached_property + def beta(self) -> beta.AsyncBetaResourceWithRawResponse: + from .resources.beta import AsyncBetaResourceWithRawResponse + + return AsyncBetaResourceWithRawResponse(self._client.beta) + + +class ParallelWithStreamedResponse: + _client: Parallel + + def __init__(self, client: Parallel) -> None: + self._client = client + + @cached_property + def task_run(self) -> task_run.TaskRunResourceWithStreamingResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + from .resources.task_run import TaskRunResourceWithStreamingResponse + + return TaskRunResourceWithStreamingResponse(self._client.task_run) + + @cached_property + def beta(self) -> beta.BetaResourceWithStreamingResponse: + from .resources.beta import BetaResourceWithStreamingResponse + + return BetaResourceWithStreamingResponse(self._client.beta) + + +class AsyncParallelWithStreamedResponse: + _client: AsyncParallel + + def __init__(self, client: AsyncParallel) -> None: + self._client = client + + @cached_property + def task_run(self) -> task_run.AsyncTaskRunResourceWithStreamingResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + from .resources.task_run import AsyncTaskRunResourceWithStreamingResponse + + return AsyncTaskRunResourceWithStreamingResponse(self._client.task_run) + + @cached_property + def beta(self) -> beta.AsyncBetaResourceWithStreamingResponse: + from .resources.beta import AsyncBetaResourceWithStreamingResponse + + return AsyncBetaResourceWithStreamingResponse(self._client.beta) + + +Client = Parallel + +AsyncClient = AsyncParallel diff --git a/src/parallel/_compat.py b/src/parallel/_compat.py new file mode 100644 index 0000000..e6690a4 --- /dev/null +++ b/src/parallel/_compat.py @@ -0,0 +1,226 @@ +from __future__ import annotations + +from typing import TYPE_CHECKING, Any, Union, Generic, TypeVar, Callable, cast, overload +from datetime import date, datetime +from typing_extensions import Self, Literal, TypedDict + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import IncEx, StrBytesIntFloat + +_T = TypeVar("_T") +_ModelT = TypeVar("_ModelT", bound=pydantic.BaseModel) + +# --------------- Pydantic v2, v3 compatibility --------------- + +# Pyright incorrectly reports some of our functions as overriding a method when they don't +# pyright: reportIncompatibleMethodOverride=false + +PYDANTIC_V1 = pydantic.VERSION.startswith("1.") + +if TYPE_CHECKING: + + def parse_date(value: date | StrBytesIntFloat) -> date: # noqa: ARG001 + ... + + def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: # noqa: ARG001 + ... + + def get_args(t: type[Any]) -> tuple[Any, ...]: # noqa: ARG001 + ... + + def is_union(tp: type[Any] | None) -> bool: # noqa: ARG001 + ... + + def get_origin(t: type[Any]) -> type[Any] | None: # noqa: ARG001 + ... + + def is_literal_type(type_: type[Any]) -> bool: # noqa: ARG001 + ... + + def is_typeddict(type_: type[Any]) -> bool: # noqa: ARG001 + ... + +else: + # v1 re-exports + if PYDANTIC_V1: + from pydantic.typing import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, + ) + from pydantic.datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime + else: + from ._utils import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + parse_date as parse_date, + is_typeddict as is_typeddict, + parse_datetime as parse_datetime, + is_literal_type as is_literal_type, + ) + + +# refactored config +if TYPE_CHECKING: + from pydantic import ConfigDict as ConfigDict +else: + if PYDANTIC_V1: + # TODO: provide an error message here? + ConfigDict = None + else: + from pydantic import ConfigDict as ConfigDict + + +# renamed methods / properties +def parse_obj(model: type[_ModelT], value: object) -> _ModelT: + if PYDANTIC_V1: + return cast(_ModelT, model.parse_obj(value)) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + else: + return model.model_validate(value) + + +def field_is_required(field: FieldInfo) -> bool: + if PYDANTIC_V1: + return field.required # type: ignore + return field.is_required() + + +def field_get_default(field: FieldInfo) -> Any: + value = field.get_default() + if PYDANTIC_V1: + return value + from pydantic_core import PydanticUndefined + + if value == PydanticUndefined: + return None + return value + + +def field_outer_type(field: FieldInfo) -> Any: + if PYDANTIC_V1: + return field.outer_type_ # type: ignore + return field.annotation + + +def get_model_config(model: type[pydantic.BaseModel]) -> Any: + if PYDANTIC_V1: + return model.__config__ # type: ignore + return model.model_config + + +def get_model_fields(model: type[pydantic.BaseModel]) -> dict[str, FieldInfo]: + if PYDANTIC_V1: + return model.__fields__ # type: ignore + return model.model_fields + + +def model_copy(model: _ModelT, *, deep: bool = False) -> _ModelT: + if PYDANTIC_V1: + return model.copy(deep=deep) # type: ignore + return model.model_copy(deep=deep) + + +def model_json(model: pydantic.BaseModel, *, indent: int | None = None) -> str: + if PYDANTIC_V1: + return model.json(indent=indent) # type: ignore + return model.model_dump_json(indent=indent) + + +class _ModelDumpKwargs(TypedDict, total=False): + by_alias: bool + + +def model_dump( + model: pydantic.BaseModel, + *, + exclude: IncEx | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + warnings: bool = True, + mode: Literal["json", "python"] = "python", + by_alias: bool | None = None, +) -> dict[str, Any]: + if (not PYDANTIC_V1) or hasattr(model, "model_dump"): + kwargs: _ModelDumpKwargs = {} + if by_alias is not None: + kwargs["by_alias"] = by_alias + return model.model_dump( + mode=mode, + exclude=exclude, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + # warnings are not supported in Pydantic v1 + warnings=True if PYDANTIC_V1 else warnings, + **kwargs, + ) + return cast( + "dict[str, Any]", + model.dict( # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + exclude=exclude, exclude_unset=exclude_unset, exclude_defaults=exclude_defaults, by_alias=bool(by_alias) + ), + ) + + +def model_parse(model: type[_ModelT], data: Any) -> _ModelT: + if PYDANTIC_V1: + return model.parse_obj(data) # pyright: ignore[reportDeprecated] + return model.model_validate(data) + + +# generic models +if TYPE_CHECKING: + + class GenericModel(pydantic.BaseModel): ... + +else: + if PYDANTIC_V1: + import pydantic.generics + + class GenericModel(pydantic.generics.GenericModel, pydantic.BaseModel): ... + else: + # there no longer needs to be a distinction in v2 but + # we still have to create our own subclass to avoid + # inconsistent MRO ordering errors + class GenericModel(pydantic.BaseModel): ... + + +# cached properties +if TYPE_CHECKING: + cached_property = property + + # we define a separate type (copied from typeshed) + # that represents that `cached_property` is `set`able + # at runtime, which differs from `@property`. + # + # this is a separate type as editors likely special case + # `@property` and we don't want to cause issues just to have + # more helpful internal types. + + class typed_cached_property(Generic[_T]): + func: Callable[[Any], _T] + attrname: str | None + + def __init__(self, func: Callable[[Any], _T]) -> None: ... + + @overload + def __get__(self, instance: None, owner: type[Any] | None = None) -> Self: ... + + @overload + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T: ... + + def __get__(self, instance: object, owner: type[Any] | None = None) -> _T | Self: + raise NotImplementedError() + + def __set_name__(self, owner: type[Any], name: str) -> None: ... + + # __set__ is not defined at runtime, but @cached_property is designed to be settable + def __set__(self, instance: object, value: _T) -> None: ... +else: + from functools import cached_property as cached_property + + typed_cached_property = cached_property diff --git a/src/parallel/_constants.py b/src/parallel/_constants.py new file mode 100644 index 0000000..6ddf2c7 --- /dev/null +++ b/src/parallel/_constants.py @@ -0,0 +1,14 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +import httpx + +RAW_RESPONSE_HEADER = "X-Stainless-Raw-Response" +OVERRIDE_CAST_TO_HEADER = "____stainless_override_cast_to" + +# default timeout is 1 minute +DEFAULT_TIMEOUT = httpx.Timeout(timeout=60, connect=5.0) +DEFAULT_MAX_RETRIES = 2 +DEFAULT_CONNECTION_LIMITS = httpx.Limits(max_connections=100, max_keepalive_connections=20) + +INITIAL_RETRY_DELAY = 0.5 +MAX_RETRY_DELAY = 8.0 diff --git a/src/parallel/_exceptions.py b/src/parallel/_exceptions.py new file mode 100644 index 0000000..eb60f24 --- /dev/null +++ b/src/parallel/_exceptions.py @@ -0,0 +1,108 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal + +import httpx + +__all__ = [ + "BadRequestError", + "AuthenticationError", + "PermissionDeniedError", + "NotFoundError", + "ConflictError", + "UnprocessableEntityError", + "RateLimitError", + "InternalServerError", +] + + +class ParallelError(Exception): + pass + + +class APIError(ParallelError): + message: str + request: httpx.Request + + body: object | None + """The API response body. + + If the API responded with a valid JSON structure then this property will be the + decoded result. + + If it isn't a valid JSON structure then this will be the raw response. + + If there was no response associated with this error then it will be `None`. + """ + + def __init__(self, message: str, request: httpx.Request, *, body: object | None) -> None: # noqa: ARG002 + super().__init__(message) + self.request = request + self.message = message + self.body = body + + +class APIResponseValidationError(APIError): + response: httpx.Response + status_code: int + + def __init__(self, response: httpx.Response, body: object | None, *, message: str | None = None) -> None: + super().__init__(message or "Data returned by API invalid for expected schema.", response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIStatusError(APIError): + """Raised when an API response has a status code of 4xx or 5xx.""" + + response: httpx.Response + status_code: int + + def __init__(self, message: str, *, response: httpx.Response, body: object | None) -> None: + super().__init__(message, response.request, body=body) + self.response = response + self.status_code = response.status_code + + +class APIConnectionError(APIError): + def __init__(self, *, message: str = "Connection error.", request: httpx.Request) -> None: + super().__init__(message, request, body=None) + + +class APITimeoutError(APIConnectionError): + def __init__(self, request: httpx.Request) -> None: + super().__init__(message="Request timed out.", request=request) + + +class BadRequestError(APIStatusError): + status_code: Literal[400] = 400 # pyright: ignore[reportIncompatibleVariableOverride] + + +class AuthenticationError(APIStatusError): + status_code: Literal[401] = 401 # pyright: ignore[reportIncompatibleVariableOverride] + + +class PermissionDeniedError(APIStatusError): + status_code: Literal[403] = 403 # pyright: ignore[reportIncompatibleVariableOverride] + + +class NotFoundError(APIStatusError): + status_code: Literal[404] = 404 # pyright: ignore[reportIncompatibleVariableOverride] + + +class ConflictError(APIStatusError): + status_code: Literal[409] = 409 # pyright: ignore[reportIncompatibleVariableOverride] + + +class UnprocessableEntityError(APIStatusError): + status_code: Literal[422] = 422 # pyright: ignore[reportIncompatibleVariableOverride] + + +class RateLimitError(APIStatusError): + status_code: Literal[429] = 429 # pyright: ignore[reportIncompatibleVariableOverride] + + +class InternalServerError(APIStatusError): + pass diff --git a/src/parallel/_files.py b/src/parallel/_files.py new file mode 100644 index 0000000..cc14c14 --- /dev/null +++ b/src/parallel/_files.py @@ -0,0 +1,123 @@ +from __future__ import annotations + +import io +import os +import pathlib +from typing import overload +from typing_extensions import TypeGuard + +import anyio + +from ._types import ( + FileTypes, + FileContent, + RequestFiles, + HttpxFileTypes, + Base64FileInput, + HttpxFileContent, + HttpxRequestFiles, +) +from ._utils import is_tuple_t, is_mapping_t, is_sequence_t + + +def is_base64_file_input(obj: object) -> TypeGuard[Base64FileInput]: + return isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + + +def is_file_content(obj: object) -> TypeGuard[FileContent]: + return ( + isinstance(obj, bytes) or isinstance(obj, tuple) or isinstance(obj, io.IOBase) or isinstance(obj, os.PathLike) + ) + + +def assert_is_file_content(obj: object, *, key: str | None = None) -> None: + if not is_file_content(obj): + prefix = f"Expected entry at `{key}`" if key is not None else f"Expected file input `{obj!r}`" + raise RuntimeError( + f"{prefix} to be bytes, an io.IOBase instance, PathLike or a tuple but received {type(obj)} instead." + ) from None + + +@overload +def to_httpx_files(files: None) -> None: ... + + +@overload +def to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +def to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: _transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, _transform_file(file)) for key, file in files] + else: + raise TypeError(f"Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +def _transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = pathlib.Path(file) + return (path.name, path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +def read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return pathlib.Path(file).read_bytes() + return file + + +@overload +async def async_to_httpx_files(files: None) -> None: ... + + +@overload +async def async_to_httpx_files(files: RequestFiles) -> HttpxRequestFiles: ... + + +async def async_to_httpx_files(files: RequestFiles | None) -> HttpxRequestFiles | None: + if files is None: + return None + + if is_mapping_t(files): + files = {key: await _async_transform_file(file) for key, file in files.items()} + elif is_sequence_t(files): + files = [(key, await _async_transform_file(file)) for key, file in files] + else: + raise TypeError("Unexpected file type input {type(files)}, expected mapping or sequence") + + return files + + +async def _async_transform_file(file: FileTypes) -> HttpxFileTypes: + if is_file_content(file): + if isinstance(file, os.PathLike): + path = anyio.Path(file) + return (path.name, await path.read_bytes()) + + return file + + if is_tuple_t(file): + return (file[0], await async_read_file_content(file[1]), *file[2:]) + + raise TypeError(f"Expected file types input to be a FileContent type or to be a tuple") + + +async def async_read_file_content(file: FileContent) -> HttpxFileContent: + if isinstance(file, os.PathLike): + return await anyio.Path(file).read_bytes() + + return file diff --git a/src/parallel/_models.py b/src/parallel/_models.py new file mode 100644 index 0000000..29070e0 --- /dev/null +++ b/src/parallel/_models.py @@ -0,0 +1,872 @@ +from __future__ import annotations + +import os +import inspect +import weakref +from typing import ( + IO, + TYPE_CHECKING, + Any, + Type, + Union, + Generic, + TypeVar, + Callable, + Iterable, + Optional, + AsyncIterable, + cast, +) +from datetime import date, datetime +from typing_extensions import ( + List, + Unpack, + Literal, + ClassVar, + Protocol, + Required, + ParamSpec, + TypedDict, + TypeGuard, + final, + override, + runtime_checkable, +) + +import pydantic +from pydantic.fields import FieldInfo + +from ._types import ( + Body, + IncEx, + Query, + ModelT, + Headers, + Timeout, + NotGiven, + AnyMapping, + HttpxRequestFiles, +) +from ._utils import ( + PropertyInfo, + is_list, + is_given, + json_safe, + lru_cache, + is_mapping, + parse_date, + coerce_boolean, + parse_datetime, + strip_not_given, + extract_type_arg, + is_annotated_type, + is_type_alias_type, + strip_annotated_type, +) +from ._compat import ( + PYDANTIC_V1, + ConfigDict, + GenericModel as BaseGenericModel, + get_args, + is_union, + parse_obj, + get_origin, + is_literal_type, + get_model_config, + get_model_fields, + field_get_default, +) +from ._constants import RAW_RESPONSE_HEADER + +if TYPE_CHECKING: + from pydantic_core.core_schema import ModelField, ModelSchema, LiteralSchema, ModelFieldsSchema + +__all__ = ["BaseModel", "GenericModel"] + +_T = TypeVar("_T") +_BaseModelT = TypeVar("_BaseModelT", bound="BaseModel") + +P = ParamSpec("P") + + +@runtime_checkable +class _ConfigProtocol(Protocol): + allow_population_by_field_name: bool + + +class BaseModel(pydantic.BaseModel): + if PYDANTIC_V1: + + @property + @override + def model_fields_set(self) -> set[str]: + # a forwards-compat shim for pydantic v2 + return self.__fields_set__ # type: ignore + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + extra: Any = pydantic.Extra.allow # type: ignore + else: + model_config: ClassVar[ConfigDict] = ConfigDict( + extra="allow", defer_build=coerce_boolean(os.environ.get("DEFER_PYDANTIC_BUILD", "true")) + ) + + def to_dict( + self, + *, + mode: Literal["json", "python"] = "python", + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> dict[str, object]: + """Recursively generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + mode: + If mode is 'json', the dictionary will only contain JSON serializable types. e.g. `datetime` will be turned into a string, `"2024-3-22T18:11:19.117000Z"`. + If mode is 'python', the dictionary may contain any Python objects. e.g. `datetime(2024, 3, 22)` + + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that are set to their default value from the output. + exclude_none: Whether to exclude fields that have a value of `None` from the output. + warnings: Whether to log warnings when invalid fields are encountered. This is only supported in Pydantic v2. + """ + return self.model_dump( + mode=mode, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + def to_json( + self, + *, + indent: int | None = 2, + use_api_names: bool = True, + exclude_unset: bool = True, + exclude_defaults: bool = False, + exclude_none: bool = False, + warnings: bool = True, + ) -> str: + """Generates a JSON string representing this model as it would be received from or sent to the API (but with indentation). + + By default, fields that were not set by the API will not be included, + and keys will match the API response, *not* the property names from the model. + + For example, if the API responds with `"fooBar": true` but we've defined a `foo_bar: bool` property, + the output will use the `"fooBar"` key (unless `use_api_names=False` is passed). + + Args: + indent: Indentation to use in the JSON output. If `None` is passed, the output will be compact. Defaults to `2` + use_api_names: Whether to use the key that the API responded with or the property name. Defaults to `True`. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + warnings: Whether to show any warnings that occurred during serialization. This is only supported in Pydantic v2. + """ + return self.model_dump_json( + indent=indent, + by_alias=use_api_names, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + warnings=warnings, + ) + + @override + def __str__(self) -> str: + # mypy complains about an invalid self arg + return f"{self.__repr_name__()}({self.__repr_str__(', ')})" # type: ignore[misc] + + # Override the 'construct' method in a way that supports recursive parsing without validation. + # Based on https://github.com/samuelcolvin/pydantic/issues/1168#issuecomment-817742836. + @classmethod + @override + def construct( # pyright: ignore[reportIncompatibleMethodOverride] + __cls: Type[ModelT], + _fields_set: set[str] | None = None, + **values: object, + ) -> ModelT: + m = __cls.__new__(__cls) + fields_values: dict[str, object] = {} + + config = get_model_config(__cls) + populate_by_name = ( + config.allow_population_by_field_name + if isinstance(config, _ConfigProtocol) + else config.get("populate_by_name") + ) + + if _fields_set is None: + _fields_set = set() + + model_fields = get_model_fields(__cls) + for name, field in model_fields.items(): + key = field.alias + if key is None or (key not in values and populate_by_name): + key = name + + if key in values: + fields_values[name] = _construct_field(value=values[key], field=field, key=key) + _fields_set.add(name) + else: + fields_values[name] = field_get_default(field) + + extra_field_type = _get_extra_fields_type(__cls) + + _extra = {} + for key, value in values.items(): + if key not in model_fields: + parsed = construct_type(value=value, type_=extra_field_type) if extra_field_type is not None else value + + if PYDANTIC_V1: + _fields_set.add(key) + fields_values[key] = parsed + else: + _extra[key] = parsed + + object.__setattr__(m, "__dict__", fields_values) + + if PYDANTIC_V1: + # init_private_attributes() does not exist in v2 + m._init_private_attributes() # type: ignore + + # copied from Pydantic v1's `construct()` method + object.__setattr__(m, "__fields_set__", _fields_set) + else: + # these properties are copied from Pydantic's `model_construct()` method + object.__setattr__(m, "__pydantic_private__", None) + object.__setattr__(m, "__pydantic_extra__", _extra) + object.__setattr__(m, "__pydantic_fields_set__", _fields_set) + + return m + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + # because the type signatures are technically different + # although not in practice + model_construct = construct + + if PYDANTIC_V1: + # we define aliases for some of the new pydantic v2 methods so + # that we can just document these methods without having to specify + # a specific pydantic version as some users may not know which + # pydantic version they are currently using + + @override + def model_dump( + self, + *, + mode: Literal["json", "python"] | str = "python", + include: IncEx | None = None, + exclude: IncEx | None = None, + context: Any | None = None, + by_alias: bool | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + exclude_computed_fields: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + fallback: Callable[[Any], Any] | None = None, + serialize_as_any: bool = False, + ) -> dict[str, Any]: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump + + Generate a dictionary representation of the model, optionally specifying which fields to include or exclude. + + Args: + mode: The mode in which `to_python` should run. + If mode is 'json', the output will only contain JSON serializable types. + If mode is 'python', the output may contain non-JSON-serializable Python objects. + include: A set of fields to include in the output. + exclude: A set of fields to exclude from the output. + context: Additional context to pass to the serializer. + by_alias: Whether to use the field's alias in the dictionary key if defined. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that are set to their default value. + exclude_none: Whether to exclude fields that have a value of `None`. + exclude_computed_fields: Whether to exclude computed fields. + While this can be useful for round-tripping, it is usually recommended to use the dedicated + `round_trip` parameter instead. + round_trip: If True, dumped values should be valid as input for non-idempotent types such as Json[T]. + warnings: How to handle serialization errors. False/"none" ignores them, True/"warn" logs errors, + "error" raises a [`PydanticSerializationError`][pydantic_core.PydanticSerializationError]. + fallback: A function to call when an unknown value is encountered. If not provided, + a [`PydanticSerializationError`][pydantic_core.PydanticSerializationError] error is raised. + serialize_as_any: Whether to serialize fields with duck-typing serialization behavior. + + Returns: + A dictionary representation of the model. + """ + if mode not in {"json", "python"}: + raise ValueError("mode must be either 'json' or 'python'") + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + if fallback is not None: + raise ValueError("fallback is only supported in Pydantic v2") + if exclude_computed_fields != False: + raise ValueError("exclude_computed_fields is only supported in Pydantic v2") + dumped = super().dict( # pyright: ignore[reportDeprecated] + include=include, + exclude=exclude, + by_alias=by_alias if by_alias is not None else False, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + return cast("dict[str, Any]", json_safe(dumped)) if mode == "json" else dumped + + @override + def model_dump_json( + self, + *, + indent: int | None = None, + ensure_ascii: bool = False, + include: IncEx | None = None, + exclude: IncEx | None = None, + context: Any | None = None, + by_alias: bool | None = None, + exclude_unset: bool = False, + exclude_defaults: bool = False, + exclude_none: bool = False, + exclude_computed_fields: bool = False, + round_trip: bool = False, + warnings: bool | Literal["none", "warn", "error"] = True, + fallback: Callable[[Any], Any] | None = None, + serialize_as_any: bool = False, + ) -> str: + """Usage docs: https://docs.pydantic.dev/2.4/concepts/serialization/#modelmodel_dump_json + + Generates a JSON representation of the model using Pydantic's `to_json` method. + + Args: + indent: Indentation to use in the JSON output. If None is passed, the output will be compact. + include: Field(s) to include in the JSON output. Can take either a string or set of strings. + exclude: Field(s) to exclude from the JSON output. Can take either a string or set of strings. + by_alias: Whether to serialize using field aliases. + exclude_unset: Whether to exclude fields that have not been explicitly set. + exclude_defaults: Whether to exclude fields that have the default value. + exclude_none: Whether to exclude fields that have a value of `None`. + round_trip: Whether to use serialization/deserialization between JSON and class instance. + warnings: Whether to show any warnings that occurred during serialization. + + Returns: + A JSON string representation of the model. + """ + if round_trip != False: + raise ValueError("round_trip is only supported in Pydantic v2") + if warnings != True: + raise ValueError("warnings is only supported in Pydantic v2") + if context is not None: + raise ValueError("context is only supported in Pydantic v2") + if serialize_as_any != False: + raise ValueError("serialize_as_any is only supported in Pydantic v2") + if fallback is not None: + raise ValueError("fallback is only supported in Pydantic v2") + if ensure_ascii != False: + raise ValueError("ensure_ascii is only supported in Pydantic v2") + if exclude_computed_fields != False: + raise ValueError("exclude_computed_fields is only supported in Pydantic v2") + return super().json( # type: ignore[reportDeprecated] + indent=indent, + include=include, + exclude=exclude, + by_alias=by_alias if by_alias is not None else False, + exclude_unset=exclude_unset, + exclude_defaults=exclude_defaults, + exclude_none=exclude_none, + ) + + +def _construct_field(value: object, field: FieldInfo, key: str) -> object: + if value is None: + return field_get_default(field) + + if PYDANTIC_V1: + type_ = cast(type, field.outer_type_) # type: ignore + else: + type_ = field.annotation # type: ignore + + if type_ is None: + raise RuntimeError(f"Unexpected field type is None for {key}") + + return construct_type(value=value, type_=type_, metadata=getattr(field, "metadata", None)) + + +def _get_extra_fields_type(cls: type[pydantic.BaseModel]) -> type | None: + if PYDANTIC_V1: + # TODO + return None + + schema = cls.__pydantic_core_schema__ + if schema["type"] == "model": + fields = schema["schema"] + if fields["type"] == "model-fields": + extras = fields.get("extras_schema") + if extras and "cls" in extras: + # mypy can't narrow the type + return extras["cls"] # type: ignore[no-any-return] + + return None + + +def is_basemodel(type_: type) -> bool: + """Returns whether or not the given type is either a `BaseModel` or a union of `BaseModel`""" + if is_union(type_): + for variant in get_args(type_): + if is_basemodel(variant): + return True + + return False + + return is_basemodel_type(type_) + + +def is_basemodel_type(type_: type) -> TypeGuard[type[BaseModel] | type[GenericModel]]: + origin = get_origin(type_) or type_ + if not inspect.isclass(origin): + return False + return issubclass(origin, BaseModel) or issubclass(origin, GenericModel) + + +def build( + base_model_cls: Callable[P, _BaseModelT], + *args: P.args, + **kwargs: P.kwargs, +) -> _BaseModelT: + """Construct a BaseModel class without validation. + + This is useful for cases where you need to instantiate a `BaseModel` + from an API response as this provides type-safe params which isn't supported + by helpers like `construct_type()`. + + ```py + build(MyModel, my_field_a="foo", my_field_b=123) + ``` + """ + if args: + raise TypeError( + "Received positional arguments which are not supported; Keyword arguments must be used instead", + ) + + return cast(_BaseModelT, construct_type(type_=base_model_cls, value=kwargs)) + + +def construct_type_unchecked(*, value: object, type_: type[_T]) -> _T: + """Loose coercion to the expected type with construction of nested values. + + Note: the returned value from this function is not guaranteed to match the + given type. + """ + return cast(_T, construct_type(value=value, type_=type_)) + + +def construct_type(*, value: object, type_: object, metadata: Optional[List[Any]] = None) -> object: + """Loose coercion to the expected type with construction of nested values. + + If the given value does not match the expected type then it is returned as-is. + """ + + # store a reference to the original type we were given before we extract any inner + # types so that we can properly resolve forward references in `TypeAliasType` annotations + original_type = None + + # we allow `object` as the input type because otherwise, passing things like + # `Literal['value']` will be reported as a type error by type checkers + type_ = cast("type[object]", type_) + if is_type_alias_type(type_): + original_type = type_ # type: ignore[unreachable] + type_ = type_.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if metadata is not None and len(metadata) > 0: + meta: tuple[Any, ...] = tuple(metadata) + elif is_annotated_type(type_): + meta = get_args(type_)[1:] + type_ = extract_type_arg(type_, 0) + else: + meta = tuple() + + # we need to use the origin class for any types that are subscripted generics + # e.g. Dict[str, object] + origin = get_origin(type_) or type_ + args = get_args(type_) + + if is_union(origin): + try: + return validate_type(type_=cast("type[object]", original_type or type_), value=value) + except Exception: + pass + + # if the type is a discriminated union then we want to construct the right variant + # in the union, even if the data doesn't match exactly, otherwise we'd break code + # that relies on the constructed class types, e.g. + # + # class FooType: + # kind: Literal['foo'] + # value: str + # + # class BarType: + # kind: Literal['bar'] + # value: int + # + # without this block, if the data we get is something like `{'kind': 'bar', 'value': 'foo'}` then + # we'd end up constructing `FooType` when it should be `BarType`. + discriminator = _build_discriminated_union_meta(union=type_, meta_annotations=meta) + if discriminator and is_mapping(value): + variant_value = value.get(discriminator.field_alias_from or discriminator.field_name) + if variant_value and isinstance(variant_value, str): + variant_type = discriminator.mapping.get(variant_value) + if variant_type: + return construct_type(type_=variant_type, value=value) + + # if the data is not valid, use the first variant that doesn't fail while deserializing + for variant in args: + try: + return construct_type(value=value, type_=variant) + except Exception: + continue + + raise RuntimeError(f"Could not convert data into a valid instance of {type_}") + + if origin == dict: + if not is_mapping(value): + return value + + _, items_type = get_args(type_) # Dict[_, items_type] + return {key: construct_type(value=item, type_=items_type) for key, item in value.items()} + + if ( + not is_literal_type(type_) + and inspect.isclass(origin) + and (issubclass(origin, BaseModel) or issubclass(origin, GenericModel)) + ): + if is_list(value): + return [cast(Any, type_).construct(**entry) if is_mapping(entry) else entry for entry in value] + + if is_mapping(value): + if issubclass(type_, BaseModel): + return type_.construct(**value) # type: ignore[arg-type] + + return cast(Any, type_).construct(**value) + + if origin == list: + if not is_list(value): + return value + + inner_type = args[0] # List[inner_type] + return [construct_type(value=entry, type_=inner_type) for entry in value] + + if origin == float: + if isinstance(value, int): + coerced = float(value) + if coerced != value: + return value + return coerced + + return value + + if type_ == datetime: + try: + return parse_datetime(value) # type: ignore + except Exception: + return value + + if type_ == date: + try: + return parse_date(value) # type: ignore + except Exception: + return value + + return value + + +@runtime_checkable +class CachedDiscriminatorType(Protocol): + __discriminator__: DiscriminatorDetails + + +DISCRIMINATOR_CACHE: weakref.WeakKeyDictionary[type, DiscriminatorDetails] = weakref.WeakKeyDictionary() + + +class DiscriminatorDetails: + field_name: str + """The name of the discriminator field in the variant class, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] + ``` + + Will result in field_name='type' + """ + + field_alias_from: str | None + """The name of the discriminator field in the API response, e.g. + + ```py + class Foo(BaseModel): + type: Literal['foo'] = Field(alias='type_from_api') + ``` + + Will result in field_alias_from='type_from_api' + """ + + mapping: dict[str, type] + """Mapping of discriminator value to variant type, e.g. + + {'foo': FooVariant, 'bar': BarVariant} + """ + + def __init__( + self, + *, + mapping: dict[str, type], + discriminator_field: str, + discriminator_alias: str | None, + ) -> None: + self.mapping = mapping + self.field_name = discriminator_field + self.field_alias_from = discriminator_alias + + +def _build_discriminated_union_meta(*, union: type, meta_annotations: tuple[Any, ...]) -> DiscriminatorDetails | None: + cached = DISCRIMINATOR_CACHE.get(union) + if cached is not None: + return cached + + discriminator_field_name: str | None = None + + for annotation in meta_annotations: + if isinstance(annotation, PropertyInfo) and annotation.discriminator is not None: + discriminator_field_name = annotation.discriminator + break + + if not discriminator_field_name: + return None + + mapping: dict[str, type] = {} + discriminator_alias: str | None = None + + for variant in get_args(union): + variant = strip_annotated_type(variant) + if is_basemodel_type(variant): + if PYDANTIC_V1: + field_info = cast("dict[str, FieldInfo]", variant.__fields__).get(discriminator_field_name) # pyright: ignore[reportDeprecated, reportUnnecessaryCast] + if not field_info: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field_info.alias + + if (annotation := getattr(field_info, "annotation", None)) and is_literal_type(annotation): + for entry in get_args(annotation): + if isinstance(entry, str): + mapping[entry] = variant + else: + field = _extract_field_schema_pv2(variant, discriminator_field_name) + if not field: + continue + + # Note: if one variant defines an alias then they all should + discriminator_alias = field.get("serialization_alias") + + field_schema = field["schema"] + + if field_schema["type"] == "literal": + for entry in cast("LiteralSchema", field_schema)["expected"]: + if isinstance(entry, str): + mapping[entry] = variant + + if not mapping: + return None + + details = DiscriminatorDetails( + mapping=mapping, + discriminator_field=discriminator_field_name, + discriminator_alias=discriminator_alias, + ) + DISCRIMINATOR_CACHE.setdefault(union, details) + return details + + +def _extract_field_schema_pv2(model: type[BaseModel], field_name: str) -> ModelField | None: + schema = model.__pydantic_core_schema__ + if schema["type"] == "definitions": + schema = schema["schema"] + + if schema["type"] != "model": + return None + + schema = cast("ModelSchema", schema) + fields_schema = schema["schema"] + if fields_schema["type"] != "model-fields": + return None + + fields_schema = cast("ModelFieldsSchema", fields_schema) + field = fields_schema["fields"].get(field_name) + if not field: + return None + + return cast("ModelField", field) # pyright: ignore[reportUnnecessaryCast] + + +def validate_type(*, type_: type[_T], value: object) -> _T: + """Strict validation that the given value matches the expected type""" + if inspect.isclass(type_) and issubclass(type_, pydantic.BaseModel): + return cast(_T, parse_obj(type_, value)) + + return cast(_T, _validate_non_model_type(type_=type_, value=value)) + + +def set_pydantic_config(typ: Any, config: pydantic.ConfigDict) -> None: + """Add a pydantic config for the given type. + + Note: this is a no-op on Pydantic v1. + """ + setattr(typ, "__pydantic_config__", config) # noqa: B010 + + +# our use of subclassing here causes weirdness for type checkers, +# so we just pretend that we don't subclass +if TYPE_CHECKING: + GenericModel = BaseModel +else: + + class GenericModel(BaseGenericModel, BaseModel): + pass + + +if not PYDANTIC_V1: + from pydantic import TypeAdapter as _TypeAdapter + + _CachedTypeAdapter = cast("TypeAdapter[object]", lru_cache(maxsize=None)(_TypeAdapter)) + + if TYPE_CHECKING: + from pydantic import TypeAdapter + else: + TypeAdapter = _CachedTypeAdapter + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + return TypeAdapter(type_).validate_python(value) + +elif not TYPE_CHECKING: # TODO: condition is weird + + class RootModel(GenericModel, Generic[_T]): + """Used as a placeholder to easily convert runtime types to a Pydantic format + to provide validation. + + For example: + ```py + validated = RootModel[int](__root__="5").__root__ + # validated: 5 + ``` + """ + + __root__: _T + + def _validate_non_model_type(*, type_: type[_T], value: object) -> _T: + model = _create_pydantic_model(type_).validate(value) + return cast(_T, model.__root__) + + def _create_pydantic_model(type_: _T) -> Type[RootModel[_T]]: + return RootModel[type_] # type: ignore + + +class FinalRequestOptionsInput(TypedDict, total=False): + method: Required[str] + url: Required[str] + params: Query + headers: Headers + max_retries: int + timeout: float | Timeout | None + files: HttpxRequestFiles | None + idempotency_key: str + content: Union[bytes, bytearray, IO[bytes], Iterable[bytes], AsyncIterable[bytes], None] + json_data: Body + extra_json: AnyMapping + follow_redirects: bool + + +@final +class FinalRequestOptions(pydantic.BaseModel): + method: str + url: str + params: Query = {} + headers: Union[Headers, NotGiven] = NotGiven() + max_retries: Union[int, NotGiven] = NotGiven() + timeout: Union[float, Timeout, None, NotGiven] = NotGiven() + files: Union[HttpxRequestFiles, None] = None + idempotency_key: Union[str, None] = None + post_parser: Union[Callable[[Any], Any], NotGiven] = NotGiven() + follow_redirects: Union[bool, None] = None + + content: Union[bytes, bytearray, IO[bytes], Iterable[bytes], AsyncIterable[bytes], None] = None + # It should be noted that we cannot use `json` here as that would override + # a BaseModel method in an incompatible fashion. + json_data: Union[Body, None] = None + extra_json: Union[AnyMapping, None] = None + + if PYDANTIC_V1: + + class Config(pydantic.BaseConfig): # pyright: ignore[reportDeprecated] + arbitrary_types_allowed: bool = True + else: + model_config: ClassVar[ConfigDict] = ConfigDict(arbitrary_types_allowed=True) + + def get_max_retries(self, max_retries: int) -> int: + if isinstance(self.max_retries, NotGiven): + return max_retries + return self.max_retries + + def _strip_raw_response_header(self) -> None: + if not is_given(self.headers): + return + + if self.headers.get(RAW_RESPONSE_HEADER): + self.headers = {**self.headers} + self.headers.pop(RAW_RESPONSE_HEADER) + + # override the `construct` method so that we can run custom transformations. + # this is necessary as we don't want to do any actual runtime type checking + # (which means we can't use validators) but we do want to ensure that `NotGiven` + # values are not present + # + # type ignore required because we're adding explicit types to `**values` + @classmethod + def construct( # type: ignore + cls, + _fields_set: set[str] | None = None, + **values: Unpack[FinalRequestOptionsInput], + ) -> FinalRequestOptions: + kwargs: dict[str, Any] = { + # we unconditionally call `strip_not_given` on any value + # as it will just ignore any non-mapping types + key: strip_not_given(value) + for key, value in values.items() + } + if PYDANTIC_V1: + return cast(FinalRequestOptions, super().construct(_fields_set, **kwargs)) # pyright: ignore[reportDeprecated] + return super().model_construct(_fields_set, **kwargs) + + if not TYPE_CHECKING: + # type checkers incorrectly complain about this assignment + model_construct = construct diff --git a/src/parallel/_qs.py b/src/parallel/_qs.py new file mode 100644 index 0000000..de8c99b --- /dev/null +++ b/src/parallel/_qs.py @@ -0,0 +1,153 @@ +from __future__ import annotations + +from typing import Any, List, Tuple, Union, Mapping, TypeVar +from urllib.parse import parse_qs, urlencode +from typing_extensions import Literal, get_args + +from ._types import NotGiven, not_given +from ._utils import flatten + +_T = TypeVar("_T") + + +ArrayFormat = Literal["comma", "repeat", "indices", "brackets"] +NestedFormat = Literal["dots", "brackets"] + +PrimitiveData = Union[str, int, float, bool, None] +# this should be Data = Union[PrimitiveData, "List[Data]", "Tuple[Data]", "Mapping[str, Data]"] +# https://github.com/microsoft/pyright/issues/3555 +Data = Union[PrimitiveData, List[Any], Tuple[Any], "Mapping[str, Any]"] +Params = Mapping[str, Data] + + +class Querystring: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + *, + array_format: ArrayFormat = "repeat", + nested_format: NestedFormat = "brackets", + ) -> None: + self.array_format = array_format + self.nested_format = nested_format + + def parse(self, query: str) -> Mapping[str, object]: + # Note: custom format syntax is not supported yet + return parse_qs(query) + + def stringify( + self, + params: Params, + *, + array_format: ArrayFormat | NotGiven = not_given, + nested_format: NestedFormat | NotGiven = not_given, + ) -> str: + return urlencode( + self.stringify_items( + params, + array_format=array_format, + nested_format=nested_format, + ) + ) + + def stringify_items( + self, + params: Params, + *, + array_format: ArrayFormat | NotGiven = not_given, + nested_format: NestedFormat | NotGiven = not_given, + ) -> list[tuple[str, str]]: + opts = Options( + qs=self, + array_format=array_format, + nested_format=nested_format, + ) + return flatten([self._stringify_item(key, value, opts) for key, value in params.items()]) + + def _stringify_item( + self, + key: str, + value: Data, + opts: Options, + ) -> list[tuple[str, str]]: + if isinstance(value, Mapping): + items: list[tuple[str, str]] = [] + nested_format = opts.nested_format + for subkey, subvalue in value.items(): + items.extend( + self._stringify_item( + # TODO: error if unknown format + f"{key}.{subkey}" if nested_format == "dots" else f"{key}[{subkey}]", + subvalue, + opts, + ) + ) + return items + + if isinstance(value, (list, tuple)): + array_format = opts.array_format + if array_format == "comma": + return [ + ( + key, + ",".join(self._primitive_value_to_str(item) for item in value if item is not None), + ), + ] + elif array_format == "repeat": + items = [] + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + elif array_format == "indices": + items = [] + for i, item in enumerate(value): + items.extend(self._stringify_item(f"{key}[{i}]", item, opts)) + return items + elif array_format == "brackets": + items = [] + key = key + "[]" + for item in value: + items.extend(self._stringify_item(key, item, opts)) + return items + else: + raise NotImplementedError( + f"Unknown array_format value: {array_format}, choose from {', '.join(get_args(ArrayFormat))}" + ) + + serialised = self._primitive_value_to_str(value) + if not serialised: + return [] + return [(key, serialised)] + + def _primitive_value_to_str(self, value: PrimitiveData) -> str: + # copied from httpx + if value is True: + return "true" + elif value is False: + return "false" + elif value is None: + return "" + return str(value) + + +_qs = Querystring() +parse = _qs.parse +stringify = _qs.stringify +stringify_items = _qs.stringify_items + + +class Options: + array_format: ArrayFormat + nested_format: NestedFormat + + def __init__( + self, + qs: Querystring = _qs, + *, + array_format: ArrayFormat | NotGiven = not_given, + nested_format: NestedFormat | NotGiven = not_given, + ) -> None: + self.array_format = qs.array_format if isinstance(array_format, NotGiven) else array_format + self.nested_format = qs.nested_format if isinstance(nested_format, NotGiven) else nested_format diff --git a/src/parallel/_resource.py b/src/parallel/_resource.py new file mode 100644 index 0000000..7dd0cf7 --- /dev/null +++ b/src/parallel/_resource.py @@ -0,0 +1,43 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import time +from typing import TYPE_CHECKING + +import anyio + +if TYPE_CHECKING: + from ._client import Parallel, AsyncParallel + + +class SyncAPIResource: + _client: Parallel + + def __init__(self, client: Parallel) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + def _sleep(self, seconds: float) -> None: + time.sleep(seconds) + + +class AsyncAPIResource: + _client: AsyncParallel + + def __init__(self, client: AsyncParallel) -> None: + self._client = client + self._get = client.get + self._post = client.post + self._patch = client.patch + self._put = client.put + self._delete = client.delete + self._get_api_list = client.get_api_list + + async def _sleep(self, seconds: float) -> None: + await anyio.sleep(seconds) diff --git a/src/parallel/_response.py b/src/parallel/_response.py new file mode 100644 index 0000000..cf9f5f3 --- /dev/null +++ b/src/parallel/_response.py @@ -0,0 +1,833 @@ +from __future__ import annotations + +import os +import inspect +import logging +import datetime +import functools +from types import TracebackType +from typing import ( + TYPE_CHECKING, + Any, + Union, + Generic, + TypeVar, + Callable, + Iterator, + AsyncIterator, + cast, + overload, +) +from typing_extensions import Awaitable, ParamSpec, override, get_origin + +import anyio +import httpx +import pydantic + +from ._types import NoneType +from ._utils import is_given, extract_type_arg, is_annotated_type, is_type_alias_type, extract_type_var_from_base +from ._models import BaseModel, is_basemodel +from ._constants import RAW_RESPONSE_HEADER, OVERRIDE_CAST_TO_HEADER +from ._streaming import Stream, AsyncStream, is_stream_class_type, extract_stream_chunk_type +from ._exceptions import ParallelError, APIResponseValidationError + +if TYPE_CHECKING: + from ._models import FinalRequestOptions + from ._base_client import BaseClient + + +P = ParamSpec("P") +R = TypeVar("R") +_T = TypeVar("_T") +_APIResponseT = TypeVar("_APIResponseT", bound="APIResponse[Any]") +_AsyncAPIResponseT = TypeVar("_AsyncAPIResponseT", bound="AsyncAPIResponse[Any]") + +log: logging.Logger = logging.getLogger(__name__) + + +class BaseAPIResponse(Generic[R]): + _cast_to: type[R] + _client: BaseClient[Any, Any] + _parsed_by_type: dict[type[Any], Any] + _is_sse_stream: bool + _stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None + _options: FinalRequestOptions + + http_response: httpx.Response + + retries_taken: int + """The number of retries made. If no retries happened this will be `0`""" + + def __init__( + self, + *, + raw: httpx.Response, + cast_to: type[R], + client: BaseClient[Any, Any], + stream: bool, + stream_cls: type[Stream[Any]] | type[AsyncStream[Any]] | None, + options: FinalRequestOptions, + retries_taken: int = 0, + ) -> None: + self._cast_to = cast_to + self._client = client + self._parsed_by_type = {} + self._is_sse_stream = stream + self._stream_cls = stream_cls + self._options = options + self.http_response = raw + self.retries_taken = retries_taken + + @property + def headers(self) -> httpx.Headers: + return self.http_response.headers + + @property + def http_request(self) -> httpx.Request: + """Returns the httpx Request instance associated with the current response.""" + return self.http_response.request + + @property + def status_code(self) -> int: + return self.http_response.status_code + + @property + def url(self) -> httpx.URL: + """Returns the URL for which the request was made.""" + return self.http_response.url + + @property + def method(self) -> str: + return self.http_request.method + + @property + def http_version(self) -> str: + return self.http_response.http_version + + @property + def elapsed(self) -> datetime.timedelta: + """The time taken for the complete request/response cycle to complete.""" + return self.http_response.elapsed + + @property + def is_closed(self) -> bool: + """Whether or not the response body has been closed. + + If this is False then there is response data that has not been read yet. + You must either fully consume the response body or call `.close()` + before discarding the response to prevent resource leaks. + """ + return self.http_response.is_closed + + @override + def __repr__(self) -> str: + return ( + f"<{self.__class__.__name__} [{self.status_code} {self.http_response.reason_phrase}] type={self._cast_to}>" + ) + + def _parse(self, *, to: type[_T] | None = None) -> R | _T: + cast_to = to if to is not None else self._cast_to + + # unwrap `TypeAlias('Name', T)` -> `T` + if is_type_alias_type(cast_to): + cast_to = cast_to.__value__ # type: ignore[unreachable] + + # unwrap `Annotated[T, ...]` -> `T` + if cast_to and is_annotated_type(cast_to): + cast_to = extract_type_arg(cast_to, 0) + + origin = get_origin(cast_to) or cast_to + + if self._is_sse_stream: + if to: + if not is_stream_class_type(to): + raise TypeError(f"Expected custom parse type to be a subclass of {Stream} or {AsyncStream}") + + return cast( + _T, + to( + cast_to=extract_stream_chunk_type( + to, + failure_message="Expected custom stream type to be passed with a type argument, e.g. Stream[ChunkType]", + ), + response=self.http_response, + client=cast(Any, self._client), + options=self._options, + ), + ) + + if self._stream_cls: + return cast( + R, + self._stream_cls( + cast_to=extract_stream_chunk_type(self._stream_cls), + response=self.http_response, + client=cast(Any, self._client), + options=self._options, + ), + ) + + stream_cls = cast("type[Stream[Any]] | type[AsyncStream[Any]] | None", self._client._default_stream_cls) + if stream_cls is None: + raise MissingStreamClassError() + + return cast( + R, + stream_cls( + cast_to=cast_to, + response=self.http_response, + client=cast(Any, self._client), + options=self._options, + ), + ) + + if cast_to is NoneType: + return cast(R, None) + + response = self.http_response + if cast_to == str: + return cast(R, response.text) + + if cast_to == bytes: + return cast(R, response.content) + + if cast_to == int: + return cast(R, int(response.text)) + + if cast_to == float: + return cast(R, float(response.text)) + + if cast_to == bool: + return cast(R, response.text.lower() == "true") + + if origin == APIResponse: + raise RuntimeError("Unexpected state - cast_to is `APIResponse`") + + if inspect.isclass(origin) and issubclass(origin, httpx.Response): + # Because of the invariance of our ResponseT TypeVar, users can subclass httpx.Response + # and pass that class to our request functions. We cannot change the variance to be either + # covariant or contravariant as that makes our usage of ResponseT illegal. We could construct + # the response class ourselves but that is something that should be supported directly in httpx + # as it would be easy to incorrectly construct the Response object due to the multitude of arguments. + if cast_to != httpx.Response: + raise ValueError(f"Subclasses of httpx.Response cannot be passed to `cast_to`") + return cast(R, response) + + if ( + inspect.isclass( + origin # pyright: ignore[reportUnknownArgumentType] + ) + and not issubclass(origin, BaseModel) + and issubclass(origin, pydantic.BaseModel) + ): + raise TypeError("Pydantic models must subclass our base model type, e.g. `from parallel import BaseModel`") + + if ( + cast_to is not object + and not origin is list + and not origin is dict + and not origin is Union + and not issubclass(origin, BaseModel) + ): + raise RuntimeError( + f"Unsupported type, expected {cast_to} to be a subclass of {BaseModel}, {dict}, {list}, {Union}, {NoneType}, {str} or {httpx.Response}." + ) + + # split is required to handle cases where additional information is included + # in the response, e.g. application/json; charset=utf-8 + content_type, *_ = response.headers.get("content-type", "*").split(";") + if not content_type.endswith("json"): + if is_basemodel(cast_to): + try: + data = response.json() + except Exception as exc: + log.debug("Could not read JSON from response data due to %s - %s", type(exc), exc) + else: + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + if self._client._strict_response_validation: + raise APIResponseValidationError( + response=response, + message=f"Expected Content-Type response header to be `application/json` but received `{content_type}` instead.", + body=response.text, + ) + + # If the API responds with content that isn't JSON then we just return + # the (decoded) text without performing any parsing so that you can still + # handle the response however you need to. + return response.text # type: ignore + + data = response.json() + + return self._client._process_response_data( + data=data, + cast_to=cast_to, # type: ignore + response=response, + ) + + +class APIResponse(BaseAPIResponse[R]): + @overload + def parse(self, *, to: type[_T]) -> _T: ... + + @overload + def parse(self) -> R: ... + + def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from parallel import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `int` + - `float` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return self.http_response.read() + except httpx.StreamConsumed as exc: + # The default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message. + raise StreamAlreadyConsumed() from exc + + def text(self) -> str: + """Read and decode the response content into a string.""" + self.read() + return self.http_response.text + + def json(self) -> object: + """Read and decode the JSON response content.""" + self.read() + return self.http_response.json() + + def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.http_response.close() + + def iter_bytes(self, chunk_size: int | None = None) -> Iterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + for chunk in self.http_response.iter_bytes(chunk_size): + yield chunk + + def iter_text(self, chunk_size: int | None = None) -> Iterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + for chunk in self.http_response.iter_text(chunk_size): + yield chunk + + def iter_lines(self) -> Iterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + for chunk in self.http_response.iter_lines(): + yield chunk + + +class AsyncAPIResponse(BaseAPIResponse[R]): + @overload + async def parse(self, *, to: type[_T]) -> _T: ... + + @overload + async def parse(self) -> R: ... + + async def parse(self, *, to: type[_T] | None = None) -> R | _T: + """Returns the rich python representation of this response's data. + + For lower-level control, see `.read()`, `.json()`, `.iter_bytes()`. + + You can customise the type that the response is parsed into through + the `to` argument, e.g. + + ```py + from parallel import BaseModel + + + class MyModel(BaseModel): + foo: str + + + obj = response.parse(to=MyModel) + print(obj.foo) + ``` + + We support parsing: + - `BaseModel` + - `dict` + - `list` + - `Union` + - `str` + - `httpx.Response` + """ + cache_key = to if to is not None else self._cast_to + cached = self._parsed_by_type.get(cache_key) + if cached is not None: + return cached # type: ignore[no-any-return] + + if not self._is_sse_stream: + await self.read() + + parsed = self._parse(to=to) + if is_given(self._options.post_parser): + parsed = self._options.post_parser(parsed) + + self._parsed_by_type[cache_key] = parsed + return parsed + + async def read(self) -> bytes: + """Read and return the binary response content.""" + try: + return await self.http_response.aread() + except httpx.StreamConsumed as exc: + # the default error raised by httpx isn't very + # helpful in our case so we re-raise it with + # a different error message + raise StreamAlreadyConsumed() from exc + + async def text(self) -> str: + """Read and decode the response content into a string.""" + await self.read() + return self.http_response.text + + async def json(self) -> object: + """Read and decode the JSON response content.""" + await self.read() + return self.http_response.json() + + async def close(self) -> None: + """Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.http_response.aclose() + + async def iter_bytes(self, chunk_size: int | None = None) -> AsyncIterator[bytes]: + """ + A byte-iterator over the decoded response content. + + This automatically handles gzip, deflate and brotli encoded responses. + """ + async for chunk in self.http_response.aiter_bytes(chunk_size): + yield chunk + + async def iter_text(self, chunk_size: int | None = None) -> AsyncIterator[str]: + """A str-iterator over the decoded response content + that handles both gzip, deflate, etc but also detects the content's + string encoding. + """ + async for chunk in self.http_response.aiter_text(chunk_size): + yield chunk + + async def iter_lines(self) -> AsyncIterator[str]: + """Like `iter_text()` but will only yield chunks for each line""" + async for chunk in self.http_response.aiter_lines(): + yield chunk + + +class BinaryAPIResponse(APIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(): + f.write(data) + + +class AsyncBinaryAPIResponse(AsyncAPIResponse[bytes]): + """Subclass of APIResponse providing helpers for dealing with binary data. + + Note: If you want to stream the response data instead of eagerly reading it + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + + async def write_to_file( + self, + file: str | os.PathLike[str], + ) -> None: + """Write the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + + Note: if you want to stream the data to the file instead of writing + all at once then you should use `.with_streaming_response` when making + the API request, e.g. `.with_streaming_response.get_binary_response()` + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(): + await f.write(data) + + +class StreamedBinaryAPIResponse(APIResponse[bytes]): + def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + with open(file, mode="wb") as f: + for data in self.iter_bytes(chunk_size): + f.write(data) + + +class AsyncStreamedBinaryAPIResponse(AsyncAPIResponse[bytes]): + async def stream_to_file( + self, + file: str | os.PathLike[str], + *, + chunk_size: int | None = None, + ) -> None: + """Streams the output to the given file. + + Accepts a filename or any path-like object, e.g. pathlib.Path + """ + path = anyio.Path(file) + async with await path.open(mode="wb") as f: + async for data in self.iter_bytes(chunk_size): + await f.write(data) + + +class MissingStreamClassError(TypeError): + def __init__(self) -> None: + super().__init__( + "The `stream` argument was set to `True` but the `stream_cls` argument was not given. See `parallel._streaming` for reference", + ) + + +class StreamAlreadyConsumed(ParallelError): + """ + Attempted to read or stream content, but the content has already + been streamed. + + This can happen if you use a method like `.iter_lines()` and then attempt + to read th entire response body afterwards, e.g. + + ```py + response = await client.post(...) + async for line in response.iter_lines(): + ... # do something with `line` + + content = await response.read() + # ^ error + ``` + + If you want this behaviour you'll need to either manually accumulate the response + content or call `await response.read()` before iterating over the stream. + """ + + def __init__(self) -> None: + message = ( + "Attempted to read or stream some content, but the content has " + "already been streamed. " + "This could be due to attempting to stream the response " + "content more than once." + "\n\n" + "You can fix this by manually accumulating the response content while streaming " + "or by calling `.read()` before starting to stream." + ) + super().__init__(message) + + +class ResponseContextManager(Generic[_APIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, request_func: Callable[[], _APIResponseT]) -> None: + self._request_func = request_func + self.__response: _APIResponseT | None = None + + def __enter__(self) -> _APIResponseT: + self.__response = self._request_func() + return self.__response + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + self.__response.close() + + +class AsyncResponseContextManager(Generic[_AsyncAPIResponseT]): + """Context manager for ensuring that a request is not made + until it is entered and that the response will always be closed + when the context manager exits + """ + + def __init__(self, api_request: Awaitable[_AsyncAPIResponseT]) -> None: + self._api_request = api_request + self.__response: _AsyncAPIResponseT | None = None + + async def __aenter__(self) -> _AsyncAPIResponseT: + self.__response = await self._api_request + return self.__response + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + if self.__response is not None: + await self.__response.close() + + +def to_streamed_response_wrapper(func: Callable[P, R]) -> Callable[P, ResponseContextManager[APIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[APIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], APIResponse[R]], make_request)) + + return wrapped + + +def async_to_streamed_response_wrapper( + func: Callable[P, Awaitable[R]], +) -> Callable[P, AsyncResponseContextManager[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support streaming and returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[AsyncAPIResponse[R]]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[AsyncAPIResponse[R]], make_request)) + + return wrapped + + +def to_custom_streamed_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, ResponseContextManager[_APIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> ResponseContextManager[_APIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = functools.partial(func, *args, **kwargs) + + return ResponseContextManager(cast(Callable[[], _APIResponseT], make_request)) + + return wrapped + + +def async_to_custom_streamed_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, AsyncResponseContextManager[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support streaming and returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncResponseContextManager[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "stream" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + make_request = func(*args, **kwargs) + + return AsyncResponseContextManager(cast(Awaitable[_AsyncAPIResponseT], make_request)) + + return wrapped + + +def to_raw_response_wrapper(func: Callable[P, R]) -> Callable[P, APIResponse[R]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> APIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(APIResponse[R], func(*args, **kwargs)) + + return wrapped + + +def async_to_raw_response_wrapper(func: Callable[P, Awaitable[R]]) -> Callable[P, Awaitable[AsyncAPIResponse[R]]]: + """Higher order function that takes one of our bound API methods and wraps it + to support returning the raw `APIResponse` object directly. + """ + + @functools.wraps(func) + async def wrapped(*args: P.args, **kwargs: P.kwargs) -> AsyncAPIResponse[R]: + extra_headers: dict[str, str] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + + kwargs["extra_headers"] = extra_headers + + return cast(AsyncAPIResponse[R], await func(*args, **kwargs)) + + return wrapped + + +def to_custom_raw_response_wrapper( + func: Callable[P, object], + response_cls: type[_APIResponseT], +) -> Callable[P, _APIResponseT]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> _APIResponseT: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(_APIResponseT, func(*args, **kwargs)) + + return wrapped + + +def async_to_custom_raw_response_wrapper( + func: Callable[P, Awaitable[object]], + response_cls: type[_AsyncAPIResponseT], +) -> Callable[P, Awaitable[_AsyncAPIResponseT]]: + """Higher order function that takes one of our bound API methods and an `APIResponse` class + and wraps the method to support returning the given response class directly. + + Note: the given `response_cls` *must* be concrete, e.g. `class BinaryAPIResponse(APIResponse[bytes])` + """ + + @functools.wraps(func) + def wrapped(*args: P.args, **kwargs: P.kwargs) -> Awaitable[_AsyncAPIResponseT]: + extra_headers: dict[str, Any] = {**(cast(Any, kwargs.get("extra_headers")) or {})} + extra_headers[RAW_RESPONSE_HEADER] = "raw" + extra_headers[OVERRIDE_CAST_TO_HEADER] = response_cls + + kwargs["extra_headers"] = extra_headers + + return cast(Awaitable[_AsyncAPIResponseT], func(*args, **kwargs)) + + return wrapped + + +def extract_response_type(typ: type[BaseAPIResponse[Any]]) -> type: + """Given a type like `APIResponse[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(APIResponse[bytes]): + ... + + extract_response_type(MyResponse) -> bytes + ``` + """ + return extract_type_var_from_base( + typ, + generic_bases=cast("tuple[type, ...]", (BaseAPIResponse, APIResponse, AsyncAPIResponse)), + index=0, + ) diff --git a/src/parallel/_streaming.py b/src/parallel/_streaming.py new file mode 100644 index 0000000..8550546 --- /dev/null +++ b/src/parallel/_streaming.py @@ -0,0 +1,338 @@ +# Note: initially copied from https://github.com/florimondmanca/httpx-sse/blob/master/src/httpx_sse/_decoders.py +from __future__ import annotations + +import json +import inspect +from types import TracebackType +from typing import TYPE_CHECKING, Any, Generic, TypeVar, Iterator, Optional, AsyncIterator, cast +from typing_extensions import Self, Protocol, TypeGuard, override, get_origin, runtime_checkable + +import httpx + +from ._utils import extract_type_var_from_base + +if TYPE_CHECKING: + from ._client import Parallel, AsyncParallel + from ._models import FinalRequestOptions + + +_T = TypeVar("_T") + + +class Stream(Generic[_T]): + """Provides the core interface to iterate over a synchronous stream response.""" + + response: httpx.Response + _options: Optional[FinalRequestOptions] = None + _decoder: SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: Parallel, + options: Optional[FinalRequestOptions] = None, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._options = options + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + def __next__(self) -> _T: + return self._iterator.__next__() + + def __iter__(self) -> Iterator[_T]: + for item in self._iterator: + yield item + + def _iter_events(self) -> Iterator[ServerSentEvent]: + yield from self._decoder.iter_bytes(self.response.iter_bytes()) + + def __stream__(self) -> Iterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + try: + for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + finally: + # Ensure the response is closed even if the consumer doesn't read all data + response.close() + + def __enter__(self) -> Self: + return self + + def __exit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + self.close() + + def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + self.response.close() + + +class AsyncStream(Generic[_T]): + """Provides the core interface to iterate over an asynchronous stream response.""" + + response: httpx.Response + _options: Optional[FinalRequestOptions] = None + _decoder: SSEDecoder | SSEBytesDecoder + + def __init__( + self, + *, + cast_to: type[_T], + response: httpx.Response, + client: AsyncParallel, + options: Optional[FinalRequestOptions] = None, + ) -> None: + self.response = response + self._cast_to = cast_to + self._client = client + self._options = options + self._decoder = client._make_sse_decoder() + self._iterator = self.__stream__() + + async def __anext__(self) -> _T: + return await self._iterator.__anext__() + + async def __aiter__(self) -> AsyncIterator[_T]: + async for item in self._iterator: + yield item + + async def _iter_events(self) -> AsyncIterator[ServerSentEvent]: + async for sse in self._decoder.aiter_bytes(self.response.aiter_bytes()): + yield sse + + async def __stream__(self) -> AsyncIterator[_T]: + cast_to = cast(Any, self._cast_to) + response = self.response + process_data = self._client._process_response_data + iterator = self._iter_events() + + try: + async for sse in iterator: + yield process_data(data=sse.json(), cast_to=cast_to, response=response) + finally: + # Ensure the response is closed even if the consumer doesn't read all data + await response.aclose() + + async def __aenter__(self) -> Self: + return self + + async def __aexit__( + self, + exc_type: type[BaseException] | None, + exc: BaseException | None, + exc_tb: TracebackType | None, + ) -> None: + await self.close() + + async def close(self) -> None: + """ + Close the response and release the connection. + + Automatically called if the response body is read to completion. + """ + await self.response.aclose() + + +class ServerSentEvent: + def __init__( + self, + *, + event: str | None = None, + data: str | None = None, + id: str | None = None, + retry: int | None = None, + ) -> None: + if data is None: + data = "" + + self._id = id + self._data = data + self._event = event or None + self._retry = retry + + @property + def event(self) -> str | None: + return self._event + + @property + def id(self) -> str | None: + return self._id + + @property + def retry(self) -> int | None: + return self._retry + + @property + def data(self) -> str: + return self._data + + def json(self) -> Any: + return json.loads(self.data) + + @override + def __repr__(self) -> str: + return f"ServerSentEvent(event={self.event}, data={self.data}, id={self.id}, retry={self.retry})" + + +class SSEDecoder: + _data: list[str] + _event: str | None + _retry: int | None + _last_event_id: str | None + + def __init__(self) -> None: + self._event = None + self._data = [] + self._last_event_id = None + self._retry = None + + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + for chunk in self._iter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + def _iter_chunks(self, iterator: Iterator[bytes]) -> Iterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + async def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + async for chunk in self._aiter_chunks(iterator): + # Split before decoding so splitlines() only uses \r and \n + for raw_line in chunk.splitlines(): + line = raw_line.decode("utf-8") + sse = self.decode(line) + if sse: + yield sse + + async def _aiter_chunks(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[bytes]: + """Given an iterator that yields raw binary data, iterate over it and yield individual SSE chunks""" + data = b"" + async for chunk in iterator: + for line in chunk.splitlines(keepends=True): + data += line + if data.endswith((b"\r\r", b"\n\n", b"\r\n\r\n")): + yield data + data = b"" + if data: + yield data + + def decode(self, line: str) -> ServerSentEvent | None: + # See: https://html.spec.whatwg.org/multipage/server-sent-events.html#event-stream-interpretation # noqa: E501 + + if not line: + if not self._event and not self._data and not self._last_event_id and self._retry is None: + return None + + sse = ServerSentEvent( + event=self._event, + data="\n".join(self._data), + id=self._last_event_id, + retry=self._retry, + ) + + # NOTE: as per the SSE spec, do not reset last_event_id. + self._event = None + self._data = [] + self._retry = None + + return sse + + if line.startswith(":"): + return None + + fieldname, _, value = line.partition(":") + + if value.startswith(" "): + value = value[1:] + + if fieldname == "event": + self._event = value + elif fieldname == "data": + self._data.append(value) + elif fieldname == "id": + if "\0" in value: + pass + else: + self._last_event_id = value + elif fieldname == "retry": + try: + self._retry = int(value) + except (TypeError, ValueError): + pass + else: + pass # Field is ignored. + + return None + + +@runtime_checkable +class SSEBytesDecoder(Protocol): + def iter_bytes(self, iterator: Iterator[bytes]) -> Iterator[ServerSentEvent]: + """Given an iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + def aiter_bytes(self, iterator: AsyncIterator[bytes]) -> AsyncIterator[ServerSentEvent]: + """Given an async iterator that yields raw binary data, iterate over it & yield every event encountered""" + ... + + +def is_stream_class_type(typ: type) -> TypeGuard[type[Stream[object]] | type[AsyncStream[object]]]: + """TypeGuard for determining whether or not the given type is a subclass of `Stream` / `AsyncStream`""" + origin = get_origin(typ) or typ + return inspect.isclass(origin) and issubclass(origin, (Stream, AsyncStream)) + + +def extract_stream_chunk_type( + stream_cls: type, + *, + failure_message: str | None = None, +) -> type: + """Given a type like `Stream[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyStream(Stream[bytes]): + ... + + extract_stream_chunk_type(MyStream) -> bytes + ``` + """ + from ._base_client import Stream, AsyncStream + + return extract_type_var_from_base( + stream_cls, + index=0, + generic_bases=cast("tuple[type, ...]", (Stream, AsyncStream)), + failure_message=failure_message, + ) diff --git a/src/parallel/_types.py b/src/parallel/_types.py new file mode 100644 index 0000000..12af1c0 --- /dev/null +++ b/src/parallel/_types.py @@ -0,0 +1,270 @@ +from __future__ import annotations + +from os import PathLike +from typing import ( + IO, + TYPE_CHECKING, + Any, + Dict, + List, + Type, + Tuple, + Union, + Mapping, + TypeVar, + Callable, + Iterable, + Iterator, + Optional, + Sequence, + AsyncIterable, +) +from typing_extensions import ( + Set, + Literal, + Protocol, + TypeAlias, + TypedDict, + SupportsIndex, + overload, + override, + runtime_checkable, +) + +import httpx +import pydantic +from httpx import URL, Proxy, Timeout, Response, BaseTransport, AsyncBaseTransport + +if TYPE_CHECKING: + from ._models import BaseModel + from ._response import APIResponse, AsyncAPIResponse + +Transport = BaseTransport +AsyncTransport = AsyncBaseTransport +Query = Mapping[str, object] +Body = object +AnyMapping = Mapping[str, object] +ModelT = TypeVar("ModelT", bound=pydantic.BaseModel) +_T = TypeVar("_T") + + +# Approximates httpx internal ProxiesTypes and RequestFiles types +# while adding support for `PathLike` instances +ProxiesDict = Dict["str | URL", Union[None, str, URL, Proxy]] +ProxiesTypes = Union[str, Proxy, ProxiesDict] +if TYPE_CHECKING: + Base64FileInput = Union[IO[bytes], PathLike[str]] + FileContent = Union[IO[bytes], bytes, PathLike[str]] +else: + Base64FileInput = Union[IO[bytes], PathLike] + FileContent = Union[IO[bytes], bytes, PathLike] # PathLike is not subscriptable in Python 3.8. + + +# Used for sending raw binary data / streaming data in request bodies +# e.g. for file uploads without multipart encoding +BinaryTypes = Union[bytes, bytearray, IO[bytes], Iterable[bytes]] +AsyncBinaryTypes = Union[bytes, bytearray, IO[bytes], AsyncIterable[bytes]] + +FileTypes = Union[ + # file (or bytes) + FileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], FileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], FileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], FileContent, Optional[str], Mapping[str, str]], +] +RequestFiles = Union[Mapping[str, FileTypes], Sequence[Tuple[str, FileTypes]]] + +# duplicate of the above but without our custom file support +HttpxFileContent = Union[IO[bytes], bytes] +HttpxFileTypes = Union[ + # file (or bytes) + HttpxFileContent, + # (filename, file (or bytes)) + Tuple[Optional[str], HttpxFileContent], + # (filename, file (or bytes), content_type) + Tuple[Optional[str], HttpxFileContent, Optional[str]], + # (filename, file (or bytes), content_type, headers) + Tuple[Optional[str], HttpxFileContent, Optional[str], Mapping[str, str]], +] +HttpxRequestFiles = Union[Mapping[str, HttpxFileTypes], Sequence[Tuple[str, HttpxFileTypes]]] + +# Workaround to support (cast_to: Type[ResponseT]) -> ResponseT +# where ResponseT includes `None`. In order to support directly +# passing `None`, overloads would have to be defined for every +# method that uses `ResponseT` which would lead to an unacceptable +# amount of code duplication and make it unreadable. See _base_client.py +# for example usage. +# +# This unfortunately means that you will either have +# to import this type and pass it explicitly: +# +# from parallel import NoneType +# client.get('/foo', cast_to=NoneType) +# +# or build it yourself: +# +# client.get('/foo', cast_to=type(None)) +if TYPE_CHECKING: + NoneType: Type[None] +else: + NoneType = type(None) + + +class RequestOptions(TypedDict, total=False): + headers: Headers + max_retries: int + timeout: float | Timeout | None + params: Query + extra_json: AnyMapping + idempotency_key: str + follow_redirects: bool + + +# Sentinel class used until PEP 0661 is accepted +class NotGiven: + """ + For parameters with a meaningful None value, we need to distinguish between + the user explicitly passing None, and the user not passing the parameter at + all. + + User code shouldn't need to use not_given directly. + + For example: + + ```py + def create(timeout: Timeout | None | NotGiven = not_given): ... + + + create(timeout=1) # 1s timeout + create(timeout=None) # No timeout + create() # Default timeout behavior + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + @override + def __repr__(self) -> str: + return "NOT_GIVEN" + + +not_given = NotGiven() +# for backwards compatibility: +NOT_GIVEN = NotGiven() + + +class Omit: + """ + To explicitly omit something from being sent in a request, use `omit`. + + ```py + # as the default `Content-Type` header is `application/json` that will be sent + client.post("/upload/files", files={"file": b"my raw file content"}) + + # you can't explicitly override the header as it has to be dynamically generated + # to look something like: 'multipart/form-data; boundary=0d8382fcf5f8c3be01ca2e11002d2983' + client.post(..., headers={"Content-Type": "multipart/form-data"}) + + # instead you can remove the default `application/json` header by passing omit + client.post(..., headers={"Content-Type": omit}) + ``` + """ + + def __bool__(self) -> Literal[False]: + return False + + +omit = Omit() + + +@runtime_checkable +class ModelBuilderProtocol(Protocol): + @classmethod + def build( + cls: type[_T], + *, + response: Response, + data: object, + ) -> _T: ... + + +Headers = Mapping[str, Union[str, Omit]] + + +class HeadersLikeProtocol(Protocol): + def get(self, __key: str) -> str | None: ... + + +HeadersLike = Union[Headers, HeadersLikeProtocol] + +ResponseT = TypeVar( + "ResponseT", + bound=Union[ + object, + str, + None, + "BaseModel", + List[Any], + Dict[str, Any], + Response, + ModelBuilderProtocol, + "APIResponse[Any]", + "AsyncAPIResponse[Any]", + ], +) + +StrBytesIntFloat = Union[str, bytes, int, float] + +# Note: copied from Pydantic +# https://github.com/pydantic/pydantic/blob/6f31f8f68ef011f84357330186f603ff295312fd/pydantic/main.py#L79 +IncEx: TypeAlias = Union[Set[int], Set[str], Mapping[int, Union["IncEx", bool]], Mapping[str, Union["IncEx", bool]]] + +PostParser = Callable[[Any], Any] + + +@runtime_checkable +class InheritsGeneric(Protocol): + """Represents a type that has inherited from `Generic` + + The `__orig_bases__` property can be used to determine the resolved + type variable for a given base class. + """ + + __orig_bases__: tuple[_GenericAlias] + + +class _GenericAlias(Protocol): + __origin__: type[object] + + +class HttpxSendArgs(TypedDict, total=False): + auth: httpx.Auth + follow_redirects: bool + + +_T_co = TypeVar("_T_co", covariant=True) + + +if TYPE_CHECKING: + # This works because str.__contains__ does not accept object (either in typeshed or at runtime) + # https://github.com/hauntsaninja/useful_types/blob/5e9710f3875107d068e7679fd7fec9cfab0eff3b/useful_types/__init__.py#L285 + # + # Note: index() and count() methods are intentionally omitted to allow pyright to properly + # infer TypedDict types when dict literals are used in lists assigned to SequenceNotStr. + class SequenceNotStr(Protocol[_T_co]): + @overload + def __getitem__(self, index: SupportsIndex, /) -> _T_co: ... + @overload + def __getitem__(self, index: slice, /) -> Sequence[_T_co]: ... + def __contains__(self, value: object, /) -> bool: ... + def __len__(self) -> int: ... + def __iter__(self) -> Iterator[_T_co]: ... + def __reversed__(self) -> Iterator[_T_co]: ... +else: + # just point this to a normal `Sequence` at runtime to avoid having to special case + # deserializing our custom sequence type + SequenceNotStr = Sequence diff --git a/src/parallel/_utils/__init__.py b/src/parallel/_utils/__init__.py new file mode 100644 index 0000000..10cb66d --- /dev/null +++ b/src/parallel/_utils/__init__.py @@ -0,0 +1,65 @@ +from ._path import path_template as path_template +from ._sync import asyncify as asyncify +from ._proxy import LazyProxy as LazyProxy +from ._utils import ( + flatten as flatten, + is_dict as is_dict, + is_list as is_list, + is_given as is_given, + is_tuple as is_tuple, + json_safe as json_safe, + lru_cache as lru_cache, + is_mapping as is_mapping, + is_tuple_t as is_tuple_t, + is_iterable as is_iterable, + is_sequence as is_sequence, + coerce_float as coerce_float, + is_mapping_t as is_mapping_t, + removeprefix as removeprefix, + removesuffix as removesuffix, + extract_files as extract_files, + is_sequence_t as is_sequence_t, + required_args as required_args, + coerce_boolean as coerce_boolean, + coerce_integer as coerce_integer, + file_from_path as file_from_path, + strip_not_given as strip_not_given, + deepcopy_minimal as deepcopy_minimal, + get_async_library as get_async_library, + maybe_coerce_float as maybe_coerce_float, + get_required_header as get_required_header, + maybe_coerce_boolean as maybe_coerce_boolean, + maybe_coerce_integer as maybe_coerce_integer, +) +from ._compat import ( + get_args as get_args, + is_union as is_union, + get_origin as get_origin, + is_typeddict as is_typeddict, + is_literal_type as is_literal_type, +) +from ._typing import ( + is_list_type as is_list_type, + is_union_type as is_union_type, + extract_type_arg as extract_type_arg, + is_iterable_type as is_iterable_type, + is_required_type as is_required_type, + is_sequence_type as is_sequence_type, + is_annotated_type as is_annotated_type, + is_type_alias_type as is_type_alias_type, + strip_annotated_type as strip_annotated_type, + extract_type_var_from_base as extract_type_var_from_base, +) +from ._streams import consume_sync_iterator as consume_sync_iterator, consume_async_iterator as consume_async_iterator +from ._transform import ( + PropertyInfo as PropertyInfo, + transform as transform, + async_transform as async_transform, + maybe_transform as maybe_transform, + async_maybe_transform as async_maybe_transform, +) +from ._reflection import ( + function_has_argument as function_has_argument, + assert_signatures_in_sync as assert_signatures_in_sync, +) +from ._datetime_parse import parse_date as parse_date, parse_datetime as parse_datetime diff --git a/src/parallel/_utils/_compat.py b/src/parallel/_utils/_compat.py new file mode 100644 index 0000000..2c70b29 --- /dev/null +++ b/src/parallel/_utils/_compat.py @@ -0,0 +1,45 @@ +from __future__ import annotations + +import sys +import typing_extensions +from typing import Any, Type, Union, Literal, Optional +from datetime import date, datetime +from typing_extensions import get_args as _get_args, get_origin as _get_origin + +from .._types import StrBytesIntFloat +from ._datetime_parse import parse_date as _parse_date, parse_datetime as _parse_datetime + +_LITERAL_TYPES = {Literal, typing_extensions.Literal} + + +def get_args(tp: type[Any]) -> tuple[Any, ...]: + return _get_args(tp) + + +def get_origin(tp: type[Any]) -> type[Any] | None: + return _get_origin(tp) + + +def is_union(tp: Optional[Type[Any]]) -> bool: + if sys.version_info < (3, 10): + return tp is Union # type: ignore[comparison-overlap] + else: + import types + + return tp is Union or tp is types.UnionType # type: ignore[comparison-overlap] + + +def is_typeddict(tp: Type[Any]) -> bool: + return typing_extensions.is_typeddict(tp) + + +def is_literal_type(tp: Type[Any]) -> bool: + return get_origin(tp) in _LITERAL_TYPES + + +def parse_date(value: Union[date, StrBytesIntFloat]) -> date: + return _parse_date(value) + + +def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: + return _parse_datetime(value) diff --git a/src/parallel/_utils/_datetime_parse.py b/src/parallel/_utils/_datetime_parse.py new file mode 100644 index 0000000..7cb9d9e --- /dev/null +++ b/src/parallel/_utils/_datetime_parse.py @@ -0,0 +1,136 @@ +""" +This file contains code from https://github.com/pydantic/pydantic/blob/main/pydantic/v1/datetime_parse.py +without the Pydantic v1 specific errors. +""" + +from __future__ import annotations + +import re +from typing import Dict, Union, Optional +from datetime import date, datetime, timezone, timedelta + +from .._types import StrBytesIntFloat + +date_expr = r"(?P\d{4})-(?P\d{1,2})-(?P\d{1,2})" +time_expr = ( + r"(?P\d{1,2}):(?P\d{1,2})" + r"(?::(?P\d{1,2})(?:\.(?P\d{1,6})\d{0,6})?)?" + r"(?PZ|[+-]\d{2}(?::?\d{2})?)?$" +) + +date_re = re.compile(f"{date_expr}$") +datetime_re = re.compile(f"{date_expr}[T ]{time_expr}") + + +EPOCH = datetime(1970, 1, 1) +# if greater than this, the number is in ms, if less than or equal it's in seconds +# (in seconds this is 11th October 2603, in ms it's 20th August 1970) +MS_WATERSHED = int(2e10) +# slightly more than datetime.max in ns - (datetime.max - EPOCH).total_seconds() * 1e9 +MAX_NUMBER = int(3e20) + + +def _get_numeric(value: StrBytesIntFloat, native_expected_type: str) -> Union[None, int, float]: + if isinstance(value, (int, float)): + return value + try: + return float(value) + except ValueError: + return None + except TypeError: + raise TypeError(f"invalid type; expected {native_expected_type}, string, bytes, int or float") from None + + +def _from_unix_seconds(seconds: Union[int, float]) -> datetime: + if seconds > MAX_NUMBER: + return datetime.max + elif seconds < -MAX_NUMBER: + return datetime.min + + while abs(seconds) > MS_WATERSHED: + seconds /= 1000 + dt = EPOCH + timedelta(seconds=seconds) + return dt.replace(tzinfo=timezone.utc) + + +def _parse_timezone(value: Optional[str]) -> Union[None, int, timezone]: + if value == "Z": + return timezone.utc + elif value is not None: + offset_mins = int(value[-2:]) if len(value) > 3 else 0 + offset = 60 * int(value[1:3]) + offset_mins + if value[0] == "-": + offset = -offset + return timezone(timedelta(minutes=offset)) + else: + return None + + +def parse_datetime(value: Union[datetime, StrBytesIntFloat]) -> datetime: + """ + Parse a datetime/int/float/string and return a datetime.datetime. + + This function supports time zone offsets. When the input contains one, + the output uses a timezone with a fixed offset from UTC. + + Raise ValueError if the input is well formatted but not a valid datetime. + Raise ValueError if the input isn't well formatted. + """ + if isinstance(value, datetime): + return value + + number = _get_numeric(value, "datetime") + if number is not None: + return _from_unix_seconds(number) + + if isinstance(value, bytes): + value = value.decode() + + assert not isinstance(value, (float, int)) + + match = datetime_re.match(value) + if match is None: + raise ValueError("invalid datetime format") + + kw = match.groupdict() + if kw["microsecond"]: + kw["microsecond"] = kw["microsecond"].ljust(6, "0") + + tzinfo = _parse_timezone(kw.pop("tzinfo")) + kw_: Dict[str, Union[None, int, timezone]] = {k: int(v) for k, v in kw.items() if v is not None} + kw_["tzinfo"] = tzinfo + + return datetime(**kw_) # type: ignore + + +def parse_date(value: Union[date, StrBytesIntFloat]) -> date: + """ + Parse a date/int/float/string and return a datetime.date. + + Raise ValueError if the input is well formatted but not a valid date. + Raise ValueError if the input isn't well formatted. + """ + if isinstance(value, date): + if isinstance(value, datetime): + return value.date() + else: + return value + + number = _get_numeric(value, "date") + if number is not None: + return _from_unix_seconds(number).date() + + if isinstance(value, bytes): + value = value.decode() + + assert not isinstance(value, (float, int)) + match = date_re.match(value) + if match is None: + raise ValueError("invalid date format") + + kw = {k: int(v) for k, v in match.groupdict().items()} + + try: + return date(**kw) + except ValueError: + raise ValueError("invalid date format") from None diff --git a/src/parallel/_utils/_json.py b/src/parallel/_utils/_json.py new file mode 100644 index 0000000..6058421 --- /dev/null +++ b/src/parallel/_utils/_json.py @@ -0,0 +1,35 @@ +import json +from typing import Any +from datetime import datetime +from typing_extensions import override + +import pydantic + +from .._compat import model_dump + + +def openapi_dumps(obj: Any) -> bytes: + """ + Serialize an object to UTF-8 encoded JSON bytes. + + Extends the standard json.dumps with support for additional types + commonly used in the SDK, such as `datetime`, `pydantic.BaseModel`, etc. + """ + return json.dumps( + obj, + cls=_CustomEncoder, + # Uses the same defaults as httpx's JSON serialization + ensure_ascii=False, + separators=(",", ":"), + allow_nan=False, + ).encode() + + +class _CustomEncoder(json.JSONEncoder): + @override + def default(self, o: Any) -> Any: + if isinstance(o, datetime): + return o.isoformat() + if isinstance(o, pydantic.BaseModel): + return model_dump(o, exclude_unset=True, mode="json", by_alias=True) + return super().default(o) diff --git a/src/parallel/_utils/_logs.py b/src/parallel/_utils/_logs.py new file mode 100644 index 0000000..a020904 --- /dev/null +++ b/src/parallel/_utils/_logs.py @@ -0,0 +1,25 @@ +import os +import logging + +logger: logging.Logger = logging.getLogger("parallel") +httpx_logger: logging.Logger = logging.getLogger("httpx") + + +def _basic_config() -> None: + # e.g. [2023-10-05 14:12:26 - parallel._base_client:818 - DEBUG] HTTP Request: POST http://127.0.0.1:4010/foo/bar "200 OK" + logging.basicConfig( + format="[%(asctime)s - %(name)s:%(lineno)d - %(levelname)s] %(message)s", + datefmt="%Y-%m-%d %H:%M:%S", + ) + + +def setup_logging() -> None: + env = os.environ.get("PARALLEL_LOG") + if env == "debug": + _basic_config() + logger.setLevel(logging.DEBUG) + httpx_logger.setLevel(logging.DEBUG) + elif env == "info": + _basic_config() + logger.setLevel(logging.INFO) + httpx_logger.setLevel(logging.INFO) diff --git a/src/parallel/_utils/_path.py b/src/parallel/_utils/_path.py new file mode 100644 index 0000000..4d6e1e4 --- /dev/null +++ b/src/parallel/_utils/_path.py @@ -0,0 +1,127 @@ +from __future__ import annotations + +import re +from typing import ( + Any, + Mapping, + Callable, +) +from urllib.parse import quote + +# Matches '.' or '..' where each dot is either literal or percent-encoded (%2e / %2E). +_DOT_SEGMENT_RE = re.compile(r"^(?:\.|%2[eE]){1,2}$") + +_PLACEHOLDER_RE = re.compile(r"\{(\w+)\}") + + +def _quote_path_segment_part(value: str) -> str: + """Percent-encode `value` for use in a URI path segment. + + Considers characters not in `pchar` set from RFC 3986 §3.3 to be unsafe. + https://datatracker.ietf.org/doc/html/rfc3986#section-3.3 + """ + # quote() already treats unreserved characters (letters, digits, and -._~) + # as safe, so we only need to add sub-delims, ':', and '@'. + # Notably, unlike the default `safe` for quote(), / is unsafe and must be quoted. + return quote(value, safe="!$&'()*+,;=:@") + + +def _quote_query_part(value: str) -> str: + """Percent-encode `value` for use in a URI query string. + + Considers &, = and characters not in `query` set from RFC 3986 §3.4 to be unsafe. + https://datatracker.ietf.org/doc/html/rfc3986#section-3.4 + """ + return quote(value, safe="!$'()*+,;:@/?") + + +def _quote_fragment_part(value: str) -> str: + """Percent-encode `value` for use in a URI fragment. + + Considers characters not in `fragment` set from RFC 3986 §3.5 to be unsafe. + https://datatracker.ietf.org/doc/html/rfc3986#section-3.5 + """ + return quote(value, safe="!$&'()*+,;=:@/?") + + +def _interpolate( + template: str, + values: Mapping[str, Any], + quoter: Callable[[str], str], +) -> str: + """Replace {name} placeholders in `template`, quoting each value with `quoter`. + + Placeholder names are looked up in `values`. + + Raises: + KeyError: If a placeholder is not found in `values`. + """ + # re.split with a capturing group returns alternating + # [text, name, text, name, ..., text] elements. + parts = _PLACEHOLDER_RE.split(template) + + for i in range(1, len(parts), 2): + name = parts[i] + if name not in values: + raise KeyError(f"a value for placeholder {{{name}}} was not provided") + val = values[name] + if val is None: + parts[i] = "null" + elif isinstance(val, bool): + parts[i] = "true" if val else "false" + else: + parts[i] = quoter(str(values[name])) + + return "".join(parts) + + +def path_template(template: str, /, **kwargs: Any) -> str: + """Interpolate {name} placeholders in `template` from keyword arguments. + + Args: + template: The template string containing {name} placeholders. + **kwargs: Keyword arguments to interpolate into the template. + + Returns: + The template with placeholders interpolated and percent-encoded. + + Safe characters for percent-encoding are dependent on the URI component. + Placeholders in path and fragment portions are percent-encoded where the `segment` + and `fragment` sets from RFC 3986 respectively are considered safe. + Placeholders in the query portion are percent-encoded where the `query` set from + RFC 3986 §3.3 is considered safe except for = and & characters. + + Raises: + KeyError: If a placeholder is not found in `kwargs`. + ValueError: If resulting path contains /./ or /../ segments (including percent-encoded dot-segments). + """ + # Split the template into path, query, and fragment portions. + fragment_template: str | None = None + query_template: str | None = None + + rest = template + if "#" in rest: + rest, fragment_template = rest.split("#", 1) + if "?" in rest: + rest, query_template = rest.split("?", 1) + path_template = rest + + # Interpolate each portion with the appropriate quoting rules. + path_result = _interpolate(path_template, kwargs, _quote_path_segment_part) + + # Reject dot-segments (. and ..) in the final assembled path. The check + # runs after interpolation so that adjacent placeholders or a mix of static + # text and placeholders that together form a dot-segment are caught. + # Also reject percent-encoded dot-segments to protect against incorrectly + # implemented normalization in servers/proxies. + for segment in path_result.split("/"): + if _DOT_SEGMENT_RE.match(segment): + raise ValueError(f"Constructed path {path_result!r} contains dot-segment {segment!r} which is not allowed") + + result = path_result + if query_template is not None: + result += "?" + _interpolate(query_template, kwargs, _quote_query_part) + if fragment_template is not None: + result += "#" + _interpolate(fragment_template, kwargs, _quote_fragment_part) + + return result diff --git a/src/parallel/_utils/_proxy.py b/src/parallel/_utils/_proxy.py new file mode 100644 index 0000000..0f239a3 --- /dev/null +++ b/src/parallel/_utils/_proxy.py @@ -0,0 +1,65 @@ +from __future__ import annotations + +from abc import ABC, abstractmethod +from typing import Generic, TypeVar, Iterable, cast +from typing_extensions import override + +T = TypeVar("T") + + +class LazyProxy(Generic[T], ABC): + """Implements data methods to pretend that an instance is another instance. + + This includes forwarding attribute access and other methods. + """ + + # Note: we have to special case proxies that themselves return proxies + # to support using a proxy as a catch-all for any random access, e.g. `proxy.foo.bar.baz` + + def __getattr__(self, attr: str) -> object: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied # pyright: ignore + return getattr(proxied, attr) + + @override + def __repr__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return repr(self.__get_proxied__()) + + @override + def __str__(self) -> str: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return proxied.__class__.__name__ + return str(proxied) + + @override + def __dir__(self) -> Iterable[str]: + proxied = self.__get_proxied__() + if isinstance(proxied, LazyProxy): + return [] + return proxied.__dir__() + + @property # type: ignore + @override + def __class__(self) -> type: # pyright: ignore + try: + proxied = self.__get_proxied__() + except Exception: + return type(self) + if issubclass(type(proxied), LazyProxy): + return type(proxied) + return proxied.__class__ + + def __get_proxied__(self) -> T: + return self.__load__() + + def __as_proxied__(self) -> T: + """Helper method that returns the current proxy, typed as the loaded object""" + return cast(T, self) + + @abstractmethod + def __load__(self) -> T: ... diff --git a/src/parallel/_utils/_reflection.py b/src/parallel/_utils/_reflection.py new file mode 100644 index 0000000..89aa712 --- /dev/null +++ b/src/parallel/_utils/_reflection.py @@ -0,0 +1,42 @@ +from __future__ import annotations + +import inspect +from typing import Any, Callable + + +def function_has_argument(func: Callable[..., Any], arg_name: str) -> bool: + """Returns whether or not the given function has a specific parameter""" + sig = inspect.signature(func) + return arg_name in sig.parameters + + +def assert_signatures_in_sync( + source_func: Callable[..., Any], + check_func: Callable[..., Any], + *, + exclude_params: set[str] = set(), +) -> None: + """Ensure that the signature of the second function matches the first.""" + + check_sig = inspect.signature(check_func) + source_sig = inspect.signature(source_func) + + errors: list[str] = [] + + for name, source_param in source_sig.parameters.items(): + if name in exclude_params: + continue + + custom_param = check_sig.parameters.get(name) + if not custom_param: + errors.append(f"the `{name}` param is missing") + continue + + if custom_param.annotation != source_param.annotation: + errors.append( + f"types for the `{name}` param are do not match; source={repr(source_param.annotation)} checking={repr(custom_param.annotation)}" + ) + continue + + if errors: + raise AssertionError(f"{len(errors)} errors encountered when comparing signatures:\n\n" + "\n\n".join(errors)) diff --git a/src/parallel/_utils/_resources_proxy.py b/src/parallel/_utils/_resources_proxy.py new file mode 100644 index 0000000..9cd4f71 --- /dev/null +++ b/src/parallel/_utils/_resources_proxy.py @@ -0,0 +1,24 @@ +from __future__ import annotations + +from typing import Any +from typing_extensions import override + +from ._proxy import LazyProxy + + +class ResourcesProxy(LazyProxy[Any]): + """A proxy for the `parallel.resources` module. + + This is used so that we can lazily import `parallel.resources` only when + needed *and* so that users can just import `parallel` and reference `parallel.resources` + """ + + @override + def __load__(self) -> Any: + import importlib + + mod = importlib.import_module("parallel.resources") + return mod + + +resources = ResourcesProxy().__as_proxied__() diff --git a/src/parallel/_utils/_streams.py b/src/parallel/_utils/_streams.py new file mode 100644 index 0000000..f4a0208 --- /dev/null +++ b/src/parallel/_utils/_streams.py @@ -0,0 +1,12 @@ +from typing import Any +from typing_extensions import Iterator, AsyncIterator + + +def consume_sync_iterator(iterator: Iterator[Any]) -> None: + for _ in iterator: + ... + + +async def consume_async_iterator(iterator: AsyncIterator[Any]) -> None: + async for _ in iterator: + ... diff --git a/src/parallel/_utils/_sync.py b/src/parallel/_utils/_sync.py new file mode 100644 index 0000000..f6027c1 --- /dev/null +++ b/src/parallel/_utils/_sync.py @@ -0,0 +1,58 @@ +from __future__ import annotations + +import asyncio +import functools +from typing import TypeVar, Callable, Awaitable +from typing_extensions import ParamSpec + +import anyio +import sniffio +import anyio.to_thread + +T_Retval = TypeVar("T_Retval") +T_ParamSpec = ParamSpec("T_ParamSpec") + + +async def to_thread( + func: Callable[T_ParamSpec, T_Retval], /, *args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs +) -> T_Retval: + if sniffio.current_async_library() == "asyncio": + return await asyncio.to_thread(func, *args, **kwargs) + + return await anyio.to_thread.run_sync( + functools.partial(func, *args, **kwargs), + ) + + +# inspired by `asyncer`, https://github.com/tiangolo/asyncer +def asyncify(function: Callable[T_ParamSpec, T_Retval]) -> Callable[T_ParamSpec, Awaitable[T_Retval]]: + """ + Take a blocking function and create an async one that receives the same + positional and keyword arguments. + + Usage: + + ```python + def blocking_func(arg1, arg2, kwarg1=None): + # blocking code + return result + + + result = asyncify(blocking_function)(arg1, arg2, kwarg1=value1) + ``` + + ## Arguments + + `function`: a blocking regular callable (e.g. a function) + + ## Return + + An async function that takes the same positional and keyword arguments as the + original one, that when called runs the same original function in a thread worker + and returns the result. + """ + + async def wrapper(*args: T_ParamSpec.args, **kwargs: T_ParamSpec.kwargs) -> T_Retval: + return await to_thread(function, *args, **kwargs) + + return wrapper diff --git a/src/parallel/_utils/_transform.py b/src/parallel/_utils/_transform.py new file mode 100644 index 0000000..5207549 --- /dev/null +++ b/src/parallel/_utils/_transform.py @@ -0,0 +1,457 @@ +from __future__ import annotations + +import io +import base64 +import pathlib +from typing import Any, Mapping, TypeVar, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, override, get_type_hints as _get_type_hints + +import anyio +import pydantic + +from ._utils import ( + is_list, + is_given, + lru_cache, + is_mapping, + is_iterable, + is_sequence, +) +from .._files import is_base64_file_input +from ._compat import get_origin, is_typeddict +from ._typing import ( + is_list_type, + is_union_type, + extract_type_arg, + is_iterable_type, + is_required_type, + is_sequence_type, + is_annotated_type, + strip_annotated_type, +) + +_T = TypeVar("_T") + + +# TODO: support for drilling globals() and locals() +# TODO: ensure works correctly with forward references in all cases + + +PropertyFormat = Literal["iso8601", "base64", "custom"] + + +class PropertyInfo: + """Metadata class to be used in Annotated types to provide information about a given type. + + For example: + + class MyParams(TypedDict): + account_holder_name: Annotated[str, PropertyInfo(alias='accountHolderName')] + + This means that {'account_holder_name': 'Robert'} will be transformed to {'accountHolderName': 'Robert'} before being sent to the API. + """ + + alias: str | None + format: PropertyFormat | None + format_template: str | None + discriminator: str | None + + def __init__( + self, + *, + alias: str | None = None, + format: PropertyFormat | None = None, + format_template: str | None = None, + discriminator: str | None = None, + ) -> None: + self.alias = alias + self.format = format + self.format_template = format_template + self.discriminator = discriminator + + @override + def __repr__(self) -> str: + return f"{self.__class__.__name__}(alias='{self.alias}', format={self.format}, format_template='{self.format_template}', discriminator='{self.discriminator}')" + + +def maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `transform()` that allows `None` to be passed. + + See `transform()` for more details. + """ + if data is None: + return None + return transform(data, expected_type) + + +# Wrapper over _transform_recursive providing fake types +def transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = _transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +@lru_cache(maxsize=8096) +def _get_annotated_type(type_: type) -> type | None: + """If the given type is an `Annotated` type then it is returned, if not `None` is returned. + + This also unwraps the type when applicable, e.g. `Required[Annotated[T, ...]]` + """ + if is_required_type(type_): + # Unwrap `Required[Annotated[T, ...]]` to `Annotated[T, ...]` + type_ = get_args(type_)[0] + + if is_annotated_type(type_): + return type_ + + return None + + +def _maybe_transform_key(key: str, type_: type) -> str: + """Transform the given `data` based on the annotations provided in `type_`. + + Note: this function only looks at `Annotated` types that contain `PropertyInfo` metadata. + """ + annotated_type = _get_annotated_type(type_) + if annotated_type is None: + # no `Annotated` definition for this type, no transformation needed + return key + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.alias is not None: + return annotation.alias + + return key + + +def _no_transform_needed(annotation: type) -> bool: + return annotation == float or annotation == int + + +def _transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + from .._compat import model_dump + + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return _transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + # Sequence[T] + or (is_sequence_type(stripped_type) and is_sequence(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = _transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return _format_data(data, annotation.format, annotation.format_template) + + return data + + +def _format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = data.read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +def _transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include omitted values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = _transform_recursive(value, annotation=type_) + return result + + +async def async_maybe_transform( + data: object, + expected_type: object, +) -> Any | None: + """Wrapper over `async_transform()` that allows `None` to be passed. + + See `async_transform()` for more details. + """ + if data is None: + return None + return await async_transform(data, expected_type) + + +async def async_transform( + data: _T, + expected_type: object, +) -> _T: + """Transform dictionaries based off of type information from the given type, for example: + + ```py + class Params(TypedDict, total=False): + card_id: Required[Annotated[str, PropertyInfo(alias="cardID")]] + + + transformed = transform({"card_id": ""}, Params) + # {'cardID': ''} + ``` + + Any keys / data that does not have type information given will be included as is. + + It should be noted that the transformations that this function does are not represented in the type system. + """ + transformed = await _async_transform_recursive(data, annotation=cast(type, expected_type)) + return cast(_T, transformed) + + +async def _async_transform_recursive( + data: object, + *, + annotation: type, + inner_type: type | None = None, +) -> object: + """Transform the given data against the expected type. + + Args: + annotation: The direct type annotation given to the particular piece of data. + This may or may not be wrapped in metadata types, e.g. `Required[T]`, `Annotated[T, ...]` etc + + inner_type: If applicable, this is the "inside" type. This is useful in certain cases where the outside type + is a container type such as `List[T]`. In that case `inner_type` should be set to `T` so that each entry in + the list can be transformed using the metadata from the container type. + + Defaults to the same value as the `annotation` argument. + """ + from .._compat import model_dump + + if inner_type is None: + inner_type = annotation + + stripped_type = strip_annotated_type(inner_type) + origin = get_origin(stripped_type) or stripped_type + if is_typeddict(stripped_type) and is_mapping(data): + return await _async_transform_typeddict(data, stripped_type) + + if origin == dict and is_mapping(data): + items_type = get_args(stripped_type)[1] + return {key: _transform_recursive(value, annotation=items_type) for key, value in data.items()} + + if ( + # List[T] + (is_list_type(stripped_type) and is_list(data)) + # Iterable[T] + or (is_iterable_type(stripped_type) and is_iterable(data) and not isinstance(data, str)) + # Sequence[T] + or (is_sequence_type(stripped_type) and is_sequence(data) and not isinstance(data, str)) + ): + # dicts are technically iterable, but it is an iterable on the keys of the dict and is not usually + # intended as an iterable, so we don't transform it. + if isinstance(data, dict): + return cast(object, data) + + inner_type = extract_type_arg(stripped_type, 0) + if _no_transform_needed(inner_type): + # for some types there is no need to transform anything, so we can get a small + # perf boost from skipping that work. + # + # but we still need to convert to a list to ensure the data is json-serializable + if is_list(data): + return data + return list(data) + + return [await _async_transform_recursive(d, annotation=annotation, inner_type=inner_type) for d in data] + + if is_union_type(stripped_type): + # For union types we run the transformation against all subtypes to ensure that everything is transformed. + # + # TODO: there may be edge cases where the same normalized field name will transform to two different names + # in different subtypes. + for subtype in get_args(stripped_type): + data = await _async_transform_recursive(data, annotation=annotation, inner_type=subtype) + return data + + if isinstance(data, pydantic.BaseModel): + return model_dump(data, exclude_unset=True, mode="json") + + annotated_type = _get_annotated_type(annotation) + if annotated_type is None: + return data + + # ignore the first argument as it is the actual type + annotations = get_args(annotated_type)[1:] + for annotation in annotations: + if isinstance(annotation, PropertyInfo) and annotation.format is not None: + return await _async_format_data(data, annotation.format, annotation.format_template) + + return data + + +async def _async_format_data(data: object, format_: PropertyFormat, format_template: str | None) -> object: + if isinstance(data, (date, datetime)): + if format_ == "iso8601": + return data.isoformat() + + if format_ == "custom" and format_template is not None: + return data.strftime(format_template) + + if format_ == "base64" and is_base64_file_input(data): + binary: str | bytes | None = None + + if isinstance(data, pathlib.Path): + binary = await anyio.Path(data).read_bytes() + elif isinstance(data, io.IOBase): + binary = data.read() + + if isinstance(binary, str): # type: ignore[unreachable] + binary = binary.encode() + + if not isinstance(binary, bytes): + raise RuntimeError(f"Could not read bytes from {data}; Received {type(binary)}") + + return base64.b64encode(binary).decode("ascii") + + return data + + +async def _async_transform_typeddict( + data: Mapping[str, object], + expected_type: type, +) -> Mapping[str, object]: + result: dict[str, object] = {} + annotations = get_type_hints(expected_type, include_extras=True) + for key, value in data.items(): + if not is_given(value): + # we don't need to include omitted values here as they'll + # be stripped out before the request is sent anyway + continue + + type_ = annotations.get(key) + if type_ is None: + # we do not have a type annotation for this field, leave it as is + result[key] = value + else: + result[_maybe_transform_key(key, type_)] = await _async_transform_recursive(value, annotation=type_) + return result + + +@lru_cache(maxsize=8096) +def get_type_hints( + obj: Any, + globalns: dict[str, Any] | None = None, + localns: Mapping[str, Any] | None = None, + include_extras: bool = False, +) -> dict[str, Any]: + return _get_type_hints(obj, globalns=globalns, localns=localns, include_extras=include_extras) diff --git a/src/parallel/_utils/_typing.py b/src/parallel/_utils/_typing.py new file mode 100644 index 0000000..193109f --- /dev/null +++ b/src/parallel/_utils/_typing.py @@ -0,0 +1,156 @@ +from __future__ import annotations + +import sys +import typing +import typing_extensions +from typing import Any, TypeVar, Iterable, cast +from collections import abc as _c_abc +from typing_extensions import ( + TypeIs, + Required, + Annotated, + get_args, + get_origin, +) + +from ._utils import lru_cache +from .._types import InheritsGeneric +from ._compat import is_union as _is_union + + +def is_annotated_type(typ: type) -> bool: + return get_origin(typ) == Annotated + + +def is_list_type(typ: type) -> bool: + return (get_origin(typ) or typ) == list + + +def is_sequence_type(typ: type) -> bool: + origin = get_origin(typ) or typ + return origin == typing_extensions.Sequence or origin == typing.Sequence or origin == _c_abc.Sequence + + +def is_iterable_type(typ: type) -> bool: + """If the given type is `typing.Iterable[T]`""" + origin = get_origin(typ) or typ + return origin == Iterable or origin == _c_abc.Iterable + + +def is_union_type(typ: type) -> bool: + return _is_union(get_origin(typ)) + + +def is_required_type(typ: type) -> bool: + return get_origin(typ) == Required + + +def is_typevar(typ: type) -> bool: + # type ignore is required because type checkers + # think this expression will always return False + return type(typ) == TypeVar # type: ignore + + +_TYPE_ALIAS_TYPES: tuple[type[typing_extensions.TypeAliasType], ...] = (typing_extensions.TypeAliasType,) +if sys.version_info >= (3, 12): + _TYPE_ALIAS_TYPES = (*_TYPE_ALIAS_TYPES, typing.TypeAliasType) + + +def is_type_alias_type(tp: Any, /) -> TypeIs[typing_extensions.TypeAliasType]: + """Return whether the provided argument is an instance of `TypeAliasType`. + + ```python + type Int = int + is_type_alias_type(Int) + # > True + Str = TypeAliasType("Str", str) + is_type_alias_type(Str) + # > True + ``` + """ + return isinstance(tp, _TYPE_ALIAS_TYPES) + + +# Extracts T from Annotated[T, ...] or from Required[Annotated[T, ...]] +@lru_cache(maxsize=8096) +def strip_annotated_type(typ: type) -> type: + if is_required_type(typ) or is_annotated_type(typ): + return strip_annotated_type(cast(type, get_args(typ)[0])) + + return typ + + +def extract_type_arg(typ: type, index: int) -> type: + args = get_args(typ) + try: + return cast(type, args[index]) + except IndexError as err: + raise RuntimeError(f"Expected type {typ} to have a type argument at index {index} but it did not") from err + + +def extract_type_var_from_base( + typ: type, + *, + generic_bases: tuple[type, ...], + index: int, + failure_message: str | None = None, +) -> type: + """Given a type like `Foo[T]`, returns the generic type variable `T`. + + This also handles the case where a concrete subclass is given, e.g. + ```py + class MyResponse(Foo[bytes]): + ... + + extract_type_var(MyResponse, bases=(Foo,), index=0) -> bytes + ``` + + And where a generic subclass is given: + ```py + _T = TypeVar('_T') + class MyResponse(Foo[_T]): + ... + + extract_type_var(MyResponse[bytes], bases=(Foo,), index=0) -> bytes + ``` + """ + cls = cast(object, get_origin(typ) or typ) + if cls in generic_bases: # pyright: ignore[reportUnnecessaryContains] + # we're given the class directly + return extract_type_arg(typ, index) + + # if a subclass is given + # --- + # this is needed as __orig_bases__ is not present in the typeshed stubs + # because it is intended to be for internal use only, however there does + # not seem to be a way to resolve generic TypeVars for inherited subclasses + # without using it. + if isinstance(cls, InheritsGeneric): + target_base_class: Any | None = None + for base in cls.__orig_bases__: + if base.__origin__ in generic_bases: + target_base_class = base + break + + if target_base_class is None: + raise RuntimeError( + "Could not find the generic base class;\n" + "This should never happen;\n" + f"Does {cls} inherit from one of {generic_bases} ?" + ) + + extracted = extract_type_arg(target_base_class, index) + if is_typevar(extracted): + # If the extracted type argument is itself a type variable + # then that means the subclass itself is generic, so we have + # to resolve the type argument from the class itself, not + # the base class. + # + # Note: if there is more than 1 type argument, the subclass could + # change the ordering of the type arguments, this is not currently + # supported. + return extract_type_arg(typ, index) + + return extracted + + raise RuntimeError(failure_message or f"Could not resolve inner type variable at index {index} for {typ}") diff --git a/src/parallel/_utils/_utils.py b/src/parallel/_utils/_utils.py new file mode 100644 index 0000000..eec7f4a --- /dev/null +++ b/src/parallel/_utils/_utils.py @@ -0,0 +1,421 @@ +from __future__ import annotations + +import os +import re +import inspect +import functools +from typing import ( + Any, + Tuple, + Mapping, + TypeVar, + Callable, + Iterable, + Sequence, + cast, + overload, +) +from pathlib import Path +from datetime import date, datetime +from typing_extensions import TypeGuard + +import sniffio + +from .._types import Omit, NotGiven, FileTypes, HeadersLike + +_T = TypeVar("_T") +_TupleT = TypeVar("_TupleT", bound=Tuple[object, ...]) +_MappingT = TypeVar("_MappingT", bound=Mapping[str, object]) +_SequenceT = TypeVar("_SequenceT", bound=Sequence[object]) +CallableT = TypeVar("CallableT", bound=Callable[..., Any]) + + +def flatten(t: Iterable[Iterable[_T]]) -> list[_T]: + return [item for sublist in t for item in sublist] + + +def extract_files( + # TODO: this needs to take Dict but variance issues..... + # create protocol type ? + query: Mapping[str, object], + *, + paths: Sequence[Sequence[str]], +) -> list[tuple[str, FileTypes]]: + """Recursively extract files from the given dictionary based on specified paths. + + A path may look like this ['foo', 'files', '', 'data']. + + Note: this mutates the given dictionary. + """ + files: list[tuple[str, FileTypes]] = [] + for path in paths: + files.extend(_extract_items(query, path, index=0, flattened_key=None)) + return files + + +def _extract_items( + obj: object, + path: Sequence[str], + *, + index: int, + flattened_key: str | None, +) -> list[tuple[str, FileTypes]]: + try: + key = path[index] + except IndexError: + if not is_given(obj): + # no value was provided - we can safely ignore + return [] + + # cyclical import + from .._files import assert_is_file_content + + # We have exhausted the path, return the entry we found. + assert flattened_key is not None + + if is_list(obj): + files: list[tuple[str, FileTypes]] = [] + for entry in obj: + assert_is_file_content(entry, key=flattened_key + "[]" if flattened_key else "") + files.append((flattened_key + "[]", cast(FileTypes, entry))) + return files + + assert_is_file_content(obj, key=flattened_key) + return [(flattened_key, cast(FileTypes, obj))] + + index += 1 + if is_dict(obj): + try: + # We are at the last entry in the path so we must remove the field + if (len(path)) == index: + item = obj.pop(key) + else: + item = obj[key] + except KeyError: + # Key was not present in the dictionary, this is not indicative of an error + # as the given path may not point to a required field. We also do not want + # to enforce required fields as the API may differ from the spec in some cases. + return [] + if flattened_key is None: + flattened_key = key + else: + flattened_key += f"[{key}]" + return _extract_items( + item, + path, + index=index, + flattened_key=flattened_key, + ) + elif is_list(obj): + if key != "": + return [] + + return flatten( + [ + _extract_items( + item, + path, + index=index, + flattened_key=flattened_key + "[]" if flattened_key is not None else "[]", + ) + for item in obj + ] + ) + + # Something unexpected was passed, just ignore it. + return [] + + +def is_given(obj: _T | NotGiven | Omit) -> TypeGuard[_T]: + return not isinstance(obj, NotGiven) and not isinstance(obj, Omit) + + +# Type safe methods for narrowing types with TypeVars. +# The default narrowing for isinstance(obj, dict) is dict[unknown, unknown], +# however this cause Pyright to rightfully report errors. As we know we don't +# care about the contained types we can safely use `object` in its place. +# +# There are two separate functions defined, `is_*` and `is_*_t` for different use cases. +# `is_*` is for when you're dealing with an unknown input +# `is_*_t` is for when you're narrowing a known union type to a specific subset + + +def is_tuple(obj: object) -> TypeGuard[tuple[object, ...]]: + return isinstance(obj, tuple) + + +def is_tuple_t(obj: _TupleT | object) -> TypeGuard[_TupleT]: + return isinstance(obj, tuple) + + +def is_sequence(obj: object) -> TypeGuard[Sequence[object]]: + return isinstance(obj, Sequence) + + +def is_sequence_t(obj: _SequenceT | object) -> TypeGuard[_SequenceT]: + return isinstance(obj, Sequence) + + +def is_mapping(obj: object) -> TypeGuard[Mapping[str, object]]: + return isinstance(obj, Mapping) + + +def is_mapping_t(obj: _MappingT | object) -> TypeGuard[_MappingT]: + return isinstance(obj, Mapping) + + +def is_dict(obj: object) -> TypeGuard[dict[object, object]]: + return isinstance(obj, dict) + + +def is_list(obj: object) -> TypeGuard[list[object]]: + return isinstance(obj, list) + + +def is_iterable(obj: object) -> TypeGuard[Iterable[object]]: + return isinstance(obj, Iterable) + + +def deepcopy_minimal(item: _T) -> _T: + """Minimal reimplementation of copy.deepcopy() that will only copy certain object types: + + - mappings, e.g. `dict` + - list + + This is done for performance reasons. + """ + if is_mapping(item): + return cast(_T, {k: deepcopy_minimal(v) for k, v in item.items()}) + if is_list(item): + return cast(_T, [deepcopy_minimal(entry) for entry in item]) + return item + + +# copied from https://github.com/Rapptz/RoboDanny +def human_join(seq: Sequence[str], *, delim: str = ", ", final: str = "or") -> str: + size = len(seq) + if size == 0: + return "" + + if size == 1: + return seq[0] + + if size == 2: + return f"{seq[0]} {final} {seq[1]}" + + return delim.join(seq[:-1]) + f" {final} {seq[-1]}" + + +def quote(string: str) -> str: + """Add single quotation marks around the given string. Does *not* do any escaping.""" + return f"'{string}'" + + +def required_args(*variants: Sequence[str]) -> Callable[[CallableT], CallableT]: + """Decorator to enforce a given set of arguments or variants of arguments are passed to the decorated function. + + Useful for enforcing runtime validation of overloaded functions. + + Example usage: + ```py + @overload + def foo(*, a: str) -> str: ... + + + @overload + def foo(*, b: bool) -> str: ... + + + # This enforces the same constraints that a static type checker would + # i.e. that either a or b must be passed to the function + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: bool | None = None) -> str: ... + ``` + """ + + def inner(func: CallableT) -> CallableT: + params = inspect.signature(func).parameters + positional = [ + name + for name, param in params.items() + if param.kind + in { + param.POSITIONAL_ONLY, + param.POSITIONAL_OR_KEYWORD, + } + ] + + @functools.wraps(func) + def wrapper(*args: object, **kwargs: object) -> object: + given_params: set[str] = set() + for i, _ in enumerate(args): + try: + given_params.add(positional[i]) + except IndexError: + raise TypeError( + f"{func.__name__}() takes {len(positional)} argument(s) but {len(args)} were given" + ) from None + + for key in kwargs.keys(): + given_params.add(key) + + for variant in variants: + matches = all((param in given_params for param in variant)) + if matches: + break + else: # no break + if len(variants) > 1: + variations = human_join( + ["(" + human_join([quote(arg) for arg in variant], final="and") + ")" for variant in variants] + ) + msg = f"Missing required arguments; Expected either {variations} arguments to be given" + else: + assert len(variants) > 0 + + # TODO: this error message is not deterministic + missing = list(set(variants[0]) - given_params) + if len(missing) > 1: + msg = f"Missing required arguments: {human_join([quote(arg) for arg in missing])}" + else: + msg = f"Missing required argument: {quote(missing[0])}" + raise TypeError(msg) + return func(*args, **kwargs) + + return wrapper # type: ignore + + return inner + + +_K = TypeVar("_K") +_V = TypeVar("_V") + + +@overload +def strip_not_given(obj: None) -> None: ... + + +@overload +def strip_not_given(obj: Mapping[_K, _V | NotGiven]) -> dict[_K, _V]: ... + + +@overload +def strip_not_given(obj: object) -> object: ... + + +def strip_not_given(obj: object | None) -> object: + """Remove all top-level keys where their values are instances of `NotGiven`""" + if obj is None: + return None + + if not is_mapping(obj): + return obj + + return {key: value for key, value in obj.items() if not isinstance(value, NotGiven)} + + +def coerce_integer(val: str) -> int: + return int(val, base=10) + + +def coerce_float(val: str) -> float: + return float(val) + + +def coerce_boolean(val: str) -> bool: + return val == "true" or val == "1" or val == "on" + + +def maybe_coerce_integer(val: str | None) -> int | None: + if val is None: + return None + return coerce_integer(val) + + +def maybe_coerce_float(val: str | None) -> float | None: + if val is None: + return None + return coerce_float(val) + + +def maybe_coerce_boolean(val: str | None) -> bool | None: + if val is None: + return None + return coerce_boolean(val) + + +def removeprefix(string: str, prefix: str) -> str: + """Remove a prefix from a string. + + Backport of `str.removeprefix` for Python < 3.9 + """ + if string.startswith(prefix): + return string[len(prefix) :] + return string + + +def removesuffix(string: str, suffix: str) -> str: + """Remove a suffix from a string. + + Backport of `str.removesuffix` for Python < 3.9 + """ + if string.endswith(suffix): + return string[: -len(suffix)] + return string + + +def file_from_path(path: str) -> FileTypes: + contents = Path(path).read_bytes() + file_name = os.path.basename(path) + return (file_name, contents) + + +def get_required_header(headers: HeadersLike, header: str) -> str: + lower_header = header.lower() + if is_mapping_t(headers): + # mypy doesn't understand the type narrowing here + for k, v in headers.items(): # type: ignore + if k.lower() == lower_header and isinstance(v, str): + return v + + # to deal with the case where the header looks like Stainless-Event-Id + intercaps_header = re.sub(r"([^\w])(\w)", lambda pat: pat.group(1) + pat.group(2).upper(), header.capitalize()) + + for normalized_header in [header, lower_header, header.upper(), intercaps_header]: + value = headers.get(normalized_header) + if value: + return value + + raise ValueError(f"Could not find {header} header") + + +def get_async_library() -> str: + try: + return sniffio.current_async_library() + except Exception: + return "false" + + +def lru_cache(*, maxsize: int | None = 128) -> Callable[[CallableT], CallableT]: + """A version of functools.lru_cache that retains the type signature + for the wrapped function arguments. + """ + wrapper = functools.lru_cache( # noqa: TID251 + maxsize=maxsize, + ) + return cast(Any, wrapper) # type: ignore[no-any-return] + + +def json_safe(data: object) -> object: + """Translates a mapping / sequence recursively in the same fashion + as `pydantic` v2's `model_dump(mode="json")`. + """ + if is_mapping(data): + return {json_safe(key): json_safe(value) for key, value in data.items()} + + if is_iterable(data) and not isinstance(data, (str, bytes, bytearray)): + return [json_safe(item) for item in data] + + if isinstance(data, (datetime, date)): + return data.isoformat() + + return data diff --git a/src/parallel/_version.py b/src/parallel/_version.py new file mode 100644 index 0000000..1b80dfe --- /dev/null +++ b/src/parallel/_version.py @@ -0,0 +1,4 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +__title__ = "parallel" +__version__ = "0.4.2" # x-release-please-version diff --git a/src/parallel/lib/.keep b/src/parallel/lib/.keep new file mode 100644 index 0000000..5e2c99f --- /dev/null +++ b/src/parallel/lib/.keep @@ -0,0 +1,4 @@ +File generated from our OpenAPI spec by Stainless. + +This directory can be used to store custom files to expand the SDK. +It is ignored by Stainless code generation and its content (other than this keep file) won't be touched. \ No newline at end of file diff --git a/src/parallel/py.typed b/src/parallel/py.typed new file mode 100644 index 0000000..e69de29 diff --git a/src/parallel/resources/__init__.py b/src/parallel/resources/__init__.py new file mode 100644 index 0000000..6fc7c06 --- /dev/null +++ b/src/parallel/resources/__init__.py @@ -0,0 +1,19 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .task_run import ( + TaskRunResource, + AsyncTaskRunResource, + TaskRunResourceWithRawResponse, + AsyncTaskRunResourceWithRawResponse, + TaskRunResourceWithStreamingResponse, + AsyncTaskRunResourceWithStreamingResponse, +) + +__all__ = [ + "TaskRunResource", + "AsyncTaskRunResource", + "TaskRunResourceWithRawResponse", + "AsyncTaskRunResourceWithRawResponse", + "TaskRunResourceWithStreamingResponse", + "AsyncTaskRunResourceWithStreamingResponse", +] diff --git a/src/parallel/resources/beta/__init__.py b/src/parallel/resources/beta/__init__.py new file mode 100644 index 0000000..6cae1b3 --- /dev/null +++ b/src/parallel/resources/beta/__init__.py @@ -0,0 +1,61 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .beta import ( + BetaResource, + AsyncBetaResource, + BetaResourceWithRawResponse, + AsyncBetaResourceWithRawResponse, + BetaResourceWithStreamingResponse, + AsyncBetaResourceWithStreamingResponse, +) +from .findall import ( + FindAllResource, + AsyncFindAllResource, + FindAllResourceWithRawResponse, + AsyncFindAllResourceWithRawResponse, + FindAllResourceWithStreamingResponse, + AsyncFindAllResourceWithStreamingResponse, +) +from .task_run import ( + TaskRunResource, + AsyncTaskRunResource, + TaskRunResourceWithRawResponse, + AsyncTaskRunResourceWithRawResponse, + TaskRunResourceWithStreamingResponse, + AsyncTaskRunResourceWithStreamingResponse, +) +from .task_group import ( + TaskGroupResource, + AsyncTaskGroupResource, + TaskGroupResourceWithRawResponse, + AsyncTaskGroupResourceWithRawResponse, + TaskGroupResourceWithStreamingResponse, + AsyncTaskGroupResourceWithStreamingResponse, +) + +__all__ = [ + "TaskRunResource", + "AsyncTaskRunResource", + "TaskRunResourceWithRawResponse", + "AsyncTaskRunResourceWithRawResponse", + "TaskRunResourceWithStreamingResponse", + "AsyncTaskRunResourceWithStreamingResponse", + "TaskGroupResource", + "AsyncTaskGroupResource", + "TaskGroupResourceWithRawResponse", + "AsyncTaskGroupResourceWithRawResponse", + "TaskGroupResourceWithStreamingResponse", + "AsyncTaskGroupResourceWithStreamingResponse", + "FindAllResource", + "AsyncFindAllResource", + "FindAllResourceWithRawResponse", + "AsyncFindAllResourceWithRawResponse", + "FindAllResourceWithStreamingResponse", + "AsyncFindAllResourceWithStreamingResponse", + "BetaResource", + "AsyncBetaResource", + "BetaResourceWithRawResponse", + "AsyncBetaResourceWithRawResponse", + "BetaResourceWithStreamingResponse", + "AsyncBetaResourceWithStreamingResponse", +] diff --git a/src/parallel/resources/beta/api.md b/src/parallel/resources/beta/api.md new file mode 100644 index 0000000..2732f08 --- /dev/null +++ b/src/parallel/resources/beta/api.md @@ -0,0 +1,99 @@ +# Beta + +Types: + +```python +from parallel.types.beta import ( + ExcerptSettings, + ExtractError, + ExtractResponse, + ExtractResult, + FetchPolicy, + SearchResult, + UsageItem, + WebSearchResult, +) +``` + +Methods: + +- client.beta.extract(\*\*params) -> ExtractResponse +- client.beta.search(\*\*params) -> SearchResult + +## TaskRun + +Types: + +```python +from parallel.types.beta import ( + ParallelBeta, + TaskRunEventsResponse, + BetaRunInput, + BetaTaskRunResult, + Webhook, + McpServer, + McpToolCall, + TaskRunEvent, + ErrorEvent, +) +``` + +Methods: + +- client.beta.task_run.create(\*\*params) -> TaskRun +- client.beta.task_run.events(run_id) -> TaskRunEventsResponse +- client.beta.task_run.result(run_id, \*\*params) -> TaskRunResult + +## TaskGroup + +Types: + +```python +from parallel.types.beta import ( + TaskGroup, + TaskGroupRunResponse, + TaskGroupStatus, + TaskGroupEventsResponse, + TaskGroupGetRunsResponse, +) +``` + +Methods: + +- client.beta.task_group.create(\*\*params) -> TaskGroup +- client.beta.task_group.retrieve(task_group_id) -> TaskGroup +- client.beta.task_group.add_runs(task_group_id, \*\*params) -> TaskGroupRunResponse +- client.beta.task_group.events(task_group_id, \*\*params) -> TaskGroupEventsResponse +- client.beta.task_group.get_runs(task_group_id, \*\*params) -> TaskGroupGetRunsResponse + +## FindAll + +Types: + +```python +from parallel.types.beta import ( + FindAllCandidateMatchStatusEvent, + FindAllEnrichInput, + FindAllExtendInput, + FindAllRun, + FindAllRunInput, + FindAllRunResult, + FindAllRunStatusEvent, + FindAllSchema, + FindAllSchemaUpdatedEvent, + IngestInput, + FindAllEventsResponse, +) +``` + +Methods: + +- client.beta.findall.create(\*\*params) -> FindAllRun +- client.beta.findall.retrieve(findall_id) -> FindAllRun +- client.beta.findall.cancel(findall_id) -> object +- client.beta.findall.enrich(findall_id, \*\*params) -> FindAllSchema +- client.beta.findall.events(findall_id, \*\*params) -> FindAllEventsResponse +- client.beta.findall.extend(findall_id, \*\*params) -> FindAllSchema +- client.beta.findall.ingest(\*\*params) -> FindAllSchema +- client.beta.findall.result(findall_id) -> FindAllRunResult +- client.beta.findall.schema(findall_id) -> FindAllSchema diff --git a/src/parallel/resources/beta/beta.py b/src/parallel/resources/beta/beta.py new file mode 100644 index 0000000..4e7da2c --- /dev/null +++ b/src/parallel/resources/beta/beta.py @@ -0,0 +1,648 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Optional +from itertools import chain +from typing_extensions import Literal + +import httpx + +from .findall import ( + FindAllResource, + AsyncFindAllResource, + FindAllResourceWithRawResponse, + AsyncFindAllResourceWithRawResponse, + FindAllResourceWithStreamingResponse, + AsyncFindAllResourceWithStreamingResponse, +) +from ..._types import Body, Omit, Query, Headers, NotGiven, SequenceNotStr, omit, not_given +from ..._utils import is_given, maybe_transform, strip_not_given, async_maybe_transform +from .task_run import ( + TaskRunResource, + AsyncTaskRunResource, + TaskRunResourceWithRawResponse, + AsyncTaskRunResourceWithRawResponse, + TaskRunResourceWithStreamingResponse, + AsyncTaskRunResourceWithStreamingResponse, +) +from ..._compat import cached_property +from .task_group import ( + TaskGroupResource, + AsyncTaskGroupResource, + TaskGroupResourceWithRawResponse, + AsyncTaskGroupResourceWithRawResponse, + TaskGroupResourceWithStreamingResponse, + AsyncTaskGroupResourceWithStreamingResponse, +) +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ...types.beta import beta_search_params, beta_extract_params +from ..._base_client import make_request_options +from ...types.beta.search_result import SearchResult +from ...types.beta.extract_response import ExtractResponse +from ...types.beta.fetch_policy_param import FetchPolicyParam +from ...types.beta.parallel_beta_param import ParallelBetaParam +from ...types.beta.excerpt_settings_param import ExcerptSettingsParam +from ...types.shared_params.source_policy import SourcePolicy + +__all__ = ["BetaResource", "AsyncBetaResource"] + + +class BetaResource(SyncAPIResource): + @cached_property + def task_run(self) -> TaskRunResource: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + return TaskRunResource(self._client) + + @cached_property + def task_group(self) -> TaskGroupResource: + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + return TaskGroupResource(self._client) + + @cached_property + def findall(self) -> FindAllResource: + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + return FindAllResource(self._client) + + @cached_property + def with_raw_response(self) -> BetaResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return BetaResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> BetaResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return BetaResourceWithStreamingResponse(self) + + def extract( + self, + *, + urls: SequenceNotStr[str], + excerpts: beta_extract_params.Excerpts | Omit = omit, + fetch_policy: Optional[FetchPolicyParam] | Omit = omit, + objective: Optional[str] | Omit = omit, + search_queries: Optional[SequenceNotStr[str]] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ExtractResponse: + """ + Extracts relevant content from specific web URLs. + + Args: + excerpts: Include excerpts from each URL relevant to the search objective and queries. + + fetch_policy: Policy for live fetching web results. + + objective: If provided, focuses extracted content on the specified search objective. + + search_queries: If provided, focuses extracted content on the specified keyword search queries. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._post( + "/v1beta/extract", + body=maybe_transform( + { + "urls": urls, + "excerpts": excerpts, + "fetch_policy": fetch_policy, + "objective": objective, + "search_queries": search_queries, + }, + beta_extract_params.BetaExtractParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ExtractResponse, + ) + + def search( + self, + *, + excerpts: ExcerptSettingsParam | Omit = omit, + fetch_policy: Optional[FetchPolicyParam] | Omit = omit, + max_chars_per_result: Optional[int] | Omit = omit, + max_results: Optional[int] | Omit = omit, + mode: Optional[Literal["one-shot", "agentic", "fast"]] | Omit = omit, + objective: Optional[str] | Omit = omit, + processor: Optional[Literal["base", "pro"]] | Omit = omit, + search_queries: Optional[SequenceNotStr[str]] | Omit = omit, + source_policy: Optional[SourcePolicy] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> SearchResult: + """ + Searches the web. + + Args: + excerpts: Optional settings to configure excerpt generation. + + fetch_policy: Policy for live fetching web results. + + max_chars_per_result: DEPRECATED: Use `excerpts.max_chars_per_result` instead. + + max_results: Upper bound on the number of results to return. Defaults to 10 if not provided. + + mode: Presets default values for parameters for different use cases. + + - `one-shot` returns more comprehensive results and longer excerpts to answer + questions from a single response + - `agentic` returns more concise, token-efficient results for use in an agentic + loop + - `fast` trades some quality for lower latency, with best results when used with + concise and high-quality objective and keyword queries + + objective: Natural-language description of what the web search is trying to find. May + include guidance about preferred sources or freshness. At least one of objective + or search_queries must be provided. + + processor: DEPRECATED: use `mode` instead. + + search_queries: Optional list of traditional keyword search queries to guide the search. May + contain search operators. At least one of objective or search_queries must be + provided. + + source_policy: Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._post( + "/v1beta/search", + body=maybe_transform( + { + "excerpts": excerpts, + "fetch_policy": fetch_policy, + "max_chars_per_result": max_chars_per_result, + "max_results": max_results, + "mode": mode, + "objective": objective, + "processor": processor, + "search_queries": search_queries, + "source_policy": source_policy, + }, + beta_search_params.BetaSearchParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=SearchResult, + ) + + +class AsyncBetaResource(AsyncAPIResource): + @cached_property + def task_run(self) -> AsyncTaskRunResource: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + return AsyncTaskRunResource(self._client) + + @cached_property + def task_group(self) -> AsyncTaskGroupResource: + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + return AsyncTaskGroupResource(self._client) + + @cached_property + def findall(self) -> AsyncFindAllResource: + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + return AsyncFindAllResource(self._client) + + @cached_property + def with_raw_response(self) -> AsyncBetaResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncBetaResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncBetaResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return AsyncBetaResourceWithStreamingResponse(self) + + async def extract( + self, + *, + urls: SequenceNotStr[str], + excerpts: beta_extract_params.Excerpts | Omit = omit, + fetch_policy: Optional[FetchPolicyParam] | Omit = omit, + objective: Optional[str] | Omit = omit, + search_queries: Optional[SequenceNotStr[str]] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> ExtractResponse: + """ + Extracts relevant content from specific web URLs. + + Args: + excerpts: Include excerpts from each URL relevant to the search objective and queries. + + fetch_policy: Policy for live fetching web results. + + objective: If provided, focuses extracted content on the specified search objective. + + search_queries: If provided, focuses extracted content on the specified keyword search queries. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._post( + "/v1beta/extract", + body=await async_maybe_transform( + { + "urls": urls, + "excerpts": excerpts, + "fetch_policy": fetch_policy, + "objective": objective, + "search_queries": search_queries, + }, + beta_extract_params.BetaExtractParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=ExtractResponse, + ) + + async def search( + self, + *, + excerpts: ExcerptSettingsParam | Omit = omit, + fetch_policy: Optional[FetchPolicyParam] | Omit = omit, + max_chars_per_result: Optional[int] | Omit = omit, + max_results: Optional[int] | Omit = omit, + mode: Optional[Literal["one-shot", "agentic", "fast"]] | Omit = omit, + objective: Optional[str] | Omit = omit, + processor: Optional[Literal["base", "pro"]] | Omit = omit, + search_queries: Optional[SequenceNotStr[str]] | Omit = omit, + source_policy: Optional[SourcePolicy] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> SearchResult: + """ + Searches the web. + + Args: + excerpts: Optional settings to configure excerpt generation. + + fetch_policy: Policy for live fetching web results. + + max_chars_per_result: DEPRECATED: Use `excerpts.max_chars_per_result` instead. + + max_results: Upper bound on the number of results to return. Defaults to 10 if not provided. + + mode: Presets default values for parameters for different use cases. + + - `one-shot` returns more comprehensive results and longer excerpts to answer + questions from a single response + - `agentic` returns more concise, token-efficient results for use in an agentic + loop + - `fast` trades some quality for lower latency, with best results when used with + concise and high-quality objective and keyword queries + + objective: Natural-language description of what the web search is trying to find. May + include guidance about preferred sources or freshness. At least one of objective + or search_queries must be provided. + + processor: DEPRECATED: use `mode` instead. + + search_queries: Optional list of traditional keyword search queries to guide the search. May + contain search operators. At least one of objective or search_queries must be + provided. + + source_policy: Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._post( + "/v1beta/search", + body=await async_maybe_transform( + { + "excerpts": excerpts, + "fetch_policy": fetch_policy, + "max_chars_per_result": max_chars_per_result, + "max_results": max_results, + "mode": mode, + "objective": objective, + "processor": processor, + "search_queries": search_queries, + "source_policy": source_policy, + }, + beta_search_params.BetaSearchParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=SearchResult, + ) + + +class BetaResourceWithRawResponse: + def __init__(self, beta: BetaResource) -> None: + self._beta = beta + + self.extract = to_raw_response_wrapper( + beta.extract, + ) + self.search = to_raw_response_wrapper( + beta.search, + ) + + @cached_property + def task_run(self) -> TaskRunResourceWithRawResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + return TaskRunResourceWithRawResponse(self._beta.task_run) + + @cached_property + def task_group(self) -> TaskGroupResourceWithRawResponse: + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + return TaskGroupResourceWithRawResponse(self._beta.task_group) + + @cached_property + def findall(self) -> FindAllResourceWithRawResponse: + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + return FindAllResourceWithRawResponse(self._beta.findall) + + +class AsyncBetaResourceWithRawResponse: + def __init__(self, beta: AsyncBetaResource) -> None: + self._beta = beta + + self.extract = async_to_raw_response_wrapper( + beta.extract, + ) + self.search = async_to_raw_response_wrapper( + beta.search, + ) + + @cached_property + def task_run(self) -> AsyncTaskRunResourceWithRawResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + return AsyncTaskRunResourceWithRawResponse(self._beta.task_run) + + @cached_property + def task_group(self) -> AsyncTaskGroupResourceWithRawResponse: + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + return AsyncTaskGroupResourceWithRawResponse(self._beta.task_group) + + @cached_property + def findall(self) -> AsyncFindAllResourceWithRawResponse: + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + return AsyncFindAllResourceWithRawResponse(self._beta.findall) + + +class BetaResourceWithStreamingResponse: + def __init__(self, beta: BetaResource) -> None: + self._beta = beta + + self.extract = to_streamed_response_wrapper( + beta.extract, + ) + self.search = to_streamed_response_wrapper( + beta.search, + ) + + @cached_property + def task_run(self) -> TaskRunResourceWithStreamingResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + return TaskRunResourceWithStreamingResponse(self._beta.task_run) + + @cached_property + def task_group(self) -> TaskGroupResourceWithStreamingResponse: + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + return TaskGroupResourceWithStreamingResponse(self._beta.task_group) + + @cached_property + def findall(self) -> FindAllResourceWithStreamingResponse: + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + return FindAllResourceWithStreamingResponse(self._beta.findall) + + +class AsyncBetaResourceWithStreamingResponse: + def __init__(self, beta: AsyncBetaResource) -> None: + self._beta = beta + + self.extract = async_to_streamed_response_wrapper( + beta.extract, + ) + self.search = async_to_streamed_response_wrapper( + beta.search, + ) + + @cached_property + def task_run(self) -> AsyncTaskRunResourceWithStreamingResponse: + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + return AsyncTaskRunResourceWithStreamingResponse(self._beta.task_run) + + @cached_property + def task_group(self) -> AsyncTaskGroupResourceWithStreamingResponse: + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + return AsyncTaskGroupResourceWithStreamingResponse(self._beta.task_group) + + @cached_property + def findall(self) -> AsyncFindAllResourceWithStreamingResponse: + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + return AsyncFindAllResourceWithStreamingResponse(self._beta.findall) diff --git a/src/parallel/resources/beta/findall.py b/src/parallel/resources/beta/findall.py new file mode 100644 index 0000000..5163909 --- /dev/null +++ b/src/parallel/resources/beta/findall.py @@ -0,0 +1,1261 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Any, Dict, List, Union, Iterable, Optional, cast +from itertools import chain +from typing_extensions import Literal + +import httpx + +from ..._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from ..._utils import is_given, path_template, maybe_transform, strip_not_given, async_maybe_transform +from ..._compat import cached_property +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ..._streaming import Stream, AsyncStream +from ...types.beta import ( + findall_create_params, + findall_enrich_params, + findall_events_params, + findall_extend_params, + findall_ingest_params, +) +from ..._base_client import make_request_options +from ...types.webhook_param import WebhookParam +from ...types.beta.findall_run import FindAllRun +from ...types.mcp_server_param import McpServerParam +from ...types.json_schema_param import JsonSchemaParam +from ...types.beta.findall_schema import FindAllSchema +from ...types.beta.findall_run_result import FindAllRunResult +from ...types.beta.parallel_beta_param import ParallelBetaParam +from ...types.beta.findall_events_response import FindAllEventsResponse + +__all__ = ["FindAllResource", "AsyncFindAllResource"] + + +class FindAllResource(SyncAPIResource): + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + + @cached_property + def with_raw_response(self) -> FindAllResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return FindAllResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> FindAllResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return FindAllResourceWithStreamingResponse(self) + + def create( + self, + *, + entity_type: str, + generator: Literal["base", "core", "pro", "preview"], + match_conditions: Iterable[findall_create_params.MatchCondition], + match_limit: int, + objective: str, + exclude_list: Optional[Iterable[findall_create_params.ExcludeList]] | Omit = omit, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + webhook: Optional[WebhookParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllRun: + """ + Starts a FindAll run. + + This endpoint immediately returns a FindAll run object with status set to + 'queued'. You can get the run result snapshot using the GET + /v1beta/findall/runs/{findall_id}/result endpoint. You can track the progress of + the run by: + + - Polling the status using the GET /v1beta/findall/runs/{findall_id} endpoint, + - Subscribing to real-time updates via the + /v1beta/findall/runs/{findall_id}/events endpoint, + - Or specifying a webhook with relevant event types during run creation to + receive notifications. + + Args: + entity_type: Type of the entity for the FindAll run. + + generator: Generator for the FindAll run. One of base, core, pro, preview. + + match_conditions: List of match conditions for the FindAll run. + + match_limit: Maximum number of matches to find for this FindAll run. Must be between 5 and + 1000 (inclusive). + + objective: Natural language objective of the FindAll run. + + exclude_list: List of entity names/IDs to exclude from results. + + metadata: Metadata for the FindAll run. + + webhook: Webhooks for Task Runs. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._post( + "/v1beta/findall/runs", + body=maybe_transform( + { + "entity_type": entity_type, + "generator": generator, + "match_conditions": match_conditions, + "match_limit": match_limit, + "objective": objective, + "exclude_list": exclude_list, + "metadata": metadata, + "webhook": webhook, + }, + findall_create_params.FindAllCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllRun, + ) + + def retrieve( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllRun: + """ + Retrieve a FindAll run. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._get( + path_template("/v1beta/findall/runs/{findall_id}", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllRun, + ) + + def cancel( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> object: + """ + Cancel a FindAll run. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._post( + path_template("/v1beta/findall/runs/{findall_id}/cancel", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=object, + ) + + def enrich( + self, + findall_id: str, + *, + output_schema: JsonSchemaParam, + mcp_servers: Optional[Iterable[McpServerParam]] | Omit = omit, + processor: str | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Add an enrichment to a FindAll run. + + Args: + output_schema: JSON schema for the enrichment output schema for the FindAll run. + + mcp_servers: List of MCP servers to use for the task. + + processor: Processor to use for the task. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._post( + path_template("/v1beta/findall/runs/{findall_id}/enrich", findall_id=findall_id), + body=maybe_transform( + { + "output_schema": output_schema, + "mcp_servers": mcp_servers, + "processor": processor, + }, + findall_enrich_params.FindAllEnrichParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + def events( + self, + findall_id: str, + *, + last_event_id: Optional[str] | Omit = omit, + api_timeout: Optional[float] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> Stream[FindAllEventsResponse]: + """ + Stream events from a FindAll run. + + Args: request: The Shapi request findall_id: The FindAll run ID last_event_id: + Optional event ID to resume from. timeout: Optional timeout in seconds. If None, + keep connection alive as long as the run is going. If set, stop after specified + duration. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._get( + path_template("/v1beta/findall/runs/{findall_id}/events", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "last_event_id": last_event_id, + "api_timeout": api_timeout, + }, + findall_events_params.FindAllEventsParams, + ), + ), + cast_to=cast(Any, FindAllEventsResponse), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=Stream[FindAllEventsResponse], + ) + + def extend( + self, + findall_id: str, + *, + additional_match_limit: int, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Extend a FindAll run by adding additional matches to the current match limit. + + Args: + additional_match_limit: Additional number of matches to find for this FindAll run. This value will be + added to the current match limit to determine the new total match limit. Must be + greater than 0. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._post( + path_template("/v1beta/findall/runs/{findall_id}/extend", findall_id=findall_id), + body=maybe_transform( + {"additional_match_limit": additional_match_limit}, findall_extend_params.FindAllExtendParams + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + def ingest( + self, + *, + objective: str, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Transforms a natural language search objective into a structured FindAll spec. + + Note: Access to this endpoint requires the parallel-beta header. + + The generated specification serves as a suggested starting point and can be + further customized by the user. + + Args: + objective: Natural language objective to create a FindAll run spec. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._post( + "/v1beta/findall/ingest", + body=maybe_transform({"objective": objective}, findall_ingest_params.FindAllIngestParams), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + def result( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllRunResult: + """ + Retrieve the FindAll run result at the time of the request. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._get( + path_template("/v1beta/findall/runs/{findall_id}/result", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllRunResult, + ) + + def schema( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Get FindAll Run Schema + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return self._get( + path_template("/v1beta/findall/runs/{findall_id}/schema", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + +class AsyncFindAllResource(AsyncAPIResource): + """ + The FindAll API discovers and evaluates entities that match complex criteria from natural language objectives. Submit a high-level goal and the service automatically generates structured match conditions, discovers relevant candidates, and evaluates each against the criteria. Returns comprehensive results with detailed reasoning, citations, and confidence scores for each match decision. Streaming events and webhooks are supported. + """ + + @cached_property + def with_raw_response(self) -> AsyncFindAllResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncFindAllResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncFindAllResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return AsyncFindAllResourceWithStreamingResponse(self) + + async def create( + self, + *, + entity_type: str, + generator: Literal["base", "core", "pro", "preview"], + match_conditions: Iterable[findall_create_params.MatchCondition], + match_limit: int, + objective: str, + exclude_list: Optional[Iterable[findall_create_params.ExcludeList]] | Omit = omit, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + webhook: Optional[WebhookParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllRun: + """ + Starts a FindAll run. + + This endpoint immediately returns a FindAll run object with status set to + 'queued'. You can get the run result snapshot using the GET + /v1beta/findall/runs/{findall_id}/result endpoint. You can track the progress of + the run by: + + - Polling the status using the GET /v1beta/findall/runs/{findall_id} endpoint, + - Subscribing to real-time updates via the + /v1beta/findall/runs/{findall_id}/events endpoint, + - Or specifying a webhook with relevant event types during run creation to + receive notifications. + + Args: + entity_type: Type of the entity for the FindAll run. + + generator: Generator for the FindAll run. One of base, core, pro, preview. + + match_conditions: List of match conditions for the FindAll run. + + match_limit: Maximum number of matches to find for this FindAll run. Must be between 5 and + 1000 (inclusive). + + objective: Natural language objective of the FindAll run. + + exclude_list: List of entity names/IDs to exclude from results. + + metadata: Metadata for the FindAll run. + + webhook: Webhooks for Task Runs. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._post( + "/v1beta/findall/runs", + body=await async_maybe_transform( + { + "entity_type": entity_type, + "generator": generator, + "match_conditions": match_conditions, + "match_limit": match_limit, + "objective": objective, + "exclude_list": exclude_list, + "metadata": metadata, + "webhook": webhook, + }, + findall_create_params.FindAllCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllRun, + ) + + async def retrieve( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllRun: + """ + Retrieve a FindAll run. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/findall/runs/{findall_id}", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllRun, + ) + + async def cancel( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> object: + """ + Cancel a FindAll run. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._post( + path_template("/v1beta/findall/runs/{findall_id}/cancel", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=object, + ) + + async def enrich( + self, + findall_id: str, + *, + output_schema: JsonSchemaParam, + mcp_servers: Optional[Iterable[McpServerParam]] | Omit = omit, + processor: str | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Add an enrichment to a FindAll run. + + Args: + output_schema: JSON schema for the enrichment output schema for the FindAll run. + + mcp_servers: List of MCP servers to use for the task. + + processor: Processor to use for the task. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._post( + path_template("/v1beta/findall/runs/{findall_id}/enrich", findall_id=findall_id), + body=await async_maybe_transform( + { + "output_schema": output_schema, + "mcp_servers": mcp_servers, + "processor": processor, + }, + findall_enrich_params.FindAllEnrichParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + async def events( + self, + findall_id: str, + *, + last_event_id: Optional[str] | Omit = omit, + api_timeout: Optional[float] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AsyncStream[FindAllEventsResponse]: + """ + Stream events from a FindAll run. + + Args: request: The Shapi request findall_id: The FindAll run ID last_event_id: + Optional event ID to resume from. timeout: Optional timeout in seconds. If None, + keep connection alive as long as the run is going. If set, stop after specified + duration. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/findall/runs/{findall_id}/events", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "last_event_id": last_event_id, + "api_timeout": api_timeout, + }, + findall_events_params.FindAllEventsParams, + ), + ), + cast_to=cast(Any, FindAllEventsResponse), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=AsyncStream[FindAllEventsResponse], + ) + + async def extend( + self, + findall_id: str, + *, + additional_match_limit: int, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Extend a FindAll run by adding additional matches to the current match limit. + + Args: + additional_match_limit: Additional number of matches to find for this FindAll run. This value will be + added to the current match limit to determine the new total match limit. Must be + greater than 0. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._post( + path_template("/v1beta/findall/runs/{findall_id}/extend", findall_id=findall_id), + body=await async_maybe_transform( + {"additional_match_limit": additional_match_limit}, findall_extend_params.FindAllExtendParams + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + async def ingest( + self, + *, + objective: str, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Transforms a natural language search objective into a structured FindAll spec. + + Note: Access to this endpoint requires the parallel-beta header. + + The generated specification serves as a suggested starting point and can be + further customized by the user. + + Args: + objective: Natural language objective to create a FindAll run spec. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._post( + "/v1beta/findall/ingest", + body=await async_maybe_transform({"objective": objective}, findall_ingest_params.FindAllIngestParams), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + async def result( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllRunResult: + """ + Retrieve the FindAll run result at the time of the request. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/findall/runs/{findall_id}/result", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllRunResult, + ) + + async def schema( + self, + findall_id: str, + *, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> FindAllSchema: + """ + Get FindAll Run Schema + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not findall_id: + raise ValueError(f"Expected a non-empty value for `findall_id` but received {findall_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["findall-2025-09-15"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "findall-2025-09-15", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/findall/runs/{findall_id}/schema", findall_id=findall_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=FindAllSchema, + ) + + +class FindAllResourceWithRawResponse: + def __init__(self, findall: FindAllResource) -> None: + self._findall = findall + + self.create = to_raw_response_wrapper( + findall.create, + ) + self.retrieve = to_raw_response_wrapper( + findall.retrieve, + ) + self.cancel = to_raw_response_wrapper( + findall.cancel, + ) + self.enrich = to_raw_response_wrapper( + findall.enrich, + ) + self.events = to_raw_response_wrapper( + findall.events, + ) + self.extend = to_raw_response_wrapper( + findall.extend, + ) + self.ingest = to_raw_response_wrapper( + findall.ingest, + ) + self.result = to_raw_response_wrapper( + findall.result, + ) + self.schema = to_raw_response_wrapper( + findall.schema, + ) + + +class AsyncFindAllResourceWithRawResponse: + def __init__(self, findall: AsyncFindAllResource) -> None: + self._findall = findall + + self.create = async_to_raw_response_wrapper( + findall.create, + ) + self.retrieve = async_to_raw_response_wrapper( + findall.retrieve, + ) + self.cancel = async_to_raw_response_wrapper( + findall.cancel, + ) + self.enrich = async_to_raw_response_wrapper( + findall.enrich, + ) + self.events = async_to_raw_response_wrapper( + findall.events, + ) + self.extend = async_to_raw_response_wrapper( + findall.extend, + ) + self.ingest = async_to_raw_response_wrapper( + findall.ingest, + ) + self.result = async_to_raw_response_wrapper( + findall.result, + ) + self.schema = async_to_raw_response_wrapper( + findall.schema, + ) + + +class FindAllResourceWithStreamingResponse: + def __init__(self, findall: FindAllResource) -> None: + self._findall = findall + + self.create = to_streamed_response_wrapper( + findall.create, + ) + self.retrieve = to_streamed_response_wrapper( + findall.retrieve, + ) + self.cancel = to_streamed_response_wrapper( + findall.cancel, + ) + self.enrich = to_streamed_response_wrapper( + findall.enrich, + ) + self.events = to_streamed_response_wrapper( + findall.events, + ) + self.extend = to_streamed_response_wrapper( + findall.extend, + ) + self.ingest = to_streamed_response_wrapper( + findall.ingest, + ) + self.result = to_streamed_response_wrapper( + findall.result, + ) + self.schema = to_streamed_response_wrapper( + findall.schema, + ) + + +class AsyncFindAllResourceWithStreamingResponse: + def __init__(self, findall: AsyncFindAllResource) -> None: + self._findall = findall + + self.create = async_to_streamed_response_wrapper( + findall.create, + ) + self.retrieve = async_to_streamed_response_wrapper( + findall.retrieve, + ) + self.cancel = async_to_streamed_response_wrapper( + findall.cancel, + ) + self.enrich = async_to_streamed_response_wrapper( + findall.enrich, + ) + self.events = async_to_streamed_response_wrapper( + findall.events, + ) + self.extend = async_to_streamed_response_wrapper( + findall.extend, + ) + self.ingest = async_to_streamed_response_wrapper( + findall.ingest, + ) + self.result = async_to_streamed_response_wrapper( + findall.result, + ) + self.schema = async_to_streamed_response_wrapper( + findall.schema, + ) diff --git a/src/parallel/resources/beta/task_group.py b/src/parallel/resources/beta/task_group.py new file mode 100644 index 0000000..047efe8 --- /dev/null +++ b/src/parallel/resources/beta/task_group.py @@ -0,0 +1,709 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Any, Dict, List, Union, Iterable, Optional, cast +from itertools import chain +from typing_extensions import Literal + +import httpx + +from ..._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from ..._utils import is_given, path_template, maybe_transform, strip_not_given, async_maybe_transform +from ..._compat import cached_property +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ..._streaming import Stream, AsyncStream +from ...types.beta import ( + task_group_create_params, + task_group_events_params, + task_group_add_runs_params, + task_group_get_runs_params, +) +from ..._base_client import make_request_options +from ...types.beta.task_group import TaskGroup +from ...types.run_input_param import RunInputParam +from ...types.task_spec_param import TaskSpecParam +from ...types.beta.parallel_beta_param import ParallelBetaParam +from ...types.beta.task_group_run_response import TaskGroupRunResponse +from ...types.beta.task_group_events_response import TaskGroupEventsResponse +from ...types.beta.task_group_get_runs_response import TaskGroupGetRunsResponse + +__all__ = ["TaskGroupResource", "AsyncTaskGroupResource"] + + +class TaskGroupResource(SyncAPIResource): + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + + @cached_property + def with_raw_response(self) -> TaskGroupResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return TaskGroupResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> TaskGroupResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return TaskGroupResourceWithStreamingResponse(self) + + def create( + self, + *, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskGroup: + """ + Initiates a TaskGroup to group and track multiple runs. + + Args: + metadata: User-provided metadata stored with the task group. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._post( + "/v1beta/tasks/groups", + body=maybe_transform({"metadata": metadata}, task_group_create_params.TaskGroupCreateParams), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskGroup, + ) + + def retrieve( + self, + task_group_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskGroup: + """ + Retrieves aggregated status across runs in a TaskGroup. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._get( + path_template("/v1beta/tasks/groups/{task_group_id}", task_group_id=task_group_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskGroup, + ) + + def add_runs( + self, + task_group_id: str, + *, + inputs: Iterable[RunInputParam], + refresh_status: bool | Omit = omit, + default_task_spec: Optional[TaskSpecParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskGroupRunResponse: + """ + Initiates multiple task runs within a TaskGroup. + + Args: + inputs: List of task runs to execute. Up to 1,000 runs can be specified per request. If + you'd like to add more runs, split them across multiple TaskGroup POST requests. + + default_task_spec: Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._post( + path_template("/v1beta/tasks/groups/{task_group_id}/runs", task_group_id=task_group_id), + body=maybe_transform( + { + "inputs": inputs, + "default_task_spec": default_task_spec, + }, + task_group_add_runs_params.TaskGroupAddRunsParams, + ), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + {"refresh_status": refresh_status}, task_group_add_runs_params.TaskGroupAddRunsParams + ), + ), + cast_to=TaskGroupRunResponse, + ) + + def events( + self, + task_group_id: str, + *, + last_event_id: Optional[str] | Omit = omit, + api_timeout: Optional[float] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> Stream[TaskGroupEventsResponse]: + """ + Streams events from a TaskGroup: status updates and run completions. + + The connection will remain open for up to an hour as long as at least one run in + the group is still active. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._get( + path_template("/v1beta/tasks/groups/{task_group_id}/events", task_group_id=task_group_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "last_event_id": last_event_id, + "api_timeout": api_timeout, + }, + task_group_events_params.TaskGroupEventsParams, + ), + ), + cast_to=cast( + Any, TaskGroupEventsResponse + ), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=Stream[TaskGroupEventsResponse], + ) + + def get_runs( + self, + task_group_id: str, + *, + include_input: bool | Omit = omit, + include_output: bool | Omit = omit, + last_event_id: Optional[str] | Omit = omit, + status: Optional[ + Literal["queued", "action_required", "running", "completed", "failed", "cancelling", "cancelled"] + ] + | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> Stream[TaskGroupGetRunsResponse]: + """ + Retrieves task runs in a TaskGroup and optionally their inputs and outputs. + + All runs within a TaskGroup are returned as a stream. To get the inputs and/or + outputs back in the stream, set the corresponding `include_input` and + `include_output` parameters to `true`. + + The stream is resumable using the `event_id` as the cursor. To resume a stream, + specify the `last_event_id` parameter with the `event_id` of the last event in + the stream. The stream will resume from the next event after the + `last_event_id`. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._get( + path_template("/v1beta/tasks/groups/{task_group_id}/runs", task_group_id=task_group_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform( + { + "include_input": include_input, + "include_output": include_output, + "last_event_id": last_event_id, + "status": status, + }, + task_group_get_runs_params.TaskGroupGetRunsParams, + ), + ), + cast_to=cast( + Any, TaskGroupGetRunsResponse + ), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=Stream[TaskGroupGetRunsResponse], + ) + + +class AsyncTaskGroupResource(AsyncAPIResource): + """ + The Task Group API is currently in beta and enables batch execution of many independent Task runs with group-level monitoring and failure handling. + - Submit hundreds or thousands of Tasks as a single group + - Observe group progress and receive results as they complete + - Real-time updates via Server-Sent Events (SSE) + - Add tasks to an existing group while it is running + - Group-level retry and error aggregation + Status: beta and subject to change. + """ + + @cached_property + def with_raw_response(self) -> AsyncTaskGroupResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncTaskGroupResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncTaskGroupResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return AsyncTaskGroupResourceWithStreamingResponse(self) + + async def create( + self, + *, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskGroup: + """ + Initiates a TaskGroup to group and track multiple runs. + + Args: + metadata: User-provided metadata stored with the task group. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._post( + "/v1beta/tasks/groups", + body=await async_maybe_transform({"metadata": metadata}, task_group_create_params.TaskGroupCreateParams), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskGroup, + ) + + async def retrieve( + self, + task_group_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskGroup: + """ + Retrieves aggregated status across runs in a TaskGroup. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/tasks/groups/{task_group_id}", task_group_id=task_group_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskGroup, + ) + + async def add_runs( + self, + task_group_id: str, + *, + inputs: Iterable[RunInputParam], + refresh_status: bool | Omit = omit, + default_task_spec: Optional[TaskSpecParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskGroupRunResponse: + """ + Initiates multiple task runs within a TaskGroup. + + Args: + inputs: List of task runs to execute. Up to 1,000 runs can be specified per request. If + you'd like to add more runs, split them across multiple TaskGroup POST requests. + + default_task_spec: Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._post( + path_template("/v1beta/tasks/groups/{task_group_id}/runs", task_group_id=task_group_id), + body=await async_maybe_transform( + { + "inputs": inputs, + "default_task_spec": default_task_spec, + }, + task_group_add_runs_params.TaskGroupAddRunsParams, + ), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + {"refresh_status": refresh_status}, task_group_add_runs_params.TaskGroupAddRunsParams + ), + ), + cast_to=TaskGroupRunResponse, + ) + + async def events( + self, + task_group_id: str, + *, + last_event_id: Optional[str] | Omit = omit, + api_timeout: Optional[float] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AsyncStream[TaskGroupEventsResponse]: + """ + Streams events from a TaskGroup: status updates and run completions. + + The connection will remain open for up to an hour as long as at least one run in + the group is still active. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/tasks/groups/{task_group_id}/events", task_group_id=task_group_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "last_event_id": last_event_id, + "api_timeout": api_timeout, + }, + task_group_events_params.TaskGroupEventsParams, + ), + ), + cast_to=cast( + Any, TaskGroupEventsResponse + ), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=AsyncStream[TaskGroupEventsResponse], + ) + + async def get_runs( + self, + task_group_id: str, + *, + include_input: bool | Omit = omit, + include_output: bool | Omit = omit, + last_event_id: Optional[str] | Omit = omit, + status: Optional[ + Literal["queued", "action_required", "running", "completed", "failed", "cancelling", "cancelled"] + ] + | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AsyncStream[TaskGroupGetRunsResponse]: + """ + Retrieves task runs in a TaskGroup and optionally their inputs and outputs. + + All runs within a TaskGroup are returned as a stream. To get the inputs and/or + outputs back in the stream, set the corresponding `include_input` and + `include_output` parameters to `true`. + + The stream is resumable using the `event_id` as the cursor. To resume a stream, + specify the `last_event_id` parameter with the `event_id` of the last event in + the stream. The stream will resume from the next event after the + `last_event_id`. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not task_group_id: + raise ValueError(f"Expected a non-empty value for `task_group_id` but received {task_group_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/tasks/groups/{task_group_id}/runs", task_group_id=task_group_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + { + "include_input": include_input, + "include_output": include_output, + "last_event_id": last_event_id, + "status": status, + }, + task_group_get_runs_params.TaskGroupGetRunsParams, + ), + ), + cast_to=cast( + Any, TaskGroupGetRunsResponse + ), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=AsyncStream[TaskGroupGetRunsResponse], + ) + + +class TaskGroupResourceWithRawResponse: + def __init__(self, task_group: TaskGroupResource) -> None: + self._task_group = task_group + + self.create = to_raw_response_wrapper( + task_group.create, + ) + self.retrieve = to_raw_response_wrapper( + task_group.retrieve, + ) + self.add_runs = to_raw_response_wrapper( + task_group.add_runs, + ) + self.events = to_raw_response_wrapper( + task_group.events, + ) + self.get_runs = to_raw_response_wrapper( + task_group.get_runs, + ) + + +class AsyncTaskGroupResourceWithRawResponse: + def __init__(self, task_group: AsyncTaskGroupResource) -> None: + self._task_group = task_group + + self.create = async_to_raw_response_wrapper( + task_group.create, + ) + self.retrieve = async_to_raw_response_wrapper( + task_group.retrieve, + ) + self.add_runs = async_to_raw_response_wrapper( + task_group.add_runs, + ) + self.events = async_to_raw_response_wrapper( + task_group.events, + ) + self.get_runs = async_to_raw_response_wrapper( + task_group.get_runs, + ) + + +class TaskGroupResourceWithStreamingResponse: + def __init__(self, task_group: TaskGroupResource) -> None: + self._task_group = task_group + + self.create = to_streamed_response_wrapper( + task_group.create, + ) + self.retrieve = to_streamed_response_wrapper( + task_group.retrieve, + ) + self.add_runs = to_streamed_response_wrapper( + task_group.add_runs, + ) + self.events = to_streamed_response_wrapper( + task_group.events, + ) + self.get_runs = to_streamed_response_wrapper( + task_group.get_runs, + ) + + +class AsyncTaskGroupResourceWithStreamingResponse: + def __init__(self, task_group: AsyncTaskGroupResource) -> None: + self._task_group = task_group + + self.create = async_to_streamed_response_wrapper( + task_group.create, + ) + self.retrieve = async_to_streamed_response_wrapper( + task_group.retrieve, + ) + self.add_runs = async_to_streamed_response_wrapper( + task_group.add_runs, + ) + self.events = async_to_streamed_response_wrapper( + task_group.events, + ) + self.get_runs = async_to_streamed_response_wrapper( + task_group.get_runs, + ) diff --git a/src/parallel/resources/beta/task_run.py b/src/parallel/resources/beta/task_run.py new file mode 100644 index 0000000..17f3d06 --- /dev/null +++ b/src/parallel/resources/beta/task_run.py @@ -0,0 +1,573 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import typing_extensions +from typing import Any, Dict, List, Union, Iterable, Optional, cast +from itertools import chain + +import httpx + +from ..._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from ..._utils import is_given, path_template, maybe_transform, strip_not_given, async_maybe_transform +from ..._compat import cached_property +from ..._resource import SyncAPIResource, AsyncAPIResource +from ..._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from ..._streaming import Stream, AsyncStream +from ...types.beta import task_run_create_params, task_run_result_params +from ..._base_client import make_request_options +from ...types.task_run import TaskRun +from ...types.webhook_param import WebhookParam +from ...types.task_run_result import TaskRunResult +from ...types.task_spec_param import TaskSpecParam +from ...types.mcp_server_param import McpServerParam +from ...types.beta.parallel_beta_param import ParallelBetaParam +from ...types.shared_params.source_policy import SourcePolicy +from ...types.beta.task_run_events_response import TaskRunEventsResponse + +__all__ = ["TaskRunResource", "AsyncTaskRunResource"] + + +class TaskRunResource(SyncAPIResource): + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + + @cached_property + def with_raw_response(self) -> TaskRunResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return TaskRunResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> TaskRunResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return TaskRunResourceWithStreamingResponse(self) + + @typing_extensions.deprecated("Use GA Task Run instead") + def create( + self, + *, + input: Union[str, Dict[str, object]], + processor: str, + enable_events: Optional[bool] | Omit = omit, + mcp_servers: Optional[Iterable[McpServerParam]] | Omit = omit, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + previous_interaction_id: Optional[str] | Omit = omit, + source_policy: Optional[SourcePolicy] | Omit = omit, + task_spec: Optional[TaskSpecParam] | Omit = omit, + webhook: Optional[WebhookParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRun: + """ + Initiates a task run. + + Returns immediately with a run object in status 'queued'. + + Beta features can be enabled by setting the 'parallel-beta' header. + + Args: + input: Input to the task, either text or a JSON object. + + processor: Processor to use for the task. + + enable_events: Controls tracking of task run execution progress. When set to true, progress + events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + + mcp_servers: Optional list of MCP servers to use for the run. + + metadata: User-provided metadata stored with the run. Keys and values must be strings with + a maximum length of 16 and 512 characters respectively. + + previous_interaction_id: Interaction ID to use as context for this request. + + source_policy: Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + + task_spec: Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + + webhook: Webhooks for Task Runs. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._post( + "/v1/tasks/runs", + body=maybe_transform( + { + "input": input, + "processor": processor, + "enable_events": enable_events, + "mcp_servers": mcp_servers, + "metadata": metadata, + "previous_interaction_id": previous_interaction_id, + "source_policy": source_policy, + "task_spec": task_spec, + "webhook": webhook, + }, + task_run_create_params.TaskRunCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskRun, + ) + + @typing_extensions.deprecated("Use GA Task Run instead") + def events( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> Stream[TaskRunEventsResponse]: + """ + Streams events for a task run. + + Returns a stream of events showing progress updates and state changes for the + task run. + + For task runs that did not have enable_events set to true during creation, the + frequency of events will be reduced. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._get( + path_template("/v1beta/tasks/runs/{run_id}/events", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=cast(Any, TaskRunEventsResponse), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=Stream[TaskRunEventsResponse], + ) + + @typing_extensions.deprecated("Use GA Task Run instead") + def result( + self, + run_id: str, + *, + api_timeout: int | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRunResult: + """ + Retrieves a run result by run_id, blocking until the run is completed. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return self._get( + path_template("/v1/tasks/runs/{run_id}/result", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform({"api_timeout": api_timeout}, task_run_result_params.TaskRunResultParams), + ), + cast_to=TaskRunResult, + ) + + +class AsyncTaskRunResource(AsyncAPIResource): + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + + @cached_property + def with_raw_response(self) -> AsyncTaskRunResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncTaskRunResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncTaskRunResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return AsyncTaskRunResourceWithStreamingResponse(self) + + @typing_extensions.deprecated("Use GA Task Run instead") + async def create( + self, + *, + input: Union[str, Dict[str, object]], + processor: str, + enable_events: Optional[bool] | Omit = omit, + mcp_servers: Optional[Iterable[McpServerParam]] | Omit = omit, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + previous_interaction_id: Optional[str] | Omit = omit, + source_policy: Optional[SourcePolicy] | Omit = omit, + task_spec: Optional[TaskSpecParam] | Omit = omit, + webhook: Optional[WebhookParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRun: + """ + Initiates a task run. + + Returns immediately with a run object in status 'queued'. + + Beta features can be enabled by setting the 'parallel-beta' header. + + Args: + input: Input to the task, either text or a JSON object. + + processor: Processor to use for the task. + + enable_events: Controls tracking of task run execution progress. When set to true, progress + events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + + mcp_servers: Optional list of MCP servers to use for the run. + + metadata: User-provided metadata stored with the run. Keys and values must be strings with + a maximum length of 16 and 512 characters respectively. + + previous_interaction_id: Interaction ID to use as context for this request. + + source_policy: Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + + task_spec: Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + + webhook: Webhooks for Task Runs. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._post( + "/v1/tasks/runs", + body=await async_maybe_transform( + { + "input": input, + "processor": processor, + "enable_events": enable_events, + "mcp_servers": mcp_servers, + "metadata": metadata, + "previous_interaction_id": previous_interaction_id, + "source_policy": source_policy, + "task_spec": task_spec, + "webhook": webhook, + }, + task_run_create_params.TaskRunCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskRun, + ) + + @typing_extensions.deprecated("Use GA Task Run instead") + async def events( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AsyncStream[TaskRunEventsResponse]: + """ + Streams events for a task run. + + Returns a stream of events showing progress updates and state changes for the + task run. + + For task runs that did not have enable_events set to true during creation, the + frequency of events will be reduced. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._get( + path_template("/v1beta/tasks/runs/{run_id}/events", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=cast(Any, TaskRunEventsResponse), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=AsyncStream[TaskRunEventsResponse], + ) + + @typing_extensions.deprecated("Use GA Task Run instead") + async def result( + self, + run_id: str, + *, + api_timeout: int | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRunResult: + """ + Retrieves a run result by run_id, blocking until the run is completed. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = { + **strip_not_given( + { + "parallel-beta": ",".join(chain((str(e) for e in betas), ["search-extract-2025-10-10"])) + if is_given(betas) + else not_given + } + ), + **(extra_headers or {}), + } + extra_headers = {"parallel-beta": "search-extract-2025-10-10", **(extra_headers or {})} + return await self._get( + path_template("/v1/tasks/runs/{run_id}/result", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + {"api_timeout": api_timeout}, task_run_result_params.TaskRunResultParams + ), + ), + cast_to=TaskRunResult, + ) + + +class TaskRunResourceWithRawResponse: + def __init__(self, task_run: TaskRunResource) -> None: + self._task_run = task_run + + self.create = ( # pyright: ignore[reportDeprecated] + to_raw_response_wrapper( + task_run.create, # pyright: ignore[reportDeprecated], + ) + ) + self.events = ( # pyright: ignore[reportDeprecated] + to_raw_response_wrapper( + task_run.events, # pyright: ignore[reportDeprecated], + ) + ) + self.result = ( # pyright: ignore[reportDeprecated] + to_raw_response_wrapper( + task_run.result, # pyright: ignore[reportDeprecated], + ) + ) + + +class AsyncTaskRunResourceWithRawResponse: + def __init__(self, task_run: AsyncTaskRunResource) -> None: + self._task_run = task_run + + self.create = ( # pyright: ignore[reportDeprecated] + async_to_raw_response_wrapper( + task_run.create, # pyright: ignore[reportDeprecated], + ) + ) + self.events = ( # pyright: ignore[reportDeprecated] + async_to_raw_response_wrapper( + task_run.events, # pyright: ignore[reportDeprecated], + ) + ) + self.result = ( # pyright: ignore[reportDeprecated] + async_to_raw_response_wrapper( + task_run.result, # pyright: ignore[reportDeprecated], + ) + ) + + +class TaskRunResourceWithStreamingResponse: + def __init__(self, task_run: TaskRunResource) -> None: + self._task_run = task_run + + self.create = ( # pyright: ignore[reportDeprecated] + to_streamed_response_wrapper( + task_run.create, # pyright: ignore[reportDeprecated], + ) + ) + self.events = ( # pyright: ignore[reportDeprecated] + to_streamed_response_wrapper( + task_run.events, # pyright: ignore[reportDeprecated], + ) + ) + self.result = ( # pyright: ignore[reportDeprecated] + to_streamed_response_wrapper( + task_run.result, # pyright: ignore[reportDeprecated], + ) + ) + + +class AsyncTaskRunResourceWithStreamingResponse: + def __init__(self, task_run: AsyncTaskRunResource) -> None: + self._task_run = task_run + + self.create = ( # pyright: ignore[reportDeprecated] + async_to_streamed_response_wrapper( + task_run.create, # pyright: ignore[reportDeprecated], + ) + ) + self.events = ( # pyright: ignore[reportDeprecated] + async_to_streamed_response_wrapper( + task_run.events, # pyright: ignore[reportDeprecated], + ) + ) + self.result = ( # pyright: ignore[reportDeprecated] + async_to_streamed_response_wrapper( + task_run.result, # pyright: ignore[reportDeprecated], + ) + ) diff --git a/src/parallel/resources/task_run.py b/src/parallel/resources/task_run.py new file mode 100644 index 0000000..c40aad8 --- /dev/null +++ b/src/parallel/resources/task_run.py @@ -0,0 +1,593 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Any, Dict, List, Union, Iterable, Optional, cast + +import httpx + +from ..types import task_run_create_params, task_run_result_params +from .._types import Body, Omit, Query, Headers, NotGiven, omit, not_given +from .._utils import is_given, path_template, maybe_transform, strip_not_given, async_maybe_transform +from .._compat import cached_property +from .._resource import SyncAPIResource, AsyncAPIResource +from .._response import ( + to_raw_response_wrapper, + to_streamed_response_wrapper, + async_to_raw_response_wrapper, + async_to_streamed_response_wrapper, +) +from .._streaming import Stream, AsyncStream +from .._base_client import make_request_options +from ..types.task_run import TaskRun +from ..types.webhook_param import WebhookParam +from ..types.task_run_result import TaskRunResult +from ..types.task_spec_param import TaskSpecParam +from ..types.mcp_server_param import McpServerParam +from ..types.beta.parallel_beta_param import ParallelBetaParam +from ..types.task_run_events_response import TaskRunEventsResponse +from ..types.shared_params.source_policy import SourcePolicy + +__all__ = ["TaskRunResource", "AsyncTaskRunResource"] + + +class TaskRunResource(SyncAPIResource): + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + + @cached_property + def with_raw_response(self) -> TaskRunResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return TaskRunResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> TaskRunResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return TaskRunResourceWithStreamingResponse(self) + + def create( + self, + *, + input: Union[str, Dict[str, object]], + processor: str, + enable_events: Optional[bool] | Omit = omit, + mcp_servers: Optional[Iterable[McpServerParam]] | Omit = omit, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + previous_interaction_id: Optional[str] | Omit = omit, + source_policy: Optional[SourcePolicy] | Omit = omit, + task_spec: Optional[TaskSpecParam] | Omit = omit, + webhook: Optional[WebhookParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRun: + """ + Initiates a task run. + + Returns immediately with a run object in status 'queued'. + + Beta features can be enabled by setting the 'parallel-beta' header. + + Args: + input: Input to the task, either text or a JSON object. + + processor: Processor to use for the task. + + enable_events: Controls tracking of task run execution progress. When set to true, progress + events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + + mcp_servers: Optional list of MCP servers to use for the run. + + metadata: User-provided metadata stored with the run. Keys and values must be strings with + a maximum length of 16 and 512 characters respectively. + + previous_interaction_id: Interaction ID to use as context for this request. + + source_policy: Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + + task_spec: Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + + webhook: Webhooks for Task Runs. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given({"parallel-beta": ",".join(str(e) for e in betas) if is_given(betas) else not_given}), + **(extra_headers or {}), + } + return self._post( + "/v1/tasks/runs", + body=maybe_transform( + { + "input": input, + "processor": processor, + "enable_events": enable_events, + "mcp_servers": mcp_servers, + "metadata": metadata, + "previous_interaction_id": previous_interaction_id, + "source_policy": source_policy, + "task_spec": task_spec, + "webhook": webhook, + }, + task_run_create_params.TaskRunCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskRun, + ) + + def retrieve( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRun: + """ + Retrieves run status by run_id. + + The run result is available from the `/result` endpoint. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + return self._get( + path_template("/v1/tasks/runs/{run_id}", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskRun, + ) + + def events( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> Stream[TaskRunEventsResponse]: + """ + Streams events for a task run. + + Returns a stream of events showing progress updates and state changes for the + task run. + + For task runs that did not have enable_events set to true during creation, the + frequency of events will be reduced. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + return self._get( + path_template("/v1/tasks/runs/{run_id}/events", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=cast(Any, TaskRunEventsResponse), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=Stream[TaskRunEventsResponse], + ) + + def result( + self, + run_id: str, + *, + api_timeout: int | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRunResult: + """ + Retrieves a run result by run_id, blocking until the run is completed. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = { + **strip_not_given({"parallel-beta": ",".join(str(e) for e in betas) if is_given(betas) else not_given}), + **(extra_headers or {}), + } + return self._get( + path_template("/v1/tasks/runs/{run_id}/result", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=maybe_transform({"api_timeout": api_timeout}, task_run_result_params.TaskRunResultParams), + ), + cast_to=TaskRunResult, + ) + + +class AsyncTaskRunResource(AsyncAPIResource): + """The Task API executes web research and extraction tasks. + + Clients submit a natural-language objective with an optional input schema; the service plans retrieval, fetches relevant URLs, and returns outputs that conform to a provided or inferred JSON schema. Supports deep research style queries and can return rich structured JSON outputs. Processors trade-off between cost, latency, and quality. Each processor supports calibrated confidences. + - Output metadata: citations, excerpts, reasoning, and confidence per field + """ + + @cached_property + def with_raw_response(self) -> AsyncTaskRunResourceWithRawResponse: + """ + This property can be used as a prefix for any HTTP method call to return + the raw response object instead of the parsed content. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#accessing-raw-response-data-eg-headers + """ + return AsyncTaskRunResourceWithRawResponse(self) + + @cached_property + def with_streaming_response(self) -> AsyncTaskRunResourceWithStreamingResponse: + """ + An alternative to `.with_raw_response` that doesn't eagerly read the response body. + + For more information, see https://www.github.com/parallel-web/parallel-sdk-python#with_streaming_response + """ + return AsyncTaskRunResourceWithStreamingResponse(self) + + async def create( + self, + *, + input: Union[str, Dict[str, object]], + processor: str, + enable_events: Optional[bool] | Omit = omit, + mcp_servers: Optional[Iterable[McpServerParam]] | Omit = omit, + metadata: Optional[Dict[str, Union[str, float, bool]]] | Omit = omit, + previous_interaction_id: Optional[str] | Omit = omit, + source_policy: Optional[SourcePolicy] | Omit = omit, + task_spec: Optional[TaskSpecParam] | Omit = omit, + webhook: Optional[WebhookParam] | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRun: + """ + Initiates a task run. + + Returns immediately with a run object in status 'queued'. + + Beta features can be enabled by setting the 'parallel-beta' header. + + Args: + input: Input to the task, either text or a JSON object. + + processor: Processor to use for the task. + + enable_events: Controls tracking of task run execution progress. When set to true, progress + events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + + mcp_servers: Optional list of MCP servers to use for the run. + + metadata: User-provided metadata stored with the run. Keys and values must be strings with + a maximum length of 16 and 512 characters respectively. + + previous_interaction_id: Interaction ID to use as context for this request. + + source_policy: Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + + task_spec: Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + + webhook: Webhooks for Task Runs. + + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + extra_headers = { + **strip_not_given({"parallel-beta": ",".join(str(e) for e in betas) if is_given(betas) else not_given}), + **(extra_headers or {}), + } + return await self._post( + "/v1/tasks/runs", + body=await async_maybe_transform( + { + "input": input, + "processor": processor, + "enable_events": enable_events, + "mcp_servers": mcp_servers, + "metadata": metadata, + "previous_interaction_id": previous_interaction_id, + "source_policy": source_policy, + "task_spec": task_spec, + "webhook": webhook, + }, + task_run_create_params.TaskRunCreateParams, + ), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskRun, + ) + + async def retrieve( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRun: + """ + Retrieves run status by run_id. + + The run result is available from the `/result` endpoint. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + return await self._get( + path_template("/v1/tasks/runs/{run_id}", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=TaskRun, + ) + + async def events( + self, + run_id: str, + *, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> AsyncStream[TaskRunEventsResponse]: + """ + Streams events for a task run. + + Returns a stream of events showing progress updates and state changes for the + task run. + + For task runs that did not have enable_events set to true during creation, the + frequency of events will be reduced. + + Args: + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = {"Accept": "text/event-stream", **(extra_headers or {})} + return await self._get( + path_template("/v1/tasks/runs/{run_id}/events", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, extra_query=extra_query, extra_body=extra_body, timeout=timeout + ), + cast_to=cast(Any, TaskRunEventsResponse), # Union types cannot be passed in as arguments in the type system + stream=True, + stream_cls=AsyncStream[TaskRunEventsResponse], + ) + + async def result( + self, + run_id: str, + *, + api_timeout: int | Omit = omit, + betas: List[ParallelBetaParam] | Omit = omit, + # Use the following arguments if you need to pass additional parameters to the API that aren't available via kwargs. + # The extra values given here take precedence over values defined on the client or passed to this method. + extra_headers: Headers | None = None, + extra_query: Query | None = None, + extra_body: Body | None = None, + timeout: float | httpx.Timeout | None | NotGiven = not_given, + ) -> TaskRunResult: + """ + Retrieves a run result by run_id, blocking until the run is completed. + + Args: + betas: Optional header to specify the beta version(s) to enable. + + extra_headers: Send extra headers + + extra_query: Add additional query parameters to the request + + extra_body: Add additional JSON properties to the request + + timeout: Override the client-level default timeout for this request, in seconds + """ + if not run_id: + raise ValueError(f"Expected a non-empty value for `run_id` but received {run_id!r}") + extra_headers = { + **strip_not_given({"parallel-beta": ",".join(str(e) for e in betas) if is_given(betas) else not_given}), + **(extra_headers or {}), + } + return await self._get( + path_template("/v1/tasks/runs/{run_id}/result", run_id=run_id), + options=make_request_options( + extra_headers=extra_headers, + extra_query=extra_query, + extra_body=extra_body, + timeout=timeout, + query=await async_maybe_transform( + {"api_timeout": api_timeout}, task_run_result_params.TaskRunResultParams + ), + ), + cast_to=TaskRunResult, + ) + + +class TaskRunResourceWithRawResponse: + def __init__(self, task_run: TaskRunResource) -> None: + self._task_run = task_run + + self.create = to_raw_response_wrapper( + task_run.create, + ) + self.retrieve = to_raw_response_wrapper( + task_run.retrieve, + ) + self.events = to_raw_response_wrapper( + task_run.events, + ) + self.result = to_raw_response_wrapper( + task_run.result, + ) + + +class AsyncTaskRunResourceWithRawResponse: + def __init__(self, task_run: AsyncTaskRunResource) -> None: + self._task_run = task_run + + self.create = async_to_raw_response_wrapper( + task_run.create, + ) + self.retrieve = async_to_raw_response_wrapper( + task_run.retrieve, + ) + self.events = async_to_raw_response_wrapper( + task_run.events, + ) + self.result = async_to_raw_response_wrapper( + task_run.result, + ) + + +class TaskRunResourceWithStreamingResponse: + def __init__(self, task_run: TaskRunResource) -> None: + self._task_run = task_run + + self.create = to_streamed_response_wrapper( + task_run.create, + ) + self.retrieve = to_streamed_response_wrapper( + task_run.retrieve, + ) + self.events = to_streamed_response_wrapper( + task_run.events, + ) + self.result = to_streamed_response_wrapper( + task_run.result, + ) + + +class AsyncTaskRunResourceWithStreamingResponse: + def __init__(self, task_run: AsyncTaskRunResource) -> None: + self._task_run = task_run + + self.create = async_to_streamed_response_wrapper( + task_run.create, + ) + self.retrieve = async_to_streamed_response_wrapper( + task_run.retrieve, + ) + self.events = async_to_streamed_response_wrapper( + task_run.events, + ) + self.result = async_to_streamed_response_wrapper( + task_run.result, + ) diff --git a/src/parallel/types/__init__.py b/src/parallel/types/__init__.py new file mode 100644 index 0000000..fc9fbfe --- /dev/null +++ b/src/parallel/types/__init__.py @@ -0,0 +1,36 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .shared import ( + Warning as Warning, + ErrorObject as ErrorObject, + SourcePolicy as SourcePolicy, + ErrorResponse as ErrorResponse, +) +from .webhook import Webhook as Webhook +from .citation import Citation as Citation +from .task_run import TaskRun as TaskRun +from .run_input import RunInput as RunInput +from .task_spec import TaskSpec as TaskSpec +from .mcp_server import McpServer as McpServer +from .auto_schema import AutoSchema as AutoSchema +from .error_event import ErrorEvent as ErrorEvent +from .field_basis import FieldBasis as FieldBasis +from .json_schema import JsonSchema as JsonSchema +from .text_schema import TextSchema as TextSchema +from .mcp_tool_call import McpToolCall as McpToolCall +from .webhook_param import WebhookParam as WebhookParam +from .task_run_event import TaskRunEvent as TaskRunEvent +from .run_input_param import RunInputParam as RunInputParam +from .task_run_result import TaskRunResult as TaskRunResult +from .task_spec_param import TaskSpecParam as TaskSpecParam +from .mcp_server_param import McpServerParam as McpServerParam +from .auto_schema_param import AutoSchemaParam as AutoSchemaParam +from .json_schema_param import JsonSchemaParam as JsonSchemaParam +from .text_schema_param import TextSchemaParam as TextSchemaParam +from .task_run_json_output import TaskRunJsonOutput as TaskRunJsonOutput +from .task_run_text_output import TaskRunTextOutput as TaskRunTextOutput +from .task_run_create_params import TaskRunCreateParams as TaskRunCreateParams +from .task_run_result_params import TaskRunResultParams as TaskRunResultParams +from .task_run_events_response import TaskRunEventsResponse as TaskRunEventsResponse diff --git a/src/parallel/types/auto_schema.py b/src/parallel/types/auto_schema.py new file mode 100644 index 0000000..f32a610 --- /dev/null +++ b/src/parallel/types/auto_schema.py @@ -0,0 +1,15 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["AutoSchema"] + + +class AutoSchema(BaseModel): + """Auto schema for a task input or output.""" + + type: Optional[Literal["auto"]] = None + """The type of schema being defined. Always `auto`.""" diff --git a/src/parallel/types/auto_schema_param.py b/src/parallel/types/auto_schema_param.py new file mode 100644 index 0000000..7c3b336 --- /dev/null +++ b/src/parallel/types/auto_schema_param.py @@ -0,0 +1,14 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing_extensions import Literal, TypedDict + +__all__ = ["AutoSchemaParam"] + + +class AutoSchemaParam(TypedDict, total=False): + """Auto schema for a task input or output.""" + + type: Literal["auto"] + """The type of schema being defined. Always `auto`.""" diff --git a/src/parallel/types/beta/__init__.py b/src/parallel/types/beta/__init__.py new file mode 100644 index 0000000..dcd2b4c --- /dev/null +++ b/src/parallel/types/beta/__init__.py @@ -0,0 +1,50 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .webhook import Webhook as Webhook +from .mcp_server import McpServer as McpServer +from .task_group import TaskGroup as TaskGroup +from .usage_item import UsageItem as UsageItem +from .error_event import ErrorEvent as ErrorEvent +from .findall_run import FindAllRun as FindAllRun +from .extract_error import ExtractError as ExtractError +from .mcp_tool_call import McpToolCall as McpToolCall +from .search_result import SearchResult as SearchResult +from .webhook_param import WebhookParam as WebhookParam +from .beta_run_input import BetaRunInput as BetaRunInput +from .extract_result import ExtractResult as ExtractResult +from .findall_schema import FindAllSchema as FindAllSchema +from .task_run_event import TaskRunEvent as TaskRunEvent +from .extract_response import ExtractResponse as ExtractResponse +from .mcp_server_param import McpServerParam as McpServerParam +from .task_group_status import TaskGroupStatus as TaskGroupStatus +from .web_search_result import WebSearchResult as WebSearchResult +from .beta_search_params import BetaSearchParams as BetaSearchParams +from .fetch_policy_param import FetchPolicyParam as FetchPolicyParam +from .findall_run_result import FindAllRunResult as FindAllRunResult +from .beta_extract_params import BetaExtractParams as BetaExtractParams +from .parallel_beta_param import ParallelBetaParam as ParallelBetaParam +from .beta_run_input_param import BetaRunInputParam as BetaRunInputParam +from .beta_task_run_result import BetaTaskRunResult as BetaTaskRunResult +from .findall_enrich_input import FindAllEnrichInput as FindAllEnrichInput +from .findall_create_params import FindAllCreateParams as FindAllCreateParams +from .findall_enrich_params import FindAllEnrichParams as FindAllEnrichParams +from .findall_events_params import FindAllEventsParams as FindAllEventsParams +from .findall_extend_params import FindAllExtendParams as FindAllExtendParams +from .findall_ingest_params import FindAllIngestParams as FindAllIngestParams +from .excerpt_settings_param import ExcerptSettingsParam as ExcerptSettingsParam +from .task_run_create_params import TaskRunCreateParams as TaskRunCreateParams +from .task_run_result_params import TaskRunResultParams as TaskRunResultParams +from .findall_events_response import FindAllEventsResponse as FindAllEventsResponse +from .task_group_run_response import TaskGroupRunResponse as TaskGroupRunResponse +from .findall_run_status_event import FindAllRunStatusEvent as FindAllRunStatusEvent +from .task_group_create_params import TaskGroupCreateParams as TaskGroupCreateParams +from .task_group_events_params import TaskGroupEventsParams as TaskGroupEventsParams +from .task_run_events_response import TaskRunEventsResponse as TaskRunEventsResponse +from .task_group_add_runs_params import TaskGroupAddRunsParams as TaskGroupAddRunsParams +from .task_group_events_response import TaskGroupEventsResponse as TaskGroupEventsResponse +from .task_group_get_runs_params import TaskGroupGetRunsParams as TaskGroupGetRunsParams +from .findall_schema_updated_event import FindAllSchemaUpdatedEvent as FindAllSchemaUpdatedEvent +from .task_group_get_runs_response import TaskGroupGetRunsResponse as TaskGroupGetRunsResponse +from .findall_candidate_match_status_event import FindAllCandidateMatchStatusEvent as FindAllCandidateMatchStatusEvent diff --git a/src/parallel/types/beta/beta_extract_params.py b/src/parallel/types/beta/beta_extract_params.py new file mode 100644 index 0000000..79c0262 --- /dev/null +++ b/src/parallel/types/beta/beta_extract_params.py @@ -0,0 +1,36 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Union, Optional +from typing_extensions import Required, Annotated, TypeAlias, TypedDict + +from ..._types import SequenceNotStr +from ..._utils import PropertyInfo +from .fetch_policy_param import FetchPolicyParam +from .parallel_beta_param import ParallelBetaParam +from .excerpt_settings_param import ExcerptSettingsParam + +__all__ = ["BetaExtractParams", "Excerpts"] + + +class BetaExtractParams(TypedDict, total=False): + urls: Required[SequenceNotStr[str]] + + excerpts: Excerpts + """Include excerpts from each URL relevant to the search objective and queries.""" + + fetch_policy: Optional[FetchPolicyParam] + """Policy for live fetching web results.""" + + objective: Optional[str] + """If provided, focuses extracted content on the specified search objective.""" + + search_queries: Optional[SequenceNotStr[str]] + """If provided, focuses extracted content on the specified keyword search queries.""" + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" + + +Excerpts: TypeAlias = Union[bool, ExcerptSettingsParam] diff --git a/src/parallel/types/beta/beta_run_input.py b/src/parallel/types/beta/beta_run_input.py new file mode 100644 index 0000000..df1860f --- /dev/null +++ b/src/parallel/types/beta/beta_run_input.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from ..run_input import RunInput + +__all__ = ["BetaRunInput"] + +BetaRunInput = RunInput +"""Use parallel.types.task_run.TaskRunInput instead""" diff --git a/src/parallel/types/beta/beta_run_input_param.py b/src/parallel/types/beta/beta_run_input_param.py new file mode 100644 index 0000000..fa83fa5 --- /dev/null +++ b/src/parallel/types/beta/beta_run_input_param.py @@ -0,0 +1,7 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from ..run_input_param import RunInputParam + +BetaRunInputParam = RunInputParam diff --git a/src/parallel/types/beta/beta_search_params.py b/src/parallel/types/beta/beta_search_params.py new file mode 100644 index 0000000..4a0776f --- /dev/null +++ b/src/parallel/types/beta/beta_search_params.py @@ -0,0 +1,66 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Optional +from typing_extensions import Literal, Annotated, TypedDict + +from ..._types import SequenceNotStr +from ..._utils import PropertyInfo +from .fetch_policy_param import FetchPolicyParam +from .parallel_beta_param import ParallelBetaParam +from .excerpt_settings_param import ExcerptSettingsParam +from ..shared_params.source_policy import SourcePolicy + +__all__ = ["BetaSearchParams"] + + +class BetaSearchParams(TypedDict, total=False): + excerpts: ExcerptSettingsParam + """Optional settings to configure excerpt generation.""" + + fetch_policy: Optional[FetchPolicyParam] + """Policy for live fetching web results.""" + + max_chars_per_result: Optional[int] + """DEPRECATED: Use `excerpts.max_chars_per_result` instead.""" + + max_results: Optional[int] + """Upper bound on the number of results to return. Defaults to 10 if not provided.""" + + mode: Optional[Literal["one-shot", "agentic", "fast"]] + """Presets default values for parameters for different use cases. + + - `one-shot` returns more comprehensive results and longer excerpts to answer + questions from a single response + - `agentic` returns more concise, token-efficient results for use in an agentic + loop + - `fast` trades some quality for lower latency, with best results when used with + concise and high-quality objective and keyword queries + """ + + objective: Optional[str] + """Natural-language description of what the web search is trying to find. + + May include guidance about preferred sources or freshness. At least one of + objective or search_queries must be provided. + """ + + processor: Optional[Literal["base", "pro"]] + """DEPRECATED: use `mode` instead.""" + + search_queries: Optional[SequenceNotStr[str]] + """Optional list of traditional keyword search queries to guide the search. + + May contain search operators. At least one of objective or search_queries must + be provided. + """ + + source_policy: Optional[SourcePolicy] + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/beta_task_run_result.py b/src/parallel/types/beta/beta_task_run_result.py new file mode 100644 index 0000000..0abec34 --- /dev/null +++ b/src/parallel/types/beta/beta_task_run_result.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from ..task_run_result import TaskRunResult + +__all__ = ["BetaTaskRunResult"] + +BetaTaskRunResult = TaskRunResult +"""Use parallel.types.task_run.TaskRunResult instead""" diff --git a/src/parallel/types/beta/error_event.py b/src/parallel/types/beta/error_event.py new file mode 100644 index 0000000..becb915 --- /dev/null +++ b/src/parallel/types/beta/error_event.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .. import error_event + +__all__ = ["ErrorEvent"] + +ErrorEvent = error_event.ErrorEvent +"""Use parallel.types.task_run.ErrorEvent instead""" diff --git a/src/parallel/types/beta/excerpt_settings_param.py b/src/parallel/types/beta/excerpt_settings_param.py new file mode 100644 index 0000000..2835f57 --- /dev/null +++ b/src/parallel/types/beta/excerpt_settings_param.py @@ -0,0 +1,27 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Optional +from typing_extensions import TypedDict + +__all__ = ["ExcerptSettingsParam"] + + +class ExcerptSettingsParam(TypedDict, total=False): + """Optional settings for returning relevant excerpts.""" + + max_chars_per_result: Optional[int] + """Optional upper bound on the total number of characters to include per url. + + Excerpts may contain fewer characters than this limit to maximize relevance and + token efficiency. Values below 1000 will be automatically set to 1000. + """ + + max_chars_total: Optional[int] + """ + Optional upper bound on the total number of characters to include across all + urls. Results may contain fewer characters than this limit to maximize relevance + and token efficiency. Values below 1000 will be automatically set to 1000. This + overall limit applies in addition to max_chars_per_result. + """ diff --git a/src/parallel/types/beta/extract_error.py b/src/parallel/types/beta/extract_error.py new file mode 100644 index 0000000..0c8a19f --- /dev/null +++ b/src/parallel/types/beta/extract_error.py @@ -0,0 +1,22 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional + +from ..._models import BaseModel + +__all__ = ["ExtractError"] + + +class ExtractError(BaseModel): + """Extract error details.""" + + content: Optional[str] = None + """Content returned for http client or server errors, if any.""" + + error_type: str + """Error type.""" + + http_status_code: Optional[int] = None + """HTTP status code, if available.""" + + url: str diff --git a/src/parallel/types/beta/extract_response.py b/src/parallel/types/beta/extract_response.py new file mode 100644 index 0000000..45717bc --- /dev/null +++ b/src/parallel/types/beta/extract_response.py @@ -0,0 +1,30 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from ..._models import BaseModel +from .usage_item import UsageItem +from .extract_error import ExtractError +from .extract_result import ExtractResult +from ..shared.warning import Warning + +__all__ = ["ExtractResponse"] + + +class ExtractResponse(BaseModel): + """Fetch result.""" + + errors: List[ExtractError] + """Extract errors: requested URLs not in the results.""" + + extract_id: str + """Extract request ID, e.g. `extract_cad0a6d2dec046bd95ae900527d880e7`""" + + results: List[ExtractResult] + """Successful extract results.""" + + usage: Optional[List[UsageItem]] = None + """Usage metrics for the extract request.""" + + warnings: Optional[List[Warning]] = None + """Warnings for the extract request, if any.""" diff --git a/src/parallel/types/beta/extract_result.py b/src/parallel/types/beta/extract_result.py new file mode 100644 index 0000000..9b5e594 --- /dev/null +++ b/src/parallel/types/beta/extract_result.py @@ -0,0 +1,23 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from ..._models import BaseModel + +__all__ = ["ExtractResult"] + + +class ExtractResult(BaseModel): + """Extract result for a single URL.""" + + url: str + """URL associated with the search result.""" + + excerpts: Optional[List[str]] = None + """Relevant excerpted content from the URL, formatted as markdown.""" + + publish_date: Optional[str] = None + """Publish date of the webpage in YYYY-MM-DD format, if available.""" + + title: Optional[str] = None + """Title of the webpage, if available.""" diff --git a/src/parallel/types/beta/fetch_policy_param.py b/src/parallel/types/beta/fetch_policy_param.py new file mode 100644 index 0000000..5bc4447 --- /dev/null +++ b/src/parallel/types/beta/fetch_policy_param.py @@ -0,0 +1,27 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Optional +from typing_extensions import TypedDict + +__all__ = ["FetchPolicyParam"] + + +class FetchPolicyParam(TypedDict, total=False): + """Policy for live fetching web results.""" + + disable_cache_fallback: bool + """ + If false, fallback to cached content older than max-age if live fetch fails or + times out. If true, returns an error instead. + """ + + max_age_seconds: Optional[int] + """Maximum age of cached content in seconds to trigger a live fetch. + + Minimum value 600 seconds (10 minutes). + """ + + timeout_seconds: Optional[float] + """Timeout in seconds for fetching live content if unavailable in cache.""" diff --git a/src/parallel/types/beta/findall_candidate_match_status_event.py b/src/parallel/types/beta/findall_candidate_match_status_event.py new file mode 100644 index 0000000..5f7e3bb --- /dev/null +++ b/src/parallel/types/beta/findall_candidate_match_status_event.py @@ -0,0 +1,68 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Optional +from datetime import datetime +from typing_extensions import Literal + +from ..._models import BaseModel +from ..field_basis import FieldBasis + +__all__ = ["FindAllCandidateMatchStatusEvent", "Data"] + + +class Data(BaseModel): + """The candidate whose match status has been updated.""" + + candidate_id: str + """ID of the candidate.""" + + match_status: Literal["generated", "matched", "unmatched", "discarded"] + """Status of the candidate. One of generated, matched, unmatched, discarded.""" + + name: str + """Name of the candidate.""" + + url: str + """URL that provides context or details of the entity for disambiguation.""" + + basis: Optional[List[FieldBasis]] = None + """List of FieldBasis objects supporting the output.""" + + description: Optional[str] = None + """ + Brief description of the entity that can help answer whether entity satisfies + the query. + """ + + output: Optional[Dict[str, object]] = None + """Results of the match condition evaluations for this candidate. + + This object contains the structured output that determines whether the candidate + matches the overall FindAll objective. + """ + + +class FindAllCandidateMatchStatusEvent(BaseModel): + """Event containing a candidate whose match status has changed.""" + + data: Data + """The candidate whose match status has been updated.""" + + event_id: str + """Unique event identifier for the event.""" + + timestamp: datetime + """Timestamp of the event.""" + + type: Literal[ + "findall.candidate.generated", + "findall.candidate.matched", + "findall.candidate.unmatched", + "findall.candidate.discarded", + "findall.candidate.enriched", + ] + """ + Event type; one of findall.candidate.generated, findall.candidate.matched, + findall.candidate.unmatched, findall.candidate.discarded, + findall.candidate.enriched. + """ diff --git a/src/parallel/types/beta/findall_create_params.py b/src/parallel/types/beta/findall_create_params.py new file mode 100644 index 0000000..cdb06ff --- /dev/null +++ b/src/parallel/types/beta/findall_create_params.py @@ -0,0 +1,68 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict, List, Union, Iterable, Optional +from typing_extensions import Literal, Required, Annotated, TypedDict + +from ..._utils import PropertyInfo +from ..webhook_param import WebhookParam +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["FindAllCreateParams", "MatchCondition", "ExcludeList"] + + +class FindAllCreateParams(TypedDict, total=False): + entity_type: Required[str] + """Type of the entity for the FindAll run.""" + + generator: Required[Literal["base", "core", "pro", "preview"]] + """Generator for the FindAll run. One of base, core, pro, preview.""" + + match_conditions: Required[Iterable[MatchCondition]] + """List of match conditions for the FindAll run.""" + + match_limit: Required[int] + """Maximum number of matches to find for this FindAll run. + + Must be between 5 and 1000 (inclusive). + """ + + objective: Required[str] + """Natural language objective of the FindAll run.""" + + exclude_list: Optional[Iterable[ExcludeList]] + """List of entity names/IDs to exclude from results.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] + """Metadata for the FindAll run.""" + + webhook: Optional[WebhookParam] + """Webhooks for Task Runs.""" + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" + + +class MatchCondition(TypedDict, total=False): + """Match condition model for FindAll ingest.""" + + description: Required[str] + """Detailed description of the match condition. + + Include as much specific information as possible to help improve the quality and + accuracy of Find All run results. + """ + + name: Required[str] + """Name of the match condition.""" + + +class ExcludeList(TypedDict, total=False): + """Exclude candidate input model for FindAll run.""" + + name: Required[str] + """Name of the entity to exclude from results.""" + + url: Required[str] + """URL of the entity to exclude from results.""" diff --git a/src/parallel/types/beta/findall_enrich_input.py b/src/parallel/types/beta/findall_enrich_input.py new file mode 100644 index 0000000..f015709 --- /dev/null +++ b/src/parallel/types/beta/findall_enrich_input.py @@ -0,0 +1,22 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from ..._models import BaseModel +from ..mcp_server import McpServer +from ..json_schema import JsonSchema + +__all__ = ["FindAllEnrichInput"] + + +class FindAllEnrichInput(BaseModel): + """Input model for FindAll enrich.""" + + output_schema: JsonSchema + """JSON schema for the enrichment output schema for the FindAll run.""" + + mcp_servers: Optional[List[McpServer]] = None + """List of MCP servers to use for the task.""" + + processor: Optional[str] = None + """Processor to use for the task.""" diff --git a/src/parallel/types/beta/findall_enrich_params.py b/src/parallel/types/beta/findall_enrich_params.py new file mode 100644 index 0000000..31ce57e --- /dev/null +++ b/src/parallel/types/beta/findall_enrich_params.py @@ -0,0 +1,27 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Iterable, Optional +from typing_extensions import Required, Annotated, TypedDict + +from ..._utils import PropertyInfo +from ..mcp_server_param import McpServerParam +from ..json_schema_param import JsonSchemaParam +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["FindAllEnrichParams"] + + +class FindAllEnrichParams(TypedDict, total=False): + output_schema: Required[JsonSchemaParam] + """JSON schema for the enrichment output schema for the FindAll run.""" + + mcp_servers: Optional[Iterable[McpServerParam]] + """List of MCP servers to use for the task.""" + + processor: str + """Processor to use for the task.""" + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/findall_events_params.py b/src/parallel/types/beta/findall_events_params.py new file mode 100644 index 0000000..1747020 --- /dev/null +++ b/src/parallel/types/beta/findall_events_params.py @@ -0,0 +1,20 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Optional +from typing_extensions import Annotated, TypedDict + +from ..._utils import PropertyInfo +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["FindAllEventsParams"] + + +class FindAllEventsParams(TypedDict, total=False): + last_event_id: Optional[str] + + api_timeout: Annotated[Optional[float], PropertyInfo(alias="timeout")] + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/findall_events_response.py b/src/parallel/types/beta/findall_events_response.py new file mode 100644 index 0000000..0334372 --- /dev/null +++ b/src/parallel/types/beta/findall_events_response.py @@ -0,0 +1,17 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union +from typing_extensions import Annotated, TypeAlias + +from ..._utils import PropertyInfo +from ..error_event import ErrorEvent +from .findall_run_status_event import FindAllRunStatusEvent +from .findall_schema_updated_event import FindAllSchemaUpdatedEvent +from .findall_candidate_match_status_event import FindAllCandidateMatchStatusEvent + +__all__ = ["FindAllEventsResponse"] + +FindAllEventsResponse: TypeAlias = Annotated[ + Union[FindAllSchemaUpdatedEvent, FindAllRunStatusEvent, FindAllCandidateMatchStatusEvent, ErrorEvent], + PropertyInfo(discriminator="type"), +] diff --git a/src/parallel/types/beta/findall_extend_params.py b/src/parallel/types/beta/findall_extend_params.py new file mode 100644 index 0000000..d90226e --- /dev/null +++ b/src/parallel/types/beta/findall_extend_params.py @@ -0,0 +1,23 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List +from typing_extensions import Required, Annotated, TypedDict + +from ..._utils import PropertyInfo +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["FindAllExtendParams"] + + +class FindAllExtendParams(TypedDict, total=False): + additional_match_limit: Required[int] + """Additional number of matches to find for this FindAll run. + + This value will be added to the current match limit to determine the new total + match limit. Must be greater than 0. + """ + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/findall_ingest_params.py b/src/parallel/types/beta/findall_ingest_params.py new file mode 100644 index 0000000..fbdb3f3 --- /dev/null +++ b/src/parallel/types/beta/findall_ingest_params.py @@ -0,0 +1,19 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List +from typing_extensions import Required, Annotated, TypedDict + +from ..._utils import PropertyInfo +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["FindAllIngestParams"] + + +class FindAllIngestParams(TypedDict, total=False): + objective: Required[str] + """Natural language objective to create a FindAll run spec.""" + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/findall_run.py b/src/parallel/types/beta/findall_run.py new file mode 100644 index 0000000..4db3135 --- /dev/null +++ b/src/parallel/types/beta/findall_run.py @@ -0,0 +1,69 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Union, Optional +from typing_extensions import Literal + +from ..._models import BaseModel + +__all__ = ["FindAllRun", "Status", "StatusMetrics"] + + +class StatusMetrics(BaseModel): + """Candidate metrics for the FindAll run.""" + + generated_candidates_count: Optional[int] = None + """Number of candidates that were selected.""" + + matched_candidates_count: Optional[int] = None + """Number of candidates that evaluated to matched.""" + + +class Status(BaseModel): + """Status object for the FindAll run.""" + + is_active: bool + """Whether the FindAll run is active""" + + metrics: StatusMetrics + """Candidate metrics for the FindAll run.""" + + status: Literal["queued", "action_required", "running", "completed", "failed", "cancelling", "cancelled"] + """Status of the FindAll run.""" + + termination_reason: Optional[ + Literal[ + "low_match_rate", + "match_limit_met", + "candidates_exhausted", + "user_cancelled", + "error_occurred", + "timeout", + "insufficient_funds", + ] + ] = None + """Reason for termination when FindAll run is in terminal status.""" + + +class FindAllRun(BaseModel): + """FindAll run object with status and metadata.""" + + findall_id: str + """ID of the FindAll run.""" + + generator: Literal["base", "core", "pro", "preview"] + """Generator for the FindAll run.""" + + status: Status + """Status object for the FindAll run.""" + + created_at: Optional[str] = None + """Timestamp of the creation of the run, in RFC 3339 format.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] = None + """Metadata for the FindAll run.""" + + modified_at: Optional[str] = None + """ + Timestamp of the latest modification to the FindAll run result, in RFC 3339 + format. + """ diff --git a/src/parallel/types/beta/findall_run_result.py b/src/parallel/types/beta/findall_run_result.py new file mode 100644 index 0000000..2b413f0 --- /dev/null +++ b/src/parallel/types/beta/findall_run_result.py @@ -0,0 +1,67 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Optional +from typing_extensions import Literal + +from ..._models import BaseModel +from .findall_run import FindAllRun +from ..field_basis import FieldBasis + +__all__ = ["FindAllRunResult", "Candidate"] + + +class Candidate(BaseModel): + """Candidate for a find all run that may end up as a match. + + Contains all the candidate's metadata and the output of the match conditions. + A candidate is a match if all match conditions are satisfied. + """ + + candidate_id: str + """ID of the candidate.""" + + match_status: Literal["generated", "matched", "unmatched", "discarded"] + """Status of the candidate. One of generated, matched, unmatched, discarded.""" + + name: str + """Name of the candidate.""" + + url: str + """URL that provides context or details of the entity for disambiguation.""" + + basis: Optional[List[FieldBasis]] = None + """List of FieldBasis objects supporting the output.""" + + description: Optional[str] = None + """ + Brief description of the entity that can help answer whether entity satisfies + the query. + """ + + output: Optional[Dict[str, object]] = None + """Results of the match condition evaluations for this candidate. + + This object contains the structured output that determines whether the candidate + matches the overall FindAll objective. + """ + + +class FindAllRunResult(BaseModel): + """Complete FindAll search results. + + Represents a snapshot of a FindAll run, including run metadata and a list of + candidate entities with their match status and details at the time the snapshot was + taken. + """ + + candidates: List[Candidate] + """All evaluated candidates at the time of the snapshot.""" + + run: FindAllRun + """FindAll run object.""" + + last_event_id: Optional[str] = None + """ID of the last event of the run at the time of the request. + + This can be used to resume streaming from the last event. + """ diff --git a/src/parallel/types/beta/findall_run_status_event.py b/src/parallel/types/beta/findall_run_status_event.py new file mode 100644 index 0000000..48371ca --- /dev/null +++ b/src/parallel/types/beta/findall_run_status_event.py @@ -0,0 +1,25 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from datetime import datetime +from typing_extensions import Literal + +from ..._models import BaseModel +from .findall_run import FindAllRun + +__all__ = ["FindAllRunStatusEvent"] + + +class FindAllRunStatusEvent(BaseModel): + """Event containing status update for FindAll run.""" + + data: FindAllRun + """Updated FindAll run information.""" + + event_id: str + """Unique event identifier for the event.""" + + timestamp: datetime + """Timestamp of the event.""" + + type: Literal["findall.status"] + """Event type; always 'findall.status'.""" diff --git a/src/parallel/types/beta/findall_schema.py b/src/parallel/types/beta/findall_schema.py new file mode 100644 index 0000000..7b9f4df --- /dev/null +++ b/src/parallel/types/beta/findall_schema.py @@ -0,0 +1,45 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional +from typing_extensions import Literal + +from ..._models import BaseModel +from .findall_enrich_input import FindAllEnrichInput + +__all__ = ["FindAllSchema", "MatchCondition"] + + +class MatchCondition(BaseModel): + """Match condition model for FindAll ingest.""" + + description: str + """Detailed description of the match condition. + + Include as much specific information as possible to help improve the quality and + accuracy of Find All run results. + """ + + name: str + """Name of the match condition.""" + + +class FindAllSchema(BaseModel): + """Response model for FindAll ingest.""" + + entity_type: str + """Type of the entity for the FindAll run.""" + + match_conditions: List[MatchCondition] + """List of match conditions for the FindAll run.""" + + objective: str + """Natural language objective of the FindAll run.""" + + enrichments: Optional[List[FindAllEnrichInput]] = None + """List of enrichment inputs for the FindAll run.""" + + generator: Optional[Literal["base", "core", "pro", "preview"]] = None + """The generator of the FindAll run.""" + + match_limit: Optional[int] = None + """Max number of candidates to evaluate""" diff --git a/src/parallel/types/beta/findall_schema_updated_event.py b/src/parallel/types/beta/findall_schema_updated_event.py new file mode 100644 index 0000000..50054ad --- /dev/null +++ b/src/parallel/types/beta/findall_schema_updated_event.py @@ -0,0 +1,25 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from datetime import datetime +from typing_extensions import Literal + +from ..._models import BaseModel +from .findall_schema import FindAllSchema + +__all__ = ["FindAllSchemaUpdatedEvent"] + + +class FindAllSchemaUpdatedEvent(BaseModel): + """Event containing full snapshot of FindAll run state.""" + + data: FindAllSchema + """Updated FindAll schema.""" + + event_id: str + """Unique event identifier for the event.""" + + timestamp: datetime + """Timestamp of the event.""" + + type: Literal["findall.schema.updated"] + """Event type; always 'findall.schema.updated'.""" diff --git a/src/parallel/types/beta/mcp_server.py b/src/parallel/types/beta/mcp_server.py new file mode 100644 index 0000000..5dc3c28 --- /dev/null +++ b/src/parallel/types/beta/mcp_server.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .. import mcp_server + +__all__ = ["McpServer"] + +McpServer = mcp_server.McpServer +"""Use parallel.types.task_run.McpServer instead""" diff --git a/src/parallel/types/beta/mcp_server_param.py b/src/parallel/types/beta/mcp_server_param.py new file mode 100644 index 0000000..b406f2d --- /dev/null +++ b/src/parallel/types/beta/mcp_server_param.py @@ -0,0 +1,7 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .. import mcp_server_param + +McpServerParam = mcp_server_param.McpServerParam diff --git a/src/parallel/types/beta/mcp_tool_call.py b/src/parallel/types/beta/mcp_tool_call.py new file mode 100644 index 0000000..785a3d5 --- /dev/null +++ b/src/parallel/types/beta/mcp_tool_call.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .. import mcp_tool_call + +__all__ = ["McpToolCall"] + +McpToolCall = mcp_tool_call.McpToolCall +"""Use parallel.types.task_run.McpToolCall instead""" diff --git a/src/parallel/types/beta/parallel_beta_param.py b/src/parallel/types/beta/parallel_beta_param.py new file mode 100644 index 0000000..03e848e --- /dev/null +++ b/src/parallel/types/beta/parallel_beta_param.py @@ -0,0 +1,20 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Union +from typing_extensions import Literal, TypeAlias + +__all__ = ["ParallelBetaParam"] + +ParallelBetaParam: TypeAlias = Union[ + Literal[ + "mcp-server-2025-07-17", + "events-sse-2025-07-24", + "webhook-2025-08-12", + "findall-2025-09-15", + "search-extract-2025-10-10", + "field-basis-2025-11-25", + ], + str, +] diff --git a/src/parallel/types/beta/search_result.py b/src/parallel/types/beta/search_result.py new file mode 100644 index 0000000..c7dd935 --- /dev/null +++ b/src/parallel/types/beta/search_result.py @@ -0,0 +1,26 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from ..._models import BaseModel +from .usage_item import UsageItem +from ..shared.warning import Warning +from .web_search_result import WebSearchResult + +__all__ = ["SearchResult"] + + +class SearchResult(BaseModel): + """Output for the Search API.""" + + results: List[WebSearchResult] + """A list of WebSearchResult objects, ordered by decreasing relevance.""" + + search_id: str + """Search ID. Example: `search_cad0a6d2dec046bd95ae900527d880e7`""" + + usage: Optional[List[UsageItem]] = None + """Usage metrics for the search request.""" + + warnings: Optional[List[Warning]] = None + """Warnings for the search request, if any.""" diff --git a/src/parallel/types/beta/task_group.py b/src/parallel/types/beta/task_group.py new file mode 100644 index 0000000..ba452dc --- /dev/null +++ b/src/parallel/types/beta/task_group.py @@ -0,0 +1,26 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Union, Optional + +from pydantic import Field as FieldInfo + +from ..._models import BaseModel +from .task_group_status import TaskGroupStatus + +__all__ = ["TaskGroup"] + + +class TaskGroup(BaseModel): + """Response object for a task group, including its status and metadata.""" + + created_at: Optional[str] = None + """Timestamp of the creation of the group, as an RFC 3339 string.""" + + status: TaskGroupStatus + """Status of the group.""" + + task_group_id: str = FieldInfo(alias="taskgroup_id") + """ID of the group.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] = None + """User-provided metadata stored with the group.""" diff --git a/src/parallel/types/beta/task_group_add_runs_params.py b/src/parallel/types/beta/task_group_add_runs_params.py new file mode 100644 index 0000000..2de405d --- /dev/null +++ b/src/parallel/types/beta/task_group_add_runs_params.py @@ -0,0 +1,36 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List, Iterable, Optional +from typing_extensions import Required, Annotated, TypedDict + +from ..._utils import PropertyInfo +from ..run_input_param import RunInputParam +from ..task_spec_param import TaskSpecParam +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["TaskGroupAddRunsParams"] + + +class TaskGroupAddRunsParams(TypedDict, total=False): + inputs: Required[Iterable[RunInputParam]] + """List of task runs to execute. + + Up to 1,000 runs can be specified per request. If you'd like to add more runs, + split them across multiple TaskGroup POST requests. + """ + + refresh_status: bool + + default_task_spec: Optional[TaskSpecParam] + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/task_group_create_params.py b/src/parallel/types/beta/task_group_create_params.py new file mode 100644 index 0000000..2b5cc73 --- /dev/null +++ b/src/parallel/types/beta/task_group_create_params.py @@ -0,0 +1,13 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict, Union, Optional +from typing_extensions import TypedDict + +__all__ = ["TaskGroupCreateParams"] + + +class TaskGroupCreateParams(TypedDict, total=False): + metadata: Optional[Dict[str, Union[str, float, bool]]] + """User-provided metadata stored with the task group.""" diff --git a/src/parallel/types/beta/task_group_events_params.py b/src/parallel/types/beta/task_group_events_params.py new file mode 100644 index 0000000..15f0d00 --- /dev/null +++ b/src/parallel/types/beta/task_group_events_params.py @@ -0,0 +1,16 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Optional +from typing_extensions import Annotated, TypedDict + +from ..._utils import PropertyInfo + +__all__ = ["TaskGroupEventsParams"] + + +class TaskGroupEventsParams(TypedDict, total=False): + last_event_id: Optional[str] + + api_timeout: Annotated[Optional[float], PropertyInfo(alias="timeout")] diff --git a/src/parallel/types/beta/task_group_events_response.py b/src/parallel/types/beta/task_group_events_response.py new file mode 100644 index 0000000..9728390 --- /dev/null +++ b/src/parallel/types/beta/task_group_events_response.py @@ -0,0 +1,30 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union +from typing_extensions import Literal, Annotated, TypeAlias + +from ..._utils import PropertyInfo +from ..._models import BaseModel +from ..error_event import ErrorEvent +from ..task_run_event import TaskRunEvent +from .task_group_status import TaskGroupStatus + +__all__ = ["TaskGroupEventsResponse", "TaskGroupStatusEvent"] + + +class TaskGroupStatusEvent(BaseModel): + """Event indicating an update to group status.""" + + event_id: str + """Cursor to resume the event stream.""" + + status: TaskGroupStatus + """Task group status object.""" + + type: Literal["task_group_status"] + """Event type; always 'task_group_status'.""" + + +TaskGroupEventsResponse: TypeAlias = Annotated[ + Union[TaskGroupStatusEvent, TaskRunEvent, ErrorEvent], PropertyInfo(discriminator="type") +] diff --git a/src/parallel/types/beta/task_group_get_runs_params.py b/src/parallel/types/beta/task_group_get_runs_params.py new file mode 100644 index 0000000..b6b1ef7 --- /dev/null +++ b/src/parallel/types/beta/task_group_get_runs_params.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Optional +from typing_extensions import Literal, TypedDict + +__all__ = ["TaskGroupGetRunsParams"] + + +class TaskGroupGetRunsParams(TypedDict, total=False): + include_input: bool + + include_output: bool + + last_event_id: Optional[str] + + status: Optional[Literal["queued", "action_required", "running", "completed", "failed", "cancelling", "cancelled"]] diff --git a/src/parallel/types/beta/task_group_get_runs_response.py b/src/parallel/types/beta/task_group_get_runs_response.py new file mode 100644 index 0000000..95eab2c --- /dev/null +++ b/src/parallel/types/beta/task_group_get_runs_response.py @@ -0,0 +1,12 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union +from typing_extensions import Annotated, TypeAlias + +from ..._utils import PropertyInfo +from ..error_event import ErrorEvent +from ..task_run_event import TaskRunEvent + +__all__ = ["TaskGroupGetRunsResponse"] + +TaskGroupGetRunsResponse: TypeAlias = Annotated[Union[TaskRunEvent, ErrorEvent], PropertyInfo(discriminator="type")] diff --git a/src/parallel/types/beta/task_group_run_response.py b/src/parallel/types/beta/task_group_run_response.py new file mode 100644 index 0000000..59acedf --- /dev/null +++ b/src/parallel/types/beta/task_group_run_response.py @@ -0,0 +1,32 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from ..._models import BaseModel +from .task_group_status import TaskGroupStatus + +__all__ = ["TaskGroupRunResponse"] + + +class TaskGroupRunResponse(BaseModel): + """Response from adding new task runs to a task group.""" + + event_cursor: Optional[str] = None + """ + Cursor for these runs in the event stream at + taskgroup/events?last_event_id=. Empty for the first runs in the + group. + """ + + run_cursor: Optional[str] = None + """ + Cursor for these runs in the run stream at + taskgroup/runs?last_event_id=. Empty for the first runs in the + group. + """ + + run_ids: List[str] + """IDs of the newly created runs.""" + + status: TaskGroupStatus + """Status of the group.""" diff --git a/src/parallel/types/beta/task_group_status.py b/src/parallel/types/beta/task_group_status.py new file mode 100644 index 0000000..0628c5d --- /dev/null +++ b/src/parallel/types/beta/task_group_status.py @@ -0,0 +1,29 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Optional + +from ..._models import BaseModel + +__all__ = ["TaskGroupStatus"] + + +class TaskGroupStatus(BaseModel): + """Status of a task group.""" + + is_active: bool + """True if at least one run in the group is currently active, i.e. + + status is one of {'cancelling', 'queued', 'running'}. + """ + + modified_at: Optional[str] = None + """Timestamp of the last status update to the group, as an RFC 3339 string.""" + + num_task_runs: int + """Number of task runs in the group.""" + + status_message: Optional[str] = None + """Human-readable status message for the group.""" + + task_run_status_counts: Dict[str, int] + """Number of task runs with each status.""" diff --git a/src/parallel/types/beta/task_run_create_params.py b/src/parallel/types/beta/task_run_create_params.py new file mode 100644 index 0000000..bccb85f --- /dev/null +++ b/src/parallel/types/beta/task_run_create_params.py @@ -0,0 +1,67 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict, List, Union, Iterable, Optional +from typing_extensions import Required, Annotated, TypedDict + +from ..._utils import PropertyInfo +from ..webhook_param import WebhookParam +from ..task_spec_param import TaskSpecParam +from ..mcp_server_param import McpServerParam +from .parallel_beta_param import ParallelBetaParam +from ..shared_params.source_policy import SourcePolicy + +__all__ = ["TaskRunCreateParams"] + + +class TaskRunCreateParams(TypedDict, total=False): + input: Required[Union[str, Dict[str, object]]] + """Input to the task, either text or a JSON object.""" + + processor: Required[str] + """Processor to use for the task.""" + + enable_events: Optional[bool] + """Controls tracking of task run execution progress. + + When set to true, progress events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + """ + + mcp_servers: Optional[Iterable[McpServerParam]] + """Optional list of MCP servers to use for the run.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] + """User-provided metadata stored with the run. + + Keys and values must be strings with a maximum length of 16 and 512 characters + respectively. + """ + + previous_interaction_id: Optional[str] + """Interaction ID to use as context for this request.""" + + source_policy: Optional[SourcePolicy] + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + task_spec: Optional[TaskSpecParam] + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + webhook: Optional[WebhookParam] + """Webhooks for Task Runs.""" + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/task_run_event.py b/src/parallel/types/beta/task_run_event.py new file mode 100644 index 0000000..e518907 --- /dev/null +++ b/src/parallel/types/beta/task_run_event.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .. import task_run_event + +__all__ = ["TaskRunEvent"] + +TaskRunEvent = task_run_event.TaskRunEvent +"""Use parallel.types.task_run.TaskRunEvent instead""" diff --git a/src/parallel/types/beta/task_run_events_response.py b/src/parallel/types/beta/task_run_events_response.py new file mode 100644 index 0000000..1516f91 --- /dev/null +++ b/src/parallel/types/beta/task_run_events_response.py @@ -0,0 +1,70 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Union, Optional +from typing_extensions import Literal, Annotated, TypeAlias + +from ..._utils import PropertyInfo +from ..._models import BaseModel +from ..error_event import ErrorEvent +from ..task_run_event import TaskRunEvent + +__all__ = [ + "TaskRunEventsResponse", + "TaskRunProgressStatsEvent", + "TaskRunProgressStatsEventSourceStats", + "TaskRunProgressMessageEvent", +] + + +class TaskRunProgressStatsEventSourceStats(BaseModel): + """Source stats describing progress so far.""" + + num_sources_considered: Optional[int] = None + """Number of sources considered in processing the task.""" + + num_sources_read: Optional[int] = None + """Number of sources read in processing the task.""" + + sources_read_sample: Optional[List[str]] = None + """A sample of URLs of sources read in processing the task.""" + + +class TaskRunProgressStatsEvent(BaseModel): + """A progress update for a task run.""" + + progress_meter: float + """Completion percentage of the task run. + + Ranges from 0 to 100 where 0 indicates no progress and 100 indicates completion. + """ + + source_stats: TaskRunProgressStatsEventSourceStats + """Source stats describing progress so far.""" + + type: Literal["task_run.progress_stats"] + """Event type; always 'task_run.progress_stats'.""" + + +class TaskRunProgressMessageEvent(BaseModel): + """A message for a task run progress update.""" + + message: str + """Progress update message.""" + + timestamp: Optional[str] = None + """Timestamp of the message.""" + + type: Literal[ + "task_run.progress_msg.plan", + "task_run.progress_msg.search", + "task_run.progress_msg.result", + "task_run.progress_msg.tool_call", + "task_run.progress_msg.exec_status", + ] + """Event type; always starts with 'task_run.progress_msg'.""" + + +TaskRunEventsResponse: TypeAlias = Annotated[ + Union[TaskRunProgressStatsEvent, TaskRunProgressMessageEvent, TaskRunEvent, ErrorEvent], + PropertyInfo(discriminator="type"), +] diff --git a/src/parallel/types/beta/task_run_result_params.py b/src/parallel/types/beta/task_run_result_params.py new file mode 100644 index 0000000..c48ef15 --- /dev/null +++ b/src/parallel/types/beta/task_run_result_params.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List +from typing_extensions import Annotated, TypedDict + +from ..._utils import PropertyInfo +from .parallel_beta_param import ParallelBetaParam + +__all__ = ["TaskRunResultParams"] + + +class TaskRunResultParams(TypedDict, total=False): + api_timeout: Annotated[int, PropertyInfo(alias="timeout")] + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/beta/usage_item.py b/src/parallel/types/beta/usage_item.py new file mode 100644 index 0000000..b3584bd --- /dev/null +++ b/src/parallel/types/beta/usage_item.py @@ -0,0 +1,15 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from ..._models import BaseModel + +__all__ = ["UsageItem"] + + +class UsageItem(BaseModel): + """Usage item for a single operation.""" + + count: int + """Count of the SKU.""" + + name: str + """Name of the SKU.""" diff --git a/src/parallel/types/beta/web_search_result.py b/src/parallel/types/beta/web_search_result.py new file mode 100644 index 0000000..aaf78ec --- /dev/null +++ b/src/parallel/types/beta/web_search_result.py @@ -0,0 +1,23 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from ..._models import BaseModel + +__all__ = ["WebSearchResult"] + + +class WebSearchResult(BaseModel): + """A single search result from the web search API.""" + + url: str + """URL associated with the search result.""" + + excerpts: Optional[List[str]] = None + """Relevant excerpted content from the URL, formatted as markdown.""" + + publish_date: Optional[str] = None + """Publish date of the webpage in YYYY-MM-DD format, if available.""" + + title: Optional[str] = None + """Title of the webpage, if available.""" diff --git a/src/parallel/types/beta/webhook.py b/src/parallel/types/beta/webhook.py new file mode 100644 index 0000000..814b154 --- /dev/null +++ b/src/parallel/types/beta/webhook.py @@ -0,0 +1,8 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .. import webhook + +__all__ = ["Webhook"] + +Webhook = webhook.Webhook +"""Use parallel.types.task_run.Webhook instead""" diff --git a/src/parallel/types/beta/webhook_param.py b/src/parallel/types/beta/webhook_param.py new file mode 100644 index 0000000..a32d4c7 --- /dev/null +++ b/src/parallel/types/beta/webhook_param.py @@ -0,0 +1,7 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from .. import webhook_param + +WebhookParam = webhook_param.WebhookParam diff --git a/src/parallel/types/citation.py b/src/parallel/types/citation.py new file mode 100644 index 0000000..8f01b2c --- /dev/null +++ b/src/parallel/types/citation.py @@ -0,0 +1,23 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from .._models import BaseModel + +__all__ = ["Citation"] + + +class Citation(BaseModel): + """A citation for a task output.""" + + url: str + """URL of the citation.""" + + excerpts: Optional[List[str]] = None + """Excerpts from the citation supporting the output. + + Only certain processors provide excerpts. + """ + + title: Optional[str] = None + """Title of the citation.""" diff --git a/src/parallel/types/error_event.py b/src/parallel/types/error_event.py new file mode 100644 index 0000000..3ededc9 --- /dev/null +++ b/src/parallel/types/error_event.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing_extensions import Literal + +from .._models import BaseModel +from .shared.error_object import ErrorObject + +__all__ = ["ErrorEvent"] + + +class ErrorEvent(BaseModel): + """Event indicating an error.""" + + error: ErrorObject + """Error.""" + + type: Literal["error"] + """Event type; always 'error'.""" diff --git a/src/parallel/types/field_basis.py b/src/parallel/types/field_basis.py new file mode 100644 index 0000000..df288f3 --- /dev/null +++ b/src/parallel/types/field_basis.py @@ -0,0 +1,27 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional + +from .._models import BaseModel +from .citation import Citation + +__all__ = ["FieldBasis"] + + +class FieldBasis(BaseModel): + """Citations and reasoning supporting one field of a task output.""" + + field: str + """Name of the output field.""" + + reasoning: str + """Reasoning for the output field.""" + + citations: Optional[List[Citation]] = None + """List of citations supporting the output field.""" + + confidence: Optional[str] = None + """Confidence level for the output field. + + Only certain processors provide confidence levels. + """ diff --git a/src/parallel/types/json_schema.py b/src/parallel/types/json_schema.py new file mode 100644 index 0000000..44e8fd3 --- /dev/null +++ b/src/parallel/types/json_schema.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["JsonSchema"] + + +class JsonSchema(BaseModel): + """JSON schema for a task input or output.""" + + json_schema: Dict[str, object] + """A JSON Schema object. Only a subset of JSON Schema is supported.""" + + type: Optional[Literal["json"]] = None + """The type of schema being defined. Always `json`.""" diff --git a/src/parallel/types/json_schema_param.py b/src/parallel/types/json_schema_param.py new file mode 100644 index 0000000..e2599bb --- /dev/null +++ b/src/parallel/types/json_schema_param.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict +from typing_extensions import Literal, Required, TypedDict + +__all__ = ["JsonSchemaParam"] + + +class JsonSchemaParam(TypedDict, total=False): + """JSON schema for a task input or output.""" + + json_schema: Required[Dict[str, object]] + """A JSON Schema object. Only a subset of JSON Schema is supported.""" + + type: Literal["json"] + """The type of schema being defined. Always `json`.""" diff --git a/src/parallel/types/mcp_server.py b/src/parallel/types/mcp_server.py new file mode 100644 index 0000000..7c4ba25 --- /dev/null +++ b/src/parallel/types/mcp_server.py @@ -0,0 +1,27 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["McpServer"] + + +class McpServer(BaseModel): + """MCP server configuration.""" + + name: str + """Name of the MCP server.""" + + url: str + """URL of the MCP server.""" + + allowed_tools: Optional[List[str]] = None + """List of allowed tools for the MCP server.""" + + headers: Optional[Dict[str, str]] = None + """Headers for the MCP server.""" + + type: Optional[Literal["url"]] = None + """Type of MCP server being configured. Always `url`.""" diff --git a/src/parallel/types/mcp_server_param.py b/src/parallel/types/mcp_server_param.py new file mode 100644 index 0000000..f3f207a --- /dev/null +++ b/src/parallel/types/mcp_server_param.py @@ -0,0 +1,29 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict, Optional +from typing_extensions import Literal, Required, TypedDict + +from .._types import SequenceNotStr + +__all__ = ["McpServerParam"] + + +class McpServerParam(TypedDict, total=False): + """MCP server configuration.""" + + name: Required[str] + """Name of the MCP server.""" + + url: Required[str] + """URL of the MCP server.""" + + allowed_tools: Optional[SequenceNotStr[str]] + """List of allowed tools for the MCP server.""" + + headers: Optional[Dict[str, str]] + """Headers for the MCP server.""" + + type: Literal["url"] + """Type of MCP server being configured. Always `url`.""" diff --git a/src/parallel/types/mcp_tool_call.py b/src/parallel/types/mcp_tool_call.py new file mode 100644 index 0000000..6cdccc2 --- /dev/null +++ b/src/parallel/types/mcp_tool_call.py @@ -0,0 +1,29 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional + +from .._models import BaseModel + +__all__ = ["McpToolCall"] + + +class McpToolCall(BaseModel): + """Result of an MCP tool call.""" + + arguments: str + """Arguments used to call the MCP tool.""" + + server_name: str + """Name of the MCP server.""" + + tool_call_id: str + """Identifier for the tool call.""" + + tool_name: str + """Name of the tool being called.""" + + content: Optional[str] = None + """Output received from the tool call, if successful.""" + + error: Optional[str] = None + """Error message if the tool call failed.""" diff --git a/src/parallel/types/run_input.py b/src/parallel/types/run_input.py new file mode 100644 index 0000000..cacdac7 --- /dev/null +++ b/src/parallel/types/run_input.py @@ -0,0 +1,62 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Union, Optional + +from .webhook import Webhook +from .._models import BaseModel +from .task_spec import TaskSpec +from .mcp_server import McpServer +from .shared.source_policy import SourcePolicy + +__all__ = ["RunInput"] + + +class RunInput(BaseModel): + """Request to run a task.""" + + input: Union[str, Dict[str, object]] + """Input to the task, either text or a JSON object.""" + + processor: str + """Processor to use for the task.""" + + enable_events: Optional[bool] = None + """Controls tracking of task run execution progress. + + When set to true, progress events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + """ + + mcp_servers: Optional[List[McpServer]] = None + """Optional list of MCP servers to use for the run.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] = None + """User-provided metadata stored with the run. + + Keys and values must be strings with a maximum length of 16 and 512 characters + respectively. + """ + + previous_interaction_id: Optional[str] = None + """Interaction ID to use as context for this request.""" + + source_policy: Optional[SourcePolicy] = None + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + task_spec: Optional[TaskSpec] = None + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + webhook: Optional[Webhook] = None + """Webhooks for Task Runs.""" diff --git a/src/parallel/types/run_input_param.py b/src/parallel/types/run_input_param.py new file mode 100644 index 0000000..e702be7 --- /dev/null +++ b/src/parallel/types/run_input_param.py @@ -0,0 +1,64 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict, Union, Iterable, Optional +from typing_extensions import Required, TypedDict + +from .webhook_param import WebhookParam +from .task_spec_param import TaskSpecParam +from .mcp_server_param import McpServerParam +from .shared_params.source_policy import SourcePolicy + +__all__ = ["RunInputParam"] + + +class RunInputParam(TypedDict, total=False): + """Request to run a task.""" + + input: Required[Union[str, Dict[str, object]]] + """Input to the task, either text or a JSON object.""" + + processor: Required[str] + """Processor to use for the task.""" + + enable_events: Optional[bool] + """Controls tracking of task run execution progress. + + When set to true, progress events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + """ + + mcp_servers: Optional[Iterable[McpServerParam]] + """Optional list of MCP servers to use for the run.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] + """User-provided metadata stored with the run. + + Keys and values must be strings with a maximum length of 16 and 512 characters + respectively. + """ + + previous_interaction_id: Optional[str] + """Interaction ID to use as context for this request.""" + + source_policy: Optional[SourcePolicy] + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + task_spec: Optional[TaskSpecParam] + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + webhook: Optional[WebhookParam] + """Webhooks for Task Runs.""" diff --git a/src/parallel/types/shared/__init__.py b/src/parallel/types/shared/__init__.py new file mode 100644 index 0000000..c7a4d05 --- /dev/null +++ b/src/parallel/types/shared/__init__.py @@ -0,0 +1,6 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .warning import Warning as Warning +from .error_object import ErrorObject as ErrorObject +from .source_policy import SourcePolicy as SourcePolicy +from .error_response import ErrorResponse as ErrorResponse diff --git a/src/parallel/types/shared/error_object.py b/src/parallel/types/shared/error_object.py new file mode 100644 index 0000000..d328532 --- /dev/null +++ b/src/parallel/types/shared/error_object.py @@ -0,0 +1,20 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Optional + +from ..._models import BaseModel + +__all__ = ["ErrorObject"] + + +class ErrorObject(BaseModel): + """An error message.""" + + message: str + """Human-readable message.""" + + ref_id: str + """Reference ID for the error.""" + + detail: Optional[Dict[str, object]] = None + """Optional detail supporting the error.""" diff --git a/src/parallel/types/shared/error_response.py b/src/parallel/types/shared/error_response.py new file mode 100644 index 0000000..14ebe29 --- /dev/null +++ b/src/parallel/types/shared/error_response.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing_extensions import Literal + +from ..._models import BaseModel +from .error_object import ErrorObject + +__all__ = ["ErrorResponse"] + + +class ErrorResponse(BaseModel): + """Response object used for non-200 status codes.""" + + error: ErrorObject + """Error.""" + + type: Literal["error"] + """Always 'error'.""" diff --git a/src/parallel/types/shared/source_policy.py b/src/parallel/types/shared/source_policy.py new file mode 100644 index 0000000..7ea1deb --- /dev/null +++ b/src/parallel/types/shared/source_policy.py @@ -0,0 +1,38 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional +from datetime import date + +from ..._models import BaseModel + +__all__ = ["SourcePolicy"] + + +class SourcePolicy(BaseModel): + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + after_date: Optional[date] = None + """Optional start date for filtering search results. + + Results will be limited to content published on or after this date. Provided as + an RFC 3339 date string (YYYY-MM-DD). + """ + + exclude_domains: Optional[List[str]] = None + """List of domains to exclude from results. + + If specified, sources from these domains will be excluded. Accepts plain domains + (e.g., example.com, subdomain.example.gov) or bare domain extension starting + with a period (e.g., .gov, .edu, .co.uk). + """ + + include_domains: Optional[List[str]] = None + """List of domains to restrict the results to. + + If specified, only sources from these domains will be included. Accepts plain + domains (e.g., example.com, subdomain.example.gov) or bare domain extension + starting with a period (e.g., .gov, .edu, .co.uk). + """ diff --git a/src/parallel/types/shared/warning.py b/src/parallel/types/shared/warning.py new file mode 100644 index 0000000..e9856ec --- /dev/null +++ b/src/parallel/types/shared/warning.py @@ -0,0 +1,24 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, Optional +from typing_extensions import Literal + +from ..._models import BaseModel + +__all__ = ["Warning"] + + +class Warning(BaseModel): + """Human-readable message for a task.""" + + message: str + """Human-readable message.""" + + type: Literal["spec_validation_warning", "input_validation_warning", "warning"] + """Type of warning. + + Note that adding new warning types is considered a backward-compatible change. + """ + + detail: Optional[Dict[str, object]] = None + """Optional detail supporting the warning.""" diff --git a/src/parallel/types/shared_params/__init__.py b/src/parallel/types/shared_params/__init__.py new file mode 100644 index 0000000..1ab16e6 --- /dev/null +++ b/src/parallel/types/shared_params/__init__.py @@ -0,0 +1,3 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from .source_policy import SourcePolicy as SourcePolicy diff --git a/src/parallel/types/shared_params/source_policy.py b/src/parallel/types/shared_params/source_policy.py new file mode 100644 index 0000000..c3da049 --- /dev/null +++ b/src/parallel/types/shared_params/source_policy.py @@ -0,0 +1,42 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Union +from datetime import date +from typing_extensions import Annotated, TypedDict + +from ..._types import SequenceNotStr +from ..._utils import PropertyInfo + +__all__ = ["SourcePolicy"] + + +class SourcePolicy(TypedDict, total=False): + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + after_date: Annotated[Union[str, date, None], PropertyInfo(format="iso8601")] + """Optional start date for filtering search results. + + Results will be limited to content published on or after this date. Provided as + an RFC 3339 date string (YYYY-MM-DD). + """ + + exclude_domains: SequenceNotStr[str] + """List of domains to exclude from results. + + If specified, sources from these domains will be excluded. Accepts plain domains + (e.g., example.com, subdomain.example.gov) or bare domain extension starting + with a period (e.g., .gov, .edu, .co.uk). + """ + + include_domains: SequenceNotStr[str] + """List of domains to restrict the results to. + + If specified, only sources from these domains will be included. Accepts plain + domains (e.g., example.com, subdomain.example.gov) or bare domain extension + starting with a period (e.g., .gov, .edu, .co.uk). + """ diff --git a/src/parallel/types/task_run.py b/src/parallel/types/task_run.py new file mode 100644 index 0000000..a4f52af --- /dev/null +++ b/src/parallel/types/task_run.py @@ -0,0 +1,56 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Union, Optional +from typing_extensions import Literal + +from pydantic import Field as FieldInfo + +from .._models import BaseModel +from .shared.warning import Warning +from .shared.error_object import ErrorObject + +__all__ = ["TaskRun"] + + +class TaskRun(BaseModel): + """Status of a task run.""" + + created_at: Optional[str] = None + """Timestamp of the creation of the task, as an RFC 3339 string.""" + + interaction_id: str + """Identifier for this interaction. + + Pass this value as `previous_interaction_id` to reuse context for a future + request. + """ + + is_active: bool + """Whether the run is currently active, i.e. + + status is one of {'cancelling', 'queued', 'running'}. + """ + + modified_at: Optional[str] = None + """Timestamp of the last modification to the task, as an RFC 3339 string.""" + + processor: str + """Processor used for the run.""" + + run_id: str + """ID of the task run.""" + + status: Literal["queued", "action_required", "running", "completed", "failed", "cancelling", "cancelled"] + """Status of the run.""" + + error: Optional[ErrorObject] = None + """An error message.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] = None + """User-provided metadata stored with the run.""" + + task_group_id: Optional[str] = FieldInfo(alias="taskgroup_id", default=None) + """ID of the taskgroup to which the run belongs.""" + + warnings: Optional[List[Warning]] = None + """Warnings for the run, if any.""" diff --git a/src/parallel/types/task_run_create_params.py b/src/parallel/types/task_run_create_params.py new file mode 100644 index 0000000..b7c91c6 --- /dev/null +++ b/src/parallel/types/task_run_create_params.py @@ -0,0 +1,67 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Dict, List, Union, Iterable, Optional +from typing_extensions import Required, Annotated, TypedDict + +from .._utils import PropertyInfo +from .webhook_param import WebhookParam +from .task_spec_param import TaskSpecParam +from .mcp_server_param import McpServerParam +from .beta.parallel_beta_param import ParallelBetaParam +from .shared_params.source_policy import SourcePolicy + +__all__ = ["TaskRunCreateParams"] + + +class TaskRunCreateParams(TypedDict, total=False): + input: Required[Union[str, Dict[str, object]]] + """Input to the task, either text or a JSON object.""" + + processor: Required[str] + """Processor to use for the task.""" + + enable_events: Optional[bool] + """Controls tracking of task run execution progress. + + When set to true, progress events are recorded and can be accessed via the + [Task Run events](https://platform.parallel.ai/api-reference) endpoint. When + false, no progress events are tracked. Note that progress tracking cannot be + enabled after a run has been created. The flag is set to true by default for + premium processors (pro and above). + """ + + mcp_servers: Optional[Iterable[McpServerParam]] + """Optional list of MCP servers to use for the run.""" + + metadata: Optional[Dict[str, Union[str, float, bool]]] + """User-provided metadata stored with the run. + + Keys and values must be strings with a maximum length of 16 and 512 characters + respectively. + """ + + previous_interaction_id: Optional[str] + """Interaction ID to use as context for this request.""" + + source_policy: Optional[SourcePolicy] + """Source policy for web search results. + + This policy governs which sources are allowed/disallowed in results. + """ + + task_spec: Optional[TaskSpecParam] + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. + Not specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + webhook: Optional[WebhookParam] + """Webhooks for Task Runs.""" + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/task_run_event.py b/src/parallel/types/task_run_event.py new file mode 100644 index 0000000..4ed9071 --- /dev/null +++ b/src/parallel/types/task_run_event.py @@ -0,0 +1,37 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union, Optional +from typing_extensions import Literal, Annotated, TypeAlias + +from .._utils import PropertyInfo +from .._models import BaseModel +from .task_run import TaskRun +from .run_input import RunInput +from .task_run_json_output import TaskRunJsonOutput +from .task_run_text_output import TaskRunTextOutput + +__all__ = ["TaskRunEvent", "Output"] + +Output: TypeAlias = Annotated[Union[TaskRunTextOutput, TaskRunJsonOutput, None], PropertyInfo(discriminator="type")] + + +class TaskRunEvent(BaseModel): + """Event when a task run transitions to a non-active status. + + May indicate completion, cancellation, or failure. + """ + + event_id: Optional[str] = None + """Cursor to resume the event stream. Always empty for non Task Group runs.""" + + run: TaskRun + """Task run object.""" + + type: Literal["task_run.state"] + """Event type; always 'task_run.state'.""" + + input: Optional[RunInput] = None + """Request to run a task.""" + + output: Optional[Output] = None + """Output from the run; included only if requested and if status == `completed`.""" diff --git a/src/parallel/types/task_run_events_response.py b/src/parallel/types/task_run_events_response.py new file mode 100644 index 0000000..20ded6e --- /dev/null +++ b/src/parallel/types/task_run_events_response.py @@ -0,0 +1,70 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Union, Optional +from typing_extensions import Literal, Annotated, TypeAlias + +from .._utils import PropertyInfo +from .._models import BaseModel +from .error_event import ErrorEvent +from .task_run_event import TaskRunEvent + +__all__ = [ + "TaskRunEventsResponse", + "TaskRunProgressStatsEvent", + "TaskRunProgressStatsEventSourceStats", + "TaskRunProgressMessageEvent", +] + + +class TaskRunProgressStatsEventSourceStats(BaseModel): + """Source stats describing progress so far.""" + + num_sources_considered: Optional[int] = None + """Number of sources considered in processing the task.""" + + num_sources_read: Optional[int] = None + """Number of sources read in processing the task.""" + + sources_read_sample: Optional[List[str]] = None + """A sample of URLs of sources read in processing the task.""" + + +class TaskRunProgressStatsEvent(BaseModel): + """A progress update for a task run.""" + + progress_meter: float + """Completion percentage of the task run. + + Ranges from 0 to 100 where 0 indicates no progress and 100 indicates completion. + """ + + source_stats: TaskRunProgressStatsEventSourceStats + """Source stats describing progress so far.""" + + type: Literal["task_run.progress_stats"] + """Event type; always 'task_run.progress_stats'.""" + + +class TaskRunProgressMessageEvent(BaseModel): + """A message for a task run progress update.""" + + message: str + """Progress update message.""" + + timestamp: Optional[str] = None + """Timestamp of the message.""" + + type: Literal[ + "task_run.progress_msg.plan", + "task_run.progress_msg.search", + "task_run.progress_msg.result", + "task_run.progress_msg.tool_call", + "task_run.progress_msg.exec_status", + ] + """Event type; always starts with 'task_run.progress_msg'.""" + + +TaskRunEventsResponse: TypeAlias = Annotated[ + Union[TaskRunProgressStatsEvent, TaskRunProgressMessageEvent, TaskRunEvent, ErrorEvent], + PropertyInfo(discriminator="type"), +] diff --git a/src/parallel/types/task_run_json_output.py b/src/parallel/types/task_run_json_output.py new file mode 100644 index 0000000..6a43d58 --- /dev/null +++ b/src/parallel/types/task_run_json_output.py @@ -0,0 +1,49 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Optional +from typing_extensions import Literal + +from .._models import BaseModel +from .field_basis import FieldBasis +from .mcp_tool_call import McpToolCall + +__all__ = ["TaskRunJsonOutput"] + + +class TaskRunJsonOutput(BaseModel): + """Output from a task that returns JSON.""" + + basis: List[FieldBasis] + """Basis for each top-level field in the JSON output. + + Per-list-element basis entries are available only when the + `parallel-beta: field-basis-2025-11-25` header is supplied. + """ + + content: Dict[str, object] + """ + Output from the task as a native JSON object, as determined by the output schema + of the task spec. + """ + + type: Literal["json"] + """ + The type of output being returned, as determined by the output schema of the + task spec. + """ + + beta_fields: Optional[Dict[str, object]] = None + """Deprecated. + + mcp-server-2025-07-17 is now included directly in the output (e.g. + mcp_tool_calls). + """ + + mcp_tool_calls: Optional[List[McpToolCall]] = None + """MCP tool calls made by the task.""" + + output_schema: Optional[Dict[str, object]] = None + """Output schema for the Task Run. + + Populated only if the task was executed with an auto schema. + """ diff --git a/src/parallel/types/task_run_result.py b/src/parallel/types/task_run_result.py new file mode 100644 index 0000000..75c3692 --- /dev/null +++ b/src/parallel/types/task_run_result.py @@ -0,0 +1,24 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union +from typing_extensions import Annotated, TypeAlias + +from .._utils import PropertyInfo +from .._models import BaseModel +from .task_run import TaskRun +from .task_run_json_output import TaskRunJsonOutput +from .task_run_text_output import TaskRunTextOutput + +__all__ = ["TaskRunResult", "Output"] + +Output: TypeAlias = Annotated[Union[TaskRunTextOutput, TaskRunJsonOutput], PropertyInfo(discriminator="type")] + + +class TaskRunResult(BaseModel): + """Result of a task run.""" + + output: Output + """Output from the task conforming to the output schema.""" + + run: TaskRun + """Task run object with status 'completed'.""" diff --git a/src/parallel/types/task_run_result_params.py b/src/parallel/types/task_run_result_params.py new file mode 100644 index 0000000..45aaafb --- /dev/null +++ b/src/parallel/types/task_run_result_params.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List +from typing_extensions import Annotated, TypedDict + +from .._utils import PropertyInfo +from .beta.parallel_beta_param import ParallelBetaParam + +__all__ = ["TaskRunResultParams"] + + +class TaskRunResultParams(TypedDict, total=False): + api_timeout: Annotated[int, PropertyInfo(alias="timeout")] + + betas: Annotated[List[ParallelBetaParam], PropertyInfo(alias="parallel-beta")] + """Optional header to specify the beta version(s) to enable.""" diff --git a/src/parallel/types/task_run_text_output.py b/src/parallel/types/task_run_text_output.py new file mode 100644 index 0000000..46c23ff --- /dev/null +++ b/src/parallel/types/task_run_text_output.py @@ -0,0 +1,36 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Dict, List, Optional +from typing_extensions import Literal + +from .._models import BaseModel +from .field_basis import FieldBasis +from .mcp_tool_call import McpToolCall + +__all__ = ["TaskRunTextOutput"] + + +class TaskRunTextOutput(BaseModel): + """Output from a task that returns text.""" + + basis: List[FieldBasis] + """Basis for the output. The basis has a single field 'output'.""" + + content: str + """Text output from the task.""" + + type: Literal["text"] + """ + The type of output being returned, as determined by the output schema of the + task spec. + """ + + beta_fields: Optional[Dict[str, object]] = None + """Deprecated. + + mcp-server-2025-07-17 is now included directly in the output (e.g. + mcp_tool_calls). + """ + + mcp_tool_calls: Optional[List[McpToolCall]] = None + """MCP tool calls made by the task.""" diff --git a/src/parallel/types/task_spec.py b/src/parallel/types/task_spec.py new file mode 100644 index 0000000..91bddfb --- /dev/null +++ b/src/parallel/types/task_spec.py @@ -0,0 +1,39 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Union, Optional +from typing_extensions import TypeAlias + +from .._models import BaseModel +from .auto_schema import AutoSchema +from .json_schema import JsonSchema +from .text_schema import TextSchema + +__all__ = ["TaskSpec", "OutputSchema", "InputSchema"] + +OutputSchema: TypeAlias = Union[JsonSchema, TextSchema, AutoSchema, str] + +InputSchema: TypeAlias = Union[str, JsonSchema, TextSchema, None] + + +class TaskSpec(BaseModel): + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. Not + specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + output_schema: OutputSchema + """JSON schema or text fully describing the desired output from the task. + + Descriptions of output fields will determine the form and content of the + response. A bare string is equivalent to a text schema with the same + description. + """ + + input_schema: Optional[InputSchema] = None + """Optional JSON schema or text description of expected input to the task. + + A bare string is equivalent to a text schema with the same description. + """ diff --git a/src/parallel/types/task_spec_param.py b/src/parallel/types/task_spec_param.py new file mode 100644 index 0000000..60ddad1 --- /dev/null +++ b/src/parallel/types/task_spec_param.py @@ -0,0 +1,40 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Union, Optional +from typing_extensions import Required, TypeAlias, TypedDict + +from .auto_schema_param import AutoSchemaParam +from .json_schema_param import JsonSchemaParam +from .text_schema_param import TextSchemaParam + +__all__ = ["TaskSpecParam", "OutputSchema", "InputSchema"] + +OutputSchema: TypeAlias = Union[JsonSchemaParam, TextSchemaParam, AutoSchemaParam, str] + +InputSchema: TypeAlias = Union[str, JsonSchemaParam, TextSchemaParam] + + +class TaskSpecParam(TypedDict, total=False): + """Specification for a task. + + Auto output schemas can be specified by setting `output_schema={"type":"auto"}`. Not + specifying a TaskSpec is the same as setting an auto output schema. + + For convenience bare strings are also accepted as input or output schemas. + """ + + output_schema: Required[OutputSchema] + """JSON schema or text fully describing the desired output from the task. + + Descriptions of output fields will determine the form and content of the + response. A bare string is equivalent to a text schema with the same + description. + """ + + input_schema: Optional[InputSchema] + """Optional JSON schema or text description of expected input to the task. + + A bare string is equivalent to a text schema with the same description. + """ diff --git a/src/parallel/types/text_schema.py b/src/parallel/types/text_schema.py new file mode 100644 index 0000000..10b2e8f --- /dev/null +++ b/src/parallel/types/text_schema.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["TextSchema"] + + +class TextSchema(BaseModel): + """Text description for a task input or output.""" + + description: Optional[str] = None + """A text description of the desired output from the task.""" + + type: Optional[Literal["text"]] = None + """The type of schema being defined. Always `text`.""" diff --git a/src/parallel/types/text_schema_param.py b/src/parallel/types/text_schema_param.py new file mode 100644 index 0000000..d333015 --- /dev/null +++ b/src/parallel/types/text_schema_param.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import Optional +from typing_extensions import Literal, TypedDict + +__all__ = ["TextSchemaParam"] + + +class TextSchemaParam(TypedDict, total=False): + """Text description for a task input or output.""" + + description: Optional[str] + """A text description of the desired output from the task.""" + + type: Literal["text"] + """The type of schema being defined. Always `text`.""" diff --git a/src/parallel/types/webhook.py b/src/parallel/types/webhook.py new file mode 100644 index 0000000..67964b3 --- /dev/null +++ b/src/parallel/types/webhook.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from typing import List, Optional +from typing_extensions import Literal + +from .._models import BaseModel + +__all__ = ["Webhook"] + + +class Webhook(BaseModel): + """Webhooks for Task Runs.""" + + url: str + """URL for the webhook.""" + + event_types: Optional[List[Literal["task_run.status"]]] = None + """Event types to send the webhook notifications for.""" diff --git a/src/parallel/types/webhook_param.py b/src/parallel/types/webhook_param.py new file mode 100644 index 0000000..90a667d --- /dev/null +++ b/src/parallel/types/webhook_param.py @@ -0,0 +1,18 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +from typing import List +from typing_extensions import Literal, Required, TypedDict + +__all__ = ["WebhookParam"] + + +class WebhookParam(TypedDict, total=False): + """Webhooks for Task Runs.""" + + url: Required[str] + """URL for the webhook.""" + + event_types: List[Literal["task_run.status"]] + """Event types to send the webhook notifications for.""" diff --git a/tests/__init__.py b/tests/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/__init__.py b/tests/api_resources/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/api_resources/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/beta/__init__.py b/tests/api_resources/beta/__init__.py new file mode 100644 index 0000000..fd8019a --- /dev/null +++ b/tests/api_resources/beta/__init__.py @@ -0,0 +1 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. diff --git a/tests/api_resources/beta/test_findall.py b/tests/api_resources/beta/test_findall.py new file mode 100644 index 0000000..18996a9 --- /dev/null +++ b/tests/api_resources/beta/test_findall.py @@ -0,0 +1,1036 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from parallel import Parallel, AsyncParallel +from tests.utils import assert_matches_type +from parallel.types.beta import ( + FindAllRun, + FindAllSchema, + FindAllRunResult, +) + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestFindAll: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + def test_method_create(self, client: Parallel) -> None: + findall = client.beta.findall.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + def test_method_create_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + exclude_list=[ + { + "name": "name", + "url": "url", + } + ], + metadata={"foo": "string"}, + webhook={ + "url": "url", + "event_types": ["task_run.status"], + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + def test_raw_response_create(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + def test_streaming_response_create(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_retrieve(self, client: Parallel) -> None: + findall = client.beta.findall.retrieve( + findall_id="findall_id", + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + def test_method_retrieve_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.retrieve( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + def test_raw_response_retrieve(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.retrieve( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + def test_streaming_response_retrieve(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.retrieve( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_retrieve(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.retrieve( + findall_id="", + ) + + @parametrize + def test_method_cancel(self, client: Parallel) -> None: + findall = client.beta.findall.cancel( + findall_id="findall_id", + ) + assert_matches_type(object, findall, path=["response"]) + + @parametrize + def test_method_cancel_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.cancel( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(object, findall, path=["response"]) + + @parametrize + def test_raw_response_cancel(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.cancel( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(object, findall, path=["response"]) + + @parametrize + def test_streaming_response_cancel(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.cancel( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(object, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_cancel(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.cancel( + findall_id="", + ) + + @parametrize + def test_method_enrich(self, client: Parallel) -> None: + findall = client.beta.findall.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_method_enrich_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + mcp_servers=[ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + processor="processor", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_raw_response_enrich(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_streaming_response_enrich(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_enrich(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.enrich( + findall_id="", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) + + @parametrize + def test_method_events(self, client: Parallel) -> None: + findall_stream = client.beta.findall.events( + findall_id="findall_id", + ) + findall_stream.response.close() + + @parametrize + def test_method_events_with_all_params(self, client: Parallel) -> None: + findall_stream = client.beta.findall.events( + findall_id="findall_id", + last_event_id="last_event_id", + api_timeout=0, + betas=["mcp-server-2025-07-17"], + ) + findall_stream.response.close() + + @parametrize + def test_raw_response_events(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.events( + findall_id="findall_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = response.parse() + stream.close() + + @parametrize + def test_streaming_response_events(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.events( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = response.parse() + stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_events(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.events( + findall_id="", + ) + + @parametrize + def test_method_extend(self, client: Parallel) -> None: + findall = client.beta.findall.extend( + findall_id="findall_id", + additional_match_limit=0, + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_method_extend_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.extend( + findall_id="findall_id", + additional_match_limit=0, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_raw_response_extend(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.extend( + findall_id="findall_id", + additional_match_limit=0, + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_streaming_response_extend(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.extend( + findall_id="findall_id", + additional_match_limit=0, + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_extend(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.extend( + findall_id="", + additional_match_limit=0, + ) + + @parametrize + def test_method_ingest(self, client: Parallel) -> None: + findall = client.beta.findall.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_method_ingest_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_raw_response_ingest(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_streaming_response_ingest(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_result(self, client: Parallel) -> None: + findall = client.beta.findall.result( + findall_id="findall_id", + ) + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + @parametrize + def test_method_result_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.result( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + @parametrize + def test_raw_response_result(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.result( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + @parametrize + def test_streaming_response_result(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.result( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_result(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.result( + findall_id="", + ) + + @parametrize + def test_method_schema(self, client: Parallel) -> None: + findall = client.beta.findall.schema( + findall_id="findall_id", + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_method_schema_with_all_params(self, client: Parallel) -> None: + findall = client.beta.findall.schema( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_raw_response_schema(self, client: Parallel) -> None: + response = client.beta.findall.with_raw_response.schema( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + def test_streaming_response_schema(self, client: Parallel) -> None: + with client.beta.findall.with_streaming_response.schema( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_schema(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + client.beta.findall.with_raw_response.schema( + findall_id="", + ) + + +class TestAsyncFindAll: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + async def test_method_create(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + async def test_method_create_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + exclude_list=[ + { + "name": "name", + "url": "url", + } + ], + metadata={"foo": "string"}, + webhook={ + "url": "url", + "event_types": ["task_run.status"], + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + async def test_raw_response_create(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + async def test_streaming_response_create(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.create( + entity_type="entity_type", + generator="base", + match_conditions=[ + { + "description": "Company must have SOC2 Type II certification (not Type I). Look for evidence in: trust centers, security/compliance pages, audit reports, or press releases specifically mentioning 'SOC2 Type II'. If no explicit SOC2 Type II mention is found, consider requirement not satisfied.", + "name": "name", + } + ], + match_limit=0, + objective="objective", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_retrieve(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.retrieve( + findall_id="findall_id", + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + async def test_method_retrieve_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.retrieve( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.retrieve( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.retrieve( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllRun, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_retrieve(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.retrieve( + findall_id="", + ) + + @parametrize + async def test_method_cancel(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.cancel( + findall_id="findall_id", + ) + assert_matches_type(object, findall, path=["response"]) + + @parametrize + async def test_method_cancel_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.cancel( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(object, findall, path=["response"]) + + @parametrize + async def test_raw_response_cancel(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.cancel( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(object, findall, path=["response"]) + + @parametrize + async def test_streaming_response_cancel(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.cancel( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(object, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_cancel(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.cancel( + findall_id="", + ) + + @parametrize + async def test_method_enrich(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_method_enrich_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + mcp_servers=[ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + processor="processor", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_raw_response_enrich(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_streaming_response_enrich(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.enrich( + findall_id="findall_id", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_enrich(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.enrich( + findall_id="", + output_schema={ + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + } + }, + ) + + @parametrize + async def test_method_events(self, async_client: AsyncParallel) -> None: + findall_stream = await async_client.beta.findall.events( + findall_id="findall_id", + ) + await findall_stream.response.aclose() + + @parametrize + async def test_method_events_with_all_params(self, async_client: AsyncParallel) -> None: + findall_stream = await async_client.beta.findall.events( + findall_id="findall_id", + last_event_id="last_event_id", + api_timeout=0, + betas=["mcp-server-2025-07-17"], + ) + await findall_stream.response.aclose() + + @parametrize + async def test_raw_response_events(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.events( + findall_id="findall_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = await response.parse() + await stream.close() + + @parametrize + async def test_streaming_response_events(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.events( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = await response.parse() + await stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_events(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.events( + findall_id="", + ) + + @parametrize + async def test_method_extend(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.extend( + findall_id="findall_id", + additional_match_limit=0, + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_method_extend_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.extend( + findall_id="findall_id", + additional_match_limit=0, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_raw_response_extend(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.extend( + findall_id="findall_id", + additional_match_limit=0, + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_streaming_response_extend(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.extend( + findall_id="findall_id", + additional_match_limit=0, + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_extend(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.extend( + findall_id="", + additional_match_limit=0, + ) + + @parametrize + async def test_method_ingest(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_method_ingest_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_raw_response_ingest(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_streaming_response_ingest(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.ingest( + objective="Find all AI companies that raised Series A funding in 2024", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_result(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.result( + findall_id="findall_id", + ) + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + @parametrize + async def test_method_result_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.result( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + @parametrize + async def test_raw_response_result(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.result( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + @parametrize + async def test_streaming_response_result(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.result( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllRunResult, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_result(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.result( + findall_id="", + ) + + @parametrize + async def test_method_schema(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.schema( + findall_id="findall_id", + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_method_schema_with_all_params(self, async_client: AsyncParallel) -> None: + findall = await async_client.beta.findall.schema( + findall_id="findall_id", + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_raw_response_schema(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.findall.with_raw_response.schema( + findall_id="findall_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + @parametrize + async def test_streaming_response_schema(self, async_client: AsyncParallel) -> None: + async with async_client.beta.findall.with_streaming_response.schema( + findall_id="findall_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + findall = await response.parse() + assert_matches_type(FindAllSchema, findall, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_schema(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `findall_id` but received ''"): + await async_client.beta.findall.with_raw_response.schema( + findall_id="", + ) diff --git a/tests/api_resources/beta/test_task_group.py b/tests/api_resources/beta/test_task_group.py new file mode 100644 index 0000000..a9c4e42 --- /dev/null +++ b/tests/api_resources/beta/test_task_group.py @@ -0,0 +1,600 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from parallel import Parallel, AsyncParallel +from tests.utils import assert_matches_type +from parallel._utils import parse_date +from parallel.types.beta import ( + TaskGroup, + TaskGroupRunResponse, +) + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestTaskGroup: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + def test_method_create(self, client: Parallel) -> None: + task_group = client.beta.task_group.create() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + def test_method_create_with_all_params(self, client: Parallel) -> None: + task_group = client.beta.task_group.create( + metadata={"foo": "string"}, + ) + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + def test_raw_response_create(self, client: Parallel) -> None: + response = client.beta.task_group.with_raw_response.create() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_group = response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + def test_streaming_response_create(self, client: Parallel) -> None: + with client.beta.task_group.with_streaming_response.create() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_group = response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_retrieve(self, client: Parallel) -> None: + task_group = client.beta.task_group.retrieve( + "taskgroup_id", + ) + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + def test_raw_response_retrieve(self, client: Parallel) -> None: + response = client.beta.task_group.with_raw_response.retrieve( + "taskgroup_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_group = response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + def test_streaming_response_retrieve(self, client: Parallel) -> None: + with client.beta.task_group.with_streaming_response.retrieve( + "taskgroup_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_group = response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_retrieve(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + client.beta.task_group.with_raw_response.retrieve( + "", + ) + + @parametrize + def test_method_add_runs(self, client: Parallel) -> None: + task_group = client.beta.task_group.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + @parametrize + def test_method_add_runs_with_all_params(self, client: Parallel) -> None: + task_group = client.beta.task_group.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + "enable_events": True, + "mcp_servers": [ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + "metadata": {"foo": "string"}, + "previous_interaction_id": "previous_interaction_id", + "source_policy": { + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + "task_spec": { + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + "webhook": { + "url": "url", + "event_types": ["task_run.status"], + }, + } + ], + refresh_status=True, + default_task_spec={ + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + @parametrize + def test_raw_response_add_runs(self, client: Parallel) -> None: + response = client.beta.task_group.with_raw_response.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_group = response.parse() + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + @parametrize + def test_streaming_response_add_runs(self, client: Parallel) -> None: + with client.beta.task_group.with_streaming_response.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_group = response.parse() + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_add_runs(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + client.beta.task_group.with_raw_response.add_runs( + task_group_id="", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) + + @parametrize + def test_method_events(self, client: Parallel) -> None: + task_group_stream = client.beta.task_group.events( + task_group_id="taskgroup_id", + ) + task_group_stream.response.close() + + @parametrize + def test_method_events_with_all_params(self, client: Parallel) -> None: + task_group_stream = client.beta.task_group.events( + task_group_id="taskgroup_id", + last_event_id="last_event_id", + api_timeout=0, + ) + task_group_stream.response.close() + + @parametrize + def test_raw_response_events(self, client: Parallel) -> None: + response = client.beta.task_group.with_raw_response.events( + task_group_id="taskgroup_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = response.parse() + stream.close() + + @parametrize + def test_streaming_response_events(self, client: Parallel) -> None: + with client.beta.task_group.with_streaming_response.events( + task_group_id="taskgroup_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = response.parse() + stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_events(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + client.beta.task_group.with_raw_response.events( + task_group_id="", + ) + + @parametrize + def test_method_get_runs(self, client: Parallel) -> None: + task_group_stream = client.beta.task_group.get_runs( + task_group_id="taskgroup_id", + ) + task_group_stream.response.close() + + @parametrize + def test_method_get_runs_with_all_params(self, client: Parallel) -> None: + task_group_stream = client.beta.task_group.get_runs( + task_group_id="taskgroup_id", + include_input=True, + include_output=True, + last_event_id="last_event_id", + status="queued", + ) + task_group_stream.response.close() + + @parametrize + def test_raw_response_get_runs(self, client: Parallel) -> None: + response = client.beta.task_group.with_raw_response.get_runs( + task_group_id="taskgroup_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = response.parse() + stream.close() + + @parametrize + def test_streaming_response_get_runs(self, client: Parallel) -> None: + with client.beta.task_group.with_streaming_response.get_runs( + task_group_id="taskgroup_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = response.parse() + stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_get_runs(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + client.beta.task_group.with_raw_response.get_runs( + task_group_id="", + ) + + +class TestAsyncTaskGroup: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + async def test_method_create(self, async_client: AsyncParallel) -> None: + task_group = await async_client.beta.task_group.create() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + async def test_method_create_with_all_params(self, async_client: AsyncParallel) -> None: + task_group = await async_client.beta.task_group.create( + metadata={"foo": "string"}, + ) + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + async def test_raw_response_create(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.task_group.with_raw_response.create() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_group = await response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + async def test_streaming_response_create(self, async_client: AsyncParallel) -> None: + async with async_client.beta.task_group.with_streaming_response.create() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_group = await response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_retrieve(self, async_client: AsyncParallel) -> None: + task_group = await async_client.beta.task_group.retrieve( + "taskgroup_id", + ) + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.task_group.with_raw_response.retrieve( + "taskgroup_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_group = await response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncParallel) -> None: + async with async_client.beta.task_group.with_streaming_response.retrieve( + "taskgroup_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_group = await response.parse() + assert_matches_type(TaskGroup, task_group, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_retrieve(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + await async_client.beta.task_group.with_raw_response.retrieve( + "", + ) + + @parametrize + async def test_method_add_runs(self, async_client: AsyncParallel) -> None: + task_group = await async_client.beta.task_group.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + @parametrize + async def test_method_add_runs_with_all_params(self, async_client: AsyncParallel) -> None: + task_group = await async_client.beta.task_group.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + "enable_events": True, + "mcp_servers": [ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + "metadata": {"foo": "string"}, + "previous_interaction_id": "previous_interaction_id", + "source_policy": { + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + "task_spec": { + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + "webhook": { + "url": "url", + "event_types": ["task_run.status"], + }, + } + ], + refresh_status=True, + default_task_spec={ + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + @parametrize + async def test_raw_response_add_runs(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.task_group.with_raw_response.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_group = await response.parse() + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + @parametrize + async def test_streaming_response_add_runs(self, async_client: AsyncParallel) -> None: + async with async_client.beta.task_group.with_streaming_response.add_runs( + task_group_id="taskgroup_id", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_group = await response.parse() + assert_matches_type(TaskGroupRunResponse, task_group, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_add_runs(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + await async_client.beta.task_group.with_raw_response.add_runs( + task_group_id="", + inputs=[ + { + "input": "What was the GDP of France in 2023?", + "processor": "base", + } + ], + ) + + @parametrize + async def test_method_events(self, async_client: AsyncParallel) -> None: + task_group_stream = await async_client.beta.task_group.events( + task_group_id="taskgroup_id", + ) + await task_group_stream.response.aclose() + + @parametrize + async def test_method_events_with_all_params(self, async_client: AsyncParallel) -> None: + task_group_stream = await async_client.beta.task_group.events( + task_group_id="taskgroup_id", + last_event_id="last_event_id", + api_timeout=0, + ) + await task_group_stream.response.aclose() + + @parametrize + async def test_raw_response_events(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.task_group.with_raw_response.events( + task_group_id="taskgroup_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = await response.parse() + await stream.close() + + @parametrize + async def test_streaming_response_events(self, async_client: AsyncParallel) -> None: + async with async_client.beta.task_group.with_streaming_response.events( + task_group_id="taskgroup_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = await response.parse() + await stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_events(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + await async_client.beta.task_group.with_raw_response.events( + task_group_id="", + ) + + @parametrize + async def test_method_get_runs(self, async_client: AsyncParallel) -> None: + task_group_stream = await async_client.beta.task_group.get_runs( + task_group_id="taskgroup_id", + ) + await task_group_stream.response.aclose() + + @parametrize + async def test_method_get_runs_with_all_params(self, async_client: AsyncParallel) -> None: + task_group_stream = await async_client.beta.task_group.get_runs( + task_group_id="taskgroup_id", + include_input=True, + include_output=True, + last_event_id="last_event_id", + status="queued", + ) + await task_group_stream.response.aclose() + + @parametrize + async def test_raw_response_get_runs(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.task_group.with_raw_response.get_runs( + task_group_id="taskgroup_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = await response.parse() + await stream.close() + + @parametrize + async def test_streaming_response_get_runs(self, async_client: AsyncParallel) -> None: + async with async_client.beta.task_group.with_streaming_response.get_runs( + task_group_id="taskgroup_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = await response.parse() + await stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_get_runs(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `task_group_id` but received ''"): + await async_client.beta.task_group.with_raw_response.get_runs( + task_group_id="", + ) diff --git a/tests/api_resources/beta/test_task_run.py b/tests/api_resources/beta/test_task_run.py new file mode 100644 index 0000000..3c22678 --- /dev/null +++ b/tests/api_resources/beta/test_task_run.py @@ -0,0 +1,383 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from parallel import Parallel, AsyncParallel +from tests.utils import assert_matches_type +from parallel.types import TaskRun, TaskRunResult +from parallel._utils import parse_date + +# pyright: reportDeprecated=false + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestTaskRun: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + def test_method_create(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = client.beta.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_method_create_with_all_params(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = client.beta.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + enable_events=True, + mcp_servers=[ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + metadata={"foo": "string"}, + previous_interaction_id="previous_interaction_id", + source_policy={ + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + task_spec={ + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + webhook={ + "url": "url", + "event_types": ["task_run.status"], + }, + betas=["mcp-server-2025-07-17"], + ) + + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_raw_response_create(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + response = client.beta.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_streaming_response_create(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + with client.beta.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_events(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + task_run_stream = client.beta.task_run.events( + "run_id", + ) + + task_run_stream.response.close() + + @parametrize + def test_raw_response_events(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + response = client.beta.task_run.with_raw_response.events( + "run_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = response.parse() + stream.close() + + @parametrize + def test_streaming_response_events(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + with client.beta.task_run.with_streaming_response.events( + "run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = response.parse() + stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_events(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.beta.task_run.with_raw_response.events( + "", + ) + + @parametrize + def test_method_result(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = client.beta.task_run.result( + run_id="run_id", + ) + + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + def test_method_result_with_all_params(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = client.beta.task_run.result( + run_id="run_id", + api_timeout=0, + betas=["mcp-server-2025-07-17"], + ) + + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + def test_raw_response_result(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + response = client.beta.task_run.with_raw_response.result( + run_id="run_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + def test_streaming_response_result(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + with client.beta.task_run.with_streaming_response.result( + run_id="run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_result(self, client: Parallel) -> None: + with pytest.warns(DeprecationWarning): + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.beta.task_run.with_raw_response.result( + run_id="", + ) + + +class TestAsyncTaskRun: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + async def test_method_create(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = await async_client.beta.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_method_create_with_all_params(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = await async_client.beta.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + enable_events=True, + mcp_servers=[ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + metadata={"foo": "string"}, + previous_interaction_id="previous_interaction_id", + source_policy={ + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + task_spec={ + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + webhook={ + "url": "url", + "event_types": ["task_run.status"], + }, + betas=["mcp-server-2025-07-17"], + ) + + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_raw_response_create(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + response = await async_client.beta.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = await response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_streaming_response_create(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + async with async_client.beta.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = await response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_events(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + task_run_stream = await async_client.beta.task_run.events( + "run_id", + ) + + await task_run_stream.response.aclose() + + @parametrize + async def test_raw_response_events(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + response = await async_client.beta.task_run.with_raw_response.events( + "run_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = await response.parse() + await stream.close() + + @parametrize + async def test_streaming_response_events(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + async with async_client.beta.task_run.with_streaming_response.events( + "run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = await response.parse() + await stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_events(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.beta.task_run.with_raw_response.events( + "", + ) + + @parametrize + async def test_method_result(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = await async_client.beta.task_run.result( + run_id="run_id", + ) + + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + async def test_method_result_with_all_params(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + task_run = await async_client.beta.task_run.result( + run_id="run_id", + api_timeout=0, + betas=["mcp-server-2025-07-17"], + ) + + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + async def test_raw_response_result(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + response = await async_client.beta.task_run.with_raw_response.result( + run_id="run_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = await response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + async def test_streaming_response_result(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + async with async_client.beta.task_run.with_streaming_response.result( + run_id="run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = await response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_result(self, async_client: AsyncParallel) -> None: + with pytest.warns(DeprecationWarning): + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.beta.task_run.with_raw_response.result( + run_id="", + ) diff --git a/tests/api_resources/test_beta.py b/tests/api_resources/test_beta.py new file mode 100644 index 0000000..a074455 --- /dev/null +++ b/tests/api_resources/test_beta.py @@ -0,0 +1,226 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from parallel import Parallel, AsyncParallel +from tests.utils import assert_matches_type +from parallel._utils import parse_date +from parallel.types.beta import ( + SearchResult, + ExtractResponse, +) + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestBeta: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + def test_method_extract(self, client: Parallel) -> None: + beta = client.beta.extract( + urls=["string"], + ) + assert_matches_type(ExtractResponse, beta, path=["response"]) + + @parametrize + def test_method_extract_with_all_params(self, client: Parallel) -> None: + beta = client.beta.extract( + urls=["string"], + excerpts=True, + fetch_policy={ + "disable_cache_fallback": True, + "max_age_seconds": 86400, + "timeout_seconds": 60, + }, + objective="objective", + search_queries=["string"], + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(ExtractResponse, beta, path=["response"]) + + @parametrize + def test_raw_response_extract(self, client: Parallel) -> None: + response = client.beta.with_raw_response.extract( + urls=["string"], + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + beta = response.parse() + assert_matches_type(ExtractResponse, beta, path=["response"]) + + @parametrize + def test_streaming_response_extract(self, client: Parallel) -> None: + with client.beta.with_streaming_response.extract( + urls=["string"], + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + beta = response.parse() + assert_matches_type(ExtractResponse, beta, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_search(self, client: Parallel) -> None: + beta = client.beta.search() + assert_matches_type(SearchResult, beta, path=["response"]) + + @parametrize + def test_method_search_with_all_params(self, client: Parallel) -> None: + beta = client.beta.search( + excerpts={ + "max_chars_per_result": 0, + "max_chars_total": 0, + }, + fetch_policy={ + "disable_cache_fallback": True, + "max_age_seconds": 86400, + "timeout_seconds": 60, + }, + max_chars_per_result=0, + max_results=0, + mode="one-shot", + objective="objective", + processor="base", + search_queries=["string"], + source_policy={ + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(SearchResult, beta, path=["response"]) + + @parametrize + def test_raw_response_search(self, client: Parallel) -> None: + response = client.beta.with_raw_response.search() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + beta = response.parse() + assert_matches_type(SearchResult, beta, path=["response"]) + + @parametrize + def test_streaming_response_search(self, client: Parallel) -> None: + with client.beta.with_streaming_response.search() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + beta = response.parse() + assert_matches_type(SearchResult, beta, path=["response"]) + + assert cast(Any, response.is_closed) is True + + +class TestAsyncBeta: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + async def test_method_extract(self, async_client: AsyncParallel) -> None: + beta = await async_client.beta.extract( + urls=["string"], + ) + assert_matches_type(ExtractResponse, beta, path=["response"]) + + @parametrize + async def test_method_extract_with_all_params(self, async_client: AsyncParallel) -> None: + beta = await async_client.beta.extract( + urls=["string"], + excerpts=True, + fetch_policy={ + "disable_cache_fallback": True, + "max_age_seconds": 86400, + "timeout_seconds": 60, + }, + objective="objective", + search_queries=["string"], + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(ExtractResponse, beta, path=["response"]) + + @parametrize + async def test_raw_response_extract(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.with_raw_response.extract( + urls=["string"], + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + beta = await response.parse() + assert_matches_type(ExtractResponse, beta, path=["response"]) + + @parametrize + async def test_streaming_response_extract(self, async_client: AsyncParallel) -> None: + async with async_client.beta.with_streaming_response.extract( + urls=["string"], + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + beta = await response.parse() + assert_matches_type(ExtractResponse, beta, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_search(self, async_client: AsyncParallel) -> None: + beta = await async_client.beta.search() + assert_matches_type(SearchResult, beta, path=["response"]) + + @parametrize + async def test_method_search_with_all_params(self, async_client: AsyncParallel) -> None: + beta = await async_client.beta.search( + excerpts={ + "max_chars_per_result": 0, + "max_chars_total": 0, + }, + fetch_policy={ + "disable_cache_fallback": True, + "max_age_seconds": 86400, + "timeout_seconds": 60, + }, + max_chars_per_result=0, + max_results=0, + mode="one-shot", + objective="objective", + processor="base", + search_queries=["string"], + source_policy={ + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(SearchResult, beta, path=["response"]) + + @parametrize + async def test_raw_response_search(self, async_client: AsyncParallel) -> None: + response = await async_client.beta.with_raw_response.search() + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + beta = await response.parse() + assert_matches_type(SearchResult, beta, path=["response"]) + + @parametrize + async def test_streaming_response_search(self, async_client: AsyncParallel) -> None: + async with async_client.beta.with_streaming_response.search() as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + beta = await response.parse() + assert_matches_type(SearchResult, beta, path=["response"]) + + assert cast(Any, response.is_closed) is True diff --git a/tests/api_resources/test_task_run.py b/tests/api_resources/test_task_run.py new file mode 100644 index 0000000..cc13f42 --- /dev/null +++ b/tests/api_resources/test_task_run.py @@ -0,0 +1,424 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +from typing import Any, cast + +import pytest + +from parallel import Parallel, AsyncParallel +from tests.utils import assert_matches_type +from parallel.types import ( + TaskRun, + TaskRunResult, +) +from parallel._utils import parse_date + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + + +class TestTaskRun: + parametrize = pytest.mark.parametrize("client", [False, True], indirect=True, ids=["loose", "strict"]) + + @parametrize + def test_method_create(self, client: Parallel) -> None: + task_run = client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_method_create_with_all_params(self, client: Parallel) -> None: + task_run = client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + enable_events=True, + mcp_servers=[ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + metadata={"foo": "string"}, + previous_interaction_id="previous_interaction_id", + source_policy={ + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + task_spec={ + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + webhook={ + "url": "url", + "event_types": ["task_run.status"], + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_raw_response_create(self, client: Parallel) -> None: + response = client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_streaming_response_create(self, client: Parallel) -> None: + with client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_method_retrieve(self, client: Parallel) -> None: + task_run = client.task_run.retrieve( + "run_id", + ) + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_raw_response_retrieve(self, client: Parallel) -> None: + response = client.task_run.with_raw_response.retrieve( + "run_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + def test_streaming_response_retrieve(self, client: Parallel) -> None: + with client.task_run.with_streaming_response.retrieve( + "run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_retrieve(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.task_run.with_raw_response.retrieve( + "", + ) + + @parametrize + def test_method_events(self, client: Parallel) -> None: + task_run_stream = client.task_run.events( + "run_id", + ) + task_run_stream.response.close() + + @parametrize + def test_raw_response_events(self, client: Parallel) -> None: + response = client.task_run.with_raw_response.events( + "run_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = response.parse() + stream.close() + + @parametrize + def test_streaming_response_events(self, client: Parallel) -> None: + with client.task_run.with_streaming_response.events( + "run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = response.parse() + stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_events(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.task_run.with_raw_response.events( + "", + ) + + @parametrize + def test_method_result(self, client: Parallel) -> None: + task_run = client.task_run.result( + run_id="run_id", + ) + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + def test_method_result_with_all_params(self, client: Parallel) -> None: + task_run = client.task_run.result( + run_id="run_id", + api_timeout=0, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + def test_raw_response_result(self, client: Parallel) -> None: + response = client.task_run.with_raw_response.result( + run_id="run_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + def test_streaming_response_result(self, client: Parallel) -> None: + with client.task_run.with_streaming_response.result( + run_id="run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + def test_path_params_result(self, client: Parallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + client.task_run.with_raw_response.result( + run_id="", + ) + + +class TestAsyncTaskRun: + parametrize = pytest.mark.parametrize( + "async_client", [False, True, {"http_client": "aiohttp"}], indirect=True, ids=["loose", "strict", "aiohttp"] + ) + + @parametrize + async def test_method_create(self, async_client: AsyncParallel) -> None: + task_run = await async_client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_method_create_with_all_params(self, async_client: AsyncParallel) -> None: + task_run = await async_client.task_run.create( + input="What was the GDP of France in 2023?", + processor="base", + enable_events=True, + mcp_servers=[ + { + "name": "name", + "url": "url", + "allowed_tools": ["string"], + "headers": {"foo": "string"}, + "type": "url", + } + ], + metadata={"foo": "string"}, + previous_interaction_id="previous_interaction_id", + source_policy={ + "after_date": parse_date("2024-01-01"), + "exclude_domains": ["reddit.com", "x.com", ".ai"], + "include_domains": ["wikipedia.org", "usa.gov", ".edu"], + }, + task_spec={ + "output_schema": { + "json_schema": { + "additionalProperties": "bar", + "properties": "bar", + "required": "bar", + "type": "bar", + }, + "type": "json", + }, + "input_schema": "string", + }, + webhook={ + "url": "url", + "event_types": ["task_run.status"], + }, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_raw_response_create(self, async_client: AsyncParallel) -> None: + response = await async_client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = await response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_streaming_response_create(self, async_client: AsyncParallel) -> None: + async with async_client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", + processor="base", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = await response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_method_retrieve(self, async_client: AsyncParallel) -> None: + task_run = await async_client.task_run.retrieve( + "run_id", + ) + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_raw_response_retrieve(self, async_client: AsyncParallel) -> None: + response = await async_client.task_run.with_raw_response.retrieve( + "run_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = await response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + @parametrize + async def test_streaming_response_retrieve(self, async_client: AsyncParallel) -> None: + async with async_client.task_run.with_streaming_response.retrieve( + "run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = await response.parse() + assert_matches_type(TaskRun, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_retrieve(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.task_run.with_raw_response.retrieve( + "", + ) + + @parametrize + async def test_method_events(self, async_client: AsyncParallel) -> None: + task_run_stream = await async_client.task_run.events( + "run_id", + ) + await task_run_stream.response.aclose() + + @parametrize + async def test_raw_response_events(self, async_client: AsyncParallel) -> None: + response = await async_client.task_run.with_raw_response.events( + "run_id", + ) + + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + stream = await response.parse() + await stream.close() + + @parametrize + async def test_streaming_response_events(self, async_client: AsyncParallel) -> None: + async with async_client.task_run.with_streaming_response.events( + "run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + stream = await response.parse() + await stream.close() + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_events(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.task_run.with_raw_response.events( + "", + ) + + @parametrize + async def test_method_result(self, async_client: AsyncParallel) -> None: + task_run = await async_client.task_run.result( + run_id="run_id", + ) + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + async def test_method_result_with_all_params(self, async_client: AsyncParallel) -> None: + task_run = await async_client.task_run.result( + run_id="run_id", + api_timeout=0, + betas=["mcp-server-2025-07-17"], + ) + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + async def test_raw_response_result(self, async_client: AsyncParallel) -> None: + response = await async_client.task_run.with_raw_response.result( + run_id="run_id", + ) + + assert response.is_closed is True + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + task_run = await response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + @parametrize + async def test_streaming_response_result(self, async_client: AsyncParallel) -> None: + async with async_client.task_run.with_streaming_response.result( + run_id="run_id", + ) as response: + assert not response.is_closed + assert response.http_request.headers.get("X-Stainless-Lang") == "python" + + task_run = await response.parse() + assert_matches_type(TaskRunResult, task_run, path=["response"]) + + assert cast(Any, response.is_closed) is True + + @parametrize + async def test_path_params_result(self, async_client: AsyncParallel) -> None: + with pytest.raises(ValueError, match=r"Expected a non-empty value for `run_id` but received ''"): + await async_client.task_run.with_raw_response.result( + run_id="", + ) diff --git a/tests/conftest.py b/tests/conftest.py new file mode 100644 index 0000000..226474b --- /dev/null +++ b/tests/conftest.py @@ -0,0 +1,84 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import os +import logging +from typing import TYPE_CHECKING, Iterator, AsyncIterator + +import httpx +import pytest +from pytest_asyncio import is_async_test + +from parallel import Parallel, AsyncParallel, DefaultAioHttpClient +from parallel._utils import is_dict + +if TYPE_CHECKING: + from _pytest.fixtures import FixtureRequest # pyright: ignore[reportPrivateImportUsage] + +pytest.register_assert_rewrite("tests.utils") + +logging.getLogger("parallel").setLevel(logging.DEBUG) + + +# automatically add `pytest.mark.asyncio()` to all of our async tests +# so we don't have to add that boilerplate everywhere +def pytest_collection_modifyitems(items: list[pytest.Function]) -> None: + pytest_asyncio_tests = (item for item in items if is_async_test(item)) + session_scope_marker = pytest.mark.asyncio(loop_scope="session") + for async_test in pytest_asyncio_tests: + async_test.add_marker(session_scope_marker, append=False) + + # We skip tests that use both the aiohttp client and respx_mock as respx_mock + # doesn't support custom transports. + for item in items: + if "async_client" not in item.fixturenames or "respx_mock" not in item.fixturenames: + continue + + if not hasattr(item, "callspec"): + continue + + async_client_param = item.callspec.params.get("async_client") + if is_dict(async_client_param) and async_client_param.get("http_client") == "aiohttp": + item.add_marker(pytest.mark.skip(reason="aiohttp client is not compatible with respx_mock")) + + +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") + +api_key = "My API Key" + + +@pytest.fixture(scope="session") +def client(request: FixtureRequest) -> Iterator[Parallel]: + strict = getattr(request, "param", True) + if not isinstance(strict, bool): + raise TypeError(f"Unexpected fixture parameter type {type(strict)}, expected {bool}") + + with Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=strict) as client: + yield client + + +@pytest.fixture(scope="session") +async def async_client(request: FixtureRequest) -> AsyncIterator[AsyncParallel]: + param = getattr(request, "param", True) + + # defaults + strict = True + http_client: None | httpx.AsyncClient = None + + if isinstance(param, bool): + strict = param + elif is_dict(param): + strict = param.get("strict", True) + assert isinstance(strict, bool) + + http_client_type = param.get("http_client", "httpx") + if http_client_type == "aiohttp": + http_client = DefaultAioHttpClient() + else: + raise TypeError(f"Unexpected fixture parameter type {type(param)}, expected bool or dict") + + async with AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=strict, http_client=http_client + ) as client: + yield client diff --git a/tests/sample_file.txt b/tests/sample_file.txt new file mode 100644 index 0000000..af5626b --- /dev/null +++ b/tests/sample_file.txt @@ -0,0 +1 @@ +Hello, world! diff --git a/tests/test_client.py b/tests/test_client.py new file mode 100644 index 0000000..5e022bd --- /dev/null +++ b/tests/test_client.py @@ -0,0 +1,1992 @@ +# File generated from our OpenAPI spec by Stainless. See CONTRIBUTING.md for details. + +from __future__ import annotations + +import gc +import os +import sys +import json +import asyncio +import inspect +import dataclasses +import tracemalloc +from typing import Any, Union, TypeVar, Callable, Iterable, Iterator, Optional, Coroutine, cast +from unittest import mock +from typing_extensions import Literal, AsyncIterator, override + +import httpx +import pytest +from respx import MockRouter +from pydantic import ValidationError + +from parallel import Parallel, AsyncParallel, APIResponseValidationError +from parallel._types import Omit +from parallel._utils import asyncify +from parallel._models import BaseModel, FinalRequestOptions +from parallel._exceptions import ParallelError, APIStatusError, APITimeoutError, APIResponseValidationError +from parallel._base_client import ( + DEFAULT_TIMEOUT, + HTTPX_DEFAULT_TIMEOUT, + BaseClient, + OtherPlatform, + DefaultHttpxClient, + DefaultAsyncHttpxClient, + get_platform, + make_request_options, +) + +from .utils import update_env + +T = TypeVar("T") +base_url = os.environ.get("TEST_API_BASE_URL", "http://127.0.0.1:4010") +api_key = "My API Key" + + +def _get_params(client: BaseClient[Any, Any]) -> dict[str, str]: + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + return dict(url.params) + + +def _low_retry_timeout(*_args: Any, **_kwargs: Any) -> float: + return 0.1 + + +def mirror_request_content(request: httpx.Request) -> httpx.Response: + return httpx.Response(200, content=request.content) + + +# note: we can't use the httpx.MockTransport class as it consumes the request +# body itself, which means we can't test that the body is read lazily +class MockTransport(httpx.BaseTransport, httpx.AsyncBaseTransport): + def __init__( + self, + handler: Callable[[httpx.Request], httpx.Response] + | Callable[[httpx.Request], Coroutine[Any, Any, httpx.Response]], + ) -> None: + self.handler = handler + + @override + def handle_request( + self, + request: httpx.Request, + ) -> httpx.Response: + assert not inspect.iscoroutinefunction(self.handler), "handler must not be a coroutine function" + assert inspect.isfunction(self.handler), "handler must be a function" + return self.handler(request) + + @override + async def handle_async_request( + self, + request: httpx.Request, + ) -> httpx.Response: + assert inspect.iscoroutinefunction(self.handler), "handler must be a coroutine function" + return await self.handler(request) + + +@dataclasses.dataclass +class Counter: + value: int = 0 + + +def _make_sync_iterator(iterable: Iterable[T], counter: Optional[Counter] = None) -> Iterator[T]: + for item in iterable: + if counter: + counter.value += 1 + yield item + + +async def _make_async_iterator(iterable: Iterable[T], counter: Optional[Counter] = None) -> AsyncIterator[T]: + for item in iterable: + if counter: + counter.value += 1 + yield item + + +def _get_open_connections(client: Parallel | AsyncParallel) -> int: + transport = client._client._transport + assert isinstance(transport, httpx.HTTPTransport) or isinstance(transport, httpx.AsyncHTTPTransport) + + pool = transport._pool + return len(pool._requests) + + +class TestParallel: + @pytest.mark.respx(base_url=base_url) + def test_raw_response(self, respx_mock: MockRouter, client: Parallel) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + def test_raw_response_for_binary(self, respx_mock: MockRouter, client: Parallel) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self, client: Parallel) -> None: + copied = client.copy() + assert id(copied) != id(client) + + copied = client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert client.api_key == "My API Key" + + def test_copy_default_options(self, client: Parallel) -> None: + # options that have a default are overridden correctly + copied = client.copy(max_retries=7) + assert copied.max_retries == 7 + assert client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(client.timeout, httpx.Timeout) + copied = client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(client.timeout, httpx.Timeout) + + def test_copy_default_headers(self) -> None: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + client.close() + + def test_copy_default_query(self) -> None: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + client.close() + + def test_copy_signature(self, client: Parallel) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self, client: Parallel) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client_copy = client.copy() + client_copy._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "parallel/_legacy_response.py", + "parallel/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "parallel/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + def test_request_timeout(self, client: Parallel) -> None: + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = client._build_request(FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0))) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + def test_client_timeout_option(self) -> None: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0) + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + client.close() + + def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + with httpx.Client(timeout=None) as http_client: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + client.close() + + # no timeout given to the httpx client should not use the httpx default + with httpx.Client() as http_client: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + client.close() + + # explicitly passing the default timeout currently results in it being ignored + with httpx.Client(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + client.close() + + async def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + async with httpx.AsyncClient() as http_client: + Parallel( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + def test_default_headers_option(self) -> None: + test_client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = test_client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + test_client2 = Parallel( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = test_client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + test_client.close() + test_client2.close() + + def test_validate_headers(self) -> None: + client = Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-api-key") == api_key + + with pytest.raises(ParallelError): + with update_env(**{"PARALLEL_API_KEY": Omit()}): + client2 = Parallel(base_url=base_url, api_key=None, _strict_response_validation=True) + _ = client2 + + def test_default_query_option(self) -> None: + client = Parallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + client.close() + + def test_hardcoded_query_params_in_url(self, client: Parallel) -> None: + request = client._build_request(FinalRequestOptions(method="get", url="/foo?beta=true")) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo?beta=true", + params={"limit": "10", "page": "abc"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true", "limit": "10", "page": "abc"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/files/a%2Fb?beta=true", + params={"limit": "10"}, + ) + ) + assert request.url.raw_path == b"/files/a%2Fb?beta=true&limit=10" + + def test_request_extra_json(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions.construct( + method="post", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + def test_binary_content_upload(self, respx_mock: MockRouter, client: Parallel) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + response = client.post( + "/upload", + content=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + def test_binary_content_upload_with_iterator(self) -> None: + file_content = b"Hello, this is a test file." + counter = Counter() + iterator = _make_sync_iterator([file_content], counter=counter) + + def mock_handler(request: httpx.Request) -> httpx.Response: + assert counter.value == 0, "the request body should not have been read" + return httpx.Response(200, content=request.read()) + + with Parallel( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(transport=MockTransport(handler=mock_handler)), + ) as client: + response = client.post( + "/upload", + content=iterator, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + assert counter.value == 1 + + @pytest.mark.respx(base_url=base_url) + def test_binary_content_upload_with_body_is_deprecated(self, respx_mock: MockRouter, client: Parallel) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + with pytest.deprecated_call( + match="Passing raw bytes as `body` is deprecated and will be removed in a future version. Please pass raw bytes via the `content` parameter instead." + ): + response = client.post( + "/upload", + body=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + @pytest.mark.respx(base_url=base_url) + def test_basic_union_response(self, respx_mock: MockRouter, client: Parallel) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + def test_union_response_different_types(self, respx_mock: MockRouter, client: Parallel) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + def test_non_application_json_content_type_for_json_data(self, respx_mock: MockRouter, client: Parallel) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + def test_base_url_setter(self) -> None: + client = Parallel(base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + client.close() + + def test_base_url_env(self) -> None: + with update_env(PARALLEL_BASE_URL="http://localhost:5000/from/env"): + client = Parallel(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + Parallel(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + Parallel( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_trailing_slash(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + client.close() + + @pytest.mark.parametrize( + "client", + [ + Parallel(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + Parallel( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_base_url_no_trailing_slash(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + client.close() + + @pytest.mark.parametrize( + "client", + [ + Parallel(base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True), + Parallel( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.Client(), + ), + ], + ids=["standard", "custom http client"], + ) + def test_absolute_request_url(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + client.close() + + def test_copied_client_does_not_close_http(self) -> None: + test_client = Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not test_client.is_closed() + + copied = test_client.copy() + assert copied is not test_client + + del copied + + assert not test_client.is_closed() + + def test_client_context_manager(self) -> None: + test_client = Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + with test_client as c2: + assert c2 is test_client + assert not c2.is_closed() + assert not test_client.is_closed() + assert test_client.is_closed() + + @pytest.mark.respx(base_url=base_url) + def test_client_response_validation_error(self, respx_mock: MockRouter, client: Parallel) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None)) + + @pytest.mark.respx(base_url=base_url) + def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + strict_client.get("/foo", cast_to=Model) + + non_strict_client = Parallel(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = non_strict_client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + strict_client.close() + non_strict_client.close() + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + def test_parse_retry_after_header( + self, remaining_retries: int, retry_after: str, timeout: float, client: Parallel + ) -> None: + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_timeout_errors_doesnt_leak(self, respx_mock: MockRouter, client: Parallel) -> None: + respx_mock.post("/v1/tasks/runs").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", processor="base" + ).__enter__() + + assert _get_open_connections(client) == 0 + + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_retrying_status_errors_doesnt_leak(self, respx_mock: MockRouter, client: Parallel) -> None: + respx_mock.post("/v1/tasks/runs").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", processor="base" + ).__enter__() + assert _get_open_connections(client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + def test_retries_taken( + self, + client: Parallel, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/tasks/runs").mock(side_effect=retry_handler) + + response = client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", processor="base" + ) + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_omit_retry_count_header( + self, client: Parallel, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/tasks/runs").mock(side_effect=retry_handler) + + response = client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + extra_headers={"x-stainless-retry-count": Omit()}, + ) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + def test_overwrite_retry_count_header( + self, client: Parallel, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/tasks/runs").mock(side_effect=retry_handler) + + response = client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + extra_headers={"x-stainless-retry-count": "42"}, + ) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + # Delete in case our environment has any proxy env vars set + monkeypatch.delenv("HTTP_PROXY", raising=False) + monkeypatch.delenv("ALL_PROXY", raising=False) + monkeypatch.delenv("NO_PROXY", raising=False) + monkeypatch.delenv("http_proxy", raising=False) + monkeypatch.delenv("https_proxy", raising=False) + monkeypatch.delenv("all_proxy", raising=False) + monkeypatch.delenv("no_proxy", raising=False) + + client = DefaultHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects(self, respx_mock: MockRouter, client: Parallel) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + def test_follow_redirects_disabled(self, respx_mock: MockRouter, client: Parallel) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + client.post("/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" + + +class TestAsyncParallel: + @pytest.mark.respx(base_url=base_url) + async def test_raw_response(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + respx_mock.post("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await async_client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + @pytest.mark.respx(base_url=base_url) + async def test_raw_response_for_binary(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + respx_mock.post("/foo").mock( + return_value=httpx.Response(200, headers={"Content-Type": "application/binary"}, content='{"foo": "bar"}') + ) + + response = await async_client.post("/foo", cast_to=httpx.Response) + assert response.status_code == 200 + assert isinstance(response, httpx.Response) + assert response.json() == {"foo": "bar"} + + def test_copy(self, async_client: AsyncParallel) -> None: + copied = async_client.copy() + assert id(copied) != id(async_client) + + copied = async_client.copy(api_key="another My API Key") + assert copied.api_key == "another My API Key" + assert async_client.api_key == "My API Key" + + def test_copy_default_options(self, async_client: AsyncParallel) -> None: + # options that have a default are overridden correctly + copied = async_client.copy(max_retries=7) + assert copied.max_retries == 7 + assert async_client.max_retries == 2 + + copied2 = copied.copy(max_retries=6) + assert copied2.max_retries == 6 + assert copied.max_retries == 7 + + # timeout + assert isinstance(async_client.timeout, httpx.Timeout) + copied = async_client.copy(timeout=None) + assert copied.timeout is None + assert isinstance(async_client.timeout, httpx.Timeout) + + async def test_copy_default_headers(self) -> None: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + assert client.default_headers["X-Foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert copied.default_headers["X-Foo"] == "bar" + + # merges already given headers + copied = client.copy(default_headers={"X-Bar": "stainless"}) + assert copied.default_headers["X-Foo"] == "bar" + assert copied.default_headers["X-Bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_headers={"X-Foo": "stainless"}) + assert copied.default_headers["X-Foo"] == "stainless" + + # set_default_headers + + # completely overrides already set values + copied = client.copy(set_default_headers={}) + assert copied.default_headers.get("X-Foo") is None + + copied = client.copy(set_default_headers={"X-Bar": "Robert"}) + assert copied.default_headers["X-Bar"] == "Robert" + + with pytest.raises( + ValueError, + match="`default_headers` and `set_default_headers` arguments are mutually exclusive", + ): + client.copy(set_default_headers={}, default_headers={"X-Foo": "Bar"}) + await client.close() + + async def test_copy_default_query(self) -> None: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"foo": "bar"} + ) + assert _get_params(client)["foo"] == "bar" + + # does not override the already given value when not specified + copied = client.copy() + assert _get_params(copied)["foo"] == "bar" + + # merges already given params + copied = client.copy(default_query={"bar": "stainless"}) + params = _get_params(copied) + assert params["foo"] == "bar" + assert params["bar"] == "stainless" + + # uses new values for any already given headers + copied = client.copy(default_query={"foo": "stainless"}) + assert _get_params(copied)["foo"] == "stainless" + + # set_default_query + + # completely overrides already set values + copied = client.copy(set_default_query={}) + assert _get_params(copied) == {} + + copied = client.copy(set_default_query={"bar": "Robert"}) + assert _get_params(copied)["bar"] == "Robert" + + with pytest.raises( + ValueError, + # TODO: update + match="`default_query` and `set_default_query` arguments are mutually exclusive", + ): + client.copy(set_default_query={}, default_query={"foo": "Bar"}) + + await client.close() + + def test_copy_signature(self, async_client: AsyncParallel) -> None: + # ensure the same parameters that can be passed to the client are defined in the `.copy()` method + init_signature = inspect.signature( + # mypy doesn't like that we access the `__init__` property. + async_client.__init__, # type: ignore[misc] + ) + copy_signature = inspect.signature(async_client.copy) + exclude_params = {"transport", "proxies", "_strict_response_validation"} + + for name in init_signature.parameters.keys(): + if name in exclude_params: + continue + + copy_param = copy_signature.parameters.get(name) + assert copy_param is not None, f"copy() signature is missing the {name} param" + + @pytest.mark.skipif(sys.version_info >= (3, 10), reason="fails because of a memory leak that started from 3.12") + def test_copy_build_request(self, async_client: AsyncParallel) -> None: + options = FinalRequestOptions(method="get", url="/foo") + + def build_request(options: FinalRequestOptions) -> None: + client_copy = async_client.copy() + client_copy._build_request(options) + + # ensure that the machinery is warmed up before tracing starts. + build_request(options) + gc.collect() + + tracemalloc.start(1000) + + snapshot_before = tracemalloc.take_snapshot() + + ITERATIONS = 10 + for _ in range(ITERATIONS): + build_request(options) + + gc.collect() + snapshot_after = tracemalloc.take_snapshot() + + tracemalloc.stop() + + def add_leak(leaks: list[tracemalloc.StatisticDiff], diff: tracemalloc.StatisticDiff) -> None: + if diff.count == 0: + # Avoid false positives by considering only leaks (i.e. allocations that persist). + return + + if diff.count % ITERATIONS != 0: + # Avoid false positives by considering only leaks that appear per iteration. + return + + for frame in diff.traceback: + if any( + frame.filename.endswith(fragment) + for fragment in [ + # to_raw_response_wrapper leaks through the @functools.wraps() decorator. + # + # removing the decorator fixes the leak for reasons we don't understand. + "parallel/_legacy_response.py", + "parallel/_response.py", + # pydantic.BaseModel.model_dump || pydantic.BaseModel.dict leak memory for some reason. + "parallel/_compat.py", + # Standard library leaks we don't care about. + "/logging/__init__.py", + ] + ): + return + + leaks.append(diff) + + leaks: list[tracemalloc.StatisticDiff] = [] + for diff in snapshot_after.compare_to(snapshot_before, "traceback"): + add_leak(leaks, diff) + if leaks: + for leak in leaks: + print("MEMORY LEAK:", leak) + for frame in leak.traceback: + print(frame) + raise AssertionError() + + async def test_request_timeout(self, async_client: AsyncParallel) -> None: + request = async_client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + request = async_client._build_request( + FinalRequestOptions(method="get", url="/foo", timeout=httpx.Timeout(100.0)) + ) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(100.0) + + async def test_client_timeout_option(self) -> None: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, timeout=httpx.Timeout(0) + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(0) + + await client.close() + + async def test_http_client_timeout_option(self) -> None: + # custom timeout given to the httpx client should be used + async with httpx.AsyncClient(timeout=None) as http_client: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == httpx.Timeout(None) + + await client.close() + + # no timeout given to the httpx client should not use the httpx default + async with httpx.AsyncClient() as http_client: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT + + await client.close() + + # explicitly passing the default timeout currently results in it being ignored + async with httpx.AsyncClient(timeout=HTTPX_DEFAULT_TIMEOUT) as http_client: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, http_client=http_client + ) + + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + timeout = httpx.Timeout(**request.extensions["timeout"]) # type: ignore + assert timeout == DEFAULT_TIMEOUT # our default + + await client.close() + + def test_invalid_http_client(self) -> None: + with pytest.raises(TypeError, match="Invalid `http_client` arg"): + with httpx.Client() as http_client: + AsyncParallel( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=cast(Any, http_client), + ) + + async def test_default_headers_option(self) -> None: + test_client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_headers={"X-Foo": "bar"} + ) + request = test_client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "bar" + assert request.headers.get("x-stainless-lang") == "python" + + test_client2 = AsyncParallel( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + default_headers={ + "X-Foo": "stainless", + "X-Stainless-Lang": "my-overriding-header", + }, + ) + request = test_client2._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-foo") == "stainless" + assert request.headers.get("x-stainless-lang") == "my-overriding-header" + + await test_client.close() + await test_client2.close() + + def test_validate_headers(self) -> None: + client = AsyncParallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + assert request.headers.get("x-api-key") == api_key + + with pytest.raises(ParallelError): + with update_env(**{"PARALLEL_API_KEY": Omit()}): + client2 = AsyncParallel(base_url=base_url, api_key=None, _strict_response_validation=True) + _ = client2 + + async def test_default_query_option(self) -> None: + client = AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, default_query={"query_param": "bar"} + ) + request = client._build_request(FinalRequestOptions(method="get", url="/foo")) + url = httpx.URL(request.url) + assert dict(url.params) == {"query_param": "bar"} + + request = client._build_request( + FinalRequestOptions( + method="get", + url="/foo", + params={"foo": "baz", "query_param": "overridden"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"foo": "baz", "query_param": "overridden"} + + await client.close() + + async def test_hardcoded_query_params_in_url(self, async_client: AsyncParallel) -> None: + request = async_client._build_request(FinalRequestOptions(method="get", url="/foo?beta=true")) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true"} + + request = async_client._build_request( + FinalRequestOptions( + method="get", + url="/foo?beta=true", + params={"limit": "10", "page": "abc"}, + ) + ) + url = httpx.URL(request.url) + assert dict(url.params) == {"beta": "true", "limit": "10", "page": "abc"} + + request = async_client._build_request( + FinalRequestOptions( + method="get", + url="/files/a%2Fb?beta=true", + params={"limit": "10"}, + ) + ) + assert request.url.raw_path == b"/files/a%2Fb?beta=true&limit=10" + + def test_request_extra_json(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": False} + + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + extra_json={"baz": False}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"baz": False} + + # `extra_json` takes priority over `json_data` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar", "baz": True}, + extra_json={"baz": None}, + ), + ) + data = json.loads(request.content.decode("utf-8")) + assert data == {"foo": "bar", "baz": None} + + def test_request_extra_headers(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options(extra_headers={"X-Foo": "Foo"}), + ), + ) + assert request.headers.get("X-Foo") == "Foo" + + # `extra_headers` takes priority over `default_headers` when keys clash + request = client.with_options(default_headers={"X-Bar": "true"})._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_headers={"X-Bar": "false"}, + ), + ), + ) + assert request.headers.get("X-Bar") == "false" + + def test_request_extra_query(self, client: Parallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + extra_query={"my_query_param": "Foo"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"my_query_param": "Foo"} + + # if both `query` and `extra_query` are given, they are merged + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"bar": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"bar": "1", "foo": "2"} + + # `extra_query` takes priority over `query` when keys clash + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + **make_request_options( + query={"foo": "1"}, + extra_query={"foo": "2"}, + ), + ), + ) + params = dict(request.url.params) + assert params == {"foo": "2"} + + def test_multipart_repeating_array(self, async_client: AsyncParallel) -> None: + request = async_client._build_request( + FinalRequestOptions.construct( + method="post", + url="/foo", + headers={"Content-Type": "multipart/form-data; boundary=6b7ba517decee4a450543ea6ae821c82"}, + json_data={"array": ["foo", "bar"]}, + files=[("foo.txt", b"hello world")], + ) + ) + + assert request.read().split(b"\r\n") == [ + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"foo", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="array[]"', + b"", + b"bar", + b"--6b7ba517decee4a450543ea6ae821c82", + b'Content-Disposition: form-data; name="foo.txt"; filename="upload"', + b"Content-Type: application/octet-stream", + b"", + b"hello world", + b"--6b7ba517decee4a450543ea6ae821c82--", + b"", + ] + + @pytest.mark.respx(base_url=base_url) + async def test_binary_content_upload(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + response = await async_client.post( + "/upload", + content=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + async def test_binary_content_upload_with_asynciterator(self) -> None: + file_content = b"Hello, this is a test file." + counter = Counter() + iterator = _make_async_iterator([file_content], counter=counter) + + async def mock_handler(request: httpx.Request) -> httpx.Response: + assert counter.value == 0, "the request body should not have been read" + return httpx.Response(200, content=await request.aread()) + + async with AsyncParallel( + base_url=base_url, + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(transport=MockTransport(handler=mock_handler)), + ) as client: + response = await client.post( + "/upload", + content=iterator, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + assert counter.value == 1 + + @pytest.mark.respx(base_url=base_url) + async def test_binary_content_upload_with_body_is_deprecated( + self, respx_mock: MockRouter, async_client: AsyncParallel + ) -> None: + respx_mock.post("/upload").mock(side_effect=mirror_request_content) + + file_content = b"Hello, this is a test file." + + with pytest.deprecated_call( + match="Passing raw bytes as `body` is deprecated and will be removed in a future version. Please pass raw bytes via the `content` parameter instead." + ): + response = await async_client.post( + "/upload", + body=file_content, + cast_to=httpx.Response, + options={"headers": {"Content-Type": "application/octet-stream"}}, + ) + + assert response.status_code == 200 + assert response.request.headers["Content-Type"] == "application/octet-stream" + assert response.content == file_content + + @pytest.mark.respx(base_url=base_url) + async def test_basic_union_response(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + class Model1(BaseModel): + name: str + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await async_client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + @pytest.mark.respx(base_url=base_url) + async def test_union_response_different_types(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + """Union of objects with the same field name using a different type""" + + class Model1(BaseModel): + foo: int + + class Model2(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": "bar"})) + + response = await async_client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model2) + assert response.foo == "bar" + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": 1})) + + response = await async_client.get("/foo", cast_to=cast(Any, Union[Model1, Model2])) + assert isinstance(response, Model1) + assert response.foo == 1 + + @pytest.mark.respx(base_url=base_url) + async def test_non_application_json_content_type_for_json_data( + self, respx_mock: MockRouter, async_client: AsyncParallel + ) -> None: + """ + Response that sets Content-Type to something other than application/json but returns json data + """ + + class Model(BaseModel): + foo: int + + respx_mock.get("/foo").mock( + return_value=httpx.Response( + 200, + content=json.dumps({"foo": 2}), + headers={"Content-Type": "application/text"}, + ) + ) + + response = await async_client.get("/foo", cast_to=Model) + assert isinstance(response, Model) + assert response.foo == 2 + + async def test_base_url_setter(self) -> None: + client = AsyncParallel( + base_url="https://example.com/from_init", api_key=api_key, _strict_response_validation=True + ) + assert client.base_url == "https://example.com/from_init/" + + client.base_url = "https://example.com/from_setter" # type: ignore[assignment] + + assert client.base_url == "https://example.com/from_setter/" + + await client.close() + + async def test_base_url_env(self) -> None: + with update_env(PARALLEL_BASE_URL="http://localhost:5000/from/env"): + client = AsyncParallel(api_key=api_key, _strict_response_validation=True) + assert client.base_url == "http://localhost:5000/from/env/" + + @pytest.mark.parametrize( + "client", + [ + AsyncParallel( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncParallel( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + async def test_base_url_trailing_slash(self, client: AsyncParallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + await client.close() + + @pytest.mark.parametrize( + "client", + [ + AsyncParallel( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncParallel( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + async def test_base_url_no_trailing_slash(self, client: AsyncParallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "http://localhost:5000/custom/path/foo" + await client.close() + + @pytest.mark.parametrize( + "client", + [ + AsyncParallel( + base_url="http://localhost:5000/custom/path/", api_key=api_key, _strict_response_validation=True + ), + AsyncParallel( + base_url="http://localhost:5000/custom/path/", + api_key=api_key, + _strict_response_validation=True, + http_client=httpx.AsyncClient(), + ), + ], + ids=["standard", "custom http client"], + ) + async def test_absolute_request_url(self, client: AsyncParallel) -> None: + request = client._build_request( + FinalRequestOptions( + method="post", + url="https://myapi.com/foo", + json_data={"foo": "bar"}, + ), + ) + assert request.url == "https://myapi.com/foo" + await client.close() + + async def test_copied_client_does_not_close_http(self) -> None: + test_client = AsyncParallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + assert not test_client.is_closed() + + copied = test_client.copy() + assert copied is not test_client + + del copied + + await asyncio.sleep(0.2) + assert not test_client.is_closed() + + async def test_client_context_manager(self) -> None: + test_client = AsyncParallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + async with test_client as c2: + assert c2 is test_client + assert not c2.is_closed() + assert not test_client.is_closed() + assert test_client.is_closed() + + @pytest.mark.respx(base_url=base_url) + async def test_client_response_validation_error(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + class Model(BaseModel): + foo: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, json={"foo": {"invalid": True}})) + + with pytest.raises(APIResponseValidationError) as exc: + await async_client.get("/foo", cast_to=Model) + + assert isinstance(exc.value.__cause__, ValidationError) + + async def test_client_max_retries_validation(self) -> None: + with pytest.raises(TypeError, match=r"max_retries cannot be None"): + AsyncParallel( + base_url=base_url, api_key=api_key, _strict_response_validation=True, max_retries=cast(Any, None) + ) + + @pytest.mark.respx(base_url=base_url) + async def test_received_text_for_expected_json(self, respx_mock: MockRouter) -> None: + class Model(BaseModel): + name: str + + respx_mock.get("/foo").mock(return_value=httpx.Response(200, text="my-custom-format")) + + strict_client = AsyncParallel(base_url=base_url, api_key=api_key, _strict_response_validation=True) + + with pytest.raises(APIResponseValidationError): + await strict_client.get("/foo", cast_to=Model) + + non_strict_client = AsyncParallel(base_url=base_url, api_key=api_key, _strict_response_validation=False) + + response = await non_strict_client.get("/foo", cast_to=Model) + assert isinstance(response, str) # type: ignore[unreachable] + + await strict_client.close() + await non_strict_client.close() + + @pytest.mark.parametrize( + "remaining_retries,retry_after,timeout", + [ + [3, "20", 20], + [3, "0", 0.5], + [3, "-10", 0.5], + [3, "60", 60], + [3, "61", 0.5], + [3, "Fri, 29 Sep 2023 16:26:57 GMT", 20], + [3, "Fri, 29 Sep 2023 16:26:37 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "Fri, 29 Sep 2023 16:27:37 GMT", 60], + [3, "Fri, 29 Sep 2023 16:27:38 GMT", 0.5], + [3, "99999999999999999999999999999999999", 0.5], + [3, "Zun, 29 Sep 2023 16:26:27 GMT", 0.5], + [3, "", 0.5], + [2, "", 0.5 * 2.0], + [1, "", 0.5 * 4.0], + [-1100, "", 8], # test large number potentially overflowing + ], + ) + @mock.patch("time.time", mock.MagicMock(return_value=1696004797)) + async def test_parse_retry_after_header( + self, remaining_retries: int, retry_after: str, timeout: float, async_client: AsyncParallel + ) -> None: + headers = httpx.Headers({"retry-after": retry_after}) + options = FinalRequestOptions(method="get", url="/foo", max_retries=3) + calculated = async_client._calculate_retry_timeout(remaining_retries, options, headers) + assert calculated == pytest.approx(timeout, 0.5 * 0.875) # pyright: ignore[reportUnknownMemberType] + + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_timeout_errors_doesnt_leak( + self, respx_mock: MockRouter, async_client: AsyncParallel + ) -> None: + respx_mock.post("/v1/tasks/runs").mock(side_effect=httpx.TimeoutException("Test timeout error")) + + with pytest.raises(APITimeoutError): + await async_client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", processor="base" + ).__aenter__() + + assert _get_open_connections(async_client) == 0 + + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_retrying_status_errors_doesnt_leak( + self, respx_mock: MockRouter, async_client: AsyncParallel + ) -> None: + respx_mock.post("/v1/tasks/runs").mock(return_value=httpx.Response(500)) + + with pytest.raises(APIStatusError): + await async_client.task_run.with_streaming_response.create( + input="What was the GDP of France in 2023?", processor="base" + ).__aenter__() + assert _get_open_connections(async_client) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + @pytest.mark.parametrize("failure_mode", ["status", "exception"]) + async def test_retries_taken( + self, + async_client: AsyncParallel, + failures_before_success: int, + failure_mode: Literal["status", "exception"], + respx_mock: MockRouter, + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + if failure_mode == "exception": + raise RuntimeError("oops") + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/tasks/runs").mock(side_effect=retry_handler) + + response = await client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", processor="base" + ) + + assert response.retries_taken == failures_before_success + assert int(response.http_request.headers.get("x-stainless-retry-count")) == failures_before_success + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_omit_retry_count_header( + self, async_client: AsyncParallel, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/tasks/runs").mock(side_effect=retry_handler) + + response = await client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + extra_headers={"x-stainless-retry-count": Omit()}, + ) + + assert len(response.http_request.headers.get_list("x-stainless-retry-count")) == 0 + + @pytest.mark.parametrize("failures_before_success", [0, 2, 4]) + @mock.patch("parallel._base_client.BaseClient._calculate_retry_timeout", _low_retry_timeout) + @pytest.mark.respx(base_url=base_url) + async def test_overwrite_retry_count_header( + self, async_client: AsyncParallel, failures_before_success: int, respx_mock: MockRouter + ) -> None: + client = async_client.with_options(max_retries=4) + + nb_retries = 0 + + def retry_handler(_request: httpx.Request) -> httpx.Response: + nonlocal nb_retries + if nb_retries < failures_before_success: + nb_retries += 1 + return httpx.Response(500) + return httpx.Response(200) + + respx_mock.post("/v1/tasks/runs").mock(side_effect=retry_handler) + + response = await client.task_run.with_raw_response.create( + input="What was the GDP of France in 2023?", + processor="base", + extra_headers={"x-stainless-retry-count": "42"}, + ) + + assert response.http_request.headers.get("x-stainless-retry-count") == "42" + + async def test_get_platform(self) -> None: + platform = await asyncify(get_platform)() + assert isinstance(platform, (str, OtherPlatform)) + + async def test_proxy_environment_variables(self, monkeypatch: pytest.MonkeyPatch) -> None: + # Test that the proxy environment variables are set correctly + monkeypatch.setenv("HTTPS_PROXY", "https://example.org") + # Delete in case our environment has any proxy env vars set + monkeypatch.delenv("HTTP_PROXY", raising=False) + monkeypatch.delenv("ALL_PROXY", raising=False) + monkeypatch.delenv("NO_PROXY", raising=False) + monkeypatch.delenv("http_proxy", raising=False) + monkeypatch.delenv("https_proxy", raising=False) + monkeypatch.delenv("all_proxy", raising=False) + monkeypatch.delenv("no_proxy", raising=False) + + client = DefaultAsyncHttpxClient() + + mounts = tuple(client._mounts.items()) + assert len(mounts) == 1 + assert mounts[0][0].pattern == "https://" + + @pytest.mark.filterwarnings("ignore:.*deprecated.*:DeprecationWarning") + async def test_default_client_creation(self) -> None: + # Ensure that the client can be initialized without any exceptions + DefaultAsyncHttpxClient( + verify=True, + cert=None, + trust_env=True, + http1=True, + http2=False, + limits=httpx.Limits(max_connections=100, max_keepalive_connections=20), + ) + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + # Test that the default follow_redirects=True allows following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + respx_mock.get("/redirected").mock(return_value=httpx.Response(200, json={"status": "ok"})) + + response = await async_client.post("/redirect", body={"key": "value"}, cast_to=httpx.Response) + assert response.status_code == 200 + assert response.json() == {"status": "ok"} + + @pytest.mark.respx(base_url=base_url) + async def test_follow_redirects_disabled(self, respx_mock: MockRouter, async_client: AsyncParallel) -> None: + # Test that follow_redirects=False prevents following redirects + respx_mock.post("/redirect").mock( + return_value=httpx.Response(302, headers={"Location": f"{base_url}/redirected"}) + ) + + with pytest.raises(APIStatusError) as exc_info: + await async_client.post( + "/redirect", body={"key": "value"}, options={"follow_redirects": False}, cast_to=httpx.Response + ) + + assert exc_info.value.response.status_code == 302 + assert exc_info.value.response.headers["Location"] == f"{base_url}/redirected" diff --git a/tests/test_deepcopy.py b/tests/test_deepcopy.py new file mode 100644 index 0000000..f6e9be1 --- /dev/null +++ b/tests/test_deepcopy.py @@ -0,0 +1,58 @@ +from parallel._utils import deepcopy_minimal + + +def assert_different_identities(obj1: object, obj2: object) -> None: + assert obj1 == obj2 + assert id(obj1) != id(obj2) + + +def test_simple_dict() -> None: + obj1 = {"foo": "bar"} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_dict() -> None: + obj1 = {"foo": {"bar": True}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + + +def test_complex_nested_dict() -> None: + obj1 = {"foo": {"bar": [{"hello": "world"}]}} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1["foo"], obj2["foo"]) + assert_different_identities(obj1["foo"]["bar"], obj2["foo"]["bar"]) + assert_different_identities(obj1["foo"]["bar"][0], obj2["foo"]["bar"][0]) + + +def test_simple_list() -> None: + obj1 = ["a", "b", "c"] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + + +def test_nested_list() -> None: + obj1 = ["a", [1, 2, 3]] + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert_different_identities(obj1[1], obj2[1]) + + +class MyObject: ... + + +def test_ignores_other_types() -> None: + # custom classes + my_obj = MyObject() + obj1 = {"foo": my_obj} + obj2 = deepcopy_minimal(obj1) + assert_different_identities(obj1, obj2) + assert obj1["foo"] is my_obj + + # tuples + obj3 = ("a", "b") + obj4 = deepcopy_minimal(obj3) + assert obj3 is obj4 diff --git a/tests/test_extract_files.py b/tests/test_extract_files.py new file mode 100644 index 0000000..ad0eca3 --- /dev/null +++ b/tests/test_extract_files.py @@ -0,0 +1,64 @@ +from __future__ import annotations + +from typing import Sequence + +import pytest + +from parallel._types import FileTypes +from parallel._utils import extract_files + + +def test_removes_files_from_input() -> None: + query = {"foo": "bar"} + assert extract_files(query, paths=[]) == [] + assert query == {"foo": "bar"} + + query2 = {"foo": b"Bar", "hello": "world"} + assert extract_files(query2, paths=[["foo"]]) == [("foo", b"Bar")] + assert query2 == {"hello": "world"} + + query3 = {"foo": {"foo": {"bar": b"Bar"}}, "hello": "world"} + assert extract_files(query3, paths=[["foo", "foo", "bar"]]) == [("foo[foo][bar]", b"Bar")] + assert query3 == {"foo": {"foo": {}}, "hello": "world"} + + query4 = {"foo": {"bar": b"Bar", "baz": "foo"}, "hello": "world"} + assert extract_files(query4, paths=[["foo", "bar"]]) == [("foo[bar]", b"Bar")] + assert query4 == {"hello": "world", "foo": {"baz": "foo"}} + + +def test_multiple_files() -> None: + query = {"documents": [{"file": b"My first file"}, {"file": b"My second file"}]} + assert extract_files(query, paths=[["documents", "", "file"]]) == [ + ("documents[][file]", b"My first file"), + ("documents[][file]", b"My second file"), + ] + assert query == {"documents": [{}, {}]} + + +@pytest.mark.parametrize( + "query,paths,expected", + [ + [ + {"foo": {"bar": "baz"}}, + [["foo", "", "bar"]], + [], + ], + [ + {"foo": ["bar", "baz"]}, + [["foo", "bar"]], + [], + ], + [ + {"foo": {"bar": "baz"}}, + [["foo", "foo"]], + [], + ], + ], + ids=["dict expecting array", "array expecting dict", "unknown keys"], +) +def test_ignores_incorrect_paths( + query: dict[str, object], + paths: Sequence[Sequence[str]], + expected: list[tuple[str, FileTypes]], +) -> None: + assert extract_files(query, paths=paths) == expected diff --git a/tests/test_files.py b/tests/test_files.py new file mode 100644 index 0000000..9cd16d8 --- /dev/null +++ b/tests/test_files.py @@ -0,0 +1,51 @@ +from pathlib import Path + +import anyio +import pytest +from dirty_equals import IsDict, IsList, IsBytes, IsTuple + +from parallel._files import to_httpx_files, async_to_httpx_files + +readme_path = Path(__file__).parent.parent.joinpath("README.md") + + +def test_pathlib_includes_file_name() -> None: + result = to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +def test_tuple_input() -> None: + result = to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +@pytest.mark.asyncio +async def test_async_pathlib_includes_file_name() -> None: + result = await async_to_httpx_files({"file": readme_path}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_supports_anyio_path() -> None: + result = await async_to_httpx_files({"file": anyio.Path(readme_path)}) + print(result) + assert result == IsDict({"file": IsTuple("README.md", IsBytes())}) + + +@pytest.mark.asyncio +async def test_async_tuple_input() -> None: + result = await async_to_httpx_files([("file", readme_path)]) + print(result) + assert result == IsList(IsTuple("file", IsTuple("README.md", IsBytes()))) + + +def test_string_not_allowed() -> None: + with pytest.raises(TypeError, match="Expected file types input to be a FileContent type or to be a tuple"): + to_httpx_files( + { + "file": "foo", # type: ignore + } + ) diff --git a/tests/test_models.py b/tests/test_models.py new file mode 100644 index 0000000..e8a5162 --- /dev/null +++ b/tests/test_models.py @@ -0,0 +1,963 @@ +import json +from typing import TYPE_CHECKING, Any, Dict, List, Union, Optional, cast +from datetime import datetime, timezone +from typing_extensions import Literal, Annotated, TypeAliasType + +import pytest +import pydantic +from pydantic import Field + +from parallel._utils import PropertyInfo +from parallel._compat import PYDANTIC_V1, parse_obj, model_dump, model_json +from parallel._models import DISCRIMINATOR_CACHE, BaseModel, construct_type + + +class BasicModel(BaseModel): + foo: str + + +@pytest.mark.parametrize("value", ["hello", 1], ids=["correct type", "mismatched"]) +def test_basic(value: object) -> None: + m = BasicModel.construct(foo=value) + assert m.foo == value + + +def test_directly_nested_model() -> None: + class NestedModel(BaseModel): + nested: BasicModel + + m = NestedModel.construct(nested={"foo": "Foo!"}) + assert m.nested.foo == "Foo!" + + # mismatched types + m = NestedModel.construct(nested="hello!") + assert cast(Any, m.nested) == "hello!" + + +def test_optional_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[BasicModel] + + m1 = NestedModel.construct(nested=None) + assert m1.nested is None + + m2 = NestedModel.construct(nested={"foo": "bar"}) + assert m2.nested is not None + assert m2.nested.foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested={"foo"}) + assert isinstance(cast(Any, m3.nested), set) + assert cast(Any, m3.nested) == {"foo"} + + +def test_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[BasicModel] + + m = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0].foo == "bar" + assert m.nested[1].foo == "2" + + # mismatched types + m = NestedModel.construct(nested=True) + assert cast(Any, m.nested) is True + + m = NestedModel.construct(nested=[False]) + assert cast(Any, m.nested) == [False] + + +def test_optional_list_nested_model() -> None: + class NestedModel(BaseModel): + nested: Optional[List[BasicModel]] + + m1 = NestedModel.construct(nested=[{"foo": "bar"}, {"foo": "2"}]) + assert m1.nested is not None + assert isinstance(m1.nested, list) + assert len(m1.nested) == 2 + assert m1.nested[0].foo == "bar" + assert m1.nested[1].foo == "2" + + m2 = NestedModel.construct(nested=None) + assert m2.nested is None + + # mismatched types + m3 = NestedModel.construct(nested={1}) + assert cast(Any, m3.nested) == {1} + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_optional_items_nested_model() -> None: + class NestedModel(BaseModel): + nested: List[Optional[BasicModel]] + + m = NestedModel.construct(nested=[None, {"foo": "bar"}]) + assert m.nested is not None + assert isinstance(m.nested, list) + assert len(m.nested) == 2 + assert m.nested[0] is None + assert m.nested[1] is not None + assert m.nested[1].foo == "bar" + + # mismatched types + m3 = NestedModel.construct(nested="foo") + assert cast(Any, m3.nested) == "foo" + + m4 = NestedModel.construct(nested=[False]) + assert cast(Any, m4.nested) == [False] + + +def test_list_mismatched_type() -> None: + class NestedModel(BaseModel): + nested: List[str] + + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_raw_dictionary() -> None: + class NestedModel(BaseModel): + nested: Dict[str, str] + + m = NestedModel.construct(nested={"hello": "world"}) + assert m.nested == {"hello": "world"} + + # mismatched types + m = NestedModel.construct(nested=False) + assert cast(Any, m.nested) is False + + +def test_nested_dictionary_model() -> None: + class NestedModel(BaseModel): + nested: Dict[str, BasicModel] + + m = NestedModel.construct(nested={"hello": {"foo": "bar"}}) + assert isinstance(m.nested, dict) + assert m.nested["hello"].foo == "bar" + + # mismatched types + m = NestedModel.construct(nested={"hello": False}) + assert cast(Any, m.nested["hello"]) is False + + +def test_unknown_fields() -> None: + m1 = BasicModel.construct(foo="foo", unknown=1) + assert m1.foo == "foo" + assert cast(Any, m1).unknown == 1 + + m2 = BasicModel.construct(foo="foo", unknown={"foo_bar": True}) + assert m2.foo == "foo" + assert cast(Any, m2).unknown == {"foo_bar": True} + + assert model_dump(m2) == {"foo": "foo", "unknown": {"foo_bar": True}} + + +def test_strict_validation_unknown_fields() -> None: + class Model(BaseModel): + foo: str + + model = parse_obj(Model, dict(foo="hello!", user="Robert")) + assert model.foo == "hello!" + assert cast(Any, model).user == "Robert" + + assert model_dump(model) == {"foo": "hello!", "user": "Robert"} + + +def test_aliases() -> None: + class Model(BaseModel): + my_field: int = Field(alias="myField") + + m = Model.construct(myField=1) + assert m.my_field == 1 + + # mismatched types + m = Model.construct(myField={"hello": False}) + assert cast(Any, m.my_field) == {"hello": False} + + +def test_repr() -> None: + model = BasicModel(foo="bar") + assert str(model) == "BasicModel(foo='bar')" + assert repr(model) == "BasicModel(foo='bar')" + + +def test_repr_nested_model() -> None: + class Child(BaseModel): + name: str + age: int + + class Parent(BaseModel): + name: str + child: Child + + model = Parent(name="Robert", child=Child(name="Foo", age=5)) + assert str(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + assert repr(model) == "Parent(name='Robert', child=Child(name='Foo', age=5))" + + +def test_optional_list() -> None: + class Submodel(BaseModel): + name: str + + class Model(BaseModel): + items: Optional[List[Submodel]] + + m = Model.construct(items=None) + assert m.items is None + + m = Model.construct(items=[]) + assert m.items == [] + + m = Model.construct(items=[{"name": "Robert"}]) + assert m.items is not None + assert len(m.items) == 1 + assert m.items[0].name == "Robert" + + +def test_nested_union_of_models() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + +def test_nested_union_of_mixed_types() -> None: + class Submodel1(BaseModel): + bar: bool + + class Model(BaseModel): + foo: Union[Submodel1, Literal[True], Literal["CARD_HOLDER"]] + + m = Model.construct(foo=True) + assert m.foo is True + + m = Model.construct(foo="CARD_HOLDER") + assert m.foo == "CARD_HOLDER" + + m = Model.construct(foo={"bar": False}) + assert isinstance(m.foo, Submodel1) + assert m.foo.bar is False + + +def test_nested_union_multiple_variants() -> None: + class Submodel1(BaseModel): + bar: bool + + class Submodel2(BaseModel): + thing: str + + class Submodel3(BaseModel): + foo: int + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2, None, Submodel3] + + m = Model.construct(foo={"thing": "hello"}) + assert isinstance(m.foo, Submodel2) + assert m.foo.thing == "hello" + + m = Model.construct(foo=None) + assert m.foo is None + + m = Model.construct() + assert m.foo is None + + m = Model.construct(foo={"foo": "1"}) + assert isinstance(m.foo, Submodel3) + assert m.foo.foo == 1 + + +def test_nested_union_invalid_data() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + foo: Union[Submodel1, Submodel2] + + m = Model.construct(foo=True) + assert cast(bool, m.foo) is True + + m = Model.construct(foo={"name": 3}) + if PYDANTIC_V1: + assert isinstance(m.foo, Submodel2) + assert m.foo.name == "3" + else: + assert isinstance(m.foo, Submodel1) + assert m.foo.name == 3 # type: ignore + + +def test_list_of_unions() -> None: + class Submodel1(BaseModel): + level: int + + class Submodel2(BaseModel): + name: str + + class Model(BaseModel): + items: List[Union[Submodel1, Submodel2]] + + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], Submodel2) + assert m.items[1].name == "Robert" + + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], Submodel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_union_of_lists() -> None: + class SubModel1(BaseModel): + level: int + + class SubModel2(BaseModel): + name: str + + class Model(BaseModel): + items: Union[List[SubModel1], List[SubModel2]] + + # with one valid entry + m = Model.construct(items=[{"name": "Robert"}]) + assert len(m.items) == 1 + assert isinstance(m.items[0], SubModel2) + assert m.items[0].name == "Robert" + + # with two entries pointing to different types + m = Model.construct(items=[{"level": 1}, {"name": "Robert"}]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == 1 + assert isinstance(m.items[1], SubModel1) + assert cast(Any, m.items[1]).name == "Robert" + + # with two entries pointing to *completely* different types + m = Model.construct(items=[{"level": -1}, 156]) + assert len(m.items) == 2 + assert isinstance(m.items[0], SubModel1) + assert m.items[0].level == -1 + assert cast(Any, m.items[1]) == 156 + + +def test_dict_of_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Dict[str, Union[SubModel1, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel2) + assert m.data["foo"].foo == "bar" + + # TODO: test mismatched type + + +def test_double_nested_union() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + bar: str + + class Model(BaseModel): + data: Dict[str, List[Union[SubModel1, SubModel2]]] + + m = Model.construct(data={"foo": [{"bar": "baz"}, {"name": "Robert"}]}) + assert len(m.data["foo"]) == 2 + + entry1 = m.data["foo"][0] + assert isinstance(entry1, SubModel2) + assert entry1.bar == "baz" + + entry2 = m.data["foo"][1] + assert isinstance(entry2, SubModel1) + assert entry2.name == "Robert" + + # TODO: test mismatched type + + +def test_union_of_dict() -> None: + class SubModel1(BaseModel): + name: str + + class SubModel2(BaseModel): + foo: str + + class Model(BaseModel): + data: Union[Dict[str, SubModel1], Dict[str, SubModel2]] + + m = Model.construct(data={"hello": {"name": "there"}, "foo": {"foo": "bar"}}) + assert len(list(m.data.keys())) == 2 + assert isinstance(m.data["hello"], SubModel1) + assert m.data["hello"].name == "there" + assert isinstance(m.data["foo"], SubModel1) + assert cast(Any, m.data["foo"]).foo == "bar" + + +def test_iso8601_datetime() -> None: + class Model(BaseModel): + created_at: datetime + + expected = datetime(2019, 12, 27, 18, 11, 19, 117000, tzinfo=timezone.utc) + + if PYDANTIC_V1: + expected_json = '{"created_at": "2019-12-27T18:11:19.117000+00:00"}' + else: + expected_json = '{"created_at":"2019-12-27T18:11:19.117000Z"}' + + model = Model.construct(created_at="2019-12-27T18:11:19.117Z") + assert model.created_at == expected + assert model_json(model) == expected_json + + model = parse_obj(Model, dict(created_at="2019-12-27T18:11:19.117Z")) + assert model.created_at == expected + assert model_json(model) == expected_json + + +def test_does_not_coerce_int() -> None: + class Model(BaseModel): + bar: int + + assert Model.construct(bar=1).bar == 1 + assert Model.construct(bar=10.9).bar == 10.9 + assert Model.construct(bar="19").bar == "19" # type: ignore[comparison-overlap] + assert Model.construct(bar=False).bar is False + + +def test_int_to_float_safe_conversion() -> None: + class Model(BaseModel): + float_field: float + + m = Model.construct(float_field=10) + assert m.float_field == 10.0 + assert isinstance(m.float_field, float) + + m = Model.construct(float_field=10.12) + assert m.float_field == 10.12 + assert isinstance(m.float_field, float) + + # number too big + m = Model.construct(float_field=2**53 + 1) + assert m.float_field == 2**53 + 1 + assert isinstance(m.float_field, int) + + +def test_deprecated_alias() -> None: + class Model(BaseModel): + resource_id: str = Field(alias="model_id") + + @property + def model_id(self) -> str: + return self.resource_id + + m = Model.construct(model_id="id") + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + m = parse_obj(Model, {"model_id": "id"}) + assert m.model_id == "id" + assert m.resource_id == "id" + assert m.resource_id is m.model_id + + +def test_omitted_fields() -> None: + class Model(BaseModel): + resource_id: Optional[str] = None + + m = Model.construct() + assert m.resource_id is None + assert "resource_id" not in m.model_fields_set + + m = Model.construct(resource_id=None) + assert m.resource_id is None + assert "resource_id" in m.model_fields_set + + m = Model.construct(resource_id="foo") + assert m.resource_id == "foo" + assert "resource_id" in m.model_fields_set + + +def test_to_dict() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.to_dict() == {"FOO": "hello"} + assert m.to_dict(use_api_names=False) == {"foo": "hello"} + + m2 = Model() + assert m2.to_dict() == {} + assert m2.to_dict(exclude_unset=False) == {"FOO": None} + assert m2.to_dict(exclude_unset=False, exclude_none=True) == {} + assert m2.to_dict(exclude_unset=False, exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.to_dict() == {"FOO": None} + assert m3.to_dict(exclude_none=True) == {} + assert m3.to_dict(exclude_defaults=True) == {} + + class Model2(BaseModel): + created_at: datetime + + time_str = "2024-03-21T11:39:01.275859" + m4 = Model2.construct(created_at=time_str) + assert m4.to_dict(mode="python") == {"created_at": datetime.fromisoformat(time_str)} + assert m4.to_dict(mode="json") == {"created_at": time_str} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_dict(warnings=False) + + +def test_forwards_compat_model_dump_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert m.model_dump() == {"foo": "hello"} + assert m.model_dump(include={"bar"}) == {} + assert m.model_dump(exclude={"foo"}) == {} + assert m.model_dump(by_alias=True) == {"FOO": "hello"} + + m2 = Model() + assert m2.model_dump() == {"foo": None} + assert m2.model_dump(exclude_unset=True) == {} + assert m2.model_dump(exclude_none=True) == {} + assert m2.model_dump(exclude_defaults=True) == {} + + m3 = Model(FOO=None) + assert m3.model_dump() == {"foo": None} + assert m3.model_dump(exclude_none=True) == {} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump(warnings=False) + + +def test_compat_method_no_error_for_warnings() -> None: + class Model(BaseModel): + foo: Optional[str] + + m = Model(foo="hello") + assert isinstance(model_dump(m, warnings=False), dict) + + +def test_to_json() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.to_json()) == {"FOO": "hello"} + assert json.loads(m.to_json(use_api_names=False)) == {"foo": "hello"} + + if PYDANTIC_V1: + assert m.to_json(indent=None) == '{"FOO": "hello"}' + else: + assert m.to_json(indent=None) == '{"FOO":"hello"}' + + m2 = Model() + assert json.loads(m2.to_json()) == {} + assert json.loads(m2.to_json(exclude_unset=False)) == {"FOO": None} + assert json.loads(m2.to_json(exclude_unset=False, exclude_none=True)) == {} + assert json.loads(m2.to_json(exclude_unset=False, exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.to_json()) == {"FOO": None} + assert json.loads(m3.to_json(exclude_none=True)) == {} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.to_json(warnings=False) + + +def test_forwards_compat_model_dump_json_method() -> None: + class Model(BaseModel): + foo: Optional[str] = Field(alias="FOO", default=None) + + m = Model(FOO="hello") + assert json.loads(m.model_dump_json()) == {"foo": "hello"} + assert json.loads(m.model_dump_json(include={"bar"})) == {} + assert json.loads(m.model_dump_json(include={"foo"})) == {"foo": "hello"} + assert json.loads(m.model_dump_json(by_alias=True)) == {"FOO": "hello"} + + assert m.model_dump_json(indent=2) == '{\n "foo": "hello"\n}' + + m2 = Model() + assert json.loads(m2.model_dump_json()) == {"foo": None} + assert json.loads(m2.model_dump_json(exclude_unset=True)) == {} + assert json.loads(m2.model_dump_json(exclude_none=True)) == {} + assert json.loads(m2.model_dump_json(exclude_defaults=True)) == {} + + m3 = Model(FOO=None) + assert json.loads(m3.model_dump_json()) == {"foo": None} + assert json.loads(m3.model_dump_json(exclude_none=True)) == {} + + if PYDANTIC_V1: + with pytest.raises(ValueError, match="round_trip is only supported in Pydantic v2"): + m.model_dump_json(round_trip=True) + + with pytest.raises(ValueError, match="warnings is only supported in Pydantic v2"): + m.model_dump_json(warnings=False) + + +def test_type_compat() -> None: + # our model type can be assigned to Pydantic's model type + + def takes_pydantic(model: pydantic.BaseModel) -> None: # noqa: ARG001 + ... + + class OurModel(BaseModel): + foo: Optional[str] = None + + takes_pydantic(OurModel()) + + +def test_annotated_types() -> None: + class Model(BaseModel): + value: str + + m = construct_type( + value={"value": "foo"}, + type_=cast(Any, Annotated[Model, "random metadata"]), + ) + assert isinstance(m, Model) + assert m.value == "foo" + + +def test_discriminated_unions_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, A) + assert m.type == "a" + if PYDANTIC_V1: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + else: + assert m.data == 100 # type: ignore[comparison-overlap] + + +def test_discriminated_unions_unknown_variant() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + m = construct_type( + value={"type": "c", "data": None, "new_thing": "bar"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + + # just chooses the first variant + assert isinstance(m, A) + assert m.type == "c" # type: ignore[comparison-overlap] + assert m.data == None # type: ignore[unreachable] + assert m.new_thing == "bar" + + +def test_discriminated_unions_invalid_data_nested_unions() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + class C(BaseModel): + type: Literal["c"] + + data: bool + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "c", "data": "foo"}, + type_=cast(Any, Annotated[Union[Union[A, B], C], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, C) + assert m.type == "c" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_with_aliases_invalid_data() -> None: + class A(BaseModel): + foo_type: Literal["a"] = Field(alias="type") + + data: str + + class B(BaseModel): + foo_type: Literal["b"] = Field(alias="type") + + data: int + + m = construct_type( + value={"type": "b", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, B) + assert m.foo_type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + m = construct_type( + value={"type": "a", "data": 100}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="foo_type")]), + ) + assert isinstance(m, A) + assert m.foo_type == "a" + if PYDANTIC_V1: + # pydantic v1 automatically converts inputs to strings + # if the expected type is a str + assert m.data == "100" + else: + assert m.data == 100 # type: ignore[comparison-overlap] + + +def test_discriminated_unions_overlapping_discriminators_invalid_data() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["a"] + + data: int + + m = construct_type( + value={"type": "a", "data": "foo"}, + type_=cast(Any, Annotated[Union[A, B], PropertyInfo(discriminator="type")]), + ) + assert isinstance(m, B) + assert m.type == "a" + assert m.data == "foo" # type: ignore[comparison-overlap] + + +def test_discriminated_unions_invalid_data_uses_cache() -> None: + class A(BaseModel): + type: Literal["a"] + + data: str + + class B(BaseModel): + type: Literal["b"] + + data: int + + UnionType = cast(Any, Union[A, B]) + + assert not DISCRIMINATOR_CACHE.get(UnionType) + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + discriminator = DISCRIMINATOR_CACHE.get(UnionType) + assert discriminator is not None + + m = construct_type( + value={"type": "b", "data": "foo"}, type_=cast(Any, Annotated[UnionType, PropertyInfo(discriminator="type")]) + ) + assert isinstance(m, B) + assert m.type == "b" + assert m.data == "foo" # type: ignore[comparison-overlap] + + # if the discriminator details object stays the same between invocations then + # we hit the cache + assert DISCRIMINATOR_CACHE.get(UnionType) is discriminator + + +@pytest.mark.skipif(PYDANTIC_V1, reason="TypeAliasType is not supported in Pydantic v1") +def test_type_alias_type() -> None: + Alias = TypeAliasType("Alias", str) # pyright: ignore + + class Model(BaseModel): + alias: Alias + union: Union[int, Alias] + + m = construct_type(value={"alias": "foo", "union": "bar"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.alias, str) + assert m.alias == "foo" + assert isinstance(m.union, str) + assert m.union == "bar" + + +@pytest.mark.skipif(PYDANTIC_V1, reason="TypeAliasType is not supported in Pydantic v1") +def test_field_named_cls() -> None: + class Model(BaseModel): + cls: str + + m = construct_type(value={"cls": "foo"}, type_=Model) + assert isinstance(m, Model) + assert isinstance(m.cls, str) + + +def test_discriminated_union_case() -> None: + class A(BaseModel): + type: Literal["a"] + + data: bool + + class B(BaseModel): + type: Literal["b"] + + data: List[Union[A, object]] + + class ModelA(BaseModel): + type: Literal["modelA"] + + data: int + + class ModelB(BaseModel): + type: Literal["modelB"] + + required: str + + data: Union[A, B] + + # when constructing ModelA | ModelB, value data doesn't match ModelB exactly - missing `required` + m = construct_type( + value={"type": "modelB", "data": {"type": "a", "data": True}}, + type_=cast(Any, Annotated[Union[ModelA, ModelB], PropertyInfo(discriminator="type")]), + ) + + assert isinstance(m, ModelB) + + +def test_nested_discriminated_union() -> None: + class InnerType1(BaseModel): + type: Literal["type_1"] + + class InnerModel(BaseModel): + inner_value: str + + class InnerType2(BaseModel): + type: Literal["type_2"] + some_inner_model: InnerModel + + class Type1(BaseModel): + base_type: Literal["base_type_1"] + value: Annotated[ + Union[ + InnerType1, + InnerType2, + ], + PropertyInfo(discriminator="type"), + ] + + class Type2(BaseModel): + base_type: Literal["base_type_2"] + + T = Annotated[ + Union[ + Type1, + Type2, + ], + PropertyInfo(discriminator="base_type"), + ] + + model = construct_type( + type_=T, + value={ + "base_type": "base_type_1", + "value": { + "type": "type_2", + }, + }, + ) + assert isinstance(model, Type1) + assert isinstance(model.value, InnerType2) + + +@pytest.mark.skipif(PYDANTIC_V1, reason="this is only supported in pydantic v2 for now") +def test_extra_properties() -> None: + class Item(BaseModel): + prop: int + + class Model(BaseModel): + __pydantic_extra__: Dict[str, Item] = Field(init=False) # pyright: ignore[reportIncompatibleVariableOverride] + + other: str + + if TYPE_CHECKING: + + def __getattr__(self, attr: str) -> Item: ... + + model = construct_type( + type_=Model, + value={ + "a": {"prop": 1}, + "other": "foo", + }, + ) + assert isinstance(model, Model) + assert model.a.prop == 1 + assert isinstance(model.a, Item) + assert model.other == "foo" diff --git a/tests/test_qs.py b/tests/test_qs.py new file mode 100644 index 0000000..5da7e20 --- /dev/null +++ b/tests/test_qs.py @@ -0,0 +1,78 @@ +from typing import Any, cast +from functools import partial +from urllib.parse import unquote + +import pytest + +from parallel._qs import Querystring, stringify + + +def test_empty() -> None: + assert stringify({}) == "" + assert stringify({"a": {}}) == "" + assert stringify({"a": {"b": {"c": {}}}}) == "" + + +def test_basic() -> None: + assert stringify({"a": 1}) == "a=1" + assert stringify({"a": "b"}) == "a=b" + assert stringify({"a": True}) == "a=true" + assert stringify({"a": False}) == "a=false" + assert stringify({"a": 1.23456}) == "a=1.23456" + assert stringify({"a": None}) == "" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_nested_dotted(method: str) -> None: + if method == "class": + serialise = Querystring(nested_format="dots").stringify + else: + serialise = partial(stringify, nested_format="dots") + + assert unquote(serialise({"a": {"b": "c"}})) == "a.b=c" + assert unquote(serialise({"a": {"b": "c", "d": "e", "f": "g"}})) == "a.b=c&a.d=e&a.f=g" + assert unquote(serialise({"a": {"b": {"c": {"d": "e"}}}})) == "a.b.c.d=e" + assert unquote(serialise({"a": {"b": True}})) == "a.b=true" + + +def test_nested_brackets() -> None: + assert unquote(stringify({"a": {"b": "c"}})) == "a[b]=c" + assert unquote(stringify({"a": {"b": "c", "d": "e", "f": "g"}})) == "a[b]=c&a[d]=e&a[f]=g" + assert unquote(stringify({"a": {"b": {"c": {"d": "e"}}}})) == "a[b][c][d]=e" + assert unquote(stringify({"a": {"b": True}})) == "a[b]=true" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_comma(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="comma").stringify + else: + serialise = partial(stringify, array_format="comma") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in=foo,bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b]=true,false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b]=true,false,true" + + +def test_array_repeat() -> None: + assert unquote(stringify({"in": ["foo", "bar"]})) == "in=foo&in=bar" + assert unquote(stringify({"a": {"b": [True, False]}})) == "a[b]=true&a[b]=false" + assert unquote(stringify({"a": {"b": [True, False, None, True]}})) == "a[b]=true&a[b]=false&a[b]=true" + assert unquote(stringify({"in": ["foo", {"b": {"c": ["d", "e"]}}]})) == "in=foo&in[b][c]=d&in[b][c]=e" + + +@pytest.mark.parametrize("method", ["class", "function"]) +def test_array_brackets(method: str) -> None: + if method == "class": + serialise = Querystring(array_format="brackets").stringify + else: + serialise = partial(stringify, array_format="brackets") + + assert unquote(serialise({"in": ["foo", "bar"]})) == "in[]=foo&in[]=bar" + assert unquote(serialise({"a": {"b": [True, False]}})) == "a[b][]=true&a[b][]=false" + assert unquote(serialise({"a": {"b": [True, False, None, True]}})) == "a[b][]=true&a[b][]=false&a[b][]=true" + + +def test_unknown_array_format() -> None: + with pytest.raises(NotImplementedError, match="Unknown array_format value: foo, choose from comma, repeat"): + stringify({"a": ["foo", "bar"]}, array_format=cast(Any, "foo")) diff --git a/tests/test_required_args.py b/tests/test_required_args.py new file mode 100644 index 0000000..c3b9e4f --- /dev/null +++ b/tests/test_required_args.py @@ -0,0 +1,111 @@ +from __future__ import annotations + +import pytest + +from parallel._utils import required_args + + +def test_too_many_positional_params() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + with pytest.raises(TypeError, match=r"foo\(\) takes 1 argument\(s\) but 2 were given"): + foo("a", "b") # type: ignore + + +def test_positional_param() -> None: + @required_args(["a"]) + def foo(a: str | None = None) -> str | None: + return a + + assert foo("a") == "a" + assert foo(None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_keyword_only_param() -> None: + @required_args(["a"]) + def foo(*, a: str | None = None) -> str | None: + return a + + assert foo(a="a") == "a" + assert foo(a=None) is None + assert foo(a="b") == "b" + + with pytest.raises(TypeError, match="Missing required argument: 'a'"): + foo() + + +def test_multiple_params() -> None: + @required_args(["a", "b", "c"]) + def foo(a: str = "", *, b: str = "", c: str = "") -> str | None: + return f"{a} {b} {c}" + + assert foo(a="a", b="b", c="c") == "a b c" + + error_message = r"Missing required arguments.*" + + with pytest.raises(TypeError, match=error_message): + foo() + + with pytest.raises(TypeError, match=error_message): + foo(a="a") + + with pytest.raises(TypeError, match=error_message): + foo(b="b") + + with pytest.raises(TypeError, match=error_message): + foo(c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'a'"): + foo(b="a", c="c") + + with pytest.raises(TypeError, match=r"Missing required argument: 'b'"): + foo("a", c="c") + + +def test_multiple_variants() -> None: + @required_args(["a"], ["b"]) + def foo(*, a: str | None = None, b: str | None = None) -> str | None: + return a if a is not None else b + + assert foo(a="foo") == "foo" + assert foo(b="bar") == "bar" + assert foo(a=None) is None + assert foo(b=None) is None + + # TODO: this error message could probably be improved + with pytest.raises( + TypeError, + match=r"Missing required arguments; Expected either \('a'\) or \('b'\) arguments to be given", + ): + foo() + + +def test_multiple_params_multiple_variants() -> None: + @required_args(["a", "b"], ["c"]) + def foo(*, a: str | None = None, b: str | None = None, c: str | None = None) -> str | None: + if a is not None: + return a + if b is not None: + return b + return c + + error_message = r"Missing required arguments; Expected either \('a' and 'b'\) or \('c'\) arguments to be given" + + with pytest.raises(TypeError, match=error_message): + foo(a="foo") + + with pytest.raises(TypeError, match=error_message): + foo(b="bar") + + with pytest.raises(TypeError, match=error_message): + foo() + + assert foo(a=None, b="bar") == "bar" + assert foo(c=None) is None + assert foo(c="foo") == "foo" diff --git a/tests/test_response.py b/tests/test_response.py new file mode 100644 index 0000000..6def62a --- /dev/null +++ b/tests/test_response.py @@ -0,0 +1,277 @@ +import json +from typing import Any, List, Union, cast +from typing_extensions import Annotated + +import httpx +import pytest +import pydantic + +from parallel import Parallel, BaseModel, AsyncParallel +from parallel._response import ( + APIResponse, + BaseAPIResponse, + AsyncAPIResponse, + BinaryAPIResponse, + AsyncBinaryAPIResponse, + extract_response_type, +) +from parallel._streaming import Stream +from parallel._base_client import FinalRequestOptions + + +class ConcreteBaseAPIResponse(APIResponse[bytes]): ... + + +class ConcreteAPIResponse(APIResponse[List[str]]): ... + + +class ConcreteAsyncAPIResponse(APIResponse[httpx.Response]): ... + + +def test_extract_response_type_direct_classes() -> None: + assert extract_response_type(BaseAPIResponse[str]) == str + assert extract_response_type(APIResponse[str]) == str + assert extract_response_type(AsyncAPIResponse[str]) == str + + +def test_extract_response_type_direct_class_missing_type_arg() -> None: + with pytest.raises( + RuntimeError, + match="Expected type to have a type argument at index 0 but it did not", + ): + extract_response_type(AsyncAPIResponse) + + +def test_extract_response_type_concrete_subclasses() -> None: + assert extract_response_type(ConcreteBaseAPIResponse) == bytes + assert extract_response_type(ConcreteAPIResponse) == List[str] + assert extract_response_type(ConcreteAsyncAPIResponse) == httpx.Response + + +def test_extract_response_type_binary_response() -> None: + assert extract_response_type(BinaryAPIResponse) == bytes + assert extract_response_type(AsyncBinaryAPIResponse) == bytes + + +class PydanticModel(pydantic.BaseModel): ... + + +def test_response_parse_mismatched_basemodel(client: Parallel) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from parallel import BaseModel`", + ): + response.parse(to=PydanticModel) + + +@pytest.mark.asyncio +async def test_async_response_parse_mismatched_basemodel(async_client: AsyncParallel) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + with pytest.raises( + TypeError, + match="Pydantic models must subclass our base model type, e.g. `from parallel import BaseModel`", + ): + await response.parse(to=PydanticModel) + + +def test_response_parse_custom_stream(client: Parallel) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo"), + client=client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = response.parse(to=Stream[int]) + assert stream._cast_to == int + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_stream(async_client: AsyncParallel) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo"), + client=async_client, + stream=True, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + stream = await response.parse(to=Stream[int]) + assert stream._cast_to == int + + +class CustomModel(BaseModel): + foo: str + bar: int + + +def test_response_parse_custom_model(client: Parallel) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.asyncio +async def test_async_response_parse_custom_model(async_client: AsyncParallel) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=CustomModel) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +def test_response_parse_annotated_type(client: Parallel) -> None: + response = APIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +async def test_async_response_parse_annotated_type(async_client: AsyncParallel) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=json.dumps({"foo": "hello!", "bar": 2})), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse( + to=cast("type[CustomModel]", Annotated[CustomModel, "random metadata"]), + ) + assert obj.foo == "hello!" + assert obj.bar == 2 + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +def test_response_parse_bool(client: Parallel, content: str, expected: bool) -> None: + response = APIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = response.parse(to=bool) + assert result is expected + + +@pytest.mark.parametrize( + "content, expected", + [ + ("false", False), + ("true", True), + ("False", False), + ("True", True), + ("TrUe", True), + ("FalSe", False), + ], +) +async def test_async_response_parse_bool(client: AsyncParallel, content: str, expected: bool) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=content), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + result = await response.parse(to=bool) + assert result is expected + + +class OtherModel(BaseModel): + a: str + + +@pytest.mark.parametrize("client", [False], indirect=True) # loose validation +def test_response_parse_expect_model_union_non_json_content(client: Parallel) -> None: + response = APIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" + + +@pytest.mark.asyncio +@pytest.mark.parametrize("async_client", [False], indirect=True) # loose validation +async def test_async_response_parse_expect_model_union_non_json_content(async_client: AsyncParallel) -> None: + response = AsyncAPIResponse( + raw=httpx.Response(200, content=b"foo", headers={"Content-Type": "application/text"}), + client=async_client, + stream=False, + stream_cls=None, + cast_to=str, + options=FinalRequestOptions.construct(method="get", url="/foo"), + ) + + obj = await response.parse(to=cast(Any, Union[CustomModel, OtherModel])) + assert isinstance(obj, str) + assert obj == "foo" diff --git a/tests/test_streaming.py b/tests/test_streaming.py new file mode 100644 index 0000000..3f96774 --- /dev/null +++ b/tests/test_streaming.py @@ -0,0 +1,248 @@ +from __future__ import annotations + +from typing import Iterator, AsyncIterator + +import httpx +import pytest + +from parallel import Parallel, AsyncParallel +from parallel._streaming import Stream, AsyncStream, ServerSentEvent + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_basic(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: completion\n" + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_missing_event(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"foo":true}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_event_missing_data(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"\n" + yield b"event: completion\n" + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.data == "" + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.data == "" + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_events_with_data(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo":true}\n' + yield b"\n" + yield b"event: completion\n" + yield b'data: {"bar":false}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + sse = await iter_next(iterator) + assert sse.event == "completion" + assert sse.json() == {"bar": False} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines_with_empty_line(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: \n" + yield b"data:\n" + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + assert sse.data == '{\n"foo":\n\n\ntrue}' + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_data_json_escaped_double_new_line(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b'data: {"foo": "my long\\n\\ncontent"}' + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": "my long\n\ncontent"} + + await assert_empty_iter(iterator) + + +@pytest.mark.asyncio +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multiple_data_lines(sync: bool, client: Parallel, async_client: AsyncParallel) -> None: + def body() -> Iterator[bytes]: + yield b"event: ping\n" + yield b"data: {\n" + yield b'data: "foo":\n' + yield b"data: true}\n" + yield b"\n\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event == "ping" + assert sse.json() == {"foo": True} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_special_new_line_character( + sync: bool, + client: Parallel, + async_client: AsyncParallel, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":" culpa"}\n' + yield b"\n" + yield b'data: {"content":" \xe2\x80\xa8"}\n' + yield b"\n" + yield b'data: {"content":"foo"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " culpa"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": " 
"} + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "foo"} + + await assert_empty_iter(iterator) + + +@pytest.mark.parametrize("sync", [True, False], ids=["sync", "async"]) +async def test_multi_byte_character_multiple_chunks( + sync: bool, + client: Parallel, + async_client: AsyncParallel, +) -> None: + def body() -> Iterator[bytes]: + yield b'data: {"content":"' + # bytes taken from the string 'известни' and arbitrarily split + # so that some multi-byte characters span multiple chunks + yield b"\xd0" + yield b"\xb8\xd0\xb7\xd0" + yield b"\xb2\xd0\xb5\xd1\x81\xd1\x82\xd0\xbd\xd0\xb8" + yield b'"}\n' + yield b"\n" + + iterator = make_event_iterator(content=body(), sync=sync, client=client, async_client=async_client) + + sse = await iter_next(iterator) + assert sse.event is None + assert sse.json() == {"content": "известни"} + + +async def to_aiter(iter: Iterator[bytes]) -> AsyncIterator[bytes]: + for chunk in iter: + yield chunk + + +async def iter_next(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> ServerSentEvent: + if isinstance(iter, AsyncIterator): + return await iter.__anext__() + + return next(iter) + + +async def assert_empty_iter(iter: Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]) -> None: + with pytest.raises((StopAsyncIteration, RuntimeError)): + await iter_next(iter) + + +def make_event_iterator( + content: Iterator[bytes], + *, + sync: bool, + client: Parallel, + async_client: AsyncParallel, +) -> Iterator[ServerSentEvent] | AsyncIterator[ServerSentEvent]: + if sync: + return Stream(cast_to=object, client=client, response=httpx.Response(200, content=content))._iter_events() + + return AsyncStream( + cast_to=object, client=async_client, response=httpx.Response(200, content=to_aiter(content)) + )._iter_events() diff --git a/tests/test_transform.py b/tests/test_transform.py new file mode 100644 index 0000000..15692f8 --- /dev/null +++ b/tests/test_transform.py @@ -0,0 +1,460 @@ +from __future__ import annotations + +import io +import pathlib +from typing import Any, Dict, List, Union, TypeVar, Iterable, Optional, cast +from datetime import date, datetime +from typing_extensions import Required, Annotated, TypedDict + +import pytest + +from parallel._types import Base64FileInput, omit, not_given +from parallel._utils import ( + PropertyInfo, + transform as _transform, + parse_datetime, + async_transform as _async_transform, +) +from parallel._compat import PYDANTIC_V1 +from parallel._models import BaseModel + +_T = TypeVar("_T") + +SAMPLE_FILE_PATH = pathlib.Path(__file__).parent.joinpath("sample_file.txt") + + +async def transform( + data: _T, + expected_type: object, + use_async: bool, +) -> _T: + if use_async: + return await _async_transform(data, expected_type=expected_type) + + return _transform(data, expected_type=expected_type) + + +parametrize = pytest.mark.parametrize("use_async", [False, True], ids=["sync", "async"]) + + +class Foo1(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +@parametrize +@pytest.mark.asyncio +async def test_top_level_alias(use_async: bool) -> None: + assert await transform({"foo_bar": "hello"}, expected_type=Foo1, use_async=use_async) == {"fooBar": "hello"} + + +class Foo2(TypedDict): + bar: Bar2 + + +class Bar2(TypedDict): + this_thing: Annotated[int, PropertyInfo(alias="this__thing")] + baz: Annotated[Baz2, PropertyInfo(alias="Baz")] + + +class Baz2(TypedDict): + my_baz: Annotated[str, PropertyInfo(alias="myBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_recursive_typeddict(use_async: bool) -> None: + assert await transform({"bar": {"this_thing": 1}}, Foo2, use_async) == {"bar": {"this__thing": 1}} + assert await transform({"bar": {"baz": {"my_baz": "foo"}}}, Foo2, use_async) == {"bar": {"Baz": {"myBaz": "foo"}}} + + +class Foo3(TypedDict): + things: List[Bar3] + + +class Bar3(TypedDict): + my_field: Annotated[str, PropertyInfo(alias="myField")] + + +@parametrize +@pytest.mark.asyncio +async def test_list_of_typeddict(use_async: bool) -> None: + result = await transform({"things": [{"my_field": "foo"}, {"my_field": "foo2"}]}, Foo3, use_async) + assert result == {"things": [{"myField": "foo"}, {"myField": "foo2"}]} + + +class Foo4(TypedDict): + foo: Union[Bar4, Baz4] + + +class Bar4(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz4(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_typeddict(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo4, use_async) == {"foo": {"fooBar": "bar"}} + assert await transform({"foo": {"foo_baz": "baz"}}, Foo4, use_async) == {"foo": {"fooBaz": "baz"}} + assert await transform({"foo": {"foo_baz": "baz", "foo_bar": "bar"}}, Foo4, use_async) == { + "foo": {"fooBaz": "baz", "fooBar": "bar"} + } + + +class Foo5(TypedDict): + foo: Annotated[Union[Bar4, List[Baz4]], PropertyInfo(alias="FOO")] + + +class Bar5(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz5(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_union_of_list(use_async: bool) -> None: + assert await transform({"foo": {"foo_bar": "bar"}}, Foo5, use_async) == {"FOO": {"fooBar": "bar"}} + assert await transform( + { + "foo": [ + {"foo_baz": "baz"}, + {"foo_baz": "baz"}, + ] + }, + Foo5, + use_async, + ) == {"FOO": [{"fooBaz": "baz"}, {"fooBaz": "baz"}]} + + +class Foo6(TypedDict): + bar: Annotated[str, PropertyInfo(alias="Bar")] + + +@parametrize +@pytest.mark.asyncio +async def test_includes_unknown_keys(use_async: bool) -> None: + assert await transform({"bar": "bar", "baz_": {"FOO": 1}}, Foo6, use_async) == { + "Bar": "bar", + "baz_": {"FOO": 1}, + } + + +class Foo7(TypedDict): + bar: Annotated[List[Bar7], PropertyInfo(alias="bAr")] + foo: Bar7 + + +class Bar7(TypedDict): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_ignores_invalid_input(use_async: bool) -> None: + assert await transform({"bar": ""}, Foo7, use_async) == {"bAr": ""} + assert await transform({"foo": ""}, Foo7, use_async) == {"foo": ""} + + +class DatetimeDict(TypedDict, total=False): + foo: Annotated[datetime, PropertyInfo(format="iso8601")] + + bar: Annotated[Optional[datetime], PropertyInfo(format="iso8601")] + + required: Required[Annotated[Optional[datetime], PropertyInfo(format="iso8601")]] + + list_: Required[Annotated[Optional[List[datetime]], PropertyInfo(format="iso8601")]] + + union: Annotated[Union[int, datetime], PropertyInfo(format="iso8601")] + + +class DateDict(TypedDict, total=False): + foo: Annotated[date, PropertyInfo(format="iso8601")] + + +class DatetimeModel(BaseModel): + foo: datetime + + +class DateModel(BaseModel): + foo: Optional[date] + + +@parametrize +@pytest.mark.asyncio +async def test_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + tz = "+00:00" if PYDANTIC_V1 else "Z" + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692" + tz} # type: ignore[comparison-overlap] + + dt = dt.replace(tzinfo=None) + assert await transform({"foo": dt}, DatetimeDict, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + assert await transform(DatetimeModel(foo=dt), Any, use_async) == {"foo": "2023-02-23T14:16:36.337692"} # type: ignore[comparison-overlap] + + assert await transform({"foo": None}, DateDict, use_async) == {"foo": None} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=None), Any, use_async) == {"foo": None} # type: ignore + assert await transform({"foo": date.fromisoformat("2023-02-23")}, DateDict, use_async) == {"foo": "2023-02-23"} # type: ignore[comparison-overlap] + assert await transform(DateModel(foo=date.fromisoformat("2023-02-23")), DateDict, use_async) == { + "foo": "2023-02-23" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_optional_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"bar": dt}, DatetimeDict, use_async) == {"bar": "2023-02-23T14:16:36.337692+00:00"} # type: ignore[comparison-overlap] + + assert await transform({"bar": None}, DatetimeDict, use_async) == {"bar": None} + + +@parametrize +@pytest.mark.asyncio +async def test_required_iso8601_format(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"required": dt}, DatetimeDict, use_async) == { + "required": "2023-02-23T14:16:36.337692+00:00" + } # type: ignore[comparison-overlap] + + assert await transform({"required": None}, DatetimeDict, use_async) == {"required": None} + + +@parametrize +@pytest.mark.asyncio +async def test_union_datetime(use_async: bool) -> None: + dt = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + assert await transform({"union": dt}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "union": "2023-02-23T14:16:36.337692+00:00" + } + + assert await transform({"union": "foo"}, DatetimeDict, use_async) == {"union": "foo"} + + +@parametrize +@pytest.mark.asyncio +async def test_nested_list_iso6801_format(use_async: bool) -> None: + dt1 = datetime.fromisoformat("2023-02-23T14:16:36.337692+00:00") + dt2 = parse_datetime("2022-01-15T06:34:23Z") + assert await transform({"list_": [dt1, dt2]}, DatetimeDict, use_async) == { # type: ignore[comparison-overlap] + "list_": ["2023-02-23T14:16:36.337692+00:00", "2022-01-15T06:34:23+00:00"] + } + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_custom_format(use_async: bool) -> None: + dt = parse_datetime("2022-01-15T06:34:23Z") + + result = await transform(dt, Annotated[datetime, PropertyInfo(format="custom", format_template="%H")], use_async) + assert result == "06" # type: ignore[comparison-overlap] + + +class DateDictWithRequiredAlias(TypedDict, total=False): + required_prop: Required[Annotated[date, PropertyInfo(format="iso8601", alias="prop")]] + + +@parametrize +@pytest.mark.asyncio +async def test_datetime_with_alias(use_async: bool) -> None: + assert await transform({"required_prop": None}, DateDictWithRequiredAlias, use_async) == {"prop": None} # type: ignore[comparison-overlap] + assert await transform( + {"required_prop": date.fromisoformat("2023-02-23")}, DateDictWithRequiredAlias, use_async + ) == {"prop": "2023-02-23"} # type: ignore[comparison-overlap] + + +class MyModel(BaseModel): + foo: str + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_model_to_dictionary(use_async: bool) -> None: + assert cast(Any, await transform(MyModel(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + assert cast(Any, await transform(MyModel.construct(foo="hi!"), Any, use_async)) == {"foo": "hi!"} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_empty_model(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(), Any, use_async)) == {} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_unknown_field(use_async: bool) -> None: + assert cast(Any, await transform(MyModel.construct(my_untyped_field=True), Any, use_async)) == { + "my_untyped_field": True + } + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_types(use_async: bool) -> None: + model = MyModel.construct(foo=True) + if PYDANTIC_V1: + params = await transform(model, Any, use_async) + else: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": True} + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_mismatched_object_type(use_async: bool) -> None: + model = MyModel.construct(foo=MyModel.construct(hello="world")) + if PYDANTIC_V1: + params = await transform(model, Any, use_async) + else: + with pytest.warns(UserWarning): + params = await transform(model, Any, use_async) + assert cast(Any, params) == {"foo": {"hello": "world"}} + + +class ModelNestedObjects(BaseModel): + nested: MyModel + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_nested_objects(use_async: bool) -> None: + model = ModelNestedObjects.construct(nested={"foo": "stainless"}) + assert isinstance(model.nested, MyModel) + assert cast(Any, await transform(model, Any, use_async)) == {"nested": {"foo": "stainless"}} + + +class ModelWithDefaultField(BaseModel): + foo: str + with_none_default: Union[str, None] = None + with_str_default: str = "foo" + + +@parametrize +@pytest.mark.asyncio +async def test_pydantic_default_field(use_async: bool) -> None: + # should be excluded when defaults are used + model = ModelWithDefaultField.construct() + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {} + + # should be included when the default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default=None, with_str_default="foo") + assert model.with_none_default is None + assert model.with_str_default == "foo" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": None, "with_str_default": "foo"} + + # should be included when a non-default value is explicitly given + model = ModelWithDefaultField.construct(with_none_default="bar", with_str_default="baz") + assert model.with_none_default == "bar" + assert model.with_str_default == "baz" + assert cast(Any, await transform(model, Any, use_async)) == {"with_none_default": "bar", "with_str_default": "baz"} + + +class TypedDictIterableUnion(TypedDict): + foo: Annotated[Union[Bar8, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +class Bar8(TypedDict): + foo_bar: Annotated[str, PropertyInfo(alias="fooBar")] + + +class Baz8(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_of_dictionaries(use_async: bool) -> None: + assert await transform({"foo": [{"foo_baz": "bar"}]}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "bar"}] + } + assert cast(Any, await transform({"foo": ({"foo_baz": "bar"},)}, TypedDictIterableUnion, use_async)) == { + "FOO": [{"fooBaz": "bar"}] + } + + def my_iter() -> Iterable[Baz8]: + yield {"foo_baz": "hello"} + yield {"foo_baz": "world"} + + assert await transform({"foo": my_iter()}, TypedDictIterableUnion, use_async) == { + "FOO": [{"fooBaz": "hello"}, {"fooBaz": "world"}] + } + + +@parametrize +@pytest.mark.asyncio +async def test_dictionary_items(use_async: bool) -> None: + class DictItems(TypedDict): + foo_baz: Annotated[str, PropertyInfo(alias="fooBaz")] + + assert await transform({"foo": {"foo_baz": "bar"}}, Dict[str, DictItems], use_async) == {"foo": {"fooBaz": "bar"}} + + +class TypedDictIterableUnionStr(TypedDict): + foo: Annotated[Union[str, Iterable[Baz8]], PropertyInfo(alias="FOO")] + + +@parametrize +@pytest.mark.asyncio +async def test_iterable_union_str(use_async: bool) -> None: + assert await transform({"foo": "bar"}, TypedDictIterableUnionStr, use_async) == {"FOO": "bar"} + assert cast(Any, await transform(iter([{"foo_baz": "bar"}]), Union[str, Iterable[Baz8]], use_async)) == [ + {"fooBaz": "bar"} + ] + + +class TypedDictBase64Input(TypedDict): + foo: Annotated[Union[str, Base64FileInput], PropertyInfo(format="base64")] + + +@parametrize +@pytest.mark.asyncio +async def test_base64_file_input(use_async: bool) -> None: + # strings are left as-is + assert await transform({"foo": "bar"}, TypedDictBase64Input, use_async) == {"foo": "bar"} + + # pathlib.Path is automatically converted to base64 + assert await transform({"foo": SAMPLE_FILE_PATH}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQo=" + } # type: ignore[comparison-overlap] + + # io instances are automatically converted to base64 + assert await transform({"foo": io.StringIO("Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + assert await transform({"foo": io.BytesIO(b"Hello, world!")}, TypedDictBase64Input, use_async) == { + "foo": "SGVsbG8sIHdvcmxkIQ==" + } # type: ignore[comparison-overlap] + + +@parametrize +@pytest.mark.asyncio +async def test_transform_skipping(use_async: bool) -> None: + # lists of ints are left as-is + data = [1, 2, 3] + assert await transform(data, List[int], use_async) is data + + # iterables of ints are converted to a list + data = iter([1, 2, 3]) + assert await transform(data, Iterable[int], use_async) == [1, 2, 3] + + +@parametrize +@pytest.mark.asyncio +async def test_strips_notgiven(use_async: bool) -> None: + assert await transform({"foo_bar": "bar"}, Foo1, use_async) == {"fooBar": "bar"} + assert await transform({"foo_bar": not_given}, Foo1, use_async) == {} + + +@parametrize +@pytest.mark.asyncio +async def test_strips_omit(use_async: bool) -> None: + assert await transform({"foo_bar": "bar"}, Foo1, use_async) == {"fooBar": "bar"} + assert await transform({"foo_bar": omit}, Foo1, use_async) == {} diff --git a/tests/test_utils/test_datetime_parse.py b/tests/test_utils/test_datetime_parse.py new file mode 100644 index 0000000..c213263 --- /dev/null +++ b/tests/test_utils/test_datetime_parse.py @@ -0,0 +1,110 @@ +""" +Copied from https://github.com/pydantic/pydantic/blob/v1.10.22/tests/test_datetime_parse.py +with modifications so it works without pydantic v1 imports. +""" + +from typing import Type, Union +from datetime import date, datetime, timezone, timedelta + +import pytest + +from parallel._utils import parse_date, parse_datetime + + +def create_tz(minutes: int) -> timezone: + return timezone(timedelta(minutes=minutes)) + + +@pytest.mark.parametrize( + "value,result", + [ + # Valid inputs + ("1494012444.883309", date(2017, 5, 5)), + (b"1494012444.883309", date(2017, 5, 5)), + (1_494_012_444.883_309, date(2017, 5, 5)), + ("1494012444", date(2017, 5, 5)), + (1_494_012_444, date(2017, 5, 5)), + (0, date(1970, 1, 1)), + ("2012-04-23", date(2012, 4, 23)), + (b"2012-04-23", date(2012, 4, 23)), + ("2012-4-9", date(2012, 4, 9)), + (date(2012, 4, 9), date(2012, 4, 9)), + (datetime(2012, 4, 9, 12, 15), date(2012, 4, 9)), + # Invalid inputs + ("x20120423", ValueError), + ("2012-04-56", ValueError), + (19_999_999_999, date(2603, 10, 11)), # just before watershed + (20_000_000_001, date(1970, 8, 20)), # just after watershed + (1_549_316_052, date(2019, 2, 4)), # nowish in s + (1_549_316_052_104, date(2019, 2, 4)), # nowish in ms + (1_549_316_052_104_324, date(2019, 2, 4)), # nowish in μs + (1_549_316_052_104_324_096, date(2019, 2, 4)), # nowish in ns + ("infinity", date(9999, 12, 31)), + ("inf", date(9999, 12, 31)), + (float("inf"), date(9999, 12, 31)), + ("infinity ", date(9999, 12, 31)), + (int("1" + "0" * 100), date(9999, 12, 31)), + (1e1000, date(9999, 12, 31)), + ("-infinity", date(1, 1, 1)), + ("-inf", date(1, 1, 1)), + ("nan", ValueError), + ], +) +def test_date_parsing(value: Union[str, bytes, int, float], result: Union[date, Type[Exception]]) -> None: + if type(result) == type and issubclass(result, Exception): # pyright: ignore[reportUnnecessaryIsInstance] + with pytest.raises(result): + parse_date(value) + else: + assert parse_date(value) == result + + +@pytest.mark.parametrize( + "value,result", + [ + # Valid inputs + # values in seconds + ("1494012444.883309", datetime(2017, 5, 5, 19, 27, 24, 883_309, tzinfo=timezone.utc)), + (1_494_012_444.883_309, datetime(2017, 5, 5, 19, 27, 24, 883_309, tzinfo=timezone.utc)), + ("1494012444", datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + (b"1494012444", datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + (1_494_012_444, datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + # values in ms + ("1494012444000.883309", datetime(2017, 5, 5, 19, 27, 24, 883, tzinfo=timezone.utc)), + ("-1494012444000.883309", datetime(1922, 8, 29, 4, 32, 35, 999117, tzinfo=timezone.utc)), + (1_494_012_444_000, datetime(2017, 5, 5, 19, 27, 24, tzinfo=timezone.utc)), + ("2012-04-23T09:15:00", datetime(2012, 4, 23, 9, 15)), + ("2012-4-9 4:8:16", datetime(2012, 4, 9, 4, 8, 16)), + ("2012-04-23T09:15:00Z", datetime(2012, 4, 23, 9, 15, 0, 0, timezone.utc)), + ("2012-4-9 4:8:16-0320", datetime(2012, 4, 9, 4, 8, 16, 0, create_tz(-200))), + ("2012-04-23T10:20:30.400+02:30", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(150))), + ("2012-04-23T10:20:30.400+02", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(120))), + ("2012-04-23T10:20:30.400-02", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(-120))), + (b"2012-04-23T10:20:30.400-02", datetime(2012, 4, 23, 10, 20, 30, 400_000, create_tz(-120))), + (datetime(2017, 5, 5), datetime(2017, 5, 5)), + (0, datetime(1970, 1, 1, 0, 0, 0, tzinfo=timezone.utc)), + # Invalid inputs + ("x20120423091500", ValueError), + ("2012-04-56T09:15:90", ValueError), + ("2012-04-23T11:05:00-25:00", ValueError), + (19_999_999_999, datetime(2603, 10, 11, 11, 33, 19, tzinfo=timezone.utc)), # just before watershed + (20_000_000_001, datetime(1970, 8, 20, 11, 33, 20, 1000, tzinfo=timezone.utc)), # just after watershed + (1_549_316_052, datetime(2019, 2, 4, 21, 34, 12, 0, tzinfo=timezone.utc)), # nowish in s + (1_549_316_052_104, datetime(2019, 2, 4, 21, 34, 12, 104_000, tzinfo=timezone.utc)), # nowish in ms + (1_549_316_052_104_324, datetime(2019, 2, 4, 21, 34, 12, 104_324, tzinfo=timezone.utc)), # nowish in μs + (1_549_316_052_104_324_096, datetime(2019, 2, 4, 21, 34, 12, 104_324, tzinfo=timezone.utc)), # nowish in ns + ("infinity", datetime(9999, 12, 31, 23, 59, 59, 999999)), + ("inf", datetime(9999, 12, 31, 23, 59, 59, 999999)), + ("inf ", datetime(9999, 12, 31, 23, 59, 59, 999999)), + (1e50, datetime(9999, 12, 31, 23, 59, 59, 999999)), + (float("inf"), datetime(9999, 12, 31, 23, 59, 59, 999999)), + ("-infinity", datetime(1, 1, 1, 0, 0)), + ("-inf", datetime(1, 1, 1, 0, 0)), + ("nan", ValueError), + ], +) +def test_datetime_parsing(value: Union[str, bytes, int, float], result: Union[datetime, Type[Exception]]) -> None: + if type(result) == type and issubclass(result, Exception): # pyright: ignore[reportUnnecessaryIsInstance] + with pytest.raises(result): + parse_datetime(value) + else: + assert parse_datetime(value) == result diff --git a/tests/test_utils/test_json.py b/tests/test_utils/test_json.py new file mode 100644 index 0000000..d6c0dfd --- /dev/null +++ b/tests/test_utils/test_json.py @@ -0,0 +1,126 @@ +from __future__ import annotations + +import datetime +from typing import Union + +import pydantic + +from parallel import _compat +from parallel._utils._json import openapi_dumps + + +class TestOpenapiDumps: + def test_basic(self) -> None: + data = {"key": "value", "number": 42} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"key":"value","number":42}' + + def test_datetime_serialization(self) -> None: + dt = datetime.datetime(2023, 1, 1, 12, 0, 0) + data = {"datetime": dt} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"datetime":"2023-01-01T12:00:00"}' + + def test_pydantic_model_serialization(self) -> None: + class User(pydantic.BaseModel): + first_name: str + last_name: str + age: int + + model_instance = User(first_name="John", last_name="Kramer", age=83) + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"first_name":"John","last_name":"Kramer","age":83}}' + + def test_pydantic_model_with_default_values(self) -> None: + class User(pydantic.BaseModel): + name: str + role: str = "user" + active: bool = True + score: int = 0 + + model_instance = User(name="Alice") + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Alice"}}' + + def test_pydantic_model_with_default_values_overridden(self) -> None: + class User(pydantic.BaseModel): + name: str + role: str = "user" + active: bool = True + + model_instance = User(name="Bob", role="admin", active=False) + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Bob","role":"admin","active":false}}' + + def test_pydantic_model_with_alias(self) -> None: + class User(pydantic.BaseModel): + first_name: str = pydantic.Field(alias="firstName") + last_name: str = pydantic.Field(alias="lastName") + + model_instance = User(firstName="John", lastName="Doe") + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"firstName":"John","lastName":"Doe"}}' + + def test_pydantic_model_with_alias_and_default(self) -> None: + class User(pydantic.BaseModel): + user_name: str = pydantic.Field(alias="userName") + user_role: str = pydantic.Field(default="member", alias="userRole") + is_active: bool = pydantic.Field(default=True, alias="isActive") + + model_instance = User(userName="charlie") + data = {"model": model_instance} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"userName":"charlie"}}' + + model_with_overrides = User(userName="diana", userRole="admin", isActive=False) + data = {"model": model_with_overrides} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"userName":"diana","userRole":"admin","isActive":false}}' + + def test_pydantic_model_with_nested_models_and_defaults(self) -> None: + class Address(pydantic.BaseModel): + street: str + city: str = "Unknown" + + class User(pydantic.BaseModel): + name: str + address: Address + verified: bool = False + + if _compat.PYDANTIC_V1: + # to handle forward references in Pydantic v1 + User.update_forward_refs(**locals()) # type: ignore[reportDeprecated] + + address = Address(street="123 Main St") + user = User(name="Diana", address=address) + data = {"user": user} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"user":{"name":"Diana","address":{"street":"123 Main St"}}}' + + address_with_city = Address(street="456 Oak Ave", city="Boston") + user_verified = User(name="Eve", address=address_with_city, verified=True) + data = {"user": user_verified} + json_bytes = openapi_dumps(data) + assert ( + json_bytes == b'{"user":{"name":"Eve","address":{"street":"456 Oak Ave","city":"Boston"},"verified":true}}' + ) + + def test_pydantic_model_with_optional_fields(self) -> None: + class User(pydantic.BaseModel): + name: str + email: Union[str, None] + phone: Union[str, None] + + model_with_none = User(name="Eve", email=None, phone=None) + data = {"model": model_with_none} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Eve","email":null,"phone":null}}' + + model_with_values = User(name="Frank", email="frank@example.com", phone=None) + data = {"model": model_with_values} + json_bytes = openapi_dumps(data) + assert json_bytes == b'{"model":{"name":"Frank","email":"frank@example.com","phone":null}}' diff --git a/tests/test_utils/test_path.py b/tests/test_utils/test_path.py new file mode 100644 index 0000000..c0364ff --- /dev/null +++ b/tests/test_utils/test_path.py @@ -0,0 +1,89 @@ +from __future__ import annotations + +from typing import Any + +import pytest + +from parallel._utils._path import path_template + + +@pytest.mark.parametrize( + "template, kwargs, expected", + [ + ("/v1/{id}", dict(id="abc"), "/v1/abc"), + ("/v1/{a}/{b}", dict(a="x", b="y"), "/v1/x/y"), + ("/v1/{a}{b}/path/{c}?val={d}#{e}", dict(a="x", b="y", c="z", d="u", e="v"), "/v1/xy/path/z?val=u#v"), + ("/{w}/{w}", dict(w="echo"), "/echo/echo"), + ("/v1/static", {}, "/v1/static"), + ("", {}, ""), + ("/v1/?q={n}&count=10", dict(n=42), "/v1/?q=42&count=10"), + ("/v1/{v}", dict(v=None), "/v1/null"), + ("/v1/{v}", dict(v=True), "/v1/true"), + ("/v1/{v}", dict(v=False), "/v1/false"), + ("/v1/{v}", dict(v=".hidden"), "/v1/.hidden"), # dot prefix ok + ("/v1/{v}", dict(v="file.txt"), "/v1/file.txt"), # dot in middle ok + ("/v1/{v}", dict(v="..."), "/v1/..."), # triple dot ok + ("/v1/{a}{b}", dict(a=".", b="txt"), "/v1/.txt"), # dot var combining with adjacent to be ok + ("/items?q={v}#{f}", dict(v=".", f=".."), "/items?q=.#.."), # dots in query/fragment are fine + ( + "/v1/{a}?query={b}", + dict(a="../../other/endpoint", b="a&bad=true"), + "/v1/..%2F..%2Fother%2Fendpoint?query=a%26bad%3Dtrue", + ), + ("/v1/{val}", dict(val="a/b/c"), "/v1/a%2Fb%2Fc"), + ("/v1/{val}", dict(val="a/b/c?query=value"), "/v1/a%2Fb%2Fc%3Fquery=value"), + ("/v1/{val}", dict(val="a/b/c?query=value&bad=true"), "/v1/a%2Fb%2Fc%3Fquery=value&bad=true"), + ("/v1/{val}", dict(val="%20"), "/v1/%2520"), # escapes escape sequences in input + # Query: slash and ? are safe, # is not + ("/items?q={v}", dict(v="a/b"), "/items?q=a/b"), + ("/items?q={v}", dict(v="a?b"), "/items?q=a?b"), + ("/items?q={v}", dict(v="a#b"), "/items?q=a%23b"), + ("/items?q={v}", dict(v="a b"), "/items?q=a%20b"), + # Fragment: slash and ? are safe + ("/docs#{v}", dict(v="a/b"), "/docs#a/b"), + ("/docs#{v}", dict(v="a?b"), "/docs#a?b"), + # Path: slash, ? and # are all encoded + ("/v1/{v}", dict(v="a/b"), "/v1/a%2Fb"), + ("/v1/{v}", dict(v="a?b"), "/v1/a%3Fb"), + ("/v1/{v}", dict(v="a#b"), "/v1/a%23b"), + # same var encoded differently by component + ( + "/v1/{v}?q={v}#{v}", + dict(v="a/b?c#d"), + "/v1/a%2Fb%3Fc%23d?q=a/b?c%23d#a/b?c%23d", + ), + ("/v1/{val}", dict(val="x?admin=true"), "/v1/x%3Fadmin=true"), # query injection + ("/v1/{val}", dict(val="x#admin"), "/v1/x%23admin"), # fragment injection + ], +) +def test_interpolation(template: str, kwargs: dict[str, Any], expected: str) -> None: + assert path_template(template, **kwargs) == expected + + +def test_missing_kwarg_raises_key_error() -> None: + with pytest.raises(KeyError, match="org_id"): + path_template("/v1/{org_id}") + + +@pytest.mark.parametrize( + "template, kwargs", + [ + ("{a}/path", dict(a=".")), + ("{a}/path", dict(a="..")), + ("/v1/{a}", dict(a=".")), + ("/v1/{a}", dict(a="..")), + ("/v1/{a}/path", dict(a=".")), + ("/v1/{a}/path", dict(a="..")), + ("/v1/{a}{b}", dict(a=".", b=".")), # adjacent vars → ".." + ("/v1/{a}.", dict(a=".")), # var + static → ".." + ("/v1/{a}{b}", dict(a="", b=".")), # empty + dot → "." + ("/v1/%2e/{x}", dict(x="ok")), # encoded dot in static text + ("/v1/%2e./{x}", dict(x="ok")), # mixed encoded ".." in static + ("/v1/.%2E/{x}", dict(x="ok")), # mixed encoded ".." in static + ("/v1/{v}?q=1", dict(v="..")), + ("/v1/{v}#frag", dict(v="..")), + ], +) +def test_dot_segment_rejected(template: str, kwargs: dict[str, Any]) -> None: + with pytest.raises(ValueError, match="dot-segment"): + path_template(template, **kwargs) diff --git a/tests/test_utils/test_proxy.py b/tests/test_utils/test_proxy.py new file mode 100644 index 0000000..8079e0e --- /dev/null +++ b/tests/test_utils/test_proxy.py @@ -0,0 +1,34 @@ +import operator +from typing import Any +from typing_extensions import override + +from parallel._utils import LazyProxy + + +class RecursiveLazyProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + return self + + def __call__(self, *_args: Any, **_kwds: Any) -> Any: + raise RuntimeError("This should never be called!") + + +def test_recursive_proxy() -> None: + proxy = RecursiveLazyProxy() + assert repr(proxy) == "RecursiveLazyProxy" + assert str(proxy) == "RecursiveLazyProxy" + assert dir(proxy) == [] + assert type(proxy).__name__ == "RecursiveLazyProxy" + assert type(operator.attrgetter("name.foo.bar.baz")(proxy)).__name__ == "RecursiveLazyProxy" + + +def test_isinstance_does_not_error() -> None: + class AlwaysErrorProxy(LazyProxy[Any]): + @override + def __load__(self) -> Any: + raise RuntimeError("Mocking missing dependency") + + proxy = AlwaysErrorProxy() + assert not isinstance(proxy, dict) + assert isinstance(proxy, LazyProxy) diff --git a/tests/test_utils/test_typing.py b/tests/test_utils/test_typing.py new file mode 100644 index 0000000..ffcffd9 --- /dev/null +++ b/tests/test_utils/test_typing.py @@ -0,0 +1,73 @@ +from __future__ import annotations + +from typing import Generic, TypeVar, cast + +from parallel._utils import extract_type_var_from_base + +_T = TypeVar("_T") +_T2 = TypeVar("_T2") +_T3 = TypeVar("_T3") + + +class BaseGeneric(Generic[_T]): ... + + +class SubclassGeneric(BaseGeneric[_T]): ... + + +class BaseGenericMultipleTypeArgs(Generic[_T, _T2, _T3]): ... + + +class SubclassGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T, _T2, _T3]): ... + + +class SubclassDifferentOrderGenericMultipleTypeArgs(BaseGenericMultipleTypeArgs[_T2, _T, _T3]): ... + + +def test_extract_type_var() -> None: + assert ( + extract_type_var_from_base( + BaseGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_generic_subclass() -> None: + assert ( + extract_type_var_from_base( + SubclassGeneric[int], + index=0, + generic_bases=cast("tuple[type, ...]", (BaseGeneric,)), + ) + == int + ) + + +def test_extract_type_var_multiple() -> None: + typ = BaseGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_multiple() -> None: + typ = SubclassGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) + + +def test_extract_type_var_generic_subclass_different_ordering_multiple() -> None: + typ = SubclassDifferentOrderGenericMultipleTypeArgs[int, str, None] + + generic_bases = cast("tuple[type, ...]", (BaseGenericMultipleTypeArgs,)) + assert extract_type_var_from_base(typ, index=0, generic_bases=generic_bases) == int + assert extract_type_var_from_base(typ, index=1, generic_bases=generic_bases) == str + assert extract_type_var_from_base(typ, index=2, generic_bases=generic_bases) == type(None) diff --git a/tests/utils.py b/tests/utils.py new file mode 100644 index 0000000..fb35131 --- /dev/null +++ b/tests/utils.py @@ -0,0 +1,167 @@ +from __future__ import annotations + +import os +import inspect +import traceback +import contextlib +from typing import Any, TypeVar, Iterator, Sequence, cast +from datetime import date, datetime +from typing_extensions import Literal, get_args, get_origin, assert_type + +from parallel._types import Omit, NoneType +from parallel._utils import ( + is_dict, + is_list, + is_list_type, + is_union_type, + extract_type_arg, + is_sequence_type, + is_annotated_type, + is_type_alias_type, +) +from parallel._compat import PYDANTIC_V1, field_outer_type, get_model_fields +from parallel._models import BaseModel + +BaseModelT = TypeVar("BaseModelT", bound=BaseModel) + + +def assert_matches_model(model: type[BaseModelT], value: BaseModelT, *, path: list[str]) -> bool: + for name, field in get_model_fields(model).items(): + field_value = getattr(value, name) + if PYDANTIC_V1: + # in v1 nullability was structured differently + # https://docs.pydantic.dev/2.0/migration/#required-optional-and-nullable-fields + allow_none = getattr(field, "allow_none", False) + else: + allow_none = False + + assert_matches_type( + field_outer_type(field), + field_value, + path=[*path, name], + allow_none=allow_none, + ) + + return True + + +# Note: the `path` argument is only used to improve error messages when `--showlocals` is used +def assert_matches_type( + type_: Any, + value: object, + *, + path: list[str], + allow_none: bool = False, +) -> None: + if is_type_alias_type(type_): + type_ = type_.__value__ + + # unwrap `Annotated[T, ...]` -> `T` + if is_annotated_type(type_): + type_ = extract_type_arg(type_, 0) + + if allow_none and value is None: + return + + if type_ is None or type_ is NoneType: + assert value is None + return + + origin = get_origin(type_) or type_ + + if is_list_type(type_): + return _assert_list_type(type_, value) + + if is_sequence_type(type_): + assert isinstance(value, Sequence) + inner_type = get_args(type_)[0] + for entry in value: # type: ignore + assert_type(inner_type, entry) # type: ignore + return + + if origin == str: + assert isinstance(value, str) + elif origin == int: + assert isinstance(value, int) + elif origin == bool: + assert isinstance(value, bool) + elif origin == float: + assert isinstance(value, float) + elif origin == bytes: + assert isinstance(value, bytes) + elif origin == datetime: + assert isinstance(value, datetime) + elif origin == date: + assert isinstance(value, date) + elif origin == object: + # nothing to do here, the expected type is unknown + pass + elif origin == Literal: + assert value in get_args(type_) + elif origin == dict: + assert is_dict(value) + + args = get_args(type_) + key_type = args[0] + items_type = args[1] + + for key, item in value.items(): + assert_matches_type(key_type, key, path=[*path, ""]) + assert_matches_type(items_type, item, path=[*path, ""]) + elif is_union_type(type_): + variants = get_args(type_) + + try: + none_index = variants.index(type(None)) + except ValueError: + pass + else: + # special case Optional[T] for better error messages + if len(variants) == 2: + if value is None: + # valid + return + + return assert_matches_type(type_=variants[not none_index], value=value, path=path) + + for i, variant in enumerate(variants): + try: + assert_matches_type(variant, value, path=[*path, f"variant {i}"]) + return + except AssertionError: + traceback.print_exc() + continue + + raise AssertionError("Did not match any variants") + elif issubclass(origin, BaseModel): + assert isinstance(value, type_) + assert assert_matches_model(type_, cast(Any, value), path=path) + elif inspect.isclass(origin) and origin.__name__ == "HttpxBinaryResponseContent": + assert value.__class__.__name__ == "HttpxBinaryResponseContent" + else: + assert None, f"Unhandled field type: {type_}" + + +def _assert_list_type(type_: type[object], value: object) -> None: + assert is_list(value) + + inner_type = get_args(type_)[0] + for entry in value: + assert_type(inner_type, entry) # type: ignore + + +@contextlib.contextmanager +def update_env(**new_env: str | Omit) -> Iterator[None]: + old = os.environ.copy() + + try: + for name, value in new_env.items(): + if isinstance(value, Omit): + os.environ.pop(name, None) + else: + os.environ[name] = value + + yield None + finally: + os.environ.clear() + os.environ.update(old)